Author: Adam Pioterek <adam.pioterek@protonmail.ch>
converter deletes old only if they exist
converter/local/converter.py | 6 research/PDP | 26213 ++++++++++++++++++++++++++++++++++++++ research/PDP.js | 1
diff --git a/converter/local/converter.py b/converter/local/converter.py index 842f7e79adce9f07473c6401dd332bb751cf1dff..95372e69ee513ee14cd36a1f6587ebedab921efc 100755 --- a/converter/local/converter.py +++ b/converter/local/converter.py @@ -151,7 +151,11 @@ for item in self.__metadata: if item['id'] not in to_remove: new_metadata.append(item) else: - Path('{}.db.gz'.format(item['id'])).unlink() + try: + Path('{}.db.gz'.format(item['id'])).unlink() + except FileNotFoundError: + pass + self.__upload_del(item['id']) self.__metadata = new_metadata diff --git a/research/PDP b/research/PDP new file mode 100644 index 0000000000000000000000000000000000000000..5ff738a2a11d6ca936d5d3002da3cc8fb3cf8266 --- /dev/null +++ b/research/PDP @@ -0,0 +1,26213 @@ +function draw_clock() { + var n, r, t; + for (canvas = Raphael("analog", 100, 100), n = canvas.circle(25, 25, 23), n.attr({ + fill: "#F9F9F9", + stroke: "#003A7D", + "stroke-width": "2" + }), i = 0; i < 12; i++) { + var u = 25 + Math.round(18 * Math.cos(30 * i * Math.PI / 180)), + f = 25 + Math.round(18 * Math.sin(30 * i * Math.PI / 180)), + e = 25 + Math.round(22 * Math.cos(30 * i * Math.PI / 180)), + o = 25 + Math.round(22 * Math.sin(30 * i * Math.PI / 180)); + r = canvas.path("M" + u + " " + f + "L" + e + " " + o) + } + hour_hand = canvas.path("M 25 25 L 25 15"); + hour_hand.attr({ + stroke: "#003A7D", + "stroke-width": 2 + }); + minute_hand = canvas.path("M 25 25 L 25 10"); + minute_hand.attr({ + stroke: "#444444", + "stroke-width": 1 + }); + second_hand = canvas.path("M 25 30 L 25 8"); + second_hand.attr({ + stroke: "#003A7D", + "stroke-width": .5 + }); + t = canvas.circle(25, 25, 1); + t.attr("fill", "#003A7D"); + update_clock(); + setInterval("update_clock()", 1e3) +} + +function update_clock() { + var r = dateTimeFromServer - dateTimeFromClient, + u = (new Date).getTime(), + t = new Date; + t.setTime(u + r); + var n = t, + f = n.getHours(), + i = n.getMinutes(), + e = n.getSeconds(); + hour_hand.rotate(30 * f + i / 2.5, 25, 25); + minute_hand.rotate(6 * i, 25, 25); + second_hand.rotate(6 * e, 25, 25) +} + +function indirectStation() { + var i = $(".route ").find(".subRow").length, + n = $("#indirect"), + r = $("#newIndirect"), + u = '<div class="row btnRow"><button id="newIndirect" class="k-button k-button-get">' + C_DodajStacjePosrednia + "<\/button><\/div>", + t = $("#switchParamsMode").parent(); + i > 0 ? (n.attr("enable", "false").addClass("k-state-disabled"), n.text(C_PrzezStacjePosrednia), t.show(), r || $(".route .container").append(u)) : (n.removeAttr("enable").removeClass("k-state-disabled"), n.text(C_DodajStacjePosrednia), $("#newIndirect").parent(".btnRow").remove(), t.hide()) +} + +function countChecks(n) { + var r = n.closest(".layer").find("ul input:checkbox").length, + i = n.closest(".layer").find("ul input:checkbox:checked").length, + t = n.closest(".multiMenu").find(".num"); + t.html(""); + r === i ? (t.html(""), t.append("wszyscy")) : t.append("<span>wybrano " + i + "<\/span>") +} + +function null2empty(n, t, i) { + if (!t || t == "") return ""; + var r = i ? i : ""; + return n + " " + t + " " + r +} + +function minuty2MinGodz(n) { + n = Math.ceil(n); + var t = Math.floor(n / 60); + return t < 10 && (t = "0" + t), t += ":", n % 60 < 10 && (t += "0"), t + Math.round(n % 60) +} + +function minuty2HHmm(n) { + var t = Math.floor(n / 60), + i = n - t * 60; + return t < 10 && (t = "0" + t), i < 10 && (i = "0" + i), t + ":" + i +} + +function timeStamp2Tekst(n) { + return minuty2MinGodz(n.TotalMinutes) +} + +function jsonTime2Time(n, t) { + return n == "" ? "" : (t = typeof t != "undefined" ? t : "yyyy-MM-dd HH:mm", kendo.toString(new Date(parseInt(n.substr(6))), t)) +} + +function jsonTime2JsTime(n, t) { + return n == "" ? "" : (t = typeof t != "undefined" ? t : "yyyy-MM-dd HH:mm", new Date(parseInt(n.substr(6)))) +} + +function usunPolskieZnaki(n) { + return n = n.replace(/Ę/g, "E").replace(/ę/g, "e"), n = n.replace(/Ó/g, "O").replace(/o/g, "o"), n = n.replace(/Ą/g, "A").replace(/ą/g, "a"), n = n.replace(/Ś/g, "S").replace(/ś/g, "s"), n = n.replace(/Ł/g, "L").replace(/ł/g, "l"), n = n.replace(/Ż/g, "Z").replace(/ż/g, "z"), n = n.replace(/Ź/g, "Z").replace(/ź/g, "z"), n = n.replace(/Ć/g, "C").replace(/ć/g, "c"), n.replace(/Ń/g, "N").replace(/ń/g, "n") +} + +function generujHashDanych(n) { + var t = ""; + return t += n.StacjaPoczatkowaID.toString(), t += n.LiczbaPrzesiadek.toString(), t += Date.parse(n.Odjazd), t += Date.parse(n.Przyjazd), t + n.Pociagi[0].ZamowienieSKRJID.toString() +} +var dateTimeFromServer, dateTimeFromClient, mouse_is_inside; +(function(n, t) { + function dt(n) { + var t = n.length, + r = i.type(n); + return i.isWindow(n) ? !1 : 1 === n.nodeType && t ? !0 : "array" === r || "function" !== r && (0 === t || "number" == typeof t && t > 0 && t - 1 in n) + } + + function kf(n) { + var t = gt[n] = {}; + return i.each(n.match(s) || [], function(n, i) { + t[i] = !0 + }), t + } + + function ir(n, r, u, f) { + if (i.acceptData(n)) { + var s, h, c = i.expando, + a = "string" == typeof r, + l = n.nodeType, + o = l ? i.cache : n, + e = l ? n[c] : n[c] && c; + if (e && o[e] && (f || o[e].data) || !a || u !== t) return e || (l ? n[c] = e = b.pop() || i.guid++ : e = c), o[e] || (o[e] = {}, l || (o[e].toJSON = i.noop)), ("object" == typeof r || "function" == typeof r) && (f ? o[e] = i.extend(o[e], r) : o[e].data = i.extend(o[e].data, r)), s = o[e], f || (s.data || (s.data = {}), s = s.data), u !== t && (s[i.camelCase(r)] = u), a ? (h = s[r], null == h && (h = s[i.camelCase(r)])) : h = s, h + } + } + + function rr(n, t, r) { + if (i.acceptData(n)) { + var o, h, e, s = n.nodeType, + u = s ? i.cache : n, + f = s ? n[i.expando] : i.expando; + if (u[f]) { + if (t && (e = r ? u[f] : u[f].data)) { + for (i.isArray(t) ? t = t.concat(i.map(t, i.camelCase)) : (t in e) ? t = [t] : (t = i.camelCase(t), t = (t in e) ? [t] : t.split(" ")), o = 0, h = t.length; h > o; o++) delete e[t[o]]; + if (!(r ? ni : i.isEmptyObject)(e)) return + }(r || (delete u[f].data, ni(u[f]))) && (s ? i.cleanData([n], !0) : i.support.deleteExpando || u != u.window ? delete u[f] : u[f] = null) + } + } + } + + function ur(n, r, u) { + if (u === t && 1 === n.nodeType) { + var f = "data-" + r.replace(tr, "-$1").toLowerCase(); + if (u = n.getAttribute(f), "string" == typeof u) { + try { + u = "true" === u ? !0 : "false" === u ? !1 : "null" === u ? null : +u + "" === u ? +u : nr.test(u) ? i.parseJSON(u) : u + } catch (e) {} + i.data(n, r, u) + } else u = t + } + return u + } + + function ni(n) { + for (var t in n) + if (("data" !== t || !i.isEmptyObject(n[t])) && "toJSON" !== t) return !1; + return !0 + } + + function ht() { + return !0 + } + + function d() { + return !1 + } + + function cr(n, t) { + do n = n[t]; while (n && 1 !== n.nodeType); + return n + } + + function lr(n, t, r) { + if (t = t || 0, i.isFunction(t)) return i.grep(n, function(n, i) { + var u = !!t.call(n, i, n); + return u === r + }); + if (t.nodeType) return i.grep(n, function(n) { + return n === t === r + }); + if ("string" == typeof t) { + var u = i.grep(n, function(n) { + return 1 === n.nodeType + }); + if (fe.test(t)) return i.filter(t, u, !r); + t = i.filter(t, u) + } + return i.grep(n, function(n) { + return i.inArray(n, t) >= 0 === r + }) + } + + function ar(n) { + var i = vr.split("|"), + t = n.createDocumentFragment(); + if (t.createElement) + while (i.length) t.createElement(i.pop()); + return t + } + + function ye(n, t) { + return n.getElementsByTagName(t)[0] || n.appendChild(n.ownerDocument.createElement(t)) + } + + function dr(n) { + var t = n.getAttributeNode("type"); + return n.type = (t && t.specified) + "/" + n.type, n + } + + function gr(n) { + var t = le.exec(n.type); + return t ? n.type = t[1] : n.removeAttribute("type"), n + } + + function si(n, t) { + for (var u, r = 0; null != (u = n[r]); r++) i._data(u, "globalEval", !t || i._data(t[r], "globalEval")) + } + + function nu(n, t) { + if (1 === t.nodeType && i.hasData(n)) { + var u, f, o, s = i._data(n), + r = i._data(t, s), + e = s.events; + if (e) { + delete r.handle; + r.events = {}; + for (u in e) + for (f = 0, o = e[u].length; o > f; f++) i.event.add(t, u, e[u][f]) + } + r.data && (r.data = i.extend({}, r.data)) + } + } + + function pe(n, t) { + var r, f, u; + if (1 === t.nodeType) { + if (r = t.nodeName.toLowerCase(), !i.support.noCloneEvent && t[i.expando]) { + u = i._data(t); + for (f in u.events) i.removeEvent(t, f, u.handle); + t.removeAttribute(i.expando) + } + "script" === r && t.text !== n.text ? (dr(t).text = n.text, gr(t)) : "object" === r ? (t.parentNode && (t.outerHTML = n.outerHTML), i.support.html5Clone && n.innerHTML && !i.trim(t.innerHTML) && (t.innerHTML = n.innerHTML)) : "input" === r && ei.test(n.type) ? (t.defaultChecked = t.checked = n.checked, t.value !== n.value && (t.value = n.value)) : "option" === r ? t.defaultSelected = t.selected = n.defaultSelected : ("input" === r || "textarea" === r) && (t.defaultValue = n.defaultValue) + } + } + + function u(n, r) { + var s, e, h = 0, + f = typeof n.getElementsByTagName !== o ? n.getElementsByTagName(r || "*") : typeof n.querySelectorAll !== o ? n.querySelectorAll(r || "*") : t; + if (!f) + for (f = [], s = n.childNodes || n; null != (e = s[h]); h++) !r || i.nodeName(e, r) ? f.push(e) : i.merge(f, u(e, r)); + return r === t || r && i.nodeName(n, r) ? i.merge([n], f) : f + } + + function we(n) { + ei.test(n.type) && (n.defaultChecked = n.checked) + } + + function fu(n, t) { + if (t in n) return t; + for (var r = t.charAt(0).toUpperCase() + t.slice(1), u = t, i = uu.length; i--;) + if (t = uu[i] + r, t in n) return t; + return u + } + + function ut(n, t) { + return n = t || n, "none" === i.css(n, "display") || !i.contains(n.ownerDocument, n) + } + + function eu(n, t) { + for (var f, r, o, e = [], u = 0, s = n.length; s > u; u++) r = n[u], r.style && (e[u] = i._data(r, "olddisplay"), f = r.style.display, t ? (e[u] || "none" !== f || (r.style.display = ""), "" === r.style.display && ut(r) && (e[u] = i._data(r, "olddisplay", cu(r.nodeName)))) : e[u] || (o = ut(r), (f && "none" !== f || !o) && i._data(r, "olddisplay", o ? f : i.css(r, "display")))); + for (u = 0; s > u; u++) r = n[u], r.style && (t && "none" !== r.style.display && "" !== r.style.display || (r.style.display = t ? e[u] || "" : "none")); + return n + } + + function ou(n, t, i) { + var r = ge.exec(t); + return r ? Math.max(0, r[1] - (i || 0)) + (r[2] || "px") : t + } + + function su(n, t, r, u, f) { + for (var e = r === (u ? "border" : "content") ? 4 : "width" === t ? 1 : 0, o = 0; 4 > e; e += 2) "margin" === r && (o += i.css(n, r + p[e], !0, f)), u ? ("content" === r && (o -= i.css(n, "padding" + p[e], !0, f)), "margin" !== r && (o -= i.css(n, "border" + p[e] + "Width", !0, f))) : (o += i.css(n, "padding" + p[e], !0, f), "padding" !== r && (o += i.css(n, "border" + p[e] + "Width", !0, f))); + return o + } + + function hu(n, t, r) { + var e = !0, + u = "width" === t ? n.offsetWidth : n.offsetHeight, + f = v(n), + o = i.support.boxSizing && "border-box" === i.css(n, "boxSizing", !1, f); + if (0 >= u || null == u) { + if (u = y(n, t, f), (0 > u || null == u) && (u = n.style[t]), ct.test(u)) return u; + e = o && (i.support.boxSizingReliable || u === n.style[t]); + u = parseFloat(u) || 0 + } + return u + su(n, t, r || (o ? "border" : "content"), e, f) + "px" + } + + function cu(n) { + var u = r, + t = iu[n]; + return t || (t = lu(n, u), "none" !== t && t || (rt = (rt || i("<iframe frameborder='0' width='0' height='0'/>").css("cssText", "display:block !important")).appendTo(u.documentElement), u = (rt[0].contentWindow || rt[0].contentDocument).document, u.write("<!doctype html><html><body>"), u.close(), t = lu(n, u), rt.detach()), iu[n] = t), t + } + + function lu(n, t) { + var r = i(t.createElement(n)).appendTo(t.body), + u = i.css(r[0], "display"); + return r.remove(), u + } + + function ci(n, t, r, u) { + var f; + if (i.isArray(t)) i.each(t, function(t, i) { + r || ro.test(n) ? u(n, i) : ci(n + "[" + ("object" == typeof i ? t : "") + "]", i, r, u) + }); + else if (r || "object" !== i.type(t)) u(n, t); + else + for (f in t) ci(n + "[" + f + "]", t[f], r, u) + } + + function ku(n) { + return function(t, r) { + "string" != typeof t && (r = t, t = "*"); + var u, f = 0, + e = t.toLowerCase().match(s) || []; + if (i.isFunction(r)) + while (u = e[f++]) "+" === u[0] ? (u = u.slice(1) || "*", (n[u] = n[u] || []).unshift(r)) : (n[u] = n[u] || []).push(r) + } + } + + function du(n, r, u, f) { + function o(h) { + var c; + return e[h] = !0, i.each(n[h] || [], function(n, i) { + var h = i(r, u, f); + return "string" != typeof h || s || e[h] ? s ? !(c = h) : t : (r.dataTypes.unshift(h), o(h), !1) + }), c + } + var e = {}, + s = n === vi; + return o(r.dataTypes[0]) || !e["*"] && o("*") + } + + function yi(n, r) { + var f, u, e = i.ajaxSettings.flatOptions || {}; + for (u in r) r[u] !== t && ((e[u] ? n : f || (f = {}))[u] = r[u]); + return f && i.extend(!0, n, f), n + } + + function co(n, i, r) { + var s, o, e, u, h = n.contents, + f = n.dataTypes, + c = n.responseFields; + for (u in c) u in r && (i[c[u]] = r[u]); + while ("*" === f[0]) f.shift(), o === t && (o = n.mimeType || i.getResponseHeader("Content-Type")); + if (o) + for (u in h) + if (h[u] && h[u].test(o)) { + f.unshift(u); + break + } + if (f[0] in r) e = f[0]; + else { + for (u in r) { + if (!f[0] || n.converters[u + " " + f[0]]) { + e = u; + break + } + s || (s = u) + } + e = e || s + } + return e ? (e !== f[0] && f.unshift(e), r[e]) : t + } + + function lo(n, t) { + var o, r, i, e, u = {}, + h = 0, + s = n.dataTypes.slice(), + f = s[0]; + if (n.dataFilter && (t = n.dataFilter(t, n.dataType)), s[1]) + for (i in n.converters) u[i.toLowerCase()] = n.converters[i]; + for (; r = s[++h];) + if ("*" !== r) { + if ("*" !== f && f !== r) { + if (i = u[f + " " + r] || u["* " + r], !i) + for (o in u) + if (e = o.split(" "), e[1] === r && (i = u[f + " " + e[0]] || u["* " + e[0]])) { + i === !0 ? i = u[o] : u[o] !== !0 && (r = e[0], s.splice(h--, 0, r)); + break + } + if (i !== !0) + if (i && n.throws) t = i(t); + else try { + t = i(t) + } catch (c) { + return { + state: "parsererror", + error: i ? c : "No conversion from " + f + " to " + r + } + } + } + f = r + } + return { + state: "success", + data: t + } + } + + function nf() { + try { + return new n.XMLHttpRequest + } catch (t) {} + } + + function ao() { + try { + return new n.ActiveXObject("Microsoft.XMLHTTP") + } catch (t) {} + } + + function tf() { + return setTimeout(function() { + tt = t + }), tt = i.now() + } + + function wo(n, t) { + i.each(t, function(t, i) { + for (var u = (ft[t] || []).concat(ft["*"]), r = 0, f = u.length; f > r; r++) + if (u[r].call(n, t, i)) return + }) + } + + function rf(n, t, r) { + var h, e, o = 0, + l = yt.length, + f = i.Deferred().always(function() { + delete c.elem + }), + c = function() { + if (e) return !1; + for (var s = tt || tf(), t = Math.max(0, u.startTime + u.duration - s), h = t / u.duration || 0, i = 1 - h, r = 0, o = u.tweens.length; o > r; r++) u.tweens[r].run(i); + return f.notifyWith(n, [u, i, t]), 1 > i && o ? t : (f.resolveWith(n, [u]), !1) + }, + u = f.promise({ + elem: n, + props: i.extend({}, t), + opts: i.extend(!0, { + specialEasing: {} + }, r), + originalProperties: t, + originalOptions: r, + startTime: tt || tf(), + duration: r.duration, + tweens: [], + createTween: function(t, r) { + var f = i.Tween(n, u.opts, t, r, u.opts.specialEasing[t] || u.opts.easing); + return u.tweens.push(f), f + }, + stop: function(t) { + var i = 0, + r = t ? u.tweens.length : 0; + if (e) return this; + for (e = !0; r > i; i++) u.tweens[i].run(1); + return t ? f.resolveWith(n, [u, t]) : f.rejectWith(n, [u, t]), this + } + }), + s = u.props; + for (bo(s, u.opts.specialEasing); l > o; o++) + if (h = yt[o].call(u, n, s, u.opts)) return h; + return wo(u, s), i.isFunction(u.opts.start) && u.opts.start.call(n, u), i.fx.timer(i.extend(c, { + elem: n, + anim: u, + queue: u.opts.queue + })), u.progress(u.opts.progress).done(u.opts.done, u.opts.complete).fail(u.opts.fail).always(u.opts.always) + } + + function bo(n, t) { + var u, f, r, e, o; + for (r in n) + if (f = i.camelCase(r), e = t[f], u = n[r], i.isArray(u) && (e = u[1], u = n[r] = u[0]), r !== f && (n[f] = u, delete n[r]), o = i.cssHooks[f], o && "expand" in o) { + u = o.expand(u); + delete n[f]; + for (r in u) r in n || (n[r] = u[r], t[r] = e) + } else t[f] = e + } + + function ko(n, t, r) { + var u, o, w, a, s, v, l, f, b, h = this, + e = n.style, + y = {}, + p = [], + c = n.nodeType && ut(n); + r.queue || (f = i._queueHooks(n, "fx"), null == f.unqueued && (f.unqueued = 0, b = f.empty.fire, f.empty.fire = function() { + f.unqueued || b() + }), f.unqueued++, h.always(function() { + h.always(function() { + f.unqueued--; + i.queue(n, "fx").length || f.empty.fire() + }) + })); + 1 === n.nodeType && ("height" in t || "width" in t) && (r.overflow = [e.overflow, e.overflowX, e.overflowY], "inline" === i.css(n, "display") && "none" === i.css(n, "float") && (i.support.inlineBlockNeedsLayout && "inline" !== cu(n.nodeName) ? e.zoom = 1 : e.display = "inline-block")); + r.overflow && (e.overflow = "hidden", i.support.shrinkWrapBlocks || h.always(function() { + e.overflow = r.overflow[0]; + e.overflowX = r.overflow[1]; + e.overflowY = r.overflow[2] + })); + for (o in t) + if (a = t[o], vo.exec(a)) { + if (delete t[o], v = v || "toggle" === a, a === (c ? "hide" : "show")) continue; + p.push(o) + } + if (w = p.length) + for (s = i._data(n, "fxshow") || i._data(n, "fxshow", {}), ("hidden" in s) && (c = s.hidden), v && (s.hidden = !c), c ? i(n).show() : h.done(function() { + i(n).hide() + }), h.done(function() { + var t; + i._removeData(n, "fxshow"); + for (t in y) i.style(n, t, y[t]) + }), o = 0; w > o; o++) u = p[o], l = h.createTween(u, c ? s[u] : 0), y[u] = s[u] || i.style(n, u), u in s || (s[u] = l.start, c && (l.end = l.start, l.start = "width" === u || "height" === u ? 1 : 0)) + } + + function f(n, t, i, r, u) { + return new f.prototype.init(n, t, i, r, u) + } + + function pt(n, t) { + var r, i = { + height: n + }, + u = 0; + for (t = t ? 1 : 0; 4 > u; u += 2 - t) r = p[u], i["margin" + r] = i["padding" + r] = n; + return t && (i.opacity = i.width = n), i + } + + function uf(n) { + return i.isWindow(n) ? n : 9 === n.nodeType ? n.defaultView || n.parentWindow : !1 + } + var et, wi, o = typeof t, + r = n.document, + ff = n.location, + ef = n.jQuery, + of = n.$, + ot = {}, + b = [], + wt = "1.9.1", + bi = b.concat, + bt = b.push, + l = b.slice, + ki = b.indexOf, + sf = ot.toString, + it = ot.hasOwnProperty, + kt = wt.trim, + i = function(n, t) { + return new i.fn.init(n, t, wi) + }, + st = /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source, + s = /\S+/g, + hf = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g, + cf = /^(?:(<[\w\W]+>)[^>]*|#([\w-]*))$/, + di = /^<(\w+)\s*\/?>(?:<\/\1>|)$/, + lf = /^[\],:{}\s]*$/, + af = /(?:^|:|,)(?:\s*\[)+/g, + vf = /\\(?:["\\\/bfnrt]|u[\da-fA-F]{4})/g, + yf = /"[^"\\\r\n]*"|true|false|null|-?(?:\d+\.|)\d+(?:[eE][+-]?\d+|)/g, + pf = /^-ms-/, + wf = /-([\da-z])/gi, + bf = function(n, t) { + return t.toUpperCase() + }, + h = function(n) { + (r.addEventListener || "load" === n.type || "complete" === r.readyState) && (gi(), i.ready()) + }, + gi = function() { + r.addEventListener ? (r.removeEventListener("DOMContentLoaded", h, !1), n.removeEventListener("load", h, !1)) : (r.detachEvent("onreadystatechange", h), n.detachEvent("onload", h)) + }, + gt, nr, tr, pi, lt, g, nt, gu, at; + i.fn = i.prototype = { + jquery: wt, + constructor: i, + init: function(n, u, f) { + var e, o; + if (!n) return this; + if ("string" == typeof n) { + if (e = "<" === n.charAt(0) && ">" === n.charAt(n.length - 1) && n.length >= 3 ? [null, n, null] : cf.exec(n), !e || !e[1] && u) return !u || u.jquery ? (u || f).find(n) : this.constructor(u).find(n); + if (e[1]) { + if (u = u instanceof i ? u[0] : u, i.merge(this, i.parseHTML(e[1], u && u.nodeType ? u.ownerDocument || u : r, !0)), di.test(e[1]) && i.isPlainObject(u)) + for (e in u) i.isFunction(this[e]) ? this[e](u[e]) : this.attr(e, u[e]); + return this + } + if (o = r.getElementById(e[2]), o && o.parentNode) { + if (o.id !== e[2]) return f.find(n); + this.length = 1; + this[0] = o + } + return this.context = r, this.selector = n, this + } + return n.nodeType ? (this.context = this[0] = n, this.length = 1, this) : i.isFunction(n) ? f.ready(n) : (n.selector !== t && (this.selector = n.selector, this.context = n.context), i.makeArray(n, this)) + }, + selector: "", + length: 0, + size: function() { + return this.length + }, + toArray: function() { + return l.call(this) + }, + get: function(n) { + return null == n ? this.toArray() : 0 > n ? this[this.length + n] : this[n] + }, + pushStack: function(n) { + var t = i.merge(this.constructor(), n); + return t.prevObject = this, t.context = this.context, t + }, + each: function(n, t) { + return i.each(this, n, t) + }, + ready: function(n) { + return i.ready.promise().done(n), this + }, + slice: function() { + return this.pushStack(l.apply(this, arguments)) + }, + first: function() { + return this.eq(0) + }, + last: function() { + return this.eq(-1) + }, + eq: function(n) { + var i = this.length, + t = +n + (0 > n ? i : 0); + return this.pushStack(t >= 0 && i > t ? [this[t]] : []) + }, + map: function(n) { + return this.pushStack(i.map(this, function(t, i) { + return n.call(t, i, t) + })) + }, + end: function() { + return this.prevObject || this.constructor(null) + }, + push: bt, + sort: [].sort, + splice: [].splice + }; + i.fn.init.prototype = i.fn; + i.extend = i.fn.extend = function() { + var u, o, r, e, s, h, n = arguments[0] || {}, + f = 1, + l = arguments.length, + c = !1; + for ("boolean" == typeof n && (c = n, n = arguments[1] || {}, f = 2), "object" == typeof n || i.isFunction(n) || (n = {}), l === f && (n = this, --f); l > f; f++) + if (null != (s = arguments[f])) + for (e in s) u = n[e], r = s[e], n !== r && (c && r && (i.isPlainObject(r) || (o = i.isArray(r))) ? (o ? (o = !1, h = u && i.isArray(u) ? u : []) : h = u && i.isPlainObject(u) ? u : {}, n[e] = i.extend(c, h, r)) : r !== t && (n[e] = r)); + return n + }; + i.extend({ + noConflict: function(t) { + return n.$ === i && (n.$ = of ), t && n.jQuery === i && (n.jQuery = ef), i + }, + isReady: !1, + readyWait: 1, + holdReady: function(n) { + n ? i.readyWait++ : i.ready(!0) + }, + ready: function(n) { + if (n === !0 ? !--i.readyWait : !i.isReady) { + if (!r.body) return setTimeout(i.ready); + i.isReady = !0; + n !== !0 && --i.readyWait > 0 || (et.resolveWith(r, [i]), i.fn.trigger && i(r).trigger("ready").off("ready")) + } + }, + isFunction: function(n) { + return "function" === i.type(n) + }, + isArray: Array.isArray || function(n) { + return "array" === i.type(n) + }, + isWindow: function(n) { + return null != n && n == n.window + }, + isNumeric: function(n) { + return !isNaN(parseFloat(n)) && isFinite(n) + }, + type: function(n) { + return null == n ? n + "" : "object" == typeof n || "function" == typeof n ? ot[sf.call(n)] || "object" : typeof n + }, + isPlainObject: function(n) { + if (!n || "object" !== i.type(n) || n.nodeType || i.isWindow(n)) return !1; + try { + if (n.constructor && !it.call(n, "constructor") && !it.call(n.constructor.prototype, "isPrototypeOf")) return !1 + } catch (u) { + return !1 + } + for (var r in n); + return r === t || it.call(n, r) + }, + isEmptyObject: function(n) { + for (var t in n) return !1; + return !0 + }, + error: function(n) { + throw Error(n); + }, + parseHTML: function(n, t, u) { + if (!n || "string" != typeof n) return null; + "boolean" == typeof t && (u = t, t = !1); + t = t || r; + var f = di.exec(n), + e = !u && []; + return f ? [t.createElement(f[1])] : (f = i.buildFragment([n], t, e), e && i(e).remove(), i.merge([], f.childNodes)) + }, + parseJSON: function(r) { + return n.JSON && n.JSON.parse ? n.JSON.parse(r) : null === r ? r : "string" == typeof r && (r = i.trim(r), r && lf.test(r.replace(vf, "@").replace(yf, "]").replace(af, ""))) ? Function("return " + r)() : (i.error("Invalid JSON: " + r), t) + }, + parseXML: function(r) { + var u, f; + if (!r || "string" != typeof r) return null; + try { + n.DOMParser ? (f = new DOMParser, u = f.parseFromString(r, "text/xml")) : (u = new ActiveXObject("Microsoft.XMLDOM"), u.async = "false", u.loadXML(r)) + } catch (e) { + u = t + } + return u && u.documentElement && !u.getElementsByTagName("parsererror").length || i.error("Invalid XML: " + r), u + }, + noop: function() {}, + globalEval: function(t) { + t && i.trim(t) && (n.execScript || function(t) { + n.eval.call(n, t) + })(t) + }, + camelCase: function(n) { + return n.replace(pf, "ms-").replace(wf, bf) + }, + nodeName: function(n, t) { + return n.nodeName && n.nodeName.toLowerCase() === t.toLowerCase() + }, + each: function(n, t, i) { + var u, r = 0, + f = n.length, + e = dt(n); + if (i) { + if (e) { + for (; f > r; r++) + if (u = t.apply(n[r], i), u === !1) break + } else + for (r in n) + if (u = t.apply(n[r], i), u === !1) break + } else if (e) { + for (; f > r; r++) + if (u = t.call(n[r], r, n[r]), u === !1) break + } else + for (r in n) + if (u = t.call(n[r], r, n[r]), u === !1) break; + return n + }, + trim: kt && !kt.call(" ") ? function(n) { + return null == n ? "" : kt.call(n) + } : function(n) { + return null == n ? "" : (n + "").replace(hf, "") + }, + makeArray: function(n, t) { + var r = t || []; + return null != n && (dt(Object(n)) ? i.merge(r, "string" == typeof n ? [n] : n) : bt.call(r, n)), r + }, + inArray: function(n, t, i) { + var r; + if (t) { + if (ki) return ki.call(t, n, i); + for (r = t.length, i = i ? 0 > i ? Math.max(0, r + i) : i : 0; r > i; i++) + if (i in t && t[i] === n) return i + } + return -1 + }, + merge: function(n, i) { + var f = i.length, + u = n.length, + r = 0; + if ("number" == typeof f) + for (; f > r; r++) n[u++] = i[r]; + else + while (i[r] !== t) n[u++] = i[r++]; + return n.length = u, n + }, + grep: function(n, t, i) { + var u, f = [], + r = 0, + e = n.length; + for (i = !!i; e > r; r++) u = !!t(n[r], r), i !== u && f.push(n[r]); + return f + }, + map: function(n, t, i) { + var u, r = 0, + e = n.length, + o = dt(n), + f = []; + if (o) + for (; e > r; r++) u = t(n[r], r, i), null != u && (f[f.length] = u); + else + for (r in n) u = t(n[r], r, i), null != u && (f[f.length] = u); + return bi.apply([], f) + }, + guid: 1, + proxy: function(n, r) { + var f, u, e; + return "string" == typeof r && (e = n[r], r = n, n = e), i.isFunction(n) ? (f = l.call(arguments, 2), u = function() { + return n.apply(r || this, f.concat(l.call(arguments))) + }, u.guid = n.guid = n.guid || i.guid++, u) : t + }, + access: function(n, r, u, f, e, o, s) { + var h = 0, + l = n.length, + c = null == u; + if ("object" === i.type(u)) { + e = !0; + for (h in u) i.access(n, r, h, u[h], !0, o, s) + } else if (f !== t && (e = !0, i.isFunction(f) || (s = !0), c && (s ? (r.call(n, f), r = null) : (c = r, r = function(n, t, r) { + return c.call(i(n), r) + })), r)) + for (; l > h; h++) r(n[h], u, s ? f : f.call(n[h], h, r(n[h], u))); + return e ? n : c ? r.call(n) : l ? r(n[0], u) : o + }, + now: function() { + return (new Date).getTime() + } + }); + i.ready.promise = function(t) { + if (!et) + if (et = i.Deferred(), "complete" === r.readyState) setTimeout(i.ready); + else if (r.addEventListener) r.addEventListener("DOMContentLoaded", h, !1), n.addEventListener("load", h, !1); + else { + r.attachEvent("onreadystatechange", h); + n.attachEvent("onload", h); + var u = !1; + try { + u = null == n.frameElement && r.documentElement + } catch (e) {} + u && u.doScroll && function f() { + if (!i.isReady) { + try { + u.doScroll("left") + } catch (n) { + return setTimeout(f, 50) + } + gi(); + i.ready() + } + }() + } + return et.promise(t) + }; + i.each("Boolean Number String Function Array Date RegExp Object Error".split(" "), function(n, t) { + ot["[object " + t + "]"] = t.toLowerCase() + }); + wi = i(r); + gt = {}; + i.Callbacks = function(n) { + n = "string" == typeof n ? gt[n] || kf(n) : i.extend({}, n); + var o, f, c, s, e, l, r = [], + u = !n.once && [], + a = function(t) { + for (f = n.memory && t, c = !0, e = l || 0, l = 0, s = r.length, o = !0; r && s > e; e++) + if (r[e].apply(t[0], t[1]) === !1 && n.stopOnFalse) { + f = !1; + break + } + o = !1; + r && (u ? u.length && a(u.shift()) : f ? r = [] : h.disable()) + }, + h = { + add: function() { + if (r) { + var t = r.length; + (function u(t) { + i.each(t, function(t, f) { + var e = i.type(f); + "function" === e ? n.unique && h.has(f) || r.push(f) : f && f.length && "string" !== e && u(f) + }) + })(arguments); + o ? s = r.length : f && (l = t, a(f)) + } + return this + }, + remove: function() { + return r && i.each(arguments, function(n, t) { + for (var u; + (u = i.inArray(t, r, u)) > -1;) r.splice(u, 1), o && (s >= u && s--, e >= u && e--) + }), this + }, + has: function(n) { + return n ? i.inArray(n, r) > -1 : !(!r || !r.length) + }, + empty: function() { + return r = [], this + }, + disable: function() { + return r = u = f = t, this + }, + disabled: function() { + return !r + }, + lock: function() { + return u = t, f || h.disable(), this + }, + locked: function() { + return !u + }, + fireWith: function(n, t) { + return t = t || [], t = [n, t.slice ? t.slice() : t], !r || c && !u || (o ? u.push(t) : a(t)), this + }, + fire: function() { + return h.fireWith(this, arguments), this + }, + fired: function() { + return !!c + } + }; + return h + }; + i.extend({ + Deferred: function(n) { + var u = [ + ["resolve", "done", i.Callbacks("once memory"), "resolved"], + ["reject", "fail", i.Callbacks("once memory"), "rejected"], + ["notify", "progress", i.Callbacks("memory")] + ], + f = "pending", + r = { + state: function() { + return f + }, + always: function() { + return t.done(arguments).fail(arguments), this + }, + then: function() { + var n = arguments; + return i.Deferred(function(f) { + i.each(u, function(u, e) { + var s = e[0], + o = i.isFunction(n[u]) && n[u]; + t[e[1]](function() { + var n = o && o.apply(this, arguments); + n && i.isFunction(n.promise) ? n.promise().done(f.resolve).fail(f.reject).progress(f.notify) : f[s + "With"](this === r ? f.promise() : this, o ? [n] : arguments) + }) + }); + n = null + }).promise() + }, + promise: function(n) { + return null != n ? i.extend(n, r) : r + } + }, + t = {}; + return r.pipe = r.then, i.each(u, function(n, i) { + var e = i[2], + o = i[3]; + r[i[1]] = e.add; + o && e.add(function() { + f = o + }, u[1 ^ n][2].disable, u[2][2].lock); + t[i[0]] = function() { + return t[i[0] + "With"](this === t ? r : this, arguments), this + }; + t[i[0] + "With"] = e.fireWith + }), r.promise(t), n && n.call(t, t), t + }, + when: function(n) { + var t = 0, + u = l.call(arguments), + r = u.length, + e = 1 !== r || n && i.isFunction(n.promise) ? r : 0, + f = 1 === e ? n : i.Deferred(), + h = function(n, t, i) { + return function(r) { + t[n] = this; + i[n] = arguments.length > 1 ? l.call(arguments) : r; + i === o ? f.notifyWith(t, i) : --e || f.resolveWith(t, i) + } + }, + o, c, s; + if (r > 1) + for (o = Array(r), c = Array(r), s = Array(r); r > t; t++) u[t] && i.isFunction(u[t].promise) ? u[t].promise().done(h(t, s, u)).fail(f.reject).progress(h(t, c, o)) : --e; + return e || f.resolveWith(s, u), f.promise() + } + }); + i.support = function() { + var u, s, e, f, h, c, l, a, y, v, t = r.createElement("div"); + if (t.setAttribute("className", "t"), t.innerHTML = " <link/><table><\/table><a href='/a'>a<\/a><input type='checkbox'/>", s = t.getElementsByTagName("*"), e = t.getElementsByTagName("a")[0], !s || !e || !s.length) return {}; + h = r.createElement("select"); + l = h.appendChild(r.createElement("option")); + f = t.getElementsByTagName("input")[0]; + e.style.cssText = "top:1px;float:left;opacity:.5"; + u = { + getSetAttribute: "t" !== t.className, + leadingWhitespace: 3 === t.firstChild.nodeType, + tbody: !t.getElementsByTagName("tbody").length, + htmlSerialize: !!t.getElementsByTagName("link").length, + style: /top/.test(e.getAttribute("style")), + hrefNormalized: "/a" === e.getAttribute("href"), + opacity: /^0.5/.test(e.style.opacity), + cssFloat: !!e.style.cssFloat, + checkOn: !!f.value, + optSelected: l.selected, + enctype: !!r.createElement("form").enctype, + html5Clone: "<:nav><\/:nav>" !== r.createElement("nav").cloneNode(!0).outerHTML, + boxModel: "CSS1Compat" === r.compatMode, + deleteExpando: !0, + noCloneEvent: !0, + inlineBlockNeedsLayout: !1, + shrinkWrapBlocks: !1, + reliableMarginRight: !0, + boxSizingReliable: !0, + pixelPosition: !1 + }; + f.checked = !0; + u.noCloneChecked = f.cloneNode(!0).checked; + h.disabled = !0; + u.optDisabled = !l.disabled; + try { + delete t.test + } catch (p) { + u.deleteExpando = !1 + } + f = r.createElement("input"); + f.setAttribute("value", ""); + u.input = "" === f.getAttribute("value"); + f.value = "t"; + f.setAttribute("type", "radio"); + u.radioValue = "t" === f.value; + f.setAttribute("checked", "t"); + f.setAttribute("name", "t"); + c = r.createDocumentFragment(); + c.appendChild(f); + u.appendChecked = f.checked; + u.checkClone = c.cloneNode(!0).cloneNode(!0).lastChild.checked; + t.attachEvent && (t.attachEvent("onclick", function() { + u.noCloneEvent = !1 + }), t.cloneNode(!0).click()); + for (v in { + submit: !0, + change: !0, + focusin: !0 + }) t.setAttribute(a = "on" + v, "t"), u[v + "Bubbles"] = a in n || t.attributes[a].expando === !1; + return t.style.backgroundClip = "content-box", t.cloneNode(!0).style.backgroundClip = "", u.clearCloneStyle = "content-box" === t.style.backgroundClip, i(function() { + var e, f, i, h = "padding:0;margin:0;border:0;display:block;box-sizing:content-box;-moz-box-sizing:content-box;-webkit-box-sizing:content-box;", + s = r.getElementsByTagName("body")[0]; + s && (e = r.createElement("div"), e.style.cssText = "border:0;width:0;height:0;position:absolute;top:0;left:-9999px;margin-top:1px", s.appendChild(e).appendChild(t), t.innerHTML = "<table><tr><td><\/td><td>t<\/td><\/tr><\/table>", i = t.getElementsByTagName("td"), i[0].style.cssText = "padding:0;margin:0;border:0;display:none", y = 0 === i[0].offsetHeight, i[0].style.display = "", i[1].style.display = "none", u.reliableHiddenOffsets = y && 0 === i[0].offsetHeight, t.innerHTML = "", t.style.cssText = "box-sizing:border-box;-moz-box-sizing:border-box;-webkit-box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%;", u.boxSizing = 4 === t.offsetWidth, u.doesNotIncludeMarginInBodyOffset = 1 !== s.offsetTop, n.getComputedStyle && (u.pixelPosition = "1%" !== (n.getComputedStyle(t, null) || {}).top, u.boxSizingReliable = "4px" === (n.getComputedStyle(t, null) || { + width: "4px" + }).width, f = t.appendChild(r.createElement("div")), f.style.cssText = t.style.cssText = h, f.style.marginRight = f.style.width = "0", t.style.width = "1px", u.reliableMarginRight = !parseFloat((n.getComputedStyle(f, null) || {}).marginRight)), typeof t.style.zoom !== o && (t.innerHTML = "", t.style.cssText = h + "width:1px;padding:1px;display:inline;zoom:1", u.inlineBlockNeedsLayout = 3 === t.offsetWidth, t.style.display = "block", t.innerHTML = "<div><\/div>", t.firstChild.style.width = "5px", u.shrinkWrapBlocks = 3 !== t.offsetWidth, u.inlineBlockNeedsLayout && (s.style.zoom = 1)), s.removeChild(e), e = t = i = f = null) + }), s = h = c = l = e = f = null, u + }(); + nr = /(?:\{[\s\S]*\}|\[[\s\S]*\])$/; + tr = /([A-Z])/g; + i.extend({ + cache: {}, + expando: "jQuery" + (wt + Math.random()).replace(/\D/g, ""), + noData: { + embed: !0, + object: "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", + applet: !0 + }, + hasData: function(n) { + return n = n.nodeType ? i.cache[n[i.expando]] : n[i.expando], !!n && !ni(n) + }, + data: function(n, t, i) { + return ir(n, t, i) + }, + removeData: function(n, t) { + return rr(n, t) + }, + _data: function(n, t, i) { + return ir(n, t, i, !0) + }, + _removeData: function(n, t) { + return rr(n, t, !0) + }, + acceptData: function(n) { + if (n.nodeType && 1 !== n.nodeType && 9 !== n.nodeType) return !1; + var t = n.nodeName && i.noData[n.nodeName.toLowerCase()]; + return !t || t !== !0 && n.getAttribute("classid") === t + } + }); + i.fn.extend({ + data: function(n, r) { + var e, f, u = this[0], + o = 0, + s = null; + if (n === t) { + if (this.length && (s = i.data(u), 1 === u.nodeType && !i._data(u, "parsedAttrs"))) { + for (e = u.attributes; e.length > o; o++) f = e[o].name, f.indexOf("data-") || (f = i.camelCase(f.slice(5)), ur(u, f, s[f])); + i._data(u, "parsedAttrs", !0) + } + return s + } + return "object" == typeof n ? this.each(function() { + i.data(this, n) + }) : i.access(this, function(r) { + return r === t ? u ? ur(u, n, i.data(u, n)) : null : (this.each(function() { + i.data(this, n, r) + }), t) + }, null, r, arguments.length > 1, null, !0) + }, + removeData: function(n) { + return this.each(function() { + i.removeData(this, n) + }) + } + }); + i.extend({ + queue: function(n, r, u) { + var f; + return n ? (r = (r || "fx") + "queue", f = i._data(n, r), u && (!f || i.isArray(u) ? f = i._data(n, r, i.makeArray(u)) : f.push(u)), f || []) : t + }, + dequeue: function(n, t) { + t = t || "fx"; + var f = i.queue(n, t), + e = f.length, + r = f.shift(), + u = i._queueHooks(n, t), + o = function() { + i.dequeue(n, t) + }; + "inprogress" === r && (r = f.shift(), e--); + u.cur = r; + r && ("fx" === t && f.unshift("inprogress"), delete u.stop, r.call(n, o, u)); + !e && u && u.empty.fire() + }, + _queueHooks: function(n, t) { + var r = t + "queueHooks"; + return i._data(n, r) || i._data(n, r, { + empty: i.Callbacks("once memory").add(function() { + i._removeData(n, t + "queue"); + i._removeData(n, r) + }) + }) + } + }); + i.fn.extend({ + queue: function(n, r) { + var u = 2; + return "string" != typeof n && (r = n, n = "fx", u--), u > arguments.length ? i.queue(this[0], n) : r === t ? this : this.each(function() { + var t = i.queue(this, n, r); + i._queueHooks(this, n); + "fx" === n && "inprogress" !== t[0] && i.dequeue(this, n) + }) + }, + dequeue: function(n) { + return this.each(function() { + i.dequeue(this, n) + }) + }, + delay: function(n, t) { + return n = i.fx ? i.fx.speeds[n] || n : n, t = t || "fx", this.queue(t, function(t, i) { + var r = setTimeout(t, n); + i.stop = function() { + clearTimeout(r) + } + }) + }, + clearQueue: function(n) { + return this.queue(n || "fx", []) + }, + promise: function(n, r) { + var u, e = 1, + o = i.Deferred(), + f = this, + s = this.length, + h = function() { + --e || o.resolveWith(f, [f]) + }; + for ("string" != typeof n && (r = n, n = t), n = n || "fx"; s--;) u = i._data(f[s], n + "queueHooks"), u && u.empty && (e++, u.empty.add(h)); + return h(), o.promise(r) + } + }); + var k, fr, ti = /[\t\r\n]/g, + df = /\r/g, + gf = /^(?:input|select|textarea|button|object)$/i, + ne = /^(?:a|area)$/i, + er = /^(?:checked|selected|autofocus|autoplay|async|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped)$/i, + ii = /^(?:checked|selected)$/i, + a = i.support.getSetAttribute, + ri = i.support.input; + i.fn.extend({ + attr: function(n, t) { + return i.access(this, i.attr, n, t, arguments.length > 1) + }, + removeAttr: function(n) { + return this.each(function() { + i.removeAttr(this, n) + }) + }, + prop: function(n, t) { + return i.access(this, i.prop, n, t, arguments.length > 1) + }, + removeProp: function(n) { + return n = i.propFix[n] || n, this.each(function() { + try { + this[n] = t; + delete this[n] + } catch (i) {} + }) + }, + addClass: function(n) { + var e, t, r, u, o, f = 0, + h = this.length, + c = "string" == typeof n && n; + if (i.isFunction(n)) return this.each(function(t) { + i(this).addClass(n.call(this, t, this.className)) + }); + if (c) + for (e = (n || "").match(s) || []; h > f; f++) + if (t = this[f], r = 1 === t.nodeType && (t.className ? (" " + t.className + " ").replace(ti, " ") : " ")) { + for (o = 0; u = e[o++];) 0 > r.indexOf(" " + u + " ") && (r += u + " "); + t.className = i.trim(r) + } + return this + }, + removeClass: function(n) { + var e, t, r, u, o, f = 0, + h = this.length, + c = 0 === arguments.length || "string" == typeof n && n; + if (i.isFunction(n)) return this.each(function(t) { + i(this).removeClass(n.call(this, t, this.className)) + }); + if (c) + for (e = (n || "").match(s) || []; h > f; f++) + if (t = this[f], r = 1 === t.nodeType && (t.className ? (" " + t.className + " ").replace(ti, " ") : "")) { + for (o = 0; u = e[o++];) + while (r.indexOf(" " + u + " ") >= 0) r = r.replace(" " + u + " ", " "); + t.className = n ? i.trim(r) : "" + } + return this + }, + toggleClass: function(n, t) { + var r = typeof n, + u = "boolean" == typeof t; + return i.isFunction(n) ? this.each(function(r) { + i(this).toggleClass(n.call(this, r, this.className, t), t) + }) : this.each(function() { + if ("string" === r) + for (var f, c = 0, h = i(this), e = t, l = n.match(s) || []; f = l[c++];) e = u ? e : !h.hasClass(f), h[e ? "addClass" : "removeClass"](f); + else(r === o || "boolean" === r) && (this.className && i._data(this, "__className__", this.className), this.className = this.className || n === !1 ? "" : i._data(this, "__className__") || "") + }) + }, + hasClass: function(n) { + for (var i = " " + n + " ", t = 0, r = this.length; r > t; t++) + if (1 === this[t].nodeType && (" " + this[t].className + " ").replace(ti, " ").indexOf(i) >= 0) return !0; + return !1 + }, + val: function(n) { + var u, r, e, f = this[0]; + return arguments.length ? (e = i.isFunction(n), this.each(function(u) { + var f, o = i(this); + 1 === this.nodeType && (f = e ? n.call(this, u, o.val()) : n, null == f ? f = "" : "number" == typeof f ? f += "" : i.isArray(f) && (f = i.map(f, function(n) { + return null == n ? "" : n + "" + })), r = i.valHooks[this.type] || i.valHooks[this.nodeName.toLowerCase()], r && "set" in r && r.set(this, f, "value") !== t || (this.value = f)) + })) : f ? (r = i.valHooks[f.type] || i.valHooks[f.nodeName.toLowerCase()], r && "get" in r && (u = r.get(f, "value")) !== t ? u : (u = f.value, "string" == typeof u ? u.replace(df, "") : null == u ? "" : u)) : void 0 + } + }); + i.extend({ + valHooks: { + option: { + get: function(n) { + var t = n.attributes.value; + return !t || t.specified ? n.value : n.text + } + }, + select: { + get: function(n) { + for (var e, t, o = n.options, r = n.selectedIndex, u = "select-one" === n.type || 0 > r, s = u ? null : [], h = u ? r + 1 : o.length, f = 0 > r ? h : u ? r : 0; h > f; f++) + if (t = o[f], !(!t.selected && f !== r || (i.support.optDisabled ? t.disabled : null !== t.getAttribute("disabled")) || t.parentNode.disabled && i.nodeName(t.parentNode, "optgroup"))) { + if (e = i(t).val(), u) return e; + s.push(e) + } + return s + }, + set: function(n, t) { + var r = i.makeArray(t); + return i(n).find("option").each(function() { + this.selected = i.inArray(i(this).val(), r) >= 0 + }), r.length || (n.selectedIndex = -1), r + } + } + }, + attr: function(n, r, u) { + var f, s, e, h = n.nodeType; + if (n && 3 !== h && 8 !== h && 2 !== h) return typeof n.getAttribute === o ? i.prop(n, r, u) : (s = 1 !== h || !i.isXMLDoc(n), s && (r = r.toLowerCase(), f = i.attrHooks[r] || (er.test(r) ? fr : k)), u === t ? f && s && "get" in f && null !== (e = f.get(n, r)) ? e : (typeof n.getAttribute !== o && (e = n.getAttribute(r)), null == e ? t : e) : null !== u ? f && s && "set" in f && (e = f.set(n, u, r)) !== t ? e : (n.setAttribute(r, u + ""), u) : (i.removeAttr(n, r), t)) + }, + removeAttr: function(n, t) { + var r, u, e = 0, + f = t && t.match(s); + if (f && 1 === n.nodeType) + while (r = f[e++]) u = i.propFix[r] || r, er.test(r) ? !a && ii.test(r) ? n[i.camelCase("default-" + r)] = n[u] = !1 : n[u] = !1 : i.attr(n, r, ""), n.removeAttribute(a ? r : u) + }, + attrHooks: { + type: { + set: function(n, t) { + if (!i.support.radioValue && "radio" === t && i.nodeName(n, "input")) { + var r = n.value; + return n.setAttribute("type", t), r && (n.value = r), t + } + } + } + }, + propFix: { + tabindex: "tabIndex", + readonly: "readOnly", + "for": "htmlFor", + "class": "className", + maxlength: "maxLength", + cellspacing: "cellSpacing", + cellpadding: "cellPadding", + rowspan: "rowSpan", + colspan: "colSpan", + usemap: "useMap", + frameborder: "frameBorder", + contenteditable: "contentEditable" + }, + prop: function(n, r, u) { + var e, f, s, o = n.nodeType; + if (n && 3 !== o && 8 !== o && 2 !== o) return s = 1 !== o || !i.isXMLDoc(n), s && (r = i.propFix[r] || r, f = i.propHooks[r]), u !== t ? f && "set" in f && (e = f.set(n, u, r)) !== t ? e : n[r] = u : f && "get" in f && null !== (e = f.get(n, r)) ? e : n[r] + }, + propHooks: { + tabIndex: { + get: function(n) { + var i = n.getAttributeNode("tabindex"); + return i && i.specified ? parseInt(i.value, 10) : gf.test(n.nodeName) || ne.test(n.nodeName) && n.href ? 0 : t + } + } + } + }); + fr = { + get: function(n, r) { + var u = i.prop(n, r), + f = "boolean" == typeof u && n.getAttribute(r), + e = "boolean" == typeof u ? ri && a ? null != f : ii.test(r) ? n[i.camelCase("default-" + r)] : !!f : n.getAttributeNode(r); + return e && e.value !== !1 ? r.toLowerCase() : t + }, + set: function(n, t, r) { + return t === !1 ? i.removeAttr(n, r) : ri && a || !ii.test(r) ? n.setAttribute(!a && i.propFix[r] || r, r) : n[i.camelCase("default-" + r)] = n[r] = !0, r + } + }; + ri && a || (i.attrHooks.value = { + get: function(n, r) { + var u = n.getAttributeNode(r); + return i.nodeName(n, "input") ? n.defaultValue : u && u.specified ? u.value : t + }, + set: function(n, r, u) { + return i.nodeName(n, "input") ? (n.defaultValue = r, t) : k && k.set(n, r, u) + } + }); + a || (k = i.valHooks.button = { + get: function(n, i) { + var r = n.getAttributeNode(i); + return r && ("id" === i || "name" === i || "coords" === i ? "" !== r.value : r.specified) ? r.value : t + }, + set: function(n, i, r) { + var u = n.getAttributeNode(r); + return u || n.setAttributeNode(u = n.ownerDocument.createAttribute(r)), u.value = i += "", "value" === r || i === n.getAttribute(r) ? i : t + } + }, i.attrHooks.contenteditable = { + get: k.get, + set: function(n, t, i) { + k.set(n, "" === t ? !1 : t, i) + } + }, i.each(["width", "height"], function(n, r) { + i.attrHooks[r] = i.extend(i.attrHooks[r], { + set: function(n, i) { + return "" === i ? (n.setAttribute(r, "auto"), i) : t + } + }) + })); + i.support.hrefNormalized || (i.each(["href", "src", "width", "height"], function(n, r) { + i.attrHooks[r] = i.extend(i.attrHooks[r], { + get: function(n) { + var i = n.getAttribute(r, 2); + return null == i ? t : i + } + }) + }), i.each(["href", "src"], function(n, t) { + i.propHooks[t] = { + get: function(n) { + return n.getAttribute(t, 4) + } + } + })); + i.support.style || (i.attrHooks.style = { + get: function(n) { + return n.style.cssText || t + }, + set: function(n, t) { + return n.style.cssText = t + "" + } + }); + i.support.optSelected || (i.propHooks.selected = i.extend(i.propHooks.selected, { + get: function(n) { + var t = n.parentNode; + return t && (t.selectedIndex, t.parentNode && t.parentNode.selectedIndex), null + } + })); + i.support.enctype || (i.propFix.enctype = "encoding"); + i.support.checkOn || i.each(["radio", "checkbox"], function() { + i.valHooks[this] = { + get: function(n) { + return null === n.getAttribute("value") ? "on" : n.value + } + } + }); + i.each(["radio", "checkbox"], function() { + i.valHooks[this] = i.extend(i.valHooks[this], { + set: function(n, r) { + return i.isArray(r) ? n.checked = i.inArray(i(n).val(), r) >= 0 : t + } + }) + }); + var ui = /^(?:input|select|textarea)$/i, + te = /^key/, + ie = /^(?:mouse|contextmenu)|click/, + or = /^(?:focusinfocus|focusoutblur)$/, + sr = /^([^.]*)(?:\.(.+)|)$/; + i.event = { + global: {}, + add: function(n, r, u, f, e) { + var b, p, k, w, c, l, a, v, h, d, g, y = i._data(n); + if (y) { + for (u.handler && (w = u, u = w.handler, e = w.selector), u.guid || (u.guid = i.guid++), (p = y.events) || (p = y.events = {}), (l = y.handle) || (l = y.handle = function(n) { + return typeof i === o || n && i.event.triggered === n.type ? t : i.event.dispatch.apply(l.elem, arguments) + }, l.elem = n), r = (r || "").match(s) || [""], k = r.length; k--;) b = sr.exec(r[k]) || [], h = g = b[1], d = (b[2] || "").split(".").sort(), c = i.event.special[h] || {}, h = (e ? c.delegateType : c.bindType) || h, c = i.event.special[h] || {}, a = i.extend({ + type: h, + origType: g, + data: f, + handler: u, + guid: u.guid, + selector: e, + needsContext: e && i.expr.match.needsContext.test(e), + namespace: d.join(".") + }, w), (v = p[h]) || (v = p[h] = [], v.delegateCount = 0, c.setup && c.setup.call(n, f, d, l) !== !1 || (n.addEventListener ? n.addEventListener(h, l, !1) : n.attachEvent && n.attachEvent("on" + h, l))), c.add && (c.add.call(n, a), a.handler.guid || (a.handler.guid = u.guid)), e ? v.splice(v.delegateCount++, 0, a) : v.push(a), i.event.global[h] = !0; + n = null + } + }, + remove: function(n, t, r, u, f) { + var y, o, h, b, p, a, c, l, e, w, k, v = i.hasData(n) && i._data(n); + if (v && (a = v.events)) { + for (t = (t || "").match(s) || [""], p = t.length; p--;) + if (h = sr.exec(t[p]) || [], e = k = h[1], w = (h[2] || "").split(".").sort(), e) { + for (c = i.event.special[e] || {}, e = (u ? c.delegateType : c.bindType) || e, l = a[e] || [], h = h[2] && RegExp("(^|\\.)" + w.join("\\.(?:.*\\.|)") + "(\\.|$)"), b = y = l.length; y--;) o = l[y], !f && k !== o.origType || r && r.guid !== o.guid || h && !h.test(o.namespace) || u && u !== o.selector && ("**" !== u || !o.selector) || (l.splice(y, 1), o.selector && l.delegateCount--, c.remove && c.remove.call(n, o)); + b && !l.length && (c.teardown && c.teardown.call(n, w, v.handle) !== !1 || i.removeEvent(n, e, v.handle), delete a[e]) + } else + for (e in a) i.event.remove(n, e + t[p], r, u, !0); + i.isEmptyObject(a) && (delete v.handle, i._removeData(n, "events")) + } + }, + trigger: function(u, f, e, o) { + var a, v, h, p, l, c, w, b = [e || r], + s = it.call(u, "type") ? u.type : u, + y = it.call(u, "namespace") ? u.namespace.split(".") : []; + if (h = c = e = e || r, 3 !== e.nodeType && 8 !== e.nodeType && !or.test(s + i.event.triggered) && (s.indexOf(".") >= 0 && (y = s.split("."), s = y.shift(), y.sort()), v = 0 > s.indexOf(":") && "on" + s, u = u[i.expando] ? u : new i.Event(s, "object" == typeof u && u), u.isTrigger = !0, u.namespace = y.join("."), u.namespace_re = u.namespace ? RegExp("(^|\\.)" + y.join("\\.(?:.*\\.|)") + "(\\.|$)") : null, u.result = t, u.target || (u.target = e), f = null == f ? [u] : i.makeArray(f, [u]), l = i.event.special[s] || {}, o || !l.trigger || l.trigger.apply(e, f) !== !1)) { + if (!o && !l.noBubble && !i.isWindow(e)) { + for (p = l.delegateType || s, or.test(p + s) || (h = h.parentNode); h; h = h.parentNode) b.push(h), c = h; + c === (e.ownerDocument || r) && b.push(c.defaultView || c.parentWindow || n) + } + for (w = 0; + (h = b[w++]) && !u.isPropagationStopped();) u.type = w > 1 ? p : l.bindType || s, a = (i._data(h, "events") || {})[u.type] && i._data(h, "handle"), a && a.apply(h, f), a = v && h[v], a && i.acceptData(h) && a.apply && a.apply(h, f) === !1 && u.preventDefault(); + if (u.type = s, !(o || u.isDefaultPrevented() || l._default && l._default.apply(e.ownerDocument, f) !== !1 || "click" === s && i.nodeName(e, "a") || !i.acceptData(e) || !v || !e[s] || i.isWindow(e))) { + c = e[v]; + c && (e[v] = null); + i.event.triggered = s; + try { + e[s]() + } catch (k) {} + i.event.triggered = t; + c && (e[v] = c) + } + return u.result + } + }, + dispatch: function(n) { + n = i.event.fix(n); + var o, e, r, u, s, h = [], + c = l.call(arguments), + a = (i._data(this, "events") || {})[n.type] || [], + f = i.event.special[n.type] || {}; + if (c[0] = n, n.delegateTarget = this, !f.preDispatch || f.preDispatch.call(this, n) !== !1) { + for (h = i.event.handlers.call(this, n, a), o = 0; + (u = h[o++]) && !n.isPropagationStopped();) + for (n.currentTarget = u.elem, s = 0; + (r = u.handlers[s++]) && !n.isImmediatePropagationStopped();)(!n.namespace_re || n.namespace_re.test(r.namespace)) && (n.handleObj = r, n.data = r.data, e = ((i.event.special[r.origType] || {}).handle || r.handler).apply(u.elem, c), e !== t && (n.result = e) === !1 && (n.preventDefault(), n.stopPropagation())); + return f.postDispatch && f.postDispatch.call(this, n), n.result + } + }, + handlers: function(n, r) { + var e, o, f, s, c = [], + h = r.delegateCount, + u = n.target; + if (h && u.nodeType && (!n.button || "click" !== n.type)) + for (; u != this; u = u.parentNode || this) + if (1 === u.nodeType && (u.disabled !== !0 || "click" !== n.type)) { + for (f = [], s = 0; h > s; s++) o = r[s], e = o.selector + " ", f[e] === t && (f[e] = o.needsContext ? i(e, this).index(u) >= 0 : i.find(e, this, null, [u]).length), f[e] && f.push(o); + f.length && c.push({ + elem: u, + handlers: f + }) + } + return r.length > h && c.push({ + elem: this, + handlers: r.slice(h) + }), c + }, + fix: function(n) { + if (n[i.expando]) return n; + var e, o, s, u = n.type, + f = n, + t = this.fixHooks[u]; + for (t || (this.fixHooks[u] = t = ie.test(u) ? this.mouseHooks : te.test(u) ? this.keyHooks : {}), s = t.props ? this.props.concat(t.props) : this.props, n = new i.Event(f), e = s.length; e--;) o = s[e], n[o] = f[o]; + return n.target || (n.target = f.srcElement || r), 3 === n.target.nodeType && (n.target = n.target.parentNode), n.metaKey = !!n.metaKey, t.filter ? t.filter(n, f) : n + }, + props: "altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "), + fixHooks: {}, + keyHooks: { + props: "char charCode key keyCode".split(" "), + filter: function(n, t) { + return null == n.which && (n.which = null != t.charCode ? t.charCode : t.keyCode), n + } + }, + mouseHooks: { + props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "), + filter: function(n, i) { + var u, o, f, e = i.button, + s = i.fromElement; + return null == n.pageX && null != i.clientX && (o = n.target.ownerDocument || r, f = o.documentElement, u = o.body, n.pageX = i.clientX + (f && f.scrollLeft || u && u.scrollLeft || 0) - (f && f.clientLeft || u && u.clientLeft || 0), n.pageY = i.clientY + (f && f.scrollTop || u && u.scrollTop || 0) - (f && f.clientTop || u && u.clientTop || 0)), !n.relatedTarget && s && (n.relatedTarget = s === n.target ? i.toElement : s), n.which || e === t || (n.which = 1 & e ? 1 : 2 & e ? 3 : 4 & e ? 2 : 0), n + } + }, + special: { + load: { + noBubble: !0 + }, + click: { + trigger: function() { + return i.nodeName(this, "input") && "checkbox" === this.type && this.click ? (this.click(), !1) : t + } + }, + focus: { + trigger: function() { + if (this !== r.activeElement && this.focus) try { + return this.focus(), !1 + } catch (n) {} + }, + delegateType: "focusin" + }, + blur: { + trigger: function() { + return this === r.activeElement && this.blur ? (this.blur(), !1) : t + }, + delegateType: "focusout" + }, + beforeunload: { + postDispatch: function(n) { + n.result !== t && (n.originalEvent.returnValue = n.result) + } + } + }, + simulate: function(n, t, r, u) { + var f = i.extend(new i.Event, r, { + type: n, + isSimulated: !0, + originalEvent: {} + }); + u ? i.event.trigger(f, null, t) : i.event.dispatch.call(t, f); + f.isDefaultPrevented() && r.preventDefault() + } + }; + i.removeEvent = r.removeEventListener ? function(n, t, i) { + n.removeEventListener && n.removeEventListener(t, i, !1) + } : function(n, t, i) { + var r = "on" + t; + n.detachEvent && (typeof n[r] === o && (n[r] = null), n.detachEvent(r, i)) + }; + i.Event = function(n, r) { + return this instanceof i.Event ? (n && n.type ? (this.originalEvent = n, this.type = n.type, this.isDefaultPrevented = n.defaultPrevented || n.returnValue === !1 || n.getPreventDefault && n.getPreventDefault() ? ht : d) : this.type = n, r && i.extend(this, r), this.timeStamp = n && n.timeStamp || i.now(), this[i.expando] = !0, t) : new i.Event(n, r) + }; + i.Event.prototype = { + isDefaultPrevented: d, + isPropagationStopped: d, + isImmediatePropagationStopped: d, + preventDefault: function() { + var n = this.originalEvent; + this.isDefaultPrevented = ht; + n && (n.preventDefault ? n.preventDefault() : n.returnValue = !1) + }, + stopPropagation: function() { + var n = this.originalEvent; + this.isPropagationStopped = ht; + n && (n.stopPropagation && n.stopPropagation(), n.cancelBubble = !0) + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = ht; + this.stopPropagation() + } + }; + i.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" + }, function(n, t) { + i.event.special[n] = { + delegateType: t, + bindType: t, + handle: function(n) { + var u, f = this, + r = n.relatedTarget, + e = n.handleObj; + return (!r || r !== f && !i.contains(f, r)) && (n.type = e.origType, u = e.handler.apply(this, arguments), n.type = t), u + } + } + }); + i.support.submitBubbles || (i.event.special.submit = { + setup: function() { + return i.nodeName(this, "form") ? !1 : (i.event.add(this, "click._submit keypress._submit", function(n) { + var u = n.target, + r = i.nodeName(u, "input") || i.nodeName(u, "button") ? u.form : t; + r && !i._data(r, "submitBubbles") && (i.event.add(r, "submit._submit", function(n) { + n._submit_bubble = !0 + }), i._data(r, "submitBubbles", !0)) + }), t) + }, + postDispatch: function(n) { + n._submit_bubble && (delete n._submit_bubble, this.parentNode && !n.isTrigger && i.event.simulate("submit", this.parentNode, n, !0)) + }, + teardown: function() { + return i.nodeName(this, "form") ? !1 : (i.event.remove(this, "._submit"), t) + } + }); + i.support.changeBubbles || (i.event.special.change = { + setup: function() { + return ui.test(this.nodeName) ? (("checkbox" === this.type || "radio" === this.type) && (i.event.add(this, "propertychange._change", function(n) { + "checked" === n.originalEvent.propertyName && (this._just_changed = !0) + }), i.event.add(this, "click._change", function(n) { + this._just_changed && !n.isTrigger && (this._just_changed = !1); + i.event.simulate("change", this, n, !0) + })), !1) : (i.event.add(this, "beforeactivate._change", function(n) { + var t = n.target; + ui.test(t.nodeName) && !i._data(t, "changeBubbles") && (i.event.add(t, "change._change", function(n) { + !this.parentNode || n.isSimulated || n.isTrigger || i.event.simulate("change", this.parentNode, n, !0) + }), i._data(t, "changeBubbles", !0)) + }), t) + }, + handle: function(n) { + var i = n.target; + return this !== i || n.isSimulated || n.isTrigger || "radio" !== i.type && "checkbox" !== i.type ? n.handleObj.handler.apply(this, arguments) : t + }, + teardown: function() { + return i.event.remove(this, "._change"), !ui.test(this.nodeName) + } + }); + i.support.focusinBubbles || i.each({ + focus: "focusin", + blur: "focusout" + }, function(n, t) { + var u = 0, + f = function(n) { + i.event.simulate(t, n.target, i.event.fix(n), !0) + }; + i.event.special[t] = { + setup: function() { + 0 == u++ && r.addEventListener(n, f, !0) + }, + teardown: function() { + 0 == --u && r.removeEventListener(n, f, !0) + } + } + }); + i.fn.extend({ + on: function(n, r, u, f, e) { + var s, o; + if ("object" == typeof n) { + "string" != typeof r && (u = u || r, r = t); + for (s in n) this.on(s, r, u, n[s], e); + return this + } + if (null == u && null == f ? (f = r, u = r = t) : null == f && ("string" == typeof r ? (f = u, u = t) : (f = u, u = r, r = t)), f === !1) f = d; + else if (!f) return this; + return 1 === e && (o = f, f = function(n) { + return i().off(n), o.apply(this, arguments) + }, f.guid = o.guid || (o.guid = i.guid++)), this.each(function() { + i.event.add(this, n, f, u, r) + }) + }, + one: function(n, t, i, r) { + return this.on(n, t, i, r, 1) + }, + off: function(n, r, u) { + var f, e; + if (n && n.preventDefault && n.handleObj) return f = n.handleObj, i(n.delegateTarget).off(f.namespace ? f.origType + "." + f.namespace : f.origType, f.selector, f.handler), this; + if ("object" == typeof n) { + for (e in n) this.off(e, r, n[e]); + return this + } + return (r === !1 || "function" == typeof r) && (u = r, r = t), u === !1 && (u = d), this.each(function() { + i.event.remove(this, n, u, r) + }) + }, + bind: function(n, t, i) { + return this.on(n, null, t, i) + }, + unbind: function(n, t) { + return this.off(n, null, t) + }, + delegate: function(n, t, i, r) { + return this.on(t, n, i, r) + }, + undelegate: function(n, t, i) { + return 1 === arguments.length ? this.off(n, "**") : this.off(t, n || "**", i) + }, + trigger: function(n, t) { + return this.each(function() { + i.event.trigger(n, t, this) + }) + }, + triggerHandler: function(n, r) { + var u = this[0]; + return u ? i.event.trigger(n, r, u, !0) : t + } + }), + function(n, t) { + function ti(n) { + return tr.test(n + "") + } + + function ii() { + var n, t = []; + return n = function(i, u) { + return t.push(i += " ") > r.cacheLength && delete n[t.shift()], n[i] = u + } + } + + function l(n) { + return n[f] = !0, n + } + + function b(n) { + var t = s.createElement("div"); + try { + return n(t) + } catch (i) { + return !1 + } finally { + t = null + } + } + + function u(n, t, i, r) { + var y, u, e, l, p, v, w, h, d, b; + if ((t ? t.ownerDocument || t : k) !== s && it(t), t = t || s, i = i || [], !n || "string" != typeof n) return i; + if (1 !== (l = t.nodeType) && 9 !== l) return []; + if (!c && !r) { + if (y = ir.exec(n)) + if (e = y[1]) { + if (9 === l) { + if (u = t.getElementById(e), !u || !u.parentNode) return i; + if (u.id === e) return i.push(u), i + } else if (t.ownerDocument && (u = t.ownerDocument.getElementById(e)) && et(t, u) && u.id === e) return i.push(u), i + } else { + if (y[2]) return ut.apply(i, ft.call(t.getElementsByTagName(n), 0)), i; + if ((e = y[3]) && o.getByClassName && t.getElementsByClassName) return ut.apply(i, ft.call(t.getElementsByClassName(e), 0)), i + } + if (o.qsa && !a.test(n)) { + if (w = !0, h = f, d = t, b = 9 === l && n, 1 === l && "object" !== t.nodeName.toLowerCase()) { + for (v = yt(n), (w = t.getAttribute("id")) ? h = w.replace(fr, "\\$&") : t.setAttribute("id", h), h = "[id='" + h + "'] ", p = v.length; p--;) v[p] = h + pt(v[p]); + d = ni.test(n) && t.parentNode || t; + b = v.join(",") + } + if (b) try { + return ut.apply(i, ft.call(d.querySelectorAll(b), 0)), i + } catch (g) {} finally { + w || t.removeAttribute("id") + } + } + } + return lr(n.replace(at, "$1"), t, i, r) + } + + function yi(n, t) { + var i = t && n, + r = i && (~t.sourceIndex || li) - (~n.sourceIndex || li); + if (r) return r; + if (i) + while (i = i.nextSibling) + if (i === t) return -1; + return n ? 1 : -1 + } + + function or(n) { + return function(t) { + var i = t.nodeName.toLowerCase(); + return "input" === i && t.type === n + } + } + + function sr(n) { + return function(t) { + var i = t.nodeName.toLowerCase(); + return ("input" === i || "button" === i) && t.type === n + } + } + + function g(n) { + return l(function(t) { + return t = +t, l(function(i, r) { + for (var u, f = n([], i.length, t), e = f.length; e--;) i[u = f[e]] && (i[u] = !(r[u] = i[u])) + }) + }) + } + + function yt(n, t) { + var e, f, s, o, i, h, c, l = hi[n + " "]; + if (l) return t ? 0 : l.slice(0); + for (i = n, h = [], c = r.preFilter; i;) { + (!e || (f = ki.exec(i))) && (f && (i = i.slice(f[0].length) || i), h.push(s = [])); + e = !1; + (f = di.exec(i)) && (e = f.shift(), s.push({ + value: e, + type: f[0].replace(at, " ") + }), i = i.slice(e.length)); + for (o in r.filter)(f = vt[o].exec(i)) && (!c[o] || (f = c[o](f))) && (e = f.shift(), s.push({ + value: e, + type: o, + matches: f + }), i = i.slice(e.length)); + if (!e) break + } + return t ? i.length : i ? u.error(n) : hi(n, h).slice(0) + } + + function pt(n) { + for (var t = 0, r = n.length, i = ""; r > t; t++) i += n[t].value; + return i + } + + function ri(n, t, i) { + var r = t.dir, + u = i && "parentNode" === r, + e = wi++; + return t.first ? function(t, i, f) { + while (t = t[r]) + if (1 === t.nodeType || u) return n(t, i, f) + } : function(t, i, o) { + var h, s, c, l = v + " " + e; + if (o) { + while (t = t[r]) + if ((1 === t.nodeType || u) && n(t, i, o)) return !0 + } else + while (t = t[r]) + if (1 === t.nodeType || u) + if (c = t[f] || (t[f] = {}), (s = c[r]) && s[0] === l) { + if ((h = s[1]) === !0 || h === ot) return h === !0 + } else if (s = c[r] = [l], s[1] = n(t, i, o) || ot, s[1] === !0) return !0 + } + } + + function ui(n) { + return n.length > 1 ? function(t, i, r) { + for (var u = n.length; u--;) + if (!n[u](t, i, r)) return !1; + return !0 + } : n[0] + } + + function wt(n, t, i, r, u) { + for (var e, o = [], f = 0, s = n.length, h = null != t; s > f; f++)(e = n[f]) && (!i || i(e, r, u)) && (o.push(e), h && t.push(f)); + return o + } + + function fi(n, t, i, r, u, e) { + return r && !r[f] && (r = fi(r)), u && !u[f] && (u = fi(u, e)), l(function(f, e, o, s) { + var l, c, a, p = [], + y = [], + w = e.length, + b = f || cr(t || "*", o.nodeType ? [o] : o, []), + v = !n || !f && t ? b : wt(b, p, n, o, s), + h = i ? u || (f ? n : w || r) ? [] : e : v; + if (i && i(v, h, o, s), r) + for (l = wt(h, y), r(l, [], o, s), c = l.length; c--;)(a = l[c]) && (h[y[c]] = !(v[y[c]] = a)); + if (f) { + if (u || n) { + if (u) { + for (l = [], c = h.length; c--;)(a = h[c]) && l.push(v[c] = a); + u(null, h = [], l, s) + } + for (c = h.length; c--;)(a = h[c]) && (l = u ? dt.call(f, a) : p[c]) > -1 && (f[l] = !(e[l] = a)) + } + } else h = wt(h === e ? h.splice(w, h.length) : h), u ? u(null, e, h, s) : ut.apply(e, h) + }) + } + + function ei(n) { + for (var s, u, i, o = n.length, h = r.relative[n[0].type], c = h || r.relative[" "], t = h ? 1 : 0, l = ri(function(n) { + return n === s + }, c, !0), a = ri(function(n) { + return dt.call(s, n) > -1 + }, c, !0), e = [function(n, t, i) { + return !h && (i || t !== ht) || ((s = t).nodeType ? l(n, t, i) : a(n, t, i)) + }]; o > t; t++) + if (u = r.relative[n[t].type]) e = [ri(ui(e), u)]; + else { + if (u = r.filter[n[t].type].apply(null, n[t].matches), u[f]) { + for (i = ++t; o > i; i++) + if (r.relative[n[i].type]) break; + return fi(t > 1 && ui(e), t > 1 && pt(n.slice(0, t - 1)).replace(at, "$1"), u, i > t && ei(n.slice(t, i)), o > i && ei(n = n.slice(i)), o > i && pt(n)) + } + e.push(u) + } + return ui(e) + } + + function hr(n, t) { + var f = 0, + i = t.length > 0, + e = n.length > 0, + o = function(o, h, c, l, a) { + var p, d, b, w = [], + k = 0, + y = "0", + g = o && [], + nt = null != a, + tt = ht, + rt = o || e && r.find.TAG("*", a && h.parentNode || h), + it = v += null == tt ? 1 : Math.random() || .1; + for (nt && (ht = h !== s && h, ot = f); null != (p = rt[y]); y++) { + if (e && p) { + for (d = 0; b = n[d++];) + if (b(p, h, c)) { + l.push(p); + break + } + nt && (v = it, ot = ++f) + } + i && ((p = !b && p) && k--, o && g.push(p)) + } + if (k += y, i && y !== k) { + for (d = 0; b = t[d++];) b(g, w, h, c); + if (o) { + if (k > 0) + while (y--) g[y] || w[y] || (w[y] = bi.call(l)); + w = wt(w) + } + ut.apply(l, w); + nt && !o && w.length > 0 && k + t.length > 1 && u.uniqueSort(l) + } + return nt && (v = it, ht = tt), g + }; + return i ? l(o) : o + } + + function cr(n, t, i) { + for (var r = 0, f = t.length; f > r; r++) u(n, t[r], i); + return i + } + + function lr(n, t, i, u) { + var o, f, e, h, l, s = yt(n); + if (!u && 1 === s.length) { + if (f = s[0] = s[0].slice(0), f.length > 2 && "ID" === (e = f[0]).type && 9 === t.nodeType && !c && r.relative[f[1].type]) { + if (t = r.find.ID(e.matches[0].replace(p, w), t)[0], !t) return i; + n = n.slice(f.shift().value.length) + } + for (o = vt.needsContext.test(n) ? 0 : f.length; o--;) { + if (e = f[o], r.relative[h = e.type]) break; + if ((l = r.find[h]) && (u = l(e.matches[0].replace(p, w), ni.test(f[0].type) && t.parentNode || t))) { + if (f.splice(o, 1), n = u.length && pt(f), !n) return ut.apply(i, ft.call(u, 0)), i; + break + } + } + } + return bt(n, s)(u, t, c, i, ni.test(n)), i + } + + function pi() {} + var nt, ot, r, st, oi, bt, tt, ht, it, s, h, c, a, rt, ct, et, kt, f = "sizzle" + -new Date, + k = n.document, + o = {}, + v = 0, + wi = 0, + si = ii(), + hi = ii(), + ci = ii(), + y = typeof t, + li = -2147483648, + lt = [], + bi = lt.pop, + ut = lt.push, + ft = lt.slice, + dt = lt.indexOf || function(n) { + for (var t = 0, i = this.length; i > t; t++) + if (this[t] === n) return t; + return -1 + }, + e = "[\\x20\\t\\r\\n\\f]", + d = "(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+", + ai = d.replace("w", "w#"), + vi = "\\[" + e + "*(" + d + ")" + e + "*(?:([*^$|!~]?=)" + e + "*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|(" + ai + ")|)|)" + e + "*\\]", + gt = ":(" + d + ")(?:\\(((['\"])((?:\\\\.|[^\\\\])*?)\\3|((?:\\\\.|[^\\\\()[\\]]|" + vi.replace(3, 8) + ")*)|.*)\\)|)", + at = RegExp("^" + e + "+|((?:^|[^\\\\])(?:\\\\.)*)" + e + "+$", "g"), + ki = RegExp("^" + e + "*," + e + "*"), + di = RegExp("^" + e + "*([\\x20\\t\\r\\n\\f>+~])" + e + "*"), + gi = RegExp(gt), + nr = RegExp("^" + ai + "$"), + vt = { + ID: RegExp("^#(" + d + ")"), + CLASS: RegExp("^\\.(" + d + ")"), + NAME: RegExp("^\\[name=['\"]?(" + d + ")['\"]?\\]"), + TAG: RegExp("^(" + d.replace("w", "w*") + ")"), + ATTR: RegExp("^" + vi), + PSEUDO: RegExp("^" + gt), + CHILD: RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + e + "*(even|odd|(([+-]|)(\\d*)n|)" + e + "*(?:([+-]|)" + e + "*(\\d+)|))" + e + "*\\)|)", "i"), + needsContext: RegExp("^" + e + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + e + "*((?:-\\d)?\\d*)" + e + "*\\)|)(?=[^-]|$)", "i") + }, + ni = /[\x20\t\r\n\f]*[+~]/, + tr = /^[^{]+\{\s*\[native code/, + ir = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/, + rr = /^(?:input|select|textarea|button)$/i, + ur = /^h\d$/i, + fr = /'|\\/g, + er = /\=[\x20\t\r\n\f]*([^'"\]]*)[\x20\t\r\n\f]*\]/g, + p = /\\([\da-fA-F]{1,6}[\x20\t\r\n\f]?|.)/g, + w = function(n, t) { + var i = "0x" + t - 65536; + return i !== i ? t : 0 > i ? String.fromCharCode(i + 65536) : String.fromCharCode(55296 | i >> 10, 56320 | 1023 & i) + }; + try { + ft.call(k.documentElement.childNodes, 0)[0].nodeType + } catch (ar) { + ft = function(n) { + for (var t, i = []; t = this[n++];) i.push(t); + return i + } + } + oi = u.isXML = function(n) { + var t = n && (n.ownerDocument || n).documentElement; + return t ? "HTML" !== t.nodeName : !1 + }; + it = u.setDocument = function(n) { + var i = n ? n.ownerDocument || n : k; + return i !== s && 9 === i.nodeType && i.documentElement ? (s = i, h = i.documentElement, c = oi(i), o.tagNameNoComments = b(function(n) { + return n.appendChild(i.createComment("")), !n.getElementsByTagName("*").length + }), o.attributes = b(function(n) { + n.innerHTML = "<select><\/select>"; + var t = typeof n.lastChild.getAttribute("multiple"); + return "boolean" !== t && "string" !== t + }), o.getByClassName = b(function(n) { + return n.innerHTML = "<div class='hidden e'><\/div><div class='hidden'><\/div>", n.getElementsByClassName && n.getElementsByClassName("e").length ? (n.lastChild.className = "e", 2 === n.getElementsByClassName("e").length) : !1 + }), o.getByName = b(function(n) { + n.id = f + 0; + n.innerHTML = "<a name='" + f + "'><\/a><div name='" + f + "'><\/div>"; + h.insertBefore(n, h.firstChild); + var t = i.getElementsByName && i.getElementsByName(f).length === 2 + i.getElementsByName(f + 0).length; + return o.getIdNotName = !i.getElementById(f), h.removeChild(n), t + }), r.attrHandle = b(function(n) { + return n.innerHTML = "<a href='#'><\/a>", n.firstChild && typeof n.firstChild.getAttribute !== y && "#" === n.firstChild.getAttribute("href") + }) ? {} : { + href: function(n) { + return n.getAttribute("href", 2) + }, + type: function(n) { + return n.getAttribute("type") + } + }, o.getIdNotName ? (r.find.ID = function(n, t) { + if (typeof t.getElementById !== y && !c) { + var i = t.getElementById(n); + return i && i.parentNode ? [i] : [] + } + }, r.filter.ID = function(n) { + var t = n.replace(p, w); + return function(n) { + return n.getAttribute("id") === t + } + }) : (r.find.ID = function(n, i) { + if (typeof i.getElementById !== y && !c) { + var r = i.getElementById(n); + return r ? r.id === n || typeof r.getAttributeNode !== y && r.getAttributeNode("id").value === n ? [r] : t : [] + } + }, r.filter.ID = function(n) { + var t = n.replace(p, w); + return function(n) { + var i = typeof n.getAttributeNode !== y && n.getAttributeNode("id"); + return i && i.value === t + } + }), r.find.TAG = o.tagNameNoComments ? function(n, i) { + return typeof i.getElementsByTagName !== y ? i.getElementsByTagName(n) : t + } : function(n, t) { + var i, r = [], + f = 0, + u = t.getElementsByTagName(n); + if ("*" === n) { + while (i = u[f++]) 1 === i.nodeType && r.push(i); + return r + } + return u + }, r.find.NAME = o.getByName && function(n, i) { + return typeof i.getElementsByName !== y ? i.getElementsByName(name) : t + }, r.find.CLASS = o.getByClassName && function(n, i) { + return typeof i.getElementsByClassName === y || c ? t : i.getElementsByClassName(n) + }, rt = [], a = [":focus"], (o.qsa = ti(i.querySelectorAll)) && (b(function(n) { + n.innerHTML = "<select><option selected=''><\/option><\/select>"; + n.querySelectorAll("[selected]").length || a.push("\\[" + e + "*(?:checked|disabled|ismap|multiple|readonly|selected|value)"); + n.querySelectorAll(":checked").length || a.push(":checked") + }), b(function(n) { + n.innerHTML = "<input type='hidden' i=''/>"; + n.querySelectorAll("[i^='']").length && a.push("[*^$]=" + e + "*(?:\"\"|'')"); + n.querySelectorAll(":enabled").length || a.push(":enabled", ":disabled"); + n.querySelectorAll("*,:x"); + a.push(",.*:") + })), (o.matchesSelector = ti(ct = h.matchesSelector || h.mozMatchesSelector || h.webkitMatchesSelector || h.oMatchesSelector || h.msMatchesSelector)) && b(function(n) { + o.disconnectedMatch = ct.call(n, "div"); + ct.call(n, "[s!='']:x"); + rt.push("!=", gt) + }), a = RegExp(a.join("|")), rt = RegExp(rt.join("|")), et = ti(h.contains) || h.compareDocumentPosition ? function(n, t) { + var r = 9 === n.nodeType ? n.documentElement : n, + i = t && t.parentNode; + return n === i || !(!i || 1 !== i.nodeType || !(r.contains ? r.contains(i) : n.compareDocumentPosition && 16 & n.compareDocumentPosition(i))) + } : function(n, t) { + if (t) + while (t = t.parentNode) + if (t === n) return !0; + return !1 + }, kt = h.compareDocumentPosition ? function(n, t) { + var r; + return n === t ? (tt = !0, 0) : (r = t.compareDocumentPosition && n.compareDocumentPosition && n.compareDocumentPosition(t)) ? 1 & r || n.parentNode && 11 === n.parentNode.nodeType ? n === i || et(k, n) ? -1 : t === i || et(k, t) ? 1 : 0 : 4 & r ? -1 : 1 : n.compareDocumentPosition ? -1 : 1 + } : function(n, t) { + var r, u = 0, + o = n.parentNode, + s = t.parentNode, + f = [n], + e = [t]; + if (n === t) return tt = !0, 0; + if (!o || !s) return n === i ? -1 : t === i ? 1 : o ? -1 : s ? 1 : 0; + if (o === s) return yi(n, t); + for (r = n; r = r.parentNode;) f.unshift(r); + for (r = t; r = r.parentNode;) e.unshift(r); + while (f[u] === e[u]) u++; + return u ? yi(f[u], e[u]) : f[u] === k ? -1 : e[u] === k ? 1 : 0 + }, tt = !1, [0, 0].sort(kt), o.detectDuplicates = tt, s) : s + }; + u.matches = function(n, t) { + return u(n, null, null, t) + }; + u.matchesSelector = function(n, t) { + if ((n.ownerDocument || n) !== s && it(n), t = t.replace(er, "='$1']"), !(!o.matchesSelector || c || rt && rt.test(t) || a.test(t))) try { + var i = ct.call(n, t); + if (i || o.disconnectedMatch || n.document && 11 !== n.document.nodeType) return i + } catch (r) {} + return u(t, s, null, [n]).length > 0 + }; + u.contains = function(n, t) { + return (n.ownerDocument || n) !== s && it(n), et(n, t) + }; + u.attr = function(n, t) { + var i; + return (n.ownerDocument || n) !== s && it(n), c || (t = t.toLowerCase()), (i = r.attrHandle[t]) ? i(n) : c || o.attributes ? n.getAttribute(t) : ((i = n.getAttributeNode(t)) || n.getAttribute(t)) && n[t] === !0 ? t : i && i.specified ? i.value : null + }; + u.error = function(n) { + throw Error("Syntax error, unrecognized expression: " + n); + }; + u.uniqueSort = function(n) { + var r, u = [], + t = 1, + i = 0; + if (tt = !o.detectDuplicates, n.sort(kt), tt) { + for (; r = n[t]; t++) r === n[t - 1] && (i = u.push(t)); + while (i--) n.splice(u[i], 1) + } + return n + }; + st = u.getText = function(n) { + var r, i = "", + u = 0, + t = n.nodeType; + if (t) { + if (1 === t || 9 === t || 11 === t) { + if ("string" == typeof n.textContent) return n.textContent; + for (n = n.firstChild; n; n = n.nextSibling) i += st(n) + } else if (3 === t || 4 === t) return n.nodeValue + } else + for (; r = n[u]; u++) i += st(r); + return i + }; + r = u.selectors = { + cacheLength: 50, + createPseudo: l, + match: vt, + find: {}, + relative: { + ">": { + dir: "parentNode", + first: !0 + }, + " ": { + dir: "parentNode" + }, + "+": { + dir: "previousSibling", + first: !0 + }, + "~": { + dir: "previousSibling" + } + }, + preFilter: { + ATTR: function(n) { + return n[1] = n[1].replace(p, w), n[3] = (n[4] || n[5] || "").replace(p, w), "~=" === n[2] && (n[3] = " " + n[3] + " "), n.slice(0, 4) + }, + CHILD: function(n) { + return n[1] = n[1].toLowerCase(), "nth" === n[1].slice(0, 3) ? (n[3] || u.error(n[0]), n[4] = +(n[4] ? n[5] + (n[6] || 1) : 2 * ("even" === n[3] || "odd" === n[3])), n[5] = +(n[7] + n[8] || "odd" === n[3])) : n[3] && u.error(n[0]), n + }, + PSEUDO: function(n) { + var i, t = !n[5] && n[2]; + return vt.CHILD.test(n[0]) ? null : (n[4] ? n[2] = n[4] : t && gi.test(t) && (i = yt(t, !0)) && (i = t.indexOf(")", t.length - i) - t.length) && (n[0] = n[0].slice(0, i), n[2] = t.slice(0, i)), n.slice(0, 3)) + } + }, + filter: { + TAG: function(n) { + return "*" === n ? function() { + return !0 + } : (n = n.replace(p, w).toLowerCase(), function(t) { + return t.nodeName && t.nodeName.toLowerCase() === n + }) + }, + CLASS: function(n) { + var t = si[n + " "]; + return t || (t = RegExp("(^|" + e + ")" + n + "(" + e + "|$)")) && si(n, function(n) { + return t.test(n.className || typeof n.getAttribute !== y && n.getAttribute("class") || "") + }) + }, + ATTR: function(n, t, i) { + return function(r) { + var f = u.attr(r, n); + return null == f ? "!=" === t : t ? (f += "", "=" === t ? f === i : "!=" === t ? f !== i : "^=" === t ? i && 0 === f.indexOf(i) : "*=" === t ? i && f.indexOf(i) > -1 : "$=" === t ? i && f.slice(-i.length) === i : "~=" === t ? (" " + f + " ").indexOf(i) > -1 : "|=" === t ? f === i || f.slice(0, i.length + 1) === i + "-" : !1) : !0 + } + }, + CHILD: function(n, t, i, r, u) { + var s = "nth" !== n.slice(0, 3), + o = "last" !== n.slice(-4), + e = "of-type" === t; + return 1 === r && 0 === u ? function(n) { + return !!n.parentNode + } : function(t, i, h) { + var a, k, c, l, y, w, b = s !== o ? "nextSibling" : "previousSibling", + p = t.parentNode, + g = e && t.nodeName.toLowerCase(), + d = !h && !e; + if (p) { + if (s) { + while (b) { + for (c = t; c = c[b];) + if (e ? c.nodeName.toLowerCase() === g : 1 === c.nodeType) return !1; + w = b = "only" === n && !w && "nextSibling" + } + return !0 + } + if (w = [o ? p.firstChild : p.lastChild], o && d) { + for (k = p[f] || (p[f] = {}), a = k[n] || [], y = a[0] === v && a[1], l = a[0] === v && a[2], c = y && p.childNodes[y]; c = ++y && c && c[b] || (l = y = 0) || w.pop();) + if (1 === c.nodeType && ++l && c === t) { + k[n] = [v, y, l]; + break + } + } else if (d && (a = (t[f] || (t[f] = {}))[n]) && a[0] === v) l = a[1]; + else + while (c = ++y && c && c[b] || (l = y = 0) || w.pop()) + if ((e ? c.nodeName.toLowerCase() === g : 1 === c.nodeType) && ++l && (d && ((c[f] || (c[f] = {}))[n] = [v, l]), c === t)) break; + return l -= u, l === r || 0 == l % r && l / r >= 0 + } + } + }, + PSEUDO: function(n, t) { + var e, i = r.pseudos[n] || r.setFilters[n.toLowerCase()] || u.error("unsupported pseudo: " + n); + return i[f] ? i(t) : i.length > 1 ? (e = [n, n, "", t], r.setFilters.hasOwnProperty(n.toLowerCase()) ? l(function(n, r) { + for (var u, f = i(n, t), e = f.length; e--;) u = dt.call(n, f[e]), n[u] = !(r[u] = f[e]) + }) : function(n) { + return i(n, 0, e) + }) : i + } + }, + pseudos: { + not: l(function(n) { + var i = [], + r = [], + t = bt(n.replace(at, "$1")); + return t[f] ? l(function(n, i, r, u) { + for (var e, o = t(n, null, u, []), f = n.length; f--;)(e = o[f]) && (n[f] = !(i[f] = e)) + }) : function(n, u, f) { + return i[0] = n, t(i, null, f, r), !r.pop() + } + }), + has: l(function(n) { + return function(t) { + return u(n, t).length > 0 + } + }), + contains: l(function(n) { + return function(t) { + return (t.textContent || t.innerText || st(t)).indexOf(n) > -1 + } + }), + lang: l(function(n) { + return nr.test(n || "") || u.error("unsupported lang: " + n), n = n.replace(p, w).toLowerCase(), + function(t) { + var i; + do + if (i = c ? t.getAttribute("xml:lang") || t.getAttribute("lang") : t.lang) return i = i.toLowerCase(), i === n || 0 === i.indexOf(n + "-"); while ((t = t.parentNode) && 1 === t.nodeType); + return !1 + } + }), + target: function(t) { + var i = n.location && n.location.hash; + return i && i.slice(1) === t.id + }, + root: function(n) { + return n === h + }, + focus: function(n) { + return n === s.activeElement && (!s.hasFocus || s.hasFocus()) && !!(n.type || n.href || ~n.tabIndex) + }, + enabled: function(n) { + return n.disabled === !1 + }, + disabled: function(n) { + return n.disabled === !0 + }, + checked: function(n) { + var t = n.nodeName.toLowerCase(); + return "input" === t && !!n.checked || "option" === t && !!n.selected + }, + selected: function(n) { + return n.parentNode && n.parentNode.selectedIndex, n.selected === !0 + }, + empty: function(n) { + for (n = n.firstChild; n; n = n.nextSibling) + if (n.nodeName > "@" || 3 === n.nodeType || 4 === n.nodeType) return !1; + return !0 + }, + parent: function(n) { + return !r.pseudos.empty(n) + }, + header: function(n) { + return ur.test(n.nodeName) + }, + input: function(n) { + return rr.test(n.nodeName) + }, + button: function(n) { + var t = n.nodeName.toLowerCase(); + return "input" === t && "button" === n.type || "button" === t + }, + text: function(n) { + var t; + return "input" === n.nodeName.toLowerCase() && "text" === n.type && (null == (t = n.getAttribute("type")) || t.toLowerCase() === n.type) + }, + first: g(function() { + return [0] + }), + last: g(function(n, t) { + return [t - 1] + }), + eq: g(function(n, t, i) { + return [0 > i ? i + t : i] + }), + even: g(function(n, t) { + for (var i = 0; t > i; i += 2) n.push(i); + return n + }), + odd: g(function(n, t) { + for (var i = 1; t > i; i += 2) n.push(i); + return n + }), + lt: g(function(n, t, i) { + for (var r = 0 > i ? i + t : i; --r >= 0;) n.push(r); + return n + }), + gt: g(function(n, t, i) { + for (var r = 0 > i ? i + t : i; t > ++r;) n.push(r); + return n + }) + } + }; + for (nt in { + radio: !0, + checkbox: !0, + file: !0, + password: !0, + image: !0 + }) r.pseudos[nt] = or(nt); + for (nt in { + submit: !0, + reset: !0 + }) r.pseudos[nt] = sr(nt); + bt = u.compile = function(n, t) { + var r, u = [], + e = [], + i = ci[n + " "]; + if (!i) { + for (t || (t = yt(n)), r = t.length; r--;) i = ei(t[r]), i[f] ? u.push(i) : e.push(i); + i = ci(n, hr(e, u)) + } + return i + }; + r.pseudos.nth = r.pseudos.eq; + r.filters = pi.prototype = r.pseudos; + r.setFilters = new pi; + it(); + u.attr = i.attr; + i.find = u; + i.expr = u.selectors; + i.expr[":"] = i.expr.pseudos; + i.unique = u.uniqueSort; + i.text = u.getText; + i.isXMLDoc = u.isXML; + i.contains = u.contains + }(n); + var re = /Until$/, + ue = /^(?:parents|prev(?:Until|All))/, + fe = /^.[^:#\[\.,]*$/, + hr = i.expr.match.needsContext, + ee = { + children: !0, + contents: !0, + next: !0, + prev: !0 + }; + i.fn.extend({ + find: function(n) { + var t, r, f, u = this.length; + if ("string" != typeof n) return f = this, this.pushStack(i(n).filter(function() { + for (t = 0; u > t; t++) + if (i.contains(f[t], this)) return !0 + })); + for (r = [], t = 0; u > t; t++) i.find(n, this[t], r); + return r = this.pushStack(u > 1 ? i.unique(r) : r), r.selector = (this.selector ? this.selector + " " : "") + n, r + }, + has: function(n) { + var t, r = i(n, this), + u = r.length; + return this.filter(function() { + for (t = 0; u > t; t++) + if (i.contains(this, r[t])) return !0 + }) + }, + not: function(n) { + return this.pushStack(lr(this, n, !1)) + }, + filter: function(n) { + return this.pushStack(lr(this, n, !0)) + }, + is: function(n) { + return !!n && ("string" == typeof n ? hr.test(n) ? i(n, this.context).index(this[0]) >= 0 : i.filter(n, this).length > 0 : this.filter(n).length > 0) + }, + closest: function(n, t) { + for (var r, f = 0, o = this.length, u = [], e = hr.test(n) || "string" != typeof n ? i(n, t || this.context) : 0; o > f; f++) + for (r = this[f]; r && r.ownerDocument && r !== t && 11 !== r.nodeType;) { + if (e ? e.index(r) > -1 : i.find.matchesSelector(r, n)) { + u.push(r); + break + } + r = r.parentNode + } + return this.pushStack(u.length > 1 ? i.unique(u) : u) + }, + index: function(n) { + return n ? "string" == typeof n ? i.inArray(this[0], i(n)) : i.inArray(n.jquery ? n[0] : n, this) : this[0] && this[0].parentNode ? this.first().prevAll().length : -1 + }, + add: function(n, t) { + var r = "string" == typeof n ? i(n, t) : i.makeArray(n && n.nodeType ? [n] : n), + u = i.merge(this.get(), r); + return this.pushStack(i.unique(u)) + }, + addBack: function(n) { + return this.add(null == n ? this.prevObject : this.prevObject.filter(n)) + } + }); + i.fn.andSelf = i.fn.addBack; + i.each({ + parent: function(n) { + var t = n.parentNode; + return t && 11 !== t.nodeType ? t : null + }, + parents: function(n) { + return i.dir(n, "parentNode") + }, + parentsUntil: function(n, t, r) { + return i.dir(n, "parentNode", r) + }, + next: function(n) { + return cr(n, "nextSibling") + }, + prev: function(n) { + return cr(n, "previousSibling") + }, + nextAll: function(n) { + return i.dir(n, "nextSibling") + }, + prevAll: function(n) { + return i.dir(n, "previousSibling") + }, + nextUntil: function(n, t, r) { + return i.dir(n, "nextSibling", r) + }, + prevUntil: function(n, t, r) { + return i.dir(n, "previousSibling", r) + }, + siblings: function(n) { + return i.sibling((n.parentNode || {}).firstChild, n) + }, + children: function(n) { + return i.sibling(n.firstChild) + }, + contents: function(n) { + return i.nodeName(n, "iframe") ? n.contentDocument || n.contentWindow.document : i.merge([], n.childNodes) + } + }, function(n, t) { + i.fn[n] = function(r, u) { + var f = i.map(this, t, r); + return re.test(n) || (u = r), u && "string" == typeof u && (f = i.filter(u, f)), f = this.length > 1 && !ee[n] ? i.unique(f) : f, this.length > 1 && ue.test(n) && (f = f.reverse()), this.pushStack(f) + } + }); + i.extend({ + filter: function(n, t, r) { + return r && (n = ":not(" + n + ")"), 1 === t.length ? i.find.matchesSelector(t[0], n) ? [t[0]] : [] : i.find.matches(n, t) + }, + dir: function(n, r, u) { + for (var e = [], f = n[r]; f && 9 !== f.nodeType && (u === t || 1 !== f.nodeType || !i(f).is(u));) 1 === f.nodeType && e.push(f), f = f[r]; + return e + }, + sibling: function(n, t) { + for (var i = []; n; n = n.nextSibling) 1 === n.nodeType && n !== t && i.push(n); + return i + } + }); + var vr = "abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video", + oe = / jQuery\d+="(?:null|\d+)"/g, + yr = RegExp("<(?:" + vr + ")[\\s/>]", "i"), + fi = /^\s+/, + pr = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi, + wr = /<([\w:]+)/, + br = /<tbody/i, + se = /<|&#?\w+;/, + he = /<(?:script|style|link)/i, + ei = /^(?:checkbox|radio)$/i, + ce = /checked\s*(?:[^=]|=\s*.checked.)/i, + kr = /^$|\/(?:java|ecma)script/i, + le = /^true\/(.*)/, + ae = /^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g, + e = { + option: [1, "<select multiple='multiple'>", "<\/select>"], + legend: [1, "<fieldset>", "<\/fieldset>"], + area: [1, "<map>", "<\/map>"], + param: [1, "<object>", "<\/object>"], + thead: [1, "<table>", "<\/table>"], + tr: [2, "<table><tbody>", "<\/tbody><\/table>"], + col: [2, "<table><tbody><\/tbody><colgroup>", "<\/colgroup><\/table>"], + td: [3, "<table><tbody><tr>", "<\/tr><\/tbody><\/table>"], + _default: i.support.htmlSerialize ? [0, "", ""] : [1, "X<div>", "<\/div>"] + }, + ve = ar(r), + oi = ve.appendChild(r.createElement("div")); + e.optgroup = e.option; + e.tbody = e.tfoot = e.colgroup = e.caption = e.thead; + e.th = e.td; + i.fn.extend({ + text: function(n) { + return i.access(this, function(n) { + return n === t ? i.text(this) : this.empty().append((this[0] && this[0].ownerDocument || r).createTextNode(n)) + }, null, n, arguments.length) + }, + wrapAll: function(n) { + if (i.isFunction(n)) return this.each(function(t) { + i(this).wrapAll(n.call(this, t)) + }); + if (this[0]) { + var t = i(n, this[0].ownerDocument).eq(0).clone(!0); + this[0].parentNode && t.insertBefore(this[0]); + t.map(function() { + for (var n = this; n.firstChild && 1 === n.firstChild.nodeType;) n = n.firstChild; + return n + }).append(this) + } + return this + }, + wrapInner: function(n) { + return i.isFunction(n) ? this.each(function(t) { + i(this).wrapInner(n.call(this, t)) + }) : this.each(function() { + var t = i(this), + r = t.contents(); + r.length ? r.wrapAll(n) : t.append(n) + }) + }, + wrap: function(n) { + var t = i.isFunction(n); + return this.each(function(r) { + i(this).wrapAll(t ? n.call(this, r) : n) + }) + }, + unwrap: function() { + return this.parent().each(function() { + i.nodeName(this, "body") || i(this).replaceWith(this.childNodes) + }).end() + }, + append: function() { + return this.domManip(arguments, !0, function(n) { + (1 === this.nodeType || 11 === this.nodeType || 9 === this.nodeType) && this.appendChild(n) + }) + }, + prepend: function() { + return this.domManip(arguments, !0, function(n) { + (1 === this.nodeType || 11 === this.nodeType || 9 === this.nodeType) && this.insertBefore(n, this.firstChild) + }) + }, + before: function() { + return this.domManip(arguments, !1, function(n) { + this.parentNode && this.parentNode.insertBefore(n, this) + }) + }, + after: function() { + return this.domManip(arguments, !1, function(n) { + this.parentNode && this.parentNode.insertBefore(n, this.nextSibling) + }) + }, + remove: function(n, t) { + for (var r, f = 0; null != (r = this[f]); f++)(!n || i.filter(n, [r]).length > 0) && (t || 1 !== r.nodeType || i.cleanData(u(r)), r.parentNode && (t && i.contains(r.ownerDocument, r) && si(u(r, "script")), r.parentNode.removeChild(r))); + return this + }, + empty: function() { + for (var n, t = 0; null != (n = this[t]); t++) { + for (1 === n.nodeType && i.cleanData(u(n, !1)); n.firstChild;) n.removeChild(n.firstChild); + n.options && i.nodeName(n, "select") && (n.options.length = 0) + } + return this + }, + clone: function(n, t) { + return n = null == n ? !1 : n, t = null == t ? n : t, this.map(function() { + return i.clone(this, n, t) + }) + }, + html: function(n) { + return i.access(this, function(n) { + var r = this[0] || {}, + f = 0, + o = this.length; + if (n === t) return 1 === r.nodeType ? r.innerHTML.replace(oe, "") : t; + if (!("string" != typeof n || he.test(n) || !i.support.htmlSerialize && yr.test(n) || !i.support.leadingWhitespace && fi.test(n) || e[(wr.exec(n) || ["", ""])[1].toLowerCase()])) { + n = n.replace(pr, "<$1><\/$2>"); + try { + for (; o > f; f++) r = this[f] || {}, 1 === r.nodeType && (i.cleanData(u(r, !1)), r.innerHTML = n); + r = 0 + } catch (s) {} + } + r && this.empty().append(n) + }, null, n, arguments.length) + }, + replaceWith: function(n) { + var t = i.isFunction(n); + return t || "string" == typeof n || (n = i(n).not(this).detach()), this.domManip([n], !0, function(n) { + var r = this.nextSibling, + t = this.parentNode; + t && (i(this).remove(), t.insertBefore(n, r)) + }) + }, + detach: function(n) { + return this.remove(n, !0) + }, + domManip: function(n, r, f) { + n = bi.apply([], n); + var c, e, l, s, y, h, o = 0, + a = this.length, + w = this, + b = a - 1, + v = n[0], + p = i.isFunction(v); + if (p || !(1 >= a || "string" != typeof v || i.support.checkClone) && ce.test(v)) return this.each(function(i) { + var u = w.eq(i); + p && (n[0] = v.call(this, i, r ? u.html() : t)); + u.domManip(n, r, f) + }); + if (a && (h = i.buildFragment(n, this[0].ownerDocument, !1, this), c = h.firstChild, 1 === h.childNodes.length && (h = c), c)) { + for (r = r && i.nodeName(c, "tr"), s = i.map(u(h, "script"), dr), l = s.length; a > o; o++) e = h, o !== b && (e = i.clone(e, !0, !0), l && i.merge(s, u(e, "script"))), f.call(r && i.nodeName(this[o], "table") ? ye(this[o], "tbody") : this[o], e, o); + if (l) + for (y = s[s.length - 1].ownerDocument, i.map(s, gr), o = 0; l > o; o++) e = s[o], kr.test(e.type || "") && !i._data(e, "globalEval") && i.contains(y, e) && (e.src ? i.ajax({ + url: e.src, + type: "GET", + dataType: "script", + async: !1, + global: !1, + throws: !0 + }) : i.globalEval((e.text || e.textContent || e.innerHTML || "").replace(ae, ""))); + h = c = null + } + return this + } + }); + i.each({ + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" + }, function(n, t) { + i.fn[n] = function(n) { + for (var u, r = 0, f = [], e = i(n), o = e.length - 1; o >= r; r++) u = r === o ? this : this.clone(!0), i(e[r])[t](u), bt.apply(f, u.get()); + return this.pushStack(f) + } + }); + i.extend({ + clone: function(n, t, r) { + var f, h, o, e, s, c = i.contains(n.ownerDocument, n); + if (i.support.html5Clone || i.isXMLDoc(n) || !yr.test("<" + n.nodeName + ">") ? o = n.cloneNode(!0) : (oi.innerHTML = n.outerHTML, oi.removeChild(o = oi.firstChild)), !(i.support.noCloneEvent && i.support.noCloneChecked || 1 !== n.nodeType && 11 !== n.nodeType || i.isXMLDoc(n))) + for (f = u(o), s = u(n), e = 0; null != (h = s[e]); ++e) f[e] && pe(h, f[e]); + if (t) + if (r) + for (s = s || u(n), f = f || u(o), e = 0; null != (h = s[e]); e++) nu(h, f[e]); + else nu(n, o); + return f = u(o, "script"), f.length > 0 && si(f, !c && u(n, "script")), f = s = h = null, o + }, + buildFragment: function(n, t, r, f) { + for (var h, o, w, s, y, p, l, b = n.length, a = ar(t), c = [], v = 0; b > v; v++) + if (o = n[v], o || 0 === o) + if ("object" === i.type(o)) i.merge(c, o.nodeType ? [o] : o); + else if (se.test(o)) { + for (s = s || a.appendChild(t.createElement("div")), y = (wr.exec(o) || ["", ""])[1].toLowerCase(), l = e[y] || e._default, s.innerHTML = l[1] + o.replace(pr, "<$1><\/$2>") + l[2], h = l[0]; h--;) s = s.lastChild; + if (!i.support.leadingWhitespace && fi.test(o) && c.push(t.createTextNode(fi.exec(o)[0])), !i.support.tbody) + for (o = "table" !== y || br.test(o) ? "<table>" !== l[1] || br.test(o) ? 0 : s : s.firstChild, h = o && o.childNodes.length; h--;) i.nodeName(p = o.childNodes[h], "tbody") && !p.childNodes.length && o.removeChild(p); + for (i.merge(c, s.childNodes), s.textContent = ""; s.firstChild;) s.removeChild(s.firstChild); + s = a.lastChild + } else c.push(t.createTextNode(o)); + for (s && a.removeChild(s), i.support.appendChecked || i.grep(u(c, "input"), we), v = 0; o = c[v++];) + if ((!f || -1 === i.inArray(o, f)) && (w = i.contains(o.ownerDocument, o), s = u(a.appendChild(o), "script"), w && si(s), r)) + for (h = 0; o = s[h++];) kr.test(o.type || "") && r.push(o); + return s = null, a + }, + cleanData: function(n, t) { + for (var r, f, u, e, c = 0, s = i.expando, h = i.cache, l = i.support.deleteExpando, a = i.event.special; null != (r = n[c]); c++) + if ((t || i.acceptData(r)) && (u = r[s], e = u && h[u])) { + if (e.events) + for (f in e.events) a[f] ? i.event.remove(r, f) : i.removeEvent(r, f, e.handle); + h[u] && (delete h[u], l ? delete r[s] : typeof r.removeAttribute !== o ? r.removeAttribute(s) : r[s] = null, b.push(u)) + } + } + }); + var rt, v, y, hi = /alpha\([^)]*\)/i, + be = /opacity\s*=\s*([^)]*)/, + ke = /^(top|right|bottom|left)$/, + de = /^(none|table(?!-c[ea]).+)/, + tu = /^margin/, + ge = RegExp("^(" + st + ")(.*)$", "i"), + ct = RegExp("^(" + st + ")(?!px)[a-z%]+$", "i"), + no = RegExp("^([+-])=(" + st + ")", "i"), + iu = { + BODY: "block" + }, + to = { + position: "absolute", + visibility: "hidden", + display: "block" + }, + ru = { + letterSpacing: 0, + fontWeight: 400 + }, + p = ["Top", "Right", "Bottom", "Left"], + uu = ["Webkit", "O", "Moz", "ms"]; + i.fn.extend({ + css: function(n, r) { + return i.access(this, function(n, r, u) { + var e, o, s = {}, + f = 0; + if (i.isArray(r)) { + for (o = v(n), e = r.length; e > f; f++) s[r[f]] = i.css(n, r[f], !1, o); + return s + } + return u !== t ? i.style(n, r, u) : i.css(n, r) + }, n, r, arguments.length > 1) + }, + show: function() { + return eu(this, !0) + }, + hide: function() { + return eu(this) + }, + toggle: function(n) { + var t = "boolean" == typeof n; + return this.each(function() { + (t ? n : ut(this)) ? i(this).show(): i(this).hide() + }) + } + }); + i.extend({ + cssHooks: { + opacity: { + get: function(n, t) { + if (t) { + var i = y(n, "opacity"); + return "" === i ? "1" : i + } + } + } + }, + cssNumber: { + columnCount: !0, + fillOpacity: !0, + fontWeight: !0, + lineHeight: !0, + opacity: !0, + orphans: !0, + widows: !0, + zIndex: !0, + zoom: !0 + }, + cssProps: { + float: i.support.cssFloat ? "cssFloat" : "styleFloat" + }, + style: function(n, r, u, f) { + if (n && 3 !== n.nodeType && 8 !== n.nodeType && n.style) { + var o, s, e, h = i.camelCase(r), + c = n.style; + if (r = i.cssProps[h] || (i.cssProps[h] = fu(c, h)), e = i.cssHooks[r] || i.cssHooks[h], u === t) return e && "get" in e && (o = e.get(n, !1, f)) !== t ? o : c[r]; + if (s = typeof u, "string" === s && (o = no.exec(u)) && (u = (o[1] + 1) * o[2] + parseFloat(i.css(n, r)), s = "number"), !(null == u || "number" === s && isNaN(u) || ("number" !== s || i.cssNumber[h] || (u += "px"), i.support.clearCloneStyle || "" !== u || 0 !== r.indexOf("background") || (c[r] = "inherit"), e && "set" in e && (u = e.set(n, u, f)) === t))) try { + c[r] = u + } catch (l) {} + } + }, + css: function(n, r, u, f) { + var h, e, o, s = i.camelCase(r); + return r = i.cssProps[s] || (i.cssProps[s] = fu(n.style, s)), o = i.cssHooks[r] || i.cssHooks[s], o && "get" in o && (e = o.get(n, !0, u)), e === t && (e = y(n, r, f)), "normal" === e && r in ru && (e = ru[r]), "" === u || u ? (h = parseFloat(e), u === !0 || i.isNumeric(h) ? h || 0 : e) : e + }, + swap: function(n, t, i, r) { + var f, u, e = {}; + for (u in t) e[u] = n.style[u], n.style[u] = t[u]; + f = i.apply(n, r || []); + for (u in t) n.style[u] = e[u]; + return f + } + }); + n.getComputedStyle ? (v = function(t) { + return n.getComputedStyle(t, null) + }, y = function(n, r, u) { + var s, h, c, o = u || v(n), + e = o ? o.getPropertyValue(r) || o[r] : t, + f = n.style; + return o && ("" !== e || i.contains(n.ownerDocument, n) || (e = i.style(n, r)), ct.test(e) && tu.test(r) && (s = f.width, h = f.minWidth, c = f.maxWidth, f.minWidth = f.maxWidth = f.width = e, e = o.width, f.width = s, f.minWidth = h, f.maxWidth = c)), e + }) : r.documentElement.currentStyle && (v = function(n) { + return n.currentStyle + }, y = function(n, i, r) { + var s, e, o, h = r || v(n), + u = h ? h[i] : t, + f = n.style; + return null == u && f && f[i] && (u = f[i]), ct.test(u) && !ke.test(i) && (s = f.left, e = n.runtimeStyle, o = e && e.left, o && (e.left = n.currentStyle.left), f.left = "fontSize" === i ? "1em" : u, u = f.pixelLeft + "px", f.left = s, o && (e.left = o)), "" === u ? "auto" : u + }); + i.each(["height", "width"], function(n, r) { + i.cssHooks[r] = { + get: function(n, u, f) { + return u ? 0 === n.offsetWidth && de.test(i.css(n, "display")) ? i.swap(n, to, function() { + return hu(n, r, f) + }) : hu(n, r, f) : t + }, + set: function(n, t, u) { + var f = u && v(n); + return ou(n, t, u ? su(n, r, u, i.support.boxSizing && "border-box" === i.css(n, "boxSizing", !1, f), f) : 0) + } + } + }); + i.support.opacity || (i.cssHooks.opacity = { + get: function(n, t) { + return be.test((t && n.currentStyle ? n.currentStyle.filter : n.style.filter) || "") ? .01 * parseFloat(RegExp.$1) + "" : t ? "1" : "" + }, + set: function(n, t) { + var r = n.style, + u = n.currentStyle, + e = i.isNumeric(t) ? "alpha(opacity=" + 100 * t + ")" : "", + f = u && u.filter || r.filter || ""; + r.zoom = 1; + (t >= 1 || "" === t) && "" === i.trim(f.replace(hi, "")) && r.removeAttribute && (r.removeAttribute("filter"), "" === t || u && !u.filter) || (r.filter = hi.test(f) ? f.replace(hi, e) : f + " " + e) + } + }); + i(function() { + i.support.reliableMarginRight || (i.cssHooks.marginRight = { + get: function(n, r) { + return r ? i.swap(n, { + display: "inline-block" + }, y, [n, "marginRight"]) : t + } + }); + !i.support.pixelPosition && i.fn.position && i.each(["top", "left"], function(n, r) { + i.cssHooks[r] = { + get: function(n, u) { + return u ? (u = y(n, r), ct.test(u) ? i(n).position()[r] + "px" : u) : t + } + } + }) + }); + i.expr && i.expr.filters && (i.expr.filters.hidden = function(n) { + return 0 >= n.offsetWidth && 0 >= n.offsetHeight || !i.support.reliableHiddenOffsets && "none" === (n.style && n.style.display || i.css(n, "display")) + }, i.expr.filters.visible = function(n) { + return !i.expr.filters.hidden(n) + }); + i.each({ + margin: "", + padding: "", + border: "Width" + }, function(n, t) { + i.cssHooks[n + t] = { + expand: function(i) { + for (var r = 0, f = {}, u = "string" == typeof i ? i.split(" ") : [i]; 4 > r; r++) f[n + p[r] + t] = u[r] || u[r - 2] || u[0]; + return f + } + }; + tu.test(n) || (i.cssHooks[n + t].set = ou) + }); + var io = /%20/g, + ro = /\[\]$/, + au = /\r?\n/g, + uo = /^(?:submit|button|image|reset|file)$/i, + fo = /^(?:input|select|textarea|keygen)/i; + i.fn.extend({ + serialize: function() { + return i.param(this.serializeArray()) + }, + serializeArray: function() { + return this.map(function() { + var n = i.prop(this, "elements"); + return n ? i.makeArray(n) : this + }).filter(function() { + var n = this.type; + return this.name && !i(this).is(":disabled") && fo.test(this.nodeName) && !uo.test(n) && (this.checked || !ei.test(n)) + }).map(function(n, t) { + var r = i(this).val(); + return null == r ? null : i.isArray(r) ? i.map(r, function(n) { + return { + name: t.name, + value: n.replace(au, "\r\n") + } + }) : { + name: t.name, + value: r.replace(au, "\r\n") + } + }).get() + } + }); + i.param = function(n, r) { + var u, f = [], + e = function(n, t) { + t = i.isFunction(t) ? t() : null == t ? "" : t; + f[f.length] = encodeURIComponent(n) + "=" + encodeURIComponent(t) + }; + if (r === t && (r = i.ajaxSettings && i.ajaxSettings.traditional), i.isArray(n) || n.jquery && !i.isPlainObject(n)) i.each(n, function() { + e(this.name, this.value) + }); + else + for (u in n) ci(u, n[u], r, e); + return f.join("&").replace(io, "+") + }; + i.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error contextmenu".split(" "), function(n, t) { + i.fn[t] = function(n, i) { + return arguments.length > 0 ? this.on(t, null, n, i) : this.trigger(t) + } + }); + i.fn.hover = function(n, t) { + return this.mouseenter(n).mouseleave(t || n) + }; + var w, c, li = i.now(), + ai = /\?/, + eo = /#.*$/, + vu = /([?&])_=[^&]*/, + oo = /^(.*?):[ \t]*([^\r\n]*)\r?$/gm, + so = /^(?:GET|HEAD)$/, + ho = /^\/\//, + yu = /^([\w.+-]+:)(?:\/\/([^\/?#:]*)(?::(\d+)|)|)/, + pu = i.fn.load, + wu = {}, + vi = {}, + bu = "*/".concat("*"); + try { + c = ff.href + } catch (go) { + c = r.createElement("a"); + c.href = ""; + c = c.href + } + w = yu.exec(c.toLowerCase()) || []; + i.fn.load = function(n, r, u) { + if ("string" != typeof n && pu) return pu.apply(this, arguments); + var f, s, h, e = this, + o = n.indexOf(" "); + return o >= 0 && (f = n.slice(o, n.length), n = n.slice(0, o)), i.isFunction(r) ? (u = r, r = t) : r && "object" == typeof r && (h = "POST"), e.length > 0 && i.ajax({ + url: n, + type: h, + dataType: "html", + data: r + }).done(function(n) { + s = arguments; + e.html(f ? i("<div>").append(i.parseHTML(n)).find(f) : n) + }).complete(u && function(n, t) { + e.each(u, s || [n.responseText, t, n]) + }), this + }; + i.each(["ajaxStart", "ajaxStop", "ajaxComplete", "ajaxError", "ajaxSuccess", "ajaxSend"], function(n, t) { + i.fn[t] = function(n) { + return this.on(t, n) + } + }); + i.each(["get", "post"], function(n, r) { + i[r] = function(n, u, f, e) { + return i.isFunction(u) && (e = e || f, f = u, u = t), i.ajax({ + url: n, + type: r, + dataType: e, + data: u, + success: f + }) + } + }); + i.extend({ + active: 0, + lastModified: {}, + etag: {}, + ajaxSettings: { + url: c, + type: "GET", + isLocal: /^(?:about|app|app-storage|.+-extension|file|res|widget):$/.test(w[1]), + global: !0, + processData: !0, + async: !0, + contentType: "application/x-www-form-urlencoded; charset=UTF-8", + accepts: { + "*": bu, + text: "text/plain", + html: "text/html", + xml: "application/xml, text/xml", + json: "application/json, text/javascript" + }, + contents: { + xml: /xml/, + html: /html/, + json: /json/ + }, + responseFields: { + xml: "responseXML", + text: "responseText" + }, + converters: { + "* text": n.String, + "text html": !0, + "text json": i.parseJSON, + "text xml": i.parseXML + }, + flatOptions: { + url: !0, + context: !0 + } + }, + ajaxSetup: function(n, t) { + return t ? yi(yi(n, i.ajaxSettings), t) : yi(i.ajaxSettings, n) + }, + ajaxPrefilter: ku(wu), + ajaxTransport: ku(vi), + ajax: function(n, r) { + function k(n, r, s, c) { + var l, k, w, rt, p, a = r; + 2 !== o && (o = 2, g && clearTimeout(g), y = t, d = c || "", f.readyState = n > 0 ? 4 : 0, s && (rt = co(u, f, s)), n >= 200 && 300 > n || 304 === n ? (u.ifModified && (p = f.getResponseHeader("Last-Modified"), p && (i.lastModified[e] = p), p = f.getResponseHeader("etag"), p && (i.etag[e] = p)), 204 === n ? (l = !0, a = "nocontent") : 304 === n ? (l = !0, a = "notmodified") : (l = lo(u, rt), a = l.state, k = l.data, w = l.error, l = !w)) : (w = a, (n || !a) && (a = "error", 0 > n && (n = 0))), f.status = n, f.statusText = (r || a) + "", l ? tt.resolveWith(h, [k, a, f]) : tt.rejectWith(h, [f, a, w]), f.statusCode(b), b = t, v && nt.trigger(l ? "ajaxSuccess" : "ajaxError", [f, u, l ? k : w]), it.fireWith(h, [f, a]), v && (nt.trigger("ajaxComplete", [f, u]), --i.active || i.event.trigger("ajaxStop"))) + } + "object" == typeof n && (r = n, n = t); + r = r || {}; + var l, a, e, d, g, v, y, p, u = i.ajaxSetup({}, r), + h = u.context || u, + nt = u.context && (h.nodeType || h.jquery) ? i(h) : i.event, + tt = i.Deferred(), + it = i.Callbacks("once memory"), + b = u.statusCode || {}, + rt = {}, + ut = {}, + o = 0, + ft = "canceled", + f = { + readyState: 0, + getResponseHeader: function(n) { + var t; + if (2 === o) { + if (!p) + for (p = {}; t = oo.exec(d);) p[t[1].toLowerCase()] = t[2]; + t = p[n.toLowerCase()] + } + return null == t ? null : t + }, + getAllResponseHeaders: function() { + return 2 === o ? d : null + }, + setRequestHeader: function(n, t) { + var i = n.toLowerCase(); + return o || (n = ut[i] = ut[i] || n, rt[n] = t), this + }, + overrideMimeType: function(n) { + return o || (u.mimeType = n), this + }, + statusCode: function(n) { + var t; + if (n) + if (2 > o) + for (t in n) b[t] = [b[t], n[t]]; + else f.always(n[f.status]); + return this + }, + abort: function(n) { + var t = n || ft; + return y && y.abort(t), k(0, t), this + } + }; + if (tt.promise(f).complete = it.add, f.success = f.done, f.error = f.fail, u.url = ((n || u.url || c) + "").replace(eo, "").replace(ho, w[1] + "//"), u.type = r.method || r.type || u.method || u.type, u.dataTypes = i.trim(u.dataType || "*").toLowerCase().match(s) || [""], null == u.crossDomain && (l = yu.exec(u.url.toLowerCase()), u.crossDomain = !(!l || l[1] === w[1] && l[2] === w[2] && (l[3] || ("http:" === l[1] ? 80 : 443)) == (w[3] || ("http:" === w[1] ? 80 : 443)))), u.data && u.processData && "string" != typeof u.data && (u.data = i.param(u.data, u.traditional)), du(wu, u, r, f), 2 === o) return f; + v = u.global; + v && 0 == i.active++ && i.event.trigger("ajaxStart"); + u.type = u.type.toUpperCase(); + u.hasContent = !so.test(u.type); + e = u.url; + u.hasContent || (u.data && (e = u.url += (ai.test(e) ? "&" : "?") + u.data, delete u.data), u.cache === !1 && (u.url = vu.test(e) ? e.replace(vu, "$1_=" + li++) : e + (ai.test(e) ? "&" : "?") + "_=" + li++)); + u.ifModified && (i.lastModified[e] && f.setRequestHeader("If-Modified-Since", i.lastModified[e]), i.etag[e] && f.setRequestHeader("If-None-Match", i.etag[e])); + (u.data && u.hasContent && u.contentType !== !1 || r.contentType) && f.setRequestHeader("Content-Type", u.contentType); + f.setRequestHeader("Accept", u.dataTypes[0] && u.accepts[u.dataTypes[0]] ? u.accepts[u.dataTypes[0]] + ("*" !== u.dataTypes[0] ? ", " + bu + "; q=0.01" : "") : u.accepts["*"]); + for (a in u.headers) f.setRequestHeader(a, u.headers[a]); + if (u.beforeSend && (u.beforeSend.call(h, f, u) === !1 || 2 === o)) return f.abort(); + ft = "abort"; + for (a in { + success: 1, + error: 1, + complete: 1 + }) f[a](u[a]); + if (y = du(vi, u, r, f)) { + f.readyState = 1; + v && nt.trigger("ajaxSend", [f, u]); + u.async && u.timeout > 0 && (g = setTimeout(function() { + f.abort("timeout") + }, u.timeout)); + try { + o = 1; + y.send(rt, k) + } catch (et) { + if (!(2 > o)) throw et; + k(-1, et) + } + } else k(-1, "No Transport"); + return f + }, + getScript: function(n, r) { + return i.get(n, t, r, "script") + }, + getJSON: function(n, t, r) { + return i.get(n, t, r, "json") + } + }); + i.ajaxSetup({ + accepts: { + script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /(?:java|ecma)script/ + }, + converters: { + "text script": function(n) { + return i.globalEval(n), n + } + } + }); + i.ajaxPrefilter("script", function(n) { + n.cache === t && (n.cache = !1); + n.crossDomain && (n.type = "GET", n.global = !1) + }); + i.ajaxTransport("script", function(n) { + if (n.crossDomain) { + var u, f = r.head || i("head")[0] || r.documentElement; + return { + send: function(t, i) { + u = r.createElement("script"); + u.async = !0; + n.scriptCharset && (u.charset = n.scriptCharset); + u.src = n.url; + u.onload = u.onreadystatechange = function(n, t) { + (t || !u.readyState || /loaded|complete/.test(u.readyState)) && (u.onload = u.onreadystatechange = null, u.parentNode && u.parentNode.removeChild(u), u = null, t || i(200, "success")) + }; + f.insertBefore(u, f.firstChild) + }, + abort: function() { + u && u.onload(t, !0) + } + } + } + }); + pi = []; + lt = /(=)\?(?=&|$)|\?\?/; + i.ajaxSetup({ + jsonp: "callback", + jsonpCallback: function() { + var n = pi.pop() || i.expando + "_" + li++; + return this[n] = !0, n + } + }); + i.ajaxPrefilter("json jsonp", function(r, u, f) { + var e, s, o, h = r.jsonp !== !1 && (lt.test(r.url) ? "url" : "string" == typeof r.data && !(r.contentType || "").indexOf("application/x-www-form-urlencoded") && lt.test(r.data) && "data"); + return h || "jsonp" === r.dataTypes[0] ? (e = r.jsonpCallback = i.isFunction(r.jsonpCallback) ? r.jsonpCallback() : r.jsonpCallback, h ? r[h] = r[h].replace(lt, "$1" + e) : r.jsonp !== !1 && (r.url += (ai.test(r.url) ? "&" : "?") + r.jsonp + "=" + e), r.converters["script json"] = function() { + return o || i.error(e + " was not called"), o[0] + }, r.dataTypes[0] = "json", s = n[e], n[e] = function() { + o = arguments + }, f.always(function() { + n[e] = s; + r[e] && (r.jsonpCallback = u.jsonpCallback, pi.push(e)); + o && i.isFunction(s) && s(o[0]); + o = s = t + }), "script") : t + }); + gu = 0; + at = n.ActiveXObject && function() { + for (var n in g) g[n](t, !0) + }; + i.ajaxSettings.xhr = n.ActiveXObject ? function() { + return !this.isLocal && nf() || ao() + } : nf; + nt = i.ajaxSettings.xhr(); + i.support.cors = !!nt && "withCredentials" in nt; + nt = i.support.ajax = !!nt; + nt && i.ajaxTransport(function(r) { + if (!r.crossDomain || i.support.cors) { + var u; + return { + send: function(f, e) { + var h, s, o = r.xhr(); + if (r.username ? o.open(r.type, r.url, r.async, r.username, r.password) : o.open(r.type, r.url, r.async), r.xhrFields) + for (s in r.xhrFields) o[s] = r.xhrFields[s]; + r.mimeType && o.overrideMimeType && o.overrideMimeType(r.mimeType); + r.crossDomain || f["X-Requested-With"] || (f["X-Requested-With"] = "XMLHttpRequest"); + try { + for (s in f) o.setRequestHeader(s, f[s]) + } catch (c) {} + o.send(r.hasContent && r.data || null); + u = function(n, f) { + var s, a, l, c; + try { + if (u && (f || 4 === o.readyState)) + if (u = t, h && (o.onreadystatechange = i.noop, at && delete g[h]), f) 4 !== o.readyState && o.abort(); + else { + c = {}; + s = o.status; + a = o.getAllResponseHeaders(); + "string" == typeof o.responseText && (c.text = o.responseText); + try { + l = o.statusText + } catch (y) { + l = "" + } + s || !r.isLocal || r.crossDomain ? 1223 === s && (s = 204) : s = c.text ? 200 : 404 + } + } catch (v) { + f || e(-1, v) + } + c && e(s, l, c, a) + }; + r.async ? 4 === o.readyState ? setTimeout(u) : (h = ++gu, at && (g || (g = {}, i(n).unload(at)), g[h] = u), o.onreadystatechange = u) : u() + }, + abort: function() { + u && u(t, !0) + } + } + } + }); + var tt, vt, vo = /^(?:toggle|show|hide)$/, + yo = RegExp("^(?:([+-])=|)(" + st + ")([a-z%]*)$", "i"), + po = /queueHooks$/, + yt = [ko], + ft = { + "*": [function(n, t) { + var o, s, r = this.createTween(n, t), + e = yo.exec(t), + h = r.cur(), + u = +h || 0, + f = 1, + c = 20; + if (e) { + if (o = +e[2], s = e[3] || (i.cssNumber[n] ? "" : "px"), "px" !== s && u) { + u = i.css(r.elem, n, !0) || o || 1; + do f = f || ".5", u /= f, i.style(r.elem, n, u + s); while (f !== (f = r.cur() / h) && 1 !== f && --c) + } + r.unit = s; + r.start = u; + r.end = e[1] ? u + (e[1] + 1) * o : o + } + return r + }] + }; + i.Animation = i.extend(rf, { + tweener: function(n, t) { + i.isFunction(n) ? (t = n, n = ["*"]) : n = n.split(" "); + for (var r, u = 0, f = n.length; f > u; u++) r = n[u], ft[r] = ft[r] || [], ft[r].unshift(t) + }, + prefilter: function(n, t) { + t ? yt.unshift(n) : yt.push(n) + } + }); + i.Tween = f; + f.prototype = { + constructor: f, + init: function(n, t, r, u, f, e) { + this.elem = n; + this.prop = r; + this.easing = f || "swing"; + this.options = t; + this.start = this.now = this.cur(); + this.end = u; + this.unit = e || (i.cssNumber[r] ? "" : "px") + }, + cur: function() { + var n = f.propHooks[this.prop]; + return n && n.get ? n.get(this) : f.propHooks._default.get(this) + }, + run: function(n) { + var r, t = f.propHooks[this.prop]; + return this.pos = r = this.options.duration ? i.easing[this.easing](n, this.options.duration * n, 0, 1, this.options.duration) : n, this.now = (this.end - this.start) * r + this.start, this.options.step && this.options.step.call(this.elem, this.now, this), t && t.set ? t.set(this) : f.propHooks._default.set(this), this + } + }; + f.prototype.init.prototype = f.prototype; + f.propHooks = { + _default: { + get: function(n) { + var t; + return null == n.elem[n.prop] || n.elem.style && null != n.elem.style[n.prop] ? (t = i.css(n.elem, n.prop, ""), t && "auto" !== t ? t : 0) : n.elem[n.prop] + }, + set: function(n) { + i.fx.step[n.prop] ? i.fx.step[n.prop](n) : n.elem.style && (null != n.elem.style[i.cssProps[n.prop]] || i.cssHooks[n.prop]) ? i.style(n.elem, n.prop, n.now + n.unit) : n.elem[n.prop] = n.now + } + } + }; + f.propHooks.scrollTop = f.propHooks.scrollLeft = { + set: function(n) { + n.elem.nodeType && n.elem.parentNode && (n.elem[n.prop] = n.now) + } + }; + i.each(["toggle", "show", "hide"], function(n, t) { + var r = i.fn[t]; + i.fn[t] = function(n, i, u) { + return null == n || "boolean" == typeof n ? r.apply(this, arguments) : this.animate(pt(t, !0), n, i, u) + } + }); + i.fn.extend({ + fadeTo: function(n, t, i, r) { + return this.filter(ut).css("opacity", 0).show().end().animate({ + opacity: t + }, n, i, r) + }, + animate: function(n, t, r, u) { + var o = i.isEmptyObject(n), + e = i.speed(t, r, u), + f = function() { + var t = rf(this, i.extend({}, n), e); + f.finish = function() { + t.stop(!0) + }; + (o || i._data(this, "finish")) && t.stop(!0) + }; + return f.finish = f, o || e.queue === !1 ? this.each(f) : this.queue(e.queue, f) + }, + stop: function(n, r, u) { + var f = function(n) { + var t = n.stop; + delete n.stop; + t(u) + }; + return "string" != typeof n && (u = r, r = n, n = t), r && n !== !1 && this.queue(n || "fx", []), this.each(function() { + var o = !0, + t = null != n && n + "queueHooks", + e = i.timers, + r = i._data(this); + if (t) r[t] && r[t].stop && f(r[t]); + else + for (t in r) r[t] && r[t].stop && po.test(t) && f(r[t]); + for (t = e.length; t--;) e[t].elem !== this || null != n && e[t].queue !== n || (e[t].anim.stop(u), o = !1, e.splice(t, 1)); + (o || !u) && i.dequeue(this, n) + }) + }, + finish: function(n) { + return n !== !1 && (n = n || "fx"), this.each(function() { + var t, f = i._data(this), + r = f[n + "queue"], + e = f[n + "queueHooks"], + u = i.timers, + o = r ? r.length : 0; + for (f.finish = !0, i.queue(this, n, []), e && e.cur && e.cur.finish && e.cur.finish.call(this), t = u.length; t--;) u[t].elem === this && u[t].queue === n && (u[t].anim.stop(!0), u.splice(t, 1)); + for (t = 0; o > t; t++) r[t] && r[t].finish && r[t].finish.call(this); + delete f.finish + }) + } + }); + i.each({ + slideDown: pt("show"), + slideUp: pt("hide"), + slideToggle: pt("toggle"), + fadeIn: { + opacity: "show" + }, + fadeOut: { + opacity: "hide" + }, + fadeToggle: { + opacity: "toggle" + } + }, function(n, t) { + i.fn[n] = function(n, i, r) { + return this.animate(t, n, i, r) + } + }); + i.speed = function(n, t, r) { + var u = n && "object" == typeof n ? i.extend({}, n) : { + complete: r || !r && t || i.isFunction(n) && n, + duration: n, + easing: r && t || t && !i.isFunction(t) && t + }; + return u.duration = i.fx.off ? 0 : "number" == typeof u.duration ? u.duration : u.duration in i.fx.speeds ? i.fx.speeds[u.duration] : i.fx.speeds._default, (null == u.queue || u.queue === !0) && (u.queue = "fx"), u.old = u.complete, u.complete = function() { + i.isFunction(u.old) && u.old.call(this); + u.queue && i.dequeue(this, u.queue) + }, u + }; + i.easing = { + linear: function(n) { + return n + }, + swing: function(n) { + return .5 - Math.cos(n * Math.PI) / 2 + } + }; + i.timers = []; + i.fx = f.prototype.init; + i.fx.tick = function() { + var u, n = i.timers, + r = 0; + for (tt = i.now(); n.length > r; r++) u = n[r], u() || n[r] !== u || n.splice(r--, 1); + n.length || i.fx.stop(); + tt = t + }; + i.fx.timer = function(n) { + n() && i.timers.push(n) && i.fx.start() + }; + i.fx.interval = 13; + i.fx.start = function() { + vt || (vt = setInterval(i.fx.tick, i.fx.interval)) + }; + i.fx.stop = function() { + clearInterval(vt); + vt = null + }; + i.fx.speeds = { + slow: 600, + fast: 200, + _default: 400 + }; + i.fx.step = {}; + i.expr && i.expr.filters && (i.expr.filters.animated = function(n) { + return i.grep(i.timers, function(t) { + return n === t.elem + }).length + }); + i.fn.offset = function(n) { + if (arguments.length) return n === t ? this : this.each(function(t) { + i.offset.setOffset(this, n, t) + }); + var r, e, f = { + top: 0, + left: 0 + }, + u = this[0], + s = u && u.ownerDocument; + if (s) return r = s.documentElement, i.contains(r, u) ? (typeof u.getBoundingClientRect !== o && (f = u.getBoundingClientRect()), e = uf(s), { + top: f.top + (e.pageYOffset || r.scrollTop) - (r.clientTop || 0), + left: f.left + (e.pageXOffset || r.scrollLeft) - (r.clientLeft || 0) + }) : f + }; + i.offset = { + setOffset: function(n, t, r) { + var f = i.css(n, "position"); + "static" === f && (n.style.position = "relative"); + var e = i(n), + o = e.offset(), + l = i.css(n, "top"), + a = i.css(n, "left"), + v = ("absolute" === f || "fixed" === f) && i.inArray("auto", [l, a]) > -1, + u = {}, + s = {}, + h, c; + v ? (s = e.position(), h = s.top, c = s.left) : (h = parseFloat(l) || 0, c = parseFloat(a) || 0); + i.isFunction(t) && (t = t.call(n, r, o)); + null != t.top && (u.top = t.top - o.top + h); + null != t.left && (u.left = t.left - o.left + c); + "using" in t ? t.using.call(n, u) : e.css(u) + } + }; + i.fn.extend({ + position: function() { + if (this[0]) { + var n, r, t = { + top: 0, + left: 0 + }, + u = this[0]; + return "fixed" === i.css(u, "position") ? r = u.getBoundingClientRect() : (n = this.offsetParent(), r = this.offset(), i.nodeName(n[0], "html") || (t = n.offset()), t.top += i.css(n[0], "borderTopWidth", !0), t.left += i.css(n[0], "borderLeftWidth", !0)), { + top: r.top - t.top - i.css(u, "marginTop", !0), + left: r.left - t.left - i.css(u, "marginLeft", !0) + } + } + }, + offsetParent: function() { + return this.map(function() { + for (var n = this.offsetParent || r.documentElement; n && !i.nodeName(n, "html") && "static" === i.css(n, "position");) n = n.offsetParent; + return n || r.documentElement + }) + } + }); + i.each({ + scrollLeft: "pageXOffset", + scrollTop: "pageYOffset" + }, function(n, r) { + var u = /Y/.test(r); + i.fn[n] = function(f) { + return i.access(this, function(n, f, e) { + var o = uf(n); + return e === t ? o ? r in o ? o[r] : o.document.documentElement[f] : n[f] : (o ? o.scrollTo(u ? i(o).scrollLeft() : e, u ? e : i(o).scrollTop()) : n[f] = e, t) + }, n, f, arguments.length, null) + } + }); + i.each({ + Height: "height", + Width: "width" + }, function(n, r) { + i.each({ + padding: "inner" + n, + content: r, + "": "outer" + n + }, function(u, f) { + i.fn[f] = function(f, e) { + var o = arguments.length && (u || "boolean" != typeof f), + s = u || (f === !0 || e === !0 ? "margin" : "border"); + return i.access(this, function(r, u, f) { + var e; + return i.isWindow(r) ? r.document.documentElement["client" + n] : 9 === r.nodeType ? (e = r.documentElement, Math.max(r.body["scroll" + n], e["scroll" + n], r.body["offset" + n], e["offset" + n], e["client" + n])) : f === t ? i.css(r, u, s) : i.style(r, u, f, s) + }, r, o ? f : t, o, null) + } + }) + }); + n.jQuery = n.$ = i; + "function" == typeof define && define.amd && define.amd.jQuery && define("jquery", [], function() { + return i + }) +})(window), +function(n) { + function i(n, t) { + for (var i = window, r = (n || "").split("."); i && r.length;) i = i[r.shift()]; + return typeof i == "function" ? i : (t.push(n), Function.constructor.apply(null, t)) + } + + function r(n) { + return n === "GET" || n === "POST" + } + + function e(n, t) { + r(t) || n.setRequestHeader("X-HTTP-Method-Override", t) + } + + function o(t, i, r) { + var u; + r.indexOf("application/x-javascript") === -1 && (u = (t.getAttribute("data-ajax-mode") || "").toUpperCase(), n(t.getAttribute("data-ajax-update")).each(function(t, r) { + var f; + switch (u) { + case "BEFORE": + f = r.firstChild; + n("<div />").html(i).contents().each(function() { + r.insertBefore(this, f) + }); + break; + case "AFTER": + n("<div />").html(i).contents().each(function() { + r.appendChild(this) + }); + break; + default: + n(r).html(i) + } + })) + } + + function u(t, u) { + var s, h, f, c; + (s = t.getAttribute("data-ajax-confirm"), !s || window.confirm(s)) && (h = n(t.getAttribute("data-ajax-loading")), c = t.getAttribute("data-ajax-loading-duration") || 0, n.extend(u, { + type: t.getAttribute("data-ajax-method") || undefined, + url: t.getAttribute("data-ajax-url") || undefined, + beforeSend: function(n) { + var r; + return e(n, f), r = i(t.getAttribute("data-ajax-begin"), ["xhr"]).apply(this, arguments), r !== !1 && h.show(c), r + }, + complete: function() { + h.hide(c); + i(t.getAttribute("data-ajax-complete"), ["xhr", "status"]).apply(this, arguments) + }, + success: function(n, r, u) { + o(t, n, u.getResponseHeader("Content-Type") || "text/html"); + i(t.getAttribute("data-ajax-success"), ["data", "status", "xhr"]).apply(this, arguments) + }, + error: i(t.getAttribute("data-ajax-failure"), ["xhr", "status", "error"]) + }), u.data.push({ + name: "X-Requested-With", + value: "XMLHttpRequest" + }), f = u.type.toUpperCase(), r(f) || (u.type = "POST", u.data.push({ + name: "X-HTTP-Method-Override", + value: f + })), n.ajax(u)) + } + + function s(t) { + var i = n(t).data(f); + return !i || !i.validate || i.validate() + } + var t = "unobtrusiveAjaxClick", + f = "unobtrusiveValidation"; + n(document).on("click", "a[data-ajax=true]", function(n) { + n.preventDefault(); + u(this, { + url: this.href, + type: "GET", + data: [] + }) + }); + n(document).on("click", "form[data-ajax=true] input[type=image]", function(i) { + var r = i.target.name, + u = n(i.target), + f = u.parents("form")[0], + e = u.offset(); + n(f).data(t, [{ + name: r + ".x", + value: Math.round(i.pageX - e.left) + }, { + name: r + ".y", + value: Math.round(i.pageY - e.top) + }]); + setTimeout(function() { + n(f).removeData(t) + }, 0) + }); + n(document).on("click", "form[data-ajax=true] :submit", function(i) { + var r = i.target.name, + u = n(i.target).parents("form")[0]; + n(u).data(t, r ? [{ + name: r, + value: i.target.value + }] : []); + setTimeout(function() { + n(u).removeData(t) + }, 0) + }); + n(document).on("submit", "form[data-ajax=true]", function(i) { + var r = n(this).data(t) || []; + (i.preventDefault(), s(this)) && u(this, { + url: this.action, + type: this.method || "GET", + data: r.concat(n(this).serializeArray()) + }) + }) +}(jQuery), +function(n) { + n.extend(n.fn, { + validate: function(t) { + if (!this.length) return t && t.debug && window.console && console.warn("Nothing selected, can't validate, returning nothing."), void 0; + var i = n.data(this[0], "validator"); + return i ? i : (this.attr("novalidate", "novalidate"), i = new n.validator(t, this[0]), n.data(this[0], "validator", i), i.settings.onsubmit && (this.validateDelegate(":submit", "click", function(t) { + i.settings.submitHandler && (i.submitButton = t.target); + n(t.target).hasClass("cancel") && (i.cancelSubmit = !0); + void 0 !== n(t.target).attr("formnovalidate") && (i.cancelSubmit = !0) + }), this.submit(function(t) { + function r() { + var r; + return i.settings.submitHandler ? (i.submitButton && (r = n("<input type='hidden'/>").attr("name", i.submitButton.name).val(n(i.submitButton).val()).appendTo(i.currentForm)), i.settings.submitHandler.call(i, i.currentForm, t), i.submitButton && r.remove(), !1) : !0 + } + return i.settings.debug && t.preventDefault(), i.cancelSubmit ? (i.cancelSubmit = !1, r()) : i.form() ? i.pendingRequest ? (i.formSubmitted = !0, !1) : r() : (i.focusInvalid(), !1) + })), i) + }, + valid: function() { + if (n(this[0]).is("form")) return this.validate().form(); + var t = !0, + i = n(this[0].form).validate(); + return this.each(function() { + t = t && i.element(this) + }), t + }, + removeAttrs: function(t) { + var i = {}, + r = this; + return n.each(t.split(/\s/), function(n, t) { + i[t] = r.attr(t); + r.removeAttr(t) + }), i + }, + rules: function(t, i) { + var r = this[0], + o, u, h; + if (t) { + var e = n.data(r.form, "validator").settings, + s = e.rules, + f = n.validator.staticRules(r); + switch (t) { + case "add": + n.extend(f, n.validator.normalizeRule(i)); + delete f.messages; + s[r.name] = f; + i.messages && (e.messages[r.name] = n.extend(e.messages[r.name], i.messages)); + break; + case "remove": + return i ? (o = {}, n.each(i.split(/\s/), function(n, t) { + o[t] = f[t]; + delete f[t] + }), o) : (delete s[r.name], f) + } + } + return u = n.validator.normalizeRules(n.extend({}, n.validator.classRules(r), n.validator.attributeRules(r), n.validator.dataRules(r), n.validator.staticRules(r)), r), u.required && (h = u.required, delete u.required, u = n.extend({ + required: h + }, u)), u + } + }); + n.extend(n.expr[":"], { + blank: function(t) { + return !n.trim("" + n(t).val()) + }, + filled: function(t) { + return !!n.trim("" + n(t).val()) + }, + unchecked: function(t) { + return !n(t).prop("checked") + } + }); + n.validator = function(t, i) { + this.settings = n.extend(!0, {}, n.validator.defaults, t); + this.currentForm = i; + this.init() + }; + n.validator.format = function(t, i) { + return 1 === arguments.length ? function() { + var i = n.makeArray(arguments); + return i.unshift(t), n.validator.format.apply(this, i) + } : (arguments.length > 2 && i.constructor !== Array && (i = n.makeArray(arguments).slice(1)), i.constructor !== Array && (i = [i]), n.each(i, function(n, i) { + t = t.replace(RegExp("\\{" + n + "\\}", "g"), function() { + return i + }) + }), t) + }; + n.extend(n.validator, { + defaults: { + messages: {}, + groups: {}, + rules: {}, + errorClass: "error", + validClass: "valid", + errorElement: "label", + focusInvalid: !0, + errorContainer: n([]), + errorLabelContainer: n([]), + onsubmit: !0, + ignore: ":hidden", + ignoreTitle: !1, + onfocusin: function(n) { + this.lastActive = n; + this.settings.focusCleanup && !this.blockFocusCleanup && (this.settings.unhighlight && this.settings.unhighlight.call(this, n, this.settings.errorClass, this.settings.validClass), this.addWrapper(this.errorsFor(n)).hide()) + }, + onfocusout: function(n) { + !this.checkable(n) && (n.name in this.submitted || !this.optional(n)) && this.element(n) + }, + onkeyup: function(n, t) { + (9 !== t.which || "" !== this.elementValue(n)) && (n.name in this.submitted || n === this.lastElement) && this.element(n) + }, + onclick: function(n) { + n.name in this.submitted ? this.element(n) : n.parentNode.name in this.submitted && this.element(n.parentNode) + }, + highlight: function(t, i, r) { + "radio" === t.type ? this.findByName(t.name).addClass(i).removeClass(r) : n(t).addClass(i).removeClass(r) + }, + unhighlight: function(t, i, r) { + "radio" === t.type ? this.findByName(t.name).removeClass(i).addClass(r) : n(t).removeClass(i).addClass(r) + } + }, + setDefaults: function(t) { + n.extend(n.validator.defaults, t) + }, + messages: { + required: "This field is required.", + remote: "Please fix this field.", + email: "Please enter a valid email address.", + url: "Please enter a valid URL.", + date: "Please enter a valid date.", + dateISO: "Please enter a valid date (ISO).", + number: "Please enter a valid number.", + digits: "Please enter only digits.", + creditcard: "Please enter a valid credit card number.", + equalTo: "Please enter the same value again.", + maxlength: n.validator.format("Please enter no more than {0} characters."), + minlength: n.validator.format("Please enter at least {0} characters."), + rangelength: n.validator.format("Please enter a value between {0} and {1} characters long."), + range: n.validator.format("Please enter a value between {0} and {1}."), + max: n.validator.format("Please enter a value less than or equal to {0}."), + min: n.validator.format("Please enter a value greater than or equal to {0}.") + }, + autoCreateRanges: !1, + prototype: { + init: function() { + function i(t) { + var i = n.data(this[0].form, "validator"), + r = "on" + t.type.replace(/^validate/, ""); + i.settings[r] && i.settings[r].call(i, this[0], t) + } + var r, t; + this.labelContainer = n(this.settings.errorLabelContainer); + this.errorContext = this.labelContainer.length && this.labelContainer || n(this.currentForm); + this.containers = n(this.settings.errorContainer).add(this.settings.errorLabelContainer); + this.submitted = {}; + this.valueCache = {}; + this.pendingRequest = 0; + this.pending = {}; + this.invalid = {}; + this.reset(); + r = this.groups = {}; + n.each(this.settings.groups, function(t, i) { + "string" == typeof i && (i = i.split(/\s/)); + n.each(i, function(n, i) { + r[i] = t + }) + }); + t = this.settings.rules; + n.each(t, function(i, r) { + t[i] = n.validator.normalizeRule(r) + }); + n(this.currentForm).validateDelegate(":text, [type='password'], [type='file'], select, textarea, [type='number'], [type='search'] ,[type='tel'], [type='url'], [type='email'], [type='datetime'], [type='date'], [type='month'], [type='week'], [type='time'], [type='datetime-local'], [type='range'], [type='color'] ", "focusin focusout keyup", i).validateDelegate("[type='radio'], [type='checkbox'], select, option", "click", i); + this.settings.invalidHandler && n(this.currentForm).bind("invalid-form.validate", this.settings.invalidHandler) + }, + form: function() { + return this.checkForm(), n.extend(this.submitted, this.errorMap), this.invalid = n.extend({}, this.errorMap), this.valid() || n(this.currentForm).triggerHandler("invalid-form", [this]), this.showErrors(), this.valid() + }, + checkForm: function() { + this.prepareForm(); + for (var n = 0, t = this.currentElements = this.elements(); t[n]; n++) this.check(t[n]); + return this.valid() + }, + element: function(t) { + t = this.validationTargetFor(this.clean(t)); + this.lastElement = t; + this.prepareElement(t); + this.currentElements = n(t); + var i = this.check(t) !== !1; + return i ? delete this.invalid[t.name] : this.invalid[t.name] = !0, this.numberOfInvalids() || (this.toHide = this.toHide.add(this.containers)), this.showErrors(), i + }, + showErrors: function(t) { + if (t) { + n.extend(this.errorMap, t); + this.errorList = []; + for (var i in t) this.errorList.push({ + message: t[i], + element: this.findByName(i)[0] + }); + this.successList = n.grep(this.successList, function(n) { + return !(n.name in t) + }) + } + this.settings.showErrors ? this.settings.showErrors.call(this, this.errorMap, this.errorList) : this.defaultShowErrors() + }, + resetForm: function() { + n.fn.resetForm && n(this.currentForm).resetForm(); + this.submitted = {}; + this.lastElement = null; + this.prepareForm(); + this.hideErrors(); + this.elements().removeClass(this.settings.errorClass).removeData("previousValue") + }, + numberOfInvalids: function() { + return this.objectLength(this.invalid) + }, + objectLength: function(n) { + var t = 0; + for (var i in n) t++; + return t + }, + hideErrors: function() { + this.addWrapper(this.toHide).hide() + }, + valid: function() { + return 0 === this.size() + }, + size: function() { + return this.errorList.length + }, + focusInvalid: function() { + if (this.settings.focusInvalid) try { + n(this.findLastActive() || this.errorList.length && this.errorList[0].element || []).filter(":visible").focus().trigger("focusin") + } catch (t) {} + }, + findLastActive: function() { + var t = this.lastActive; + return t && 1 === n.grep(this.errorList, function(n) { + return n.element.name === t.name + }).length && t + }, + elements: function() { + var t = this, + i = {}; + return n(this.currentForm).find("input, select, textarea").not(":submit, :reset, :image, [disabled]").not(this.settings.ignore).filter(function() { + return !this.name && t.settings.debug && window.console && console.error("%o has no name assigned", this), this.name in i || !t.objectLength(n(this).rules()) ? !1 : (i[this.name] = !0, !0) + }) + }, + clean: function(t) { + return n(t)[0] + }, + errors: function() { + var t = this.settings.errorClass.replace(" ", "."); + return n(this.settings.errorElement + "." + t, this.errorContext) + }, + reset: function() { + this.successList = []; + this.errorList = []; + this.errorMap = {}; + this.toShow = n([]); + this.toHide = n([]); + this.currentElements = n([]) + }, + prepareForm: function() { + this.reset(); + this.toHide = this.errors().add(this.containers) + }, + prepareElement: function(n) { + this.reset(); + this.toHide = this.errorsFor(n) + }, + elementValue: function(t) { + var r = n(t).attr("type"), + i = n(t).val(); + return "radio" === r || "checkbox" === r ? n("input[name='" + n(t).attr("name") + "']:checked").val() : "string" == typeof i ? i.replace(/\r/g, "") : i + }, + check: function(t) { + var r, u; + t = this.validationTargetFor(this.clean(t)); + var i, f = n(t).rules(), + e = !1, + s = this.elementValue(t); + for (r in f) { + u = { + method: r, + parameters: f[r] + }; + try { + if (i = n.validator.methods[r].call(this, s, t, u.parameters), "dependency-mismatch" === i) { + e = !0; + continue + } + if (e = !1, "pending" === i) return this.toHide = this.toHide.not(this.errorsFor(t)), void 0; + if (!i) return this.formatAndAdd(t, u), !1 + } catch (o) { + throw this.settings.debug && window.console && console.log("Exception occurred when checking element " + t.id + ", check the '" + u.method + "' method.", o), o; + } + } + if (!e) return (this.objectLength(f) && this.successList.push(t), !0) + }, + customDataMessage: function(t, i) { + return n(t).data("msg-" + i.toLowerCase()) || t.attributes && n(t).attr("data-msg-" + i.toLowerCase()) + }, + customMessage: function(n, t) { + var i = this.settings.messages[n]; + return i && (i.constructor === String ? i : i[t]) + }, + findDefined: function() { + for (var n = 0; arguments.length > n; n++) + if (void 0 !== arguments[n]) return arguments[n]; + return void 0 + }, + defaultMessage: function(t, i) { + return this.findDefined(this.customMessage(t.name, i), this.customDataMessage(t, i), !this.settings.ignoreTitle && t.title || void 0, n.validator.messages[i], "<strong>Warning: No message defined for " + t.name + "<\/strong>") + }, + formatAndAdd: function(t, i) { + var r = this.defaultMessage(t, i.method), + u = /\$?\{(\d+)\}/g; + "function" == typeof r ? r = r.call(this, i.parameters, t) : u.test(r) && (r = n.validator.format(r.replace(u, "{$1}"), i.parameters)); + this.errorList.push({ + message: r, + element: t + }); + this.errorMap[t.name] = r; + this.submitted[t.name] = r + }, + addWrapper: function(n) { + return this.settings.wrapper && (n = n.add(n.parent(this.settings.wrapper))), n + }, + defaultShowErrors: function() { + for (var i, t, n = 0; this.errorList[n]; n++) t = this.errorList[n], this.settings.highlight && this.settings.highlight.call(this, t.element, this.settings.errorClass, this.settings.validClass), this.showLabel(t.element, t.message); + if (this.errorList.length && (this.toShow = this.toShow.add(this.containers)), this.settings.success) + for (n = 0; this.successList[n]; n++) this.showLabel(this.successList[n]); + if (this.settings.unhighlight) + for (n = 0, i = this.validElements(); i[n]; n++) this.settings.unhighlight.call(this, i[n], this.settings.errorClass, this.settings.validClass); + this.toHide = this.toHide.not(this.toShow); + this.hideErrors(); + this.addWrapper(this.toShow).show() + }, + validElements: function() { + return this.currentElements.not(this.invalidElements()) + }, + invalidElements: function() { + return n(this.errorList).map(function() { + return this.element + }) + }, + showLabel: function(t, i) { + var r = this.errorsFor(t); + r.length ? (r.removeClass(this.settings.validClass).addClass(this.settings.errorClass), r.html(i)) : (r = n("<" + this.settings.errorElement + ">").attr("for", this.idOrName(t)).addClass(this.settings.errorClass).html(i || ""), this.settings.wrapper && (r = r.hide().show().wrap("<" + this.settings.wrapper + "/>").parent()), this.labelContainer.append(r).length || (this.settings.errorPlacement ? this.settings.errorPlacement(r, n(t)) : r.insertAfter(t))); + !i && this.settings.success && (r.text(""), "string" == typeof this.settings.success ? r.addClass(this.settings.success) : this.settings.success(r, t)); + this.toShow = this.toShow.add(r) + }, + errorsFor: function(t) { + var i = this.idOrName(t); + return this.errors().filter(function() { + return n(this).attr("for") === i + }) + }, + idOrName: function(n) { + return this.groups[n.name] || (this.checkable(n) ? n.name : n.id || n.name) + }, + validationTargetFor: function(n) { + return this.checkable(n) && (n = this.findByName(n.name).not(this.settings.ignore)[0]), n + }, + checkable: function(n) { + return /radio|checkbox/i.test(n.type) + }, + findByName: function(t) { + return n(this.currentForm).find("[name='" + t + "']") + }, + getLength: function(t, i) { + switch (i.nodeName.toLowerCase()) { + case "select": + return n("option:selected", i).length; + case "input": + if (this.checkable(i)) return this.findByName(i.name).filter(":checked").length + } + return t.length + }, + depend: function(n, t) { + return this.dependTypes[typeof n] ? this.dependTypes[typeof n](n, t) : !0 + }, + dependTypes: { + boolean: function(n) { + return n + }, + string: function(t, i) { + return !!n(t, i.form).length + }, + "function": function(n, t) { + return n(t) + } + }, + optional: function(t) { + var i = this.elementValue(t); + return !n.validator.methods.required.call(this, i, t) && "dependency-mismatch" + }, + startRequest: function(n) { + this.pending[n.name] || (this.pendingRequest++, this.pending[n.name] = !0) + }, + stopRequest: function(t, i) { + this.pendingRequest--; + 0 > this.pendingRequest && (this.pendingRequest = 0); + delete this.pending[t.name]; + i && 0 === this.pendingRequest && this.formSubmitted && this.form() ? (n(this.currentForm).submit(), this.formSubmitted = !1) : !i && 0 === this.pendingRequest && this.formSubmitted && (n(this.currentForm).triggerHandler("invalid-form", [this]), this.formSubmitted = !1) + }, + previousValue: function(t) { + return n.data(t, "previousValue") || n.data(t, "previousValue", { + old: null, + valid: !0, + message: this.defaultMessage(t, "remote") + }) + } + }, + classRuleSettings: { + required: { + required: !0 + }, + email: { + email: !0 + }, + url: { + url: !0 + }, + date: { + date: !0 + }, + dateISO: { + dateISO: !0 + }, + number: { + number: !0 + }, + digits: { + digits: !0 + }, + creditcard: { + creditcard: !0 + } + }, + addClassRules: function(t, i) { + t.constructor === String ? this.classRuleSettings[t] = i : n.extend(this.classRuleSettings, t) + }, + classRules: function(t) { + var i = {}, + r = n(t).attr("class"); + return r && n.each(r.split(" "), function() { + this in n.validator.classRuleSettings && n.extend(i, n.validator.classRuleSettings[this]) + }), i + }, + attributeRules: function(t) { + var u = {}, + e = n(t), + f = e[0].getAttribute("type"), + r, i; + for (r in n.validator.methods) "required" === r ? (i = e.get(0).getAttribute(r), "" === i && (i = !0), i = !!i) : i = e.attr(r), /min|max/.test(r) && (null === f || /number|range|text/.test(f)) && (i = Number(i)), i ? u[r] = i : f === r && "range" !== f && (u[r] = !0); + return u.maxlength && /-1|2147483647|524288/.test(u.maxlength) && delete u.maxlength, u + }, + dataRules: function(t) { + var i, r, u = {}, + f = n(t); + for (i in n.validator.methods) r = f.data("rule-" + i.toLowerCase()), void 0 !== r && (u[i] = r); + return u + }, + staticRules: function(t) { + var i = {}, + r = n.data(t.form, "validator"); + return r.settings.rules && (i = n.validator.normalizeRule(r.settings.rules[t.name]) || {}), i + }, + normalizeRules: function(t, i) { + return n.each(t, function(r, u) { + if (u === !1) return delete t[r], void 0; + if (u.param || u.depends) { + var f = !0; + switch (typeof u.depends) { + case "string": + f = !!n(u.depends, i.form).length; + break; + case "function": + f = u.depends.call(i, i) + } + f ? t[r] = void 0 !== u.param ? u.param : !0 : delete t[r] + } + }), n.each(t, function(r, u) { + t[r] = n.isFunction(u) ? u(i) : u + }), n.each(["minlength", "maxlength"], function() { + t[this] && (t[this] = Number(t[this])) + }), n.each(["rangelength", "range"], function() { + var i; + t[this] && (n.isArray(t[this]) ? t[this] = [Number(t[this][0]), Number(t[this][1])] : "string" == typeof t[this] && (i = t[this].split(/[\s,]+/), t[this] = [Number(i[0]), Number(i[1])])) + }), n.validator.autoCreateRanges && (t.min && t.max && (t.range = [t.min, t.max], delete t.min, delete t.max), t.minlength && t.maxlength && (t.rangelength = [t.minlength, t.maxlength], delete t.minlength, delete t.maxlength)), t + }, + normalizeRule: function(t) { + if ("string" == typeof t) { + var i = {}; + n.each(t.split(/\s/), function() { + i[this] = !0 + }); + t = i + } + return t + }, + addMethod: function(t, i, r) { + n.validator.methods[t] = i; + n.validator.messages[t] = void 0 !== r ? r : n.validator.messages[t]; + 3 > i.length && n.validator.addClassRules(t, n.validator.normalizeRule(t)) + }, + methods: { + required: function(t, i, r) { + if (!this.depend(r, i)) return "dependency-mismatch"; + if ("select" === i.nodeName.toLowerCase()) { + var u = n(i).val(); + return u && u.length > 0 + } + return this.checkable(i) ? this.getLength(t, i) > 0 : n.trim(t).length > 0 + }, + email: function(n, t) { + return this.optional(t) || /^((([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+(\.([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+)*)|((\x22)((((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(([\x01-\x08\x0b\x0c\x0e-\x1f\x7f]|\x21|[\x23-\x5b]|[\x5d-\x7e]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(\\([\x01-\x09\x0b\x0c\x0d-\x7f]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]))))*(((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(\x22)))@((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))$/i.test(n) + }, + url: function(n, t) { + return this.optional(t) || /^(https?|s?ftp):\/\/(((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:)*@)?(((\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5]))|((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?)(:\d*)?)(\/((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)+(\/(([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)*)*)?)?(\?((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|[\uE000-\uF8FF]|\/|\?)*)?(#((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|\/|\?)*)?$/i.test(n) + }, + date: function(n, t) { + return this.optional(t) || !/Invalid|NaN/.test("" + new Date(n)) + }, + dateISO: function(n, t) { + return this.optional(t) || /^\d{4}[\/\-]\d{1,2}[\/\-]\d{1,2}$/.test(n) + }, + number: function(n, t) { + return this.optional(t) || /^-?(?:\d+|\d{1,3}(?:,\d{3})+)?(?:\.\d+)?$/.test(n) + }, + digits: function(n, t) { + return this.optional(t) || /^\d+$/.test(n) + }, + creditcard: function(n, t) { + var r, e; + if (this.optional(t)) return "dependency-mismatch"; + if (/[^0-9 \-]+/.test(n)) return !1; + var f = 0, + i = 0, + u = !1; + for (n = n.replace(/\D/g, ""), r = n.length - 1; r >= 0; r--) e = n.charAt(r), i = parseInt(e, 10), u && (i *= 2) > 9 && (i -= 9), f += i, u = !u; + return 0 == f % 10 + }, + minlength: function(t, i, r) { + var u = n.isArray(t) ? t.length : this.getLength(n.trim(t), i); + return this.optional(i) || u >= r + }, + maxlength: function(t, i, r) { + var u = n.isArray(t) ? t.length : this.getLength(n.trim(t), i); + return this.optional(i) || r >= u + }, + rangelength: function(t, i, r) { + var u = n.isArray(t) ? t.length : this.getLength(n.trim(t), i); + return this.optional(i) || u >= r[0] && r[1] >= u + }, + min: function(n, t, i) { + return this.optional(t) || n >= i + }, + max: function(n, t, i) { + return this.optional(t) || i >= n + }, + range: function(n, t, i) { + return this.optional(t) || n >= i[0] && i[1] >= n + }, + equalTo: function(t, i, r) { + var u = n(r); + return this.settings.onfocusout && u.unbind(".validate-equalTo").bind("blur.validate-equalTo", function() { + n(i).valid() + }), t === u.val() + }, + remote: function(t, i, r) { + var f, u, e; + return this.optional(i) ? "dependency-mismatch" : (f = this.previousValue(i), this.settings.messages[i.name] || (this.settings.messages[i.name] = {}), f.originalMessage = this.settings.messages[i.name].remote, this.settings.messages[i.name].remote = f.message, r = "string" == typeof r && { + url: r + } || r, f.old === t) ? f.valid : (f.old = t, u = this, this.startRequest(i), e = {}, e[i.name] = t, n.ajax(n.extend(!0, { + url: r, + mode: "abort", + port: "validate" + i.name, + dataType: "json", + data: e, + success: function(r) { + var e, h, s, o; + u.settings.messages[i.name].remote = f.originalMessage; + e = r === !0 || "true" === r; + e ? (h = u.formSubmitted, u.prepareElement(i), u.formSubmitted = h, u.successList.push(i), delete u.invalid[i.name], u.showErrors()) : (s = {}, o = r || u.defaultMessage(i, "remote"), s[i.name] = f.message = n.isFunction(o) ? o(t) : o, u.invalid[i.name] = !0, u.showErrors(s)); + f.valid = e; + u.stopRequest(i, e) + } + }, r)), "pending") + } + } + }); + n.format = n.validator.format +}(jQuery), +function(n) { + var t = {}, + i; + n.ajaxPrefilter ? n.ajaxPrefilter(function(n, i, r) { + var u = n.port; + "abort" === n.mode && (t[u] && t[u].abort(), t[u] = r) + }) : (i = n.ajax, n.ajax = function(r) { + var f = ("mode" in r ? r : n.ajaxSettings).mode, + u = ("port" in r ? r : n.ajaxSettings).port; + return "abort" === f ? (t[u] && t[u].abort(), t[u] = i.apply(this, arguments), t[u]) : i.apply(this, arguments) + }) +}(jQuery), +function(n) { + n.extend(n.fn, { + validateDelegate: function(t, i, r) { + return this.bind(i, function(i) { + var u = n(i.target); + if (u.is(t)) return r.apply(u, arguments) + }) + } + }) +}(jQuery), +function(n) { + function i(n, t, i) { + n.rules[t] = i; + n.message && (n.messages[t] = n.message) + } + + function h(n) { + return n.replace(/^\s+|\s+$/g, "").split(/\s*,\s*/g) + } + + function f(n) { + return n.replace(/([!"#$%&'()*+,./:;<=>?@\[\\\]^`{|}~])/g, "\\$1") + } + + function e(n) { + return n.substr(0, n.lastIndexOf(".") + 1) + } + + function o(n, t) { + return n.indexOf("*.") === 0 && (n = n.replace("*.", t)), n + } + + function c(t, i) { + var r = n(this).find("[data-valmsg-for='" + f(i[0].name) + "']"), + u = r.attr("data-valmsg-replace"), + e = u ? n.parseJSON(u) !== !1 : null; + r.removeClass("field-validation-valid").addClass("field-validation-error"); + t.data("unobtrusiveContainer", r); + e ? (r.empty(), t.removeClass("input-validation-error").appendTo(r)) : t.hide() + } + + function l(t, i) { + var u = n(this).find("[data-valmsg-summary=true]"), + r = u.find("ul"); + r && r.length && i.errorList.length && (r.empty(), u.addClass("validation-summary-errors").removeClass("validation-summary-valid"), n.each(i.errorList, function() { + n("<li />").html(this.message).appendTo(r) + })) + } + + function a(t) { + var i = t.data("unobtrusiveContainer"), + r = i.attr("data-valmsg-replace"), + u = r ? n.parseJSON(r) : null; + i && (i.addClass("field-validation-valid").removeClass("field-validation-error"), t.removeData("unobtrusiveContainer"), u && i.empty()) + } + + function v() { + var t = n(this); + t.data("validator").resetForm(); + t.find(".validation-summary-errors").addClass("validation-summary-valid").removeClass("validation-summary-errors"); + t.find(".field-validation-error").addClass("field-validation-valid").removeClass("field-validation-error").removeData("unobtrusiveContainer").find(">*").removeData("unobtrusiveContainer") + } + + function s(t) { + var i = n(t), + r = i.data(u), + f = n.proxy(v, t); + return r || (r = { + options: { + errorClass: "input-validation-error", + errorElement: "span", + errorPlacement: n.proxy(c, t), + invalidHandler: n.proxy(l, t), + messages: {}, + rules: {}, + success: n.proxy(a, t) + }, + attachValidation: function() { + i.unbind("reset." + u, f).bind("reset." + u, f).validate(this.options) + }, + validate: function() { + return i.validate(), i.valid() + } + }, i.data(u, r)), r + } + var r = n.validator, + t, u = "unobtrusiveValidation"; + r.unobtrusive = { + adapters: [], + parseElement: function(t, i) { + var u = n(t), + f = u.parents("form")[0], + r, e, o; + f && (r = s(f), r.options.rules[t.name] = e = {}, r.options.messages[t.name] = o = {}, n.each(this.adapters, function() { + var i = "data-val-" + this.name, + r = u.attr(i), + s = {}; + r !== undefined && (i += "-", n.each(this.params, function() { + s[this] = u.attr(i + this) + }), this.adapt({ + element: t, + form: f, + message: r, + params: s, + rules: e, + messages: o + })) + }), n.extend(e, { + __dummy__: !0 + }), i || r.attachValidation()) + }, + parse: function(t) { + var i = n(t).parents("form").andSelf().add(n(t).find("form")).filter("form"); + n(t).find(":input[data-val=true]").each(function() { + r.unobtrusive.parseElement(this, !0) + }); + i.each(function() { + var n = s(this); + n && n.attachValidation() + }) + } + }; + t = r.unobtrusive.adapters; + t.add = function(n, t, i) { + return i || (i = t, t = []), this.push({ + name: n, + params: t, + adapt: i + }), this + }; + t.addBool = function(n, t) { + return this.add(n, function(r) { + i(r, t || n, !0) + }) + }; + t.addMinMax = function(n, t, r, u, f, e) { + return this.add(n, [f || "min", e || "max"], function(n) { + var f = n.params.min, + e = n.params.max; + f && e ? i(n, u, [f, e]) : f ? i(n, t, f) : e && i(n, r, e) + }) + }; + t.addSingleVal = function(n, t, r) { + return this.add(n, [t || "val"], function(u) { + i(u, r || n, u.params[t]) + }) + }; + r.addMethod("__dummy__", function() { + return !0 + }); + r.addMethod("regex", function(n, t, i) { + var r; + return this.optional(t) ? !0 : (r = new RegExp(i).exec(n), r && r.index === 0 && r[0].length === n.length) + }); + r.addMethod("nonalphamin", function(n, t, i) { + var r; + return i && (r = n.match(/\W/g), r = r && r.length >= i), r + }); + t.addSingleVal("accept", "exts").addSingleVal("regex", "pattern"); + t.addBool("creditcard").addBool("date").addBool("digits").addBool("email").addBool("number").addBool("url"); + t.addMinMax("length", "minlength", "maxlength", "rangelength").addMinMax("range", "min", "max", "range"); + t.add("equalto", ["other"], function(t) { + var r = e(t.element.name), + u = t.params.other, + s = o(u, r), + h = n(t.form).find(":input[name='" + f(s) + "']")[0]; + i(t, "equalTo", h) + }); + t.add("required", function(n) { + (n.element.tagName.toUpperCase() !== "INPUT" || n.element.type.toUpperCase() !== "CHECKBOX") && i(n, "required", !0) + }); + t.add("remote", ["url", "type", "additionalfields"], function(t) { + var r = { + url: t.params.url, + type: t.params.type || "GET", + data: {} + }, + u = e(t.element.name); + n.each(h(t.params.additionalfields || t.element.name), function(i, e) { + var s = o(e, u); + r.data[s] = function() { + return n(t.form).find(":input[name='" + f(s) + "']").val() + } + }); + i(t, "remote", r) + }); + t.add("password", ["min", "nonalphamin", "regex"], function(n) { + n.params.min && i(n, "minlength", n.params.min); + n.params.nonalphamin && i(n, "nonalphamin", n.params.nonalphamin); + n.params.regex && i(n, "regex", n.params.regex) + }); + n(function() { + r.unobtrusive.parse(document) + }) +}(jQuery); +window.Modernizr = function(n, t, i) { + function a(n) { + c.cssText = n + } + + function vt(n, t) { + return a(y.join(n + ";") + (t || "")) + } + + function h(n, t) { + return typeof n === t + } + + function v(n, t) { + return !!~("" + n).indexOf(t) + } + + function lt(n, t) { + var u, r; + for (u in n) + if (r = n[u], !v(r, "-") && c[r] !== i) return t == "pfx" ? r : !0; + return !1 + } + + function yt(n, t, r) { + var f, u; + for (f in n) + if (u = t[n[f]], u !== i) return r === !1 ? n[f] : h(u, "function") ? u.bind(r || t) : u; + return !1 + } + + function f(n, t, i) { + var r = n.charAt(0).toUpperCase() + n.slice(1), + u = (n + " " + ot.join(r + " ") + r).split(" "); + return h(t, "string") || h(t, "undefined") ? lt(u, t) : (u = (n + " " + st.join(r + " ") + r).split(" "), yt(u, t, i)) + } + + function pt() { + u.input = function(i) { + for (var r = 0, u = i.length; r < u; r++) w[i[r]] = !!(i[r] in o); + return w.list && (w.list = !!(t.createElement("datalist") && n.HTMLDataListElement)), w + }("autocomplete autofocus list placeholder max min multiple pattern required step".split(" ")); + u.inputtypes = function(n) { + for (var u = 0, r, f, e, h = n.length; u < h; u++) o.setAttribute("type", f = n[u]), r = o.type !== "text", r && (o.value = g, o.style.cssText = "position:absolute;visibility:hidden;", /^range$/.test(f) && o.style.WebkitAppearance !== i ? (s.appendChild(o), e = t.defaultView, r = e.getComputedStyle && e.getComputedStyle(o, null).WebkitAppearance !== "textfield" && o.offsetHeight !== 0, s.removeChild(o)) : /^(search|tel)$/.test(f) || (r = /^(url|email)$/.test(f) ? o.checkValidity && o.checkValidity() === !1 : o.value != g)), ht[n[u]] = !!r; + return ht + }("search tel url email datetime date month week time datetime-local number range color".split(" ")) + } + var u = {}, + d = !0, + s = t.documentElement, + e = "modernizr", + ut = t.createElement(e), + c = ut.style, + o = t.createElement("input"), + g = ":)", + ft = {}.toString, + y = " -webkit- -moz- -o- -ms- ".split(" "), + et = "Webkit Moz O ms", + ot = et.split(" "), + st = et.toLowerCase().split(" "), + p = { + svg: "http://www.w3.org/2000/svg" + }, + r = {}, + ht = {}, + w = {}, + nt = [], + tt = nt.slice, + b, l = function(n, i, r, u) { + var l, a, c, v, f = t.createElement("div"), + h = t.body, + o = h || t.createElement("body"); + if (parseInt(r, 10)) + while (r--) c = t.createElement("div"), c.id = u ? u[r] : e + (r + 1), f.appendChild(c); + return l = ["­", '<style id="s', e, '">', n, "<\/style>"].join(""), f.id = e, (h ? f : o).innerHTML += l, o.appendChild(f), h || (o.style.background = "", o.style.overflow = "hidden", v = s.style.overflow, s.style.overflow = "hidden", s.appendChild(o)), a = i(f, n), h ? f.parentNode.removeChild(f) : (o.parentNode.removeChild(o), s.style.overflow = v), !!a + }, + at = function(t) { + var i = n.matchMedia || n.msMatchMedia, + r; + return i ? i(t).matches : (l("@media " + t + " { #" + e + " { position: absolute; } }", function(t) { + r = (n.getComputedStyle ? getComputedStyle(t, null) : t.currentStyle).position == "absolute" + }), r) + }, + ct = function() { + function r(r, u) { + u = u || t.createElement(n[r] || "div"); + r = "on" + r; + var f = r in u; + return f || (u.setAttribute || (u = t.createElement("div")), u.setAttribute && u.removeAttribute && (u.setAttribute(r, ""), f = h(u[r], "function"), h(u[r], "undefined") || (u[r] = i), u.removeAttribute(r))), u = null, f + } + var n = { + select: "input", + change: "input", + submit: "form", + reset: "form", + error: "img", + load: "img", + abort: "img" + }; + return r + }(), + it = {}.hasOwnProperty, + rt, k; + rt = h(it, "undefined") || h(it.call, "undefined") ? function(n, t) { + return t in n && h(n.constructor.prototype[t], "undefined") + } : function(n, t) { + return it.call(n, t) + }; + Function.prototype.bind || (Function.prototype.bind = function(n) { + var t = this, + i, r; + if (typeof t != "function") throw new TypeError; + return i = tt.call(arguments, 1), r = function() { + var f, e, u; + return this instanceof r ? (f = function() {}, f.prototype = t.prototype, e = new f, u = t.apply(e, i.concat(tt.call(arguments))), Object(u) === u) ? u : e : t.apply(n, i.concat(tt.call(arguments))) + }, r + }); + r.flexbox = function() { + return f("flexWrap") + }; + r.flexboxlegacy = function() { + return f("boxDirection") + }; + r.canvas = function() { + var n = t.createElement("canvas"); + return !!(n.getContext && n.getContext("2d")) + }; + r.canvastext = function() { + return !!(u.canvas && h(t.createElement("canvas").getContext("2d").fillText, "function")) + }; + r.webgl = function() { + return !!n.WebGLRenderingContext + }; + r.touch = function() { + var i; + return "ontouchstart" in n || n.DocumentTouch && t instanceof DocumentTouch ? i = !0 : l(["@media (", y.join("touch-enabled),("), e, ")", "{#modernizr{top:9px;position:absolute}}"].join(""), function(n) { + i = n.offsetTop === 9 + }), i + }; + r.geolocation = function() { + return "geolocation" in navigator + }; + r.postmessage = function() { + return !!n.postMessage + }; + r.websqldatabase = function() { + return !!n.openDatabase + }; + r.indexedDB = function() { + return !!f("indexedDB", n) + }; + r.hashchange = function() { + return ct("hashchange", n) && (t.documentMode === i || t.documentMode > 7) + }; + r.history = function() { + return !!(n.history && history.pushState) + }; + r.draganddrop = function() { + var n = t.createElement("div"); + return "draggable" in n || "ondragstart" in n && "ondrop" in n + }; + r.websockets = function() { + return "WebSocket" in n || "MozWebSocket" in n + }; + r.rgba = function() { + return a("background-color:rgba(150,255,150,.5)"), v(c.backgroundColor, "rgba") + }; + r.hsla = function() { + return a("background-color:hsla(120,40%,100%,.5)"), v(c.backgroundColor, "rgba") || v(c.backgroundColor, "hsla") + }; + r.multiplebgs = function() { + return a("background:url(https://),url(https://),red url(https://)"), /(url\s*\(.*?){3}/.test(c.background) + }; + r.backgroundsize = function() { + return f("backgroundSize") + }; + r.borderimage = function() { + return f("borderImage") + }; + r.borderradius = function() { + return f("borderRadius") + }; + r.boxshadow = function() { + return f("boxShadow") + }; + r.textshadow = function() { + return t.createElement("div").style.textShadow === "" + }; + r.opacity = function() { + return vt("opacity:.55"), /^0.55$/.test(c.opacity) + }; + r.cssanimations = function() { + return f("animationName") + }; + r.csscolumns = function() { + return f("columnCount") + }; + r.cssgradients = function() { + var n = "background-image:"; + return a((n + "-webkit- ".split(" ").join("gradient(linear,left top,right bottom,from(#9f9),to(white));" + n) + y.join("linear-gradient(left top,#9f9, white);" + n)).slice(0, -n.length)), v(c.backgroundImage, "gradient") + }; + r.cssreflections = function() { + return f("boxReflect") + }; + r.csstransforms = function() { + return !!f("transform") + }; + r.csstransforms3d = function() { + var n = !!f("perspective"); + return n && "webkitPerspective" in s.style && l("@media (transform-3d),(-webkit-transform-3d){#modernizr{left:9px;position:absolute;height:3px;}}", function(t) { + n = t.offsetLeft === 9 && t.offsetHeight === 3 + }), n + }; + r.csstransitions = function() { + return f("transition") + }; + r.fontface = function() { + var n; + return l('@font-face {font-family:"font";src:url("https://")}', function(i, r) { + var f = t.getElementById("smodernizr"), + u = f.sheet || f.styleSheet, + e = u ? u.cssRules && u.cssRules[0] ? u.cssRules[0].cssText : u.cssText || "" : ""; + n = /src/i.test(e) && e.indexOf(r.split(" ")[0]) === 0 + }), n + }; + r.generatedcontent = function() { + var n; + return l(["#", e, "{font:0/0 a}#", e, ':after{content:"', g, '";visibility:hidden;font:3px/1 a}'].join(""), function(t) { + n = t.offsetHeight >= 3 + }), n + }; + r.video = function() { + var i = t.createElement("video"), + n = !1; + try { + (n = !!i.canPlayType) && (n = new Boolean(n), n.ogg = i.canPlayType('video/ogg; codecs="theora"').replace(/^no$/, ""), n.h264 = i.canPlayType('video/mp4; codecs="avc1.42E01E"').replace(/^no$/, ""), n.webm = i.canPlayType('video/webm; codecs="vp8, vorbis"').replace(/^no$/, "")) + } catch (r) {} + return n + }; + r.audio = function() { + var i = t.createElement("audio"), + n = !1; + try { + (n = !!i.canPlayType) && (n = new Boolean(n), n.ogg = i.canPlayType('audio/ogg; codecs="vorbis"').replace(/^no$/, ""), n.mp3 = i.canPlayType("audio/mpeg;").replace(/^no$/, ""), n.wav = i.canPlayType('audio/wav; codecs="1"').replace(/^no$/, ""), n.m4a = (i.canPlayType("audio/x-m4a;") || i.canPlayType("audio/aac;")).replace(/^no$/, "")) + } catch (r) {} + return n + }; + r.localstorage = function() { + try { + return localStorage.setItem(e, e), localStorage.removeItem(e), !0 + } catch (n) { + return !1 + } + }; + r.sessionstorage = function() { + try { + return sessionStorage.setItem(e, e), sessionStorage.removeItem(e), !0 + } catch (n) { + return !1 + } + }; + r.webworkers = function() { + return !!n.Worker + }; + r.applicationcache = function() { + return !!n.applicationCache + }; + r.svg = function() { + return !!t.createElementNS && !!t.createElementNS(p.svg, "svg").createSVGRect + }; + r.inlinesvg = function() { + var n = t.createElement("div"); + return n.innerHTML = "<svg/>", (n.firstChild && n.firstChild.namespaceURI) == p.svg + }; + r.smil = function() { + return !!t.createElementNS && /SVGAnimate/.test(ft.call(t.createElementNS(p.svg, "animate"))) + }; + r.svgclippaths = function() { + return !!t.createElementNS && /SVGClipPath/.test(ft.call(t.createElementNS(p.svg, "clipPath"))) + }; + for (k in r) rt(r, k) && (b = k.toLowerCase(), u[b] = r[k](), nt.push((u[b] ? "" : "no-") + b)); + return u.input || pt(), u.addTest = function(n, t) { + if (typeof n == "object") + for (var r in n) rt(n, r) && u.addTest(r, n[r]); + else { + if (n = n.toLowerCase(), u[n] !== i) return u; + t = typeof t == "function" ? t() : t; + typeof d != "undefined" && d && (s.className += " " + (t ? "" : "no-") + n); + u[n] = t + } + return u + }, a(""), ut = o = null, + function(n, t) { + function p(n, t) { + var i = n.createElement("p"), + r = n.getElementsByTagName("head")[0] || n.documentElement; + return i.innerHTML = "x<style>" + t + "<\/style>", r.insertBefore(i.lastChild, r.firstChild) + } + + function c() { + var n = r.elements; + return typeof n == "string" ? n.split(" ") : n + } + + function o(n) { + var t = h[n[s]]; + return t || (t = {}, e++, n[s] = e, h[e] = t), t + } + + function l(n, r, u) { + if (r || (r = t), i) return r.createElement(n); + u || (u = o(r)); + var f; + return f = u.cache[n] ? u.cache[n].cloneNode() : y.test(n) ? (u.cache[n] = u.createElem(n)).cloneNode() : u.createElem(n), f.canHaveChildren && !v.test(n) ? u.frag.appendChild(f) : f + } + + function w(n, r) { + if (n || (n = t), i) return n.createDocumentFragment(); + r = r || o(n); + for (var f = r.frag.cloneNode(), u = 0, e = c(), s = e.length; u < s; u++) f.createElement(e[u]); + return f + } + + function b(n, t) { + t.cache || (t.cache = {}, t.createElem = n.createElement, t.createFrag = n.createDocumentFragment, t.frag = t.createFrag()); + n.createElement = function(i) { + return r.shivMethods ? l(i, n, t) : t.createElem(i) + }; + n.createDocumentFragment = Function("h,f", "return function(){var n=f.cloneNode(),c=n.createElement;h.shivMethods&&(" + c().join().replace(/\w+/g, function(n) { + return t.createElem(n), t.frag.createElement(n), 'c("' + n + '")' + }) + ");return n}")(r, t.frag) + } + + function a(n) { + n || (n = t); + var u = o(n); + return !r.shivCSS || f || u.hasCSS || (u.hasCSS = !!p(n, "article,aside,figcaption,figure,footer,header,hgroup,nav,section{display:block}mark{background:#FF0;color:#000}")), i || b(n, u), n + } + var u = n.html5 || {}, + v = /^<|^(?:button|map|select|textarea|object|iframe|option|optgroup)$/i, + y = /^(?:a|b|code|div|fieldset|h1|h2|h3|h4|h5|h6|i|label|li|ol|p|q|span|strong|style|table|tbody|td|th|tr|ul)$/i, + f, s = "_html5shiv", + e = 0, + h = {}, + i, r; + (function() { + try { + var n = t.createElement("a"); + n.innerHTML = "<xyz><\/xyz>"; + f = "hidden" in n; + i = n.childNodes.length == 1 || function() { + t.createElement("a"); + var n = t.createDocumentFragment(); + return typeof n.cloneNode == "undefined" || typeof n.createDocumentFragment == "undefined" || typeof n.createElement == "undefined" + }() + } catch (r) { + f = !0; + i = !0 + } + })(); + r = { + elements: u.elements || "abbr article aside audio bdi canvas data datalist details figcaption figure footer header hgroup mark meter nav output progress section summary time video", + shivCSS: u.shivCSS !== !1, + supportsUnknownElements: i, + shivMethods: u.shivMethods !== !1, + type: "default", + shivDocument: a, + createElement: l, + createDocumentFragment: w + }; + n.html5 = r; + a(t) + }(this, t), u._version = "2.6.2", u._prefixes = y, u._domPrefixes = st, u._cssomPrefixes = ot, u.mq = at, u.hasEvent = ct, u.testProp = function(n) { + return lt([n]) + }, u.testAllProps = f, u.testStyles = l, u.prefixed = function(n, t, i) { + return t ? f(n, t, i) : f(n, "pfx") + }, s.className = s.className.replace(/(^|\s)no-js(\s|$)/, "$1$2") + (d ? " js " + nt.join(" ") : ""), u + }(this, this.document), + function(n, t, i) { + function l(n) { + var t = {}, + r = /^jQuery\d+$/; + return i.each(n.attributes, function(n, i) { + i.specified && !r.test(i.name) && (t[i.name] = i.value) + }), t + } + + function f(n, r) { + var f = this, + u = i(f); + if (f.value == u.attr("placeholder") && u.hasClass("placeholder")) + if (u.data("placeholder-password")) { + if (u = u.hide().next().show().attr("id", u.removeAttr("id").data("placeholder-id")), n === !0) return u[0].value = r; + u.focus() + } else f.value = "", u.removeClass("placeholder"), f == t.activeElement && f.select() + } + + function s() { + var t, r = this, + n = i(r), + e = n, + u = this.id; + if (r.value == "") { + if (r.type == "password") { + if (!n.data("placeholder-textinput")) { + try { + t = n.clone().attr({ + type: "text" + }) + } catch (o) { + t = i("<input>").attr(i.extend(l(this), { + type: "text" + })) + } + t.removeAttr("name").data({ + "placeholder-password": !0, + "placeholder-id": u + }).bind("focus.placeholder", f); + n.data({ + "placeholder-textinput": t, + "placeholder-id": u + }).before(t) + } + n = n.removeAttr("id").hide().prev().attr("id", u).show() + } + n.addClass("placeholder"); + n[0].value = n.attr("placeholder") + } else n.removeClass("placeholder") + } + var u = "placeholder" in t.createElement("input"), + e = "placeholder" in t.createElement("textarea"), + h = i.fn, + c = i.valHooks, + o, r; + u && e ? (r = h.placeholder = function() { + return this + }, r.input = r.textarea = !0) : (r = h.placeholder = function() { + var n = this; + return n.filter((u ? "textarea" : ":input") + "[placeholder]").not(".placeholder").bind({ + "focus.placeholder": f, + "blur.placeholder": s + }).data("placeholder-enabled", !0).trigger("blur.placeholder"), n + }, r.input = u, r.textarea = e, o = { + get: function(n) { + var t = i(n); + return t.data("placeholder-enabled") && t.hasClass("placeholder") ? "" : n.value + }, + set: function(n, r) { + var u = i(n); + return u.data("placeholder-enabled") ? (r == "" ? (n.value = r, n != t.activeElement && s.call(n)) : u.hasClass("placeholder") ? f.call(n, !0, r) || (n.value = r) : n.value = r, u) : n.value = r + } + }, u || (c.input = o), e || (c.textarea = o), i(function() { + i(t).delegate("form", "submit.placeholder", function() { + var n = i(".placeholder", this).each(f); + setTimeout(function() { + n.each(s) + }, 10) + }) + }), i(n).bind("beforeunload.placeholder", function() { + i(".placeholder").each(function() { + this.value = "" + }) + })) + }(this, document, jQuery), + function(n) { + "function" == typeof define && define.amd ? define(["jquery"], n) : n(jQuery) + }(function(n) { + function r(n) { + return n + } + + function u(n) { + return decodeURIComponent(n.replace(f, " ")) + } + + function i(n) { + 0 === n.indexOf('"') && (n = n.slice(1, -1).replace(/\\"/g, '"').replace(/\\\\/g, "\\")); + try { + return t.json ? JSON.parse(n) : n + } catch (i) {} + } + var f = /\+/g, + t = n.cookie = function(f, e, o) { + var l, s; + if (void 0 !== e) return (o = n.extend({}, t.defaults, o), "number" == typeof o.expires) && (l = o.expires, s = o.expires = new Date, s.setDate(s.getDate() + l)), e = t.json ? JSON.stringify(e) : e + "", document.cookie = [t.raw ? f : encodeURIComponent(f), "=", t.raw ? e : encodeURIComponent(e), o.expires ? "; expires=" + o.expires.toUTCString() : "", o.path ? "; path=" + o.path : "", o.domain ? "; domain=" + o.domain : "", o.secure ? "; secure" : ""].join(""); + for (var a = t.raw ? r : u, v = document.cookie.split("; "), h = f ? void 0 : {}, c = 0, b = v.length; b > c; c++) { + var y = v[c].split("="), + p = a(y.shift()), + w = a(y.join("=")); + if (f && f === p) { + h = i(w); + break + } + f || (h[p] = i(w)) + } + return h + }; + t.defaults = {}; + n.removeCookie = function(t, i) { + return void 0 !== n.cookie(t) ? (n.cookie(t, "", n.extend(i, { + expires: -1 + })), !0) : !1 + } + }); +typeof JSON != "object" && (JSON = {}), + function() { + "use strict"; + + function i(n) { + return n < 10 ? "0" + n : n + } + + function o(n) { + return e.lastIndex = 0, e.test(n) ? '"' + n.replace(e, function(n) { + var t = s[n]; + return typeof t == "string" ? t : "\\u" + ("0000" + n.charCodeAt(0).toString(16)).slice(-4) + }) + '"' : '"' + n + '"' + } + + function u(i, f) { + var s, l, h, a, v = n, + c, e = f[i]; + e && typeof e == "object" && typeof e.toJSON == "function" && (e = e.toJSON(i)); + typeof t == "function" && (e = t.call(f, i, e)); + switch (typeof e) { + case "string": + return o(e); + case "number": + return isFinite(e) ? String(e) : "null"; + case "boolean": + case "null": + return String(e); + case "object": + if (!e) return "null"; + if (n += r, c = [], Object.prototype.toString.apply(e) === "[object Array]") { + for (a = e.length, s = 0; s < a; s += 1) c[s] = u(s, e) || "null"; + return h = c.length === 0 ? "[]" : n ? "[\n" + n + c.join(",\n" + n) + "\n" + v + "]" : "[" + c.join(",") + "]", n = v, h + } + if (t && typeof t == "object") + for (a = t.length, s = 0; s < a; s += 1) typeof t[s] == "string" && (l = t[s], h = u(l, e), h && c.push(o(l) + (n ? ": " : ":") + h)); + else + for (l in e) Object.prototype.hasOwnProperty.call(e, l) && (h = u(l, e), h && c.push(o(l) + (n ? ": " : ":") + h)); + return h = c.length === 0 ? "{}" : n ? "{\n" + n + c.join(",\n" + n) + "\n" + v + "}" : "{" + c.join(",") + "}", n = v, h + } + } + typeof Date.prototype.toJSON != "function" && (Date.prototype.toJSON = function() { + return isFinite(this.valueOf()) ? this.getUTCFullYear() + "-" + i(this.getUTCMonth() + 1) + "-" + i(this.getUTCDate()) + "T" + i(this.getUTCHours()) + ":" + i(this.getUTCMinutes()) + ":" + i(this.getUTCSeconds()) + "Z" : null + }, String.prototype.toJSON = Number.prototype.toJSON = Boolean.prototype.toJSON = function() { + return this.valueOf() + }); + var f = /[\u0000\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g, + e = /[\\\"\x00-\x1f\x7f-\x9f\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g, + n, r, s = { + "\b": "\\b", + "\t": "\\t", + "\n": "\\n", + "\f": "\\f", + "\r": "\\r", + '"': '\\"', + "\\": "\\\\" + }, + t; + typeof JSON.stringify != "function" && (JSON.stringify = function(i, f, e) { + var o; + if (n = "", r = "", typeof e == "number") + for (o = 0; o < e; o += 1) r += " "; + else typeof e == "string" && (r = e); + if (t = f, f && typeof f != "function" && (typeof f != "object" || typeof f.length != "number")) throw new Error("JSON.stringify"); + return u("", { + "": i + }) + }); + typeof JSON.parse != "function" && (JSON.parse = function(text, reviver) { + function walk(n, t) { + var r, u, i = n[t]; + if (i && typeof i == "object") + for (r in i) Object.prototype.hasOwnProperty.call(i, r) && (u = walk(i, r), u !== undefined ? i[r] = u : delete i[r]); + return reviver.call(n, t, i) + } + var j; + if (text = String(text), f.lastIndex = 0, f.test(text) && (text = text.replace(f, function(n) { + return "\\u" + ("0000" + n.charCodeAt(0).toString(16)).slice(-4) + })), /^[\],:{}\s]*$/.test(text.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, "@").replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, "]").replace(/(?:^|:|,)(?:\s*\[)+/g, ""))) return j = eval("(" + text + ")"), typeof reviver == "function" ? walk({ + "": j + }, "") : j; + throw new SyntaxError("JSON.parse"); + }) + }(), + function() { + function ut() { + var u = !1, + n; + if ("localStorage" in window) try { + window.localStorage.setItem("_tmptest", "tmpval"); + u = !0; + window.localStorage.removeItem("_tmptest") + } catch (f) {} + if (u) try { + window.localStorage && (i = window.localStorage, r = "localStorage", s = i.jStorage_update) + } catch (e) {} else if ("globalStorage" in window) try { + window.globalStorage && (i = window.globalStorage[window.location.hostname], r = "globalStorage", s = i.jStorage_update) + } catch (o) {} else if (t = document.createElement("link"), t.addBehavior) { + t.style.behavior = "url(#default#userData)"; + document.getElementsByTagName("head")[0].appendChild(t); + try { + t.load("jStorage") + } catch (h) { + t.setAttribute("jStorage", "{}"); + t.save("jStorage"); + t.load("jStorage") + } + n = "{}"; + try { + n = t.getAttribute("jStorage") + } catch (c) {} + try { + s = t.getAttribute("jStorage_update") + } catch (a) {} + i.jStorage = n; + r = "userDataBehavior" + } else { + t = null; + return + } + it(); + p(); + y("local"); + y("session"); + ft(); + rt(); + "addEventListener" in window && window.addEventListener("pageshow", function(n) { + n.persisted && l() + }, !1) + } + + function y(t, i) { + function l() { + if (t == "session") try { + o = u.parse(window.name || "{}") + } catch (n) { + o = {} + } + } + + function a() { + t == "session" && (window.name = u.stringify(o)) + } + var c = !1, + s = 0, + h, f, o = {}, + v = Math.random(); + if (i || typeof window[t + "Storage"] == "undefined") { + if (t == "local" && window.globalStorage) { + localStorage = window.globalStorage[window.location.hostname]; + return + } + if (r == "userDataBehavior") { + i && window[t + "Storage"] && window[t + "Storage"].parentNode && window[t + "Storage"].parentNode.removeChild(window[t + "Storage"]); + f = document.createElement("button"); + document.getElementsByTagName("head")[0].appendChild(f); + t == "local" ? o = n : t == "session" && l(); + for (h in o) o.hasOwnProperty(h) && h != "__jstorage_meta" && h != "length" && typeof o[h] != "undefined" && (h in f || s++, f[h] = o[h]); + f.length = s; + f.key = function(n) { + var i = 0, + t; + l(); + for (t in o) + if (o.hasOwnProperty(t) && t != "__jstorage_meta" && t != "length" && typeof o[t] != "undefined") { + if (i == n) return t; + i++ + } + }; + f.getItem = function(n) { + return (l(), t == "session") ? o[n] : e.jStorage.get(n) + }; + f.setItem = function(n, t) { + typeof t != "undefined" && (f[n] = (t || "").toString()) + }; + f.removeItem = function(n) { + if (t == "local") return e.jStorage.deleteKey(n); + f[n] = undefined; + c = !0; + n in f && f.removeAttribute(n); + c = !1 + }; + f.clear = function() { + if (t == "session") { + window.name = ""; + y("session", !0); + return + } + e.jStorage.flush() + }; + t == "local" && (d = function(n, t) { + n != "length" && (c = !0, typeof t == "undefined" ? n in f && (s--, f.removeAttribute(n)) : (n in f || s++, f[n] = (t || "").toString()), f.length = s, c = !1) + }); + f.attachEvent("onpropertychange", function(n) { + if (n.propertyName != "length" && !c && n.propertyName != "length") { + if (t == "local") n.propertyName in o || typeof f[n.propertyName] == "undefined" || s++; + else if (t == "session") { + l(); + typeof f[n.propertyName] == "undefined" || n.propertyName in o ? typeof f[n.propertyName] == "undefined" && n.propertyName in o ? (delete o[n.propertyName], s--) : o[n.propertyName] = f[n.propertyName] : (o[n.propertyName] = f[n.propertyName], s++); + a(); + f.length = s; + return + } + e.jStorage.set(n.propertyName, f[n.propertyName]); + f.length = s + } + }); + window[t + "Storage"] = f + } + } + } + + function tt() { + var n = "{}"; + if (r == "userDataBehavior") { + t.load("jStorage"); + try { + n = t.getAttribute("jStorage") + } catch (u) {} + try { + s = t.getAttribute("jStorage_update") + } catch (f) {} + i.jStorage = n + } + it(); + p(); + rt() + } + + function ft() { + r == "localStorage" || r == "globalStorage" ? "addEventListener" in window ? window.addEventListener("storage", l, !1) : document.attachEvent("onstorage", l) : r == "userDataBehavior" && setInterval(l, 1e3) + } + + function l() { + var n; + clearTimeout(g); + g = setTimeout(function() { + if (r == "localStorage" || r == "globalStorage") n = i.jStorage_update; + else if (r == "userDataBehavior") { + t.load("jStorage"); + try { + n = t.getAttribute("jStorage_update") + } catch (u) {} + } + n && n != s && (s = n, et()) + }, 25) + } + + function et() { + var i = u.parse(u.stringify(n.__jstorage_meta.CRC32)), + r, t, f, e; + tt(); + r = u.parse(u.stringify(n.__jstorage_meta.CRC32)); + f = []; + e = []; + for (t in i) + if (i.hasOwnProperty(t)) { + if (!r[t]) { + e.push(t); + continue + } + i[t] != r[t] && String(i[t]).substr(0, 2) == "2." && f.push(t) + } + for (t in r) r.hasOwnProperty(t) && (i[t] || f.push(t)); + c(f, "updated"); + c(e, "deleted") + } + + function c(n, t) { + var u, i, e, r, o; + if (n = [].concat(n || []), t == "flushed") { + n = []; + for (u in f) f.hasOwnProperty(u) && n.push(u); + t = "deleted" + } + for (i = 0, e = n.length; i < e; i++) + if (f[n[i]]) + for (r = 0, o = f[n[i]].length; r < o; r++) f[n[i]][r](n[i], t) + } + + function a() { + var n = (+new Date).toString(); + r == "localStorage" || r == "globalStorage" ? i.jStorage_update = n : r == "userDataBehavior" && (t.setAttribute("jStorage_update", n), t.save("jStorage")); + l() + } + + function it() { + if (i.jStorage) try { + n = u.parse(String(i.jStorage)) + } catch (t) { + i.jStorage = "{}" + } else i.jStorage = "{}"; + w = i.jStorage ? String(i.jStorage).length : 0; + n.__jstorage_meta || (n.__jstorage_meta = {}); + n.__jstorage_meta.CRC32 || (n.__jstorage_meta.CRC32 = {}) + } + + function v() { + st(); + try { + i.jStorage = u.stringify(n); + t && (t.setAttribute("jStorage", i.jStorage), t.save("jStorage")); + w = i.jStorage ? String(i.jStorage).length : 0 + } catch (r) {} + } + + function o(n) { + if (!n || typeof n != "string" && typeof n != "number") throw new TypeError("Key name must be string or numeric"); + if (n == "__jstorage_meta") throw new TypeError("Reserved key name"); + return !0 + } + + function p() { + var u, t, i, f, r = Infinity, + e = !1, + o = []; + if (clearTimeout(nt), n.__jstorage_meta && typeof n.__jstorage_meta.TTL == "object") { + u = +new Date; + i = n.__jstorage_meta.TTL; + f = n.__jstorage_meta.CRC32; + for (t in i) i.hasOwnProperty(t) && (i[t] <= u ? (delete i[t], delete f[t], delete n[t], e = !0, o.push(t)) : i[t] < r && (r = i[t])); + r != Infinity && (nt = setTimeout(p, r - u)); + e && (v(), a(), c(o, "deleted")) + } + } + + function rt() { + var t, r, i; + if (n.__jstorage_meta.PubSub) { + for (r = b, i = len = n.__jstorage_meta.PubSub.length - 1; i >= 0; i--) t = n.__jstorage_meta.PubSub[i], t[0] > b && (r = t[0], ot(t[1], t[2])); + b = r + } + } + + function ot(n, t) { + if (h[n]) + for (var i = 0, r = h[n].length; i < r; i++) h[n][i](n, u.parse(u.stringify(t))) + } + + function st() { + var i, t, r; + if (n.__jstorage_meta.PubSub) { + for (i = +new Date - 2e3, t = 0, r = n.__jstorage_meta.PubSub.length; t < r; t++) + if (n.__jstorage_meta.PubSub[t][0] <= i) { + n.__jstorage_meta.PubSub.splice(t, n.__jstorage_meta.PubSub.length - t); + break + } + n.__jstorage_meta.PubSub.length || delete n.__jstorage_meta.PubSub + } + } + + function ht(t, i) { + n.__jstorage_meta || (n.__jstorage_meta = {}); + n.__jstorage_meta.PubSub || (n.__jstorage_meta.PubSub = []); + n.__jstorage_meta.PubSub.unshift([+new Date, t, i]); + v(); + a() + } + + function ct(n, t) { + for (var f = n.length, i = t ^ f, u = 0, r; f >= 4;) r = n.charCodeAt(u) & 255 | (n.charCodeAt(++u) & 255) << 8 | (n.charCodeAt(++u) & 255) << 16 | (n.charCodeAt(++u) & 255) << 24, r = (r & 65535) * 1540483477 + (((r >>> 16) * 1540483477 & 65535) << 16), r ^= r >>> 24, r = (r & 65535) * 1540483477 + (((r >>> 16) * 1540483477 & 65535) << 16), i = (i & 65535) * 1540483477 + (((i >>> 16) * 1540483477 & 65535) << 16) ^ r, f -= 4, ++u; + switch (f) { + case 3: + i ^= (n.charCodeAt(u + 2) & 255) << 16; + case 2: + i ^= (n.charCodeAt(u + 1) & 255) << 8; + case 1: + i ^= n.charCodeAt(u) & 255; + i = (i & 65535) * 1540483477 + (((i >>> 16) * 1540483477 & 65535) << 16) + } + return i ^= i >>> 13, i = (i & 65535) * 1540483477 + (((i >>> 16) * 1540483477 & 65535) << 16), i ^= i >>> 15, i >>> 0 + } + var e = window.jQuery || window.$ || (window.$ = {}), + u = { + parse: window.JSON && (window.JSON.parse || window.JSON.decode) || String.prototype.evalJSON && function(n) { + return String(n).evalJSON() + } || e.parseJSON || e.evalJSON, + stringify: Object.toJSON || window.JSON && (window.JSON.stringify || window.JSON.encode) || e.toJSON + }; + if (!u.parse || !u.stringify) throw new Error("No JSON support found, include //cdnjs.cloudflare.com/ajax/libs/json2/20110223/json2.js to page"); + var n = {}, + i = { + jStorage: "{}" + }, + t = null, + w = 0, + r = !1, + f = {}, + g = !1, + s = 0, + h = {}, + b = +new Date, + nt, k = { + isXML: function(n) { + var t = (n ? n.ownerDocument || n : 0).documentElement; + return t ? t.nodeName !== "HTML" : !1 + }, + encode: function(n) { + if (!this.isXML(n)) return !1; + try { + return (new XMLSerializer).serializeToString(n) + } catch (t) { + try { + return n.xml + } catch (i) {} + } + return !1 + }, + decode: function(n) { + var i = "DOMParser" in window && (new DOMParser).parseFromString || window.ActiveXObject && function(n) { + var t = new ActiveXObject("Microsoft.XMLDOM"); + return t.async = "false", t.loadXML(n), t + }, + t; + return i ? (t = i.call("DOMParser" in window && new DOMParser || window, n, "text/xml"), this.isXML(t) ? t : !1) : !1 + } + }, + d = function() {}; + e.jStorage = { + version: "0.3.1", + set: function(t, i, r) { + if (o(t), r = r || {}, typeof i == "undefined") return this.deleteKey(t), i; + if (k.isXML(i)) i = { + _is_xml: !0, + xml: k.encode(i) + }; + else { + if (typeof i == "function") return undefined; + i && typeof i == "object" && (i = u.parse(u.stringify(i))) + } + return n[t] = i, n.__jstorage_meta.CRC32[t] = "2." + ct(u.stringify(i)), this.setTTL(t, r.TTL || 0), d(t, i), c(t, "updated"), i + }, + get: function(t, i) { + return (o(t), t in n) ? n[t] && typeof n[t] == "object" && n[t]._is_xml ? k.decode(n[t].xml) : n[t] : typeof i == "undefined" ? null : i + }, + deleteKey: function(t) { + return (o(t), t in n) ? (delete n[t], typeof n.__jstorage_meta.TTL == "object" && t in n.__jstorage_meta.TTL && delete n.__jstorage_meta.TTL[t], delete n.__jstorage_meta.CRC32[t], d(t, undefined), v(), a(), c(t, "deleted"), !0) : !1 + }, + setTTL: function(t, i) { + var r = +new Date; + return (o(t), i = Number(i) || 0, t in n) ? (n.__jstorage_meta.TTL || (n.__jstorage_meta.TTL = {}), i > 0 ? n.__jstorage_meta.TTL[t] = r + i : delete n.__jstorage_meta.TTL[t], v(), p(), a(), !0) : !1 + }, + getTTL: function(t) { + var r = +new Date, + i; + return (o(t), t in n && n.__jstorage_meta.TTL && n.__jstorage_meta.TTL[t]) ? (i = n.__jstorage_meta.TTL[t] - r, i || 0) : 0 + }, + flush: function() { + return n = { + __jstorage_meta: { + CRC32: {} + } + }, y("local", !0), v(), a(), c(null, "flushed"), !0 + }, + storageObj: function() { + function t() {} + return t.prototype = n, new t + }, + index: function() { + var i = []; + for (var t in n) n.hasOwnProperty(t) && t != "__jstorage_meta" && i.push(t); + return i + }, + storageSize: function() { + return w + }, + currentBackend: function() { + return r + }, + storageAvailable: function() { + return !!r + }, + listenKeyChange: function(n, t) { + o(n); + f[n] || (f[n] = []); + f[n].push(t) + }, + stopListening: function(n, t) { + if (o(n), f[n]) { + if (!t) { + delete f[n]; + return + } + for (var i = f[n].length - 1; i >= 0; i--) f[n][i] == t && f[n].splice(i, 1) + } + }, + subscribe: function(n, t) { + if (n = (n || "").toString(), !n) throw new TypeError("Channel not defined"); + h[n] || (h[n] = []); + h[n].push(t) + }, + publish: function(n, t) { + if (n = (n || "").toString(), !n) throw new TypeError("Channel not defined"); + ht(n, t) + }, + reInit: function() { + tt() + } + }; + ut() + }(), + function(n, t) { + function ut() {} + + function bi(n, t) { + if (t) return "'" + n.split("'").join("\\'").split('\\"').join('\\\\\\"').replace(/\n/g, "\\n").replace(/\r/g, "\\r").replace(/\t/g, "\\t") + "'"; + var i = n.charAt(0), + r = n.substring(1); + return i === "=" ? "+(" + r + ")+" : i === ":" ? "+e(" + r + ")+" : ";" + n + ";o+=" + } + + function e(n, t, i) { + return (n = n + "", t = t || 2, i = t - n.length, i) ? rr[t].substring(0, i) + n : n + } + + function ur(t, u) { + var c = r.browser, + o, g = t.css("direction") == "rtl", + e, v; + if (t.parent().hasClass("k-animation-container")) e = t.parent(".k-animation-container"), v = e[0].style, e.is(":hidden") && e.show(), o = tt.test(v.width) || tt.test(v.height), o || e.css({ + width: t.outerWidth(), + height: t.outerHeight(), + boxSizing: "content-box", + mozBoxSizing: "content-box", + webkitBoxSizing: "content-box" + }); + else { + var y = t.css(i.support.transitions.css + "box-shadow") || t.css("box-shadow"), + f = y ? y.match(vi) || [0, 0, 0, 0, 0] : [0, 0, 0, 0, 0], + l = p.max(+f[3], +(f[4] || 0)), + a = -f[1] + l, + w = +f[1] + l, + b = +f[2] + l, + s = t[0].style.width, + h = t[0].style.height, + k = tt.test(s), + d = tt.test(h); + c.opera && (a = w = b = 5); + o = k || d; + !k && (!u || u && s) && (s = t.outerWidth()); + !d && (!u || u && h) && (h = t.outerHeight()); + t.wrap(n("<div/>").addClass("k-animation-container").css({ + width: s, + height: h, + marginLeft: a * (g ? 1 : -1), + paddingLeft: a, + paddingRight: w, + paddingBottom: b + })); + o && t.css({ + width: "100%", + height: "100%", + boxSizing: "border-box", + mozBoxSizing: "border-box", + webkitBoxSizing: "border-box" + }) + } + return c.msie && p.floor(c.version) <= 7 && (t.css({ + zoom: 1 + }), t.children(".k-menu").width(t.width())), t.parent() + } + + function kt(n) { + for (var t = 1, i = arguments.length, t = 1; t < i; t++) dt(n, arguments[t]); + return n + } + + function dt(n, t) { + var o = i.data.ObservableArray, + s = i.data.DataSource, + u, r, f, e; + for (u in t) r = t[u], f = typeof r, f === a && r !== null && r.constructor !== Array && r.constructor !== o && r.constructor !== s ? r instanceof Date ? n[u] = new Date(r.getTime()) : ft(r.clone) ? n[u] = r.clone() : (e = n[u], n[u] = typeof e === a ? e || {} : {}, dt(n[u], r)) : f !== rt && (n[u] = r); + return n + } + + function ct(n, i, r) { + for (var u in i) + if (i.hasOwnProperty(u) && i[u].test(n)) return u; + return r !== t ? r : n + } + + function fr(n) { + return n.replace(/([a-z][A-Z])/g, function(n) { + return n.charAt(0) + "-" + n.charAt(1).toLowerCase() + }) + } + + function gt(n) { + return n.replace(/\-(\w)/g, function(n, t) { + return t.toUpperCase() + }) + } + + function er(t, r) { + var u = {}, + f; + return document.defaultView && document.defaultView.getComputedStyle ? (f = document.defaultView.getComputedStyle(t, ""), r && n.each(r, function(n, t) { + u[t] = f.getPropertyValue(t) + })) : (f = t.currentStyle, r && n.each(r, function(n, t) { + u[t] = f[gt(t)] + })), i.size(u) || (u = f), u + } + + function or(n) { + var t = 0; + for (var i in n) n.hasOwnProperty(i) && i != "toJSON" && t++; + return t + } + + function sr(n, t, i) { + var u, f, e, o; + return (t || (t = "offset"), u = n[t](), f = r.mobileOS, r.touch && f.ios && f.flatVersion < 410 && (e = t == "offset" ? u : n.offset(), o = u.left == e.left && u.top == e.top, o)) ? { + top: u.top - window.scrollY, + left: u.left - window.scrollX + } : (r.browser.msie && (r.pointers || r.msPointers) && !i && (u.top -= window.pageYOffset - document.documentElement.scrollTop, u.left -= window.pageXOffset - document.documentElement.scrollLeft), u) + } + + function hr(n) { + var t = {}; + return d(typeof n == "string" ? n.split(" ") : n, function(n) { + t[n] = this + }), t + } + + function cr(n) { + return new i.effects.Element(n) + } + + function ti(n, t, i, r) { + return typeof n === u && (ft(t) && (r = t, t = 400, i = !1), ft(i) && (r = i, i = !1), typeof t === pt && (i = t, t = 400), n = { + effects: n, + duration: t, + reverse: i, + complete: r + }), s({ + effects: {}, + duration: 400, + reverse: !1, + init: g, + teardown: g, + hide: !1 + }, n, { + completeCallback: n.complete, + complete: g + }) + } + + function ii(t, i, r, u, f) { + for (var e = 0, s = t.length, o; e < s; e++) o = n(t[e]), o.queue(function() { + h.promise(o, ti(i, r, u, f)) + }); + return t + } + + function lr(n, t, i, r, u, f) { + return h.transitionPromise(n, t, ti(i, r, u, f)) + } + + function ar(n, t, i, r) { + return t && (t = t.split(" "), d(t, function(t, i) { + n.toggleClass(i, r) + })), n + } + + function wr(n) { + return ("" + n).replace(vr, "&").replace(yr, "<").replace(pr, ">") + } + + function at(n, r) { + var u; + return r.indexOf("data") === 0 && (r = r.substring(4), r = r.charAt(0).toLowerCase() + r.substring(1)), r = r.replace(gr, "-$1"), u = n.getAttribute("data-" + i.ns + r), u === null ? u = t : u === "null" ? u = null : u === "true" ? u = !0 : u === "false" ? u = !1 : yi.test(u) ? u = parseFloat(u) : kr.test(u) && !dr.test(u) && (u = new Function("return (" + u + ")")()), u + } + + function fi(r, u) { + var o = {}, + e, f; + for (e in u) f = at(r, e), f !== t && (br.test(e) && (f = i.template(n("#" + f).html())), o[e] = f); + return o + } + + function nu(t, i) { + return n.contains(t, i) ? -1 : 1 + } + + function tu() { + var t = n(this); + return n.inArray(t.attr("data-role"), ["slider", "rangeslider"]) > 0 || t.is(":visible") + } + + function iu(n, t) { + var i = n.nodeName.toLowerCase(); + return (/input|select|textarea|button|object/.test(i) ? !n.disabled : "a" === i ? n.href || t : t) && ru(n) + } + + function ru(t) { + return !n(t).parents().addBack().filter(function() { + return n.css(this, "visibility") === "hidden" || n.expr.filters.hidden(this) + }).length + } + + function o(n, t) { + return new o.fn.init(n, t) + } + var i = window.kendo = window.kendo || { + cultures: {} + }, + s = n.extend, + d = n.each, + li = n.isArray, + ot = n.proxy, + g = n.noop, + p = Math, + v, nt = window.JSON || {}, + r = {}, + tt = /%/, + ai = /\{(\d+)(:[^\}]+)?\}/g, + vi = /(\d+(?:\.?)\d*)px\s*(\d+(?:\.?)\d*)px\s*(\d+(?:\.?)\d*)px\s*(\d+)?/i, + yi = /^(\+|-?)\d+(\.?)\d*$/, + c = "function", + u = "string", + l = "number", + a = "object", + it = "null", + pt = "boolean", + rt = "undefined", + wt = {}, + bt = {}, + st = [].slice, + y = window.Globalize, + ni, h, lt, ri, ui, w, ei, oi, hi, vt, et, ci, yt, k; + i.version = "2013.3.1324"; + ut.extend = function(n) { + var r = function() {}, + t, u = this, + i = n && n.init ? n.init : function() { + u.apply(this, arguments) + }, + f; + r.prototype = u.prototype; + f = i.fn = i.prototype = new r; + for (t in n) f[t] = typeof n[t] !== a || n[t] instanceof Array || n[t] === null ? n[t] : s(!0, {}, r.prototype[t], n[t]); + return f.constructor = i, i.extend = u.extend, i + }; + ut.prototype._initOptions = function(n) { + this.options = kt({}, this.options, n) + }; + var ft = i.isFunction = function(n) { + return typeof n == "function" + }, + pi = function() { + this._defaultPrevented = !0 + }, + wi = function() { + return this._defaultPrevented === !0 + }, + ht = ut.extend({ + init: function() { + this._events = {} + }, + bind: function(n, i, r) { + var f = this, + e, s = typeof n === u ? [n] : n, + h, l, o, v = typeof i === c, + a; + if (i === t) { + for (e in n) f.bind(e, n[e]); + return f + } + for (e = 0, h = s.length; e < h; e++) n = s[e], o = v ? i : i[n], o && (r && (l = o, o = function() { + f.unbind(n, o); + l.apply(f, arguments) + }), a = f._events[n] = f._events[n] || [], a.push(o)); + return f + }, + one: function(n, t) { + return this.bind(n, t, !0) + }, + first: function(n, t) { + for (var r = this, e = typeof n === u ? [n] : n, f, h = typeof t === c, s, i = 0, o = e.length; i < o; i++) n = e[i], f = h ? t : t[n], f && (s = r._events[n] = r._events[n] || [], s.unshift(f)); + return r + }, + trigger: function(n, t) { + var u = this, + i = u._events[n], + r, f; + if (i) { + for (t = t || {}, t.sender = u, t._defaultPrevented = !1, t.preventDefault = pi, t.isDefaultPrevented = wi, i = i.slice(), r = 0, f = i.length; r < f; r++) i[r].call(u, t); + return t._defaultPrevented === !0 + } + return !1 + }, + unbind: function(n, i) { + var u = this, + f = u._events[n], + r; + if (n === t) u._events = {}; + else if (f) + if (i) + for (r = f.length - 1; r >= 0; r--) f[r] === i && f.splice(r, 1); + else u._events[n] = []; + return u + } + }); + var ki = /^\w+/, + di = /\$\{([^}]*)\}/g, + gi = /\\\}/g, + nr = /__CURLY__/g, + tr = /\\#/g, + ir = /__SHARP__/g, + rr = ["", "0", "00", "000", "0000"]; + v = { + paramName: "data", + useWithBlock: !0, + render: function(n, t) { + for (var u = "", i = 0, r = t.length; i < r; i++) u += n(t[i]); + return u + }, + compile: function(t, r) { + var h = s({}, this, r), + c = h.paramName, + a = c.match(ki)[0], + l = h.useWithBlock, + u = "var o,e=kendo.htmlEncode;", + o, e, f; + if (ft(t)) return t.length === 2 ? function(i) { + return t(n, { + data: i + }).join("") + } : t; + for (u += l ? "with(" + c + "){" : "", u += "o=", e = t.replace(gi, "__CURLY__").replace(di, "#=e($1)#").replace(nr, "}").replace(tr, "__SHARP__").split("#"), f = 0; f < e.length; f++) u += bi(e[f], f % 2 == 0); + u += l ? ";}" : ";"; + u += "return o;"; + u = u.replace(ir, "#"); + try { + return o = new Function(a, u), o._slotCount = Math.floor(e.length / 2), o + } catch (v) { + throw new Error(i.format("Invalid template:'{0}' Generated code:'{1}'", t, u)); + } + } + }, + function() { + function o(n) { + return f.lastIndex = 0, f.test(n) ? '"' + n.replace(f, function(n) { + var t = s[n]; + return typeof t === u ? t : "\\u" + ("0000" + n.charCodeAt(0).toString(16)).slice(-4) + }) + '"' : '"' + n + '"' + } + + function r(f, e) { + var v, w, y, k, d = n, + p, s = e[f], + b; + if (s && typeof s === a && typeof s.toJSON === c && (s = s.toJSON(f)), typeof t === c && (s = t.call(e, f, s)), b = typeof s, b === u) return o(s); + if (b === l) return isFinite(s) ? String(s) : it; + if (b === pt || b === it) return String(s); + if (b === a) { + if (!s) return it; + if (n += i, p = [], h.apply(s) === "[object Array]") { + for (k = s.length, v = 0; v < k; v++) p[v] = r(v, s) || it; + return y = p.length === 0 ? "[]" : n ? "[\n" + n + p.join(",\n" + n) + "\n" + d + "]" : "[" + p.join(",") + "]", n = d, y + } + if (t && typeof t === a) + for (k = t.length, v = 0; v < k; v++) typeof t[v] === u && (w = t[v], y = r(w, s), y && p.push(o(w) + (n ? ": " : ":") + y)); + else + for (w in s) Object.hasOwnProperty.call(s, w) && (y = r(w, s), y && p.push(o(w) + (n ? ": " : ":") + y)); + return y = p.length === 0 ? "{}" : n ? "{\n" + n + p.join(",\n" + n) + "\n" + d + "}" : "{" + p.join(",") + "}", n = d, y + } + } + var f = /[\\\"\x00-\x1f\x7f-\x9f\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g, + n, i, s = { + "\b": "\\b", + "\t": "\\t", + "\n": "\\n", + "\f": "\\f", + "\r": "\\r", + '"': '\\"', + "\\": "\\\\" + }, + t, h = {}.toString; + typeof Date.prototype.toJSON !== c && (Date.prototype.toJSON = function() { + var n = this; + return isFinite(n.valueOf()) ? e(n.getUTCFullYear(), 4) + "-" + e(n.getUTCMonth() + 1) + "-" + e(n.getUTCDate()) + "T" + e(n.getUTCHours()) + ":" + e(n.getUTCMinutes()) + ":" + e(n.getUTCSeconds()) + "Z" : null + }, String.prototype.toJSON = Number.prototype.toJSON = Boolean.prototype.toJSON = function() { + return this.valueOf() + }); + typeof nt.stringify !== c && (nt.stringify = function(f, e, o) { + var s; + if (n = "", i = "", typeof o === l) + for (s = 0; s < o; s += 1) i += " "; + else typeof o === u && (i = o); + if (t = e, e && typeof e !== c && (typeof e !== a || typeof e.length !== l)) throw new Error("JSON.stringify"); + return r("", { + "": f + }) + }) + }(), + function() { + function v(n) { + if (n) { + if (n.numberFormat) return n; + if (typeof n === u) { + var t = i.cultures; + return t[n] || t[n.split("-")[0]] || null + } + return null + } + return null + } + + function w(n) { + return n && (n = v(n)), n || i.cultures.current + } + + function rt(n) { + n.groupSizes = n.groupSize; + n.percent.groupSizes = n.percent.groupSize; + n.currency.groupSizes = n.currency.groupSize + } + + function ut(n, i, r) { + r = w(r); + var u = r.calendars.standard, + f = u.days, + o = u.months; + return i = u.patterns[i] || i, i.replace(d, function(i) { + var r; + return i === "d" ? r = n.getDate() : i === "dd" ? r = e(n.getDate()) : i === "ddd" ? r = f.namesAbbr[n.getDay()] : i === "dddd" ? r = f.names[n.getDay()] : i === "M" ? r = n.getMonth() + 1 : i === "MM" ? r = e(n.getMonth() + 1) : i === "MMM" ? r = o.namesAbbr[n.getMonth()] : i === "MMMM" ? r = o.names[n.getMonth()] : i === "yy" ? r = e(n.getFullYear() % 100) : i === "yyyy" ? r = e(n.getFullYear(), 4) : i === "h" ? r = n.getHours() % 12 || 12 : i === "hh" ? r = e(n.getHours() % 12 || 12) : i === "H" ? r = n.getHours() : i === "HH" ? r = e(n.getHours()) : i === "m" ? r = n.getMinutes() : i === "mm" ? r = e(n.getMinutes()) : i === "s" ? r = n.getSeconds() : i === "ss" ? r = e(n.getSeconds()) : i === "f" ? r = p.floor(n.getMilliseconds() / 100) : i === "ff" ? r = p.floor(n.getMilliseconds() / 10) : i === "fff" ? r = n.getMilliseconds() : i === "tt" && (r = n.getHours() < 12 ? u.AM[0] : u.PM[0]), r !== t ? r : i.slice(1, i.length - 1) + }) + } + + function ft(n, i, u) { + u = w(u); + var l = u.numberFormat, + ot = l.groupSize[0], + lt = l[c], + vt = l[f], + at = l.decimals, + kt = l.pattern[0], + dt = [], + yt, ft, st, pt, wt, et = n < 0, + b, p, rt, ei, gt = r, + y = r, + e, ut, d, ni, ri, it, v, a, bt, ti, ui, ii, fi, ht = -1, + ct; + if (n === t) return r; + if (!isFinite(n)) return n; + if (!i) return u.name.length ? n.toLocaleString() : n.toString(); + if (wt = g.exec(i), wt) { + if (i = wt[1].toLowerCase(), ft = i === "c", st = i === "p", (ft || st) && (l = ft ? l.currency : l.percent, ot = l.groupSize[0], lt = l[c], vt = l[f], at = l.decimals, yt = l.symbol, kt = l.pattern[et ? 0 : 1]), pt = wt[2], pt && (at = +pt), i === "e") return pt ? n.toExponential(at) : n.toExponential(); + if (st && (n *= 100), n = h(n, at), et = n < 0, n = n.split(f), b = n[0], p = n[1], et && (b = b.substring(1)), y = b, rt = b.length, rt >= ot) + for (y = r, e = 0; e < rt; e++) e > 0 && (rt - e) % ot == 0 && (y += lt), y += b.charAt(e); + if (p && (y += vt + p), i === "n" && !et) return y; + for (n = r, e = 0, ut = kt.length; e < ut; e++) d = kt.charAt(e), n += d === "n" ? y : d === "$" || d === "%" ? yt : d; + return n + } + if (et && (n = -n), (i.indexOf("'") > -1 || i.indexOf('"') > -1 || i.indexOf("\\") > -1) && (i = i.replace(nt, function(n) { + var t = n.charAt(0).replace("\\", ""), + i = n.slice(1).replace(t, ""); + return dt.push(i), k + })), i = i.split(";"), et && i[1]) i = i[1], ri = !0; + else if (n === 0) { + if (i = i[2] || i[0], i.indexOf(o) == -1 && i.indexOf(s) == -1) return i + } else i = i[0]; + if (ui = i.indexOf("%"), ii = i.indexOf("$"), st = ui != -1, ft = ii != -1, st && (n *= 100), ft && i[ii - 1] === "\\" && (i = i.split("\\").join(""), ft = !1), (ft || st) && (l = ft ? l.currency : l.percent, ot = l.groupSize[0], lt = l[c], vt = l[f], at = l.decimals, yt = l.symbol), ni = i.indexOf(c) > -1, ni && (i = i.replace(tt, r)), it = i.indexOf(f), ut = i.length, it != -1 ? (p = n.toString().split("e"), p = p[1] ? h(n, Math.abs(p[1])) : p[0], p = p.split(f)[1] || r, a = i.lastIndexOf(s) - it, v = i.lastIndexOf(o) - it, bt = a > -1, ti = v > -1, e = p.length, bt || ti || (i = i.substring(0, it) + i.substring(it + 1), ut = i.length, it = -1, e = 0), bt && a > v ? e = a : v > a && (ti && e > v ? e = v : bt && e < a && (e = a)), e > -1 && (n = h(n, e))) : n = h(n), v = i.indexOf(o), fi = a = i.indexOf(s), ht = v == -1 && a != -1 ? a : v != -1 && a == -1 ? v : v > a ? a : v, v = i.lastIndexOf(o), a = i.lastIndexOf(s), ct = v == -1 && a != -1 ? a : v != -1 && a == -1 ? v : v > a ? v : a, ht == ut && (ct = ht), ht != -1) { + if (y = n.toString().split(f), b = y[0], p = y[1] || r, rt = b.length, ei = p.length, et && n * -1 >= 0 && (et = !1), ni) + if (rt === ot && rt < it - fi) b = lt + b; + else if (rt > ot) { + for (y = r, e = 0; e < rt; e++) e > 0 && (rt - e) % ot == 0 && (y += lt), y += b.charAt(e); + b = y + } + for (n = i.substring(0, ht), et && !ri && (n += "-"), e = ht; e < ut; e++) { + if (d = i.charAt(e), it == -1) { + if (ct - e < rt) { + n += b; + break + } + } else if (a != -1 && a < e && (gt = r), it - e <= rt && it - e > -1 && (n += b, e = it), it === e) { + n += (p ? vt : r) + p; + e += ct - it + 1; + continue + } + d === s ? (n += d, gt = d) : d === o && (n += gt) + } + if (ct >= ht && (n += i.substring(ct + 1)), ft || st) { + for (y = r, e = 0, ut = n.length; e < ut; e++) d = n.charAt(e), y += d === "$" || d === "%" ? yt : d; + n = y + } + if (ut = dt.length, ut) + for (e = 0; e < ut; e++) n = n.replace(k, dt[e]) + } + return n + } + var d = /dddd|ddd|dd|d|MMMM|MMM|MM|M|yyyy|yy|HH|H|hh|h|mm|m|fff|ff|f|tt|ss|s|"[^"]*"|'[^']*'/g, + g = /^(n|c|p|e)(\d*)$/i, + nt = /(\\.)|(['][^']*[']?)|(["][^"]*["]?)/g, + tt = /\,/g, + r = "", + f = ".", + c = ",", + o = "#", + s = "0", + k = "??", + a = "en-US", + it = {}.toString; + i.cultures["en-US"] = { + name: a, + numberFormat: { + pattern: ["-n"], + decimals: 2, + ",": ",", + ".": ".", + groupSize: [3], + percent: { + pattern: ["-n %", "n %"], + decimals: 2, + ",": ",", + ".": ".", + groupSize: [3], + symbol: "%" + }, + currency: { + pattern: ["($n)", "$n"], + decimals: 2, + ",": ",", + ".": ".", + groupSize: [3], + symbol: "$" + } + }, + calendars: { + standard: { + days: { + names: ["Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday"], + namesAbbr: ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"], + namesShort: ["Su", "Mo", "Tu", "We", "Th", "Fr", "Sa"] + }, + months: { + names: ["January", "February", "March", "April", "May", "June", "July", "August", "September", "October", "November", "December"], + namesAbbr: ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"] + }, + AM: ["AM", "am", "AM"], + PM: ["PM", "pm", "PM"], + patterns: { + d: "M/d/yyyy", + D: "dddd, MMMM dd, yyyy", + F: "dddd, MMMM dd, yyyy h:mm:ss tt", + g: "M/d/yyyy h:mm tt", + G: "M/d/yyyy h:mm:ss tt", + m: "MMMM dd", + M: "MMMM dd", + s: "yyyy'-'MM'-'ddTHH':'mm':'ss", + t: "h:mm tt", + T: "h:mm:ss tt", + u: "yyyy'-'MM'-'dd HH':'mm':'ss'Z'", + y: "MMMM, yyyy", + Y: "MMMM, yyyy" + }, + "/": "/", + ":": ":", + firstDay: 0, + twoDigitYearMax: 2029 + } + } + }; + i.culture = function(n) { + var u = i.cultures, + r; + if (n !== t) r = v(n) || u[a], r.calendar = r.calendars.standard, u.current = r, y && rt(r.numberFormat); + else return u.current + }; + i.findCulture = v; + i.getCulture = w; + i.culture(a); + var et = 9e15, + h = function(n, t) { + var i = Math.pow(10, t || 0), + r = Math.round(n * i); + return r > et ? n.toFixed(t) : (r / i).toFixed(t) + }, + b = function(n, i, r) { + if (i) { + if (it.call(n) === "[object Date]") return ut(n, i, r); + if (typeof n === l) return ft(n, i, r) + } + return n !== t ? n : "" + }; + y && (b = function(t, i, r) { + return n.isPlainObject(r) && (r = r.name), y.format(t, i, r) + }); + i.format = function(n) { + var t = arguments; + return n.replace(ai, function(n, i, r) { + var u = t[parseInt(i, 10) + 1]; + return b(u, r ? r.substring(1) : "") + }) + }; + i._extractFormat = function(n) { + return n.slice(0, 3) === "{0:" && (n = n.slice(3, n.length - 1)), n + }; + i._activeElement = function() { + try { + return document.activeElement + } catch (n) { + return document.documentElement.activeElement + } + }; + i._round = h; + i.toString = b + }(), + function() { + function r(n, t, i) { + return !(n >= t && n <= i) + } + + function b(n) { + return n.charAt(0) + } + + function s(t) { + return n.map(t, b) + } + + function k(n, t) { + t || n.getHours() !== 23 || n.setHours(n.getHours() + 2) + } + + function d(n) { + for (var t = 0, r = n.length, i = []; t < r; t++) i[t] = (n[t] + "").toLowerCase(); + return i + } + + function h(n) { + var t = {}; + for (var i in n) t[i] = d(n[i]); + return t + } + + function g(n, i, u) { + if (!n) return null; + var p = function(n) { + for (var t = 0; i[rt] === n;) t++, rt++; + return t > 0 && (rt -= 1), t + }, + nt = function(t) { + var r = e[t] || new RegExp("^\\d{1," + t + "}"), + i = n.substr(b, t).match(r); + return i ? (i = i[0], b += i.length, parseInt(i, 10)) : null + }, + ht = function(t, i) { + for (var r = 0, o = t.length, f, e, u; r < o; r++) + if (f = t[r], e = f.length, u = n.substr(b, e), i && (u = u.toLowerCase()), u == f) return b += e, r + 1; + return null + }, + ft = function() { + var t = !1; + return n.charAt(b) === i[rt] && (b++, t = !0), t + }, + y = u.calendars.standard, + c = null, + tt = null, + w = null, + o = null, + it = null, + ut = null, + d = null, + rt = 0, + b = 0, + yt = !1, + pt = new Date, + ct = y.twoDigitYearMax || 2029, + et = pt.getFullYear(), + l, f, dt, wt, bt, kt, gt, g, lt, at, vt, ot, ni, st; + for (i || (i = "d"), wt = y.patterns[i], wt && (i = wt), i = i.split(""), dt = i.length; rt < dt; rt++) + if (l = i[rt], yt) l === "'" ? yt = !1 : ft(); + else if (l === "d") { + if (f = p("d"), y._lowerDays || (y._lowerDays = h(y.days)), w = f < 3 ? nt(2) : ht(y._lowerDays[f == 3 ? "namesAbbr" : "names"], !0), w === null || r(w, 1, 31)) return null + } else if (l === "M") { + if (f = p("M"), y._lowerMonths || (y._lowerMonths = h(y.months)), tt = f < 3 ? nt(2) : ht(y._lowerMonths[f == 3 ? "namesAbbr" : "names"], !0), tt === null || r(tt, 1, 12)) return null; + tt -= 1 + } else if (l === "y") { + if (f = p("y"), c = nt(f), c === null) return null; + f == 2 && (typeof ct == "string" && (ct = et + parseInt(ct, 10)), c = et - et % 100 + c, c > ct && (c -= 100)) + } else if (l === "h") { + if (p("h"), o = nt(2), o == 12 && (o = 0), o === null || r(o, 0, 11)) return null + } else if (l === "H") { + if (p("H"), o = nt(2), o === null || r(o, 0, 23)) return null + } else if (l === "m") { + if (p("m"), it = nt(2), it === null || r(it, 0, 59)) return null + } else if (l === "s") { + if (p("s"), ut = nt(2), ut === null || r(ut, 0, 59)) return null + } else if (l === "f") { + if (f = p("f"), st = n.substr(b, f).match(e[3]), d = nt(f), d !== null && (st = st[0].length, st < 3 && (d *= Math.pow(10, 3 - st)), f > 3 && (d = parseInt(d.toString().substring(0, 3), 10))), d === null || r(d, 0, 999)) return null + } else if (l === "t") { + if (f = p("t"), lt = y.AM, at = y.PM, f === 1 && (lt = s(lt), at = s(at)), bt = ht(at), !bt && !ht(lt)) return null + } else if (l === "z") { + if (kt = !0, f = p("z"), n.substr(b, 1) === "Z") { + if (!gt) return null; + ft(); + continue + } + if ((g = n.substr(b, 6).match(f > 2 ? v : a), !g) || (g = g[0], b = g.length, g = g.split(":"), vt = parseInt(g[0], 10), r(vt, -12, 13)) || f > 2 && (ot = parseInt(g[1], 10), isNaN(ot) || r(ot, 0, 59))) return null + } else if (l === "T") gt = ft(); + else if (l === "'") yt = !0, ft(); + else if (!ft()) return null; + return (ni = o !== null || it !== null || ut || null, c === null && tt === null && w === null && ni ? (c = et, tt = pt.getMonth(), w = pt.getDate()) : (c === null && (c = et), w === null && (w = 1)), bt && o < 12 && (o += 12), kt ? (vt && (o += -vt), ot && (it += -ot), n = new Date(Date.UTC(c, tt, w, o, it, ut, d))) : (n = new Date(c, tt, w, o, it, ut, d), k(n, o)), c < 100 && n.setFullYear(c), n.getDate() !== w && kt === t) ? null : n + } + var u = /\u00A0/g, + c = /[eE][\-+]?[0-9]+/, + a = /[+|\-]\d{1,2}/, + v = /[+|\-]\d{1,2}:\d{2}/, + p = /^\/Date\((.*?)\)\/$/, + w = /[+-]{1}\d+/, + f = ["G", "g", "d", "F", "D", "y", "m", "T", "t"], + e = { + 2: /^\d{1,2}/, + 3: /^\d{1,3}/, + 4: /^\d{4}/ + }, + o = {}.toString; + i.parseDate = function(n, t, r) { + if (o.call(n) === "[object Date]") return n; + var e = 0, + u = null, + s, c, h; + if (n && n.indexOf("/D") === 0 && (u = p.exec(n), u)) return u = u[1], h = w.exec(u), u = parseInt(u, 10), h && (u -= parseInt(h[0], 10) * i.date.MS_PER_MINUTE), new Date(u); + if (r = i.getCulture(r), !t) { + for (t = [], c = r.calendar.patterns, s = f.length; e < s; e++) t[e] = c[f[e]]; + e = 0; + t = ["yyyy/MM/dd HH:mm:ss", "yyyy/MM/dd HH:mm", "yyyy/MM/dd", "ddd MMM dd yyyy HH:mm:ss", "yyyy-MM-ddTHH:mm:ss.fffffffzzz", "yyyy-MM-ddTHH:mm:ss.fffzzz", "yyyy-MM-ddTHH:mm:sszzz", "yyyy-MM-ddTHH:mmzzz", "yyyy-MM-ddTHH:mmzz", "yyyy-MM-ddTHH:mm:ss", "yyyy-MM-ddTHH:mm", "yyyy-MM-dd HH:mm:ss", "yyyy-MM-dd HH:mm", "yyyy-MM-dd"].concat(t) + } + for (t = li(t) ? t : [t], s = t.length; e < s; e++) + if (u = g(n, t[e], r), u) return u; + return u + }; + i.parseInt = function(n, t) { + var r = i.parseFloat(n, t); + return r && (r = r | 0), r + }; + i.parseFloat = function(n, t, r) { + if (!n && n !== 0) return null; + if (typeof n === l) return n; + n = n.toString(); + t = i.getCulture(t); + var f = t.numberFormat, + h = f.percent, + a = f.currency, + s = a.symbol, + v = h.symbol, + e = n.indexOf("-"), + o, y; + return c.test(n) ? (n = parseFloat(n.replace(f["."], ".")), isNaN(n) && (n = null), n) : e > 0 ? null : (e = e > -1, n.indexOf(s) > -1 || r && r.toLowerCase().indexOf("c") > -1 ? (f = a, o = f.pattern[0].replace("$", s).split("n"), n.indexOf(o[0]) > -1 && n.indexOf(o[1]) > -1 && (n = n.replace(o[0], "").replace(o[1], ""), e = !0)) : n.indexOf(v) > -1 && (y = !0, f = h, s = v), n = n.replace("-", "").replace(s, "").replace(u, " ").split(f[","].replace(u, " ")).join("").replace(f["."], "."), n = parseFloat(n), isNaN(n) ? n = null : e && (n *= -1), n && y && (n /= 100), n) + }; + y && (i.parseDate = function(n, t, i) { + return o.call(n) === "[object Date]" ? n : y.parseDate(n, t, i) + }, i.parseFloat = function(i, r) { + return typeof i === l ? i : i === t || i === null ? null : (n.isPlainObject(r) && (r = r.name), i = y.parseFloat(i, r), isNaN(i) ? null : i) + }) + }(), + function() { + var e, i, f, c; + r.scrollbar = function() { + var n = document.createElement("div"), + t; + return n.style.cssText = "overflow:scroll;overflow-x:hidden;zoom:1;clear:both", n.innerHTML = " ", document.body.appendChild(n), t = n.offsetWidth - n.scrollWidth, document.body.removeChild(n), t + }; + r.isRtl = function(t) { + return n(t).closest(".k-rtl").length > 0 + }; + e = document.createElement("table"); + try { + e.innerHTML = "<tr><td><\/td><\/tr>"; + r.tbodyInnerHtml = !0 + } catch (l) { + r.tbodyInnerHtml = !1 + } + r.touch = "ontouchstart" in window; + r.msPointers = window.MSPointerEvent; + r.pointers = window.PointerEvent; + var o = r.transitions = !1, + h = r.transforms = !1, + s = "HTMLElement" in window ? HTMLElement.prototype : []; + r.hasHW3D = "WebKitCSSMatrix" in window && "m11" in new window.WebKitCSSMatrix || "MozPerspective" in document.documentElement.style || "msPerspective" in document.documentElement.style; + d(["Moz", "webkit", "O", "ms"], function() { + var t = this.toString(), + i = typeof e.style[t + "Transition"] === u, + n; + if (i || typeof e.style[t + "Transform"] === u) return n = t.toLowerCase(), h = { + css: n != "ms" ? "-" + n + "-" : "", + prefix: t, + event: n === "o" || n === "webkit" ? n : "" + }, i && (o = h, o.event = o.event ? o.event + "TransitionEnd" : "transitionend"), !1 + }); + e = null; + r.transforms = h; + r.transitions = o; + r.devicePixelRatio = window.devicePixelRatio === t ? 1 : window.devicePixelRatio; + try { + r.screenWidth = window.outerWidth || window.screen ? window.screen.availWidth : window.innerWidth; + r.screenHeight = window.outerHeight || window.screen ? window.screen.availHeight : window.innerHeight + } catch (l) { + r.screenWidth = window.screen.availWidth; + r.screenHeight = window.screen.availHeight + } + r.detectOS = function(n) { + var t = !1, + u, f = [], + o = !/mobile safari/i.test(n), + e = { + fire: /(Silk)\/(\d+)\.(\d+(\.\d+)?)/, + android: /(Android|Android.*(?:Opera|Firefox).*?\/)\s*(\d+)\.(\d+(\.\d+)?)/, + iphone: /(iPhone|iPod).*OS\s+(\d+)[\._]([\d\._]+)/, + ipad: /(iPad).*OS\s+(\d+)[\._]([\d_]+)/, + meego: /(MeeGo).+NokiaBrowser\/(\d+)\.([\d\._]+)/, + webos: /(webOS)\/(\d+)\.(\d+(\.\d+)?)/, + blackberry: /(BlackBerry|BB10).*?Version\/(\d+)\.(\d+(\.\d+)?)/, + playbook: /(PlayBook).*?Tablet\s*OS\s*(\d+)\.(\d+(\.\d+)?)/, + wp: /(Windows Phone(?: OS)?)\s(\d+)\.(\d+(\.\d+)?)/, + windows: /(MSIE)\s+(\d+)\.(\d+(\.\d+)?)/, + tizen: /(tizen).*?Version\/(\d+)\.(\d+(\.\d+)?)/i, + sailfish: /(sailfish).*rv:(\d+)\.(\d+(\.\d+)?).*firefox/i, + ffos: /(Mobile).*rv:(\d+)\.(\d+(\.\d+)?).*Firefox/ + }, + s = { + ios: /^i(phone|pad|pod)$/i, + android: /^android|fire$/i, + blackberry: /^blackberry|playbook/i, + windows: /windows/, + wp: /wp/, + flat: /sailfish|ffos|tizen/i, + meego: /meego/ + }, + h = { + tablet: /playbook|ipad|fire/i + }, + c = { + omini: /Opera\sMini/i, + omobile: /Opera\sMobi/i, + firefox: /Firefox|Fennec/i, + mobilesafari: /version\/.*safari/i, + chrome: /chrome/i, + webkit: /webkit/i, + ie: /MSIE|Windows\sPhone/i + }; + for (var i in e) + if (e.hasOwnProperty(i) && (f = n.match(e[i]), f)) { + if (i == "windows" && "plugins" in navigator) return !1; + t = {}; + t.device = i; + t.tablet = ct(i, h, !1); + t.browser = ct(n, c, "default"); + t.name = ct(i, s); + t[t.name] = !0; + t.majorVersion = f[2]; + t.minorVersion = f[3].replace("_", "."); + u = t.minorVersion.replace(".", "").substr(0, 2); + t.flatVersion = t.majorVersion + u + new Array(3 - (u.length < 3 ? u.length : 2)).join("0"); + t.appMode = window.navigator.standalone || /file|local|wmapp/.test(window.location.protocol) || typeof PhoneGap !== rt || typeof cordova !== rt; + t.android && (r.devicePixelRatio < 1.5 && t.flatVersion < 400 || o) && (r.screenWidth > 800 || r.screenHeight > 800) && (t.tablet = i); + break + } + return t + }; + i = r.mobileOS = r.detectOS(navigator.userAgent); + r.wpDevicePixelRatio = i.wp ? screen.width / 320 : 0; + r.kineticScrollNeeded = i && (r.touch || r.msPointers || r.pointers); + r.hasNativeScrolling = !1; + (i.ios && i.majorVersion > 4 || i.android && i.majorVersion > 2 || i.wp) && (r.hasNativeScrolling = i); + r.mouseAndTouchPresent = r.touch && !(r.mobileOS.ios || r.mobileOS.android); + r.detectBrowser = function(n) { + var t = !1, + i = [], + r = { + webkit: /(chrome)[ \/]([\w.]+)/i, + safari: /(webkit)[ \/]([\w.]+)/i, + opera: /(opera)(?:.*version|)[ \/]([\w.]+)/i, + msie: /(msie\s|trident.*? rv:)([\w.]+)/i, + mozilla: /(mozilla)(?:.*? rv:([\w.]+)|)/i + }; + for (var u in r) + if (r.hasOwnProperty(u) && (i = n.match(r[u]), i)) { + t = {}; + t[u] = !0; + t[i[1].toLowerCase()] = !0; + t.version = parseInt(document.documentMode || i[2], 10); + break + } + return t + }; + r.browser = r.detectBrowser(navigator.userAgent); + r.zoomLevel = function() { + try { + return r.touch ? document.documentElement.clientWidth / window.innerWidth : r.browser.msie && r.browser.version >= 10 ? (top || window).document.documentElement.offsetWidth / (top || window).innerWidth : 1 + } catch (n) { + return 1 + } + }; + r.cssBorderSpacing = typeof document.documentElement.style.borderSpacing != "undefined" && !(r.browser.msie && r.browser.version < 8), + function(t) { + var i, r = parseInt(t.version, 10); + t.msie ? i = "ie" : t.mozilla ? i = "ff" : t.safari ? i = "safari" : t.webkit ? i = "webkit" : t.opera && (i = "opera"); + i && n(document.documentElement).addClass("k-" + i + " k-" + i + r) + }(r.browser); + r.eventCapture = document.documentElement.addEventListener; + f = document.createElement("input"); + r.placeholder = "placeholder" in f; + r.input = function() { + for (var i = ["number", "date", "time", "month", "week", "datetime", "datetime-local"], e = i.length, r = "test", u = {}, n = 0, t; n < e; n++) t = i[n], f.setAttribute("type", t), f.value = r, u[t.replace("-", "")] = f.type !== "text" && f.value !== r; + return u + }(); + f.style.cssText = "float:left;"; + r.cssFloat = !!f.style.cssFloat; + f = null; + r.stableSort = function() { + var n = [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12].sort(function() { + return 0 + }); + return n[0] === 0 && n[1] === 1 && n[2] === 2 && n[3] === 3 && n[4] === 4 && n[5] === 5 && n[6] === 6 && n[7] === 7 && n[8] === 8 && n[9] === 9 && n[10] === 10 && n[11] === 11 && n[12] === 12 + }(); + r.matchesSelector = s.webkitMatchesSelector || s.mozMatchesSelector || s.msMatchesSelector || s.oMatchesSelector || s.matchesSelector || function(t) { + for (var i = document.querySelectorAll ? (this.parentNode || document).querySelectorAll(t) || [] : n(t), r = i.length; r--;) + if (i[r] == this) return !0; + return !1 + }; + r.pushState = window.history && window.history.pushState; + c = document.documentMode; + r.hashChange = "onhashchange" in window && !(r.browser.msie && (!c || c <= 8)) + }(); + ni = { + left: { + reverse: "right" + }, + right: { + reverse: "left" + }, + down: { + reverse: "up" + }, + up: { + reverse: "down" + }, + top: { + reverse: "bottom" + }, + bottom: { + reverse: "top" + }, + "in": { + reverse: "out" + }, + out: { + reverse: "in" + } + }; + h = {}; + n.extend(h, { + Element: function(t) { + this.element = n(t) + }, + promise: function(n, t) { + n.is(":visible") || n.css({ + display: n.data("olddisplay") || "block" + }).css("display"); + t.hide && n.data("olddisplay", n.css("display")).hide(); + t.init && t.init(); + t.completeCallback && t.completeCallback(n); + n.dequeue() + }, + transitionPromise: function(n, t, r) { + var u = i.wrap(n); + return u.append(t), n.hide(), t.show(), r.completeCallback && r.completeCallback(n), n + }, + disable: function() { + this.promise = this.promiseShim; + this.transitionPromise = this.transitionPromiseShim + }, + enable: function() { + this.promise = this.animatedPromise; + this.transitionPromise = this.animatedTransitionPromise + } + }); + h.promiseShim = h.promise; + h.transitionPromiseShim = h.transitionPromise; + "kendoAnimate" in n.fn || s(n.fn, { + kendoStop: function(n, t) { + return this.stop(n, t) + }, + kendoAnimate: function(n, t, i, r) { + return ii(this, n, t, i, r) + }, + kendoAnimateTo: function(n, t, i, r, u) { + return lr(this, n, t, i, r, u) + }, + kendoAddClass: function(n, t) { + return i.toggleClass(this, n, t, !0) + }, + kendoRemoveClass: function(n, t) { + return i.toggleClass(this, n, t, !1) + }, + kendoToggleClass: function(n, t, r) { + return i.toggleClass(this, n, t, r) + } + }); + var vr = /&/g, + yr = /</g, + pr = />/g; + lt = function(n) { + return n.target + }; + r.touch && (lt = function(n) { + var t = "originalEvent" in n ? n.originalEvent.changedTouches : "changedTouches" in n ? n.changedTouches : null; + return t ? document.elementFromPoint(t[0].clientX, t[0].clientY) : n.target + }, d(["swipe", "swipeLeft", "swipeRight", "swipeUp", "swipeDown", "doubleTap", "tap"], function(t, i) { + n.fn[i] = function(n) { + return this.bind(i, n) + } + })); + r.touch ? r.mobileOS ? (r.mousedown = "touchstart", r.mouseup = "touchend", r.mousemove = "touchmove", r.mousecancel = "touchcancel", r.click = "touchend", r.resize = "orientationchange") : (r.mousedown = "mousedown touchstart", r.mouseup = "mouseup touchend", r.mousemove = "mousemove touchmove", r.mousecancel = "mouseleave touchcancel", r.click = "click", r.resize = "resize") : r.pointers ? (r.mousemove = "pointermove", r.mousedown = "pointerdown", r.mouseup = "pointerup", r.mousecancel = "pointercancel", r.click = "pointerup", r.resize = "orientationchange resize") : r.msPointers ? (r.mousemove = "MSPointerMove", r.mousedown = "MSPointerDown", r.mouseup = "MSPointerUp", r.mousecancel = "MSPointerCancel", r.click = "MSPointerUp", r.resize = "orientationchange resize") : (r.mousemove = "mousemove", r.mousedown = "mousedown", r.mouseup = "mouseup", r.mousecancel = "mouseleave", r.click = "click", r.resize = "resize"); + ri = function(n, t) { + for (var o = t || "d", r, i, e = 1, u = 0, f = n.length; u < f; u++) i = n[u], i !== "" && (r = i.indexOf("["), r !== 0 && (r == -1 ? i = "." + i : (e++, i = "." + i.substring(0, r) + " || {})" + i.substring(r))), e++, o += i + (u < f - 1 ? " || {})" : ")")); + return new Array(e).join("(") + o + }; + ui = /^([a-z]+:)?\/\//i; + s(i, { + ui: i.ui || {}, + fx: i.fx || cr, + effects: i.effects || h, + mobile: i.mobile || {}, + data: i.data || {}, + dataviz: i.dataviz || { + ui: { + roles: {} + } + }, + keys: { + INSERT: 45, + DELETE: 46, + BACKSPACE: 8, + TAB: 9, + ENTER: 13, + ESC: 27, + LEFT: 37, + UP: 38, + RIGHT: 39, + DOWN: 40, + END: 35, + HOME: 36, + SPACEBAR: 32, + PAGEUP: 33, + PAGEDOWN: 34, + F2: 113, + F10: 121, + F12: 123 + }, + support: i.support || r, + animate: i.animate || ii, + ns: "", + attr: function(n) { + return "data-" + i.ns + n + }, + wrap: ur, + deepExtend: kt, + getComputedStyles: er, + size: or, + toCamelCase: gt, + toHyphens: fr, + getOffset: i.getOffset || sr, + parseEffects: i.parseEffects || hr, + toggleClass: i.toggleClass || ar, + directions: i.directions || ni, + Observable: ht, + Class: ut, + Template: v, + template: ot(v.compile, v), + render: ot(v.render, v), + stringify: ot(nt.stringify, nt), + eventTarget: lt, + htmlEncode: wr, + isLocalUrl: function(n) { + return n && !ui.test(n) + }, + expr: function(n, t, i) { + return n = n || "", typeof t == u && (i = t, t = !1), i = i || "d", n && n.charAt(0) !== "[" && (n = "." + n), t ? ri(n.split("."), i) : i + n + }, + getter: function(n, t) { + return wt[n] = wt[n] || new Function("d", "return " + i.expr(n, t)) + }, + setter: function(n) { + return bt[n] = bt[n] || new Function("d,value", i.expr(n) + "=value") + }, + accessor: function(n) { + return { + get: i.getter(n), + set: i.setter(n) + } + }, + guid: function() { + for (var t = "", i, n = 0; n < 32; n++) i = p.random() * 16 | 0, (n == 8 || n == 12 || n == 16 || n == 20) && (t += "-"), t += (n == 12 ? 4 : n == 16 ? i & 3 | 8 : i).toString(16); + return t + }, + roleSelector: function(n) { + return n.replace(/(\S+)/g, "[" + i.attr("role") + "=$1],").slice(0, -1) + }, + triggeredByInput: function(n) { + return /^(label|input|textarea|select)$/i.test(n.target.tagName) + }, + logToConsole: function(n) { + var t = window.console; + typeof t != "undefined" && t.log && t.log(n) + } + }); + w = ht.extend({ + init: function(n, t) { + var r = this; + r.element = i.jQuery(n).handler(r); + ht.fn.init.call(r); + t = r.options = s(!0, {}, r.options, t); + r.element.attr(i.attr("role")) || r.element.attr(i.attr("role"), (t.name || "").toLowerCase()); + r.element.data("kendo" + t.prefix + t.name, r); + r.bind(r.events, t) + }, + events: [], + options: { + prefix: "" + }, + _hasBindingTarget: function() { + return !!this.element[0].kendoBindingTarget + }, + _tabindex: function(n) { + n = n || this.wrapper; + var i = this.element, + t = "tabindex", + r = n.attr(t) || i.attr(t); + i.removeAttr(t); + n.attr(t, isNaN(r) ? 0 : r) + }, + setOptions: function(t) { + for (var i = this, u = 0, f = i.events.length, r; u < f; u++) r = i.events[u], i.options[r] && t[r] && i.unbind(r, i.options[r]); + n.extend(i.options, t); + i.bind(i.events, t) + }, + resize: function(n) { + var t = this.getSize(), + i = this._size; + (n || !i || t.width !== i.width || t.height !== i.height) && (this._resize(t), this.trigger("resize", t), this._size = t) + }, + getSize: function() { + return i.dimensions(this.element) + }, + size: function(n) { + if (n) this.setSize(n); + else return this.getSize() + }, + setSize: n.noop, + _resize: n.noop, + destroy: function() { + var n = this; + n.element.removeData("kendo" + n.options.prefix + n.options.name); + n.element.removeData("handler"); + n.unbind() + } + }); + i.dimensions = function(n, t) { + var i = n[0]; + return t && n.css(t), { + width: i.offsetWidth, + height: i.offsetHeight + } + }; + i.notify = g; + var br = /template$/i, + kr = /^\s*(?:\{(?:.|\r\n|\n)*\}|\[(?:.|\r\n|\n)*\])\s*$/, + dr = /^\{(\d+)(:[^\}]+)?\}/, + gr = /([A-Z])/g; + i.initWidget = function(r, f, e) { + var s, a, o, l, y, h, v, c; + if ((e ? e.roles && (e = e.roles) : e = i.ui.roles, r = r.nodeType ? r : r[0], h = r.getAttribute("data-" + i.ns + "role"), h) && (o = h.indexOf(".") === -1 ? e[h] : i.getter(h)(window), o)) { + for (c = at(r, "dataSource"), f = n.extend({}, fi(r, o.fn.options), f), c && (f.dataSource = typeof c === u ? i.getter(c)(window) : c), l = 0, y = o.fn.events.length; l < y; l++) a = o.fn.events[l], v = at(r, a), v !== t && (f[a] = i.getter(v)(window)); + return s = n(r).data("kendo" + o.fn.options.prefix + o.fn.options.name), s ? s.setOptions(f) : s = new o(r, f), s + } + }; + i.rolesFromNamespaces = function(n) { + var r = [], + t, u; + for (n[0] || (n = [i.ui, i.dataviz.ui]), t = 0, u = n.length; t < u; t++) r[t] = n[t].roles; + return s.apply(null, [{}].concat(r.reverse())) + }; + i.init = function(t) { + var r = i.rolesFromNamespaces(st.call(arguments, 1)); + n(t).find("[data-" + i.ns + "role]").addBack().each(function() { + i.initWidget(this, {}, r) + }) + }; + i.destroy = function(t) { + n(t).find("[data-" + i.ns + "role]").addBack().each(function() { + var t = i.widgetInstance(n(this)); + t && t.destroy() + }) + }; + i.resize = function(t) { + var u = n(t).find("[data-" + i.ns + "role]").addBack().filter(tu), + r; + u.length && (r = n.makeArray(u), r.sort(nu), n.each(r, function() { + var t = i.widgetInstance(n(this)); + t && t.resize() + })) + }; + i.parseOptions = fi; + s(i.ui, { + Widget: w, + roles: {}, + progress: function(t, r) { + var u = t.find(".k-loading-mask"), + o = i.support, + c = o.browser, + f, s, h, e; + r ? u.length || (f = o.isRtl(t), s = f ? "right" : "left", e = t.scrollLeft(), h = c.webkit ? f ? t[0].scrollWidth - t.width() - 2 * e : 0 : 0, u = n("<div class='k-loading-mask'><span class='k-loading-text'>Loading...<\/span><div class='k-loading-image'/><div class='k-loading-color'/><\/div>").width("100%").height("100%").css("top", t.scrollTop()).css(s, Math.abs(e) + h).prependTo(t)) : u && u.remove() + }, + plugin: function(r, f, e) { + var o = r.fn.options.name, + s; + f = f || i.ui; + e = e || ""; + f[o] = r; + f.roles[o.toLowerCase()] = r; + s = "getKendo" + e + o; + o = "kendo" + e + o; + n.fn[o] = function(f) { + var e = this, + s; + return typeof f === u ? (s = st.call(arguments, 1), this.each(function() { + var r = n.data(this, o), + u, h; + if (!r) throw new Error(i.format("Cannot call method '{0}' of {1} before it is initialized", f, o)); + if (u = r[f], typeof u !== c) throw new Error(i.format("Cannot find method '{0}' of {1}", f, o)); + return h = u.apply(r, s), h !== t ? (e = h, !1) : void 0 + })) : this.each(function() { + new r(this, f) + }), e + }; + n.fn[s] = function() { + return this.data(o) + } + } + }); + ei = { + bind: function() { + return this + } + }; + oi = w.extend({ + init: function(n, t) { + w.fn.init.call(this, n, t); + this.element.autoApplyNS(); + this.wrapper = this.element; + this.element.addClass("km-widget") + }, + destroy: function() { + w.fn.destroy.call(this); + this.element.kendoDestroy() + }, + options: { + prefix: "Mobile" + }, + events: [], + view: function() { + var n = this.element.closest(i.roleSelector("view splitview modalview drawer")); + return i.widgetInstance(n, i.mobile.ui) + }, + container: function() { + var n = this.element.closest(i.roleSelector("view layout modalview drawer")); + return i.widgetInstance(n, i.mobile.ui) || ei + } + }); + s(i.mobile, { + init: function(n) { + i.init(n, i.mobile.ui, i.ui, i.dataviz.ui) + }, + ui: { + Widget: oi, + roles: {}, + plugin: function(n) { + i.ui.plugin(n, i.mobile.ui, "Mobile") + } + } + }); + i.touchScroller = function(t, u) { + return n(t).map(function(t, f) { + return f = n(f), r.kineticScrollNeeded && i.mobile.ui.Scroller && !f.data("kendoMobileScroller") ? (f.kendoMobileScroller(u), f.data("kendoMobileScroller")) : !1 + })[0] + }; + i.preventDefault = function(n) { + n.preventDefault() + }; + i.widgetInstance = function(n, t) { + var r = n.data(i.ns + "role"), + u, f, s, e, o; + if (r) + for (r === "content" && (r = "scroller"), u = t ? [t.roles[r]] : [i.ui.roles[r], i.dataviz.ui.roles[r], i.mobile.ui.roles[r]], r.indexOf(".") >= 0 && (u = [i.getter(r)(window)]), f = 0, s = u.length; f < s; f++) + if (e = u[f], e && (o = n.data("kendo" + e.fn.options.prefix + e.fn.options.name), o)) return o + }; + i.onResize = function(t) { + var i = t; + r.mobileOS.android && (i = function() { + setTimeout(t, 600) + }); + n(window).on(r.resize, i); + return i + }; + i.unbindResize = function(t) { + n(window).off(r.resize, t) + }; + i.attrValue = function(n, t) { + return n.data(i.ns + t) + }; + i.days = { + Sunday: 0, + Monday: 1, + Tuesday: 2, + Wednesday: 3, + Thursday: 4, + Friday: 5, + Saturday: 6 + }; + n.extend(n.expr[":"], { + kendoFocusable: function(t) { + var i = n.attr(t, "tabindex"); + return iu(t, !isNaN(i) && i > -1) + } + }); + var si = ["mousedown", "mousemove", "mouseenter", "mouseleave", "mouseover", "mouseout", "mouseup", "click"], + uu = "label, input, [data-rel=external]", + f = { + setupMouseMute: function() { + var t = 0, + u = si.length, + e = document.documentElement, + i; + if (!f.mouseTrap && r.eventCapture) + for (f.mouseTrap = !0, f.bustClick = !1, f.captureMouse = !1, i = function(t) { + f.captureMouse && (t.type === "click" ? f.bustClick && !n(t.target).is(uu) && (t.preventDefault(), t.stopPropagation()) : t.stopPropagation()) + }; t < u; t++) e.addEventListener(si[t], i, !0) + }, + muteMouse: function(n) { + f.captureMouse = !0; + n.data.bustClick && (f.bustClick = !0); + clearTimeout(f.mouseTrapTimeoutID) + }, + unMuteMouse: function() { + clearTimeout(f.mouseTrapTimeoutID); + f.mouseTrapTimeoutID = setTimeout(function() { + f.captureMouse = !1; + f.bustClick = !1 + }, 400) + } + }, + b = { + down: "touchstart mousedown", + move: "mousemove touchmove", + up: "mouseup touchend touchcancel", + cancel: "mouseleave touchcancel" + }; + r.touch && (r.mobileOS.ios || r.mobileOS.android) ? b = { + down: "touchstart", + move: "touchmove", + up: "touchend touchcancel", + cancel: "touchcancel" + } : r.pointers ? b = { + down: "pointerdown", + move: "pointermove", + up: "pointerup", + cancel: "pointercancel pointerleave" + } : r.msPointers && (b = { + down: "MSPointerDown", + move: "MSPointerMove", + up: "MSPointerUp", + cancel: "MSPointerCancel MSPointerLeave" + }); + !r.msPointers || "onmspointerenter" in window || n.each({ + MSPointerEnter: "MSPointerOver", + MSPointerLeave: "MSPointerOut" + }, function(t, i) { + n.event.special[t] = { + delegateType: i, + bindType: i, + handle: function(t) { + var u, f = this, + r = t.relatedTarget, + e = t.handleObj; + return r && (r === f || n.contains(f, r)) || (t.type = e.origType, u = e.handler.apply(this, arguments), t.type = i), u + } + } + }); + hi = function(n) { + return b[n] || n + }; + vt = /([^ ]+)/g; + i.applyEventMap = function(n, t) { + return n = n.replace(vt, hi), t && (n = n.replace(vt, "$1." + t)), n + }; + et = n.fn.on; + s(!0, o, n); + o.fn = o.prototype = new n; + o.fn.constructor = o; + o.fn.init = function(t, i) { + return i && i instanceof n && !(i instanceof o) && (i = o(i)), n.fn.init.call(this, t, i, ci) + }; + o.fn.init.prototype = o.fn; + ci = o(document); + s(o.fn, { + handler: function(n) { + return this.data("handler", n), this + }, + autoApplyNS: function(n) { + return this.data("kendoNS", n || i.guid()), this + }, + on: function() { + var t = this, + l = t.data("kendoNS"), + s, n, e, o, h, c; + return arguments.length === 1 ? et.call(t, arguments[0]) : (s = t, n = st.call(arguments), typeof n[n.length - 1] === rt && n.pop(), e = n[n.length - 1], o = i.applyEventMap(n[0], l), r.mouseAndTouchPresent && o.search(/mouse|click/) > -1 && this[0] !== document.documentElement && (f.setupMouseMute(), h = n.length === 2 ? null : n[1], c = o.indexOf("click") > -1 && o.indexOf("touchend") > -1, et.call(this, { + touchstart: f.muteMouse, + touchend: f.unMuteMouse + }, h, { + bustClick: c + })), typeof e === u && (s = t.data("handler"), e = s[e], n[n.length - 1] = function(n) { + e.call(s, n) + }), n[0] = o, et.apply(t, n), t) + }, + kendoDestroy: function(n) { + return n = n || this.data("kendoNS"), n && this.off("." + n), this + } + }); + i.jQuery = o; + i.eventMap = b; + i.timezone = function() { + function i(i, r) { + var u, o, s, c = r[3], + e = r[4], + f = r[5], + h = r[8]; + return (h || (r[8] = h = {}), h[i]) ? h[i] : (isNaN(e) ? e.indexOf("last") === 0 ? (u = new Date(Date.UTC(i, n[c] + 1, 1, f[0] - 24, f[1], f[2], 0)), o = t[e.substr(4, 3)], s = u.getUTCDay(), u.setUTCDate(u.getUTCDate() + o - s - (o > s ? 7 : 0))) : e.indexOf(">=") >= 0 && (u = new Date(Date.UTC(i, n[c], e.substr(5), f[0], f[1], f[2], 0)), o = t[e.substr(0, 3)], s = u.getUTCDay(), u.setUTCDate(u.getUTCDate() + o - s + (o < s ? 7 : 0))) : u = new Date(Date.UTC(i, n[c], e, f[0], f[1], f[2], 0)), h[i] = u) + } + + function f(n, t, r) { + var f, e, u; + return (t = t[r], !t) ? (f = r.split(":"), e = 0, f.length > 1 && (e = f[0] * 60 + Number(f[1])), [-1e6, "max", "-", "Jan", 1, [0, 0, 0], e, "-"]) : (u = new Date(n).getUTCFullYear(), t = jQuery.grep(t, function(n) { + var i = n[0], + t = n[1]; + return i <= u && (t >= u || i == u && t == "only" || t == "max") + }), t.push(n), t.sort(function(n, t) { + return typeof n != "number" && (n = Number(i(u, n))), typeof t != "number" && (t = Number(i(u, t))), n - t + }), t[jQuery.inArray(n, t) - 1]) + } + + function e(n, t, i) { + var r = t[i], + u, f, e; + if (typeof r == "string" && (r = t[r]), !r) throw new Error('Timezone "' + i + '" is either incorrect, or kendo.timezones.min.js is not included.'); + for (u = r.length - 1; u >= 0; u--) + if (f = r[u][3], f && n > f) break; + if (e = r[u + 1], !e) throw new Error('Timezone "' + i + '" not found on ' + n + "."); + return e + } + + function r(n, t, i, r) { + typeof n != l && (n = Date.UTC(n.getFullYear(), n.getMonth(), n.getDate(), n.getHours(), n.getMinutes(), n.getSeconds(), n.getMilliseconds())); + var u = e(n, t, r); + return { + zone: u, + rule: f(n, i, u[1]) + } + } + + function o(n, t) { + if (t == "Etc/UTC" || t == "Etc/GMT") return 0; + var i = r(n, this.zones, this.rules, t), + u = i.zone, + f = i.rule; + return f ? u[0] - f[6] : u[0] + } + + function s(n, t) { + var f = r(n, this.zones, this.rules, t), + e = f.zone, + i = f.rule, + u = e[2]; + return u.indexOf("/") >= 0 ? u.split("/")[i && i[6] ? 1 : 0] : u.indexOf("%s") >= 0 ? u.replace("%s", !i || i[7] == "-" ? "" : i[7]) : u + } + + function h(n, t, i) { + var r, f; + return typeof t == u && (t = this.offset(n, t)), typeof i == u && (i = this.offset(n, i)), r = n.getTimezoneOffset(), n = new Date(n.getTime() + (t - i) * 6e4), f = n.getTimezoneOffset(), new Date(n.getTime() + (f - r) * 6e4) + } + + function c(n, t) { + return this.convert(n, n.getTimezoneOffset(), t) + } + + function a(n, t) { + return this.convert(n, t, n.getTimezoneOffset()) + } + + function v(n) { + return this.apply(new Date(n), "Etc/UTC") + } + var n = { + Jan: 0, + Feb: 1, + Mar: 2, + Apr: 3, + May: 4, + Jun: 5, + Jul: 6, + Aug: 7, + Sep: 8, + Oct: 9, + Nov: 10, + Dec: 11 + }, + t = { + Sun: 0, + Mon: 1, + Tue: 2, + Wed: 3, + Thu: 4, + Fri: 5, + Sat: 6 + }; + return { + zones: {}, + rules: {}, + offset: o, + convert: h, + apply: c, + remove: a, + abbr: s, + toLocalDate: v + } + }(); + i.date = function() { + function t(n, t) { + return t === 0 && n.getHours() === 23 ? (n.setHours(n.getHours() + 2), !0) : !1 + } + + function e(n, i, r) { + var u = n.getHours(); + r = r || 1; + i = (i - n.getDay() + 7 * r) % 7; + n.setDate(n.getDate() + i); + t(n, u) + } + + function c(n, t, i) { + return n = new Date(n), e(n, t, i), n + } + + function o(n) { + return new Date(n.getFullYear(), n.getMonth(), 1) + } + + function l(n) { + var t = new Date(n.getFullYear(), n.getMonth() + 1, 0), + i = o(n), + r = Math.abs(t.getTimezoneOffset() - i.getTimezoneOffset()); + return r && t.setHours(i.getHours() + r / 60), t + } + + function i(n) { + return n = new Date(n.getFullYear(), n.getMonth(), n.getDate(), 0, 0, 0), t(n, 0), n + } + + function a(n) { + return Date.UTC(n.getFullYear(), n.getMonth(), n.getDate(), n.getHours(), n.getMinutes(), n.getSeconds(), n.getMilliseconds()) + } + + function r(n) { + return n.getTime() - i(n) + } + + function v(t, i, u) { + var e = r(i), + o = r(u), + f; + return !t || e == o ? !0 : (i >= u && (u += n), f = r(t), e > f && (f += n), o < e && (o += n), f >= e && f <= o) + } + + function y(t, i, r) { + var e = i.getTime(), + u = r.getTime(), + f; + return e >= u && (u += n), f = t.getTime(), f >= e && f <= u + } + + function u(i, r) { + var u = i.getHours(); + return i = new Date(i), s(i, r * n), t(i, u), i + } + + function s(n, t, i) { + var u = n.getTimezoneOffset(), + r; + n.setTime(n.getTime() + t); + i || (r = n.getTimezoneOffset() - u, n.setTime(n.getTime() + r * f)) + } + + function h() { + return i(new Date) + } + + function p(n) { + return i(n).getTime() == h().getTime() + } + + function w(n) { + var t = new Date(1980, 1, 1, 0, 0, 0); + return n && t.setHours(n.getHours(), n.getMinutes(), n.getSeconds(), n.getMilliseconds()), t + } + var f = 6e4, + n = 864e5; + return { + adjustDST: t, + dayOfWeek: c, + setDayOfWeek: e, + getDate: i, + isInDateRange: y, + isInTimeRange: v, + isToday: p, + nextDay: function(n) { + return u(n, 1) + }, + previousDay: function(n) { + return u(n, -1) + }, + toUtcTime: a, + MS_PER_DAY: n, + MS_PER_MINUTE: f, + setTime: s, + addDays: u, + today: h, + toInvariantTime: w, + firstDayOfMonth: o, + lastDayOfMonth: l, + getMilliseconds: r + } + }(); + i.stripWhitespace = function(n) { + for (var t = document.createNodeIterator(n, NodeFilter.SHOW_TEXT, function(t) { + return t.parentNode == n ? NodeFilter.FILTER_ACCEPT : NodeFilter.FILTER_REJECT + }, !1); t.nextNode();) t.referenceNode && !t.referenceNode.textContent.trim() && t.referenceNode.parentNode.removeChild(t.referenceNode) + }; + yt = window.requestAnimationFrame || window.webkitRequestAnimationFrame || window.mozRequestAnimationFrame || window.oRequestAnimationFrame || window.msRequestAnimationFrame || function(n) { + setTimeout(n, 1e3 / 60) + }; + i.animationFrame = function(n) { + yt.call(window, n) + }; + k = []; + i.queueAnimation = function(n) { + k[k.length] = n; + k.length === 1 && i.runNextAnimation() + }; + i.runNextAnimation = function() { + var n = k.shift(); + i.animationFrame(function() { + n(); + yt[0] && i.runNextAnimation() + }) + }; + i.parseQueryStringParams = function(n) { + for (var u = n.split("?")[1] || "", r = {}, i = u.split(/&|=/), f = i.length, t = 0; t < f; t += 2) i[t] !== "" && (r[decodeURIComponent(i[t])] = decodeURIComponent(i[t + 1])); + return r + } + }(jQuery); +typeof kendo_module == "undefined" && (kendo_module = function() {}); +kendo_module({ + id: "core", + name: "Core", + category: "framework", + description: "The core of the Kendo framework." +}); +kendo_module({ + id: "fx", + name: "Effects", + category: "framework", + description: "Required for animation effects in all Kendo UI widgets.", + depends: ["core"] + }), + function(n, t) { + function ii(n) { + return parseInt(n, 10) + } + + function p(n, t) { + return ii(n.css(t)) + } + + function ir(n) { + var t = n.effects; + return t === "zoom" && (t = "zoom:in fade:in"), t === "fade" && (t = "fade:in"), t === "slide" && (t = "tile:left"), /^slide:(.+)$/.test(t) && (t = "tile:" + RegExp.$1), t === "overlay" && (t = "slideIn:left"), /^overlay:(.+)$/.test(t) && (t = "slideIn:" + RegExp.$1), n.effects = i.parseEffects(t), tr && t == "tile:left" && (n.previousDivisor = 3), n + } + + function rr(n) { + var t = []; + for (var i in n) t.push(i); + return t + } + + function st(n) { + for (var t in n) rt.indexOf(t) != -1 && d.indexOf(t) == -1 && delete n[t]; + return n + } + + function ht(n, t) { + var r = [], + u = {}, + o, i, s, c; + for (i in t) o = i.toLowerCase(), c = f && rt.indexOf(o) != -1, !h.hasHW3D && c && d.indexOf(o) == -1 ? delete t[i] : (s = t[i], c ? r.push(i + "(" + s + ")") : u[i] = s); + return r.length && (u[e] = r.join(" ")), u + } + + function ri(n, t) { + var u, i, r; + return f ? (u = n.css(e), u == gi) ? t == "scale" ? 1 : 0 : (i = u.match(new RegExp(t + "\\s*\\(([\\d\\w\\.]+)")), r = 0, i ? r = ii(i[1]) : (i = u.match(vi) || [0, 0, 0, 0, 0], t = t.toLowerCase(), yi.test(t) ? r = parseFloat(i[3] / i[2]) : t == "translatey" ? r = parseFloat(i[4] / i[2]) : t == "scale" ? r = parseFloat(i[2]) : t == "rotate" && (r = parseFloat(Math.atan2(i[2], i[1])))), r) : parseFloat(n.css(t)) + } + + function lt(n) { + return n.charAt(0).toUpperCase() + n.substring(1) + } + + function o(n, t) { + var i = l.extend(t), + r = i.prototype.directions; + u[lt(n)] = i; + u.Element.prototype[n] = function(n, t, r, u) { + return new i(this.element, n, t, r, u) + }; + a(r, function(t, r) { + u.Element.prototype[n + lt(r)] = function(n, t, u) { + return new i(this.element, r, n, t, u) + } + }) + } + + function fi(n, t, i, r) { + o(n, { + directions: ui, + startValue: function(n) { + return this._startValue = n, this + }, + endValue: function(n) { + return this._endValue = n, this + }, + shouldHide: function() { + return this._shouldHide + }, + prepare: function(n, u) { + var s = this, + f, e, h = this._direction === "out", + o = s.element.data(t), + c = !(isNaN(o) || o == i); + f = c ? o : typeof this._startValue != "undefined" ? this._startValue : h ? i : r; + e = typeof this._endValue != "undefined" ? this._endValue : h ? r : i; + this._reverse ? (n[t] = e, u[t] = f) : (n[t] = f, u[t] = e); + s._shouldHide = u[t] === r + } + }) + } + + function hi(n, t) { + var r = i.directions[t].vertical, + u = n[r ? nt : ft]() / 2 + "px"; + return oi[t].replace("$size", u) + } + var i = window.kendo, + u = i.effects, + a = n.each, + r = n.extend, + ci = n.proxy, + h = i.support, + vt = h.browser, + f = h.transforms, + s = h.transitions, + li = { + scale: 0, + scalex: 0, + scaley: 0, + scale3d: 0 + }, + ai = { + translate: 0, + translatex: 0, + translatey: 0, + translate3d: 0 + }, + yt = typeof document.documentElement.style.zoom != "undefined" && !f, + vi = /matrix3?d?\s*\(.*,\s*([\d\.\-]+)\w*?,\s*([\d\.\-]+)\w*?,\s*([\d\.\-]+)\w*?,\s*([\d\.\-]+)\w*?/i, + pt = /^(-?[\d\.\-]+)?[\w\s]*,?\s*(-?[\d\.\-]+)?[\w\s]*/i, + yi = /translatex?$/i, + pi = /(zoom|fade|expand)(\w+)/, + wt = /(zoom|fade|expand)/, + wi = /[xy]$/i, + rt = ["perspective", "rotate", "rotatex", "rotatey", "rotatez", "rotate3d", "scale", "scalex", "scaley", "scalez", "scale3d", "skew", "skewx", "skewy", "translate", "translatex", "translatey", "translatez", "translate3d", "matrix", "matrix3d"], + d = ["rotate", "scale", "scalex", "scaley", "skew", "skewx", "skewy", "translate", "translatex", "translatey", "matrix"], + bi = { + rotate: "deg", + scale: "", + skew: "px", + translate: "px" + }, + g = f.css, + ki = Math.round, + di = "", + w = "px", + gi = "none", + ut = "auto", + ft = "width", + nt = "height", + bt = "hidden", + et = "origin", + kt = "abortId", + tt = "overflow", + v = "translate", + b = "position", + dt = "completeCallback", + y = g + "transition", + e = g + "transform", + nr = g + "backface-visibility", + gt = g + "perspective", + ot = "1500px", + ni = "perspective(" + ot + ")", + tr = h.mobileOS && h.mobileOS.majorVersion == 7, + c = { + left: { + reverse: "right", + property: "left", + transition: "translatex", + vertical: !1, + modifier: -1 + }, + right: { + reverse: "left", + property: "left", + transition: "translatex", + vertical: !1, + modifier: 1 + }, + down: { + reverse: "up", + property: "top", + transition: "translatey", + vertical: !0, + modifier: 1 + }, + up: { + reverse: "down", + property: "top", + transition: "translatey", + vertical: !0, + modifier: -1 + }, + top: { + reverse: "bottom" + }, + bottom: { + reverse: "top" + }, + "in": { + reverse: "out", + modifier: -1 + }, + out: { + reverse: "in", + modifier: 1 + }, + vertical: { + reverse: "vertical" + }, + horizontal: { + reverse: "horizontal" + } + }, + ti, ct, l, k, ui, ei, oi, si, it, at; + i.directions = c; + r(n.fn, { + kendoStop: function(n, t) { + return s ? u.stopQueue(this, n || !1, t || !1) : this.stop(n, t) + } + }); + f && !s && (a(d, function(t, i) { + n.fn[i] = function(t) { + if (typeof t == "undefined") return ri(this, i); + var r = n(this)[0], + u = i + "(" + t + bi[i.replace(wi, "")] + ")"; + return r.style.cssText.indexOf(e) == -1 ? n(this).css(e, u) : r.style.cssText = r.style.cssText.replace(new RegExp(i + "\\(.*?\\)", "i"), u), this + }; + n.fx.step[i] = function(t) { + n(t.elem)[i](t.now) + } + }), ti = n.fx.prototype.cur, n.fx.prototype.cur = function() { + return d.indexOf(this.prop) != -1 ? parseFloat(n(this.elem)[this.prop]()) : ti.apply(this, arguments) + }); + i.toggleClass = function(n, t, i, u) { + return t && (t = t.split(" "), s && (i = r({ + exclusive: "all", + duration: 400, + ease: "ease-out" + }, i), n.css(y, i.exclusive + " " + i.duration + "ms " + i.ease), setTimeout(function() { + n.css(y, "").css(nt) + }, i.duration)), a(t, function(t, i) { + n.toggleClass(i, u) + })), n + }; + i.parseEffects = function(n, t) { + var i = {}; + return typeof n == "string" ? a(n.split(" "), function(n, r) { + var o = !wt.test(r), + s = r.replace(pi, function(n, t, i) { + return t + ":" + i.toLowerCase() + }), + u = s.split(":"), + f = u[1], + e = {}; + u.length > 1 && (e.direction = t && o ? c[f].reverse : f); + i[u[0]] = e + }) : a(n, function(n) { + var r = this.direction; + r && t && !wt.test(n) && (this.direction = c[r].reverse); + i[n] = this + }), i + }; + s && r(u, { + transition: function(t, i, u) { + var h, l = 0, + a = t.data("keys") || [], + f, c, o; + if (u = r({ + duration: 200, + ease: "ease-out", + complete: null, + exclusive: "all" + }, u), c = !1, o = function() { + c || (c = !0, f && (clearTimeout(f), f = null), t.removeData(kt).dequeue().css(y, "").css(y), u.complete.call(t)) + }, u.duration = n.fx ? n.fx.speeds[u.duration] || u.duration : u.duration, h = ht(t, i), n.merge(a, rr(h)), t.data("keys", n.unique(a)).height(), t.css(y, u.exclusive + " " + u.duration + "ms " + u.ease).css(y), t.css(h).css(e), s.event) { + t.one(s.event, o); + u.duration !== 0 && (l = 500) + } + f = setTimeout(o, u.duration + l); + t.data(kt, f); + t.data(dt, o) + }, + stopQueue: function(n, t, r) { + var u, f = n.data("keys"), + e = !r && f, + o = n.data(dt); + return e && (u = i.getComputedStyles(n[0], f)), o && o(), e && n.css(u), n.removeData("keys").stop(t) + } + }); + ct = i.Class.extend({ + init: function(n, t) { + var i = this; + i.element = n; + i.effects = []; + i.options = t; + i.restore = [] + }, + run: function(t) { + var a = this, + l, h, v, k = t.length, + c = a.element, + i = a.options, + p = n.Deferred(), + o = {}, + y = {}, + w, b, d, g; + for (a.effects = t, p.then(n.proxy(a, "complete")), c.data("animating", !0), h = 0; h < k; h++) + for (l = t[h], l.setReverse(i.reverse), l.setOptions(i), a.addRestoreProperties(l.restore), l.prepare(o, y), b = l.children(), v = 0, d = b.length; v < d; v++) b[v].duration(i.duration).run(); + for (g in i.effects) r(y, i.effects[g].properties); + for (c.is(":visible") || r(o, { + display: c.data("olddisplay") || "block" + }), f && !i.reset && (w = c.data("targetTransform"), w && (o = r(w, o))), o = ht(c, o), f && !s && (o = st(o)), c.css(o).css(e), h = 0; h < k; h++) t[h].setup(); + return i.init && i.init(), c.data("targetTransform", y), u.animate(c, y, r({}, i, { + complete: p.resolve + })), p.promise() + }, + stop: function() { + n(this.element).kendoStop(!0, !0) + }, + addRestoreProperties: function(n) { + for (var i = this.element, t, r = 0, u = n.length; r < u; r++) t = n[r], this.restore.push(t), i.data(t) || i.data(t, i.css(t)) + }, + restoreCallback: function() { + for (var t, i = this.element, n = 0, r = this.restore.length; n < r; n++) t = this.restore[n], i.css(t, i.data(t)) + }, + complete: function() { + var i = this, + r = 0, + t = i.element, + u = i.options, + e = i.effects, + o = e.length; + for (t.removeData("animating").dequeue(), u.hide && t.data("olddisplay", t.css("display")).hide(), this.restoreCallback(), yt && !f && setTimeout(n.proxy(this, "restoreCallback"), 0); r < o; r++) e[r].teardown(); + u.completeCallback && u.completeCallback(t) + } + }); + u.promise = function(n, t) { + var r = [], + f, s = new ct(n, t), + e = i.parseEffects(t.effects), + h, o; + t.effects = e; + for (o in e) f = u[lt(o)], f && (h = new f(n, e[o].direction), r.push(h)); + r[0] ? s.run(r) : (n.is(":visible") || n.css({ + display: n.data("olddisplay") || "block" + }).css("display"), t.init && t.init(), n.dequeue(), s.complete()) + }; + u.transitionPromise = function(n, t, i) { + return u.animateTo(n, t, i), n + }; + r(u, { + animate: function(i, e, o) { + var h = o.transition !== !1; + delete o.transition; + s && "transition" in u && h ? u.transition(i, e, o) : f ? i.animate(st(e), { + queue: !1, + show: !1, + hide: !1, + duration: o.duration, + complete: o.complete + }) : i.each(function() { + var i = n(this), + u = {}; + a(rt, function(n, o) { + var c, y = e ? e[o] + " " : null, + s, w, k, h, l, a; + y && (s = e, o in li && e[o] !== t ? (c = y.match(pt), f && r(s, { + scale: +c[0] + })) : o in ai && e[o] !== t && (w = i.css(b), k = w == "absolute" || w == "fixed", i.data(v) || (k ? i.data(v, { + top: p(i, "top") || 0, + left: p(i, "left") || 0, + bottom: p(i, "bottom"), + right: p(i, "right") + }) : i.data(v, { + top: p(i, "marginTop") || 0, + left: p(i, "marginLeft") || 0 + })), h = i.data(v), c = y.match(pt), c && (l = o == v + "y" ? 0 : +c[1], a = o == v + "y" ? +c[1] : +c[2], k ? (isNaN(h.right) ? isNaN(l) || r(s, { + left: h.left + l + }) : isNaN(l) || r(s, { + right: h.right - l + }), isNaN(h.bottom) ? isNaN(a) || r(s, { + top: h.top + a + }) : isNaN(a) || r(s, { + bottom: h.bottom - a + })) : (isNaN(l) || r(s, { + marginLeft: h.left + l + }), isNaN(a) || r(s, { + marginTop: h.top + a + })))), !f && o != "scale" && o in s && delete s[o], s && r(u, s)) + }); + vt.msie && delete u.scale; + i.animate(u, { + queue: !1, + show: !1, + hide: !1, + duration: o.duration, + complete: o.complete + }) + }) + }, + animateTo: function(t, i, u) { + function a(n) { + i[0].style.cssText = ""; + t.each(function() { + this.style.cssText = "" + }); + h.mobileOS.android || f.css(tt, c); + s || e.css(b, l); + u.completeCallback && u.completeCallback.call(t, n) + } + var o, f = t.parents().filter(i.parents()).first(), + e = n().add(t.parent()).add(i.parent()), + s = t.css(b) == "absolute", + c, l; + s || (l = e.css(b), e.css(b, "absolute")); + u = ir(u); + h.mobileOS.android || (c = f.css(tt), f.css(tt, "hidden")); + n.each(u.effects, function(n, t) { + o = o || t.direction + }); + u.complete = vt.msie ? function() { + setTimeout(a, 0) + } : a; + u.previous = u.reverse ? i : t; + u.reset = !0; + (u.reverse ? t : i).each(function() { + n(this).kendoAnimate(r(!0, {}, u)); + u.complete = null; + u.previous = null + }) + } + }); + u.animatedPromise = u.promise; + u.animatedTransitionPromise = u.transitionPromise; + l = i.Class.extend({ + init: function(n, t) { + var i = this; + i.element = n; + i._direction = t; + i.options = {}; + i._additionalEffects = []; + i.restore || (i.restore = []) + }, + reverse: function() { + return this._reverse = !0, this.run() + }, + play: function() { + return this._reverse = !1, this.run() + }, + add: function(n) { + return this._additionalEffects.push(n), this + }, + direction: function(n) { + return this._direction = n, this + }, + duration: function(n) { + return this._duration = n, this + }, + compositeRun: function() { + var n = this, + t = new ct(n.element, { + reverse: n._reverse, + duration: n._duration + }), + i = n._additionalEffects.concat([n]); + return t.run(i) + }, + run: function() { + if (this._additionalEffects && this._additionalEffects[0]) return this.compositeRun(); + var o = this, + t = o.element, + h = 0, + y = o.restore, + w = y.length, + c, l = n.Deferred(), + i = {}, + a = {}, + v, p = o.children(), + b = p.length; + for (l.then(n.proxy(o, "_complete")), t.data("animating", !0), h = 0; h < w; h++) c = y[h], t.data(c) || t.data(c, t.css(c)); + for (h = 0; h < b; h++) p[h].duration(o._duration).run(); + return o.prepare(i, a), t.is(":visible") || r(i, { + display: t.data("olddisplay") || "block" + }), f && (v = t.data("targetTransform"), v && (i = r(v, i))), i = ht(t, i), f && !s && (i = st(i)), t.css(i).css(e), o.setup(), t.data("targetTransform", a), u.animate(t, a, { + duration: o._duration, + complete: l.resolve + }), l.promise() + }, + stop: function() { + for (var t = 0, i = this.children(), r = i.length, t = 0; t < r; t++) i[t].stop(); + return n(this.element).kendoStop(!0, !0), this + }, + restoreCallback: function() { + for (var t, i = this.element, n = 0, r = this.restore.length; n < r; n++) t = this.restore[n], i.css(t, i.data(t)) + }, + _complete: function() { + var t = this, + i = t.element; + i.removeData("animating").dequeue(); + t.restoreCallback(); + t.shouldHide() && i.data("olddisplay", i.css("display")).hide(); + yt && !f && setTimeout(n.proxy(t, "restoreCallback"), 0); + t.teardown() + }, + setOptions: function(n) { + r(!0, this.options, n) + }, + children: function() { + return [] + }, + shouldHide: n.noop, + setup: n.noop, + prepare: n.noop, + teardown: n.noop, + directions: [], + setReverse: function(n) { + return this._reverse = n, this + } + }); + k = ["left", "right", "up", "down"]; + ui = ["in", "out"]; + o("slideIn", { + directions: k, + divisor: function(n) { + return this.options.divisor = n, this + }, + prepare: function(n, t) { + var r = this, + u, e = r.element, + i = c[r._direction], + h = -i.modifier * (i.vertical ? e.outerHeight() : e.outerWidth()), + o = h / (r.options && r.options.divisor || 1) + w, + s = "0px"; + r._reverse && (u = n, n = t, t = u); + f ? (n[i.transition] = o, t[i.transition] = s) : (n[i.property] = o, t[i.property] = s) + } + }); + o("tile", { + directions: k, + init: function(n, t, i) { + l.prototype.init.call(this, n, t); + this.options = { + previous: i + } + }, + previousDivisor: function(n) { + return this.options.previousDivisor = n, this + }, + children: function() { + var n = this, + t = n._reverse, + r = n.options.previous, + e = n.options.previousDivisor || 1, + u = n._direction, + f = [i.fx(n.element).slideIn(u).setReverse(t)]; + return r && f.push(i.fx(r).slideIn(c[u].reverse).divisor(e).setReverse(!t)), f + } + }); + fi("fade", "opacity", 1, 0); + fi("zoom", "scale", 1, .01); + o("slideMargin", { + prepare: function(n, t) { + var r = this, + i = r.element, + u = r.options, + o = i.data(et), + s = u.offset, + f, e = r._reverse; + e || o !== null || i.data(et, parseFloat(i.css("margin-" + u.axis))); + f = i.data(et) || 0; + t["margin-" + u.axis] = e ? f : f + s + } + }); + o("slideTo", { + prepare: function(n, t) { + var u = this, + e = u.element, + o = u.options, + i = o.offset.split(","), + r = u._reverse; + f ? (t.translatex = r ? 0 : i[0], t.translatey = r ? 0 : i[1]) : (t.left = r ? 0 : i[0], t.top = r ? 0 : i[1]); + e.css("left") + } + }); + o("expand", { + directions: ["horizontal", "vertical"], + restore: [tt], + prepare: function(n, i) { + var f = this, + e = f.element, + o = f.options, + s = f._reverse, + r = f._direction === "vertical" ? nt : ft, + h = e[0].style[r], + c = e.data(r), + u = parseFloat(c || h), + l = ki(e.css(r, ut)[r]()); + n.overflow = bt; + u = o && o.reset ? l || u : u || l; + i[r] = (s ? 0 : u) + w; + n[r] = (s ? u : 0) + w; + c === t && e.data(r, h) + }, + shouldHide: function() { + return this._reverse + }, + teardown: function() { + var t = this, + i = t.element, + n = t._direction === "vertical" ? nt : ft, + r = i.data(n); + (r == ut || r === di) && setTimeout(function() { + i.css(n, ut).css(n) + }, 0) + } + }); + ei = { + position: "absolute", + marginLeft: 0, + marginTop: 0, + scale: 1 + }; + o("transfer", { + init: function(n, t) { + this.element = n; + this.options = { + target: t + }; + this.restore = [] + }, + setup: function() { + this.element.appendTo(document.body) + }, + prepare: function(n, t) { + var s = this, + i = s.element, + g = s.options, + nt = s._reverse, + h = g.target, + u, tt = ri(i, "scale"), + l = h.offset(), + a = h.outerHeight() / i.outerHeight(); + r(n, ei); + t.scale = 1; + i.css(e, "scale(1)").css(e); + u = i.offset(); + i.css(e, "scale(" + tt + ")"); + var f = 0, + o = 0, + v = l.left - u.left, + y = l.top - u.top, + p = f + i.outerWidth(), + b = o, + it = v + h.outerWidth(), + rt = y, + c = (y - o) / (v - f), + k = (rt - b) / (it - p), + d = (o - b - c * f + k * p) / (k - c), + ut = o + c * (d - f); + n.top = u.top; + n.left = u.left; + n.transformOrigin = d + w + " " + ut + w; + nt ? n.scale = a : t.scale = a + } + }); + oi = { + top: "rect(auto auto $size auto)", + bottom: "rect($size auto auto auto)", + left: "rect(auto $size auto auto)", + right: "rect(auto auto auto $size)" + }; + si = { + top: { + start: "rotatex(0deg)", + end: "rotatex(180deg)" + }, + bottom: { + start: "rotatex(-180deg)", + end: "rotatex(0deg)" + }, + left: { + start: "rotatey(0deg)", + end: "rotatey(-180deg)" + }, + right: { + start: "rotatey(180deg)", + end: "rotatey(0deg)" + } + }; + o("turningPage", { + directions: k, + init: function(n, t, i) { + l.prototype.init.call(this, n, t); + this._container = i + }, + prepare: function(n, t) { + var r = this, + f = r._reverse, + o = f ? c[r._direction].reverse : r._direction, + u = si[o]; + n.zIndex = 1; + r._clipInHalf && (n.clip = hi(r._container, i.directions[o].reverse)); + n[nr] = bt; + t[e] = ni + (f ? u.start : u.end); + n[e] = ni + (f ? u.end : u.start) + }, + setup: function() { + this._container.append(this.element) + }, + face: function(n) { + return this._face = n, this + }, + shouldHide: function() { + var n = this, + t = n._reverse, + i = n._face; + return t && !i || !t && i + }, + clipInHalf: function(n) { + return this._clipInHalf = n, this + }, + temporary: function() { + return this.element.addClass("temp-page"), this + } + }); + o("staticPage", { + directions: k, + init: function(n, t, i) { + l.prototype.init.call(this, n, t); + this._container = i + }, + restore: ["clip"], + prepare: function(n, t) { + var i = this, + r = i._reverse ? c[i._direction].reverse : i._direction; + n.clip = hi(i._container, r); + n.opacity = .999; + t.opacity = 1 + }, + shouldHide: function() { + var n = this, + t = n._reverse, + i = n._face; + return t && !i || !t && i + }, + face: function(n) { + return this._face = n, this + } + }); + o("pageturn", { + directions: ["horizontal", "vertical"], + init: function(n, t, i, r) { + l.prototype.init.call(this, n, t); + this.options = {}; + this.options.face = i; + this.options.back = r + }, + children: function() { + var r = this, + u = r.options, + n = r._direction === "horizontal" ? "left" : "top", + f = i.directions[n].reverse, + t = r._reverse, + o, s = u.face.clone(!0).removeAttr("id"), + h = u.back.clone(!0).removeAttr("id"), + e = r.element; + return t && (o = n, n = f, f = o), [i.fx(u.face).staticPage(n, e).face(!0).setReverse(t), i.fx(u.back).staticPage(f, e).setReverse(t), i.fx(s).turningPage(n, e).face(!0).clipInHalf(!0).temporary().setReverse(t), i.fx(h).turningPage(f, e).clipInHalf(!0).temporary().setReverse(t)] + }, + prepare: function(n, t) { + n[gt] = ot; + n.transformStyle = "preserve-3d"; + n.opacity = .999; + t.opacity = 1 + }, + teardown: function() { + this.element.find(".temp-page").remove() + } + }); + o("flip", { + directions: ["horizontal", "vertical"], + init: function(n, t, i, r) { + l.prototype.init.call(this, n, t); + this.options = {}; + this.options.face = i; + this.options.back = r + }, + children: function() { + var n = this, + f = n.options, + t = n._direction === "horizontal" ? "left" : "top", + r = i.directions[t].reverse, + u = n._reverse, + e, o = n.element; + return u && (e = t, t = r, r = e), [i.fx(f.face).turningPage(t, o).face(!0).setReverse(u), i.fx(f.back).turningPage(r, o).setReverse(u)] + }, + prepare: function(n) { + n[gt] = ot; + n.transformStyle = "preserve-3d" + } + }); + it = i.Class.extend({ + init: function() { + var n = this; + n._tickProxy = ci(n._tick, n); + n._started = !1 + }, + tick: n.noop, + done: n.noop, + onEnd: n.noop, + onCancel: n.noop, + start: function() { + this.done() || (this._started = !0, i.animationFrame(this._tickProxy)) + }, + cancel: function() { + this._started = !1; + this.onCancel() + }, + _tick: function() { + var n = this; + n._started && (n.tick(), n.done() ? (n._started = !1, n.onEnd()) : i.queueAnimation(n._tickProxy)) + } + }); + at = it.extend({ + init: function(n) { + var t = this; + r(t, n); + it.fn.init.call(t) + }, + done: function() { + return this.timePassed() >= this.duration + }, + timePassed: function() { + return Math.min(this.duration, new Date - this.startDate) + }, + moveTo: function(n) { + var t = this, + i = t.movable; + t.initial = i[t.axis]; + t.delta = n.location - t.initial; + t.duration = typeof n.duration == "number" ? n.duration : 300; + t.tick = t._easeProxy(n.ease); + t.startDate = new Date; + t.start() + }, + _easeProxy: function(n) { + var t = this; + return function() { + t.movable.moveAxis(t.axis, n(t.timePassed(), t.initial, t.delta, t.duration)) + } + } + }); + r(at, { + easeOutExpo: function(n, t, i, r) { + return n == r ? t + i : i * (-Math.pow(2, -10 * n / r) + 1) + t + }, + easeOutBack: function(n, t, i, r, u) { + return u = 1.70158, i * ((n = n / r - 1) * n * ((u + 1) * n + u) + 1) + t + } + }); + u.Animation = it; + u.Transition = at; + u.createEffect = o + }(window.kendo.jQuery); +kendo_module({ + id: "data", + name: "Data source", + category: "framework", + description: "Powerful component for using local and remote data.Fully supports CRUD, Sorting, Paging, Filtering, Grouping, and Aggregates.", + depends: ["core"], + features: [{ + id: "data-odata", + name: "OData", + description: "Support for accessing Open Data Protocol (OData) services.", + depends: ["data.odata"] + }, { + id: "data-XML", + name: "XML", + description: "Support for binding to XML.", + depends: ["data.xml"] + }] + }), + function(n, t) { + function gt(n, t, i, u) { + return function(f) { + var e = {}; + for (var o in f) e[o] = f[o]; + e.field = u ? i + "." + f.field : i; + t == r && n._notifyChange && n._notifyChange(e); + n.trigger(t, e) + } + } + + function li(t, i) { + if (t === i) return !0; + var r = n.type(t), + f = n.type(i), + u; + if (r !== f) return !1; + if (r === "date") return t.getTime() === i.getTime(); + if (r !== "object" && r !== "array") return !1; + for (u in t) + if (!li(t[u], i[u])) return !1; + return !0 + } + + function ou(n, t) { + var i; + for (var r in n) + if ((i = n[r], l(i) && i.field && i.field === t) || i === t) return i; + return null + } + + function u(n) { + this.data = n || [] + } + + function it(n, i) { + if (n) { + var r = typeof n === o ? { + field: n, + dir: i + } : n, + u = d(r) ? r : r !== t ? [r] : []; + return pr(u, function(n) { + return !!n.dir + }) + } + } + + function wi(n) { + var i, f, r, t, u = n.filters; + if (u) + for (i = 0, f = u.length; i < f; i++) r = u[i], t = r.operator, t && typeof t === o && (r.operator = pi[t.toLowerCase()] || t), wi(r) + } + + function ct(n) { + if (n && !k(n)) return (d(n) || !n.filters) && (n = { + logic: "and", + filters: d(n) ? n : [n] + }), wi(n), n + } + + function su(n) { + return d(n) ? n : [n] + } + + function rt(n, i) { + var r = typeof n === o ? { + field: n, + dir: i + } : n, + u = d(r) ? r : r !== t ? [r] : []; + return vt(u, function(n) { + return { + field: n.field, + dir: n.dir || "asc", + aggregates: n.aggregates + } + }) + } + + function hu(n, t) { + return n && n.getTime && t && t.getTime ? n.getTime() === t.getTime() : n === t + } + + function cu(n, t, r, u, f) { + var o, h, s, c, e; + for (t = t || [], c = t.length, o = 0; o < c; o++) h = t[o], s = h.aggregate, e = h.field, n[e] = n[e] || {}, n[e][s] = bi[s.toLowerCase()](n[e][s], r, i.accessor(e), u, f) + } + + function ki(n) { + return typeof n == "number" && !isNaN(n) + } + + function lu(n) { + for (var i = n.length, r = new Array(i), t = 0; t < i; t++) r[t] = n[t].toJSON(); + return r + } + + function di(n, t) { + t = t || {}; + var i = new u(n), + f = t.aggregate, + r = t.filter; + return r && (i = i.filter(r)), i.aggregate(f) + } + + function au(n, t, i, r, u) { + for (var e, f, o, s = 0, h = n.length; s < h; s++) { + e = n[s]; + for (f in t) o = u[f], o && o !== f && (e[o] = t[f](e), delete e[f]) + } + } + + function tr(n, t, i, r, u) { + for (var e, f, o, s = 0, h = n.length; s < h; s++) { + e = n[s]; + for (f in t) e[f] = i._parse(f, t[f](e)), o = u[f], o && o !== f && delete e[o] + } + } + + function ir(n, t, i, r, u) { + for (var f, o, e = 0, s = n.length; e < s; e++) f = n[e], o = r[f.field], o && o != f.field && (f.field = o), f.value = i._parse(f.field, f.value), f.hasSubgroups ? ir(f.items, t, i, r, u) : tr(f.items, t, i, r, u) + } + + function ni(n, t, i, r, u, f) { + return function(e) { + return e = n(e), e && !k(r) && (st.call(e) === "[object Array]" || e instanceof p || (e = [e]), i(e, r, new t, u, f)), e || [] + } + } + + function ii(n, t, i, r) { + for (var f, e = 0, u, o; t.length && r;) + if (f = t[e], u = f.items, o = u.length, n && n.field === f.field && n.value === f.value ? (n.hasSubgroups && n.items.length ? ii(n.items[n.items.length - 1], f.items, i, r) : (u = u.slice(i, i + r), n.items = n.items.concat(u)), t.splice(e--, 1)) : f.hasSubgroups && u.length ? ii(f, u, i, r) : (u = u.slice(i, i + r), f.items = u, f.items.length || t.splice(e--, 1)), u.length === 0 ? i -= o : (i = 0, r -= u.length), ++e >= t.length) break; + e < t.length && t.splice(e, t.length - e) + } + + function rr(n) { + for (var i = [], t = 0, r = n.length; t < r; t++) i = n[t].hasSubgroups ? i.concat(rr(n[t].items)) : i.concat(n[t].items.slice()); + return i + } + + function ur(n, t) { + var r, f, u, i; + if (t) + for (r = 0, f = n.length; r < f; r++) u = n[r], i = u.items, u.hasSubgroups ? ur(i, t) : !i.length || i[0] instanceof t || (i.type = t, i.wrapAll(i, i)) + } + + function fr(n, t) { + for (var i = 0, r = n.length; i < r; i++) + if (n[i].hasSubgroups) { + if (fr(n[i].items, t)) return !0 + } else if (t(n[i].items, n[i])) return !0 + } + + function vu(n, t) { + for (var i = 0, r = n.length; i < r; i++) + if (n[i].uid == t.uid) return t = n[i], n.splice(i, 1), t + } + + function er(n, t) { + for (var i, u, r = n.length - 1, f = 0; r >= f; r--) u = n[r], i = { + value: t.get(u.field), + field: u.field, + items: i ? [i] : [t], + hasSubgroups: !!i, + aggregates: {} + }; + return i + } + + function or(n, t) { + return t ? hr(n, function(n) { + return n[t.idField] === t.id + }) : -1 + } + + function sr(n, t) { + return t ? hr(n, function(n) { + return n.uid == t.uid + }) : -1 + } + + function hr(n, t) { + for (var i = 0, r = n.length; i < r; i++) + if (t(n[i])) return i; + return -1 + } + + function cr(n, t) { + if (n && !k(n)) { + var i = n[t], + r; + return (r = l(i) ? i.from || i.field || t : n[t] || t, y(r)) ? t : r + } + return t + } + + function lr(n, t) { + var r, f, i = {}; + for (var u in n) u !== "filters" && (i[u] = n[u]); + if (n.filters) + for (i.filters = [], r = 0, f = n.filters.length; r < f; r++) i.filters[r] = lr(n.filters[r], t); + else i.field = cr(t.fields, i.field); + return i + } + + function lt(n, t) { + for (var o = [], i, u, f, r = 0, e = n.length; r < e; r++) { + i = {}; + u = n[r]; + for (f in u) i[f] = u[f]; + i.field = cr(t.fields, i.field); + i.aggregates && d(i.aggregates) && (i.aggregates = lt(i.aggregates, t)); + o.push(i) + } + return o + } + + function yu(t, i) { + for (var o = n(t)[0].children, h = [], e, c = i[0], l = i[1], u, r, f = 0, s = o.length; f < s; f++)(e = {}, r = o[f], r.disabled) || (e[c.field] = r.text, u = r.attributes.value, u = u && u.specified ? r.value : r.text, e[l.field] = u, h.push(e)); + return h + } + + function pu(t, i) { + for (var s = n(t)[0].tBodies[0], h = s ? s.rows : [], r, v = i.length, l = [], a, f, e, o, u = 0, c = h.length; u < c; u++) { + for (f = {}, o = !0, a = h[u].cells, r = 0; r < v; r++) e = a[r], e.nodeName.toLowerCase() !== "th" && (o = !1, f[i[r].field] = e.innerHTML); + o || l.push(f) + } + return l + } + + function ar(n) { + return function() { + var t = this._data, + i = h.fn[n].apply(this, dt.call(arguments)); + return this._data != t && this._attachBubbleHandlers(), i + } + } + + function vr(t, i) { + function c(n, t) { + return n.filter(t).add(n.find(t)) + } + for (var l = n(t).children(), v = [], r, b = i[0].field, y = i[1] && i[1].field, p = i[2] && i[2].field, w = i[3] && i[3].field, f, s, o, h, u, e = 0, a = l.length; e < a; e++) r = { + _loaded: !0 + }, f = l.eq(e), o = f[0].firstChild, u = f.children(), t = u.filter("ul"), u = u.filter(":not(ul)"), s = f.attr("data-id"), s && (r.id = s), o && (r[b] = o.nodeType == 3 ? o.nodeValue : u.text()), y && (r[y] = c(u, "a").attr("href")), w && (r[w] = c(u, "img").attr("src")), p && (h = c(u, ".k-sprite").prop("className"), r[p] = h && n.trim(h.replace("k-sprite", ""))), t.length && (r.items = vr(t.eq(0), i)), f.attr("data-hasChildren") == "true" && (r.hasChildren = !0), v.push(r); + return v + } + var e = n.extend, + v = n.proxy, + l = n.isPlainObject, + k = n.isEmptyObject, + d = n.isArray, + pr = n.grep, + at = n.ajax, + vt, yt = n.each, + b = n.noop, + i = window.kendo, + y = i.isFunction, + g = i.Observable, + ft = i.Class, + o = "string", + pt = "function", + ei = "create", + oi = "read", + si = "update", + hi = "destroy", + r = "change", + ci = "sync", + wt = "get", + a = "error", + tt = "requestStart", + bt = "progress", + nt = "requestEnd", + wr = [ei, oi, si, hi], + et = function(n) { + return n + }, + ot = i.getter, + kt = i.stringify, + f = Math, + br = [].push, + kr = [].join, + dr = [].pop, + gr = [].splice, + nu = [].shift, + dt = [].slice, + tu = [].unshift, + st = {}.toString, + iu = i.support.stableSort, + ru = /^\/Date\((.*?)\)\/$/, + uu = /(\r+|\n+)/g, + fu = /(?=['\\])/g, + p = g.extend({ + init: function(n, t) { + var i = this; + i.type = t || s; + g.fn.init.call(i); + i.length = n.length; + i.wrapAll(n, i) + }, + toJSON: function() { + for (var i = this.length, t, r = new Array(i), n = 0; n < i; n++) t = this[n], t instanceof s && (t = t.toJSON()), r[n] = t; + return r + }, + parent: b, + wrapAll: function(n, t) { + var r = this, + i, u, f = function() { + return r + }; + for (t = t || [], i = 0, u = n.length; i < u; i++) t[i] = r.wrap(n[i], f); + return t + }, + wrap: function(n, t) { + var i = this, + u; + return n !== null && st.call(n) === "[object Object]" && (u = n instanceof i.type || n instanceof c, u || (n = n instanceof s ? n.toJSON() : n, n = new i.type(n)), n.parent = t, n.bind(r, function(n) { + i.trigger(r, { + field: n.field, + node: n.node, + index: n.index, + items: n.items || [this], + action: n.node ? n.action || "itemchange" : "itemchange" + }) + })), n + }, + push: function() { + var i = this.length, + n = this.wrapAll(arguments), + t; + return t = br.apply(this, n), this.trigger(r, { + action: "add", + index: i, + items: n + }), t + }, + slice: dt, + join: kr, + pop: function() { + var n = this.length, + t = dr.apply(this); + return n && this.trigger(r, { + action: "remove", + index: n - 1, + items: [t] + }), t + }, + splice: function(n, t, i) { + var e = this.wrapAll(dt.call(arguments, 2)), + u, f, o; + if (u = gr.apply(this, [n, t].concat(e)), u.length) + for (this.trigger(r, { + action: "remove", + index: n, + items: u + }), f = 0, o = u.length; f < o; f++) u[f].children && u[f].unbind(r); + return i && this.trigger(r, { + action: "add", + index: n, + items: e + }), u + }, + shift: function() { + var t = this.length, + n = nu.apply(this); + return t && this.trigger(r, { + action: "remove", + index: 0, + items: [n] + }), n + }, + unshift: function() { + var n = this.wrapAll(arguments), + t; + return t = tu.apply(this, n), this.trigger(r, { + action: "add", + index: 0, + items: n + }), t + }, + indexOf: function(n) { + for (var i = this, t = 0, r = i.length; t < r; t++) + if (i[t] === n) return t; + return -1 + }, + forEach: function(n) { + for (var t = 0, i = this.length; t < i; t++) n(this[t], t, this) + }, + map: function(n) { + for (var t = 0, i = [], r = this.length; t < r; t++) i[t] = n(this[t], t, this); + return i + }, + filter: function(n) { + for (var t = 0, i = [], r, u = this.length; t < u; t++) r = this[t], n(r, t, this) && (i[i.length] = r); + return i + }, + find: function(n) { + for (var t = 0, i, r = this.length; t < r; t++) + if (i = this[t], n(i, t, this)) return i + }, + every: function(n) { + for (var t = 0, i, r = this.length; t < r; t++) + if (i = this[t], !n(i, t, this)) return !1; + return !0 + }, + some: function(n) { + for (var t = 0, i, r = this.length; t < r; t++) + if (i = this[t], n(i, t, this)) return !0; + return !1 + }, + remove: function(n) { + this.splice(this.indexOf(n), 1) + }, + empty: function() { + this.splice(0, this.length) + } + }), + s = g.extend({ + init: function(n) { + var r = this, + u, t, f = function() { + return r + }; + g.fn.init.call(this); + for (t in n) u = n[t], t.charAt(0) != "_" && (u = r.wrap(u, t, f)), r[t] = u; + r.uid = i.guid() + }, + shouldSerialize: function(n) { + return this.hasOwnProperty(n) && n !== "_events" && typeof this[n] !== pt && n !== "uid" + }, + forEach: function(n) { + for (var t in this) this.shouldSerialize(t) && n(this[t], t) + }, + toJSON: function() { + var i = {}, + n; + for (var t in this) this.shouldSerialize(t) && (n = this[t], (n instanceof s || n instanceof p) && (n = n.toJSON()), i[t] = n); + return i + }, + get: function(n) { + var t = this; + return t.trigger(wt, { + field: n + }), n === "this" ? t : i.getter(n, !0)(t) + }, + _set: function(n, t) { + var o = this, + f = n.indexOf(".") >= 0, + r, u, e; + if (f) + for (r = n.split("."), u = ""; r.length > 1;) { + if (u += r.shift(), e = i.getter(u, !0)(o), e instanceof s) return e.set(r.join("."), t), f; + u += "." + } + return i.setter(n)(o, t), f + }, + set: function(n, t) { + var u = this, + f = i.getter(n, !0)(u); + f !== t && (u.trigger("set", { + field: n, + value: t + }) || (!u._set(n, u.wrap(t, n, function() { + return u + })) || n.indexOf("(") >= 0 || n.indexOf("[") >= 0) && u.trigger(r, { + field: n + })) + }, + parent: b, + wrap: function(n, t, i) { + var o = this, + u = st.call(n), + f, e; + return n != null && (u === "[object Object]" || u === "[object Array]") && (f = n instanceof p, e = n instanceof h, u !== "[object Object]" || e || f ? (u === "[object Array]" || f || e) && (f || e || (n = new p(n)), n.parent() != i() && n.bind(r, gt(o, r, t, !1))) : (n instanceof s || (n = new s(n)), n.parent() != i() && (n.bind(wt, gt(o, wt, t, !0)), n.bind(r, gt(o, r, t, !0)))), n.parent = i), n + } + }), + ai = { + number: function(n) { + return i.parseFloat(n) + }, + date: function(n) { + return i.parseDate(n) + }, + boolean: function(n) { + return typeof n === o ? n.toLowerCase() === "true" : n != null ? !!n : n + }, + string: function(n) { + return n != null ? n + "" : n + }, + "default": function(n) { + return n + } + }, + eu = { + string: "", + number: 0, + date: new Date, + boolean: !1, + "default": "" + }, + c = s.extend({ + init: function(i) { + var r = this; + (!i || n.isEmptyObject(i)) && (i = n.extend({}, r.defaults, i)); + s.fn.init.call(r, i); + r.dirty = !1; + r.idField && (r.id = r.get(r.idField), r.id === t && (r.id = r._defaultId)) + }, + shouldSerialize: function(n) { + return s.fn.shouldSerialize.call(this, n) && n !== "uid" && !(this.idField !== "id" && n === "id") && n !== "dirty" && n !== "_accessors" + }, + _parse: function(n, t) { + var u = this, + f = n, + r = u.fields || {}, + i; + return n = r[n], n || (n = ou(r, f)), n && (i = n.parse, !i && n.type && (i = ai[n.type.toLowerCase()])), i ? i(t) : t + }, + _notifyChange: function(n) { + var t = n.action; + (t == "add" || t == "remove") && (this.dirty = !0) + }, + editable: function(n) { + return n = (this.fields || {})[n], n ? n.editable !== !1 : !0 + }, + set: function(n, t, i) { + var r = this; + r.editable(n) && (t = r._parse(n, t), li(t, r.get(n)) || (r.dirty = !0, s.fn.set.call(r, n, t, i))) + }, + accept: function(n) { + var t = this, + u = function() { + return t + }, + i, r; + for (i in n) r = n[i], i.charAt(0) != "_" && (r = t.wrap(n[i], i, u)), t._set(i, r); + t.idField && (t.id = t.get(t.idField)); + t.dirty = !1 + }, + isNew: function() { + return this.id === this._defaultId + } + }), + ht, vi, yi, pi, bi, ti, h, ri, ui, w, fi, yr; + c.define = function(n, i) { + i === t && (i = n, n = c); + var s, r = e({ + defaults: {} + }, i), + f, u, y, l, a, w, p = {}, + h, v = r.id; + if (v && (r.idField = v), r.id && delete r.id, v && (r.defaults[v] = r._defaultId = ""), st.call(r.fields) === "[object Array]") { + for (a = 0, w = r.fields.length; a < w; a++) u = r.fields[a], typeof u === o ? p[u] = {} : u.field && (p[u.field] = u); + r.fields = p + } + for (f in r.fields) u = r.fields[f], y = u.type || "default", l = null, h = f, f = typeof u.field === o ? u.field : f, u.nullable || (l = r.defaults[h !== f ? h : f] = u.defaultValue !== t ? u.defaultValue : eu[y.toLowerCase()]), i.id === f && (r._defaultId = l), r.defaults[h !== f ? h : f] = l, u.parse = u.parse || ai[y]; + return s = n.extend(r), s.define = function(n) { + return c.define(s, n) + }, r.fields && (s.fields = r.fields, s.idField = r.idField), s + }; + ht = { + selector: function(n) { + return y(n) ? n : ot(n) + }, + compare: function(n) { + var t = this.selector(n); + return function(n, i) { + return (n = t(n), i = t(i), n == null && i == null) ? 0 : n == null ? -1 : i == null ? 1 : n.localeCompare ? n.localeCompare(i) : n > i ? 1 : n < i ? -1 : 0 + } + }, + create: function(n) { + var t = n.compare || this.compare(n.field); + return n.dir == "desc" ? function(n, i) { + return t(i, n, !0) + } : t + }, + combine: function(n) { + return function(t, i) { + for (var u = n[0](t, i), r = 1, f = n.length; r < f; r++) u = u || n[r](t, i); + return u + } + } + }; + vi = e({}, ht, { + asc: function(n) { + var t = this.selector(n); + return function(n, i) { + var r = t(n), + u = t(i); + return (r && r.getTime && u && u.getTime && (r = r.getTime(), u = u.getTime()), r === u) ? n.__position - i.__position : r == null ? -1 : u == null ? 1 : r.localeCompare ? r.localeCompare(u) : r > u ? 1 : -1 + } + }, + desc: function(n) { + var t = this.selector(n); + return function(n, i) { + var u = t(n), + r = t(i); + return (u && u.getTime && r && r.getTime && (u = u.getTime(), r = r.getTime()), u === r) ? n.__position - i.__position : u == null ? 1 : r == null ? -1 : r.localeCompare ? r.localeCompare(u) : u < r ? 1 : -1 + } + }, + create: function(n) { + return this[n.dir](n.field) + } + }); + vt = function(n, t) { + for (var r = n.length, u = new Array(r), i = 0; i < r; i++) u[i] = t(n[i], i, n); + return u + }; + yi = function() { + function t(n) { + return n.replace(fu, "\\").replace(uu, "") + } + + function n(n, i, r, u) { + var f; + return r != null && (typeof r === o && (r = t(r), f = ru.exec(r), f ? r = new Date(+f[1]) : u ? (r = "'" + r.toLowerCase() + "'", i = "(" + i + " || '').toLowerCase()") : r = "'" + r + "'"), r.getTime && (i = "(" + i + "?" + i + ".getTime():" + i + ")", r = r.getTime())), i + " " + n + " " + r + } + return { + eq: function(t, i, r) { + return n("==", t, i, r) + }, + neq: function(t, i, r) { + return n("!=", t, i, r) + }, + gt: function(t, i, r) { + return n(">", t, i, r) + }, + gte: function(t, i, r) { + return n(">=", t, i, r) + }, + lt: function(t, i, r) { + return n("<", t, i, r) + }, + lte: function(t, i, r) { + return n("<=", t, i, r) + }, + startswith: function(n, i, r) { + return r && (n = "(" + n + " || '').toLowerCase()", i && (i = i.toLowerCase())), i && (i = t(i)), n + ".lastIndexOf('" + i + "', 0) == 0" + }, + endswith: function(n, i, r) { + return r && (n = "(" + n + " || '').toLowerCase()", i && (i = i.toLowerCase())), i && (i = t(i)), n + ".indexOf('" + i + "', " + n + ".length - " + (i || "").length + ") >= 0" + }, + contains: function(n, i, r) { + return r && (n = "(" + n + " || '').toLowerCase()", i && (i = i.toLowerCase())), i && (i = t(i)), n + ".indexOf('" + i + "') >= 0" + }, + doesnotcontain: function(n, i, r) { + return r && (n = "(" + n + " || '').toLowerCase()", i && (i = i.toLowerCase())), i && (i = t(i)), n + ".indexOf('" + i + "') == -1" + } + } + }(); + u.filterExpr = function(n) { + for (var l = [], r, f, e = [], o = [], h, c, v = n.filters, s = 0, a = v.length; s < a; s++) r = v[s], h = r.field, c = r.operator, r.filters ? (f = u.filterExpr(r), r = f.expression.replace(/__o\[(\d+)\]/g, function(n, t) { + return t = +t, "__o[" + (o.length + t) + "]" + }).replace(/__f\[(\d+)\]/g, function(n, t) { + return t = +t, "__f[" + (e.length + t) + "]" + }), o.push.apply(o, f.operators), e.push.apply(e, f.fields)) : (typeof h === pt ? (f = "__f[" + e.length + "](d)", e.push(h)) : f = i.expr(h), typeof c === pt ? (r = "__o[" + o.length + "](" + f + ", " + r.value + ")", o.push(c)) : r = yi[(c || "eq").toLowerCase()](f, r.value, r.ignoreCase !== t ? r.ignoreCase : !0)), l.push(r); + return { + expression: "(" + l.join({ + and: " && ", + or: " || " + }[n.logic]) + ")", + fields: e, + operators: o + } + }; + pi = { + "==": "eq", + equals: "eq", + isequalto: "eq", + equalto: "eq", + equal: "eq", + "!=": "neq", + ne: "neq", + notequals: "neq", + isnotequalto: "neq", + notequalto: "neq", + notequal: "neq", + "<": "lt", + islessthan: "lt", + lessthan: "lt", + less: "lt", + "<=": "lte", + le: "lte", + islessthanorequalto: "lte", + lessthanequal: "lte", + ">": "gt", + isgreaterthan: "gt", + greaterthan: "gt", + greater: "gt", + ">=": "gte", + isgreaterthanorequalto: "gte", + greaterthanequal: "gte", + ge: "gte", + notsubstringof: "doesnotcontain" + }; + u.normalizeFilter = ct; + u.prototype = { + toArray: function() { + return this.data + }, + range: function(n, t) { + return new u(this.data.slice(n, n + t)) + }, + skip: function(n) { + return new u(this.data.slice(n)) + }, + take: function(n) { + return new u(this.data.slice(0, n)) + }, + select: function(n) { + return new u(vt(this.data, n)) + }, + order: function(n, t) { + var i = { + dir: t + }; + return n && (n.compare ? i.compare = n.compare : i.field = n), new u(this.data.slice(0).sort(ht.create(i))) + }, + orderBy: function(n) { + return this.order(n, "asc") + }, + orderByDescending: function(n) { + return this.order(n, "desc") + }, + sort: function(n, t, i) { + var r, f, u = it(n, t), + e = []; + if (i = i || ht, u.length) { + for (r = 0, f = u.length; r < f; r++) e.push(i.create(u[r])); + return this.orderBy({ + compare: i.combine(e) + }) + } + return this + }, + filter: function(n) { + var t, r, s, i, h, c = this.data, + f, e, l = [], + o; + if (n = ct(n), !n || n.filters.length === 0) return this; + for (i = u.filterExpr(n), f = i.fields, e = i.operators, h = o = new Function("d, __f, __o", "return " + i.expression), (f.length || e.length) && (o = function(n) { + return h(n, f, e) + }), t = 0, s = c.length; t < s; t++) r = c[t], o(r) && l.push(r); + return new u(l) + }, + group: function(n, t) { + n = rt(n || []); + t = t || this.data; + var f = this, + i = new u(f.data), + r; + return n.length > 0 && (r = n[0], i = i.groupBy(r).select(function(i) { + var f = new u(t).filter([{ + field: i.field, + operator: "eq", + value: i.value, + ignoreCase: !1 + }]); + return { + field: i.field, + value: i.value, + items: n.length > 1 ? new u(i.items).group(n.slice(1), f.toArray()).toArray() : i.items, + hasSubgroups: n.length > 1, + aggregates: f.aggregate(r.aggregates) + } + })), i + }, + groupBy: function(n) { + if (k(n) || !this.data.length) return new u([]); + for (var t = n.field, o = this._sortForGrouping(t, n.dir || "asc"), c = i.accessor(t), s, r = c.get(o[0], t), f = { + field: t, + value: r, + items: [] + }, h, a = [f], e = 0, l = o.length; e < l; e++) s = o[e], h = c.get(s, t), hu(r, h) || (r = h, f = { + field: t, + value: r, + items: [] + }, a.push(f)), f.items.push(s); + return new u(a) + }, + _sortForGrouping: function(n, t) { + var i, f, r = this.data; + if (!iu) { + for (i = 0, f = r.length; i < f; i++) r[i].__position = i; + for (r = new u(r).sort(n, t, vi).toArray(), i = 0, f = r.length; i < f; i++) delete r[i].__position; + return r + } + return this.sort(n, t).toArray() + }, + aggregate: function(n) { + var t, i, r = {}; + if (n && n.length) + for (t = 0, i = this.data.length; t < i; t++) cu(r, n, this.data[t], t, i); + return r + } + }; + bi = { + sum: function(n, t, i) { + return (n || 0) + i.get(t) + }, + count: function(n) { + return (n || 0) + 1 + }, + average: function(n, t, i, r, u) { + return n = (n || 0) + i.get(t), r == u - 1 && (n = n / u), n + }, + max: function(n, t, i) { + var r = i.get(t); + return n = n || 0, n < r && (n = r), n + }, + min: function(n, t, i) { + var r = i.get(t); + return ki(n) || (n = r), n > r && ki(r) && (n = r), n + } + }; + u.process = function(n, i) { + i = i || {}; + var r = new u(n), + f = i.group, + e = rt(f || []).concat(it(i.sort || [])), + o, s = i.filter, + h = i.skip, + c = i.take; + return s && (r = r.filter(s), o = r.toArray().length), e && (r = r.sort(e), f && (n = r.toArray())), h !== t && c !== t && (r = r.range(h, c)), f && (r = r.group(f, n)), { + total: o, + data: r.toArray() + } + }; + var gi = ft.extend({ + init: function(n) { + this.data = n.data + }, + read: function(n) { + n.success(this.data) + }, + update: function(n) { + n.success(n.data) + }, + create: function(n) { + n.success(n.data) + }, + destroy: function(n) { + n.success(n.data) + } + }), + nr = ft.extend({ + init: function(n) { + var i = this, + t; + n = i.options = e({}, i.options, n); + yt(wr, function(t, i) { + typeof n[i] === o && (n[i] = { + url: n[i] + }) + }); + i.cache = n.cache ? ut.create(n.cache) : { + find: b, + add: b + }; + t = n.parameterMap; + i.parameterMap = y(t) ? t : function(n) { + var i = {}; + return yt(n, function(n, r) { + n in t && (n = t[n], l(n) && (r = n.value(r), n = n.key)); + i[n] = r + }), i + } + }, + options: { + parameterMap: et + }, + create: function(n) { + return at(this.setup(n, ei)) + }, + read: function(i) { + var f = this, + r, o, u, e = f.cache; + i = f.setup(i, oi); + r = i.success || b; + o = i.error || b; + u = e.find(i.data); + u !== t ? r(u) : (i.success = function(n) { + e.add(i.data, n); + r(n) + }, n.ajax(i)) + }, + update: function(n) { + return at(this.setup(n, si)) + }, + destroy: function(n) { + return at(this.setup(n, hi)) + }, + setup: function(n, t) { + n = n || {}; + var u = this, + r, i = u.options[t], + f = y(i.data) ? i.data(n.data) : i.data; + return n = e(!0, {}, i, n), r = e(!0, {}, f, n.data), n.data = u.parameterMap(r, t), y(n.url) && (n.url = n.url(r)), n + } + }), + ut = ft.extend({ + init: function() { + this._store = {} + }, + add: function(n, i) { + n !== t && (this._store[kt(n)] = i) + }, + find: function(n) { + return this._store[kt(n)] + }, + clear: function() { + this._store = {} + }, + remove: function(n) { + delete this._store[kt(n)] + } + }); + ut.create = function(n) { + var t = { + inmemory: function() { + return new ut + } + }; + return l(n) && y(n.find) ? n : n === !0 ? new ut : t[n]() + }; + ti = ft.extend({ + init: function(n) { + var t = this, + s, u, i, y; + n = n || {}; + for (s in n) u = n[s], t[s] = typeof u === o ? ot(u) : u; + if (y = n.modelBase || c, l(t.model) && (t.model = i = y.define(t.model)), t.model) { + var w = v(t.data, t), + b = v(t.groups, t), + k = v(t.serialize, t), + f = {}, + h = {}, + p = {}, + e = {}, + a = !1, + r; + i = t.model; + i.fields && (yt(i.fields, function(n, t) { + var i; + r = n; + l(t) && t.field ? r = t.field : typeof t === o && (r = t); + l(t) && t.from && (i = t.from); + a = a || i && i !== n || r !== n; + h[n] = ot(i || r); + p[n] = ot(n); + f[i || r] = n; + e[n] = i || r + }), !n.serialize && a && (t.serialize = ni(k, i, au, p, f, e))); + t.data = ni(w, i, tr, h, f, e); + t.groups = ni(b, i, ir, h, f, e) + } + }, + errors: function(n) { + return n ? n.errors : null + }, + parse: et, + data: et, + total: function(n) { + return n.length + }, + groups: et, + aggregates: function() { + return {} + }, + serialize: function(n) { + return n + } + }); + h = g.extend({ + init: function(n) { + var u = this, + o, f; + n && (f = n.data); + n = u.options = e({}, u.options, n); + u._map = {}; + u._prefetch = {}; + u._data = []; + u._pristineData = []; + u._ranges = []; + u._view = []; + u._pristine = []; + u._destroyed = []; + u._pageSize = n.pageSize; + u._page = n.page || (n.pageSize ? 1 : t); + u._sort = it(n.sort); + u._filter = ct(n.filter); + u._group = rt(n.group); + u._aggregate = n.aggregate; + u._total = n.total; + g.fn.init.call(u); + u.transport = ri.create(n, f); + u.reader = new i.data.readers[n.schema.type || "json"](n.schema); + o = u.reader.model || {}; + u._data = u._observe(u._data); + u.bind([a, r, tt, ci, nt, bt], n) + }, + options: { + data: [], + schema: { + modelBase: c + }, + serverSorting: !1, + serverPaging: !1, + serverFiltering: !1, + serverGrouping: !1, + serverAggregates: !1, + batch: !1 + }, + _isServerGrouped: function() { + var n = this.group() || []; + return this.options.serverGrouping && n.length + }, + _flatData: function(n) { + return this._isServerGrouped() ? rr(n) : n + }, + parent: b, + get: function(n) { + for (var i = this._flatData(this._data), t = 0, r = i.length; t < r; t++) + if (i[t].id == n) return i[t] + }, + getByUid: function(n) { + var t, r, i = this._flatData(this._data); + if (i) + for (t = 0, r = i.length; t < r; t++) + if (i[t].uid == n) return i[t] + }, + indexOf: function(n) { + return sr(this._data, n) + }, + at: function(n) { + return this._data[n] + }, + data: function(n) { + var i = this; + if (n !== t) i._data = this._observe(n), i._ranges = [], i._addRange(i._data), i._total = i._data.length, i._process(i._data); + else return i._data + }, + view: function() { + return this._view + }, + add: function(n) { + return this.insert(this._data.length, n) + }, + _createNewModel: function(n) { + return this.reader.model ? new this.reader.model(n) : new s(n) + }, + insert: function(n, t) { + return t || (t = n, n = 0), t instanceof c || (t = this._createNewModel(t)), this._isServerGrouped() ? this._data.splice(n, 0, er(this.group(), t)) : this._data.splice(n, 0, t), t + }, + remove: function(n) { + var t, i = this, + r = i._isServerGrouped(); + return this._eachItem(i._data, function(u) { + return t = vu(u, n), t && r ? (t.isNew && t.isNew() || i._destroyed.push(t), !0) : void 0 + }), n + }, + sync: function() { + var t = this, + i, f, e = [], + o = [], + s = t._destroyed, + u = t._flatData(t._data), + r; + if (t.reader.model) { + for (i = 0, f = u.length; i < f; i++) u[i].isNew() ? e.push(u[i]) : u[i].dirty && o.push(u[i]); + r = t._send("create", e); + r.push.apply(r, t._send("update", o)); + r.push.apply(r, t._send("destroy", s)); + n.when.apply(null, r).then(function() { + for (var n = 0, i = arguments.length; n < i; n++) t._accept(arguments[n]); + t._change({ + action: "sync" + }); + t.trigger(ci) + }) + } + }, + cancelChanges: function(n) { + var t = this; + n instanceof i.data.Model ? t._cancelModel(n) : (t._destroyed = [], t._data = t._observe(t._pristineData), t.options.serverPaging && (t._total = t.reader.total(t._pristine)), t._change()) + }, + hasChanges: function() { + var n, i, t = this._data; + if (this._destroyed.length) return !0; + for (n = 0, i = t.length; n < i; n++) + if (t[n].isNew() || t[n].dirty) return !0; + return !1 + }, + _accept: function(t) { + var r = this, + f = t.models, + i = t.response, + u = 0, + s = r._isServerGrouped(), + h = r._pristineData, + e = t.type, + o; + if (r.trigger(nt, { + response: i, + type: e + }), i && !k(i)) { + if (i = r.reader.parse(i), r._handleCustomErrors(i)) return; + i = r.reader.data(i); + n.isArray(i) || (i = [i]) + } else i = n.map(f, function(n) { + return n.toJSON() + }); + for (e === "destroy" && (r._destroyed = []), u = 0, o = f.length; u < o; u++) e !== "destroy" ? (f[u].accept(i[u]), e === "create" ? h.push(s ? er(r.group(), f[u]) : i[u]) : e === "update" && r._updatePristineForModel(f[u], i[u])) : r._removePristineForModel(f[u]) + }, + _updatePristineForModel: function(n, t) { + this._executeOnPristineForModel(n, function(n, r) { + i.deepExtend(r[n], t) + }) + }, + _executeOnPristineForModel: function(n, t) { + this._eachPristineItem(function(i) { + var r = or(i, n); + if (r > -1) return t(r, i), !0 + }) + }, + _removePristineForModel: function(n) { + this._executeOnPristineForModel(n, function(n, t) { + t.splice(n, 1) + }) + }, + _readData: function(n) { + var t = this._isServerGrouped() ? this.reader.groups : this.reader.data; + return t(n) + }, + _eachPristineItem: function(n) { + this._eachItem(this._pristineData, n) + }, + _eachItem: function(n, t) { + n && n.length && (this._isServerGrouped() ? fr(n, t) : t(n)) + }, + _pristineForModel: function(n) { + var i, t, r = function(r) { + return t = or(r, n), t > -1 ? (i = r[t], !0) : void 0 + }; + return this._eachPristineItem(r), i + }, + _cancelModel: function(n) { + var i = this._pristineForModel(n), + t; + this._eachItem(this._data, function(r) { + t = sr(r, n); + t != -1 && (!n.isNew() && i ? r[t].accept(i) : r.splice(t, 1)) + }) + }, + _promise: function(t, i, r) { + var u = this, + f = u.transport; + return n.Deferred(function(n) { + u.trigger(tt, { + type: r + }); + f[r].call(f, e({ + success: function(t) { + n.resolve({ + response: t, + models: i, + type: r + }) + }, + error: function(t, i, r) { + n.reject(t); + u.error(t, i, r) + } + }, t)) + }).promise() + }, + _send: function(n, t) { + var r = this, + i, f, u = [], + e = r.reader.serialize(lu(t)); + if (r.options.batch) t.length && u.push(r._promise({ + data: { + models: e + } + }, t, n)); + else + for (i = 0, f = t.length; i < f; i++) u.push(r._promise({ + data: e[i] + }, [t[i]], n)); + return u + }, + read: function(n) { + var t = this, + i = t._params(n); + t._queueRequest(i, function() { + t.trigger(tt, { + type: "read" + }) ? t._dequeueRequest() : (t.trigger(bt), t._ranges = [], t.transport.read({ + data: i, + success: v(t.success, t), + error: v(t.error, t) + })) + }) + }, + success: function(t) { + var i = this, + r = i.options; + if (i.trigger(nt, { + response: t, + type: "read" + }), t = i.reader.parse(t), i._handleCustomErrors(t)) { + i._dequeueRequest(); + return + } + i._pristine = l(t) ? n.extend(!0, {}, t) : t.slice ? t.slice(0) : t; + i._total = i.reader.total(t); + i._aggregate && r.serverAggregates && (i._aggregateResult = i.reader.aggregates(t)); + t = i._readData(t); + i._pristineData = t.slice(0); + i._data = i._observe(t); + i._addRange(i._data); + i._process(i._data); + i._dequeueRequest() + }, + _addRange: function(n) { + var t = this, + i = t._skip || 0, + r = i + t._flatData(n).length; + t._ranges.push({ + start: i, + end: r, + data: n + }); + t._ranges.sort(function(n, t) { + return n.start - t.start + }) + }, + error: function(n, t, i) { + this._dequeueRequest(); + this.trigger(nt, {}); + this.trigger(a, { + xhr: n, + status: t, + errorThrown: i + }) + }, + _params: function(n) { + var t = this, + i = e({ + take: t.take(), + skip: t.skip(), + page: t.page(), + pageSize: t.pageSize(), + sort: t._sort, + filter: t._filter, + group: t._group, + aggregate: t._aggregate + }, n); + return t.options.serverPaging || (delete i.take, delete i.skip, delete i.page, delete i.pageSize), t.options.serverGrouping ? t.reader.model && i.group && (i.group = lt(i.group, t.reader.model)) : delete i.group, t.options.serverFiltering ? t.reader.model && i.filter && (i.filter = lr(i.filter, t.reader.model)) : delete i.filter, t.options.serverSorting ? t.reader.model && i.sort && (i.sort = lt(i.sort, t.reader.model)) : delete i.sort, t.options.serverAggregates ? t.reader.model && i.aggregate && (i.aggregate = lt(i.aggregate, t.reader.model)) : delete i.aggregate, i + }, + _queueRequest: function(n, i) { + var r = this; + r._requestInProgress ? r._pending = { + callback: v(i, r), + options: n + } : (r._requestInProgress = !0, r._pending = t, i()) + }, + _dequeueRequest: function() { + var n = this; + n._requestInProgress = !1; + n._pending && n._queueRequest(n._pending.options, n._pending.callback) + }, + _handleCustomErrors: function(n) { + if (this.reader.errors) { + var t = this.reader.errors(n); + if (t) return this.trigger(a, { + xhr: null, + status: "customerror", + errorThrown: "custom error", + errors: t + }), !0 + } + return !1 + }, + _observe: function(n) { + var t = this, + i = t.reader.model, + u = !1; + return i && n.length && (u = !(n[0] instanceof i)), n instanceof p ? u && (n.type = t.reader.model, n.wrapAll(n, n)) : (n = new p(n, t.reader.model), n.parent = function() { + return t.parent() + }), t._isServerGrouped() && ur(n, i), t._changeHandler && t._data && t._data instanceof p ? t._data.unbind(r, t._changeHandler) : t._changeHandler = v(t._change, t), n.bind(r, t._changeHandler) + }, + _change: function(n) { + var t = this, + r, f, i = n ? n.action : "", + u; + if (i === "remove") + for (r = 0, f = n.items.length; r < f; r++) n.items[r].isNew && n.items[r].isNew() || t._destroyed.push(n.items[r]); + t.options.autoSync && (i === "add" || i === "remove" || i === "itemchange") ? t.sync() : (u = parseInt(t._total || t.reader.total(t._pristine), 10), i === "add" ? u += n.items.length : i === "remove" ? u -= n.items.length : i === "itemchange" || i === "sync" || t.options.serverPaging || (u = t.reader.total(t._pristine)), t._total = u, t._process(t._data, n)) + }, + _process: function(n, i) { + var f = this, + e = {}, + o; + f.options.serverPaging !== !0 && (e.skip = f._skip, e.take = f._take || f._pageSize, e.skip === t && f._page !== t && f._pageSize !== t && (e.skip = (f._page - 1) * f._pageSize)); + f.options.serverSorting !== !0 && (e.sort = f._sort); + f.options.serverFiltering !== !0 && (e.filter = f._filter); + f.options.serverGrouping !== !0 && (e.group = f._group); + f.options.serverAggregates !== !0 && (e.aggregate = f._aggregate, f._aggregateResult = di(n, e)); + o = u.process(n, e); + f._view = o.data; + o.total === t || f.options.serverFiltering || (f._total = o.total); + i = i || {}; + i.items = i.items || f._view; + f.trigger(r, i) + }, + _mergeState: function(n) { + var i = this; + return n !== t && (i._pageSize = n.pageSize, i._page = n.page, i._sort = n.sort, i._filter = n.filter, i._group = n.group, i._aggregate = n.aggregate, i._skip = n.skip, i._take = n.take, i._skip === t && (i._skip = i.skip(), n.skip = i.skip()), i._take === t && i._pageSize !== t && (i._take = i._pageSize, n.take = i._take), n.sort && (i._sort = n.sort = it(n.sort)), n.filter && (i._filter = n.filter = ct(n.filter)), n.group && (i._group = n.group = rt(n.group)), n.aggregate && (i._aggregate = n.aggregate = su(n.aggregate))), n + }, + query: function(n) { + var i = this, + f, e = i.options.serverSorting || i.options.serverPaging || i.options.serverFiltering || i.options.serverGrouping || i.options.serverAggregates; + e || (i._data === t || i._data.length === 0) && !i._destroyed.length ? i.read(i._mergeState(n)) : i.trigger(tt, { + type: "read" + }) || (i.trigger(bt), f = u.process(i._data, i._mergeState(n)), i.options.serverFiltering || (i._total = f.total !== t ? f.total : i._data.length), i._view = f.data, i._aggregateResult = di(i._data, n), i.trigger(nt, {}), i.trigger(r, { + items: f.data + })) + }, + fetch: function(t) { + var i = this; + return n.Deferred(function(n) { + var f = function(r) { + i.unbind(a, u); + n.resolve(); + t && t.call(i, r) + }, + u = function(t) { + n.reject(t) + }; + i.one(r, f); + i.one(a, u); + i._query() + }).promise() + }, + _query: function(n) { + var t = this; + t.query(e({}, { + page: t.page(), + pageSize: t.pageSize(), + sort: t.sort(), + filter: t.filter(), + group: t.group(), + aggregate: t.aggregate() + }, n)) + }, + next: function(n) { + var t = this, + i = t.page(), + r = t.total(); + if (n = n || {}, i && (!r || !(i + 1 > t.totalPages()))) return t._skip = i * t.take(), i += 1, n.page = i, t._query(n), i + }, + prev: function(n) { + var t = this, + i = t.page(); + if (n = n || {}, i && i !== 1) return t._skip = t._skip - t.take(), i -= 1, n.page = i, t._query(n), i + }, + page: function(n) { + var i = this, + r; + if (n !== t) { + n = f.max(f.min(f.max(n, 1), i.totalPages()), 1); + i._query({ + page: n + }); + return + } + return r = i.skip(), r !== t ? f.round((r || 0) / (i.take() || 1)) + 1 : t + }, + pageSize: function(n) { + var i = this; + if (n !== t) { + i._query({ + pageSize: n, + page: 1 + }); + return + } + return i.take() + }, + sort: function(n) { + var i = this; + if (n !== t) { + i._query({ + sort: n + }); + return + } + return i._sort + }, + filter: function(n) { + var i = this; + if (n === t) return i._filter; + i._query({ + filter: n, + page: 1 + }) + }, + group: function(n) { + var i = this; + if (n !== t) { + i._query({ + group: n + }); + return + } + return i._group + }, + total: function() { + return parseInt(this._total || 0, 10) + }, + aggregate: function(n) { + var i = this; + if (n !== t) { + i._query({ + aggregate: n + }); + return + } + return i._aggregate + }, + aggregates: function() { + return this._aggregateResult + }, + totalPages: function() { + var n = this, + t = n.pageSize() || n.total(); + return f.ceil((n.total() || 0) / t) + }, + inRange: function(n, t) { + var i = this, + r = f.min(n + t, i.total()); + return !i.options.serverPaging && i.data.length > 0 ? !0 : i._findRange(n, r).length > 0 + }, + lastRange: function() { + var n = this._ranges; + return n[n.length - 1] || { + start: 0, + end: 0, + data: [] + } + }, + firstItemUid: function() { + var n = this._ranges; + return n.length && n[0].data.length && n[0].data[0].uid + }, + range: function(n, i) { + n = f.min(n || 0, this.total()); + var r = this, + e = f.max(f.floor(n / i), 0) * i, + u = f.min(e + i, r.total()), + o; + if (o = r._findRange(n, f.min(n + i, r.total())), o.length) { + r._skip = n > r.skip() ? f.min(u, (r.totalPages() - 1) * r.take()) : e; + r._take = i; + var s = r.options.serverPaging, + h = r.options.serverSorting, + c = r.options.serverFiltering; + try { + r.options.serverPaging = !0; + r._isServerGrouped() || r.group() && r.group().length || (r.options.serverSorting = !0); + r.options.serverFiltering = !0; + s && (r._data = o = r._observe(o)); + r._process(o) + } finally { + r.options.serverPaging = s; + r.options.serverSorting = h; + r.options.serverFiltering = c + } + return + } + i !== t && (r._rangeExists(e, u) ? e < n && r.prefetch(u, i, function() { + r.range(n, i) + }) : r.prefetch(e, i, function() { + n > e && u < r.total() && !r._rangeExists(u, f.min(u + i, r.total())) ? r.prefetch(u, i, function() { + r.range(n, i) + }) : r.range(n, i) + })) + }, + _findRange: function(n, i) { + for (var f = this, p = f._ranges, r, w = [], c, l, s, b, a, v, h = f.options, g = h.serverSorting || h.serverPaging || h.serverFiltering || h.serverGrouping || h.serverAggregates, y, e, d, o = 0, k = p.length; o < k; o++) + if (r = p[o], n >= r.start && n <= r.end) { + for (e = 0, c = o; c < k; c++) + if (r = p[c], y = f._flatData(r.data), y.length && n + e >= r.start && (b = r.data, a = r.end, g || (d = rt(f.group() || []).concat(it(f.sort() || [])), v = u.process(r.data, { + sort: d, + filter: f.filter() + }), y = b = v.data, v.total !== t && (a = v.total)), l = 0, n + e > r.start && (l = n + e - r.start), s = y.length, a > i && (s = s - (a - i)), e += s - l, w = f._mergeGroups(w, b, l, s), i <= r.end && e == i - n)) return w; + break + } + return [] + }, + _mergeGroups: function(n, t, i, r) { + if (this._isServerGrouped()) { + var u = t.toJSON(), + f; + return n.length && (f = n[n.length - 1]), ii(f, u, i, r), n.concat(u) + } + return n.concat(t.slice(i, r)) + }, + skip: function() { + var n = this; + return n._skip === t ? n._page !== t ? (n._page - 1) * (n.take() || 1) : t : n._skip + }, + take: function() { + return this._take || this._pageSize + }, + _prefetchSuccessHandler: function(n, t, i) { + var u = this; + return function(f) { + var h = !1, + e = { + start: n, + end: t, + data: [] + }, + o, c, s; + if (u._dequeueRequest(), u.trigger(nt, { + response: f, + type: "read" + }), f = u.reader.parse(f), s = u._readData(f), s.length) { + for (o = 0, c = u._ranges.length; o < c; o++) + if (u._ranges[o].start === n) { + h = !0; + e = u._ranges[o]; + break + } + h || u._ranges.push(e) + } + e.data = u._observe(s); + e.end = e.start + u._flatData(e.data).length; + u._ranges.sort(function(n, t) { + return n.start - t.start + }); + u._total = u.reader.total(f); + i && s.length ? i() : u.trigger(r, {}) + } + }, + prefetch: function(n, t, i) { + var r = this, + u = f.min(n + t, r.total()), + e = { + take: t, + skip: n, + page: n / t + 1, + pageSize: t, + sort: r._sort, + filter: r._filter, + group: r._group, + aggregate: r._aggregate + }; + r._rangeExists(n, u) ? i && i() : (clearTimeout(r._timeout), r._timeout = setTimeout(function() { + r._queueRequest(e, function() { + r.trigger(tt, { + type: "read" + }) ? r._dequeueRequest() : r.transport.read({ + data: r._params(e), + success: r._prefetchSuccessHandler(n, u, i) + }) + }) + }, 100)) + }, + _rangeExists: function(n, t) { + for (var f = this, r = f._ranges, i = 0, u = r.length; i < u; i++) + if (r[i].start <= n && r[i].end >= t) return !0; + return !1 + } + }); + ri = {}; + ri.create = function(n, t) { + var u, r = n.transport; + return r ? (r.read = typeof r.read === o ? { + url: r.read + } : r.read, n.type && (i.data.transports[n.type] && !l(i.data.transports[n.type]) ? u = new i.data.transports[n.type](e(r, { + data: t + })) : r = e(!0, {}, i.data.transports[n.type], r), n.schema = e(!0, {}, i.data.schemas[n.type], n.schema)), u || (u = y(r.read) ? r : new nr(r))) : u = new gi({ + data: n.data + }), u + }; + h.create = function(n) { + n = n && n.push ? { + data: n + } : n; + var t = n || {}, + u = t.data, + r = t.fields, + c = t.table, + l = t.select, + f, a, s = {}, + o; + if (u || !r || t.transport || (c ? u = pu(c, r) : l && (u = yu(l, r))), i.data.Model && r && (!t.schema || !t.schema.model)) { + for (f = 0, a = r.length; f < a; f++) o = r[f], o.type && (s[o.field] = o); + k(s) || (t.schema = e(!0, t.schema, { + model: { + fields: s + } + })) + } + return t.data = u, t instanceof h ? t : new h(t) + }; + ui = c.define({ + init: function(n) { + var t = this, + r = t.hasChildren || n && n.hasChildren, + f = "items", + u = {}; + i.data.Model.fn.init.call(t, n); + typeof t.children === o && (f = t.children); + u = { + schema: { + data: f, + model: { + hasChildren: r, + id: t.idField + } + } + }; + typeof t.children !== o && e(u, t.children); + u.data = n; + r || (r = u.schema.data); + typeof r === o && (r = i.getter(r)); + y(r) && (t.hasChildren = !!r.call(t, t)); + t._childrenOptions = u; + t.hasChildren && t._initChildren(); + t._loaded = !!(n && (n[f] || n._loaded)) + }, + _initChildren: function() { + var n = this, + t, i, u; + n.children instanceof w || (t = n.children = new w(n._childrenOptions), i = t.transport, u = i.parameterMap, i.parameterMap = function(t) { + return t[n.idField || "id"] = n.id, u && (t = u(t)), t + }, t.parent = function() { + return n + }, t.bind(r, function(t) { + t.node = t.node || n; + n.trigger(r, t) + }), t.bind(a, function(t) { + var i = n.parent(); + i && (t.node = t.node || n, i.trigger(a, t)) + }), n._updateChildrenField()) + }, + append: function(n) { + this._initChildren(); + this.loaded(!0); + this.children.add(n) + }, + hasChildren: !1, + level: function() { + for (var n = this.parentNode(), t = 0; n && n.parentNode;) t++, n = n.parentNode ? n.parentNode() : null; + return t + }, + _updateChildrenField: function() { + var n = this._childrenOptions.schema.data; + this[n || "items"] = this.children.data() + }, + _childrenLoaded: function() { + this._loaded = !0; + this._updateChildrenField() + }, + load: function() { + var i = {}, + u = "_query", + n; + if (this.hasChildren) { + this._initChildren(); + n = this.children; + i[this.idField || "id"] = this.id; + this._loaded || (n._data = t, u = "read"); + n.one(r, v(this._childrenLoaded, this)); + n[u](i) + } else this.loaded(!0) + }, + parentNode: function() { + var n = this.parent(); + return n.parent() + }, + loaded: function(n) { + if (n !== t) this._loaded = n; + else return this._loaded + }, + shouldSerialize: function(n) { + return c.fn.shouldSerialize.call(this, n) && n !== "children" && n !== "_loaded" && n !== "hasChildren" && n !== "_childrenOptions" + } + }); + w = h.extend({ + init: function(n) { + var t = ui.define({ + children: n + }); + h.fn.init.call(this, e(!0, {}, { + schema: { + modelBase: t, + model: t + } + }, n)); + this._attachBubbleHandlers() + }, + _attachBubbleHandlers: function() { + var n = this; + n._data.bind(a, function(t) { + n.trigger(a, t) + }) + }, + remove: function(n) { + var t = n.parentNode(), + i = this, + r; + return t && t._initChildren && (i = t.children), r = h.fn.remove.call(i, n), t && !i.data().length && (t.hasChildren = !1), r + }, + success: ar("success"), + data: ar("data"), + insert: function(n, t) { + var i = this.parent(); + return i && i._initChildren && (i.hasChildren = !0, i._initChildren()), h.fn.insert.call(this, n, t) + }, + _find: function(n, t) { + var r, e, i, u, f; + if (i = h.fn[n].call(this, t), i) return i; + if (u = this._flatData(this.data()), u) + for (r = 0, e = u.length; r < e; r++) + if ((f = u[r].children, f instanceof w) && (i = f[n](t), i)) return i + }, + get: function(n) { + return this._find("get", n) + }, + getByUid: function(n) { + return this._find("getByUid", n) + } + }); + w.create = function(n) { + n = n && n.push ? { + data: n + } : n; + var t = n || {}, + i = t.data, + r = t.fields, + u = t.list; + return i && i._dataSource ? i._dataSource : (i || !r || t.transport || u && (i = vr(u, r)), t.data = i, t instanceof w ? t : new w(t)) + }; + fi = i.Observable.extend({ + init: function(n, t, r) { + i.Observable.fn.init.call(this); + this._prefetching = !1; + this.dataSource = n; + this.prefetch = !r; + var u = this; + n.bind("change", function() { + u._change() + }); + this._syncWithDataSource(); + this.setViewSize(t) + }, + setViewSize: function(n) { + this.viewSize = n; + this._recalculate() + }, + at: function(n) { + var i = this.pageSize, + r, u; + if (n >= this.total()) { + this.trigger("endreached", { + index: n + }); + return + } + return this.useRanges ? (this.useRanges && ((n < this.dataOffset || n > this.skip + i) && (u = Math.floor(n / i) * i, this.range(u)), n === this.prefetchThreshold && this._prefetch(), n === this.midPageThreshold ? this.range(this.nextMidRange) : n === this.nextPageThreshold ? this.range(this.nextFullRange) : n === this.pullBackThreshold && (this.offset === this.skip ? this.range(this.previousMidRange) : this.range(this.previousFullRange)), r = this.dataSource.at(n - this.dataOffset)), r === t && this.trigger("endreached", { + index: n + }), r) : this.dataSource.view()[n] + }, + indexOf: function(n) { + return this.dataSource.data().indexOf(n) + this.dataOffset + }, + total: function() { + return parseInt(this.dataSource.total(), 10) + }, + next: function() { + var n = this, + t = n.pageSize, + i = n.skip - n.viewSize, + r = f.max(f.floor(i / t), 0) * t + t; + this.offset = i; + this.dataSource.prefetch(r, t, function() { + n._goToRange(i, !0) + }) + }, + range: function(n) { + if (this.offset !== n) { + var r = this, + t = this.pageSize, + u = f.max(f.floor(n / t), 0) * t + t, + i = this.dataSource; + this.offset = n; + this._recalculate(); + i.inRange(n, t) ? this._goToRange(n) : this.prefetch && i.prefetch(u, t, function() { + r._goToRange(n, !0) + }) + } + }, + syncDataSource: function() { + var n = this.offset; + this.offset = null; + this.range(n) + }, + destroy: function() { + this.unbind() + }, + _prefetch: function() { + var i = this, + n = this.pageSize, + t = this.skip + n, + r = this.dataSource; + r.inRange(t, n) || this._prefetching || !this.prefetch || (this._prefetching = !0, this.trigger("prefetching", { + skip: t, + take: n + }), r.prefetch(t, n, function() { + i._prefetching = !1; + i.trigger("prefetched", { + skip: t, + take: n + }) + })) + }, + _goToRange: function(n, t) { + this.offset === n && (this.dataOffset = n, this._expanding = t, this.dataSource.range(n, this.pageSize)) + }, + _change: function() { + var n = this.dataSource, + t = n.firstItemUid(); + this.length = this.useRanges ? n.lastRange().end : n.view().length; + this._firstItemUid === t && this.useRanges || (this._syncWithDataSource(), this._recalculate(), this.trigger("reset", { + offset: this.offset + })); + this.trigger("resize"); + this._expanding && this.trigger("expand"); + delete this._expanding + }, + _syncWithDataSource: function() { + var n = this.dataSource; + this._firstItemUid = n.firstItemUid(); + this.dataOffset = this.offset = n.skip() || 0; + this.pageSize = n.pageSize(); + this.useRanges = n.options.serverPaging + }, + _recalculate: function() { + var t = this.pageSize, + r = this.offset, + i = this.viewSize, + n = Math.ceil(r / t) * t; + this.skip = n; + this.midPageThreshold = n + t - 1; + this.nextPageThreshold = n + i - 1; + this.prefetchThreshold = n + Math.floor(t / 3 * 2); + this.pullBackThreshold = this.offset - 1; + this.nextMidRange = n + t - i; + this.nextFullRange = n; + this.previousMidRange = r - i; + this.previousFullRange = n - t + } + }); + yr = i.Observable.extend({ + init: function(n, t) { + var r = this; + i.Observable.fn.init.call(r); + this.dataSource = n; + this.batchSize = t; + this._total = 0; + this.buffer = new fi(n, t * 3); + this.buffer.bind({ + endreached: function(n) { + r.trigger("endreached", { + index: n.index + }) + }, + prefetching: function(n) { + r.trigger("prefetching", { + skip: n.skip, + take: n.take + }) + }, + prefetched: function(n) { + r.trigger("prefetched", { + skip: n.skip, + take: n.take + }) + }, + reset: function() { + r._total = 0; + r.trigger("reset") + }, + resize: function() { + r._total = Math.ceil(this.length / r.batchSize); + r.trigger("resize", { + total: r.total(), + offset: this.offset + }) + } + }) + }, + syncDataSource: function() { + this.buffer.syncDataSource() + }, + at: function(n) { + var i = this.buffer, + f = n * this.batchSize, + o = this.batchSize, + e = [], + u, r; + for (i.offset > f && i.at(i.offset - 1), r = 0; r < o; r++) { + if (u = i.at(f + r), u === t) break; + e.push(u) + } + return e + }, + total: function() { + return this._total + }, + destroy: function() { + this.buffer.destroy(); + this.unbind() + } + }); + e(!0, i.data, { + readers: { + json: ti + }, + Query: u, + DataSource: h, + HierarchicalDataSource: w, + Node: ui, + ObservableObject: s, + ObservableArray: p, + LocalTransport: gi, + RemoteTransport: nr, + Cache: ut, + DataReader: ti, + Model: c, + Buffer: fi, + BatchBuffer: yr + }) + }(window.kendo.jQuery); +kendo_module({ + id: "validator", + name: "Validator", + category: "web", + description: "The Validator offers an easy way to do a client-side form validation.", + depends: ["core"] + }), + function(n) { + function nt(i) { + var r = t.ui.validator.ruleResolvers || {}, + u = {}; + for (var f in r) n.extend(!0, u, r[f].resolve(i)); + return u + } + + function tt(n) { + return n.replace(/&/g, "&").replace(/"/g, '"').replace(/'/g, "'").replace(/</g, "<").replace(/>/g, ">") + } + + function it(n) { + return (n = (n + "").split("."), n.length > 1) ? n[1].length : 0 + } + + function rt(t) { + return n.parseHTML ? n(n.parseHTML(t)) : n(t) + } + var t = window.kendo, + f = t.ui.Widget, + i = ".kendoValidator", + u = "k-invalid-msg", + p = new RegExp(u, "i"), + w = "k-invalid", + b = /^((([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+(\.([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+)*)|((\x22)((((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(([\x01-\x08\x0b\x0c\x0e-\x1f\x7f]|\x21|[\x23-\x5b]|[\x5d-\x7e]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(\\([\x01-\x09\x0b\x0c\x0d-\x7f]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]))))*(((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(\x22)))@((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))$/i, + k = /^(https?|ftp):\/\/(((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:)*@)?(((\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5]))|((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?)(:\d*)?)(\/((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)+(\/(([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)*)*)?)?(\?((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|[\uE000-\uF8FF]|\/|\?)*)?(\#((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|\/|\?)*)?$/i, + r = ":input:not(:button,[type=submit],[type=reset],[disabled],[readonly])", + o = ":checkbox:not([disabled],[readonly])", + e = "[type=number],[type=range]", + s = "blur", + h = "name", + c = "form", + l = "novalidate", + d = n.proxy, + a = function(n, t) { + return typeof t == "string" && (t = new RegExp("^(?:" + t + ")$")), t.test(n) + }, + v = function(n, t, i) { + var r = n.val(); + return n.filter(t).length && r !== "" ? a(r, i) : !0 + }, + g = function(n, t) { + return n.length ? n[0].attributes[t] != null : !1 + }, + y; + t.ui.validator || (t.ui.validator = { + rules: {}, + messages: {} + }); + y = f.extend({ + init: function(i, r) { + var u = this, + e = nt(i); + r = r || {}; + r.rules = n.extend({}, t.ui.validator.rules, e.rules, r.rules); + r.messages = n.extend({}, t.ui.validator.messages, e.messages, r.messages); + f.fn.init.call(u, i, r); + u._errorTemplate = t.template(u.options.errorTemplate); + u.element.is(c) && u.element.attr(l, l); + u._errors = {}; + u._attachEvents() + }, + events: ["validate"], + options: { + name: "Validator", + errorTemplate: '<span class="k-widget k-tooltip k-tooltip-validation"><span class="k-icon k-warning"> <\/span> #=message#<\/span>', + messages: { + required: "{0} is required", + pattern: "{0} is not valid", + min: "{0} should be greater than or equal to {1}", + max: "{0} should be smaller than or equal to {1}", + step: "{0} is not valid", + email: "{0} is not valid email", + url: "{0} is not valid URL", + date: "{0} is not valid date" + }, + rules: { + required: function(n) { + var i = n.filter("[type=checkbox]").length && !n.is(":checked"), + t = n.val(); + return !(g(n, "required") && (t === "" || !t || i)) + }, + pattern: function(n) { + return n.filter("[type=text],[type=email],[type=url],[type=tel],[type=search],[type=password]").filter("[pattern]").length && n.val() !== "" ? a(n.val(), n.attr("pattern")) : !0 + }, + min: function(n) { + if (n.filter(e + ",[" + t.attr("type") + "=number]").filter("[min]").length && n.val() !== "") { + var i = parseFloat(n.attr("min")) || 0, + r = t.parseFloat(n.val()); + return i <= r + } + return !0 + }, + max: function(n) { + if (n.filter(e + ",[" + t.attr("type") + "=number]").filter("[max]").length && n.val() !== "") { + var i = parseFloat(n.attr("max")) || 0, + r = t.parseFloat(n.val()); + return i >= r + } + return !0 + }, + step: function(n) { + if (n.filter(e + ",[" + t.attr("type") + "=number]").filter("[step]").length && n.val() !== "") { + var f = parseFloat(n.attr("min")) || 0, + i = parseFloat(n.attr("step")) || 1, + o = parseFloat(n.val()), + r = it(i), + u; + return r ? (u = Math.pow(10, r), (o - f) * u % (i * u) / Math.pow(100, r) == 0) : (o - f) % i == 0 + } + return !0 + }, + email: function(n) { + return v(n, "[type=email],[" + t.attr("type") + "=email]", b) + }, + url: function(n) { + return v(n, "[type=url],[" + t.attr("type") + "=url]", k) + }, + date: function(n) { + return n.filter("[type^=date],[" + t.attr("type") + "=date]").length && n.val() !== "" ? t.parseDate(n.val(), n.attr(t.attr("format"))) !== null : !0 + } + }, + validateOnBlur: !0 + }, + destroy: function() { + f.fn.destroy.call(this); + this.element.off(i) + }, + _submit: function(n) { + return this.validate() ? !0 : (n.stopPropagation(), n.stopImmediatePropagation(), n.preventDefault(), !1) + }, + _attachEvents: function() { + var t = this; + if (t.element.is(c)) t.element.on("submit" + i, d(t._submit, t)); + if (t.options.validateOnBlur) + if (t.element.is(r)) { + t.element.on(s + i, function() { + t.validateInput(t.element) + }); + if (t.element.is(o)) t.element.on("click" + i, function() { + t.validateInput(t.element) + }) + } else { + t.element.on(s + i, r, function() { + t.validateInput(n(this)) + }); + t.element.on("click" + i, o, function() { + t.validateInput(n(this)) + }) + } + }, + validate: function() { + var i, n, t = !1, + f, u; + if (this._errors = {}, this.element.is(r)) t = this.validateInput(this.element); + else { + for (u = !1, i = this.element.find(r), n = 0, f = i.length; n < f; n++) this.validateInput(i.eq(n)) || (u = !0); + t = !u + } + return this.trigger("validate", { + valid: t + }), t + }, + validateInput: function(t) { + var r; + t = n(t); + var i = this, + c = i._errorTemplate, + s = i._checkValidity(t), + f = s.valid, + l = "." + u, + e = t.attr(h) || "", + a = i._findMessageContainer(e).add(t.next(l)).hide(), + o; + return t.removeAttr("aria-invalid"), f || (o = i._extractMessage(t, s.key), i._errors[e] = o, r = rt(c({ + message: tt(o) + })), i._decorateMessageContainer(r, e), a.replaceWith(r).length || r.insertAfter(t), r.show(), t.attr("aria-invalid", !0)), t.toggleClass(w, !f), f + }, + hideMessages: function() { + var i = this, + t = "." + u, + n = i.element; + n.is(r) ? n.next(t).hide() : n.find(t).hide() + }, + _findMessageContainer: function(i) { + for (var u, h, e = t.ui.validator.messageLocators, o, r = n(), s = this.element[0].getElementsByTagName("*"), f = 0, c = s.length; f < c; f++) u = s[f], p.test(u.className) && (h = u.getAttribute(t.attr("for")), h === i && (r = r.add(u))); + for (o in e) r = r.add(e[o].locate(this.element, i)); + return r + }, + _decorateMessageContainer: function(n, i) { + var r = t.ui.validator.messageLocators, + f; + n.addClass(u).attr(t.attr("for"), i || ""); + for (f in r) r[f].decorate(n, i); + n.attr("role", "alert") + }, + _extractMessage: function(n, i) { + var u = this, + r = u.options.messages[i], + f = n.attr(h); + return r = t.isFunction(r) ? r(n) : r, t.format(n.attr(t.attr(i + "-msg")) || n.attr("validationMessage") || n.attr("title") || r || "", f, n.attr(i)) + }, + _checkValidity: function(n) { + var t = this.options.rules; + for (var i in t) + if (!t[i](n)) return { + valid: !1, + key: i + }; + return { + valid: !0 + } + }, + errors: function() { + var n = [], + t = this._errors; + for (var i in t) n.push(t[i]); + return n + } + }); + t.ui.plugin(y) + }(window.kendo.jQuery); +kendo_module({ + id: "userevents", + name: "User Events", + category: "framework", + depends: ["core"], + hidden: !0 + }), + function(n) { + function it(n, t) { + var i = n.x.location, + r = n.y.location, + u = t.x.location, + f = t.y.location, + e = i - u, + o = r - f; + return { + center: { + x: (i + u) / 2, + y: (r + f) / 2 + }, + distance: Math.sqrt(e * e + o * o) + } + } + + function h(n) { + var t = [], + r = n.originalEvent, + f = n.currentTarget, + e = 0, + s, o, u; + if (n.api) t.push({ + id: 2, + event: n, + target: n.target, + currentTarget: n.target, + location: n + }); + else if (n.type.match(/touch/)) + for (o = r ? r.changedTouches : [], s = o.length; e < s; e++) u = o[e], t.push({ + location: u, + event: n, + target: u.target, + currentTarget: f, + id: u.identifier + }); + else i.pointers || i.msPointers ? t.push({ + location: r, + event: n, + target: n.target, + currentTarget: f, + id: r.pointerId + }) : t.push({ + id: 1, + event: n, + target: n.target, + currentTarget: f, + location: n + }); + return t + } + + function ct(t) { + var i, r, u; + t.preventDefault(); + i = n(t.data.root); + r = i.closest(".k-widget").parent(); + r[0] || (r = i.parent()); + u = n.extend(!0, {}, t, { + target: i[0] + }); + r.trigger(n.Event(t.type, u)) + } + + function ut(n) { + for (var r = t.eventMap.up.split(" "), i = 0, u = r.length; i < u; i++) n(r[i]) + } + var t = window.kendo, + i = t.support, + ft = window.document, + c = t.Class, + l = t.Observable, + u = n.now, + f = n.extend, + a = i.mobileOS, + et = a && a.android, + v = 800, + ot = i.browser.msie ? 5 : 0, + y = "press", + p = "hold", + w = "select", + b = "start", + e = "move", + o = "end", + k = "cancel", + s = "tap", + d = "release", + st = "gesturestart", + g = "gesturechange", + nt = "gestureend", + tt = "gesturetap", + rt = c.extend({ + init: function(n, t) { + var i = this; + i.axis = n; + i._updateLocationData(t); + i.startLocation = i.location; + i.velocity = i.delta = 0; + i.timeStamp = u() + }, + move: function(n) { + var t = this, + i = n["page" + t.axis], + r = u(), + f = r - t.timeStamp || 1; + (i || !et) && (t.delta = i - t.location, t._updateLocationData(n), t.initialDelta = i - t.startLocation, t.velocity = t.delta / f, t.timeStamp = r) + }, + _updateLocationData: function(n) { + var t = this, + i = t.axis; + t.location = n["page" + i]; + t.client = n["client" + i]; + t.screen = n["screen" + i] + } + }), + ht = c.extend({ + init: function(n, t, i) { + var r = this; + f(r, { + x: new rt("X", i.location), + y: new rt("Y", i.location), + userEvents: n, + target: t, + currentTarget: i.currentTarget, + initialTouch: i.target, + id: i.id, + _moved: !1, + _finished: !1 + }); + r.press = function() { + r._trigger(y, i); + r._holdTimeout = setTimeout(function() { + r._trigger(p, i) + }, n.minHold) + } + }, + move: function(n) { + var t = this; + if (!t._finished) { + if (t.x.move(n.location), t.y.move(n.location), !t._moved) { + if (t._withinIgnoreThreshold()) return; + if (r.current && r.current !== t.userEvents) return t.dispose(); + t._start(n) + } + t._finished || t._trigger(e, n) + } + }, + end: function(n) { + var t = this; + (t.endTime = u(), t._finished) || (t._finished = !0, t._moved ? t._trigger(o, n) : t._trigger(s, n), clearTimeout(t._holdTimeout), t._trigger(d, n), t.dispose()) + }, + dispose: function() { + var t = this, + r = t.userEvents, + i = r.touches; + t._finished = !0; + i.splice(n.inArray(t, i), 1) + }, + skip: function() { + this.dispose() + }, + cancel: function() { + this.dispose() + }, + isMoved: function() { + return this._moved + }, + _start: function(n) { + clearTimeout(this._holdTimeout); + this.startTime = u(); + this._moved = !0; + this._trigger(b, n) + }, + _trigger: function(n, t) { + var i = this, + r = t.event, + u = { + touch: i, + x: i.x, + y: i.y, + target: i.target, + event: r + }; + i.userEvents.notify(n, u) && r.preventDefault() + }, + _withinIgnoreThreshold: function() { + var n = this.x.initialDelta, + t = this.y.initialDelta; + return Math.sqrt(n * n + t * t) <= this.userEvents.threshold + } + }), + r = l.extend({ + init: function(r, u) { + var h = this, + a, c = t.guid(), + it, rt; + u = u || {}; + a = h.filter = u.filter; + h.threshold = u.threshold || ot; + h.minHold = u.minHold || v; + h.touches = []; + h._maxTouches = u.multiTouch ? 2 : 1; + h.allowSelection = u.allowSelection; + h.captureUpIfMoved = u.captureUpIfMoved; + h.eventNS = c; + r = n(r).handler(h); + l.fn.init.call(h); + f(h, { + element: r, + surface: u.global ? n(ft.documentElement) : n(u.surface || r), + stopPropagation: u.stopPropagation, + pressed: !1 + }); + h.surface.handler(h).on(t.applyEventMap("move", c), "_move").on(t.applyEventMap("up cancel", c), "_end"); + r.on(t.applyEventMap("down", c), a, "_start"); + if ((i.pointers || i.msPointers) && r.css("-ms-touch-action", "pinch-zoom double-tap-zoom"), u.preventDragEvent) r.on(t.applyEventMap("dragstart", c), t.preventDefault); + r.on(t.applyEventMap("mousedown selectstart", c), a, { + root: r + }, "_select"); + h.captureUpIfMoved && i.eventCapture && (it = h.surface[0], rt = n.proxy(h.preventIfMoving, h), ut(function(n) { + it.addEventListener(n, rt, !0) + })); + h.bind([y, p, s, b, e, o, d, k, st, g, nt, tt, w], u) + }, + preventIfMoving: function(n) { + this._isMoved() && n.preventDefault() + }, + destroy: function() { + var n = this, + t; + n._destroyed || (n._destroyed = !0, n.captureUpIfMoved && i.eventCapture && (t = n.surface[0], ut(function(i) { + t.removeEventListener(i, n.preventIfMoving) + })), n.element.kendoDestroy(n.eventNS), n.surface.kendoDestroy(n.eventNS), n.element.removeData("handler"), n.surface.removeData("handler"), n._disposeAll(), n.unbind(), delete n.surface, delete n.element) + }, + capture: function() { + r.current = this + }, + cancel: function() { + this._disposeAll(); + this.trigger(k) + }, + notify: function(n, t) { + var r = this, + i = r.touches; + if (this._isMultiTouch()) { + switch (n) { + case e: + n = g; + break; + case o: + n = nt; + break; + case s: + n = tt + } + f(t, { + touches: i + }, it(i[0], i[1])) + } + return this.trigger(n, t) + }, + press: function(n, t, i) { + this._apiCall("_start", n, t, i) + }, + move: function(n, t) { + this._apiCall("_move", n, t) + }, + end: function(n, t) { + this._apiCall("_end", n, t) + }, + _isMultiTouch: function() { + return this.touches.length > 1 + }, + _maxTouchesReached: function() { + return this.touches.length >= this._maxTouches + }, + _disposeAll: function() { + for (var n = this.touches; n.length > 0;) n.pop().dispose() + }, + _isMoved: function() { + return n.grep(this.touches, function(n) { + return n.isMoved() + }).length + }, + _select: function(n) { + (!this.allowSelection || this.trigger(w, { + event: n + })) && ct(n) + }, + _start: function(t) { + var i = this, + f = 0, + s = i.filter, + e, o = h(t), + c = o.length, + u; + if (!i._maxTouchesReached()) + for (r.current = null, i.currentTarget = t.currentTarget, i.stopPropagation && t.stopPropagation(); f < c; f++) { + if (i._maxTouchesReached()) break; + (u = o[f], e = s ? n(u.currentTarget) : i.element, e.length) && (u = new ht(i, e, u), i.touches.push(u), u.press(), i._isMultiTouch() && i.notify("gesturestart", {})) + } + }, + _move: function(n) { + this._eachTouch("move", n) + }, + _end: function(n) { + this._eachTouch("end", n) + }, + _eachTouch: function(n, t) { + for (var c = this, e = {}, o = h(t), s = c.touches, r, u, f, i = 0; i < s.length; i++) r = s[i], e[r.id] = r; + for (i = 0; i < o.length; i++) u = o[i], f = e[u.id], f && f[n](u) + }, + _apiCall: function(t, i, r, u) { + this[t]({ + api: !0, + pageX: i, + pageY: r, + clientX: i, + clientY: r, + target: u || this.element, + stopPropagation: n.noop, + preventDefault: n.noop + }) + } + }); + r.minHold = function(n) { + v = n + }; + t.getTouches = h; + t.touchDelta = it; + t.UserEvents = r + }(window.kendo.jQuery); +kendo_module({ + id: "draganddrop", + name: "Drag & drop", + category: "framework", + description: "Drag & drop functionality for any DOM element.", + depends: ["core", "userevents"] + }), + function(n, t) { + function dt(t, i) { + try { + return n.contains(t, i) || t == i + } catch (r) { + return !1 + } + } + + function g(n) { + return kt ? l.elementFromPoint(n.x.screen, n.y.screen) : l.elementFromPoint(n.x.client, n.y.client) + } + + function w(n, t) { + return parseInt(n.css(t), 10) || 0 + } + + function st(n, t) { + return Math.min(Math.max(n, t.min), t.max) + } + + function ht(n, t) { + var i = b(n), + r = i.left + w(n, "borderLeftWidth") + w(n, "paddingLeft"), + u = i.top + w(n, "borderTopWidth") + w(n, "paddingTop"), + f = r + n.width() - t.outerWidth(!0), + e = u + n.height() - t.outerHeight(!0); + return { + x: { + min: r, + max: f + }, + y: { + min: u, + max: e + } + } + } + + function gt(n, i, r) { + for (var f, e, u = 0, o = i && i.length, s = r && r.length; n && n.parentNode;) { + for (u = 0; u < o; u++) + if (f = i[u], f.element[0] === n) return { + target: f, + targetElement: n + }; + for (u = 0; u < s; u++) + if (e = r[u], v.matchesSelector.call(n, e.options.filter)) return { + target: e, + targetElement: n + }; + n = n.parentNode + } + return t + } + var i = window.kendo, + v = i.support, + l = window.document, + pt = i.Class, + o = i.ui.Widget, + u = i.Observable, + wt = i.UserEvents, + f = n.proxy, + r = n.extend, + b = i.getOffset, + y = {}, + s = {}, + h = {}, + e, k = v.mobileOS, + bt = k && k.android, + kt = bt && k.browser == "chrome", + tt = "keyup", + a = "change", + it = "dragstart", + rt = "hold", + ut = "drag", + ft = "dragend", + et = "dragcancel", + d = "dragenter", + p = "dragleave", + ot = "drop", + ni = u.extend({ + init: function(t, r) { + var e = this, + o = t[0]; + e.capture = !1; + o.addEventListener ? (n.each(i.eventMap.down.split(" "), function() { + o.addEventListener(this, f(e._press, e), !0) + }), n.each(i.eventMap.up.split(" "), function() { + o.addEventListener(this, f(e._release, e), !0) + })) : (n.each(i.eventMap.down.split(" "), function() { + o.attachEvent(this, f(e._press, e)) + }), n.each(i.eventMap.up.split(" "), function() { + o.attachEvent(this, f(e._release, e)) + })); + u.fn.init.call(e); + e.bind(["press", "release"], r || {}) + }, + captureNext: function() { + this.capture = !0 + }, + cancelCapture: function() { + this.capture = !1 + }, + _press: function(n) { + var t = this; + t.trigger("press"); + t.capture && n.preventDefault() + }, + _release: function(n) { + var t = this; + t.trigger("release"); + t.capture && (n.preventDefault(), t.cancelCapture()) + } + }), + ct = u.extend({ + init: function(t) { + var i = this; + u.fn.init.call(i); + i.forcedEnabled = !1; + n.extend(i, t); + i.scale = 1; + i.horizontal ? (i.measure = "offsetWidth", i.scrollSize = "scrollWidth", i.axis = "x") : (i.measure = "offsetHeight", i.scrollSize = "scrollHeight", i.axis = "y") + }, + makeVirtual: function() { + n.extend(this, { + virtual: !0, + forcedEnabled: !0, + _virtualMin: 0, + _virtualMax: 0 + }) + }, + virtualSize: function(n, t) { + (this._virtualMin !== n || this._virtualMax !== t) && (this._virtualMin = n, this._virtualMax = t, this.update()) + }, + outOfBounds: function(n) { + return n > this.max || n < this.min + }, + forceEnabled: function() { + this.forcedEnabled = !0 + }, + getSize: function() { + return this.container[0][this.measure] + }, + getTotal: function() { + return this.element[0][this.scrollSize] + }, + rescale: function(n) { + this.scale = n + }, + update: function(n) { + var t = this, + u = t.virtual ? t._virtualMax : t.getTotal(), + r = u * t.scale, + i = t.getSize(); + t.max = t.virtual ? -t._virtualMin : 0; + t.size = i; + t.total = r; + t.min = Math.min(t.max, i - r); + t.minScale = i / u; + t.centerOffset = (r - i) / 2; + t.enabled = t.forcedEnabled || r > i; + n || t.trigger(a, t) + } + }), + ti = u.extend({ + init: function(n) { + var t = this; + u.fn.init.call(t); + t.x = new ct(r({ + horizontal: !0 + }, n)); + t.y = new ct(r({ + horizontal: !1 + }, n)); + t.container = n.container; + t.forcedMinScale = n.minScale; + t.maxScale = n.maxScale || 100; + t.bind(a, n) + }, + rescale: function(n) { + this.x.rescale(n); + this.y.rescale(n); + this.refresh() + }, + centerCoordinates: function() { + return { + x: Math.min(0, -this.x.centerOffset), + y: Math.min(0, -this.y.centerOffset) + } + }, + refresh: function() { + var n = this; + n.x.update(); + n.y.update(); + n.enabled = n.x.enabled || n.y.enabled; + n.minScale = n.forcedMinScale || Math.min(n.x.minScale, n.y.minScale); + n.fitScale = Math.max(n.x.minScale, n.y.minScale); + n.trigger(a) + } + }), + lt = u.extend({ + init: function(n) { + var t = this; + r(t, n); + u.fn.init.call(t) + }, + dragMove: function(n) { + var t = this, + i = t.dimension, + r = t.axis, + u = t.movable, + f = u[r] + n; + i.enabled && ((f < i.min && n < 0 || f > i.max && n > 0) && (n *= t.resistance), u.translateAxis(r, n), t.trigger(a, t)) + } + }), + ii = pt.extend({ + init: function(n) { + var t = this, + u, f, e, i; + r(t, { + elastic: !0 + }, n); + e = t.elastic ? .5 : 0; + i = t.movable; + t.x = u = new lt({ + axis: "x", + dimension: t.dimensions.x, + resistance: e, + movable: i + }); + t.y = f = new lt({ + axis: "y", + dimension: t.dimensions.y, + resistance: e, + movable: i + }); + t.userEvents.bind(["move", "end", "gesturestart", "gesturechange"], { + gesturestart: function(n) { + t.gesture = n; + t.offset = t.dimensions.container.offset() + }, + gesturechange: function(n) { + var h = t.gesture, + c = h.center, + l = n.center, + r = n.distance / h.distance, + v = t.dimensions.minScale, + a = t.dimensions.maxScale, + e, o, s; + i.scale <= v && r < 1 && (r += (1 - r) * .8); + i.scale * r >= a && (r = a / i.scale); + o = i.x + t.offset.left; + s = i.y + t.offset.top; + e = { + x: (o - c.x) * r + l.x - o, + y: (s - c.y) * r + l.y - s + }; + i.scaleWith(r); + u.dragMove(e.x); + f.dragMove(e.y); + t.dimensions.rescale(i.scale); + t.gesture = n; + n.preventDefault() + }, + move: function(n) { + n.event.target.tagName.match(/textarea|input/i) || (u.dimension.enabled || f.dimension.enabled ? (u.dragMove(n.x.delta), f.dragMove(n.y.delta), n.preventDefault()) : n.touch.skip()) + }, + end: function(n) { + n.preventDefault() + } + }) + } + }), + ri = v.transitions.prefix + "Transform", + nt, at, c, vt, yt; + nt = v.hasHW3D ? function(n, t, i) { + return "translate3d(" + n + "px," + t + "px,0) scale(" + i + ")" + } : function(n, t, i) { + return "translate(" + n + "px," + t + "px) scale(" + i + ")" + }; + at = u.extend({ + init: function(t) { + var i = this; + u.fn.init.call(i); + i.element = n(t); + i.element[0].style.webkitTransformOrigin = "left top"; + i.x = 0; + i.y = 0; + i.scale = 1; + i._saveCoordinates(nt(i.x, i.y, i.scale)) + }, + translateAxis: function(n, t) { + this[n] += t; + this.refresh() + }, + scaleTo: function(n) { + this.scale = n; + this.refresh() + }, + scaleWith: function(n) { + this.scale *= n; + this.refresh() + }, + translate: function(n) { + this.x += n.x; + this.y += n.y; + this.refresh() + }, + moveAxis: function(n, t) { + this[n] = t; + this.refresh() + }, + moveTo: function(n) { + r(this, n); + this.refresh() + }, + refresh: function() { + var n = this, + r = n.x, + u = n.y, + t; + n.round && (r = Math.round(r), u = Math.round(u)); + t = nt(r, u, n.scale); + t != n.coordinates && (i.support.browser.msie && i.support.browser.version < 10 ? (n.element[0].style.position = "absolute", n.element[0].style.left = n.x + "px", n.element[0].style.top = n.y + "px") : n.element[0].style[ri] = t, n._saveCoordinates(t), n.trigger(a)) + }, + _saveCoordinates: function(n) { + this.coordinates = n + } + }); + c = o.extend({ + init: function(n, t) { + var i = this, + r; + o.fn.init.call(i, n, t); + r = i.options.group; + r in s ? s[r].push(i) : s[r] = [i] + }, + events: [d, p, ot], + options: { + name: "DropTarget", + group: "default" + }, + destroy: function() { + var i = this.options.group, + t = s[i] || h[i], + n; + if (t.length > 1) { + for (o.fn.destroy.call(this), n = 0; n < t.length; n++) + if (t[n] == this) { + t.splice(n, 1); + break + } + } else c.destroyGroup(i) + }, + _trigger: function(n, t) { + var i = this, + u = y[i.options.group]; + if (u) return i.trigger(n, r({}, t.event, { + draggable: u, + dropTarget: t.dropTarget + })) + }, + _over: function(n) { + this._trigger(d, n) + }, + _out: function(n) { + this._trigger(p, n) + }, + _drop: function(n) { + var t = this, + i = y[t.options.group]; + i && (i.dropped = !t._trigger(ot, n)) + } + }); + c.destroyGroup = function(n) { + var t = s[n] || h[n], + i; + if (t) { + for (i = 0; i < t.length; i++) o.fn.destroy.call(t[i]); + t.length = 0; + delete s[n]; + delete h[n] + } + }; + c._cache = s; + vt = c.extend({ + init: function(n, t) { + var i = this, + r; + o.fn.init.call(i, n, t); + r = i.options.group; + r in h ? h[r].push(i) : h[r] = [i] + }, + options: { + name: "DropTargetArea", + group: "default", + filter: null + } + }); + yt = o.extend({ + init: function(n, t) { + var r = this; + o.fn.init.call(r, n, t); + r._activated = !1; + r.userEvents = new wt(r.element, { + global: !0, + stopPropagation: !0, + filter: r.options.filter, + threshold: r.options.distance, + start: f(r._start, r), + hold: f(r._hold, r), + move: f(r._drag, r), + end: f(r._end, r), + cancel: f(r._cancel, r) + }); + r._afterEndHandler = f(r._afterEnd, r); + r.captureEscape = function(n) { + n.keyCode === i.keys.ESC && (r._trigger(et, { + event: n + }), r.userEvents.cancel()) + } + }, + events: [rt, it, ut, ft, et], + options: { + name: "Draggable", + distance: 5, + group: "default", + cursorOffset: null, + axis: null, + container: null, + holdToDrag: !1, + dropped: !1 + }, + cancelHold: function() { + this._activated = !1 + }, + _updateHint: function(t) { + var r = this, + i, o = r.options, + u = r.boundaries, + e = o.axis, + f = r.options.cursorOffset; + f ? i = { + left: t.x.location + f.left, + top: t.y.location + f.top + } : (r.hintOffset.left += t.x.delta, r.hintOffset.top += t.y.delta, i = n.extend({}, r.hintOffset)); + u && (i.top = st(i.top, u.y), i.left = st(i.left, u.x)); + e === "x" ? delete i.top : e === "y" && delete i.left; + r.hint.css(i) + }, + _start: function(t) { + var r = this, + u = r.options, + o = u.container, + f = u.hint, + e; + if (u.holdToDrag && !r._activated) { + r.userEvents.cancel(); + return + } + r.currentTarget = t.target; + r.currentTargetOffset = b(r.currentTarget); + f && (r.hint && r.hint.stop(!0, !0).remove(), r.hint = i.isFunction(f) ? n(f.call(r, r.currentTarget)) : f, e = b(r.currentTarget), r.hintOffset = e, r.hint.css({ + position: "absolute", + zIndex: 2e4, + left: e.left, + top: e.top + }).appendTo(l.body)); + y[u.group] = r; + r.dropped = !1; + o && (r.boundaries = ht(o, r.hint)); + r._trigger(it, t) && (r.userEvents.cancel(), r._afterEnd()); + n(l).on(tt, r.captureEscape) + }, + _hold: function(n) { + this.currentTarget = n.target; + this._trigger(rt, n) ? this.userEvents.cancel() : this._activated = !0 + }, + _drag: function(t) { + var i = this; + t.preventDefault(); + i._withDropTarget(t, function(i, u) { + if (!i) { + e && (e._trigger(p, r(t, { + dropTarget: n(e.targetElement) + })), e = null); + return + } + if (e) { + if (u === e.targetElement) return; + e._trigger(p, r(t, { + dropTarget: n(e.targetElement) + })) + } + i._trigger(d, r(t, { + dropTarget: n(u) + })); + e = r(i, { + targetElement: u + }) + }); + i._trigger(ut, t); + i.hint && i._updateHint(t) + }, + _end: function(t) { + var i = this; + i._withDropTarget(t, function(i, u) { + i && (i._drop(r({}, t, { + dropTarget: n(u) + })), e = null) + }); + i._trigger(ft, t); + i._cancel(t.event) + }, + _cancel: function() { + var n = this; + n._activated = !1; + n.hint && !n.dropped ? setTimeout(function() { + n.hint.stop(!0, !0).animate(n.currentTargetOffset, "fast", n._afterEndHandler) + }, 0) : n._afterEnd() + }, + _trigger: function(n, t) { + var i = this; + return i.trigger(n, r({}, t.event, { + x: t.x, + y: t.y, + currentTarget: i.currentTarget, + dropTarget: t.dropTarget + })) + }, + _withDropTarget: function(n, t) { + var r = this, + i, u, o = r.options, + f = s[o.group], + e = h[o.group]; + (f && f.length || e && e.length) && (i = g(n), r.hint && dt(r.hint[0], i) && (r.hint.hide(), i = g(n), i || (i = g(n)), r.hint.show()), u = gt(i, f, e), u ? t(u.target, u.targetElement) : t()) + }, + destroy: function() { + var n = this; + o.fn.destroy.call(n); + n._afterEnd(); + n.userEvents.destroy() + }, + _afterEnd: function() { + var t = this; + t.hint && t.hint.remove(); + delete y[t.options.group]; + t.trigger("destroy"); + n(l).off(tt, t.captureEscape) + } + }); + i.ui.plugin(c); + i.ui.plugin(vt); + i.ui.plugin(yt); + i.TapCapture = ni; + i.containerBoundaries = ht; + r(i.ui, { + Pane: ii, + PaneDimensions: ti, + Movable: at + }) + }(window.kendo.jQuery); +kendo_module({ + id: "reorderable", + name: "Reorderable", + category: "framework", + depends: ["core", "draganddrop"], + advanced: !0 + }), + function(n) { + function u(t, i) { + t = n(t); + i ? t.find(".k-drag-status").removeClass("k-add").addClass("k-denied") : t.find(".k-drag-status").removeClass("k-denied").addClass("k-add") + } + var t = window.kendo, + i = t.ui.Widget, + r = "change", + f = "k-reorderable", + e = i.extend({ + init: function(e, o) { + var s = this, + h, c = t.guid() + "-reorderable"; + i.fn.init.call(s, e, o); + e = s.element.addClass(f); + o = s.options; + s.draggable = h = o.draggable || new t.ui.Draggable(e, { + group: c, + filter: o.filter, + hint: o.hint + }); + s.reorderDropCue = n('<div class="k-reorder-cue"><div class="k-icon k-i-arrow-s"><\/div><div class="k-icon k-i-arrow-n"><\/div><\/div>'); + e.find(h.options.filter).kendoDropTarget({ + group: h.options.group, + dragenter: function(n) { + if (s._draggable) { + var i = this.element, + r, f = i[0] === s._draggable[0]; + u(n.draggable.hint, f); + f || (r = t.getOffset(i), s.reorderDropCue.css({ + height: i.outerHeight(), + top: r.top, + left: r.left + (i.index() > s._draggable.index() ? i.outerWidth() : 0) + }).appendTo(document.body)) + } + }, + dragleave: function(n) { + u(n.draggable.hint, !0); + s.reorderDropCue.remove() + }, + drop: function() { + if (s._draggable) { + var t = s._draggable[0], + i = this.element[0], + n; + t !== i && (n = e.find(h.options.filter), s.trigger(r, { + element: s._draggable, + oldIndex: n.index(t), + newIndex: n.index(i) + })) + } + } + }); + h.bind(["dragcancel", "dragend", "dragstart"], { + dragcancel: function() { + s.reorderDropCue.remove(); + s._draggable = null + }, + dragend: function() { + s.reorderDropCue.remove(); + s._draggable = null + }, + dragstart: function(n) { + s._draggable = n.currentTarget + } + }) + }, + options: { + name: "Reorderable", + filter: "*" + }, + events: [r], + destroy: function() { + var n = this; + i.fn.destroy.call(n); + n.draggable && n.draggable.destroy(); + t.destroy(n.element) + } + }); + t.ui.plugin(e) + }(window.kendo.jQuery); +kendo_module({ + id: "resizable", + name: "Resizable", + category: "framework", + depends: ["core", "draganddrop"], + advanced: !0 + }), + function(n, t) { + var u = window.kendo, + o = u.ui, + f = o.Widget, + r = n.proxy, + e = u.isFunction, + s = n.extend, + i = "horizontal", + h = "vertical", + c = "start", + l = "resize", + a = "resizeend", + v = f.extend({ + init: function(n, t) { + var u = this; + f.fn.init.call(u, n, t); + u.orientation = u.options.orientation.toLowerCase() != h ? i : h; + u._positionMouse = u.orientation == i ? "x" : "y"; + u._position = u.orientation == i ? "left" : "top"; + u._sizingDom = u.orientation == i ? "outerWidth" : "outerHeight"; + u.draggable = new o.Draggable(n, { + distance: 0, + filter: t.handle, + drag: r(u._resize, u), + dragcancel: r(u._cancel, u), + dragstart: r(u._start, u), + dragend: r(u._stop, u) + }); + u.userEvents = u.draggable.userEvents + }, + events: [l, a, c], + options: { + name: "Resizable", + orientation: i + }, + resize: function() {}, + _max: function(n) { + var i = this, + u = i.hint ? i.hint[i._sizingDom]() : 0, + r = i.options.max; + return e(r) ? r(n) : r !== t ? i._initialElementPosition + r - u : r + }, + _min: function(n) { + var r = this, + i = r.options.min; + return e(i) ? i(n) : i !== t ? r._initialElementPosition + i : i + }, + _start: function(t) { + var i = this, + r = i.options.hint, + u = n(t.currentTarget); + i._initialElementPosition = u.position()[i._position]; + i._initialMousePosition = t[i._positionMouse].startLocation; + r && (i.hint = e(r) ? n(r(u)) : r, i.hint.css({ + position: "absolute" + }).css(i._position, i._initialElementPosition).appendTo(i.element)); + i.trigger(c, t); + i._maxPosition = i._max(t); + i._minPosition = i._min(t); + n(document.body).css("cursor", u.css("cursor")) + }, + _resize: function(n) { + var i = this, + u = i._maxPosition, + f = i._minPosition, + e = i._initialElementPosition + (n[i._positionMouse].location - i._initialMousePosition), + r; + r = f !== t ? Math.max(f, e) : e; + i.position = r = u !== t ? Math.min(u, r) : r; + i.hint && i.hint.toggleClass(i.options.invalidClass || "", r == u || r == f).css(i._position, r); + i.resizing = !0; + i.trigger(l, s(n, { + position: r + })) + }, + _stop: function(t) { + var i = this; + i.hint && i.hint.remove(); + i.resizing = !1; + i.trigger(a, s(t, { + position: i.position + })); + n(document.body).css("cursor", "") + }, + _cancel: function(n) { + var i = this; + i.hint && (i.position = t, i.hint.css(i._position, i._initialElementPosition), i._stop(n)) + }, + destroy: function() { + var n = this; + f.fn.destroy.call(n); + n.draggable && n.draggable.destroy() + }, + press: function(n) { + if (n) { + var t = n.position(), + i = this; + i.userEvents.press(t.left, t.top, n[0]); + i.targetPosition = t; + i.target = n + } + }, + move: function(n) { + var i = this, + f = i._position, + r = i.targetPosition, + u = i.position; + u === t && (u = r[f]); + r[f] = u + n; + i.userEvents.move(r.left, r.top) + }, + end: function() { + this.userEvents.end(); + this.target = this.position = t + } + }); + u.ui.plugin(v) + }(window.kendo.jQuery); +kendo_module({ + id: "sortable", + name: "Sortable", + category: "framework", + depends: ["data"], + advanced: !0 + }), + function(n, t) { + var i = window.kendo, + s = n.proxy, + r = "dir", + u = "asc", + h = "single", + c = "field", + f = "desc", + l = ".kendoSortable", + a = ".k-link", + e = "aria-sort", + o = i.ui.Widget, + v = o.extend({ + init: function(n, t) { + var i = this, + r; + o.fn.init.call(i, n, t); + i._refreshHandler = s(i.refresh, i); + i.dataSource = i.options.dataSource.bind("change", i._refreshHandler); + r = i.element.find(a); + r[0] || (r = i.element.wrapInner('<a class="k-link" href="#"/>').find(a)); + i.link = r; + i.element.on("click" + l, s(i._click, i)) + }, + options: { + name: "Sortable", + mode: h, + allowUnsort: !0, + compare: null, + filter: "" + }, + destroy: function() { + var n = this; + o.fn.destroy.call(n); + n.element.off(l); + n.dataSource.unbind("change", n._refreshHandler) + }, + refresh: function() { + var o = this, + a = o.dataSource.sort() || [], + s, v, h, l, t = o.element, + y = t.attr(i.attr(c)); + for (t.removeAttr(i.attr(r)), t.removeAttr(e), s = 0, v = a.length; s < v; s++) h = a[s], y == h.field && t.attr(i.attr(r), h.dir); + l = t.attr(i.attr(r)); + t.find(".k-i-arrow-n,.k-i-arrow-s").remove(); + l === u ? (n('<span class="k-icon k-i-arrow-n" />').appendTo(o.link), t.attr(e, "ascending")) : l === f && (n('<span class="k-icon k-i-arrow-s" />').appendTo(o.link), t.attr(e, "descending")) + }, + _click: function(n) { + var e = this, + v = e.element, + y = v.attr(i.attr(c)), + s = v.attr(i.attr(r)), + l = e.options, + p = e.options.compare == null ? t : e.options.compare, + o = e.dataSource.sort() || [], + a, w; + if (n.preventDefault(), !l.filter || v.is(l.filter)) { + if (s = s === u ? f : s === f && l.allowUnsort ? t : u, l.mode === h) o = [{ + field: y, + dir: s, + compare: p + }]; + else if (l.mode === "multiple") { + for (a = 0, w = o.length; a < w; a++) + if (o[a].field === y) { + o.splice(a, 1); + break + } + o.push({ + field: y, + dir: s, + compare: p + }) + } + e.dataSource.sort(o) + } + } + }); + i.ui.plugin(v) + }(window.kendo.jQuery); +kendo_module({ + id: "selectable", + name: "Selectable", + category: "framework", + depends: ["core", "userevents"], + advanced: !0 + }), + function(n) { + function y(n, t) { + var i = u.getOffset(n), + r = t.left + t.width, + f = t.top + t.height; + return i.right = i.left + n.outerWidth(), i.bottom = i.top + n.outerHeight(), !(i.left > r || i.right < t.left || i.top > f || i.bottom < t.top) + } + + function p(n, i, u, e) { + for (var o, s = 0, h = n.length; s < h; s++) o = n.eq(s), y(o, u) ? o.hasClass(t) ? e && i !== o[0] && o.removeClass(t).addClass(r) : o.hasClass(f) || o.hasClass(r) || o.addClass(f) : o.hasClass(f) ? o.removeClass(f) : e && o.hasClass(r) && o.removeClass(r).addClass(t) + } + var u = window.kendo, + s = u.ui.Widget, + i = n.proxy, + h = Math.abs, + c = "aria-selected", + t = "k-state-selected", + f = "k-state-selecting", + e = "k-selectable", + o = "change", + v = ".kendoSelectable", + r = "k-state-unselecting", + l = !1, + a; + (function(n) { + (function() { + n('<div class="parent"><span /><\/div>').on("click", ">*", function() { + l = !0 + }).find("span").click().end().off() + })() + })(n); + a = s.extend({ + init: function(t, r) { + var f = this, + o; + s.fn.init.call(f, t, r); + f._marquee = n("<div class='k-marquee'><div class='k-marquee-color'><\/div><\/div>"); + f._lastActive = null; + f.element.addClass(e); + o = f.options.multiple; + f.userEvents = new u.UserEvents(f.element, { + global: !0, + allowSelection: !0, + filter: (l ? "" : "." + e + " ") + f.options.filter, + tap: i(f._tap, f) + }); + o && f.userEvents.bind("start", i(f._start, f)).bind("move", i(f._move, f)).bind("end", i(f._end, f)).bind("select", i(f._select, f)) + }, + events: [o], + options: { + name: "Selectable", + filter: ">*", + multiple: !1 + }, + _tap: function(i) { + var u = n(i.target), + r = this, + f = i.event.ctrlKey || i.event.metaKey, + s = r.options.multiple, + a = s && i.event.shiftKey, + h, c = i.event.which, + l = i.event.button; + u.closest("." + e)[0] !== r.element[0] || c && c == 3 || l && l == 2 || (h = u.hasClass(t), s && f || r.clear(), a ? r.selectRange(r._firstSelectee(), u) : (h && f ? (r._unselect(u), r._notify(o)) : r.value(u), r._lastActive = r._downTarget = u)) + }, + _start: function(i) { + var u = this, + f = n(i.target), + s = f.hasClass(t), + o = i.event.ctrlKey || i.event.metaKey; + if (u._downTarget = f, f.closest("." + e)[0] !== u.element[0]) { + u.userEvents.cancel(); + u._downTarget = null; + return + } + u._marquee.appendTo(document.body).css({ + left: i.x.client + 1, + top: i.y.client + 1, + width: 0, + height: 0 + }); + o || u.clear(); + s && (u._selectElement(f, !0), o && f.addClass(r)) + }, + _move: function(n) { + var t = this, + i = { + left: n.x.startLocation > n.x.location ? n.x.location : n.x.startLocation, + top: n.y.startLocation > n.y.location ? n.y.location : n.y.startLocation, + width: h(n.x.initialDelta), + height: h(n.y.initialDelta) + }, + r = t.element.find(t.options.filter); + t._marquee.css(i); + p(r, t._downTarget[0], i, n.event.ctrlKey || n.event.metaKey); + n.preventDefault() + }, + _end: function() { + var n = this; + n._marquee.remove(); + n._unselect(n.element.find(n.options.filter + "." + r)).removeClass(r); + n.value(n.element.find(n.options.filter + "." + f)); + n._lastActive = n._downTarget + }, + value: function(n) { + var r = this, + u = i(r._selectElement, r); + if (n) { + n.each(function() { + u(this) + }); + r._notify(o); + return + } + return r.element.find(r.options.filter + "." + t) + }, + _firstSelectee: function() { + var n = this, + t; + return n._lastActive !== null ? n._lastActive : (t = n.value(), t.length > 0 ? t[0] : n.element.find(n.options.filter)) + }, + _selectElement: function(i, r) { + var u = n(i), + e = !r && this._notify("select", { + element: i + }); + u.removeClass(f); + e || (u.addClass(t), this.options.aria && u.attr(c, !0)) + }, + _notify: function(n, t) { + return t = t || {}, this.trigger(n, t) + }, + _unselect: function(n) { + return n.removeClass(t), this.options.aria && n.attr(c, !1), n + }, + _select: function(t) { + var i = "input,a,textarea,.k-multiselect-wrap,select", + r = u.support.browser.msie; + n(t.event.target).is(i) ? (this.userEvents.cancel(), this._downTarget = null) : r && (!r || n(u._activeElement()).is(i)) || t.preventDefault() + }, + clear: function() { + var n = this.element.find(this.options.filter + "." + t); + this._unselect(n) + }, + selectRange: function(r, u) { + var e = this, + s = !1, + h, l, a, f, v = e.element.find(e.options.filter), + c = i(e._selectElement, e); + for (r = n(r)[0], u = n(u)[0], h = 0, l = v.length; h < l; h++) f = v[h], s ? (c(f), s = f !== u) : f === r ? (s = r !== u, c(f)) : f === u ? (a = r, r = u, u = a, s = !0, c(f)) : n(f).removeClass(t); + e._notify(o) + }, + destroy: function() { + var n = this; + s.fn.destroy.call(n); + n.element.off(v); + n.userEvents.destroy() + } + }); + u.ui.plugin(a) + }(window.kendo.jQuery); +kendo_module({ + id: "button", + name: "Button", + category: "web", + description: "The Button widget displays styled buttons.", + depends: ["core"] + }), + function(n, t) { + var u = window.kendo, + o = u.ui.Widget, + i = n.proxy, + f = u.keys, + e = "click", + l = "k-button", + a = "k-button-icon", + v = "k-button-icontext", + r = ".kendoButton", + s = "disabled", + y = "k-state-disabled", + h = "k-state-focused", + c = "k-state-selected", + p = o.extend({ + init: function(n, t) { + var f = this; + o.fn.init.call(f, n, t); + n = f.wrapper = f.element; + t = f.options; + n.addClass(l).attr("role", "button"); + t.enable = t.enable && !n.attr(s); + f.enable(t.enable); + f._tabindex(); + f._graphics(); + n.on(e + r, i(f._click, f)).on("focus" + r, i(f._focus, f)).on("blur" + r, i(f._blur, f)).on("keydown" + r, i(f._keydown, f)).on("keyup" + r, i(f._keyup, f)); + u.notify(f) + }, + events: [e], + options: { + name: "Button", + icon: "", + spriteCssClass: "", + imageUrl: "", + enable: !0 + }, + _isNativeButton: function() { + return this.element.prop("tagName").toLowerCase() == "button" + }, + _click: function(n) { + this.options.enable && this.trigger(e, { + event: n + }) + }, + _focus: function() { + this.options.enable && this.element.addClass(h) + }, + _blur: function() { + this.element.removeClass(h) + }, + _keydown: function(n) { + var t = this; + t._isNativeButton() || (n.keyCode == f.ENTER || n.keyCode == f.SPACEBAR) && (n.keyCode == f.SPACEBAR && (n.preventDefault(), t.options.enable && t.element.addClass(c)), t._click(n)) + }, + _keyup: function() { + this.element.removeClass(c) + }, + _graphics: function() { + var h = this, + t = h.element, + u = h.options, + f = u.icon, + e = u.spriteCssClass, + o = u.imageUrl, + i, r, s; + (e || o || f) && (s = !0, t.contents().not("span.k-sprite").not("span.k-icon").not("img.k-image").each(function(t, i) { + (i.nodeType == 1 || i.nodeType == 3 && n.trim(i.nodeValue).length > 0) && (s = !1) + }), s ? t.addClass(a) : t.addClass(v)); + f ? (i = t.children("span.k-icon").first(), i[0] || (i = n('<span class="k-icon"><\/span>').prependTo(t)), i.addClass("k-i-" + f)) : e ? (i = t.children("span.k-sprite").first(), i[0] || (i = n('<span class="k-sprite"><\/span>').prependTo(t)), i.addClass(e)) : o && (r = t.children("img.k-image").first(), r[0] || (r = n('<img alt="icon" class="k-image" />').prependTo(t)), r.attr("src", o)) + }, + enable: function(n) { + var i = this, + r = i.element; + n === t && (n = !0); + n = !!n; + i.options.enable = n; + r.toggleClass(y, !n).attr("aria-disabled", !n).attr(s, !n) + } + }); + u.ui.plugin(p) + }(window.kendo.jQuery); +kendo_module({ + id: "pager", + name: "Pager", + category: "framework", + depends: ["data"], + advanced: !0 + }), + function(n, t) { + function v(n, t, r, u, f) { + return n({ + idx: t, + text: r, + ns: i.ns, + numeric: u, + title: f || "" + }) + } + + function e(n, t, i) { + return tt({ + className: n.substring(1), + text: t, + wrapClassName: i || "" + }) + } + + function o(n, t, r, u) { + n.find(t).parent().attr(i.attr("page"), r).attr("tabindex", -1).toggleClass("k-state-disabled", u) + } + + function w(n, t) { + o(n, h, 1, t <= 1) + } + + function b(n, t) { + o(n, l, Math.max(1, t - 1), t <= 1) + } + + function k(n, t, i) { + o(n, a, Math.min(i, t + 1), t >= i) + } + + function d(n, t, i) { + o(n, c, i, t >= i) + } + var i = window.kendo, + y = i.ui, + s = y.Widget, + u = n.proxy, + h = ".k-i-seek-w", + c = ".k-i-seek-e", + l = ".k-i-arrow-w", + a = ".k-i-arrow-e", + r = "change", + f = ".kendoPager", + p = "click", + g = "keydown", + nt = "disabled", + tt = i.template('<a href="\\#" title="#=text#" class="k-link k-pager-nav #= wrapClassName #"><span class="k-icon #= className #">#=text#<\/span><\/a>'), + it = s.extend({ + init: function(t, o) { + var v = this, + nt, y; + if (s.fn.init.call(v, t, o), o = v.options, v.dataSource = i.data.DataSource.create(o.dataSource), v.linkTemplate = i.template(v.options.linkTemplate), v.selectTemplate = i.template(v.options.selectTemplate), nt = v.page(), y = v.totalPages(), v._refreshHandler = u(v.refresh, v), v.dataSource.bind(r, v._refreshHandler), o.previousNext && (v.element.find(h).length || (v.element.append(e(h, o.messages.first, "k-pager-first")), w(v.element, nt, y)), v.element.find(l).length || (v.element.append(e(l, o.messages.previous)), b(v.element, nt, y))), o.numeric && (v.list = v.element.find(".k-pager-numbers"), v.list.length || (v.list = n('<ul class="k-pager-numbers k-reset" />').appendTo(v.element))), o.input) { + v.element.find(".k-pager-input").length || v.element.append('<span class="k-pager-input k-label">' + o.messages.page + '<input class="k-textbox">' + i.format(o.messages.of, y) + "<\/span>"); + v.element.on(g + f, ".k-pager-input input", u(v._keydown, v)) + } + if (o.previousNext && (v.element.find(a).length || (v.element.append(e(a, o.messages.next)), k(v.element, nt, y)), v.element.find(c).length || (v.element.append(e(c, o.messages.last, "k-pager-last")), d(v.element, nt, y))), o.pageSizes) { + v.element.find(".k-pager-sizes").length || n('<span class="k-pager-sizes k-label"><select/>' + o.messages.itemsPerPage + "<\/span>").appendTo(v.element).find("select").html(n.map(n.isArray(o.pageSizes) ? o.pageSizes : [5, 10, 20], function(n) { + return "<option>" + n + "<\/option>" + }).join("")).end().appendTo(v.element); + v.element.find(".k-pager-sizes select").val(v.pageSize()); + i.ui.DropDownList && v.element.find(".k-pager-sizes select").show().kendoDropDownList(); + v.element.on(r + f, ".k-pager-sizes select", u(v._change, v)) + } + if (o.refresh) { + v.element.find(".k-pager-refresh").length || v.element.append('<a href="#" class="k-pager-refresh k-link" title="' + o.messages.refresh + '"><span class="k-icon k-i-refresh">' + o.messages.refresh + "<\/span><\/a>"); + v.element.on(p + f, ".k-pager-refresh", u(v._refreshClick, v)) + } + o.info && (v.element.find(".k-pager-info").length || v.element.append('<span class="k-pager-info k-label" />')); + v.element.on(p + f, "a", u(v._click, v)).addClass("k-pager-wrap k-widget"); + o.autoBind && v.refresh(); + i.notify(v) + }, + destroy: function() { + var n = this; + s.fn.destroy.call(n); + n.element.off(f); + n.dataSource.unbind(r, n._refreshHandler); + i.destroy(n.element) + }, + events: [r], + options: { + name: "Pager", + selectTemplate: '<li><span class="k-state-selected">#=text#<\/span><\/li>', + linkTemplate: '<li><a tabindex="-1" href="\\#" class="k-link" data-#=ns#page="#=idx#" #if (title !== "") {# title="#=title#" #}#>#=text#<\/a><\/li>', + buttonCount: 10, + autoBind: !0, + numeric: !0, + info: !0, + input: !1, + previousNext: !0, + pageSizes: !1, + refresh: !1, + messages: { + display: "{0} - {1} of {2} items", + empty: "No items to display", + page: "Page", + of: "of {0}", + itemsPerPage: "items per page", + first: "Go to the first page", + previous: "Go to the previous page", + next: "Go to the next page", + last: "Go to the last page", + refresh: "Refresh", + morePages: "More pages" + } + }, + setDataSource: function(n) { + var t = this; + t.dataSource.unbind(r, t._refreshHandler); + t.dataSource = t.options.dataSource = n; + n.bind(r, t._refreshHandler); + t.options.autoBind && n.fetch() + }, + refresh: function(n) { + var t = this, + e, a, s = 1, + f = "", + y, r = t.page(), + u = t.options, + h = t.pageSize(), + c = t.dataSource.total(), + o = t.totalPages(), + p = t.linkTemplate, + l = u.buttonCount; + if (!n || n.action != "itemchange") { + if (u.numeric) { + for (r > l && (y = r % l, s = y === 0 ? r - l + 1 : r - y + 1), a = Math.min(s + l - 1, o), s > 1 && (f += v(p, s - 1, "...", !1, u.messages.morePages)), e = s; e <= a; e++) f += v(e == r ? t.selectTemplate : p, e, e, !0); + a < o && (f += v(p, e, "...", !1, u.messages.morePages)); + f === "" && (f = t.selectTemplate({ + text: 0 + })); + t.list.html(f) + } + u.info && (f = c > 0 ? i.format(u.messages.display, (r - 1) * h + 1, Math.min(r * h, c), c) : u.messages.empty, t.element.find(".k-pager-info").html(f)); + u.input && t.element.find(".k-pager-input").html(t.options.messages.page + '<input class="k-textbox">' + i.format(u.messages.of, o)).find("input").val(r).attr(nt, c < 1).toggleClass("k-state-disabled", c < 1); + u.previousNext && (w(t.element, r, o), b(t.element, r, o), k(t.element, r, o), d(t.element, r, o)); + u.pageSizes && t.element.find(".k-pager-sizes select").val(h).filter("[" + i.attr("role") + "=dropdownlist]").kendoDropDownList("value", h).kendoDropDownList("text", h) + } + }, + _keydown: function(n) { + if (n.keyCode === i.keys.ENTER) { + var r = this.element.find(".k-pager-input").find("input"), + t = parseInt(r.val(), 10); + (isNaN(t) || t < 1 || t > this.totalPages()) && (t = this.page()); + r.val(t); + this.page(t) + } + }, + _refreshClick: function(n) { + n.preventDefault(); + this.dataSource.read() + }, + _change: function(n) { + var t = parseInt(n.currentTarget.value, 10); + isNaN(t) || this.dataSource.pageSize(t) + }, + _click: function(t) { + var r = n(t.currentTarget); + t.preventDefault(); + r.is(".k-state-disabled") || this.page(r.attr(i.attr("page"))) + }, + totalPages: function() { + return Math.ceil((this.dataSource.total() || 0) / this.pageSize()) + }, + pageSize: function() { + return this.dataSource.pageSize() || this.dataSource.total() + }, + page: function(n) { + if (n !== t) this.dataSource.page(n), this.trigger(r, { + index: n + }); + else return this.dataSource.total() > 0 ? this.dataSource.page() : 0 + } + }); + y.plugin(it) + }(window.kendo.jQuery); +kendo_module({ + id: "popup", + name: "Pop-up", + category: "framework", + depends: ["core"], + advanced: !0 + }), + function(n) { + function y(t, i) { + return t === i || n.contains(t, i) + } + var t = window.kendo, + it = t.ui, + p = it.Widget, + f = t.support, + r = t.getOffset, + lt = t._activeElement, + w = "open", + b = "close", + rt = "deactivate", + ut = "activate", + u = "center", + ft = "left", + s = "right", + k = "top", + h = "bottom", + d = "absolute", + et = "hidden", + c = "body", + g = "location", + e = "position", + ot = "visible", + st = "effects", + ht = "k-state-active", + l = "k-state-border", + at = /k-state-border-(\w+)/, + ct = ".k-picker-wrap, .k-dropdown-wrap, .k-link", + a = "down", + nt = n(window), + tt = n(document.documentElement), + v = "resize scroll", + vt = f.transitions.css, + yt = vt + "transform", + i = n.extend, + o = ".kendoPopup", + pt = ["font-family", "font-size", "font-stretch", "font-style", "font-weight", "line-height"], + wt = p.extend({ + init: function(r, u) { + var f = this, + e; + u = u || {}; + u.isRtl && (u.origin = u.origin || h + " " + s, u.position = u.position || k + " " + s); + p.fn.init.call(f, r, u); + r = f.element; + u = f.options; + f.collisions = u.collision ? u.collision.split(" ") : []; + f.collisions.length === 1 && f.collisions.push(f.collisions[0]); + e = n(f.options.anchor).closest(".k-popup,.k-group").filter(":not([class^=km-])"); + u.appendTo = n(n(u.appendTo)[0] || e[0] || c); + f.element.hide().addClass("k-popup k-group k-reset").toggleClass("k-rtl", !!u.isRtl).css({ + position: d + }).appendTo(u.appendTo).on("mouseenter" + o, function() { + f._hovered = !0 + }).on("mouseleave" + o, function() { + f._hovered = !1 + }); + if (f.wrapper = n(), u.animation === !1 && (u.animation = { + open: { + effects: {} + }, + close: { + hide: !0, + effects: {} + } + }), i(u.animation.open, { + complete: function() { + f.wrapper.css({ + overflow: ot + }); + f.trigger(ut) + } + }), i(u.animation.close, { + complete: function() { + f.wrapper.hide(); + var o = f.wrapper.data(g), + s = n(u.anchor), + i, e; + o && f.wrapper.css(o); + u.anchor != c && (i = (s[0].className.match(at) || ["", "down"])[1], e = l + "-" + i, s.removeClass(e).children(ct).removeClass(ht).removeClass(e), r.removeClass(l + "-" + t.directions[i].reverse)); + f._closing = !1; + f.trigger(rt) + } + }), f._mousedownProxy = function(n) { + f._mousedown(n) + }, f._resizeProxy = function(n) { + f._resize(n) + }, u.toggleTarget) n(u.toggleTarget).on(u.toggleEvent + o, n.proxy(f.toggle, f)) + }, + events: [w, ut, b, rt], + options: { + name: "Popup", + toggleEvent: "click", + origin: h + " " + ft, + position: k + " " + ft, + anchor: c, + collision: "flip fit", + viewport: window, + copyAnchorStyles: !0, + autosize: !1, + modal: !1, + animation: { + open: { + effects: "slideIn:down", + transition: !0, + duration: 200 + }, + close: { + duration: 100, + hide: !0 + } + } + }, + destroy: function() { + var i = this, + r = i.options, + f = i.element.off(o), + u; + p.fn.destroy.call(i); + r.toggleTarget && n(r.toggleTarget).off(o); + r.modal || (tt.unbind(a, i._mousedownProxy), nt.unbind(v, i._resizeProxy)); + t.destroy(i.element.children()); + r.appendTo[0] === document.body && (u = f.parent(".k-animation-container"), u[0] ? u.remove() : f.remove()) + }, + open: function(r, u) { + var o = this, + rt = { + isFixed: !isNaN(parseInt(u, 10)), + x: r, + y: u + }, + y = o.element, + s = o.options, + p = "down", + h, b, g = n(s.anchor), + it; + if (!o.visible()) { + if (s.copyAnchorStyles && y.css(t.getComputedStyles(g[0], pt)), y.data("animating") || o.trigger(w)) return; + s.modal || (tt.unbind(a, o._mousedownProxy).bind(a, o._mousedownProxy), f.mobileOS.ios || f.mobileOS.android || nt.unbind(v, o._resizeProxy).bind(v, o._resizeProxy)); + o.wrapper = b = t.wrap(y, s.autosize).css({ + overflow: et, + display: "block", + position: d + }); + f.mobileOS.android && b.add(g).css(yt, "translatez(0)"); + b.css(e); + n(s.appendTo)[0] == document.body && b.css(k, "-10000px"); + h = i(!0, {}, s.animation.open); + o.flipped = o._position(rt); + h.effects = t.parseEffects(h.effects, o.flipped); + p = h.effects.slideIn ? h.effects.slideIn.direction : p; + s.anchor != c && (it = l + "-" + p, y.addClass(l + "-" + t.directions[p].reverse), g.addClass(it).children(ct).addClass(ht).addClass(it)); + y.data(st, h.effects).kendoStop(!0).kendoAnimate(h) + } + }, + toggle: function() { + var n = this; + n[n.visible() ? b : w]() + }, + visible: function() { + return this.element.is(":" + ot) + }, + close: function() { + var r = this, + s = r.options, + o, u, f, e; + if (r.visible()) { + if (o = r.wrapper[0] ? r.wrapper : t.wrap(r.element).hide(), r._closing || r.trigger(b)) return; + r.element.find(".k-popup").each(function() { + var i = n(this), + t = i.data("kendoPopup"); + t && t.close() + }); + tt.unbind(a, r._mousedownProxy); + nt.unbind(v, r._resizeProxy); + u = i(!0, {}, s.animation.close); + f = r.element.data(st); + e = u.effects; + !e && !t.size(e) && f && t.size(f) && (u.effects = f, u.reverse = !0); + r._closing = !0; + r.element.kendoStop(!0); + o.css({ + overflow: et + }); + r.element.kendoAnimate(u) + } + }, + _resize: function(n) { + var t = this; + n.type === "resize" ? (clearTimeout(t._resizeTimeout), t._resizeTimeout = setTimeout(function() { + t._position(); + t._resizeTimeout = null + }, 50)) : t._hovered || y(t.element[0], lt()) || t.close() + }, + _mousedown: function(i) { + var u = this, + s = u.element[0], + e = u.options, + h = n(e.anchor)[0], + o = e.toggleTarget, + f = t.eventTarget(i), + r = n(f).closest(".k-popup"), + c = r.parent().parent(".km-shim").length; + (r = r[0], c || !r || r === u.element[0]) && n(i.target).closest("a").data("rel") !== "popover" && (y(s, f) || y(h, f) || o && y(n(o)[0], f) || u.close()) + }, + _fit: function(n, t, i) { + var r = 0; + return n + t > i && (r = i - (n + t)), n < 0 && (r = -n), r + }, + _flip: function(n, t, i, r, f, e, o) { + var s = 0; + return o = o || t, e !== f && e !== u && f !== u && (n + o > r && (s += -(i + t)), n + s < 0 && (s += i + t)), s + }, + _position: function(t) { + var o = this, + nt = o.element.css(e, ""), + u = o.wrapper, + y = o.options, + c = n(y.viewport), + ot = n(c).offset(), + l = n(y.anchor), + tt = y.origin.toLowerCase().split(" "), + it = y.position.toLowerCase().split(" "), + p = o.collisions, + w = f.zoomLevel(), + b, rt, h, k = 10002, + ut = 0, + st, v, s, et; + if (b = l.parents().filter(u.siblings()), b[0]) + if (h = Number(n(b).css("zIndex")), h) k = h + 1; + else + for (rt = l.parentsUntil(b), st = rt.length; ut < st; ut++) h = Number(n(rt[ut]).css("zIndex")), h && k < h && (k = h + 1); + u.css("zIndex", k); + t && t.isFixed ? u.css({ + left: t.x, + top: t.y + }) : u.css(o._align(tt, it)); + var ft = r(u, e, l[0] === u.offsetParent()[0]), + a = r(u), + ht = l.offsetParent().parent(".k-animation-container,.k-popup,.k-group"); + return ht.length && (ft = r(u, e, !0), a = r(u)), c[0] === window ? (a.top -= window.pageYOffset || document.documentElement.scrollTop || 0, a.left -= window.pageXOffset || document.documentElement.scrollLeft || 0) : (a.top -= ot.top, a.left -= ot.left), o.wrapper.data(g) || u.data(g, i({}, ft)), v = i({}, a), s = i({}, ft), p[0] === "fit" && (s.top += o._fit(v.top, u.outerHeight(), c.height() / w)), p[1] === "fit" && (s.left += o._fit(v.left, u.outerWidth(), c.width() / w)), et = i({}, s), p[0] === "flip" && (s.top += o._flip(v.top, nt.outerHeight(), l.outerHeight(), c.height() / w, tt[0], it[0], u.outerHeight())), p[1] === "flip" && (s.left += o._flip(v.left, nt.outerWidth(), l.outerWidth(), c.width() / w, tt[1], it[1], u.outerWidth())), nt.css(e, d), u.css(s), s.left != et.left || s.top != et.top + }, + _align: function(t, i) { + var c = this, + v = c.wrapper, + l = n(c.options.anchor), + y = t[0], + p = t[1], + w = i[0], + b = i[1], + k = r(l), + d = n(c.options.appendTo), + a, g = v.outerWidth(), + nt = v.outerHeight(), + tt = l.outerWidth(), + it = l.outerHeight(), + f = k.top, + e = k.left, + o = Math.round; + return d[0] != document.body && (a = r(d), f -= a.top, e -= a.left), y === h && (f += it), y === u && (f += o(it / 2)), w === h && (f -= nt), w === u && (f -= o(nt / 2)), p === s && (e += tt), p === u && (e += o(tt / 2)), b === s && (e -= g), b === u && (e -= o(g / 2)), { + top: f, + left: e + } + } + }); + it.plugin(wt) + }(window.kendo.jQuery); +kendo_module({ + id: "tooltip", + name: "Tooltip", + category: "web", + description: "The Tooltip widget displays a popup hint for a given html element.", + depends: ["core", "popup"] + }), + function(n) { + function w(n) { + while (n.length) ot(n), n = n.parent() + } + + function ot(n) { + var i = n.data(t.ns + "title"); + i && (n.attr("title", i), n.removeData(t.ns + "title")) + } + + function st(n) { + var i = n.attr("title"); + i && (n.data(t.ns + "title", i), n.attr("title", "")) + } + + function b(n) { + while (n.length && !n.is("body")) st(n), n = n.parent() + } + var t = window.kendo, + u = t.ui.Widget, + k = t.ui.Popup, + d = t.isFunction, + g = n.isPlainObject, + s = n.extend, + r = n.proxy, + f = n(document), + nt = t.isLocalUrl, + h = "_tt_active", + c = "aria-describedby", + l = "show", + a = "hide", + v = "error", + e = "contentLoad", + y = "requestStart", + o = "k-content-frame", + tt = '<div role="tooltip" class="k-widget k-tooltip#if (!autoHide) {# k-tooltip-closable#}#">#if (!autoHide) {# <div class="k-tooltip-button"><a href="\\#" class="k-icon k-i-close">close<\/a><\/div> #}#<div class="k-tooltip-content"><\/div>#if (callout){ #<div class="k-callout k-callout-#=dir#"><\/div>#}#<\/div>', + it = t.template("<iframe frameborder='0' class='" + o + "' src='#= content.url #'>This page requires frames in order to show content<\/iframe>"), + i = ".kendoTooltip", + rt = { + bottom: { + origin: "bottom center", + position: "top center" + }, + top: { + origin: "top center", + position: "bottom center" + }, + left: { + origin: "center left", + position: "center right", + collision: "fit flip" + }, + right: { + origin: "center right", + position: "center left", + collision: "fit flip" + }, + center: { + position: "center center", + origin: "center center" + } + }, + ut = { + top: "bottom", + bottom: "top", + left: "right", + right: "left", + center: "center" + }, + p = { + bottom: "n", + top: "s", + left: "e", + right: "w", + center: "n" + }, + ft = { + horizontal: { + offset: "top", + size: "outerHeight" + }, + vertical: { + offset: "left", + size: "outerWidth" + } + }, + et = function(n) { + return n.target.data(t.ns + "title") + }, + ht = u.extend({ + init: function(n, t) { + var f = this, + e; + u.fn.init.call(f, n, t); + e = f.options.position.match(/left|right/) ? "horizontal" : "vertical"; + f.dimensions = ft[e]; + f._documentKeyDownHandler = r(f._documentKeyDown, f); + f.element.on(f.options.showOn + i, f.options.filter, r(f._showOn, f)).on("mouseenter" + i, f.options.filter, r(f._mouseenter, f)); + if (this.options.autoHide) f.element.on("mouseleave" + i, f.options.filter, r(f._mouseleave, f)) + }, + options: { + name: "Tooltip", + filter: "", + content: et, + showAfter: 100, + callout: !0, + position: "bottom", + showOn: "mouseenter", + autoHide: !0, + width: null, + height: null, + animation: { + open: { + effects: "fade:in", + duration: 0 + }, + close: { + effects: "fade:out", + duration: 40, + hide: !0 + } + } + }, + events: [l, a, e, v, y], + _mouseenter: function(t) { + b(n(t.currentTarget)) + }, + _showOn: function(t) { + var i = this, + r = n(t.currentTarget); + i.options.showOn && i.options.showOn.match(/click|focus/) ? i._show(r) : (clearTimeout(i.timeout), i.timeout = setTimeout(function() { + i._show(r) + }, i.options.showAfter)) + }, + _appendContent: function(n) { + var u = this, + r = u.options.content, + f = u.content, + h = u.options.iframe, + s; + if (g(r) && r.url) + if ("iframe" in u.options || (h = !nt(r.url)), u.trigger(y, { + options: r, + target: n + }), h) { + f.hide(); + s = f.find("." + o)[0]; + s ? s.src = r.url || s.src : f.html(it({ + content: r + })); + f.find("." + o).off("load" + i).on("load" + i, function() { + u.trigger(e); + f.show() + }) + } else f.empty(), t.ui.progress(f, !0), u._ajaxRequest(r); + else r && d(r) ? (r = r({ + sender: this, + target: n + }), u.content.html(r || "")) : u.content.html(r) + }, + _ajaxRequest: function(n) { + var i = this; + jQuery.ajax(s({ + type: "GET", + dataType: "html", + cache: !1, + error: function(n, r) { + t.ui.progress(i.content, !1); + i.trigger(v, { + status: r, + xhr: n + }) + }, + success: r(function(n) { + t.ui.progress(i.content, !1); + i.content.html(n); + i.trigger(e) + }, i) + }, n)) + }, + _documentKeyDown: function(n) { + n.keyCode === t.keys.ESC && this.hide() + }, + refresh: function() { + var t = this, + n = t.popup; + n && n.options.anchor && t._appendContent(n.options.anchor) + }, + hide: function() { + this.popup && this.popup.close() + }, + show: function(n) { + n = n || this.element; + b(n); + this._show(n) + }, + _show: function(n) { + var t = this, + r = t.target(); + t.popup || t._initPopup(); + r && r[0] != n[0] && (t.popup.close(), t.popup.element.kendoStop(!0, !0)); + r && r[0] == n[0] || (t._appendContent(n), t.popup.options.anchor = n); + t.popup.one("deactivate", function() { + w(n); + n.removeAttr(c); + this.element.removeAttr("id").attr("aria-hidden", !0); + f.off("keydown" + i, t._documentKeyDownHandler) + }); + t.popup.open() + }, + _initPopup: function() { + var u = this, + e = u.options, + o = n(t.template(tt)({ + callout: e.callout && e.position !== "center", + dir: p[e.position], + autoHide: e.autoHide + })); + if (u.popup = new k(o, s({ + activate: function() { + var t = this.options.anchor, + n = t[0].id || u.element[0].id; + n && (t.attr(c, n + h), this.element.attr("id", n + h)); + e.callout && u._positionCallout(); + this.element.removeAttr("aria-hidden"); + f.on("keydown" + i, u._documentKeyDownHandler); + u.trigger(l) + }, + close: function() { + u.trigger(a) + }, + copyAnchorStyles: !1, + animation: e.animation + }, rt[e.position])), o.css({ + width: e.width, + height: e.height + }), u.content = o.find(".k-tooltip-content"), u.arrow = o.find(".k-callout"), e.autoHide) o.on("mouseleave" + i, r(u._mouseleave, u)); + else o.on("click" + i, ".k-tooltip-button", r(u._closeButtonClick, u)) + }, + _closeButtonClick: function(n) { + n.preventDefault(); + this.hide() + }, + _mouseleave: function(t) { + if (this.popup) { + var r = n(t.currentTarget), + i = r.offset(), + u = t.pageX, + f = t.pageY; + if (i.right = i.left + r.outerWidth(), i.bottom = i.top + r.outerHeight(), u > i.left && u < i.right && f > i.top && f < i.bottom) return; + this.popup.close() + } else w(n(t.currentTarget)); + clearTimeout(this.timeout) + }, + _positionCallout: function() { + var t = this, + u = t.options.position, + f = t.dimensions, + i = f.offset, + r = t.popup, + e = r.options.anchor, + o = n(e).offset(), + s = parseInt(t.arrow.css("border-top-width"), 10), + h = n(r.element).offset(), + c = p[r.flipped ? ut[u] : u], + l = o[i] - h[i] + n(e)[f.size]() / 2 - s; + t.arrow.removeClass("k-callout-n k-callout-s k-callout-w k-callout-e").addClass("k-callout-" + c).css(i, l) + }, + target: function() { + return this.popup ? this.popup.options.anchor : null + }, + destroy: function() { + var n = this.popup; + n && (n.element.off(i), n.destroy()); + this.element.off(i); + f.off("keydown" + i, this._documentKeyDownHandler); + u.fn.destroy.call(this) + } + }); + t.ui.plugin(ht) + }(window.kendo.jQuery); +kendo_module({ + id: "list", + name: "List", + category: "framework", + depends: ["data", "popup"], + hidden: !0 + }), + function(n, t) { + function b(t, i) { + t.filters && (t.filters = n.grep(t.filters, function(n) { + return b(n, i), n.filters ? n.filters.length : n.field != i + })) + } + var i = window.kendo, + l = i.ui, + o = l.Widget, + f = i.keys, + u = i.support, + ft = i.htmlEncode, + et = i._activeElement, + s = "id", + a = "li", + r = "change", + v = "character", + k = "k-state-focused", + y = "k-state-hover", + d = "k-loading", + p = "open", + g = "close", + nt = "select", + w = "selected", + tt = "progress", + it = "requestEnd", + rt = "width", + ut = n.extend, + e = n.proxy, + h = u.browser, + ot = h.msie && h.version < 9, + st = /"/g, + ht = { + ComboBox: "DropDownList", + DropDownList: "ComboBox" + }, + c = o.extend({ + init: function(t, i) { + var r = this, + h = r.ns, + f; + o.fn.init.call(r, t, i); + t = r.element; + r._isSelect = t.is(nt); + r._template(); + r.ul = n('<ul unselectable="on" class="k-list k-reset"/>').css({ + overflow: u.kineticScrollNeeded ? "" : "auto" + }).on("mouseenter" + h, a, function() { + n(this).addClass(y) + }).on("mouseleave" + h, a, function() { + n(this).removeClass(y) + }).on("click" + h, a, e(r._click, r)).attr({ + tabIndex: -1, + role: "listbox", + "aria-hidden": !0 + }); + r.list = n("<div class='k-list-container'/>").append(r.ul).on("mousedown" + h, function(n) { + n.preventDefault() + }); + f = t.attr(s); + f && (r.list.attr(s, f + "-list"), r.ul.attr(s, f + "_listbox"), r._optionID = f + "_option_selected"); + r._header(); + r._accessors(); + r._initValue() + }, + options: { + valuePrimitive: !1, + headerTemplate: "" + }, + setOptions: function(n) { + o.fn.setOptions.call(this, n); + n && n.enable !== t && (n.enabled = n.enable) + }, + focus: function() { + this._focused.focus() + }, + readonly: function(n) { + this._editable({ + readonly: n === t ? !0 : n, + disable: !1 + }) + }, + enable: function(n) { + this._editable({ + readonly: !1, + disable: !(n = n === t ? !0 : n) + }) + }, + _filterSource: function(n) { + var i = this, + u = i.options, + r = i.dataSource, + t = r.filter() || {}; + b(t, u.dataTextField); + n && (t = t.filters || [], t.push(n)); + r.filter(t) + }, + _header: function() { + var t = this.options.headerTemplate, + i; + n.isFunction(t) && (t = t({})); + t && (this.list.prepend(t), i = this.ul.prev(), this.header = i[0] ? i : null) + }, + _initValue: function() { + var n = this, + t = n.options.value; + t !== null ? n.element.val(t) : (t = n._accessor(), n.options.value = t); + n._old = t + }, + _ignoreCase: function() { + var t = this, + i = t.dataSource.reader.model, + n; + i && i.fields && (n = i.fields[t.options.dataTextField], n && n.type && n.type !== "string" && (t.options.ignoreCase = !1)) + }, + items: function() { + return this.ul[0].children + }, + current: function(n) { + var i = this, + r = i._optionID; + if (n !== t) i._current && (i._current.removeClass(k).removeAttr("aria-selected").removeAttr(s), i._focused.removeAttr("aria-activedescendant")), n && (n.addClass(k), i._scroll(n), r && (n.attr("id", r), i._focused.attr("aria-activedescendant", r))), i._current = n; + else return i._current + }, + destroy: function() { + var n = this, + t = n.ns; + o.fn.destroy.call(n); + n._unbindDataSource(); + n.ul.off(t); + n.list.off(t); + n._touchScroller && n._touchScroller.destroy(); + n.popup.destroy(); + n._form && n._form.off("reset", n._resetHandler) + }, + dataItem: function(n) { + var i = this; + return n === t && (n = i.selectedIndex), i._data()[n] + }, + _accessors: function() { + var n = this, + r = n.element, + t = n.options, + u = i.getter, + f = r.attr(i.attr("text-field")), + e = r.attr(i.attr("value-field")); + f && (t.dataTextField = f); + e && (t.dataValueField = e); + n._text = u(t.dataTextField); + n._value = u(t.dataValueField) + }, + _aria: function(n) { + var i = this, + r = i.options, + u = i._focused; + r.suggest !== t && u.attr("aria-autocomplete", r.suggest ? "both" : "list"); + n = n ? n + " " + i.ul[0].id : i.ul[0].id; + u.attr("aria-owns", n); + i.ul.attr("aria-live", !r.filter || r.filter === "none" ? "off" : "polite") + }, + _blur: function() { + var n = this; + n._change(); + n.close() + }, + _change: function() { + var n = this, + i = n.selectedIndex, + e = n.options.value, + u = n.value(), + f; + n._isSelect && !n._bound && e && (u = e); + u !== n._old ? f = !0 : i !== t && i !== n._oldIndex && (f = !0); + f && (n._old = u, n._oldIndex = i, n.trigger(r), n.element.trigger(r)) + }, + _click: function(t) { + t.isDefaultPrevented() || this._accept(n(t.currentTarget)) + }, + _data: function() { + return this.dataSource.view() + }, + _enable: function() { + var n = this, + i = n.options, + r = n.element.is("[disabled]"); + i.enable !== t && (i.enabled = i.enable); + !i.enabled || r ? n.enable(!1) : n.readonly(n.element.is("[readonly]")) + }, + _focus: function(n) { + var t = this; + if (t.popup.visible() && n && t.trigger(nt, { + item: n + })) { + t.close(); + return + } + t._select(n); + t._triggerCascade(!0); + t._blur() + }, + _index: function(n) { + for (var i = this, u = i._data(), t = 0, r = u.length; t < r; t++) + if (i._dataValue(u[t]) == n) return t; + return -1 + }, + _dataValue: function(n) { + var i = this._value(n); + return i === t && (i = this._text(n)), i + }, + _height: function(n) { + if (n) { + var t = this, + r = t.list, + e = t.popup.visible(), + i = t.options.height, + f = t.header, + u; + u = r.add(r.parent(".k-animation-container")).show(); + i = t.ul[0].scrollHeight > i ? i : "auto"; + u.height(i); + f && t.ul.height(i == "auto" ? i : r.height() - f.height()); + e || u.hide() + } + }, + _adjustListWidth: function() { + var t = this.list, + i = t[0].style.width, + u = this.wrapper, + n, r; + if (t.data(rt) || !i) return n = window.getComputedStyle ? window.getComputedStyle(u[0], null) : 0, r = n ? parseFloat(n.width) : u.outerWidth(), n && (h.mozilla || h.msie) && (r += parseFloat(n.paddingLeft) + parseFloat(n.paddingRight) + parseFloat(n.borderLeftWidth) + parseFloat(n.borderRightWidth)), i = t.css("box-sizing") !== "border-box" ? r - (t.outerWidth() - t.width()) : r, t.css({ + fontFamily: u.css("font-family"), + width: i + }).data(rt, i), !0 + }, + _popup: function() { + var n = this, + e = n.list, + t = n._focused, + r = n.options, + f = n.wrapper; + n.popup = new l.Popup(e, ut({}, r.popup, { + anchor: f, + open: function(i) { + n._adjustListWidth(); + n.trigger(p) ? i.preventDefault() : (t.attr("aria-expanded", !0), n.ul.attr("aria-hidden", !1)) + }, + close: function(i) { + n.trigger(g) ? i.preventDefault() : (t.attr("aria-expanded", !1), n.ul.attr("aria-hidden", !0)) + }, + animation: r.animation, + isRtl: u.isRtl(f) + })); + n.popup.one(p, function() { + n._height(n._data().length) + }); + n._touchScroller = i.touchScroller(n.popup.element) + }, + _makeUnselectable: function() { + ot && this.list.find("*").attr("unselectable", "on") + }, + _toggleHover: function(t) { + n(t.currentTarget).toggleClass(y, t.type === "mouseenter") + }, + _toggle: function(n) { + var i = this, + r = u.touch && u.MSPointers && u.pointers; + n = n !== t ? n : !i.popup.visible(); + r || i._focused[0] === et() || i._focused.focus(); + i[n ? p : g]() + }, + _scroll: function(n) { + if (n) { + n[0] && (n = n[0]); + var r = this.ul[0], + t = n.offsetTop, + o = n.offsetHeight, + u = r.scrollTop, + s = r.clientHeight, + h = t + o, + f = this._touchScroller, + i, e; + f ? (i = f.dimensions.y, i.enabled && t > i.size && (t = t - i.size + o + 4, f.scrollTo(0, -t))) : (e = this.header ? this.header.outerHeight() : 0, r.scrollTop = u > t ? t - e : h > u + s ? h - s - e : u) + } + }, + _template: function() { + var t = this, + n = t.options, + r = n.template, + u = n.dataSource; + t._isSelect && t.element[0].length && (u || (n.dataTextField = n.dataTextField || "text", n.dataValueField = n.dataValueField || "value")); + r ? (r = i.template(r), t.template = function(n) { + return '<li tabindex="-1" role="option" unselectable="on" class="k-item">' + r(n) + "<\/li>" + }) : t.template = i.template('<li tabindex="-1" role="option" unselectable="on" class="k-item">${' + i.expr(n.dataTextField, "data") + "}<\/li>", { + useWithBlock: !1 + }) + }, + _triggerCascade: function(n) { + var t = this, + i = t.value(); + (!t._bound && i || t._old !== i) && t.trigger("cascade", { + userTriggered: n + }) + }, + _unbindDataSource: function() { + var n = this; + n.dataSource.unbind(r, n._refreshHandler).unbind(tt, n._progressHandler).unbind(it, n._requestEndHandler).unbind("error", n._errorHandler) + } + }); + ut(c, { + caret: function(n) { + var t = n.ownerDocument.selection; + return t ? Math.abs(t.createRange().moveStart(v, -n.value.length)) : n.selectionStart + }, + selectText: function(n, t, i) { + try { + if (n.createTextRange) { + n.focus(); + var r = n.createTextRange(); + r.collapse(!0); + r.moveStart(v, t); + r.moveEnd(v, i - t); + r.select() + } else n.setSelectionRange(t, i) + } catch (u) {} + }, + inArray: function(n, t) { + var i, r, u = t.children; + if (!n || n.parentNode !== t) return -1; + for (i = 0, r = u.length; i < r; i++) + if (n === u[i]) return i; + return -1 + } + }); + i.ui.List = c; + l.Select = c.extend({ + init: function(n, t) { + c.fn.init.call(this, n, t); + this._initial = this.element.val() + }, + setDataSource: function(n) { + this.options.dataSource = n; + this._dataSource(); + this._bound = !1; + this.options.autoBind && this.dataSource.fetch() + }, + close: function() { + this.popup.close() + }, + select: function(n) { + var i = this; + if (n === t) return i.selectedIndex; + i._select(n); + i._triggerCascade(); + i._old = i._accessor(); + i._oldIndex = i.selectedIndex + }, + _accessor: function(n, i) { + var r = this.element[0], + e = this._isSelect, + f = r.selectedIndex, + u; + if (n === t) return e ? f > -1 && (u = r.options[f], u && (n = u.value)) : n = r.value, n; + e ? (f > -1 && r.options[f].removeAttribute(w), r.selectedIndex = i, u = r.options[i], u && u.setAttribute(w, w)) : r.value = n + }, + _hideBusy: function() { + var n = this; + clearTimeout(n._busy); + n._arrow.removeClass(d); + n._focused.attr("aria-busy", !1); + n._busy = null + }, + _showBusy: function() { + var n = this; + (n._request = !0, n._busy) || (n._busy = setTimeout(function() { + n._focused.attr("aria-busy", !0); + n._arrow.addClass(d) + }, 100)) + }, + _requestEnd: function() { + this._request = !1 + }, + _dataSource: function() { + var t = this, + s = t.element, + f = t.options, + u = f.dataSource || {}, + o; + u = n.isArray(u) ? { + data: u + } : u; + t._isSelect && (o = s[0].selectedIndex, o > -1 && (f.index = o), u.select = s, u.fields = [{ + field: f.dataTextField + }, { + field: f.dataValueField + }]); + t.dataSource && t._refreshHandler ? t._unbindDataSource() : (t._refreshHandler = e(t.refresh, t), t._progressHandler = e(t._showBusy, t), t._requestEndHandler = e(t._requestEnd, t), t._errorHandler = e(t._hideBusy, t)); + t.dataSource = i.data.DataSource.create(u).bind(r, t._refreshHandler).bind(tt, t._progressHandler).bind(it, t._requestEndHandler).bind("error", t._errorHandler) + }, + _get: function(t) { + var r = this, + u = r._data(), + i, f; + if (typeof t == "function") + for (i = 0, f = u.length; i < f; i++) + if (t(u[i])) { + t = i; + break + } + if (typeof t == "number") { + if (t < 0) return n(); + t = n(r.ul[0].children[t]) + } + return t && t.nodeType && (t = n(t)), t + }, + _move: function(n) { + var t = this, + e = n.keyCode, + o = t.ul[0], + c = t.popup.visible() ? "_select" : "_accept", + i = t._current, + h = e === f.DOWN, + u, s; + if (e === f.UP || h) { + if (n.altKey) t.toggle(h); + else { + if (u = o.firstChild, !u && !t._accessor() && t._state !== "filter") { + if (!t._fetch) { + t.dataSource.one(r, function() { + t._move(n); + t._fetch = !1 + }); + t._fetch = !0; + t._filterSource() + } + return n.preventDefault(), !0 + } + h ? (i && (t.selectedIndex !== -1 || t.value() || i[0] !== u) ? (i = i[0].nextSibling, i || u !== o.lastChild || (i = u)) : i = u, t[c](i)) : (i = i ? i[0].previousSibling : o.lastChild, i || u !== o.lastChild || (i = u), t[c](i)) + } + n.preventDefault(); + s = !0 + } else e === f.ENTER || e === f.TAB ? (t.popup.visible() && n.preventDefault(), (t._typing || !t.popup.visible() && t.selectedIndex === -1) && (i = null), t._accept(i), s = !0) : e === f.ESC && (t.popup.visible() && n.preventDefault(), t.close(), s = !0); + return s + }, + _selectItem: function() { + var n = this, + i = n.options, + u, r; + u = n._isSelect && !n._initial && !i.value && i.index && !n._bound; + u || (r = n._selectedValue || i.value || n._accessor()); + r ? n.value(r) : n._bound === t && n.select(i.index) + }, + _fetchItems: function(n) { + var t = this, + i = t.ul[0].firstChild; + if (t._request) return !0; + if (!t._fetch && !i) { + if (t.options.cascadeFrom) return !i; + t.dataSource.one(r, function() { + t.value(n); + t._fetch = !1 + }); + return t._fetch = !0, t.dataSource.fetch(), !0 + } + }, + _options: function(n, i) { + var e = this, + c = e.element, + l = n.length, + o = "", + u, s, h, r, f = 0; + for (i && (f = 1, o = i); f < l; f++) u = "<option", s = n[f], h = e._text(s), r = e._value(s), r !== t && (r += "", r.indexOf('"') !== -1 && (r = r.replace(st, """)), u += ' value="' + r + '"'), u += ">", h !== t && (u += ft(h)), u += "<\/option>", o += u; + c.html(o) + }, + _reset: function() { + var t = this, + i = t.element, + r = i.attr("form"), + u = r ? n("#" + r) : i.closest("form"); + u[0] && (t._resetHandler = function() { + setTimeout(function() { + t.value(t._initial) + }) + }, t._form = u.on("reset", t._resetHandler)) + }, + _cascade: function() { + var t = this, + u = t.options, + s = u.cascadeFrom, + i, f, e, o, h; + if (s) { + if (t._selectedValue = u.value || t._accessor(), f = n("#" + s), i = f.data("kendo" + u.name), i || (i = f.data("kendo" + ht[u.name])), !i) return; + u.autoBind = !1; + o = u.cascadeFromField || i.options.dataValueField; + h = function() { + var n = t._selectedValue || t.value(); + t._userTriggered ? t._clearSelection(i, !0) : n ? (t.value(n), t.dataSource.view()[0] && t.selectedIndex !== -1 || t._clearSelection(i, !0)) : t.select(u.index); + t.enable(); + t._triggerCascade(t._userTriggered); + t._userTriggered = !1 + }; + e = function() { + var e = i.dataItem(), + n = e ? i._value(e) : null, + u, f; + n || n === 0 ? (u = t.dataSource.filter() || {}, b(u, o), f = u.filters || [], f.push({ + field: o, + operator: "eq", + value: n + }), t.dataSource.one(r, h).filter(f)) : (t.enable(!1), t._clearSelection(i), t._triggerCascade(t._userTriggered), t._userTriggered = !1) + }; + i.bind("cascade", function(n) { + t._userTriggered = n.userTriggered; + e() + }); + i._bound ? e() : i.value() || t.enable(!1) + } + } + }) + }(window.kendo.jQuery); +kendo_module({ + id: "calendar", + name: "Calendar", + category: "web", + description: "The Calendar widget renders a graphical calendar that supports navigation and selection.", + depends: ["core"] + }), + function(n, t) { + function li(n, t, i, r) { + var u = n.getFullYear(), + e = t.getFullYear(), + o = i.getFullYear(), + f; + return u = u - u % r, f = u + (r - 1), u < e && (u = e), f > o && (f = o), u + "-" + f + } + + function d(n) { + for (var t = 0, i, f = n.min, e = n.max, r = n.start, o = n.setter, s = n.build, h = n.cells || 12, c = n.perRow || 4, l = n.content || bi, a = n.empty || ki, u = n.html || '<table tabindex="0" role="grid" class="k-content k-meta-view" cellspacing="0"><tbody><tr role="row">'; t < h; t++) t > 0 && t % c == 0 && (u += '<\/tr><tr role="row">'), i = s(r, t), u += nt(r, f, e) ? l(i) : a(i), o(r, 1); + return u + "<\/tr><\/tbody><\/table>" + } + + function st(n, t, i) { + var f = n.getFullYear(), + r = t.getFullYear(), + e = r, + u = 0; + return i && (r = r - r % i, e = r - r % i + i - 1), f > e ? u = 1 : f < r && (u = -1), u + } + + function g() { + var n = new i; + return new i(n.getFullYear(), n.getMonth(), n.getDate()) + } + + function v(n, t, r) { + var u = g(); + return n && (u = new i(+n)), t > u ? u = new i(+t) : r < u && (u = new i(+r)), u + } + + function nt(n, t, i) { + return +n >= +t && +n <= +i + } + + function ai(n, t) { + return n.slice(t).concat(n.slice(0, t)) + } + + function vi(n, t, r) { + t = t instanceof i ? t.getFullYear() : n.getFullYear() + r * t; + n.setFullYear(t) + } + + function yi(t) { + n(this).toggleClass(nr, tr.indexOf(t.type) > -1 || t.type == ri) + } + + function ur(n) { + n.preventDefault() + } + + function ht(n) { + return at(n).calendars.standard + } + + function ct(n) { + var i = o[n.start], + r = o[n.depth], + u = at(n.culture); + n.format = wi(n.format || u.calendars.standard.patterns.d); + isNaN(i) && (i = 0, n.start = a); + (r === t || r > i) && (n.depth = a); + n.dates || (n.dates = []) + } + + function pi(n) { + di && n.find("*").attr("unselectable", "on") + } + + function fr(n, t) { + for (var i = 0, r = t.length; i < r; i++) + if (n === +t[i]) return !0; + return !1 + } + + function er(n, t) { + return n ? n.getFullYear() === t.getFullYear() && n.getMonth() === t.getMonth() && n.getDate() === t.getDate() : !1 + } + + function or(n, t) { + return n ? n.getFullYear() === t.getFullYear() && n.getMonth() === t.getMonth() : !1 + } + var r = window.kendo, + tt = r.support, + lt = r.ui, + y = lt.Widget, + u = r.keys, + it = r.parseDate, + p = r.date.adjustDST, + wi = r._extractFormat, + l = r.template, + at = r.getCulture, + vt = r.support.transitions, + yt = vt ? vt.css + "transform-origin" : "", + bi = l('<td#=data.cssClass# role="gridcell"><a tabindex="-1" class="k-link" href="\\#" data-#=data.ns#value="#=data.dateString#">#=data.value#<\/a><\/td>', { + useWithBlock: !1 + }), + ki = l('<td role="gridcell"> <\/td>', { + useWithBlock: !1 + }), + pt = r.support.browser, + di = pt.msie && pt.version < 9, + f = ".kendoCalendar", + s = "click" + f, + gi = "keydown" + f, + rt = "id", + wt = "min", + bt = "left", + ut = "slideIn", + a = "month", + kt = "century", + ft = "change", + dt = "navigate", + et = "value", + nr = "k-state-hover", + h = "k-state-disabled", + c = "k-state-focused", + w = "k-other-month", + gt = ' class="' + w + '"', + ni = "k-nav-today", + ti = "td:has(.k-link)", + ii = "blur" + f, + ri = "focus", + ui = ri + f, + tr = tt.touch ? "touchstart" : "mouseenter", + fi = tt.touch ? "touchstart" + f : "mouseenter" + f, + ei = tt.touch ? "touchend" + f + " touchmove" + f : "mouseleave" + f, + ir = 6e4, + oi = 864e5, + b = "_prevArrow", + k = "_nextArrow", + ot = "aria-disabled", + si = "aria-selected", + hi = n.proxy, + ci = n.extend, + i = Date, + o = { + month: 0, + year: 1, + decade: 2, + century: 3 + }, + rr = y.extend({ + init: function(t, u) { + var e = this, + h, l; + y.fn.init.call(e, t, u); + t = e.wrapper = e.element; + u = e.options; + u.url = window.unescape(u.url); + e._templates(); + e._header(); + e._footer(e.footer); + l = t.addClass("k-widget k-calendar").on(fi + " " + ei, ti, yi).on(gi, "table.k-content", hi(e._move, e)).on(s, ti, function(t) { + var i = t.currentTarget.firstChild; + i.href.indexOf("#") != -1 && t.preventDefault(); + e._click(n(i)) + }).on("mouseup" + f, function() { + e._focusView(e.options.focusOnNav !== !1) + }).attr(rt); + l && (e._cellID = l + "_cell_selected"); + ct(u); + h = it(u.value, u.format, u.culture); + e._index = o[u.start]; + e._current = new i(+v(h, u.min, u.max)); + e._addClassProxy = function() { + e._active = !0; + e._cell.addClass(c) + }; + e._removeClassProxy = function() { + e._active = !1; + e._cell.removeClass(c) + }; + e.value(h); + r.notify(e) + }, + options: { + name: "Calendar", + value: null, + min: new i(1900, 0, 1), + max: new i(2099, 11, 31), + dates: [], + url: "", + culture: "", + footer: "", + format: "", + month: {}, + start: a, + depth: a, + animation: { + horizontal: { + effects: ut, + reverse: !0, + duration: 500, + divisor: 2 + }, + vertical: { + effects: "zoomIn", + duration: 400 + } + } + }, + events: [ft, dt], + setOptions: function(n) { + var t = this; + ct(n); + y.fn.setOptions.call(t, n); + t._templates(); + t._footer(t.footer); + t._index = o[t.options.start]; + t.navigate() + }, + destroy: function() { + var n = this, + t = n._today; + n.element.off(f); + n._title.off(f); + n[b].off(f); + n[k].off(f); + r.destroy(n._table); + t && r.destroy(t.off(f)); + y.fn.destroy.call(n) + }, + current: function() { + return this._current + }, + view: function() { + return this._view + }, + focus: function(n) { + n = n || this._table; + this._bindTable(n); + n.focus() + }, + min: function(n) { + return this._option(wt, n) + }, + max: function(n) { + return this._option("max", n) + }, + navigateToPast: function() { + this._navigate(b, -1) + }, + navigateToFuture: function() { + this._navigate(k, 1) + }, + navigateUp: function() { + var n = this, + t = n._index; + n._title.hasClass(h) || n.navigate(n._current, ++t) + }, + navigateDown: function(n) { + var t = this, + i = t._index, + r = t.options.depth; + if (n) { + if (i === o[r]) { + +t._value != +n && (t.value(n), t.trigger(ft)); + return + } + t.navigate(n, --i) + } + }, + navigate: function(r, u) { + u = isNaN(u) ? o[u] : u; + var f = this, + l = f.options, + tt = l.culture, + p = l.min, + w = l.max, + it = f._title, + y = f._table, + d = f._oldTable, + rt = f._value, + ut = f._current, + ft = r && +r > +ut, + et = u !== t && u !== f._index, + g, a, nt, s; + r || (r = ut); + f._current = r = new i(+v(r, p, w)); + u === t ? u = f._index : f._index = u; + f._view = a = e.views[u]; + nt = a.compare; + s = u === o[kt]; + it.toggleClass(h, s).attr(ot, s); + s = nt(r, p) < 1; + f[b].toggleClass(h, s).attr(ot, s); + s = nt(r, w) > -1; + f[k].toggleClass(h, s).attr(ot, s); + y && d && d.data("animating") && (d.kendoStop(!0, !0), y.kendoStop(!0, !0)); + f._oldTable = y; + (!y || f._changeView) && (it.html(a.title(r, p, w, tt)), f._table = g = n(a.content(ci({ + min: p, + max: w, + date: r, + url: l.url, + dates: l.dates, + format: l.format, + culture: tt + }, f[a.name]))), pi(g), f._animate({ + from: y, + to: g, + vertical: et, + future: ft + }), f._focus(r), f.trigger(dt)); + u === o[l.depth] && rt && f._class("k-state-selected", a.toDateString(rt)); + f._class(c, a.toDateString(r)); + !y && f._cell && f._cell.removeClass(c); + f._changeView = !0 + }, + value: function(n) { + var r = this, + f = r._view, + u = r.options, + e = r._view, + o = u.min, + s = u.max; + if (n === t) return r._value; + n = it(n, u.format, u.culture); + n !== null && (n = new i(+n), nt(n, o, s) || (n = null)); + r._value = n; + e && n === null && r._cell ? r._cell.removeClass("k-state-selected") : (r._changeView = !n || f && f.compare(n, r._current) !== 0, r.navigate(n)) + }, + _move: function(t) { + var f = this, + y = f.options, + e = t.keyCode, + p = f._view, + w = f._index, + s = new i(+f._current), + h = r.support.isRtl(f.wrapper), + c, o, l, a; + return t.target === f._table[0] && (f._active = !0), t.ctrlKey ? e == u.RIGHT && !h || e == u.LEFT && h ? (f.navigateToFuture(), o = !0) : e == u.LEFT && !h || e == u.RIGHT && h ? (f.navigateToPast(), o = !0) : e == u.UP ? (f.navigateUp(), o = !0) : e == u.DOWN && (f._click(n(f._cell[0].firstChild)), o = !0) : (e == u.RIGHT && !h || e == u.LEFT && h ? (c = 1, o = !0) : e == u.LEFT && !h || e == u.RIGHT && h ? (c = -1, o = !0) : e == u.UP ? (c = w === 0 ? -7 : -4, o = !0) : e == u.DOWN ? (c = w === 0 ? 7 : 4, o = !0) : e == u.ENTER ? (f._click(n(f._cell[0].firstChild)), o = !0) : e == u.HOME || e == u.END ? (l = e == u.HOME ? "first" : "last", a = p[l](s), s = new i(a.getFullYear(), a.getMonth(), a.getDate(), s.getHours(), s.getMinutes(), s.getSeconds(), s.getMilliseconds()), o = !0) : e == u.PAGEUP ? (o = !0, f.navigateToPast()) : e == u.PAGEDOWN && (o = !0, f.navigateToFuture()), (c || l) && (l || p.setDate(s, c), f._focus(v(s, y.min, y.max)))), o && t.preventDefault(), f._current + }, + _animate: function(n) { + var t = this, + i = n.from, + r = n.to, + u = t._active; + i ? i.parent().data("animating") ? (i.parent().kendoStop(!0, !0).remove(), i.remove(), r.insertAfter(t.element[0].firstChild), t._focusView(u)) : i.is(":visible") && t.options.animation !== !1 ? t[n.vertical ? "_vertical" : "_horizontal"](i, r, n.future) : (r.insertAfter(i), i.remove(), t._focusView(u)) : (r.insertAfter(t.element[0].firstChild), t._bindTable(r)) + }, + _horizontal: function(n, i, r) { + var u = this, + o = u._active, + f = u.options.animation.horizontal, + s = f.effects, + e = n.outerWidth(); + s && s.indexOf(ut) != -1 && (n.add(i).css({ + width: e + }), n.wrap("<div/>"), u._focusView(o, n), n.parent().css({ + position: "relative", + width: e * 2, + float: bt, + "margin-left": r ? 0 : -e + }), i[r ? "insertAfter" : "insertBefore"](n), ci(f, { + effects: ut + ":" + (r ? "right" : bt), + complete: function() { + n.remove(); + i.unwrap(); + u._focusView(o); + u._oldTable = t + } + }), n.parent().kendoStop(!0, !0).kendoAnimate(f)) + }, + _vertical: function(n, i) { + var r = this, + e = r.options.animation.vertical, + o = e.effects, + s = r._active, + f, u; + o && o.indexOf("zoom") != -1 && (i.css({ + position: "absolute", + top: n.prev().outerHeight(), + left: 0 + }).insertBefore(n), yt && (f = r._cellByDate(r._view.toDateString(r._current)), u = f.position(), u = u.left + parseInt(f.width() / 2, 10) + "px " + (u.top + parseInt(f.height() / 2, 10) + "px"), i.css(yt, u)), n.kendoStop(!0, !0).kendoAnimate({ + effects: "fadeOut", + duration: 600, + complete: function() { + n.remove(); + i.css({ + position: "static", + top: 0, + left: 0 + }); + r._focusView(s); + r._oldTable = t + } + }), i.kendoStop(!0, !0).kendoAnimate(e)) + }, + _cellByDate: function(t) { + return this._table.find("td:not(." + w + ")").filter(function() { + return n(this.firstChild).attr(r.attr(et)) === t + }) + }, + _class: function(t, i) { + var u = this, + e = u._cellID, + f = u._cell; + f && f.removeAttr(si).removeAttr("aria-label").removeAttr(rt); + f = u._table.find("td:not(." + w + ")").removeClass(t).filter(function() { + return n(this.firstChild).attr(r.attr(et)) === i + }).attr(si, !0); + t !== c || u._active || u.options.focusOnNav === !1 || (t = ""); + f.addClass(t); + f[0] && (u._cell = f); + e && (f.attr(rt, e), u._table.removeAttr("aria-activedescendant").attr("aria-activedescendant", e)) + }, + _bindTable: function(n) { + n.on(ui, this._addClassProxy).on(ii, this._removeClassProxy) + }, + _click: function(n) { + var u = this, + f = u.options, + e = new Date(+u._current), + t = n.attr(r.attr(et)).split("/"); + t = new i(t[0], t[1], t[2]); + p(t, 0); + u._view.setDate(e, t); + u.navigateDown(v(e, f.min, f.max)) + }, + _focus: function(n) { + var t = this, + i = t._view; + i.compare(n, t._current) !== 0 ? t.navigate(n) : (t._current = n, t._class(c, i.toDateString(n))) + }, + _focusView: function(n, t) { + n && this.focus(t) + }, + _footer: function(t) { + var i = this, + f = g(), + e = i.element, + u = e.find(".k-footer"); + if (!t) { + i._toggle(!1); + u.hide(); + return + } + u[0] || (u = n('<div class="k-footer"><a href="#" class="k-link k-nav-today"><\/a><\/div>').appendTo(e)); + i._today = u.show().find(".k-link").html(t(f)).attr("title", r.toString(f, "D", i.options.culture)); + i._toggle() + }, + _header: function() { + var n = this, + i = n.element, + t; + i.find(".k-header")[0] || i.html('<div class="k-header"><a href="#" role="button" class="k-link k-nav-prev"><span class="k-icon k-i-arrow-w"><\/span><\/a><a href="#" role="button" aria-live="assertive" aria-atomic="true" class="k-link k-nav-fast"><\/a><a href="#" role="button" class="k-link k-nav-next"><span class="k-icon k-i-arrow-e"><\/span><\/a><\/div>'); + t = i.find(".k-link").on(fi + " " + ei + " " + ui + " " + ii, yi).click(!1); + n._title = t.eq(1).on(s, function() { + n._focusView(n.options.focusOnNav !== !1); + n.navigateUp() + }); + n[b] = t.eq(0).on(s, function() { + n._focusView(n.options.focusOnNav !== !1); + n.navigateToPast() + }); + n[k] = t.eq(2).on(s, function() { + n._focusView(n.options.focusOnNav !== !1); + n.navigateToFuture() + }) + }, + _navigate: function(n, t) { + var r = this, + f = r._index + 1, + u = new i(+r._current); + n = r[n]; + n.hasClass(h) || (f > 3 ? u.setFullYear(u.getFullYear() + 100 * t) : e.views[f].setDate(u, t), r.navigate(u)) + }, + _option: function(n, r) { + var u = this, + f = u.options, + e = u._value || u._current, + o; + if (r === t) return f[n]; + (r = it(r, f.format, f.culture), r) && (f[n] = new i(+r), o = n === wt ? r > e : e > r, (o || or(e, r)) && (o && (u._value = null), u._changeView = !0), u._changeView || (u._changeView = !!(f.month.content || f.month.empty)), u.navigate(u._value), u._toggle()) + }, + _toggle: function(n) { + var i = this, + u = i.options, + r = i._today; + if (n === t && (n = nt(g(), u.min, u.max)), r) + if (r.off(s), n) r.addClass(ni).removeClass(h).on(s, hi(i._todayClick, i)); + else r.removeClass(ni).addClass(h).on(s, ur) + }, + _todayClick: function(n) { + var t = this, + r = o[t.options.depth], + i = g(); + n.preventDefault(); + t._view.compare(t._current, i) === 0 && t._index == r && (t._changeView = !1); + t._value = i; + t.navigate(i, r); + t.trigger(ft) + }, + _templates: function() { + var n = this, + t = n.options, + i = t.footer, + u = t.month, + f = u.content, + e = u.empty; + n.month = { + content: l('<td#=data.cssClass# role="gridcell"><a tabindex="-1" class="k-link#=data.linkClass#" href="#=data.url#" ' + r.attr("value") + '="#=data.dateString#" title="#=data.title#">' + (f || "#=data.value#") + "<\/a><\/td>", { + useWithBlock: !!f + }), + empty: l('<td role="gridcell">' + (e || " ") + "<\/td>", { + useWithBlock: !!e + }) + }; + n.footer = i !== !1 ? l(i || '#= kendo.toString(data,"D","' + t.culture + '") #', { + useWithBlock: !1 + }) : null + } + }), + e; + lt.plugin(rr); + e = { + firstDayOfMonth: function(n) { + return new i(n.getFullYear(), n.getMonth(), 1) + }, + firstVisibleDay: function(n, t) { + t = t || r.culture().calendar; + for (var f = t.firstDay, u = new i(n.getFullYear(), n.getMonth(), 0, n.getHours(), n.getMinutes(), n.getSeconds(), n.getMilliseconds()); u.getDay() != f;) e.setTime(u, -1 * oi); + return u + }, + setTime: function(n, t) { + var u = n.getTimezoneOffset(), + r = new i(n.getTime() + t), + f = r.getTimezoneOffset() - u; + n.setTime(r.getTime() + f * ir) + }, + views: [{ + name: a, + title: function(n, t, i, r) { + return ht(r).months.names[n.getMonth()] + " " + n.getFullYear() + }, + content: function(n) { + for (var u = this, f = 0, o = n.min, s = n.max, h = n.date, c = n.dates, nt = n.format, l = n.culture, y = n.url, tt = y && c[0], a = ht(l), b = a.firstDay, k = a.days, it = ai(k.names, b), rt = ai(k.namesShort, b), v = e.firstVisibleDay(h, a), ut = u.first(h), ft = u.last(h), et = u.toDateString, t = new i, g = '<table tabindex="0" role="grid" class="k-content" cellspacing="0"><thead><tr role="row">'; f < 7; f++) g += '<th scope="col" title="' + it[f] + '">' + rt[f] + "<\/th>"; + return t = new i(t.getFullYear(), t.getMonth(), t.getDate()), p(t, 0), t = +t, d({ + cells: 42, + perRow: 7, + html: g += '<\/tr><\/thead><tbody><tr role="row">', + start: new i(v.getFullYear(), v.getMonth(), v.getDate()), + min: new i(o.getFullYear(), o.getMonth(), o.getDate()), + max: new i(s.getFullYear(), s.getMonth(), s.getDate()), + content: n.content, + empty: n.empty, + setter: u.setDate, + build: function(n) { + var i = [], + u = n.getDay(), + f = "", + e = "#"; + return (n < ut || n > ft) && i.push(w), +n === t && i.push("k-today"), (u === 0 || u === 6) && i.push("k-weekend"), tt && fr(+n, c) && (e = y.replace("{0}", r.toString(n, nt, l)), f = " k-action-link"), { + date: n, + dates: c, + ns: r.ns, + title: r.toString(n, "D", l), + value: n.getDate(), + dateString: et(n), + cssClass: i[0] ? ' class="' + i.join(" ") + '"' : "", + linkClass: f, + url: e + } + } + }) + }, + first: function(n) { + return e.firstDayOfMonth(n) + }, + last: function(n) { + var t = new i(n.getFullYear(), n.getMonth() + 1, 0), + r = e.firstDayOfMonth(n), + u = Math.abs(t.getTimezoneOffset() - r.getTimezoneOffset()); + return u && t.setHours(r.getHours() + u / 60), t + }, + compare: function(n, t) { + var i = n.getMonth(), + r = n.getFullYear(), + u = t.getMonth(), + f = t.getFullYear(); + return r > f ? 1 : r < f ? -1 : i == u ? 0 : i > u ? 1 : -1 + }, + setDate: function(n, t) { + var r = n.getHours(); + t instanceof i ? n.setFullYear(t.getFullYear(), t.getMonth(), t.getDate()) : e.setTime(n, t * oi); + p(n, r) + }, + toDateString: function(n) { + return n.getFullYear() + "/" + n.getMonth() + "/" + n.getDate() + } + }, { + name: "year", + title: function(n) { + return n.getFullYear() + }, + content: function(n) { + var f = ht(n.culture).months.namesAbbr, + e = this.toDateString, + t = n.min, + u = n.max; + return d({ + min: new i(t.getFullYear(), t.getMonth(), 1), + max: new i(u.getFullYear(), u.getMonth(), 1), + start: new i(n.date.getFullYear(), 0, 1), + setter: this.setDate, + build: function(n) { + return { + value: f[n.getMonth()], + ns: r.ns, + dateString: e(n), + cssClass: "" + } + } + }) + }, + first: function(n) { + return new i(n.getFullYear(), 0, n.getDate()) + }, + last: function(n) { + return new i(n.getFullYear(), 11, n.getDate()) + }, + compare: function(n, t) { + return st(n, t) + }, + setDate: function(n, t) { + var r, u = n.getHours(); + t instanceof i ? (r = t.getMonth(), n.setFullYear(t.getFullYear(), r, n.getDate()), r !== n.getMonth() && n.setDate(0)) : (r = n.getMonth() + t, n.setMonth(r), r > 11 && (r -= 12), r > 0 && n.getMonth() != r && n.setDate(0)); + p(n, u) + }, + toDateString: function(n) { + return n.getFullYear() + "/" + n.getMonth() + "/1" + } + }, { + name: "decade", + title: function(n, t, i) { + return li(n, t, i, 10) + }, + content: function(n) { + var t = n.date.getFullYear(), + u = this.toDateString; + return d({ + start: new i(t - t % 10 - 1, 0, 1), + min: new i(n.min.getFullYear(), 0, 1), + max: new i(n.max.getFullYear(), 0, 1), + setter: this.setDate, + build: function(n, t) { + return { + value: n.getFullYear(), + ns: r.ns, + dateString: u(n), + cssClass: t === 0 || t == 11 ? gt : "" + } + } + }) + }, + first: function(n) { + var t = n.getFullYear(); + return new i(t - t % 10, n.getMonth(), n.getDate()) + }, + last: function(n) { + var t = n.getFullYear(); + return new i(t - t % 10 + 9, n.getMonth(), n.getDate()) + }, + compare: function(n, t) { + return st(n, t, 10) + }, + setDate: function(n, t) { + vi(n, t, 1) + }, + toDateString: function(n) { + return n.getFullYear() + "/0/1" + } + }, { + name: kt, + title: function(n, t, i) { + return li(n, t, i, 100) + }, + content: function(n) { + var o = n.date.getFullYear(), + f = n.min.getFullYear(), + e = n.max.getFullYear(), + s = this.toDateString, + t = f, + u = e; + return t = t - t % 10, u = u - u % 10, u - t < 10 && (u = t + 9), d({ + start: new i(o - o % 100 - 10, 0, 1), + min: new i(t, 0, 1), + max: new i(u, 0, 1), + setter: this.setDate, + build: function(n, t) { + var i = n.getFullYear(), + u = i + 9; + return i < f && (i = f), u > e && (u = e), { + ns: r.ns, + value: i + " - " + u, + dateString: s(n), + cssClass: t === 0 || t == 11 ? gt : "" + } + } + }) + }, + first: function(n) { + var t = n.getFullYear(); + return new i(t - t % 100, n.getMonth(), n.getDate()) + }, + last: function(n) { + var t = n.getFullYear(); + return new i(t - t % 100 + 99, n.getMonth(), n.getDate()) + }, + compare: function(n, t) { + return st(n, t, 100) + }, + setDate: function(n, t) { + vi(n, t, 10) + }, + toDateString: function(n) { + var t = n.getFullYear(); + return t - t % 10 + "/0/1" + } + }] + }; + e.isEqualDatePart = er; + e.makeUnselectable = pi; + e.restrictValue = v; + e.isInRange = nt; + e.normalize = ct; + e.viewsEnum = o; + r.calendar = e + }(window.kendo.jQuery); +kendo_module({ + id: "datepicker", + name: "DatePicker", + category: "web", + description: "The DatePicker widget allows the user to select a date from a calendar or by direct input.", + depends: ["calendar", "popup"] + }), + function(n, t) { + function d(t) { + var i = t.parseFormats, + r = t.format; + o.normalize(t); + i = n.isArray(i) ? i : [i]; + n.inArray(r, i) === -1 && i.splice(0, 0, t.format); + t.parseFormats = i + } + + function pt(n) { + n.preventDefault() + } + var i = window.kendo, + f = i.ui, + e = f.Widget, + c = i.parseDate, + u = i.keys, + bt = i.template, + kt = i._activeElement, + g = "<div />", + nt = "<span />", + r = ".kendoDatePicker", + tt = "click" + r, + l = "open", + a = "close", + v = "change", + it = "disabled", + rt = "readonly", + y = "k-state-default", + ut = "k-state-focused", + ft = "k-state-selected", + p = "k-state-disabled", + dt = "k-state-hover", + ii = "keydown" + r, + gt = "mouseenter" + r + " mouseleave" + r, + et = "mousedown" + r, + w = "id", + ot = "min", + st = "max", + ht = "month", + ct = "aria-disabled", + lt = "aria-expanded", + b = "aria-hidden", + at = "aria-readonly", + o = i.calendar, + ni = o.isInRange, + vt = o.restrictValue, + ti = o.isEqualDatePart, + k = n.extend, + s = n.proxy, + yt = Date, + h = function(t) { + var r = this, + u, o = document.body, + e = n(g).attr(b, "true").addClass("k-calendar-container").appendTo(o); + r.options = t = t || {}; + u = t.id; + u && (u += "_dateview", e.attr(w, u), r._dateViewID = u); + r.popup = new f.Popup(e, k(t.popup, t, { + name: "Popup", + isRtl: i.support.isRtl(t.anchor) + })); + r.div = e; + r.value(t.value) + }, + wt; + h.prototype = { + _calendar: function() { + var t = this, + r = t.calendar, + u = t.options, + e; + r || (e = n(g).attr(w, i.guid()).appendTo(t.popup.element).on(et, pt).on(tt, "td:has(.k-link)", s(t._click, t)), t.calendar = r = new f.Calendar(e), t._setOptions(u), i.calendar.makeUnselectable(r.element), r.navigate(t._value || t._current, u.start), t.value(t._value)) + }, + _setOptions: function(n) { + this.calendar.setOptions({ + focusOnNav: !1, + change: n.change, + culture: n.culture, + dates: n.dates, + depth: n.depth, + footer: n.footer, + format: n.format, + max: n.max, + min: n.min, + month: n.month, + start: n.start + }) + }, + setOptions: function(n) { + var t = this.options; + this.options = k(t, n, { + change: t.change, + close: t.close, + open: t.open + }); + this.calendar && this._setOptions(this.options) + }, + destroy: function() { + this.popup.destroy() + }, + open: function() { + var n = this; + n._calendar(); + n.popup.open() + }, + close: function() { + this.popup.close() + }, + min: function(n) { + this._option(ot, n) + }, + max: function(n) { + this._option(st, n) + }, + toggle: function() { + var n = this; + n[n.popup.visible() ? a : l]() + }, + move: function(n) { + var t = this, + i = n.keyCode, + r = t.calendar, + f = n.ctrlKey && i == u.DOWN || i == u.ENTER; + if (i == u.ESC) { + t.close(); + return + } + if (n.altKey) { + i == u.DOWN ? (t.open(), n.preventDefault()) : i == u.UP && (t.close(), n.preventDefault()); + return + } + if (t.popup.visible()) { + if (f && r._cell.hasClass(ft)) { + t.close(); + n.preventDefault(); + return + } + t._current = r._move(n) + } + }, + current: function(n) { + this._current = n; + this.calendar._focus(n) + }, + value: function(n) { + var t = this, + i = t.calendar, + r = t.options; + t._value = n; + t._current = new yt(+vt(n, r.min, r.max)); + i && i.value(n) + }, + _click: function(n) { + n.currentTarget.className.indexOf(ft) !== -1 && this.close() + }, + _option: function(n, t) { + var i = this, + r = i.calendar; + i.options[n] = t; + r && r[n](t) + } + }; + h.normalize = d; + i.DateView = h; + wt = e.extend({ + init: function(n, t) { + var r = this, + f, u; + e.fn.init.call(r, n, t); + n = r.element; + t = r.options; + d(t); + r._wrapper(); + r.dateView = new h(k({}, t, { + id: n.attr(w), + anchor: r.wrapper, + change: function() { + r._change(this.value()); + r.close() + }, + close: function(t) { + r.trigger(a) ? t.preventDefault() : (n.attr(lt, !1), u.attr(b, !0)) + }, + open: function(t) { + var f = r.options, + i; + r.trigger(l) ? t.preventDefault() : (r.element.val() !== r._oldText && (i = c(n.val(), f.parseFormats, f.culture), r.dateView[i ? "current" : "value"](i)), n.attr(lt, !0), u.attr(b, !1), r._updateARIA(i)) + } + })); + u = r.dateView.div; + r._icon(); + try { + n[0].setAttribute("type", "text") + } catch (o) { + n[0].type = "text" + } + n.addClass("k-input").attr({ + role: "combobox", + "aria-expanded": !1, + "aria-owns": r.dateView._dateViewID + }); + r._reset(); + r._template(); + f = n.is("[disabled]"); + f ? r.enable(!1) : r.readonly(n.is("[readonly]")); + r._old = r._update(t.value || r.element.val()); + r._oldText = n.val(); + i.notify(r) + }, + events: [l, a, v], + options: { + name: "DatePicker", + value: null, + footer: "", + format: "", + culture: "", + parseFormats: [], + min: new Date(1900, 0, 1), + max: new Date(2099, 11, 31), + start: ht, + depth: ht, + animation: {}, + month: {}, + dates: [], + ARIATemplate: 'Current focused date is #=kendo.toString(data.current, "D")#' + }, + setOptions: function(n) { + var t = this, + r = t._value; + e.fn.setOptions.call(t, n); + n = t.options; + d(n); + t.dateView.setOptions(n); + r && (t.element.val(i.toString(r, n.format, n.culture)), t._updateARIA(r)) + }, + _editable: function(n) { + var t = this, + o = t._dateIcon.off(r), + f = t.element.off(r), + e = t._inputWrapper.off(r), + u = n.readonly, + i = n.disable; + if (u || i) e.addClass(i ? p : y).removeClass(i ? y : p), f.attr(it, i).attr(rt, u).attr(ct, i).attr(at, u); + else { + e.addClass(y).removeClass(p).on(gt, t._toggleHover); + f.removeAttr(it).removeAttr(rt).attr(ct, !1).attr(at, !1).on("keydown" + r, s(t._keydown, t)).on("blur" + r, s(t._blur, t)).on("focus" + r, function() { + t._inputWrapper.addClass(ut) + }); + o.on(tt, s(t._click, t)).on(et, pt) + } + }, + readonly: function(n) { + this._editable({ + readonly: n === t ? !0 : n, + disable: !1 + }) + }, + enable: function(n) { + this._editable({ + readonly: !1, + disable: !(n = n === t ? !0 : n) + }) + }, + destroy: function() { + var n = this; + e.fn.destroy.call(n); + n.dateView.destroy(); + n.element.off(r); + n._dateIcon.off(r); + n._inputWrapper.off(r); + n._form && n._form.off("reset", n._resetHandler) + }, + open: function() { + this.dateView.open() + }, + close: function() { + this.dateView.close() + }, + min: function(n) { + return this._option(ot, n) + }, + max: function(n) { + return this._option(st, n) + }, + value: function(n) { + var i = this; + if (n === t) return i._value; + i._old = i._update(n); + i._old === null && i.element.val(""); + i._oldText = i.element.val() + }, + _toggleHover: function(t) { + n(t.currentTarget).toggleClass(dt, t.type === "mouseenter") + }, + _blur: function() { + var n = this, + t = n.element.val(); + n.close(); + t !== n._oldText && n._change(t); + n._inputWrapper.removeClass(ut) + }, + _click: function() { + var n = this, + t = n.element; + n.dateView.toggle(); + i.support.touch || t[0] === kt() || t.focus() + }, + _change: function(n) { + var t = this; + n = t._update(n); + t._old != +n && (t._old = n, t._oldText = t.element.val(), t.trigger(v), t.element.trigger(v)) + }, + _keydown: function(n) { + var t = this, + i = t.dateView, + r = t.element.val(); + i.popup.visible() || n.keyCode != u.ENTER || r === t._oldText ? (i.move(n), t._updateARIA(i._current)) : t._change(r) + }, + _icon: function() { + var i = this, + r = i.element, + t; + t = r.next("span.k-select"); + t[0] || (t = n('<span unselectable="on" class="k-select"><span unselectable="on" class="k-icon k-i-calendar">select<\/span><\/span>').insertAfter(r)); + i._dateIcon = t.attr({ + role: "button", + "aria-controls": i.dateView._dateViewID + }) + }, + _option: function(n, i) { + var u = this, + r = u.options; + if (i === t) return r[n]; + (i = c(i, r.parseFormats, r.culture), i) && (r[n] = new yt(+i), u.dateView[n](i)) + }, + _update: function(n) { + var u = this, + r = u.options, + f = r.min, + o = r.max, + t = c(n, r.parseFormats, r.culture), + e; + return +t == +u._value ? (e = i.toString(t, r.format, r.culture), e !== n && u.element.val(t === null ? n : e), t) : (t !== null && ti(t, f) ? t = vt(t, f, o) : ni(t, f, o) || (t = null), u._value = t, u.dateView.value(t), u.element.val(t ? i.toString(t, r.format, r.culture) : n), u._updateARIA(t), t) + }, + _wrapper: function() { + var r = this, + i = r.element, + t; + t = i.parents(".k-datepicker"); + t[0] || (t = i.wrap(nt).parent().addClass("k-picker-wrap k-state-default"), t = t.wrap(nt).parent()); + t[0].style.cssText = i[0].style.cssText; + i.css({ + width: "100%", + height: i[0].style.height + }); + r.wrapper = t.addClass("k-widget k-datepicker k-header").addClass(i[0].className); + r._inputWrapper = n(t[0].firstChild) + }, + _reset: function() { + var t = this, + i = t.element, + r = i.attr("form"), + u = r ? n("#" + r) : i.closest("form"); + u[0] && (t._resetHandler = function() { + t.value(i[0].defaultValue) + }, t._form = u.on("reset", t._resetHandler)) + }, + _template: function() { + this._ariaTemplate = bt(this.options.ARIATemplate) + }, + _updateARIA: function(n) { + var i, t = this, + r = t.dateView.calendar; + t.element.removeAttr("aria-activedescendant"); + r && (i = r._cell, i.attr("aria-label", t._ariaTemplate({ + current: n || r.current() + })), t.element.attr("aria-activedescendant", i.attr("id"))) + } + }); + f.plugin(wt) + }(window.kendo.jQuery); +kendo_module({ + id: "dropdownlist", + name: "DropDownList", + category: "web", + description: "The DropDownList widget displays a list of values and allows the selection of a single value from the list.", + depends: ["list"], + features: [{ + id: "mobile-scroller", + name: "Mobile scroller", + description: "Support for kinetic scrolling in mobile device", + depends: ["mobile.scroller"] + }] + }), + function(n, t) { + function o(n, t, i) { + for (var u = 0, f = t.length - 1, r; u < f; ++u) r = t[u], r in n || (n[r] = {}), n = n[r]; + n[t[f]] = i + } + var r = window.kendo, + s = r.ui, + u = s.Select, + f = r.support.mobileOS, + i = ".kendoDropDownList", + a = "disabled", + v = "readonly", + y = "change", + p = "k-state-focused", + h = "k-state-default", + c = "k-state-disabled", + w = "aria-disabled", + b = "aria-readonly", + l = "k-state-selected", + k = "mouseenter" + i + " mouseleave" + i, + e = "tabindex", + d = n.proxy, + g = u.extend({ + init: function(f, o) { + var s = this, + a = o && o.index, + c, l, h; + s.ns = i; + o = n.isArray(o) ? { + dataSource: o + } : o; + u.fn.init.call(s, f, o); + s._focusHandler = function() { + s.wrapper.focus() + }; + o = s.options; + f = s.element.on("focus" + i, s._focusHandler); + this._inputTemplate(); + s._reset(); + s._word = ""; + s._wrapper(); + s._tabindex(); + s.wrapper.data(e, s.wrapper.attr(e)); + s._aria(); + s._span(); + s._popup(); + s._mobile(); + s._dataSource(); + s._ignoreCase(); + s._enable(); + s._oldIndex = s.selectedIndex = -1; + s._cascade(); + a !== t && (o.index = a); + o.autoBind ? s.dataSource.fetch() : s.selectedIndex === -1 && (h = o.text || "", h || (c = o.optionLabel, l = c && o.index === 0, s._isSelect ? h = l ? c : f.children(":selected").text() : !f[0].value && l && (h = c)), s._textAccessor(h)); + r.notify(s) + }, + options: { + name: "DropDownList", + enabled: !0, + autoBind: !0, + index: 0, + text: null, + value: null, + template: "", + valueTemplate: "", + delay: 500, + height: 200, + dataTextField: "", + dataValueField: "", + optionLabel: "", + cascadeFrom: "", + cascadeFromField: "", + ignoreCase: !0, + animation: {} + }, + events: ["open", "close", y, "select", "dataBinding", "dataBound", "cascade"], + setOptions: function(n) { + u.fn.setOptions.call(this, n); + this._template(); + this._inputTemplate(); + this._accessors(); + this._aria() + }, + destroy: function() { + var n = this; + n.wrapper.off(i); + n.element.off(i); + n._inputWrapper.off(i); + u.fn.destroy.call(n) + }, + open: function() { + var n = this; + n.ul[0].firstChild ? (n.popup.open(), n._scroll(n._current)) : (n._open = !0, n._request || n.dataSource.fetch()) + }, + toggle: function(n) { + this._toggle(n) + }, + refresh: function() { + var n = this, + u = n._data(), + t = u.length, + i = n.options.optionLabel, + e = n.element[0], + f; + n.trigger("dataBinding"); + n._current && n.current(null); + n.ul[0].innerHTML = r.render(n.template, u); + n._height(t); + n.popup.visible() && n.popup._position(); + n._isSelect && (f = e.selectedIndex, i && t && (i = '<option value="">' + n._optionLabelText(i) + "<\/option>"), n._options(u, i), e.selectedIndex = f === -1 ? 0 : f); + n._open && (n._open = !1, n.toggle(!!t)); + n._hideBusy(); + n._makeUnselectable(); + n._fetch || (t ? n._selectItem() : n._textAccessor() !== i && (n.element.val(""), n._textAccessor(""))); + n._bound = !!t; + n.trigger("dataBound") + }, + search: function(n) { + if (n) { + var i = this, + r = i.options.ignoreCase; + r && (n = n.toLowerCase()); + i._select(function(u) { + var f = i._text(u); + if (f !== t) return f = f + "", r && (f = f.toLowerCase()), f.indexOf(n) === 0 + }) + } + }, + text: function(n) { + var i = this, + r, u, f = i.options.ignoreCase; + if (n = n === null ? "" : n, n !== t) typeof n == "string" && (u = f ? n.toLowerCase() : n, r = i._select(function(n) { + return n = i._text(n), f && (n = (n + "").toLowerCase()), n === u + }), r && (n = r)), i._textAccessor(n); + else return i._textAccessor() + }, + value: function(n) { + var i = this, + r, u; + if (n !== t) { + if (n !== null && (n = n.toString()), i._selectedValue = n, u = n || i.options.optionLabel && !i.element[0].disabled && n === "", u && i._fetchItems(n)) return; + r = i._index(n); + i.select(r > -1 ? r : 0) + } else return i._accessor() + }, + _editable: function(n) { + var t = this, + s = t.element, + o = n.disable, + l = n.readonly, + u = t.wrapper.off(i), + f = t._inputWrapper.off(k), + y = function() { + f.addClass(p); + t._blured = !1 + }, + g = function() { + if (!t._blured) { + t._triggerCascade(); + var n = window.self !== window.top; + r.support.mobileOS.ios && n ? t._change() : t._blur(); + f.removeClass(p); + t._blured = !0; + s.blur() + } + }; + if (l || o) { + if (o) u.removeAttr(e), f.addClass(c).removeClass(h); + else { + f.addClass(h).removeClass(c); + u.on("focusin" + i, y).on("focusout" + i, g) + } + s.attr(a, o).attr(v, l); + u.attr(w, o).attr(b, l) + } else { + s.removeAttr(a).removeAttr(v); + f.addClass(h).removeClass(c).on(k, t._toggleHover); + u.attr(e, u.data(e)).attr(w, !1).attr(b, !1).on("click" + i, function(n) { + t._blured = !1; + n.preventDefault(); + t.toggle() + }).on("keydown" + i, d(t._keydown, t)).on("keypress" + i, d(t._keypress, t)).on("focusin" + i, y).on("focusout" + i, g) + } + }, + _accept: function(n) { + this._focus(n) + }, + _optionLabelText: function() { + var t = this.options, + i = t.dataTextField, + n = t.optionLabel; + return n && i && typeof n == "object" ? this._text(n) : n + }, + _data: function() { + var h = this, + f = h.options, + t = f.optionLabel, + i = f.dataTextField, + e = f.dataValueField, + u = h.dataSource.view(), + c = u.length, + n = t, + s = 0; + if (t && c) { + for (typeof t == "object" ? n = t : i && (n = {}, i = i.split("."), e = e.split("."), o(n, e, ""), o(n, i, t)), n = new r.data.ObservableArray([n]); s < c; s++) n.push(u[s]); + u = n + } + return u + }, + _selectItem: function() { + u.fn._selectItem.call(this); + this.current() || this.select(0) + }, + _keydown: function(n) { + var u = this, + t = n.keyCode, + i = r.keys, + f = u.ul[0]; + t === i.LEFT ? t = i.UP : t === i.RIGHT && (t = i.DOWN); + n.keyCode = t; + u._move(n); + t === i.HOME ? (n.preventDefault(), u._select(f.firstChild)) : t === i.END && (n.preventDefault(), u._select(f.lastChild)) + }, + _selectNext: function(n, t) { + for (var i = this, r, f = t, u = i._data(), o = u.length, s = i.options.ignoreCase, e = function(t, r) { + return t = t + "", s && (t = t.toLowerCase()), t.indexOf(n) === 0 ? (i._select(r), i._triggerEvents(), !0) : void 0 + }; t < o; t++) + if (r = i._text(u[t]), r && e(r, t)) return !0; + if (f > 0) + for (t = 0; t <= f; t++) + if (r = i._text(u[t]), r && e(r, t)) return !0; + return !1 + }, + _keypress: function(n) { + if (n.charCode !== 0) { + var t = this, + i = String.fromCharCode(n.charCode || n.keyCode), + u = t.selectedIndex, + r = t._word; + (t.options.ignoreCase && (i = i.toLowerCase()), i === " " && n.preventDefault(), t._last === i && r.length <= 1 && u > -1 && (r || (r = i), t._selectNext(r, u + 1))) || (t._word = r + i, t._last = i, t._search()) + } + }, + _popup: function() { + u.fn._popup.call(this); + this.popup.one("open", function() { + this.wrapper = r.wrap(this.element).addClass("km-popup") + }) + }, + _search: function() { + var n = this, + i = n.dataSource, + t = n.selectedIndex, + r = n._word; + if (clearTimeout(n._typing), n._typing = setTimeout(function() { + n._word = "" + }, n.options.delay), t === -1 && (t = 0), !n.ul[0].firstChild) { + i.one(y, function() { + i.data()[0] && t > -1 && n._selectNext(r, t) + }).fetch(); + return + } + n._selectNext(r, t); + n._triggerEvents() + }, + _select: function(n) { + var i = this, + e = i._current, + r = null, + f, u; + return n = i._get(n), n && n[0] && !n.hasClass(l) && (e && e.removeClass(l), u = s.List.inArray(n[0], i.ul[0]), u > -1 && (r = i._data()[u], f = i._value(r), i.selectedIndex = u, i._textAccessor(r), i._accessor(f !== t ? f : i._text(r), u), i._selectedValue = i._accessor(), i.current(n.addClass(l)), i._optionID && i._current.attr("aria-selected", !0))), r + }, + _triggerEvents: function() { + this.popup.visible() || (this._triggerCascade(), this._change()) + }, + _mobile: function() { + var t = this, + n = t.popup, + i = n.element.parents(".km-root").eq(0); + i.length && f && (n.options.animation.open.effects = f.android || f.meego ? "fadeIn" : f.ios || f.wp ? "slideIn:up" : n.options.animation.open.effects) + }, + _span: function() { + var t = this, + i = t.wrapper, + u = "span.k-input", + r; + r = i.find(u); + r[0] || (i.append('<span unselectable="on" class="k-dropdown-wrap k-state-default"><span unselectable="on" class="k-input"> <\/span><span unselectable="on" class="k-select"><span unselectable="on" class="k-icon k-i-arrow-s">select<\/span><\/span><\/span>').append(t.element), r = i.find(u)); + t.span = r; + t._inputWrapper = n(i[0].firstChild); + t._arrow = i.find(".k-icon").mousedown(function(n) { + n.preventDefault() + }) + }, + _wrapper: function() { + var i = this, + t = i.element, + r = t[0], + n; + n = t.parent(); + n.is("span.k-widget") || (n = t.wrap("<span />").parent(), n[0].style.cssText = r.style.cssText); + t.hide(); + i._focused = i.wrapper = n.addClass("k-widget k-dropdown k-header").addClass(r.className).css("display", "").attr({ + unselectable: "on", + role: "listbox", + "aria-haspopup": !0, + "aria-expanded": !1 + }) + }, + _clearSelection: function() { + var n = this, + t = n.options.optionLabel; + if (n.options.value = "", n._selectedValue = "", n.dataSource.view()[0] && (t || n._userTriggered)) { + n.select(0); + return + } + n.selectedIndex = -1; + n.element.val(""); + n._textAccessor(n.options.optionLabel) + }, + _inputTemplate: function() { + var i = this, + t = i.options.valueTemplate; + t = t ? r.template(t) : n.proxy(r.template("#:this._text(data)#"), i); + i.valueTemplate = t + }, + _textAccessor: function(i) { + var u = this.dataItem(), + f = this.options, + e = this.span; + if (i !== t) n.isPlainObject(i) || i instanceof r.data.ObservableObject ? u = i : u && this._text(u) === i || (f.dataTextField ? (u = {}, o(u, f.dataTextField.split("."), i), o(u, f.dataValueField.split("."), this._accessor())) : u = i), e.html(this.valueTemplate(u)); + else return e.text() + } + }); + s.plugin(g) + }(window.kendo.jQuery); +kendo_module({ + id: "combobox", + name: "ComboBox", + category: "web", + description: "The ComboBox widget allows the selection from pre-defined values or entering a new value.", + depends: ["list"], + features: [{ + id: "mobile-scroller", + name: "Mobile scroller", + description: "Support for kinetic scrolling in mobile device", + depends: ["mobile.scroller"] + }] + }), + function(n, t) { + var r = window.kendo, + o = r.ui, + u = o.List, + f = o.Select, + ut = r.support, + v = ut.placeholder, + s = r._activeElement, + h = r.keys, + i = ".kendoComboBox", + y = "click" + i, + p = "mousedown" + i, + w = "disabled", + b = "readonly", + k = "change", + c = "k-state-default", + d = "k-state-focused", + l = "k-state-disabled", + g = "aria-disabled", + nt = "aria-readonly", + tt = "k-state-selected", + e = "filter", + a = "accept", + it = "rebind", + ft = "mouseenter" + i + " mouseleave" + i, + rt = null, + et = n.proxy, + ot = f.extend({ + init: function(t, u) { + var e = this, + o; + e.ns = i; + u = n.isArray(u) ? { + dataSource: u + } : u; + f.fn.init.call(e, t, u); + e._focusHandler = function() { + e.input.focus() + }; + u = e.options; + t = e.element.on("focus" + i, e._focusHandler); + u.placeholder = u.placeholder || t.attr("placeholder"); + e._reset(); + e._wrapper(); + e._input(); + e._tabindex(e.input); + e._popup(); + e._dataSource(); + e._ignoreCase(); + e._enable(); + e._cascade(); + e._aria(); + e._oldIndex = e.selectedIndex = -1; + u.autoBind ? e._filterSource() : (o = u.text, !o && e._isSelect && (o = t.children(":selected").text()), o && (e.input.val(o), e._prev = o)); + o || e._placeholder(); + r.notify(e) + }, + options: { + name: "ComboBox", + enabled: !0, + index: -1, + text: null, + value: null, + autoBind: !0, + delay: 200, + dataTextField: "", + dataValueField: "", + minLength: 0, + height: 200, + highlightFirst: !0, + template: "", + filter: "none", + placeholder: "", + suggest: !1, + cascadeFrom: "", + cascadeFromField: "", + ignoreCase: !0, + animation: {} + }, + events: ["open", "close", k, "select", "dataBinding", "dataBound", "cascade"], + setOptions: function(n) { + f.fn.setOptions.call(this, n); + this._template(); + this._accessors(); + this._aria() + }, + current: function(n) { + var r = this, + i = r._current; + if (n === t) return i; + i && i.removeClass(tt); + f.fn.current.call(r, n) + }, + destroy: function() { + var n = this; + n.input.off(i); + n.element.off(i); + n._inputWrapper.off(i); + f.fn.destroy.call(n) + }, + _editable: function(n) { + var t = this, + r = n.disable, + f = n.readonly, + u = t._inputWrapper.off(i), + e = t.element.add(t.input.off(i)), + o = t._arrow.parent().off(y + " " + p); + if (f || r) u.addClass(r ? l : c).removeClass(r ? c : l), e.attr(w, r).attr(b, f).attr(g, r).attr(nt, f); + else { + u.addClass(c).removeClass(l).on(ft, t._toggleHover); + e.removeAttr(w).removeAttr(b).attr(g, !1).attr(nt, !1); + o.on(y, function() { + t.toggle() + }).on(p, function(n) { + n.preventDefault() + }); + t.input.on("keydown" + i, et(t._keydown, t)).on("focus" + i, function() { + u.addClass(d); + t._placeholder(!1) + }).on("blur" + i, function() { + u.removeClass(d); + clearTimeout(t._typing); + t.options.text !== t.input.val() && t.text(t.text()); + t._placeholder(); + t._blur(); + t.element.blur() + }) + } + }, + open: function() { + var n = this, + t = n.dataSource.options.serverFiltering; + n.popup.visible() || (n.ul[0].firstChild && (n._state !== a || t) ? (n.popup.open(), n._scroll(n._current)) : (n._open = !0, n._state = it, n._filterSource())) + }, + refresh: function() { + var i = this, + f = i.ul[0], + l = i.options, + a = i._state, + o = i._data(), + h = o.length, + v = !0, + y, c, u; + i.trigger("dataBinding"); + f.innerHTML = r.render(i.template, o); + i._height(h); + i.popup.visible() && i.popup._position(); + i._isSelect && (y = i.element[0].firstChild, a === it && (i._state = ""), u = i._option, i._option = t, i._options(o), u && u[0].selected ? i._custom(u.val(), v) : i._bound || y || i._custom("", v)); + h && (l.highlightFirst && i.current(n(f.firstChild)), l.suggest && i.input.val() && i._request !== t && i.suggest(n(f.firstChild))); + a === e || i._fetch || i._selectItem(); + i._open && (i._open = !1, c = !!h, i._typing && i.input[0] !== s() && (c = !1), i.toggle(c), i._typing = t); + i._touchScroller && i._touchScroller.reset(); + i._makeUnselectable(); + i._hideBusy(); + i._bound = !0; + i.trigger("dataBound") + }, + search: function(n) { + n = typeof n == "string" ? n : this.text(); + var t = this, + f = n.length, + i = t.options, + r = i.ignoreCase, + u = i.filter, + o = i.dataTextField; + clearTimeout(t._typing); + f >= i.minLength && (t._state = e, u === "none" ? t._filter(n) : (t._open = !0, t._filterSource({ + value: r ? n.toLowerCase() : n, + field: o, + operator: u, + ignoreCase: r + }))) + }, + suggest: function(n) { + var r = this, + o = r.input[0], + i = r.text(), + e = u.caret(o), + c = r._last, + f; + if (c == h.BACKSPACE || c == h.DELETE) { + r._last = t; + return + } + n = n || ""; + typeof n != "string" && (f = u.inArray(n[0], r.ul[0]), n = f > -1 ? r._text(r.dataSource.view()[f]) : ""); + e <= 0 && (e = i.toLowerCase().indexOf(n.toLowerCase()) + 1); + n ? (f = n.toLowerCase().indexOf(i.toLowerCase()), f > -1 && (i += n.substring(f + i.length))) : i = i.substring(0, e); + i.length === e && n || (o.value = i, o === s() && u.selectText(o, e, i.length)) + }, + text: function(n) { + n = n === null ? "" : n; + var i = this, + u = i.input[0], + e = i.options.ignoreCase, + f = n, + r; + if (n !== t) { + if (r = i.dataItem(), r && i._text(r) === n && i._value(r).toString() === i._old) { + i._triggerCascade(); + return + } + e && (f = f.toLowerCase()); + i._select(function(n) { + return n = i._text(n), e && (n = (n + "").toLowerCase()), n === f + }); + i.selectedIndex < 0 && (i._custom(n), u.value = n); + i._prev = u.value; + i._triggerCascade() + } else return u.value + }, + toggle: function(n) { + var t = this; + t._toggle(n) + }, + value: function(n) { + var i = this, + u = i.options, + r; + if (n !== t) { + if (n !== null && (n = n.toString()), i._selectedValue = n, !i._open && n && i._fetchItems(n)) return; + r = i._index(n); + r > -1 ? i.select(r) : (i.current(rt), i._custom(n), (u.value !== n || u.text !== i.input.val()) && (i.text(n), i._placeholder())); + i._old = i._accessor(); + i._oldIndex = i.selectedIndex + } else return i._accessor() + }, + _accept: function(n) { + var t = this; + n ? t._focus(n) : (t.text(t.text()), t._change()) + }, + _custom: function(t, i) { + var r = this, + f = r.element, + u = r._option; + r._state !== e || i || (r._state = a); + r._isSelect ? (u || (u = r._option = n("<option/>"), f.append(u)), u.text(t), u[0].selected = !0) : f.val(t); + r._selectedValue = t + }, + _filter: function(n) { + var i = this, + r = i.options, + u = i.dataSource, + f = r.ignoreCase, + e = function(r) { + var u = i._text(r); + if (u !== t) return (u = u + "", u !== "" && n === "") ? !1 : (f && (u = u.toLowerCase()), u.indexOf(n) === 0) + }; + if (f && (n = n.toLowerCase()), !i.ul[0].firstChild) { + u.one(k, function() { + u.data()[0] && i.search(n) + }).fetch(); + return + } + i._highlight(e) !== -1 && (r.suggest && i._current && i.suggest(i._current), i.open()); + i._hideBusy() + }, + _highlight: function(i) { + var r = this, + f; + return i === t || i === null ? -1 : (i = r._get(i), f = u.inArray(i[0], r.ul[0]), f == -1 && (r.options.highlightFirst && !r.text() ? (i = r.ul[0].firstChild, i && (i = n(i))) : i = rt), r.current(i), f) + }, + _input: function() { + var t = this, + i = t.element.removeClass("k-input")[0], + e = i.accessKey, + u = t.wrapper, + o = "input.k-input", + f = i.name || "", + r; + f && (f = 'name="' + f + '_input" '); + r = u.find(o); + r[0] || (u.append('<span tabindex="-1" unselectable="on" class="k-dropdown-wrap k-state-default"><input ' + f + 'class="k-input" type="text" autocomplete="off"/><span tabindex="-1" unselectable="on" class="k-select"><span unselectable="on" class="k-icon k-i-arrow-s">select<\/span><\/span><\/span>').append(t.element), r = u.find(o)); + r[0].style.cssText = i.style.cssText; + i.maxLength > -1 && (r[0].maxLength = i.maxLength); + r.addClass(i.className).val(this.options.text || i.value).css({ + width: "100%", + height: i.style.height + }).attr({ + role: "combobox", + "aria-expanded": !1 + }).show(); + v && r.attr("placeholder", t.options.placeholder); + e && (i.accessKey = "", r[0].accessKey = e); + t._focused = t.input = r; + t._inputWrapper = n(u[0].firstChild); + t._arrow = u.find(".k-icon").attr({ + role: "button", + tabIndex: -1 + }); + i.id && t._arrow.attr("aria-controls", t.ul[0].id) + }, + _keydown: function(n) { + var t = this, + i = n.keyCode; + t._last = i; + clearTimeout(t._typing); + i == h.TAB || t._move(n) || t._search() + }, + _placeholder: function(n) { + if (!v) { + var f = this, + i = f.input, + r = f.options.placeholder, + e; + if (r) { + if (e = f.value(), n === t && (n = !e), i.toggleClass("k-readonly", n), !n) { + if (e) return; + r = "" + } + i.val(r); + r || i[0] !== s() || u.selectText(i[0], 0, 0) + } + } + }, + _search: function() { + var n = this; + n._typing = setTimeout(function() { + var t = n.text(); + n._prev !== t && (n._prev = t, n.search(t)); + n._typing = null + }, n.options.delay) + }, + _select: function(n) { + var i = this, + f, o, r = i._data(), + u = i._highlight(n); + i.selectedIndex = u; + u !== -1 && (i._state === e && (i._state = a), i._current.addClass(tt), r = r[u], f = i._text(r), o = i._value(r), i._prev = i.input[0].value = f, i._accessor(o !== t ? o : f, u), i._selectedValue = i._accessor(), i._placeholder(), i._optionID && i._current.attr("aria-selected", !0)) + }, + _wrapper: function() { + var i = this, + n = i.element, + t = n.parent(); + t.is("span.k-widget") || (t = n.hide().wrap("<span />").parent(), t[0].style.cssText = n[0].style.cssText); + i.wrapper = t.addClass("k-widget k-combobox k-header").addClass(n[0].className).css("display", "") + }, + _clearSelection: function(n, t) { + var i = this, + r = n._selectedValue || n.value(), + u = r && n.selectedIndex === -1; + (t || !r || u) && (i.value(""), i.options.value = "") + } + }); + o.plugin(ot) + }(window.kendo.jQuery); +kendo_module({ + id: "multiselect", + name: "MultiSelect", + category: "web", + description: "The MultiSelect widget allows the selection from pre-defined values.", + depends: ["list"], + features: [{ + id: "mobile-scroller", + name: "Mobile scroller", + description: "Support for kinetic scrolling in mobile device", + depends: ["mobile.scroller"] + }] + }), + function(n, t) { + function ni(n, t) { + var i; + if (n === null && t !== null || n !== null && t === null || (i = n.length, i !== t.length)) return !1; + while (i--) + if (n[i] !== t[i]) return !1; + return !0 + } + + function s(t) { + var i = t.firstChild; + return (i && i.style.display === "none" && (i = h(i, it)), i) ? n(i) : i + } + + function lt(t) { + var i = t.lastChild; + return (i && i.style.display === "none" && (i = h(i, rt)), i) ? n(i) : i + } + + function h(n, t) { + return n = n[t], n && n.style.display === "none" && (n = h(n, t)), n + } + var i = window.kendo, + d = i.ui, + f = d.List, + r = i.keys, + g = i._activeElement, + at = i.data.ObservableArray, + c = n.proxy, + e = "id", + v = "li", + y = "accept", + p = "filter", + nt = "open", + tt = "close", + o = "change", + vt = "progress", + w = "select", + it = "nextSibling", + rt = "previousSibling", + yt = ' style="display:none"', + ut = "aria-disabled", + ft = "aria-readonly", + l = "k-state-focused", + b = "k-loading-hidden", + et = "k-state-hover", + k = "k-state-disabled", + ot = "disabled", + st = "readonly", + u = ".kendoMultiSelect", + pt = "click" + u, + wt = "keydown" + u, + ht = "mouseenter" + u, + ct = "mouseleave" + u, + bt = ht + " " + ct, + kt = /"/g, + a = n.isArray, + dt = ["font-family", "font-size", "font-stretch", "font-style", "font-weight", "letter-spacing", "text-transform", "line-height"], + gt = f.extend({ + init: function(t, r) { + var o = this, + s, h; + o.ns = u; + f.fn.init.call(o, t, r); + o._wrapper(); + o._tagList(); + o._input(); + o._textContainer(); + o._loader(); + o._tabindex(o.input); + t = o.element.attr("multiple", "multiple").hide(); + r = o.options; + h = r.value; + r.placeholder || (r.placeholder = t.data("placeholder")); + s = t.attr(e); + s && (o._tagID = s + "_tag_active", s = s + "_taglist", o.tagList.attr(e, s)); + o._aria(s); + o._dataSource(); + o._ignoreCase(); + o._popup(); + o._values = []; + o._dataItems = []; + o._reset(); + o._enable(); + o._placeholder(); + r.autoBind ? o.dataSource.fetch() : h && (a(h) || (h = [h]), (n.isPlainObject(h[0]) || !r.dataValueField) && (o._retrieveData = !0, o.dataSource.data(h), o.value(o._initialValues))); + i.notify(o) + }, + options: { + name: "MultiSelect", + enabled: !0, + autoBind: !0, + autoClose: !0, + highlightFirst: !0, + dataTextField: "", + dataValueField: "", + filter: "startswith", + ignoreCase: !0, + minLength: 0, + delay: 100, + value: null, + maxSelectedItems: null, + itemTemplate: "", + tagTemplate: "", + placeholder: "", + height: 200, + animation: {} + }, + events: [nt, tt, o, w, "dataBinding", "dataBound"], + setDataSource: function(n) { + this.options.dataSource = n; + this._dataSource(); + this.options.autoBind && this.dataSource.fetch() + }, + setOptions: function(n) { + f.fn.setOptions.call(this, n); + this._template(); + this._accessors(); + this._aria(this.tagList.attr(e)) + }, + current: function(n) { + return this.currentTag(null), f.fn.current.call(this, n) + }, + currentTag: function(n) { + var i = this; + if (n !== t) i._currentTag && (i._currentTag.removeClass(l).removeAttr(e), i.input.removeAttr("aria-activedescendant")), n && (n.addClass(l).attr(e, i._tagID), i.input.attr("aria-activedescendant", i._tagID)), i._currentTag = n; + else return i._currentTag + }, + dataItems: function() { + return this._dataItems + }, + destroy: function() { + var n = this, + t = n.ns; + n.wrapper.off(t); + n.tagList.off(t); + n.input.off(t); + f.fn.destroy.call(n) + }, + _editable: function(t) { + var i = this, + r = t.disable, + f = t.readonly, + e = i.wrapper.off(u), + s = i.tagList.off(u), + o = i.element.add(i.input.off(u)); + if (f || r) r ? e.addClass(k) : e.removeClass(k), o.attr(ot, r).attr(st, f).attr(ut, r).attr(ft, f); + else { + e.removeClass(k).on(bt, i._toggleHover).on("mousedown" + u, function(n) { + var t = n.target.nodeName.toLowerCase() !== "input"; + t && n.preventDefault(); + n.target.className.indexOf("k-delete") === -1 && (i.input[0] !== g() && t && i.input.focus(), i.options.minLength === 0 && i.open()) + }); + i.input.on(wt, c(i._keydown, i)).on("paste" + u, c(i._search, i)).on("focus" + u, function() { + i._placeholder(!1) + }).on("blur" + u, function() { + clearTimeout(i._typing); + i._placeholder(); + i.close(); + i._state === p && (i._state = y); + i.element.blur() + }); + o.removeAttr(ot).removeAttr(st).attr(ut, !1).attr(ft, !1); + s.on(ht, v, function() { + n(this).addClass(et) + }).on(ct, v, function() { + n(this).removeClass(et) + }).on(pt, ".k-delete", function(t) { + i._unselect(n(t.target).closest(v)); + i._change(); + i.close() + }) + } + }, + _close: function() { + var n = this; + n.options.autoClose || !n._visibleItems ? n.close() : (n.current(n.options.highlightFirst ? s(n.ul[0]) : null), n.popup._position()) + }, + close: function() { + this.popup.close(); + this.current(null) + }, + open: function() { + var n = this; + !n.ul[0].firstChild || n._state === y || n._retrieveData ? (n._state = "", n._open = !0, n._retrieveData = !1, n._filterSource()) : n._visibleItems && n._allowSelection() && (n.popup.open(), n.current(n.options.highlightFirst ? s(n.ul[0]) : null)) + }, + toggle: function(n) { + n = n !== t ? n : !this.popup.visible(); + this[n ? nt : tt]() + }, + refresh: function() { + var n = this, + i = null, + t; + n.trigger("dataBinding"); + t = n._render(n.dataSource.view()); + n._height(t); + n._setInitialValues && (n._setInitialValues = !1, n.value(n._initialValues)); + n._open && (n._open = !1, n.toggle(t)); + n.popup.visible() && (n.popup._position(), n.options.highlightFirst && (i = s(n.ul[0]))); + n.current(i); + n._touchScroller && n._touchScroller.reset(); + n._makeUnselectable(); + n._hideBusy(); + n.trigger("dataBound") + }, + search: function(n) { + var t = this, + i = t.options, + u = i.ignoreCase, + f = i.filter, + e = i.dataTextField, + r = t.input.val(); + i.placeholder === r && (r = ""); + clearTimeout(t._typing); + n = typeof n == "string" ? n : r; + n.length >= i.minLength && (t._state = p, t._open = !0, t._filterSource({ + value: u ? n.toLowerCase() : n, + field: e, + operator: f, + ignoreCase: u + })) + }, + value: function(i) { + var r = this, + o = n(r.tagList[0].children), + f = o.length, + e, u = 0; + if (i === t) return r._values; + if (!r._fetchItems(i)) { + for (; u < f; u++) r._unselect(o.eq(u)); + if (i !== null) { + for (i = a(i) || i instanceof at ? i : [i], u = 0, f = i.length; u < f; u++) e = r._index(i[u]), e > -1 && r._select(e); + r._old = r._values.slice() + } + } + }, + _dataSource: function() { + var n = this, + u = n.element, + r = n.options, + t = r.dataSource || {}; + t = a(t) ? { + data: t + } : t; + t.select = u; + t.fields = [{ + field: r.dataTextField + }, { + field: r.dataValueField + }]; + n.dataSource && n._refreshHandler ? n._unbindDataSource() : (n._refreshHandler = c(n.refresh, n), n._progressHandler = c(n._showBusy, n)); + n.dataSource = i.data.DataSource.create(t).bind(o, n._refreshHandler).bind(vt, n._progressHandler) + }, + _fetchItems: function(t) { + var i = this, + r = n.isArray(t) && t.length === 0; + if (!r && t && !i._fetch && !i.ul[0].firstChild) { + i.dataSource.one(o, function() { + i.value(t); + i._fetch = !1 + }); + return i._fetch = !0, i.dataSource.fetch(), !0 + } + }, + _reset: function() { + var t = this, + i = t.element, + r = i.attr("form"), + u = r ? n("#" + r) : i.closest("form"); + u[0] && (t._resetHandler = function() { + setTimeout(function() { + t.value(t._initialValues) + }) + }, t._form = u.on("reset", t._resetHandler)) + }, + _initValue: function() { + var t = this, + n = t.options.value || t.element.val(); + n === null ? n = [] : (a(n) || (n = [n]), n = t._mapValues(n)); + t._old = t._initialValues = n; + t._setInitialValues = !!n[0] + }, + _mapValues: function(t) { + var i = this; + return t && n.isPlainObject(t[0]) && (t = n.map(t, function(n) { + return i._value(n) + })), t + }, + _change: function() { + var n = this, + t = n.value(); + ni(t, n._old) || (n._old = t.slice(), n.trigger(o), n.element.trigger(o)) + }, + _click: function(t) { + var i = this, + r = n(t.currentTarget); + if (!t.isDefaultPrevented()) { + if (i.trigger(w, { + item: r + })) { + i._close(); + return + } + i._select(r); + i._change(); + i._close() + } + }, + _item: function(n, t) { + return n = n[t](), n[0] && !n.is(":visible") && (n = this._item(n, t)), n + }, + _keydown: function(t) { + var u = this, + e = t.keyCode, + f = u._currentTag, + o = u._current, + l = u.input.val(), + a = i.support.isRtl(u.wrapper), + c = u.popup.visible(); + if (e === r.DOWN) { + if (t.preventDefault(), !c) { + u.open(); + return + } + o = o ? h(o[0], it) : s(u.ul[0]); + o && u.current(n(o)) + } else if (e === r.UP) c && (o = o ? h(o[0], rt) : lt(u.ul[0]), u.current(n(o)), u._current[0] || u.close()), t.preventDefault(); + else if (e === r.LEFT && !a || e === r.RIGHT && a) l || (f = f ? f.prev() : n(u.tagList[0].lastChild), f[0] && u.currentTag(f)); + else if (e === r.RIGHT && !a || e === r.LEFT && a) !l && f && (f = f.next(), u.currentTag(f[0] ? f : null)); + else if (e === r.ENTER && c) { + if (o) { + if (u.trigger(w, { + item: o + })) { + u._close(); + return + } + u._select(o) + } + u._change(); + u._close(); + t.preventDefault() + } else e === r.ESC ? (c ? t.preventDefault() : u.currentTag(null), u.close()) : e === r.HOME ? c ? u.current(s(u.ul[0])) : l || (f = u.tagList[0].firstChild, f && u.currentTag(n(f))) : e === r.END ? c ? u.current(lt(u.ul[0])) : l || (f = u.tagList[0].lastChild, f && u.currentTag(n(f))) : e !== r.DELETE && e !== r.BACKSPACE || l ? (clearTimeout(u._typing), setTimeout(function() { + u._scale() + }), u._search()) : (e !== r.BACKSPACE || f || (f = n(u.tagList[0].lastChild)), f && f[0] && (u._unselect(f), u._change(), u._close())) + }, + _hideBusy: function() { + var n = this; + clearTimeout(n._busy); + n.input.attr("aria-busy", !1); + n._loading.addClass(b); + n._busy = null + }, + _showBusy: function() { + var n = this; + n._busy || (n._busy = setTimeout(function() { + n.input.attr("aria-busy", !0); + n._loading.removeClass(b) + }, 100)) + }, + _placeholder: function(n) { + var i = this, + r = i.input, + u = g(); + n === t ? (n = !1, r[0] !== u && (n = !i._dataItems[0]), i.wrapper.removeClass(l)) : i.wrapper.addClass(l); + i._prev = ""; + r.toggleClass("k-readonly", n).val(n ? i.options.placeholder : ""); + r[0] === u && f.selectText(r[0], 0, 0); + i._scale() + }, + _scale: function() { + var n = this, + r = n.wrapper, + u = r.width(), + t = n._span.text(n.input.val()), + i; + r.is(":visible") ? i = t.width() + 25 : (t.appendTo(document.documentElement), u = i = t.width() + 25, t.appendTo(r)); + n.input.width(i > u ? u : i) + }, + _option: function(n, r) { + var f = "<option", + e = this._text(n), + u = this._value(n); + return u !== t && (u += "", u.indexOf('"') !== -1 && (u = u.replace(kt, """)), f += ' value="' + u + '"'), r && (f += ' selected="selected"'), f += ">", e !== t && (f += i.htmlEncode(e)), f + "<\/option>" + }, + _render: function(n) { + for (var t = this, r = n.length, c = t.itemTemplate, e = t._dataItems.slice(0), o = 0, i = 0, s = "", h = "", u, f; i < r; i++) u = n[i], f = t._selected(e, u), h += c(u, i, f), s += t._option(u, f), f || (o += 1); + if (r = e.length, r) + for (i = 0; i < r; i++) s += t._option(e[i], !0); + return t.ul[0].innerHTML = h, t.element.html(s), t._visibleItems = o, o + }, + _selected: function(n, i) { + var o = this, + s = o._text, + h = o._value, + f = h(i), + c = n.length, + e = !1, + r, u = 0; + for (f === t && (f = s(i)); u < c; u++) + if (i = n[u], r = h(i), r === t && (r = s(i)), r !== t && r === f) { + e = !0; + break + } + return e && n.splice(u, 1), e + }, + _search: function() { + var n = this; + n._typing = setTimeout(function() { + var t = n.input.val(); + n._prev !== t && (n._prev = t, n.search(t)) + }, n.options.delay) + }, + _allowSelection: function() { + var n = this.options.maxSelectedItems; + return n === null || n > this._values.length + }, + _select: function(n) { + var t = this, + u = t._values, + r, i; + t._allowSelection() && (isNaN(n) ? i = n.hide().data("idx") : (i = n, t.ul[0].children[i].style.display = "none"), t.element[0].children[i].selected = !0, r = t.dataSource.view()[i], t.tagList.append(t.tagTemplate(r)), t._dataItems.push(r), u.push(t._dataValue(r)), t._visibleItems -= 1, t.currentTag(null), t._placeholder(), t._height(t._visibleItems), t._state === p && (t._state = y)) + }, + _unselect: function(t) { + var i = this, + r = t.index(), + o, u, f, e, s; + if (t.remove(), i.currentTag(null), i._values.splice(r, 1), o = i._dataItems.splice(r, 1)[0], u = i._dataValue(o), r = i._index(u), r !== -1) n(i.ul[0].children[r]).show(), i.element[0].children[r].selected = !1, i._visibleItems += 1, i._height(i._visibleItems); + else + for (r = i.dataSource.view().length, f = i.element[0].children, s = f.length; r < s; r++) + if (e = f[r], e.value == u) { + e.selected = !1; + break + } + i._placeholder() + }, + _template: function() { + var t = this, + n = t.options, + r = n.itemTemplate, + u = n.tagTemplate, + e = n.dataSource, + f; + t.element[0].length && !e && (n.dataTextField = n.dataTextField || "text", n.dataValueField = n.dataValueField || "value"); + f = i.template("#:" + i.expr(n.dataTextField, "data") + "#", { + useWithBlock: !1 + }); + r = r ? i.template(r) : f; + u = u ? i.template(u) : f; + t.itemTemplate = function(n, t, i) { + return '<li tabindex="-1" role="option" data-idx="' + t + '" unselectable="on" class="k-item"' + (i ? yt : "") + ">" + r(n) + "<\/li>" + }; + t.tagTemplate = function(n) { + return '<li class="k-button" unselectable="on"><span unselectable="on">' + u(n) + '<\/span><span unselectable="on" class="k-icon k-delete">delete<\/span><\/li>' + } + }, + _input: function() { + var t = this, + r = t.element[0].accessKey, + i = t._innerWrapper.children("input.k-input"); + i[0] || (i = n('<input class="k-input" style="width: 25px" />').appendTo(t._innerWrapper)); + t.element.removeAttr("accesskey"); + t._focused = t.input = i.attr({ + accesskey: r, + role: "listbox", + "aria-expanded": !1 + }) + }, + _tagList: function() { + var t = this, + i = t._innerWrapper.children("ul"); + i[0] || (i = n('<ul role="listbox" unselectable="on" class="k-reset"/>').appendTo(t._innerWrapper)); + t.tagList = i + }, + _loader: function() { + this._loading = n('<span class="k-icon k-loading ' + b + '"><\/span>').insertAfter(this.input) + }, + _textContainer: function() { + var t = i.getComputedStyles(this.input[0], dt); + t.position = "absolute"; + t.visibility = "hidden"; + t.top = -3333; + t.left = -3333; + this._span = n("<span/>").css(t).appendTo(this.wrapper) + }, + _wrapper: function() { + var r = this, + t = r.element, + i = t.parent("span.k-multiselect"); + i[0] || (i = t.wrap('<div class="k-widget k-multiselect k-header" unselectable="on" />').parent(), i[0].style.cssText = t[0].style.cssText, n('<div class="k-multiselect-wrap k-floatwrap" unselectable="on" />').insertBefore(t)); + r.wrapper = i.addClass(t[0].className).css("display", ""); + r._innerWrapper = n(i[0].firstChild) + } + }); + d.plugin(gt) + }(window.kendo.jQuery); +kendo_module({ + id: "columnmenu", + name: "Column Menu", + category: "framework", + depends: ["popup", "filtermenu", "menu"], + advanced: !0 + }), + function(n, t) { + function g(t) { + return n.trim(t).replace(/ /gi, "") + } + var i = window.kendo, + a = i.ui, + e = n.proxy, + d = n.extend, + s = n.grep, + v = n.map, + h = n.inArray, + u = "k-state-selected", + c = "asc", + y = "desc", + p = "change", + w = "init", + o = "select", + l = "kendoPopup", + b = "kendoFilterMenu", + k = "kendoMenu", + r = ".kendoColumnMenu", + f = a.Widget, + nt = f.extend({ + init: function(t, u) { + var o = this, + s; + f.fn.init.call(o, t, u); + t = o.element; + u = o.options; + o.owner = u.owner; + o.dataSource = u.dataSource; + o.field = t.attr(i.attr("field")); + s = t.find(".k-header-column-menu"); + s[0] || (s = t.addClass("k-with-icon").prepend('<a class="k-header-column-menu" href="#"><span class="k-icon k-i-arrowhead-s"/><\/a>').find(".k-header-column-menu")); + o.link = s.attr("tabindex", -1).on("click" + r, e(o._click, o)); + o.wrapper = n('<div class="k-column-menu"/>') + }, + _init: function() { + var n = this; + n.pane = n.options.pane; + n.pane && (n._isMobile = !0); + n._isMobile ? n._createMobileMenu() : n._createMenu(); + n._sort(); + n._columns(); + n._filter(); + n.trigger(w, { + field: n.field, + container: n.wrapper + }) + }, + events: [w], + options: { + name: "ColumnMenu", + messages: { + sortAscending: "Sort Ascending", + sortDescending: "Sort Descending", + filter: "Filter", + columns: "Columns", + done: "Done", + settings: "Column Settings" + }, + filter: "", + columns: !0, + sortable: !0, + filterable: !0, + animations: { + left: "slide" + } + }, + _createMenu: function() { + var n = this, + t = n.options; + n.wrapper.html(i.template(tt)({ + ns: i.ns, + messages: t.messages, + sortable: t.sortable, + filterable: t.filterable, + columns: n._ownerColumns(), + showColumns: t.columns + })); + n.popup = n.wrapper[l]({ + anchor: n.link, + open: e(n._open, n), + activate: e(n._activate, n), + close: n.options.closeCallback + }).data(l); + n.menu = n.wrapper.children()[k]({ + orientation: "vertical", + closeOnClick: !1 + }).data(k) + }, + _createMobileMenu: function() { + var n = this, + t = n.options, + r = i.template(it)({ + ns: i.ns, + field: n.field, + messages: t.messages, + sortable: t.sortable, + filterable: t.filterable, + columns: n._ownerColumns(), + showColumns: t.columns + }); + n.view = n.pane.append(r); + n.wrapper = n.view.element.find(".k-column-menu"); + n.menu = new rt(n.wrapper.children(), { + pane: n.pane + }); + n.view.element.on("click", ".k-done", function(t) { + n.close(); + t.preventDefault() + }) + }, + destroy: function() { + var n = this; + f.fn.destroy.call(n); + n.filterMenu && n.filterMenu.destroy(); + n._refreshHandler && n.dataSource.unbind(p, n._refreshHandler); + n.options.columns && n.owner && (n.owner.unbind("columnShow", n._updateColumnsMenuHandler), n.owner.unbind("columnHide", n._updateColumnsMenuHandler)); + n.menu && (n.menu.element.off(r), n.menu.destroy()); + n.wrapper.off(r); + n.popup && n.popup.destroy(); + n.view && n.view.purge(); + n.link.off(r) + }, + close: function() { + this.menu.close(); + this.popup && (this.popup.close(), this.popup.element.off("keydown" + r)) + }, + _click: function(n) { + n.preventDefault(); + n.stopPropagation(); + var t = this.options; + t.filter && this.element.is(!t.filter) || (this.popup || this.pane || this._init(), this._isMobile ? this.pane.navigate(this.view, this.options.animations.left) : this.popup.toggle()) + }, + _open: function() { + var t = this; + n(".k-column-menu").not(t.wrapper).each(function() { + n(this).data(l).close() + }); + t.popup.element.on("keydown" + r, function(n) { + n.keyCode == i.keys.ESC && t.close() + }) + }, + _activate: function() { + this.menu.element.focus() + }, + _ownerColumns: function() { + var n = this.owner.columns, + t = s(n, function(n) { + var t = !0, + i = g(n.title || ""); + return n.menu !== !1 && (n.field || i.length) || (t = !1), t + }); + return v(t, function(t) { + return { + originalField: t.field, + field: t.field || t.title, + title: t.title || t.field, + hidden: t.hidden, + index: h(t, n) + } + }) + }, + _sort: function() { + var t = this; + t.options.sortable && (t.refresh(), t._refreshHandler = e(t.refresh, t), t.dataSource.bind(p, t._refreshHandler), t.menu.bind(o, function(i) { + var f = n(i.item), + r; + (f.hasClass("k-sort-asc") ? r = c : f.hasClass("k-sort-desc") && (r = y), r) && (f.parent().find(".k-sort-" + (r == c ? y : c)).removeClass(u), t._sortDataSource(f, r), t.close()) + })) + }, + _sortDataSource: function(n, i) { + var f = this, + o = f.options.sortable, + s = f.dataSource, + e, h, r = s.sort() || []; + if (n.hasClass(u) && o && o.allowUnsort !== !1 ? (n.removeClass(u), i = t) : n.addClass(u), o === !0 || o.mode === "single") r = [{ + field: f.field, + dir: i + }]; + else { + for (e = 0, h = r.length; e < h; e++) + if (r[e].field === f.field) { + r.splice(e, 1); + break + } + r.push({ + field: f.field, + dir: i + }) + } + s.sort(r) + }, + _columns: function() { + var t = this; + t.options.columns && (t._updateColumnsMenu(), t._updateColumnsMenuHandler = e(t._updateColumnsMenu, t), t.owner.bind(["columnHide", "columnShow"], t._updateColumnsMenuHandler), t.menu.bind(o, function(r) { + var c = n(r.item), + u, f, e, l = t.owner.columns, + o; + (t._isMobile && r.preventDefault(), c.parent().closest("li.k-columns-item")[0]) && ((u = c.find(":checkbox"), u.attr("disabled")) || (o = u.attr(i.attr("field")), e = s(l, function(n) { + return n.field == o || n.title == o + })[0], f = h(e, l), e.hidden === !0 ? t.owner.showColumn(f) : t.owner.hideColumn(f))) + })) + }, + _updateColumnsMenu: function() { + var r = i.attr("field"), + t = s(this._ownerColumns(), function(n) { + return !n.hidden + }), + u = s(t, function(n) { + return n.originalField + }).length; + t = v(t, function(n) { + return n.field + }); + this.wrapper.find(".k-columns-item input[" + r + "]").prop("checked", !1).filter(function() { + return h(n(this).attr(r), t) > -1 + }).prop("checked", !0).prop("disabled", u == 1) + }, + _filter: function() { + var t = this, + i = t.options; + i.filterable !== !1 && (t.filterMenu = t.wrapper.find(".k-filterable")[b](d(!0, {}, { + appendToElement: !0, + dataSource: i.dataSource, + values: i.values, + field: t.field + }, i.filterable)).data(b), t._isMobile && t.menu.bind(o, function(i) { + var r = n(i.item); + r.hasClass("k-filter-item") && t.pane.navigate(t.filterMenu.view, t.options.animations.left) + })) + }, + refresh: function() { + var n = this, + r = n.options.dataSource.sort() || [], + i, e = n.field, + t, f; + for (n.wrapper.find(".k-sort-asc, .k-sort-desc").removeClass(u), t = 0, f = r.length; t < f; t++) i = r[t], e == i.field && n.wrapper.find(".k-sort-" + i.dir).addClass(u) + } + }), + tt = '<ul>#if(sortable){#<li class="k-item k-sort-asc"><span class="k-link"><span class="k-sprite k-i-sort-asc"><\/span>${messages.sortAscending}<\/span><\/li><li class="k-item k-sort-desc"><span class="k-link"><span class="k-sprite k-i-sort-desc"><\/span>${messages.sortDescending}<\/span><\/li>#if(showColumns || filterable){#<li class="k-separator"><\/li>#}##}##if(showColumns){#<li class="k-item k-columns-item"><span class="k-link"><span class="k-sprite k-i-columns"><\/span>${messages.columns}<\/span><ul>#for (var idx = 0; idx < columns.length; idx++) {#<li><input type="checkbox" data-#=ns#field="#=columns[idx].field.replace(/"/g,"&\\#34;")#" data-#=ns#index="#=columns[idx].index#"/>#=columns[idx].title#<\/li>#}#<\/ul><\/li>#if(filterable){#<li class="k-separator"><\/li>#}##}##if(filterable){#<li class="k-item k-filter-item"><span class="k-link"><span class="k-sprite k-filter"><\/span>${messages.filter}<\/span><ul><li><div class="k-filterable"><\/div><\/li><\/ul><\/li>#}#<\/ul>', + it = '<div data-#=ns#role="view" data-#=ns#init-widgets="false" class="k-grid-column-menu"><div data-#=ns#role="header" class="k-header">${messages.settings}<button class="k-button k-done">#=messages.done#<\/button><\/div><div class="k-column-menu k-mobile-list"><ul><li><span class="k-link">${field}<\/span><ul>#if(sortable){#<li class="k-item k-sort-asc"><span class="k-link"><span class="k-sprite k-i-sort-asc"><\/span>${messages.sortAscending}<\/span><\/li><li class="k-item k-sort-desc"><span class="k-link"><span class="k-sprite k-i-sort-desc"><\/span>${messages.sortDescending}<\/span><\/li>#}##if(filterable){#<li class="k-item k-filter-item"><span class="k-link k-filterable"><span class="k-sprite k-filter"><\/span>${messages.filter}<\/span><\/li>#}#<\/ul><\/li>#if(showColumns){#<li class="k-columns-item"><span class="k-link">${messages.columns}<\/span><ul>#for (var idx = 0; idx < columns.length; idx++) {#<li class="k-item"><label class="k-label"><input type="checkbox" class="k-check" data-#=ns#field="#=columns[idx].field.replace(/"/g,"&\\#34;")#" data-#=ns#index="#=columns[idx].index#"/>#=columns[idx].title#<\/label><\/li>#}#<\/ul><\/li>#}#<\/ul><\/div><\/div>', + rt = f.extend({ + init: function(n, t) { + f.fn.init.call(this, n, t); + this.element.on("click" + r, "li:not(.k-separator)", "_click") + }, + events: [o], + _click: function(n) { + this.trigger(o, { + item: n.currentTarget + }) && n.preventDefault() + }, + close: function() { + this.options.pane.navigate("") + }, + destroy: function() { + f.fn.destroy.call(this); + this.element.off(r) + } + }); + a.plugin(nt) + }(window.kendo.jQuery); +kendo_module({ + id: "grid", + name: "Grid", + category: "web", + description: "The Grid widget displays tabular data and offers rich support for interacting with data,including paging, sorting, grouping, and selection.", + depends: ["data"], + features: [{ + id: "grid-editing", + name: "Editing", + description: "Support for record editing", + depends: ["editable", "window"] + }, { + id: "grid-filtering", + name: "Filtering", + description: "Support for record filtering", + depends: ["filtermenu"] + }, { + id: "grid-columnmenu", + name: "Column menu", + description: "Support for header column menu", + depends: ["columnmenu"] + }, { + id: "grid-grouping", + name: "Grouping", + description: "Support for grid grouping", + depends: ["groupable"] + }, { + id: "grid-paging", + name: "Paging", + description: "Suppot for grid paging", + depends: ["pager"] + }, { + id: "grid-selection", + name: "Selection", + description: "Support for row selection", + depends: ["selectable"] + }, { + id: "grid-sorting", + name: "Sorting", + description: "Support for grid sorting", + depends: ["sortable"] + }, { + id: "grid-column-reorder", + name: "Column reordering", + description: "Support for column reordering", + depends: ["reorderable"] + }, { + id: "grid-column-resize", + name: "Column resizing", + description: "Support for column resizing", + depends: ["resizable"] + }, { + id: "grid-mobile", + name: "Grid adaptive rendering", + description: "Support for adaptive rendering", + depends: ["mobile.actionsheet", "mobile.pane"] + }] + }), + function(n, t) { + function pt(n) { + return new Array(n + 1).join('<td class="k-group-cell"> <\/td>') + } + + function lt(n) { + var t, i = " "; + if (n) { + if (typeof n === c) return n; + for (t in n) i += t + '="' + n[t] + '"' + } + return i + } + + function pr(t) { + var i = 0; + return n("> .k-grouping-header, > .k-grid-toolbar", t).each(function() { + i += this.offsetHeight + }), i + } + + function ui(t, i) { + n("th, th .k-grid-filter, th .k-link", t).add(document.body).css("cursor", i) + } + + function fi(n) { + var t, i, r = {}, + u = {}; + if (!at(n)) + for (k(n) || (n = [n]), t = 0, i = n.length; t < i; t++) r[n[t].aggregate] = 0, u[n[t].field] = r; + return u + } + + function et(n, t, i) { + var r = n.eq(t), + u = n.eq(i); + r[t > i ? "insertBefore" : "insertAfter"](u) + } + + function wr(n, t, i) { + var e, c, u, s; + for (i = k(i) ? i : [i], e = 0, c = i.length; e < c; e++) + if (u = i[e], o(u) && u.click) { + s = u.name || u.text; + t.on(h + r, "a.k-grid-" + (s || "").replace(/\s/g, ""), { + commandName: s + }, f(u.click, n)) + } + } + + function tt(n) { + return b(n, function(n) { + return !n.hidden + }) + } + + function ot(n) { + n = n || {}; + var t = n.style; + return t ? (t = t.replace(/((.*)?display)(.*)?:([^;]*)/i, "$1:none"), t === n.style && (t = t.replace(/(.*)?/i, "display:none;$1"))) : t = "display:none", u({}, n, { + style: t + }) + } + + function ei(n) { + n = n || {}; + var t = n.style; + return t && (n.style = t.replace(/(display\s*:\s*none\s*;?)*/ig, "")), n + } + + function ir(t, r, u, f) { + var o = t.find(">colgroup"), + s, h = bt(r, function(n) { + return (s = n.width, s && parseInt(s, 10) !== 0) ? i.format('<col style="width:{0}"/>', typeof s === c ? s : s + "px") : "<col />" + }); + (u || o.find(".k-hierarchy-col").length) && h.splice(0, 0, '<col class="k-hierarchy-col" />'); + o.length && o.remove(); + o = n(new Array(f + 1).join('<col class="k-group-col">') + h.join("")); + o.is("colgroup") || (o = n("<colgroup/>").append(o)); + t.prepend(o); + e.msie && e.version == 8 && (t.css("display", "inline-table"), window.setTimeout(function() { + t.css("display", "") + }, 1)) + } + + function rr(n) { + for (var r = {}, i, t = 0, u = n.length; t < u; t++) i = n[t], r[i.value] = i.text; + return r + } + + function br(n, t, r) { + var f = r && r.length && o(r[0]) && "value" in r[0], + u = f ? rr(r)[n] : n; + return u = u != null ? u : "", t ? i.format(t, u) : u + } + + function st(n, t, i) { + for (var u = 0, f, r = n[u]; r;) { + if (f = i ? !0 : r.style.display !== "none", f && !ar.test(r.className) && --t < 0) { + r.style.display = i ? "" : "none"; + break + } + r = n[++u] + } + } + + function oi(n, t) { + var r, u, i; + if (typeof n === c && n === t || o(n) && n.name === t) return n; + if (k(n)) + for (r = 0, u = n.length; r < u; r++) + if (i = n[r], typeof i === c && i === t || i.name === t) return i; + return null + } + + function l(t, i) { + var u = e.msie, + r, f, o; + if (i === !0) { + if (t = n(t), r = u && t.parent().is(".k-grid-content,.k-grid-header-wrap"), r && (f = t.parent().scrollTop(), o = t.parent().scrollLeft()), u) try { + t[0].setActive() + } catch (s) { + t[0].focus() + } else t[0].focus(); + r && (t.parent().scrollTop(f), t.parent().scrollLeft(o)) + } else n(t).one("focusin", function(n) { + n.preventDefault() + }).focus() + } + + function dr(t) { + var r = n(t.currentTarget), + f = r.is("th"), + u = r.closest("table")[0]; + i.support.touch || (u === this.table[0] || u === this.thead.parent()[0]) && (this.current(r), (f || !n(t.target).is(":button,a,:input,a>.k-icon,textarea,span.k-icon,span.k-link,.k-input,.k-multiselect-wrap")) && setTimeout(function() { + yr && n(i._activeElement()).hasClass("k-widget") || l(u, !0) + }), f && t.preventDefault()) + } + var i = window.kendo, + it = i.ui, + ur = i.data.DataSource, + fr = it.Groupable, + er = i.support.tbodyInnerHtml, + rt = i._activeElement, + w = it.Widget, + s = i.keys, + o = n.isPlainObject, + u = n.extend, + bt = n.map, + b = n.grep, + k = n.isArray, + d = n.inArray, + f = n.proxy, + or = i.isFunction, + at = n.isEmptyObject, + y = Math, + kt = "progress", + dt = "error", + g = ":not(.k-group-cell):not(.k-hierarchy-cell):visible", + sr = "tbody>tr:not(.k-grouping-row):not(.k-detail-row):not(.k-group-footer) > td:not(.k-group-cell):not(.k-hierarchy-cell)", + ut = "tr:not(.k-footer-template):visible", + v = ":not(.k-group-cell):not(.k-hierarchy-cell):visible", + ft = ut + ":first>" + v + ":first", + vt = "th.k-header:not(.k-group-cell,.k-hierarchy-cell)", + r = ".kendoGrid", + yt = "edit", + gt = "save", + si = "remove", + ni = "detailInit", + hi = "filterMenuInit", + ci = "columnMenuInit", + a = "change", + li = "columnHide", + ai = "columnShow", + vi = "saveChanges", + yi = "dataBound", + pi = "detailExpand", + wi = "detailCollapse", + ht = "k-state-focused", + bi = "k-state-selected", + ki = "columnResize", + di = "columnReorder", + h = "click", + ti = "height", + nt = "tabIndex", + ct = "function", + c = "string", + gi = "Are you sure you want to delete this record?", + hr = "Delete", + cr = "Cancel", + lr = /(\}|\#)/ig, + ii = /#/ig, + nr = "[\\x20\\t\\r\\n\\f]", + ar = new RegExp("(^|" + nr + ")(k-group-cell|k-hierarchy-cell)(" + nr + "|$)"), + vr = '<a class="k-button k-button-icontext #=className#" #=attr# href="\\#"><span class="#=iconClass# #=imageClass#"><\/span>#=text#<\/a>', + p = !1, + e = i.support.browser, + ri = e.msie && e.version == 7, + yr = e.msie && e.version == 8, + tr = w.extend({ + init: function(n, t) { + var i = this; + w.fn.init.call(i, n, t); + i._refreshHandler = f(i.refresh, i); + i.setDataSource(t.dataSource); + i.wrap() + }, + setDataSource: function(n) { + var t = this; + t.dataSource && t.dataSource.unbind(a, t._refreshHandler); + t.dataSource = n; + t.dataSource.bind(a, t._refreshHandler) + }, + options: { + name: "VirtualScrollable", + itemHeight: n.noop + }, + destroy: function() { + var n = this; + w.fn.destroy.call(n); + n.dataSource.unbind(a, n._refreshHandler); + n.wrapper.add(n.verticalScrollbar).off(r); + n.drag && n.drag.destroy() + }, + wrap: function() { + var t = this, + o = i.support.scrollbar() + 1, + u = t.element, + e; + u.css({ + width: "auto", + overflow: "hidden" + }).css(p ? "padding-left" : "padding-right", o); + t.content = u.children().first(); + e = t.wrapper = t.content.wrap('<div class="k-virtual-scrollable-wrap"/>').parent().bind("DOMMouseScroll" + r + " mousewheel" + r, f(t._wheelScroll, t)); + i.support.kineticScrollNeeded && (t.drag = new i.UserEvents(t.wrapper, { + global: !0, + move: function(n) { + t.verticalScrollbar.scrollTop(t.verticalScrollbar.scrollTop() - n.y.delta); + e.scrollLeft(e.scrollLeft() - n.x.delta); + n.preventDefault() + } + })); + t.verticalScrollbar = n('<div class="k-scrollbar k-scrollbar-vertical" />').css({ + width: o + }).appendTo(u).bind("scroll" + r, f(t._scroll, t)) + }, + _wheelScroll: function(n) { + var u = this, + e = u.verticalScrollbar.scrollTop(), + i = n.originalEvent, + f = i.wheelDeltaY, + r; + i.wheelDelta ? (f === t || f) && (r = i.wheelDelta) : i.detail && i.axis === i.VERTICAL_AXIS && (r = -i.detail * 10); + r && (n.preventDefault(), u.verticalScrollbar.scrollTop(e + -r)) + }, + _scroll: function(n) { + var t = this, + i = n.currentTarget.scrollTop, + f = t.dataSource, + r = t.itemHeight, + e = f.skip() || 0, + o = t._rangeStart || e, + s = t.element.innerHeight(), + h = !!(t._scrollbarTop && t._scrollbarTop > i), + u = y.max(y.floor(i / r), 0), + c = y.max(u + y.floor(s / r), 0); + t._scrollTop = i - o * r; + t._scrollbarTop = i; + t._fetch(u, c, h) || (t.wrapper[0].scrollTop = t._scrollTop) + }, + _fetch: function(n, t, i) { + var u = this, + e = u.dataSource, + h = u.itemHeight, + r = e.take(), + f = u._rangeStart || e.skip() || 0, + o = y.floor(n / r) * r, + s = !1, + c = .33; + return n < f ? (s = !0, f = y.max(0, t - r), u._scrollTop = (n - f) * h, u._page(f, r)) : t >= f + r && !i ? (s = !0, f = n, u._scrollTop = h, u._page(f, r)) : u._fetching || (n < o + r - r * c && n > r && e.prefetch(o - r, r), t > o + r * c && e.prefetch(o + r, r)), s + }, + _page: function(n, t) { + var r = this, + u = r.dataSource; + clearTimeout(r._timeout); + r._fetching = !0; + r._rangeStart = n; + u.inRange(n, t) ? u.range(n, t) : (i.ui.progress(r.wrapper.parent(), !0), r._timeout = setTimeout(function() { + u.range(n, t) + }, 100)) + }, + refresh: function() { + var n = this, + u = "", + t = 25e4, + o = n.dataSource, + c = n._rangeStart, + l = i.support.kineticScrollNeeded ? 0 : i.support.scrollbar(), + f = n.wrapper[0], + r, e, s, h; + for (i.ui.progress(n.wrapper.parent(), !1), clearTimeout(n._timeout), s = n.itemHeight = n.options.itemHeight() || 0, h = f.scrollWidth > f.offsetWidth ? l : 0, r = o.total() * s + h, e = 0; e < y.floor(r / t); e++) u += '<div style="width:1px;height:' + t + 'px"><\/div>'; + r % t && (u += '<div style="width:1px;height:' + r % t + 'px"><\/div>'); + n.verticalScrollbar.html(u); + f.scrollTop = n._scrollTop; + n.drag && n.drag.cancel(); + c && !n._fetching && (n._rangeStart = o.skip()); + n._fetching = !1 + } + }), + wt = { + create: { + text: "Add new record", + imageClass: "k-add", + className: "k-grid-add", + iconClass: "k-icon" + }, + cancel: { + text: "Cancel changes", + imageClass: "k-cancel", + className: "k-grid-cancel-changes", + iconClass: "k-icon" + }, + save: { + text: "Save changes", + imageClass: "k-update", + className: "k-grid-save-changes", + iconClass: "k-icon" + }, + destroy: { + text: "Delete", + imageClass: "k-delete", + className: "k-grid-delete", + iconClass: "k-icon" + }, + edit: { + text: "Edit", + imageClass: "k-edit", + className: "k-grid-edit", + iconClass: "k-icon" + }, + update: { + text: "Update", + imageClass: "k-update", + className: "k-grid-update", + iconClass: "k-icon" + }, + canceledit: { + text: "Cancel", + imageClass: "k-cancel", + className: "k-grid-cancel", + iconClass: "k-icon" + } + }, + kr = w.extend({ + init: function(n, t) { + var r = this; + t = k(t) ? { + dataSource: t + } : t; + w.fn.init.call(r, n, t); + p = i.support.isRtl(n); + r._element(); + r._aria(); + r._columns(r.options.columns); + r._dataSource(); + r._tbody(); + r._pageable(); + r._thead(); + r._groupable(); + r._toolbar(); + r._setContentHeight(); + r._templates(); + r._navigatable(); + r._selectable(); + r._details(); + r._editable(); + r._attachCustomCommandsEvent(); + r.options.autoBind ? r.dataSource.fetch() : r._footer(); + i.notify(r) + }, + events: [a, "dataBinding", "cancel", yi, pi, wi, ni, hi, ci, yt, gt, si, vi, ki, di, ai, li], + setDataSource: function(n) { + var t = this; + t.options.dataSource = n; + t._dataSource(); + t._pageable(); + t.options.groupable && t._groupable(); + t._thead(); + t.virtualScrollable && t.virtualScrollable.setDataSource(t.options.dataSource); + t.options.autoBind && n.fetch() + }, + options: { + name: "Grid", + columns: [], + toolbar: null, + autoBind: !0, + filterable: !1, + scrollable: !0, + sortable: !1, + selectable: !1, + navigatable: !1, + pageable: !1, + editable: !1, + groupable: !1, + rowTemplate: "", + altRowTemplate: "", + dataSource: {}, + height: null, + resizable: !1, + reorderable: !1, + columnMenu: !1, + detailTemplate: null, + columnResizeHandleWidth: 3, + mobile: "" + }, + destroy: function() { + var t = this, + u; + w.fn.destroy.call(t); + t.pager && t.pager.destroy(); + t.groupable && t.groupable.destroy(); + t.options.reorderable && t.wrapper.data("kendoReorderable").destroy(); + t.selectable && t.selectable.destroy(); + t.resizable && (t.resizable.destroy(), t._resizeUserEvents && (t._resizeHandleDocumentClickHandler && n(document).off("click", t._resizeHandleDocumentClickHandler), t._resizeUserEvents.destroy())); + t.virtualScrollable && t.virtualScrollable.destroy(); + t._destroyColumnAttachments(); + t._destroyEditable(); + t.dataSource.unbind(a, t._refreshHandler).unbind(kt, t._progressHandler).unbind(dt, t._errorHandler); + u = t.element.add(t.wrapper).add(t.table).add(t.thead).add(t.wrapper.find(">.k-grid-toolbar")); + t.content && (u = u.add(t.content).add(t.content.find(">.k-virtual-scrollable-wrap"))); + t.pane && t.pane.destroy(); + u.off(r); + i.destroy(t.wrapper) + }, + setOptions: function(n) { + var t = this; + w.fn.setOptions.call(this, n); + t._templates() + }, + items: function() { + return this.tbody.children(":not(.k-grouping-row,.k-detail-row,.k-group-footer)") + }, + _destroyColumnAttachments: function() { + var t = this; + t.resizeHandle = null; + t.thead.find("th").each(function() { + var t = n(this), + i = t.data("kendoFilterMenu"), + r = t.data("kendoSortable"), + u = t.data("kendoColumnMenu"); + i && i.destroy(); + r && r.destroy(); + u && u.destroy() + }) + }, + _attachCustomCommandsEvent: function() { + for (var t = this, r = t.columns || [], i, n = 0, u = r.length; n < u; n++) i = r[n].command, i && wr(t, t.wrapper, i) + }, + _aria: function() { + var n = this.element.attr("id") || "aria"; + n && (this._cellId = n + "_active_cell") + }, + _element: function() { + var t = this, + i = t.element; + i.is("table") || (i = t.options.scrollable ? t.element.find("> .k-grid-content > table") : t.element.children("table"), i.length || (i = n("<table />").appendTo(t.element))); + ri && i.attr("cellspacing", 0); + t.table = i.attr("role", t._hasDetails() ? "treegrid" : "grid"); + t._wrapper() + }, + _createResizeHandle: function(t, i) { + var u = this, + s = u.options.columnResizeHandleWidth, + h = u.options.scrollable, + f = u.resizeHandle, + o; + if (f || (f = u.resizeHandle = n('<div class="k-resize-handle"><div class="k-resize-handle-inner"><\/div><\/div>'), t.append(f)), p) { + var r = i.closest(".k-grid-header-wrap"), + c = e.msie ? r.scrollLeft() : 0, + l = e.webkit ? r[0].scrollWidth - r[0].offsetWidth - r.scrollLeft() : 0, + a = e.mozilla ? r[0].scrollWidth - r[0].offsetWidth - (r[0].scrollWidth - r[0].offsetWidth - r.scrollLeft()) : 0; + o = i.position().left - l + a - c + } else o = i[0].offsetWidth, i.prevAll(":visible").each(function() { + o += this.offsetWidth + }); + f.css({ + top: h ? 0 : pr(u.wrapper), + left: o - s, + height: i.outerHeight(), + width: s * 3 + }).data("th", i).show() + }, + _positionColumnResizeHandle: function(t) { + var i = this, + u = i.resizeHandle, + f = i.options.columnResizeHandleWidth; + i.thead.on("mousemove" + r, "th:not(.k-group-cell,.k-hierarchy-cell)", function(r) { + var e = n(this), + o = r.clientX, + s = n(window).scrollLeft(), + h = e.offset().left + (p ? 0 : this.offsetWidth); + o + s > h - f && o + s < h + f ? i._createResizeHandle(t, e) : u ? u.hide() : ui(i.wrapper, "") + }) + }, + _resizeHandleDocumentClick: function(t) { + n(t.target).closest(".k-column-active").length || (n(document).off(t), this._hideResizeHandle()) + }, + _hideResizeHandle: function() { + this.resizeHandle && (this.resizeHandle.data("th").removeClass("k-column-active"), this.resizeHandle.hide()) + }, + _positionColumnResizeHandleTouch: function(t) { + var r = this; + r._resizeUserEvents = new i.UserEvents(r.thead, { + filter: "th:not(.k-group-cell,.k-hierarchy-cell)", + threshold: 10, + hold: function(i) { + var u = n(i.target); + i.preventDefault(); + u.addClass("k-column-active"); + r._createResizeHandle(t, u); + r._resizeHandleDocumentClickHandler || (r._resizeHandleDocumentClickHandler = f(r._resizeHandleDocumentClick, r)); + n(document).on("click", r._resizeHandleDocumentClickHandler) + } + }) + }, + _resizable: function() { + var t = this, + r = t.options, + u, e, f, o, h = this._isMobile, + s, i; + r.resizable && (u = r.scrollable ? t.wrapper.find(".k-grid-header-wrap:first") : t.wrapper, h ? t._positionColumnResizeHandleTouch(u) : t._positionColumnResizeHandle(u), t.resizable = new it.Resizable(u, { + handle: ".k-resize-handle", + hint: function(i) { + return n('<div class="k-grid-resize-indicator" />').css({ + height: i.data("th").outerHeight() + t.tbody.attr("clientHeight") + }) + }, + start: function(u) { + i = n(u.currentTarget).data("th"); + h && t._hideResizeHandle(); + var c = n.inArray(i[0], i.parent().children(":visible")), + l = t.tbody.parent(), + a = t.footer || n(); + ui(t.wrapper, "col-resize"); + s = r.scrollable ? t.thead.parent().find("col:eq(" + c + ")").add(l.children("colgroup").find("col:eq(" + c + ")")).add(a.find("colgroup").find("col:eq(" + c + ")")) : l.children("colgroup").find("col:eq(" + c + ")"); + e = u.x.location; + f = i.outerWidth(); + o = t.tbody.outerWidth() + }, + resize: function(i) { + var u = p ? -1 : 1, + h = f + i.x.location * u - e * u, + c = t.footer || n(); + h > 10 && (s.css("width", h), r.scrollable && o && (t._footerWidth = o + i.x.location * u - e * u, t.tbody.parent().add(t.thead.parent()).add(c.find("table")).css("width", t._footerWidth))) + }, + resizeend: function() { + var n = i.outerWidth(), + r; + ui(t.wrapper, ""); + f != n && (r = t.columns[i.parent().find("th:not(.k-group-cell,.k-hierarchy-cell)").index(i)], r.width = n, t.trigger(ki, { + column: r, + oldWidth: f, + newWidth: n + })); + t._hideResizeHandle(); + i = null + } + })) + }, + _draggable: function() { + var t = this; + t.options.reorderable && (t._draggableInstance && t._draggableInstance.destroy(), t._draggableInstance = t.wrapper.kendoDraggable({ + group: i.guid(), + filter: t.content ? ".k-grid-header:first " + vt : "table:first>.k-grid-header " + vt, + drag: function() { + t._hideResizeHandle() + }, + hint: function(t) { + return n('<div class="k-header k-drag-clue" />').css({ + width: t.width(), + paddingLeft: t.css("paddingLeft"), + paddingRight: t.css("paddingRight"), + lineHeight: t.height() + "px", + paddingTop: t.css("paddingTop"), + paddingBottom: t.css("paddingBottom") + }).html(t.attr(i.attr("title")) || t.attr(i.attr("field")) || t.text()).prepend('<span class="k-icon k-drag-status k-denied" />') + } + }).data("kendoDraggable")) + }, + _reorderable: function() { + var n = this; + n.options.reorderable && n.wrapper.kendoReorderable({ + draggable: n._draggableInstance, + change: function(t) { + var r = d(n.columns[t.newIndex], n.columns), + i = n.columns[t.oldIndex]; + n.trigger(di, { + newIndex: r, + oldIndex: d(i, n.columns), + column: i + }); + n.reorderColumn(r, i) + } + }) + }, + reorderColumn: function(n, t) { + var i = this, + r = d(t, i.columns), + e = d(t, tt(i.columns)), + o = d(i.columns[n], tt(i.columns)), + s, u, h, f = i.footer || i.wrapper.find(".k-grid-footer"); + if (r !== n) + for (i._hideResizeHandle(), i.columns.splice(r, 1), i.columns.splice(n, 0, t), i._templates(), et(i.thead.prev().find("col:not(.k-group-col,.k-hierarchy-col)"), e, o), i.options.scrollable && et(i.tbody.prev().find("col:not(.k-group-col,.k-hierarchy-col)"), e, o), et(i.thead.find(".k-header:not(.k-group-cell,.k-hierarchy-cell)"), r, n), f && f.length && (et(f.find(".k-grid-footer-wrap>table>colgroup>col:not(.k-group-col,.k-hierarchy-col)"), e, o), et(f.find(".k-footer-template>td:not(.k-group-cell,.k-hierarchy-cell)"), r, n)), s = i.tbody.children(":not(.k-grouping-row,.k-detail-row)"), u = 0, h = s.length; u < h; u += 1) et(s.eq(u).find(">td:not(.k-group-cell,.k-hierarchy-cell)"), r, n) + }, + cellIndex: function(t) { + return n(t).parent().children("td:not(.k-group-cell,.k-hierarchy-cell)").index(t) + }, + _modelForContainer: function(t) { + t = n(t); + t.is("tr") || this._editMode() === "popup" || (t = t.closest("tr")); + var r = t.attr(i.attr("uid")); + return this.dataSource.getByUid(r) + }, + _editable: function() { + var t = this, + f = t.selectable && t.selectable.options.multiple, + i = t.options.editable, + e = function() { + var i = rt(), + r = t._editContainer; + !r || n.contains(r[0], i) || r[0] === i || n(i).closest(".k-animation-container").length || t.editable.end() && t.closeCell() + }, + u; + if (i) { + if (u = t._editMode(), u === "incell") { + if (i.update !== !1) t.wrapper.on(h + r, "tr:not(.k-grouping-row) > td", function(i) { + var r = n(this); + r.hasClass("k-hierarchy-cell") || r.hasClass("k-detail-cell") || r.hasClass("k-group-cell") || r.hasClass("k-edit-cell") || r.has("a.k-grid-delete").length || r.has("button.k-grid-delete").length || r.closest("tbody")[0] !== t.tbody[0] || n(i.target).is(":input") || (t.editable ? t.editable.end() && (f && n(rt()).blur(), t.closeCell(), t.editCell(r)) : t.editCell(r)) + }).on("focusin" + r, function() { + clearTimeout(t.timer); + t.timer = null + }).on("focusout" + r, function() { + t.timer = setTimeout(e, 1) + }) + } else if (i.update !== !1) t.wrapper.on(h + r, "tbody>tr:not(.k-detail-row,.k-grouping-row):visible a.k-grid-edit", function(i) { + i.preventDefault(); + t.editRow(n(this).closest("tr")) + }); + if (i.destroy !== !1) t.wrapper.on(h + r, "tbody>tr:not(.k-detail-row,.k-grouping-row):visible .k-grid-delete", function(i) { + i.preventDefault(); + i.stopPropagation(); + t.removeRow(n(this).closest("tr")) + }); + else t.wrapper.on(h + r, "tbody>tr:not(.k-detail-row,.k-grouping-row):visible button.k-grid-delete", function(n) { + n.stopPropagation(); + t._confirmation() || n.preventDefault() + }) + } + }, + editCell: function(t) { + t = n(t); + var i = this, + r = i.columns[i.cellIndex(t)], + u = i._modelForContainer(t); + u && (!u.editable || u.editable(r.field)) && !r.command && r.field && (i._attachModelChange(u), i._editContainer = t, i.editable = t.addClass("k-edit-cell").kendoEditable({ + fields: { + field: r.field, + format: r.format, + editor: r.editor, + values: r.values + }, + model: u, + change: function(n) { + i.trigger(gt, { + values: n.values, + container: t, + model: u + }) && n.preventDefault() + } + }).data("kendoEditable"), t.parent().addClass("k-grid-edit-row"), i.trigger(yt, { + container: t, + model: u + })) + }, + _destroyEditable: function() { + var n = this, + t = function() { + n.editable && (n._detachModelChange(), n.editable.destroy(), n.editable = null, n._editContainer = null, n._destroyEditView()) + }; + n.editable && (n._editMode() !== "popup" || n._isMobile ? t() : n._editContainer.data("kendoWindow").bind("deactivate", t).close()); + n._actionSheet && (n._actionSheet.destroy(), n._actionSheet = null) + }, + _destroyEditView: function() { + this.editView && (this.editView.purge(), this.editView = null, this.pane.navigate("")) + }, + _attachModelChange: function(n) { + var t = this; + t._modelChangeHandler = function(n) { + t._modelChange({ + field: n.field, + model: this + }) + }; + n.bind("change", t._modelChangeHandler) + }, + _detachModelChange: function() { + var n = this, + i = n._editContainer, + t = n._modelForContainer(i); + t && t.unbind(a, n._modelChangeHandler) + }, + closeCell: function(t) { + var u = this, + r = u._editContainer, + e, o, f; + r && ((e = r.closest("tr").attr(i.attr("uid")), f = u.dataSource.getByUid(e), t && u.trigger("cancel", { + container: r, + model: f + })) || (r.removeClass("k-edit-cell"), o = u.columns[u.cellIndex(r)], r.parent().removeClass("k-grid-edit-row"), u._destroyEditable(), u._displayCell(r, o, f), r.hasClass("k-dirty-cell") && n('<span class="k-dirty"/>').prependTo(r))) + }, + _displayCell: function(n, t, r) { + var s = this, + e = { + storage: {}, + count: 0 + }, + h = u({}, i.Template, s.options.templateSettings), + o = i.template(s._cellTmpl(t, e), h); + e.count > 0 && (o = f(o, e.storage)); + n.empty().html(o(r)) + }, + removeRow: function(n) { + this._confirmation(n) && this._removeRow(n) + }, + _removeRow: function(t) { + var i = this, + r, u; + t = n(t).hide(); + r = i._modelForContainer(t); + r && !i.trigger(si, { + row: t, + model: r + }) && (u = i._editMode(), u !== "incell" && i.cancelRow(), i.dataSource.remove(r), (u === "inline" || u === "popup") && i.dataSource.sync()) + }, + _editMode: function() { + var t = "incell", + n = this.options.editable; + return n !== !0 && (t = typeof n == "string" ? n : n.mode || t), t + }, + editRow: function(t) { + var f, u = this, + e, s, o; + if (t instanceof i.data.ObservableObject ? f = t : (t = n(t), f = u._modelForContainer(t)), e = u._editMode(), s = u.options.navigatable, u.cancelRow(), f) { + u._attachModelChange(f); + e === "popup" ? u._createPopupEditor(f) : e === "inline" ? u._createInlineEditor(t, f) : e === "incell" && n(t).children(g).each(function() { + var t = n(this), + i = u.columns[t.index()]; + return f = u._modelForContainer(t), f && (!f.editable || f.editable(i.field)) && i.field ? (u.editCell(t), !1) : void 0 + }); + o = u.editView ? u.editView.element : u._editContainer; + o.on(h + r, "a.k-grid-cancel", function(t) { + if (t.preventDefault(), t.stopPropagation(), !u.trigger("cancel", { + container: o, + model: f + })) { + var i = u.items().index(n(u.current()).parent()); + u.cancelRow(); + s && (u.current(u.items().eq(i).children().filter(v).first()), l(u.table, !0)) + } + }); + o.on(h + r, "a.k-grid-update", function(n) { + n.preventDefault(); + n.stopPropagation(); + u.saveRow() + }) + } + }, + _createPopupEditor: function(t) { + var r = this, + s = "<div " + i.attr("uid") + '="' + t.uid + '" class="k-popup-edit-form' + (r._isMobile ? " k-mobile-list" : "") + '"><div class="k-edit-form-container">', + e, h, ut = [], + a, k, d, tt, it, y, p, rt = r.options.editable, + w = rt.template, + g = o(rt) ? rt.window : {}, + ft = u({}, i.Template, r.options.templateSettings), + nt, b; + if (g = g || {}, w) + for (typeof w === c && (w = window.unescape(w)), s += i.template(w, ft)(t), a = 0, k = r.columns.length; a < k; a++) e = r.columns[a], e.command && (y = oi(e.command, "edit"), y && (h = y)); + else + for (a = 0, k = r.columns.length; a < k; a++) e = r.columns[a], e.command ? e.command && (y = oi(e.command, "edit"), y && (h = y)) : (s += '<div class="k-edit-label"><label for="' + e.field + '">' + (e.title || e.field || "") + "<\/label><\/div>", (!t.editable || t.editable(e.field)) && e.field ? (ut.push({ + field: e.field, + format: e.format, + editor: e.editor, + values: e.values + }), s += "<div " + i.attr("container-for") + '="' + e.field + '" class="k-edit-field"><\/div>') : (nt = { + storage: {}, + count: 0 + }, d = i.template(r._cellTmpl(e, nt), ft), nt.count > 0 && (d = f(d, nt.storage)), s += '<div class="k-edit-field">' + d(t) + "<\/div>")); + h && o(h) && (h.text && o(h.text) && (tt = h.text.update, it = h.text.cancel), h.attr && (p = h.attr)); + r._isMobile ? (s += "<\/div><\/div>", r.editView = r.pane.append("<div data-" + i.ns + 'role="view" data-' + i.ns + 'init-widgets="false" class="k-grid-edit-form"><div data-' + i.ns + 'role="header" class="k-header">' + r._createButton({ + name: "update", + text: tt, + attr: p + }) + (g.title || "Edit") + r._createButton({ + name: "canceledit", + text: it, + attr: p + }) + "<\/div>" + s + "<\/div>"), b = r._editContainer = r.editView.element.find(".k-popup-edit-form")) : (s += '<div class="k-edit-buttons k-state-default">', s += r._createButton({ + name: "update", + text: tt, + attr: p + }) + r._createButton({ + name: "canceledit", + text: it, + attr: p + }), s += "<\/div><\/div><\/div>", b = r._editContainer = n(s).appendTo(r.wrapper).eq(0).kendoWindow(u({ + modal: !0, + resizable: !1, + draggable: !0, + title: "Edit", + visible: !1, + close: function(i) { + if (i.userTriggered) { + if (i.sender.element.focus(), r.trigger("cancel", { + container: b, + model: t + })) { + i.preventDefault(); + return + } + var u = r.items().index(n(r.current()).parent()); + r.cancelRow(); + r.options.navigatable && (r.current(r.items().eq(u).children().filter(v).first()), l(r.table, !0)) + } + } + }, g))); + r.editable = r._editContainer.kendoEditable({ + fields: ut, + model: t, + clearContainer: !1 + }).data("kendoEditable"); + r._isMobile && b.find("input[type=checkbox],input[type=radio]").parent(".k-edit-field").addClass("k-check").prev(".k-edit-label").addClass("k-check").click(function() { + n(this).next().children("input").click() + }); + r._openPopUpEditor(); + r.trigger(yt, { + container: b, + model: t + }) + }, + _openPopUpEditor: function() { + this._isMobile ? this.pane.navigate(this.editView, this._editAnimation) : this._editContainer.data("kendoWindow").center().open() + }, + _createInlineEditor: function(t, r) { + var e = this, + u, s, f, h = []; + t.children(":not(.k-group-cell,.k-hierarchy-cell)").each(function() { + if (s = n(this), u = e.columns[e.cellIndex(s)], !u.command && u.field && (!r.editable || r.editable(u.field))) h.push({ + field: u.field, + format: u.format, + editor: u.editor, + values: u.values + }), s.attr(i.attr("container-for"), u.field), s.empty(); + else if (u.command && (f = oi(u.command, "edit"), f)) { + s.empty(); + var c, l, t; + o(f) && (f.text && o(f.text) && (c = f.text.update, l = f.text.cancel), f.attr && (t = f.attr)); + n(e._createButton({ + name: "update", + text: c, + attr: t + }) + e._createButton({ + name: "canceledit", + text: l, + attr: t + })).appendTo(s) + } + }); + e._editContainer = t; + e.editable = t.addClass("k-grid-edit-row").kendoEditable({ + fields: h, + model: r, + clearContainer: !1 + }).data("kendoEditable"); + e.trigger(yt, { + container: t, + model: r + }) + }, + cancelRow: function() { + var n = this, + t = n._editContainer, + r; + t && (r = n._modelForContainer(t), n._destroyEditable(), n.dataSource.cancelChanges(r), n._editMode() !== "popup" ? n._displayRow(t) : n._displayRow(n.items().filter("[" + i.attr("uid") + "=" + r.uid + "]"))) + }, + saveRow: function() { + var n = this, + t = n._editContainer, + r = n._modelForContainer(t), + i = n.editable; + t && i && i.end() && !n.trigger(gt, { + container: t, + model: r + }) && n.dataSource.sync() + }, + _displayRow: function(t) { + var i = this, + r = i._modelForContainer(t); + r && t.replaceWith(n((t.hasClass("k-alt") ? i.altRowTemplate : i.rowTemplate)(r))) + }, + _showMessage: function(t, r) { + var u = this; + if (!u._isMobile) return window.confirm(t.title); + var f = i.template('<ul><li class="km-actionsheet-title">#:title#<\/li><li><a href="\\#" class="k-button k-grid-delete">#:confirmDelete#<\/a><\/li><\/ul>'), + e = n(f(t)).appendTo(u.view.element), + o = u._actionSheet = new i.mobile.ui.ActionSheet(e, { + cancel: t.cancelDelete, + cancelTemplate: '<li class="km-actionsheet-cancel"><a class="k-button" href="\\#">#:cancel#<\/a><\/li>', + close: function() { + this.destroy() + }, + command: function(t) { + var i = n(t.currentTarget).parent(); + i.hasClass("km-actionsheet-cancel") || u._removeRow(r) + }, + popup: u._actionSheetPopupOptions + }); + return o.open(r), !1 + }, + _confirmation: function(n) { + var r = this, + t = r.options.editable, + i = t === !0 || typeof t === c ? gi : t.confirmation; + return i !== !1 && i != null ? r._showMessage({ + confirmDelete: t.confirmDelete || hr, + cancelDelete: t.cancelDelete || cr, + title: i === !0 ? gi : i + }, n) : !0 + }, + cancelChanges: function() { + this.dataSource.cancelChanges() + }, + saveChanges: function() { + var n = this; + (n.editable && n.editable.end() || !n.editable) && !n.trigger(vi) && n.dataSource.sync() + }, + addRow: function() { + var n = this, + r, t = n.dataSource, + f = n._editMode(), + c = n.options.editable.createAt || "", + e = t.pageSize(), + o = t.view() || []; + if (n.editable && n.editable.end() || !n.editable) { + f != "incell" && n.cancelRow(); + r = t.indexOf(o[0]); + c.toLowerCase() == "bottom" && (r += o.length, e && !t.options.serverPaging && e <= o.length && (r -= 1)); + r < 0 && (r = t.page() > t.totalPages() ? (t.page() - 1) * e : 0); + var s = t.insert(r, {}), + l = s.uid, + u = n.table.find("tr[" + i.attr("uid") + "=" + l + "]"), + h = u.children("td:not(.k-group-cell,.k-hierarchy-cell)").eq(n._firstEditableColumnIndex(u)); + f === "inline" && u.length ? n.editRow(u) : f === "popup" ? n.editRow(s) : h.length && n.editCell(h) + } + }, + _firstEditableColumnIndex: function(n) { + for (var u = this, i, f = u.columns, r = u._modelForContainer(n), t = 0, e = f.length; t < e; t++) + if (i = f[t], r && (!r.editable || r.editable(i.field)) && !i.command && i.field) return t; + return -1 + }, + _toolbar: function() { + var t = this, + s = t.wrapper, + u = t.options.toolbar, + o = t.options.editable, + e; + if (u && (e = t.wrapper.find(".k-grid-toolbar"), e.length || (or(u) || (u = typeof u === c ? u : t._toolbarTmpl(u).replace(ii, "\\#"), u = f(i.template(u), t)), e = n('<div class="k-toolbar k-grid-toolbar" />').html(u({})).prependTo(s)), o && o.create !== !1)) e.on(h + r, ".k-grid-add", function(n) { + n.preventDefault(); + t.addRow() + }).on(h + r, ".k-grid-cancel-changes", function(n) { + n.preventDefault(); + t.cancelChanges() + }).on(h + r, ".k-grid-save-changes", function(n) { + n.preventDefault(); + t.saveChanges() + }) + }, + _toolbarTmpl: function(n) { + var u = this, + t, i, r = ""; + if (k(n)) + for (t = 0, i = n.length; t < i; t++) r += u._createButton(n[t]); + return r + }, + _createButton: function(n) { + var f = n.template || vr, + t = typeof n === c ? n : n.name || n.text, + e = wt[t] ? wt[t].className : "k-grid-" + (t || "").replace(/\s/g, ""), + r = { + className: e, + text: t, + imageClass: "", + attr: "", + iconClass: "" + }; + if (!t && !(o(n) && n.template)) throw new Error("Custom commands should have name specified"); + return o(n) ? (n.className && (n.className += " " + r.className), t === "edit" && o(n.text) && (n = u(!0, {}, n), n.text = n.text.edit), n.attr && o(n.attr) && (n.attr = lt(n.attr)), r = u(!0, r, wt[t], n)) : r = u(!0, r, wt[t]), i.template(f)(r) + }, + _hasFooters: function() { + for (var t = this.columns, i = t.length, n = 0; n < i; n++) + if (t[n].footerTemplate !== "" || t[n].groupFooterTemplate !== "") return !0; + return !1 + }, + _groupable: function() { + var t = this; + t._groupableClickHandler ? t.table.off(h + r, t._groupableClickHandler) : t._groupableClickHandler = function(i) { + var r = n(this), + u = r.closest("tr"); + r.hasClass("k-i-collapse") ? t.collapseGroup(u) : t.expandGroup(u); + i.preventDefault(); + i.stopPropagation() + }; + t.table.on(h + r, ".k-grouping-row .k-i-collapse, .k-grouping-row .k-i-expand", t._groupableClickHandler); + t._attachGroupable() + }, + _attachGroupable: function() { + var t = this, + r = t.wrapper, + f = t.options.groupable, + e = vt + ":visible[" + i.attr("field") + "]", + o = vt + "[" + i.attr("field") + "]"; + f && (r.has("div.k-grouping-header")[0] || n("<div> <\/div>").addClass("k-grouping-header").prependTo(r), t.groupable && t.groupable.destroy(), t.groupable = new fr(r, u({}, f, { + draggable: t._draggableInstance, + groupContainer: ">div.k-grouping-header", + dataSource: t.dataSource, + draggableElements: t.content ? ".k-grid-header:first " + e : "table:first>.k-grid-header " + e, + filter: t.content ? ".k-grid-header:first " + o : "table:first>.k-grid-header " + o, + allowDrag: t.options.reorderable + }))) + }, + _selectable: function() { + var n = this, + f, e, t = [], + u = n.options.selectable; + if (u && (f = typeof u === c && u.toLowerCase().indexOf("multiple") > -1, e = typeof u === c && u.toLowerCase().indexOf("cell") > -1, n._hasDetails() && (t[t.length] = ".k-detail-row"), (n.options.groupable || n._hasFooters()) && (t[t.length] = ".k-grouping-row,.k-group-footer"), t = t.join(","), t !== "" && (t = ":not(" + t + ")"), n.selectable = new i.ui.Selectable(n.table, { + filter: ">" + (e ? sr : "tbody>tr" + t), + aria: !0, + multiple: f, + change: function() { + n.trigger(a) + } + }), n.options.navigatable)) n.table.on("keydown" + r, function(t) { + var i = n.current(); + if (t.keyCode === s.SPACEBAR && t.target == n.table[0] && !i.is(".k-edit-cell,.k-header") && i.parent().is(":not(.k-grouping-row,.k-detail-row,.k-group-footer)")) { + if (t.preventDefault(), t.stopPropagation(), i = e ? i : i.parent(), f) + if (t.ctrlKey) { + if (i.hasClass(bi)) { + i.removeClass(bi); + n.trigger(a); + return + } + } else n.selectable.clear(); + else n.selectable.clear(); + n.selectable.value(i) + } + }) + }, + clearSelection: function() { + var n = this; + n.selectable.clear(); + n.trigger(a) + }, + select: function(t) { + var r = this, + i = r.selectable; + if (t = n(t), t.length) { + i.options.multiple || (i.clear(), t = t.first()); + i.value(t); + return + } + return i.value() + }, + current: function(i) { + var r = this, + f = r.options.scrollable, + u = r._current, + e = r.table.add(r.thead.parent()); + return i !== t && i.length && (u && u[0] === i[0] || (u && (u.removeClass(ht).removeAttr("id"), e.removeAttr("aria-activedescendant")), i.attr("id", r._cellId), r._current = i.addClass(ht), e.attr("aria-activedescendant", r._cellId), i.length && f && (n.contains(r.content[0], i[0]) && r._scrollTo(i.parent()[0], r.content[0]), f.virtual ? r._scrollTo(i[0], r.content.find(">.k-virtual-scrollable-wrap")[0]) : r._scrollTo(i[0], r.content[0])))), r._current + }, + _removeCurrent: function() { + this._current && (this._current.removeClass(ht), this._current = null) + }, + _scrollTo: function(n, t) { + var e = n.tagName.toLowerCase(), + i = e === "td" || e === "th", + r = n[i ? "offsetLeft" : "offsetTop"], + o = n[i ? "offsetWidth" : "offsetHeight"], + u = t[i ? "scrollLeft" : "scrollTop"], + f = t[i ? "clientWidth" : "clientHeight"], + s = r + o, + h = 0; + h = u > r ? r : s > u + f ? o <= f ? s - f : r : u; + t[i ? "scrollLeft" : "scrollTop"] = h + }, + _navigatable: function() { + var t = this, + o = f(t.current, t), + u = t.table, + h = t.thead.parent(), + c = u, + a = i.support.isRtl(t.element); + if (t.options.navigatable) { + t.options.scrollable && (c = u.add(h), h.attr(nt, -1)); + h.on("keydown" + r, function(n) { + n.altKey && n.keyCode == s.DOWN && (o().find(".k-grid-filter, .k-header-column-menu").click(), n.stopImmediatePropagation()) + }).find("a.k-link").attr("tabIndex", -1); + u.attr(nt, y.max(u.attr(nt) || 0, 0)).on("mousedown" + r + " keydown" + r, ".k-detail-cell", function(n) { + n.target !== n.currentTarget && n.stopImmediatePropagation() + }); + c.on(i.support.touch ? "touchstart" + r : "mousedown" + r, ut + ">" + v, f(dr, t)).on("focus" + r, function() { + if (!i.support.touch) { + var t = o(); + t && t.is(":visible") ? t.addClass(ht) : o(n(this).find(ft)); + this == u[0] ? (h.attr(nt, -1), u.attr(nt, 0)) : (u.attr(nt, -1), h.attr(nt, 0)) + } + }).on("focusout" + r, function() { + var n = o(); + n && n.removeClass(ht) + }).on("keydown" + r, function(i) { + var h = i.keyCode, + f = !1, + p = !i.isDefaultPrevented() && !n(i.target).is(":button,a,:input,a>.k-icon"), + st = t.options.pageable, + w = t.dataSource, + nt = t._editMode() == "incell", + b, tt, c, k, it, et = i.shiftKey, + r = o(), + ot, d, y; + r && r.is("th") && (p = !0); + p && h == s.UP ? (r ? (c = r.parent().prevAll(ut).first(), c[0] || (it = t.thead.parent(), l(it, !0), c = it.find(ut).first()), k = r.index(), r = c.children().eq(k), r[0] && r.is(v) || (r = c.children(v).first())) : r = u.find(ft), f = !0, o(r)) : p && h == s.DOWN ? (r ? (c = r.parent().nextAll(ut).first(), !c[0] && r.is("th") && (l(t.tbody.parent()), c = t.tbody.find(ut).first()), k = r.index(), r = c.children().eq(k), r[0] && r.is(v) || (r = c.children(v).first())) : r = u.find(ft), f = !0, o(r)) : p && h == (a ? s.RIGHT : s.LEFT) ? (o(r ? r.prevAll(g + ":first") : u.find(ft)), f = !0) : p && h == (a ? s.LEFT : s.RIGHT) ? (r ? r.next()[0] && (r = r.nextAll(g + ":first")) : r = u.find(ft), f = !0, o(r)) : p && st && s.PAGEDOWN == h ? (w.page(w.page() + 1), f = !0) : p && st && s.PAGEUP == h ? (w.page(w.page() - 1), f = !0) : h == s.ENTER || s.F2 == h ? (r = r ? r : u.find(ft), r.is("th") ? (r.find(".k-link").click(), f = !0) : r.parent().is(".k-master-row,.k-grouping-row") ? (r.parent().find(".k-icon:first").click(), f = !0) : (ot = r.find(":kendoFocusable:first"), !r.hasClass("k-edit-cell") && ot[0] && r.hasClass("k-state-focused") ? (ot.focus(), f = !0) : t.options.editable && !n(i.target).is(":button,.k-button,textarea") && (d = n(i.target).closest("[role=gridcell]"), d[0] || (d = r), t._handleEditing(d), f = !0))) : s.ESC == h ? (b = rt(), r && n.contains(r[0], b) && !r.hasClass("k-edit-cell") && !r.parent().hasClass("k-grid-edit-row") ? (l(t.table[0], !0), f = !0) : t._editContainer && (!r || t._editContainer.has(r[0]) || r[0] === t._editContainer[0]) && (nt ? t.closeCell(!0) : (tt = t.items().index(n(r).parent()), b && b.blur(), t.cancelRow(), tt >= 0 && t.current(t.items().eq(tt).children().filter(v).first())), e.msie && e.version < 9 && document.body.focus(), l(u, !0), f = !0)) : s.TAB == h && (r = n(r), t.options.editable && nt && (y = n(rt()).closest(".k-edit-cell"), y[0] && y[0] !== r[0] && (r = y)), y = et ? r.prevAll(g + ":first") : r.nextAll(":visible:first"), y.length || (y = r.parent()[et ? "prevAll" : "nextAll"]("tr:not(.k-grouping-row):not(.k-detail-row):visible:first").children(g + (et ? ":last" : ":first"))), !r.is("th") && y.length && t.options.editable && nt && (t._handleEditing(r, y), f = !0)); + f && (i.preventDefault(), i.stopPropagation()) + }) + } + }, + _handleEditing: function(t, i) { + var r = this, + u = n(rt()), + f = r._editMode(), + c = e.msie, + a = c && e.version < 9, + o = r._editContainer, + s, h; + if (h = f == "incell" ? t.hasClass("k-edit-cell") : t.parent().hasClass("k-grid-edit-row"), r.editable) { + if (n.contains(o[0], u[0]) && (e.opera || a ? u.change().triggerHandler("blur") : (u.blur(), c && u.blur())), !r.editable) { + l(r.table); + return + } + if (r.editable.end()) f == "incell" ? r.closeCell() : (r.saveRow(), h = !0); + else { + f == "incell" ? r.current(o) : r.current(o.children().filter(g).first()); + s = o.find(":kendoFocusable:first")[0]; + s && s.focus(); + return + } + } + i && r.current(i); + a && document.body.focus(); + l(r.table, !0); + (h || i) && !i || (f == "incell" ? r.editCell(r.current()) : r.editRow(r.current().parent())) + }, + _wrapper: function() { + var n = this, + r = n.table, + i = n.options.height, + t = n.element; + t.is("div") || (t = t.wrap("<div/>").parent()); + n.wrapper = t.addClass("k-grid k-widget k-secondary"); + i && (n.wrapper.css(ti, i), r.css(ti, "auto")); + n._initMobile() + }, + _initMobile: function() { + var t = this.options, + r; + this._isMobile = t.mobile === !0 && i.support.mobileOS || t.mobile === "phone" || t.mobile === "tablet"; + this._isMobile && (r = this.wrapper.addClass("k-grid-mobile").wrap("<div data-" + i.ns + 'role="view" data-' + i.ns + 'init-widgets="false"><\/div>').parent(), this.pane = i.mobile.ui.Pane.wrap(r), this.view = this.pane.view(), this._actionSheetPopupOptions = n(document.documentElement).hasClass("km-root") ? { + modal: !1 + } : { + align: "bottom center", + position: "bottom center", + effect: "slideIn:up" + }, t.height && this.pane.element.parent().css(ti, t.height), this._editAnimation = "slide") + }, + _tbody: function() { + var i = this, + r = i.table, + t; + t = r.find(">tbody"); + t.length || (t = n("<tbody/>").appendTo(r)); + i.tbody = t + }, + _scrollable: function() { + var t = this, + u, s, y = t.options, + o = y.scrollable, + v = o !== !0 && o.virtual && !t.virtualScrollable, + c = !i.support.kineticScrollNeeded || v ? i.support.scrollbar() : 0, + l, a, h; + o && (u = t.wrapper.children(".k-grid-header"), u[0] || (u = n('<div class="k-grid-header" />').insertBefore(t.table)), u.css(p ? "padding-left" : "padding-right", o.virtual ? c + 1 : c), s = n('<table role="grid" />'), ri && s.attr("cellspacing", 0), s.append(t.thead), u.empty().append(n('<div class="k-grid-header-wrap" />').append(s)), t.content = t.table.parent(), t.content.is(".k-virtual-scrollable-wrap") && (t.content = t.content.parent()), t.content.is(".k-grid-content, .k-virtual-scrollable-wrap") || (t.content = t.table.wrap('<div class="k-grid-content" />').parent()), v && (t.virtualScrollable = new tr(t.content, { + dataSource: t.dataSource, + itemHeight: f(t._averageRowHeight, t) + })), t.scrollables = u.children(".k-grid-header-wrap"), l = t.wrapper.find(".k-grid-footer"), a = p && e.webkit ? c : 0, l.length && (t.scrollables = t.scrollables.add(l.children(".k-grid-footer-wrap"))), o.virtual ? t.content.find(">.k-virtual-scrollable-wrap").bind("scroll" + r, function() { + t.scrollables.scrollLeft(this.scrollLeft + a) + }) : (t.content.bind("scroll" + r, function() { + t.scrollables.scrollLeft(this.scrollLeft + a) + }), h = i.touchScroller(t.content), h && h.movable && h.movable.bind("change", function(n) { + t.scrollables.scrollLeft(-n.sender.x) + }))) + }, + _setContentWidth: function() { + var t = this, + u = "k-grid-content-expander", + e = '<div class="' + u + '"><\/div>', + r = t.resizable, + i; + t.options.scrollable && t.wrapper.is(":visible") && (i = t.table.parent().children("." + u), t._setContentWidthHandler = f(t._setContentWidth, t), t.dataSource && t.dataSource.view().length ? i[0] && (i.remove(), r && r.unbind("resize", t._setContentWidthHandler)) : (i[0] || (i = n(e).appendTo(t.table.parent()), r && r.bind("resize", t._setContentWidthHandler)), t.thead && i.width(t.thead.width()))) + }, + _setContentHeight: function() { + var n = this, + r = n.options, + t = n.wrapper.innerHeight(), + e = n.wrapper.children(".k-grid-header"), + u = i.support.scrollbar(), + f; + r.scrollable && n.wrapper.is(":visible") && (t -= e.outerHeight(), n.pager && (t -= n.pager.element.outerHeight()), r.groupable && (t -= n.wrapper.children(".k-grouping-header").outerHeight()), r.toolbar && (t -= n.wrapper.children(".k-grid-toolbar").outerHeight()), n.footerTemplate && (t -= n.wrapper.children(".k-grid-footer").outerHeight()), f = function(n) { + var t, i; + return n[0].style.height ? !0 : (t = n.height(), n.height("auto"), i = n.height(), t != i) ? (n.height(""), !0) : (n.height(""), !1) + }, f(n.wrapper) && (t > u * 2 ? n.content.height(t) : n.content.height(u * 2 + 1))) + }, + _averageRowHeight: function() { + var n = this, + t = n._rowHeight, + i; + return n._rowHeight || (n._rowHeight = t = n.table.outerHeight() / n.items().length, n._sum = t, n._measures = 1), i = n.table.outerHeight() / n.items().length, t !== i && (n._measures++, n._sum += i, n._rowHeight = n._sum / n._measures), t + }, + _dataSource: function() { + var n = this, + e = n.options, + r, i = e.dataSource; + i = k(i) ? { + data: i + } : i; + o(i) && (u(i, { + table: n.table, + fields: n.columns + }), r = e.pageable, o(r) && r.pageSize !== t && (i.pageSize = r.pageSize)); + n.dataSource && n._refreshHandler ? n.dataSource.unbind(a, n._refreshHandler).unbind(kt, n._progressHandler).unbind(dt, n._errorHandler) : (n._refreshHandler = f(n.refresh, n), n._progressHandler = f(n._requestStart, n), n._errorHandler = f(n._error, n)); + n.dataSource = ur.create(i).bind(a, n._refreshHandler).bind(kt, n._progressHandler).bind(dt, n._errorHandler) + }, + _error: function() { + this._progress(!1) + }, + _requestStart: function() { + this._progress(!0) + }, + _modelChange: function(t) { + var r = this, + h = t.model, + f = r.tbody.find("tr[" + i.attr("uid") + "=" + h.uid + "]"), + u, o, l = f.hasClass("k-alt"), + s, e = r.items().index(f), + c; + if (f.children(".k-edit-cell").length && !r.options.rowTemplate) f.children(":not(.k-group-cell,.k-hierarchy-cell)").each(function() { + u = n(this); + o = r.columns[r.cellIndex(u)]; + o.field === t.field && (u.hasClass("k-edit-cell") ? u.addClass("k-dirty-cell") : (r._displayCell(u, o, h), n('<span class="k-dirty"/>').prependTo(u))) + }); + else if (!f.hasClass("k-grid-edit-row")) { + for (s = (l ? r.altRowTemplate : r.rowTemplate)(h), f.replaceWith(s), s = r.items().eq(e), e = 0, c = r.columns.length; e < c; e++) o = r.columns[e], o.field === t.field && (u = s.children(":not(.k-group-cell,.k-hierarchy-cell)").eq(e), n('<span class="k-dirty"/>').prependTo(u)); + r.trigger("itemChange", { + item: s, + data: h, + ns: it + }) + } + }, + _pageable: function() { + var t = this, + f, r = t.options.pageable; + r && (f = t.wrapper.children("div.k-grid-pager"), f.length || (f = n('<div class="k-pager-wrap k-grid-pager"/>').appendTo(t.wrapper)), t.pager && t.pager.destroy(), t.pager = typeof r == "object" && r instanceof i.ui.Pager ? r : new i.ui.Pager(f, u({}, r, { + dataSource: t.dataSource + }))) + }, + _footer: function() { + var t = this, + u = t.dataSource.aggregates(), + r = "", + s = t.footerTemplate, + e = t.options, + f, i = t.footer || t.wrapper.find(".k-grid-footer"), + o; + s ? (u = at(u) ? fi(t.dataSource.aggregate()) : u, r = n(t._wrapFooter(s(u))), i.length ? (o = r, i.replaceWith(o), i = t.footer = o) : i = e.scrollable ? t.footer = e.pageable ? r.insertBefore(t.wrapper.children("div.k-grid-pager")) : r.appendTo(t.wrapper) : t.footer = r.insertBefore(t.tbody)) : i && !t.footer && (t.footer = i); + i.length && (e.scrollable && (f = i.attr("tabindex", -1).children(".k-grid-footer-wrap"), t.scrollables = t.scrollables.not(".k-grid-footer-wrap").add(f)), t._footerWidth && i.find("table").css("width", t._footerWidth), f && f.scrollLeft(t.content.scrollLeft())) + }, + _wrapFooter: function(t) { + var u = this, + r = "", + f = i.support.mobileOS ? 0 : i.support.scrollbar(); + return u.options.scrollable ? (r = n('<div class="k-grid-footer"><div class="k-grid-footer-wrap"><table' + (ri ? ' cellspacing="0"' : "") + "><tbody>" + t + "<\/tbody><\/table><\/div><\/div>"), u._appendCols(r.find("table")), r.css(p ? "padding-left" : "padding-right", f), r) : '<tfoot class="k-grid-footer">' + t + "<\/tfoot>" + }, + _columnMenu: function() { + var t = this, + s, v = t.columns, + r, e = t.options, + f = e.columnMenu, + h, c, a, y = this._isMobile, + p = function() { + l(t.thead.parent(), !0) + }, + w = function(n) { + t.trigger(ci, { + field: n.field, + container: n.container + }) + }, + o; + f && (typeof f == "boolean" && (f = {}), t.thead.find("th:not(.k-hierarchy-cell,.k-group-cell)").each(function(l) { + r = v[l]; + o = n(this); + !r.command && (r.field || o.attr("data-" + i.ns + "field")) && (s = o.data("kendoColumnMenu"), s && s.destroy(), c = r.sortable !== !1 && f.sortable !== !1 ? e.sortable : !1, a = e.filterable && r.filterable !== !1 && f.filterable !== !1 ? u({ + pane: t.pane + }, r.filterable, e.filterable) : !1, h = { + dataSource: t.dataSource, + values: r.values, + columns: f.columns, + sortable: c, + filterable: a, + messages: f.messages, + owner: t, + closeCallback: p, + init: w, + pane: t.pane, + filter: y ? ":not(.k-column-active)" : "" + }, o.kendoColumnMenu(h)) + })) + }, + _filterable: function() { + var t = this, + r = t.columns, + f, e, s = function() { + l(t.thead.parent(), !0) + }, + o = t.options.filterable; + o && !t.options.columnMenu && t.thead.find("th:not(.k-hierarchy-cell,.k-group-cell)").each(function(h) { + if (f = n(this), r[h].filterable !== !1 && !r[h].command && (r[h].field || f.attr("data-" + i.ns + "field"))) { + e = f.data("kendoFilterMenu"); + e && e.destroy(); + var c = r[h].filterable, + l = u({}, o, c, { + dataSource: t.dataSource, + values: r[h].values, + closeCallback: s, + init: function(n) { + t.trigger(hi, { + field: n.field, + container: n.container + }) + }, + pane: t.pane + }); + c && c.messages && (l.messages = u(!0, {}, o.messages, c.messages)); + f.kendoFilterMenu(l) + } + }) + }, + _sortable: function() { + var r = this, + s = r.columns, + t, f, e, o = r.options.sortable; + o && r.thead.find("th:not(.k-hierarchy-cell,.k-group-cell)").each(function(h) { + t = s[h]; + t.sortable !== !1 && !t.command && t.field && (f = n(this), e = f.data("kendoSortable"), e && e.destroy(), f.attr("data-" + i.ns + "field", t.field).kendoSortable(u({}, o, t.sortable, { + dataSource: r.dataSource, + aria: !0, + filter: ":not(.k-column-active)" + }))) + }) + }, + _columns: function(t) { + var r = this, + f = r.table, + e, s = f.find("col"), + o = r.options.dataSource; + t = t.length ? t : bt(f.find("th"), function(t, r) { + t = n(t); + var f = t.attr(i.attr("sortable")), + e = t.attr(i.attr("filterable")), + o = t.attr(i.attr("type")), + h = t.attr(i.attr("groupable")), + u = t.attr(i.attr("field")), + c = t.attr(i.attr("menu")); + return u || (u = t.text().replace(/\s|[^A-z0-9]/g, "")), { + field: u, + type: o, + sortable: f !== "false", + filterable: e !== "false", + groupable: h !== "false", + menu: c, + template: t.attr(i.attr("template")), + width: s.eq(r).css("width") + } + }); + e = !(r.table.find("tbody tr").length > 0 && (!o || !o.transport)); + r.columns = bt(t, function(n) { + return n = typeof n === c ? { + field: n + } : n, n.hidden && (n.attributes = ot(n.attributes), n.footerAttributes = ot(n.footerAttributes), n.headerAttributes = ot(n.headerAttributes)), u({ + encoded: e + }, n) + }) + }, + _groups: function() { + var n = this.dataSource.group(); + return n ? n.length : 0 + }, + _tmpl: function(n, t) { + var r = this, + c = u({}, i.Template, r.options.templateSettings), + e, l = r.columns.length, + a, h = { + storage: {}, + count: 0 + }, + o, p, v = r._hasDetails(), + s = [], + y = r._groups(); + if (!n) { + for (n = "<tr", t && s.push("k-alt"), v && s.push("k-master-row"), s.length && (n += ' class="' + s.join(" ") + '"'), l && (n += " " + i.attr("uid") + '="#=' + i.expr("uid", c.paramName) + '#"'), n += " role='row'>", y > 0 && (n += pt(y)), v && (n += '<td class="k-hierarchy-cell"><a class="k-icon k-plus" href="\\#" tabindex="-1"><\/a><\/td>'), e = 0; e < l; e++) o = r.columns[e], a = o.template, p = typeof a, n += "<td" + lt(o.attributes) + " role='gridcell'>", n += r._cellTmpl(o, h), n += "<\/td>"; + n += "<\/tr>" + } + return (n = i.template(n, c), h.count > 0) ? f(n, h.storage) : n + }, + _headerCellText: function(n) { + var e = this, + o = u({}, i.Template, e.options.templateSettings), + t = n.headerTemplate, + f = typeof t, + r = n.title || n.field || ""; + return f === ct ? r = i.template(t, o)({}) : f === c && (r = t), r + }, + _cellTmpl: function(n, t) { + var h = this, + y = u({}, i.Template, h.options.templateSettings), + l = n.template, + a = y.paramName, + f = n.field, + r = "", + s, p, v = n.format, + w = typeof l, + e = n.values; + if (n.command) { + if (k(n.command)) { + for (s = 0, p = n.command.length; s < p; s++) r += h._createButton(n.command[s]); + return r.replace(ii, "\\#") + } + return h._createButton(n.command).replace(ii, "\\#") + } + return w === ct ? (t.storage["tmpl" + t.count] = l, r += "#=this.tmpl" + t.count + "(" + a + ")#", t.count++) : w === c ? r += l : e && e.length && o(e[0]) && "value" in e[0] && f ? (r += "#var v =" + i.stringify(rr(e)) + "#", r += "#var f = v[", y.useWithBlock || (r += a + "."), r += f + "]#", r += "${f != null ? f : ''}") : (r += n.encoded ? "#:" : "#=", v && (r += 'kendo.format("' + v.replace(lr, "\\$1") + '",'), f ? (f = i.expr(f, a), r += f + "==null?'':" + f) : r += "''", v && (r += ")"), r += "#"), r + }, + _templates: function() { + var t = this, + r = t.options, + u = t.dataSource, + f = u.group(), + e = t.footer || t.wrapper.find(".k-grid-footer"), + i = u.aggregate(); + t.rowTemplate = t._tmpl(r.rowTemplate); + t.altRowTemplate = t._tmpl(r.altRowTemplate || r.rowTemplate, !0); + t._hasDetails() && (t.detailTemplate = t._detailTmpl(r.detailTemplate || "")); + (!t._group || at(i)) && (at(i) || e.length) && !b(t.columns, function(n) { + return n.footerTemplate + }).length || (t.footerTemplate = t._footerTmpl(i, "footerTemplate", "k-footer-template")); + f && b(t.columns, function(n) { + return n.groupFooterTemplate + }).length && (i = n.map(f, function(n) { + return n.aggregates + }), t.groupFooterTemplate = t._footerTmpl(i, "groupFooterTemplate", "k-group-footer")) + }, + _footerTmpl: function(n, t, r) { + var s = this, + a = u({}, i.Template, s.options.templateSettings), + v = a.paramName, + e = "", + c, y, d = s.columns, + o, p, w = {}, + l = 0, + b = {}, + k = s._groups(), + g = fi(n), + h; + for (e += '<tr class="' + r + '">', k > 0 && (e += pt(k)), s._hasDetails() && (e += '<td class="k-hierarchy-cell"> <\/td>'), c = 0, y = s.columns.length; c < y; c++) h = d[c], o = h[t], p = typeof o, e += "<td" + lt(h.footerAttributes) + ">", o ? (p !== ct && (b = g[h.field] ? u({}, a, { + paramName: v + "." + h.field + }) : {}, o = i.template(o, b)), w["tmpl" + l] = o, e += "#=this.tmpl" + l + "(" + v + ")#", l++) : e += " ", e += "<\/td>"; + return (e += "<\/tr>", e = i.template(e, a), l > 0) ? f(e, w) : e + }, + _detailTmpl: function(n) { + var e = this, + t = "", + o = u({}, i.Template, e.options.templateSettings), + l = o.paramName, + s = {}, + r = 0, + h = e._groups(), + c = tt(e.columns).length, + a = typeof n; + return (t += '<tr class="k-detail-row">', h > 0 && (t += pt(h)), t += '<td class="k-hierarchy-cell"><\/td><td class="k-detail-cell"' + (c ? ' colspan="' + c + '"' : "") + ">", a === ct ? (s["tmpl" + r] = n, t += "#=this.tmpl" + r + "(" + l + ")#", r++) : t += n, t += "<\/td><\/tr>", t = i.template(t, o), r > 0) ? f(t, s) : t + }, + _hasDetails: function() { + var n = this; + return n.options.detailTemplate !== null || (n._events[ni] || []).length + }, + _details: function() { + var t = this; + t.table.on(h + r, ".k-hierarchy-cell .k-plus, .k-hierarchy-cell .k-minus", function(i) { + var f = n(this), + u = f.hasClass("k-plus"), + r = f.closest("tr.k-master-row"), + e, s = t.detailTemplate, + o, h = t._hasDetails(); + return f.toggleClass("k-plus", !u).toggleClass("k-minus", u), h && !r.next().hasClass("k-detail-row") && (o = t.dataItem(r), n(s(o)).addClass(r.hasClass("k-alt") ? "k-alt" : "").insertAfter(r), t.trigger(ni, { + masterRow: r, + detailRow: r.next(), + data: o, + detailCell: r.next().find(".k-detail-cell") + })), e = r.next(), t.trigger(u ? pi : wi, { + masterRow: r, + detailRow: e + }), e.toggle(u), t._current && t._current.attr("aria-expanded", u), i.preventDefault(), !1 + }) + }, + dataItem: function(t) { + if (t = n(t)[0], !t) return null; + for (var f = this.tbody.children(), u = t.sectionRowIndex, r = u, i = 0; i < u; i++) /k-grouping-row|k-detail-row|k-group-footer/.test(f[i].className) && r--; + return this._data[r] + }, + expandRow: function(t) { + n(t).find("> td .k-plus, > td .k-i-expand").click() + }, + collapseRow: function(t) { + n(t).find("> td .k-minus, > td .k-i-collapse").click() + }, + _thead: function() { + var r = this, + h = r.columns, + l = r._hasDetails() && h.length, + s, a, e = "", + o = r.table.find(">thead"), + f, c, u; + if (o.length || (o = n("<thead/>").insertBefore(r.tbody)), f = r.element.find("tr:has(th):first"), f.length || (f = o.children().first(), f.length || (f = n("<tr/>"))), f.children().length) l && !f.find(".k-hierarchy-cell")[0] && f.prepend('<th class="k-hierarchy-cell"> <\/th>'); + else { + for (l && (e += '<th class="k-hierarchy-cell"> <\/th>'), s = 0, a = h.length; s < a; s++) u = h[s], c = r._headerCellText(u), u.command ? e += "<th" + lt(u.headerAttributes) + ">" + c + "<\/th>" : (e += "<th role='columnheader' " + i.attr("field") + "='" + (u.field || "") + "' ", u.title && (e += i.attr("title") + '="' + u.title.replace(/'/g, "'") + '" '), u.groupable !== t && (e += i.attr("groupable") + "='" + u.groupable + "' "), u.aggregates && (e += i.attr("aggregates") + "='" + u.aggregates + "'"), e += lt(u.headerAttributes), e += ">" + c + "<\/th>"); + f.html(e) + } + f.find("th").addClass("k-header"); + r.options.scrollable || o.addClass("k-grid-header"); + f.find("script").remove().end().appendTo(o); + r.thead && r._destroyColumnAttachments(); + r.thead = o; + r._sortable(); + r._filterable(); + r._scrollable(); + r._updateCols(); + r._resizable(); + r._draggable(); + r._reorderable(); + r.groupable && r._attachGroupable(); + r._columnMenu() + }, + _updateCols: function() { + var n = this; + n._appendCols(n.thead.parent().add(n.table)) + }, + _appendCols: function(n) { + var t = this; + ir(n, tt(t.columns), t._hasDetails(), t._groups()) + }, + _autoColumns: function(n) { + if (n && n.toJSON) { + var t = this, + i; + n = n.toJSON(); + for (i in n) t.columns.push({ + field: i + }); + t._thead(); + t._templates() + } + }, + _rowsHtml: function(n) { + for (var i = this, r = "", f = i.rowTemplate, e = i.altRowTemplate, t = 0, u = n.length; t < u; t++) r += t % 2 ? e(n[t]) : f(n[t]), i._data.push(n[t]); + return r + }, + _groupRowHtml: function(n, t, r) { + var f = this, + e = "", + o, l, a = n.field, + s = b(f.columns, function(n) { + return n.field == a + })[0] || {}, + h = s.groupHeaderTemplate, + v = (s.title || a) + ": " + br(n.value, s.format, s.values), + y = u({}, { + field: n.field, + value: n.value + }, n.aggregates[n.field]), + p = f._groupAggregatesDefaultObject || {}, + c = n.items; + if (h && (v = typeof h === ct ? h(y) : i.template(h)(y)), e += '<tr class="k-grouping-row">' + pt(r) + '<td colspan="' + t + '" aria-expanded="true"><p class="k-reset"><a class="k-icon k-i-collapse" href="#" tabindex="-1"><\/a>' + v + "<\/p><\/td><\/tr>", n.hasSubgroups) + for (o = 0, l = c.length; o < l; o++) e += f._groupRowHtml(c[o], t - 1, r + 1); + else e += f._rowsHtml(c); + return f.groupFooterTemplate && (e += f.groupFooterTemplate(u(p, n.aggregates))), e + }, + collapseGroup: function(t) { + t = n(t).find(".k-icon").addClass("k-i-expand").removeClass("k-i-collapse").end(); + var f = t.find(".k-group-cell").length, + r = 1, + u, i; + t.find("td:first").attr("aria-expanded", !1); + t.nextAll("tr").each(function() { + if (i = n(this), u = i.find(".k-group-cell").length, i.hasClass("k-grouping-row") ? r++ : i.hasClass("k-group-footer") && r--, u <= f || i.hasClass("k-group-footer") && r < 0) return !1; + i.hide() + }) + }, + expandGroup: function(t) { + t = n(t).find(".k-icon").addClass("k-i-collapse").removeClass("k-i-expand").end(); + var e = this, + f = t.find(".k-group-cell").length, + i, r, u = 1; + t.find("td:first").attr("aria-expanded", !0); + t.nextAll("tr").each(function() { + if (i = n(this), r = i.find(".k-group-cell").length, r <= f) return !1; + r != f + 1 || i.hasClass("k-detail-row") || (i.show(), i.hasClass("k-grouping-row") && i.find(".k-icon").hasClass("k-i-collapse") && e.expandGroup(i), i.hasClass("k-master-row") && i.find(".k-icon").hasClass("k-minus") && i.next().show()); + i.hasClass("k-grouping-row") && u++; + i.hasClass("k-group-footer") && (u == 1 ? i.show() : u--) + }) + }, + _updateHeader: function(t) { + var r = this, + u = r.thead.find("th.k-group-cell"), + i = u.length; + t > i ? n(new Array(t - i + 1).join('<th class="k-group-cell k-header"> <\/th>')).prependTo(r.thead.find("tr")) : t < i && (i = i - t, n(b(u, function(n, t) { + return i > t + })).remove()) + }, + _firstDataItem: function(n, t) { + return n && t && (n = n.hasSubgroups ? this._firstDataItem(n.items[0], t) : n.items[0]), n + }, + hideColumn: function(t) { + var i = this, + a, f, r, h, u, v, c, o = 0, + l, y = i.footer || i.wrapper.find(".k-grid-footer"), + p = i.columns, + s; + if (t = typeof t == "number" ? p[t] : b(p, function(n) { + return n.field === t + })[0], t && !t.hidden) { + for (s = d(t, tt(p)), t.hidden = !0, t.attributes = ot(t.attributes), t.footerAttributes = ot(t.footerAttributes), t.headerAttributes = ot(t.headerAttributes), i._templates(), i._updateCols(), st(i.thead.find(">tr")[0].cells, s, !1), y[0] && (i._appendCols(y.find("table:first")), st(y.find(".k-footer-template")[0].cells, s, !1)), a = i.tbody.children(), u = 0, l = a.length; u < l; u += 1) f = a.eq(u), f.is(".k-grouping-row,.k-detail-row") ? (r = f.children(":not(.k-group-cell):first,.k-detail-cell").last(), r.attr("colspan", parseInt(r.attr("colspan"), 10) - 1)) : (f.hasClass("k-grid-edit-row") && (r = f.children(".k-edit-container")[0]) && (r = n(r), r.attr("colspan", parseInt(r.attr("colspan"), 10) - 1), r.find("col").eq(s).remove(), f = r.find("tr:first")), st(f[0].cells, s, !1)); + for (v = i.thead.prev().find("col"), u = 0, l = v.length; u < l; u += 1) + if (c = v[u].style.width, c && c.indexOf("%") == -1) o += parseInt(c, 10); + else { + o = 0; + break + } + h = n(">.k-grid-header table:first,>.k-grid-footer table:first", i.wrapper).add(i.table); + i._footerWidth = null; + o && (h.width(o), i._footerWidth = o); + e.msie && e.version == 8 && (h.css("display", "inline-table"), setTimeout(function() { + h.css("display", "table") + }, 1)); + i.trigger(li, { + column: t + }) + } + }, + showColumn: function(t) { + var i = this, + c, u, o, f, r, l, e, a, v, s = i.columns, + y = i.footer || i.wrapper.find(".k-grid-footer"), + h; + if (t = typeof t == "number" ? s[t] : b(s, function(n) { + return n.field === t + })[0], t && t.hidden) { + for (h = d(t, s), t.hidden = !1, t.attributes = ei(t.attributes), t.footerAttributes = ei(t.footerAttributes), t.headerAttributes = ei(t.headerAttributes), i._templates(), i._updateCols(), st(i.thead.find(">tr")[0].cells, h, !0), y[0] && (i._appendCols(y.find("table:first")), st(y.find(".k-footer-template")[0].cells, h, !0)), c = i.tbody.children(), u = 0, o = c.length; u < o; u += 1) f = c.eq(u), f.is(".k-grouping-row,.k-detail-row") ? (r = f.children(":not(.k-group-cell):first,.k-detail-cell").last(), r.attr("colspan", parseInt(r.attr("colspan"), 10) + 1)) : (f.hasClass("k-grid-edit-row") && (r = f.children(".k-edit-container")[0]) && (r = n(r), r.attr("colspan", parseInt(r.attr("colspan"), 10) + 1), ir(r.find(">form>table"), tt(s), !1, 0), f = r.find("tr:first")), st(f[0].cells, h, !0)); + if (l = n(">.k-grid-header table:first,>.k-grid-footer table:first", i.wrapper).add(i.table), t.width) { + for (e = 0, v = i.thead.prev().find("col"), u = 0, o = v.length; u < o; u += 1) { + if (a = v[u].style.width, a.indexOf("%") > -1) { + e = 0; + break + } + e += parseInt(a, 10) + } + i._footerWidth = null; + e && (l.width(e), i._footerWidth = e) + } else l.width(""); + i.trigger(ai, { + column: t + }) + } + }, + _progress: function(n) { + var t = this, + r = t.element.is("table") ? t.element.parent() : t.content && t.content.length ? t.content : t.element; + i.ui.progress(r, n) + }, + _resize: function() { + this.content && (this._setContentHeight(), this._setContentWidth()) + }, + refresh: function(t) { + var i = this, + y, f, e = "", + o = i.dataSource.view(), + w = i.options.navigatable, + s, h, u, p = n(i.current()), + c = !1, + r = (i.dataSource.group() || []).length, + a = r + tt(i.columns).length, + v; + if ((!t || t.action !== "itemchange" || !i.editable) && (t = t || {}, !i.trigger("dataBinding", { + action: t.action || "rebind", + index: t.index, + items: t.items + }))) { + if (v = rt(), w && (i.table[0] === v || n.contains(i.table[0], v) || i._editContainer && i._editContainer.data("kendoWindow")) && (c = p.is("th"), u = 0, c && (u = i.thead.find("th:not(.k-group-cell)").index(p))), i._destroyEditable(), i._progress(!1), i._hideResizeHandle(), i._data = [], i.columns.length || (i._autoColumns(i._firstDataItem(o[0], r)), a = r + i.columns.length), i._group = r > 0 || i._group, i._group && (i._templates(), i._updateCols(), i._updateHeader(r), i._group = r > 0), r > 0) + for (i.detailTemplate && a++, i.groupFooterTemplate && (i._groupAggregatesDefaultObject = fi(i.dataSource.aggregate())), f = 0, y = o.length; f < y; f++) e += i._groupRowHtml(o[f], a, 0); + else e += i._rowsHtml(o); + er ? i.tbody[0].innerHTML = e : (h = document.createElement("div"), h.innerHTML = "<table><tbody>" + e + "<\/tbody><\/table>", s = h.firstChild.firstChild, i.table[0].replaceChild(s, i.tbody[0]), i.tbody = n(s)); + i._footer(); + i._setContentHeight(); + i._setContentWidth(); + u >= 0 && (i._removeCurrent(), c ? i.current(i.thead.find("th:not(.k-group-cell)").eq(u)) : i.current(i.items().eq(u).children().filter(g).first()), i._current && l(i._current.closest("table")[0], !0)); + i.trigger(yi) + } + } + }); + it.plugin(kr); + it.plugin(tr) + }(window.kendo.jQuery); +kendo_module({ + id: "listview", + name: "ListView", + category: "web", + description: "The ListView widget offers rich support for interacting with data.", + depends: ["data"], + features: [{ + id: "listview-editing", + name: "Editing", + description: "Support for record editing", + depends: ["editable"] + }, { + id: "listview-selection", + name: "Selection", + description: "Support for selection", + depends: ["selectable"] + }] + }), + function(n, t) { + var i = window.kendo, + f = "change", + c = "cancel", + l = "dataBound", + a = "dataBinding", + e = i.ui.Widget, + r = i.keys, + v = ">*", + y = "progress", + p = "error", + s = "k-state-focused", + w = "k-state-selected", + h = "k-edit-item", + tt = "string", + b = "edit", + k = "remove", + d = "save", + it = "click", + u = ".kendoListView", + o = n.proxy, + g = i._activeElement, + nt = i.ui.progress, + rt = i.data.DataSource, + ut = e.extend({ + init: function(t, r) { + var u = this; + r = n.isArray(r) ? { + dataSource: r + } : r; + e.fn.init.call(u, t, r); + r = u.options; + u.wrapper = t = u.element; + t[0].id && (u._itemId = t[0].id + "_lv_active"); + u._element(); + u._dataSource(); + u._templates(); + u._navigatable(); + u._selectable(); + u._pageable(); + u._crudHandlers(); + u.options.autoBind && u.dataSource.fetch(); + i.notify(u) + }, + events: [f, c, a, l, b, k, d], + options: { + name: "ListView", + autoBind: !0, + selectable: !1, + navigatable: !1, + template: "", + altTemplate: "", + editTemplate: "" + }, + setOptions: function(n) { + e.fn.setOptions.call(this, n); + this._templates() + }, + _templates: function() { + var n = this.options; + this.template = i.template(n.template || ""); + this.altTemplate = i.template(n.altTemplate || n.template); + this.editTemplate = i.template(n.editTemplate || "") + }, + _item: function(n) { + return this.element.children()[n]() + }, + items: function() { + return this.element.children() + }, + setDataSource: function(n) { + this.options.dataSource = n; + this._dataSource(); + this.options.autoBind && n.fetch() + }, + _unbindDataSource: function() { + var n = this; + n.dataSource.unbind(f, n._refreshHandler).unbind(y, n._progressHandler).unbind(p, n._errorHandler) + }, + _dataSource: function() { + var n = this; + n.dataSource && n._refreshHandler ? n._unbindDataSource() : (n._refreshHandler = o(n.refresh, n), n._progressHandler = o(n._progress, n), n._errorHandler = o(n._error, n)); + n.dataSource = rt.create(n.options.dataSource).bind(f, n._refreshHandler).bind(y, n._progressHandler).bind(p, n._errorHandler) + }, + _progress: function() { + nt(this.element, !0) + }, + _error: function() { + nt(this.element, !1) + }, + _element: function() { + this.element.addClass("k-widget k-listview").attr("role", "listbox") + }, + refresh: function(n) { + var t = this, + f = t.dataSource.view(), + e, s, u, h = "", + r, o, c = t.template, + v = t.altTemplate, + y = g(); + if (n = n || {}, n.action === "itemchange") { + t._hasBindingTarget() || t.editable || (e = n.items[0], u = t.items().filter("[" + i.attr("uid") + "=" + e.uid + "]"), u.length > 0 && (r = u.index(), u.replaceWith(c(e)), u = t.items().eq(r), u.attr(i.attr("uid"), e.uid), t.trigger("itemChange", { + item: u, + data: e + }))); + return + } + if (!t.trigger(a, { + action: n.action || "rebind", + items: n.items, + index: n.index + })) { + for (t._destroyEditable(), r = 0, o = f.length; r < o; r++) h += r % 2 ? v(f[r]) : c(f[r]); + for (t.element.html(h), s = t.items(), r = 0, o = f.length; r < o; r++) s.eq(r).attr(i.attr("uid"), f[r].uid).attr("role", "option").attr("aria-selected", "false"); + t.element[0] === y && t.options.navigatable && t.current(s.eq(0)); + t.trigger(l) + } + }, + _pageable: function() { + var t = this, + r = t.options.pageable, + u, f; + n.isPlainObject(r) && (f = r.pagerId, u = n.extend({}, r, { + dataSource: t.dataSource, + pagerId: null + }), t.pager = new i.ui.Pager(n("#" + f), u)) + }, + _selectable: function() { + var n = this, + e, t, o = n.options.selectable, + s = n.options.navigatable; + if (o && (e = typeof o === tt && o.toLowerCase().indexOf("multiple") > -1, e && n.element.attr("aria-multiselectable", !0), n.selectable = new i.ui.Selectable(n.element, { + aria: !0, + multiple: e, + filter: v, + change: function() { + n.trigger(f) + } + }), s)) n.element.on("keydown" + u, function(i) { + if (i.keyCode === r.SPACEBAR) { + if (t = n.current(), i.target == i.currentTarget && i.preventDefault(), e) + if (i.ctrlKey) { + if (t && t.hasClass(w)) { + t.removeClass(w); + return + } + } else n.selectable.clear(); + else n.selectable.clear(); + n.selectable.value(t) + } + }) + }, + current: function(n) { + var r = this, + f = r.element, + i = r._current, + u = r._itemId; + if (n === t) return i; + i && i[0] && (i[0].id === u && i.removeAttr("id"), i.removeClass(s), f.removeAttr("aria-activedescendant")); + n && n[0] && (u = n[0].id || u, r._scrollTo(n[0]), f.attr("aria-activedescendant", u), n.addClass(s).attr("id", u)); + r._current = n + }, + _scrollTo: function(t) { + var u = this, + i, e = !1, + r = "scroll", + f; + u.wrapper.css("overflow") == "auto" || u.wrapper.css("overflow") == r ? i = u.wrapper[0] : (i = window, e = !0); + f = function(u, f) { + var o = e ? n(t).offset()[u.toLowerCase()] : t["offset" + u], + s = t["client" + f], + h = n(i)[r + u](), + c = n(i)[f.toLowerCase()](); + o + s > h + c ? n(i)[r + u](o + s - c) : o < h && n(i)[r + u](o) + }; + f("Top", "Height"); + f("Left", "Width") + }, + _navigatable: function() { + var t = this, + e = t.options.navigatable, + f = t.element, + c = function(i) { + t.current(n(i.currentTarget)); + n(i.target).is(":button,a,:input,a>.k-icon,textarea") || f.focus() + }; + if (e) { + t._tabindex(); + f.on("focus" + u, function() { + var n = t._current; + n && n.is(":visible") || (n = t._item("first")); + t.current(n) + }).on("focusout" + u, function() { + t._current && t._current.removeClass(s) + }).on("keydown" + u, function(u) { + var e = u.keyCode, + o = t.current(), + v = n(u.target), + y = !v.is(":button,textarea,a,a>.t-icon,input"), + a = v.is(":text"), + s = i.preventDefault, + c = f.find("." + h), + p = g(), + l, w; + if ((y || a || r.ESC == e) && (!a || r.ESC == e || r.ENTER == e)) + if (r.UP === e || r.LEFT === e) o && (o = o.prev()), t.current(!o || !o[0] ? t._item("last") : o), s(u); + else if (r.DOWN === e || r.RIGHT === e) o && (o = o.next()), t.current(!o || !o[0] ? t._item("first") : o), s(u); + else if (r.PAGEUP === e) t.current(null), t.dataSource.page(t.dataSource.page() - 1), s(u); + else if (r.PAGEDOWN === e) t.current(null), t.dataSource.page(t.dataSource.page() + 1), s(u); + else if (r.HOME === e) t.current(t._item("first")), s(u); + else if (r.END === e) t.current(t._item("last")), s(u); + else if (r.ENTER === e) + if (c.length !== 0 && (y || a)) { + l = t.items().index(c); + p && p.blur(); + t.save(); + w = function() { + t.element.trigger("focus"); + t.current(t.items().eq(l)) + }; + t.one("dataBound", w) + } else t.options.editTemplate !== "" && t.edit(o); + else if (r.ESC === e) { + if (c = f.find("." + h), c.length === 0) return; + l = t.items().index(c); + t.cancel(); + t.element.trigger("focus"); + t.current(t.items().eq(l)) + } + }); + f.on("mousedown" + u + " touchstart" + u, v, o(c, t)) + } + }, + clearSelection: function() { + var n = this; + n.selectable.clear(); + n.trigger(f) + }, + select: function(t) { + var r = this, + i = r.selectable; + if (t = n(t), t.length) { + i.options.multiple || (i.clear(), t = t.first()); + i.value(t); + return + } + return i.value() + }, + _destroyEditable: function() { + var n = this; + n.editable && (n.editable.destroy(), delete n.editable) + }, + _modelFromElement: function(n) { + var t = n.attr(i.attr("uid")); + return this.dataSource.getByUid(t) + }, + _closeEditable: function(n) { + var t = this, + r = t.editable, + u, e, o = t.template, + f = !0; + return r && (n && (f = r.end()), f && (r.element.index() % 2 && (o = t.altTemplate), u = t._modelFromElement(r.element), t._destroyEditable(), e = r.element.index(), r.element.replaceWith(o(u)), t.items().eq(e).attr(i.attr("uid"), u.uid))), f + }, + edit: function(n) { + var t = this, + r = t._modelFromElement(n), + u, e = r.uid, + f; + t.cancel(); + n = t.items().filter("[" + i.attr("uid") + "=" + e + "]"); + f = n.index(); + n.replaceWith(t.editTemplate(r)); + u = t.items().eq(f).addClass(h).attr(i.attr("uid"), r.uid); + t.editable = u.kendoEditable({ + model: r, + clearContainer: !1, + errorTemplate: !1 + }).data("kendoEditable"); + t.trigger(b, { + model: r, + item: u + }) + }, + save: function() { + var n = this, + t = n.editable, + i; + t && (t = t.element, i = n._modelFromElement(t), !n.trigger(d, { + model: i, + item: t + }) && n._closeEditable(!0) && n.dataSource.sync()) + }, + remove: function(n) { + var t = this, + i = t.dataSource, + r = t._modelFromElement(n); + t.trigger(k, { + model: r, + item: n + }) || (n.hide(), i.remove(r), i.sync()) + }, + add: function() { + var n = this, + t = n.dataSource, + i = t.indexOf((t.view() || [])[0]); + i < 0 && (i = 0); + n.cancel(); + t.insert(i, {}); + n.edit(n.element.children().first()) + }, + cancel: function() { + var n = this, + r = n.dataSource, + t, i; + n.editable && (t = n.editable.element, i = n._modelFromElement(t), n.trigger(c, { + model: i, + container: t + }) || (r.cancelChanges(i), n._closeEditable(!1))) + }, + _crudHandlers: function() { + var t = this, + r = it + u; + t.element.on(r, ".k-edit-button", function(r) { + var u = n(this).closest("[" + i.attr("uid") + "]"); + t.edit(u); + r.preventDefault() + }); + t.element.on(r, ".k-delete-button", function(r) { + var u = n(this).closest("[" + i.attr("uid") + "]"); + t.remove(u); + r.preventDefault() + }); + t.element.on(r, ".k-update-button", function(n) { + t.save(); + n.preventDefault() + }); + t.element.on(r, ".k-cancel-button", function(n) { + t.cancel(); + n.preventDefault() + }) + }, + destroy: function() { + var n = this; + e.fn.destroy.call(n); + n._unbindDataSource(); + n._destroyEditable(); + n.element.off(u); + n.pager && n.pager.destroy(); + n.selectable && n.selectable.destroy(); + i.destroy(n.element) + } + }); + i.ui.plugin(ut) + }(window.kendo.jQuery); +kendo_module({ + id: "numerictextbox", + name: "NumericTextBox", + category: "web", + description: "The NumericTextBox widget can format and display numeric, percentage or currency textbox.", + depends: ["core", "userevents"] + }), + function(n, t) { + function ut(n, t) { + return '<span unselectable="on" class="k-link"><span unselectable="on" class="k-icon k-i-arrow-' + n + '" title="' + t + '">' + t + "<\/span><\/span>" + } + + function y(i, r) { + var f, s = r !== t, + u, e, o, h; + return i.selectionStart !== t ? s ? (i.focus(), i.setSelectionRange(r, r)) : r = [i.selectionStart, i.selectionEnd] : document.selection && (n(i).is(":visible") && i.focus(), f = document.selection.createRange(), s ? (f.move("character", r), f.select()) : (u = i.createTextRange(), e = u.duplicate(), u.moveToBookmark(f.getBookmark()), e.setEndPoint("EndToStart", u), o = e.text.length, h = o + u.text.length, r = [o, h])), r + } + var r = window.kendo, + e = r.keys, + p = r.ui, + s = p.Widget, + ft = r._activeElement, + et = r._extractFormat, + ot = r.parseFloat, + st = r.support.placeholder, + ht = r.getCulture, + w = r._round, + h = "change", + b = "disabled", + k = "readonly", + ct = "k-input", + d = "spin", + u = ".kendoNumericTextBox", + lt = "touchend", + at = "mouseleave" + u, + g = "mouseenter" + u + " " + at, + c = "k-state-default", + nt = "k-state-focused", + tt = "k-state-hover", + l = "focus", + f = ".", + a = "k-state-selected", + v = "k-state-disabled", + it = "aria-disabled", + rt = "aria-readonly", + vt = /^(-)?(\d*)$/, + i = null, + o = n.proxy, + yt = s.extend({ + init: function(n, f) { + var e = this, + p = f && f.step !== t, + h, c, a, v, y; + if (s.fn.init.call(e, n, f), f = e.options, n = e.element.on("blur" + u, o(e._focusout, e)).attr("role", "spinbutton"), f.placeholder = f.placeholder || n.attr("placeholder"), e._reset(), e._wrapper(), e._arrows(), e._input(), r.support.mobileOS) e._text.on(lt + u + " " + l + u, function(t) { + e._toggleText(!1); + t.type === l && n.focus() + }); + else e._text.on(l + u, o(e._click, e)); + h = e.min(n.attr("min")); + c = e.max(n.attr("max")); + a = e._parse(n.attr("step")); + f.min === i && h !== i && (f.min = h); + f.max === i && c !== i && (f.max = c); + p || a === i || (f.step = a); + n.attr("aria-valuemin", f.min).attr("aria-valuemax", f.max); + f.format = et(f.format); + v = f.value; + e.value(v !== i ? v : n.val()); + y = n.is("[disabled]"); + y ? e.enable(!1) : e.readonly(n.is("[readonly]")); + r.notify(e) + }, + options: { + name: "NumericTextBox", + decimals: i, + min: i, + max: i, + value: i, + step: 1, + culture: "", + format: "n", + spinners: !0, + placeholder: "", + upArrowText: "Increase value", + downArrowText: "Decrease value" + }, + events: [h, d], + _editable: function(n) { + var t = this, + f = t.element, + i = n.disable, + r = n.readonly, + e = t._text.add(f), + s = t._inputWrapper.off(g); + if (t._toggleText(!0), t._upArrowEventHandler.unbind("press"), t._downArrowEventHandler.unbind("press"), f.off("keydown" + u).off("keypress" + u).off("paste" + u), r || i) s.addClass(i ? v : c).removeClass(i ? c : v), e.attr(b, i).attr(k, r).attr(it, i).attr(rt, r); + else { + s.addClass(c).removeClass(v).on(g, t._toggleHover); + e.removeAttr(b).removeAttr(k).attr(it, !1).attr(rt, !1); + t._upArrowEventHandler.bind("press", function(n) { + n.preventDefault(); + t._spin(1); + t._upArrow.addClass(a) + }); + t._downArrowEventHandler.bind("press", function(n) { + n.preventDefault(); + t._spin(-1); + t._downArrow.addClass(a) + }); + t.element.on("keydown" + u, o(t._keydown, t)).on("keypress" + u, o(t._keypress, t)).on("paste" + u, o(t._paste, t)) + } + }, + readonly: function(n) { + this._editable({ + readonly: n === t ? !0 : n, + disable: !1 + }) + }, + enable: function(n) { + this._editable({ + readonly: !1, + disable: !(n = n === t ? !0 : n) + }) + }, + destroy: function() { + var n = this; + n.element.add(n._text).add(n._upArrow).add(n._downArrow).add(n._inputWrapper).off(u); + n._upArrowEventHandler.destroy(); + n._downArrowEventHandler.destroy(); + n._form && n._form.off("reset", n._resetHandler); + s.fn.destroy.call(n) + }, + min: function(n) { + return this._option("min", n) + }, + max: function(n) { + return this._option("max", n) + }, + step: function(n) { + return this._option("step", n) + }, + value: function(n) { + var i = this, + r; + if (n === t) return i._value; + (n = i._parse(n), r = i._adjust(n), n === r) && (i._update(n), i._old = i._value) + }, + focus: function() { + this._focusin() + }, + _adjust: function(n) { + var f = this, + u = f.options, + t = u.min, + r = u.max; + return n === i ? n : (t !== i && n < t ? n = t : r !== i && n > r && (n = r), n) + }, + _arrows: function() { + var t = this, + i, f = function() { + clearTimeout(t._spinning); + i.removeClass(a) + }, + u = t.options, + e = u.spinners, + o = t.element; + i = o.siblings(".k-icon"); + i[0] || (i = n(ut("n", u.upArrowText) + ut("s", u.downArrowText)).insertAfter(o), i.wrapAll('<span class="k-select"/>')); + e || (i.parent().toggle(e), t._inputWrapper.addClass("k-expand-padding")); + t._upArrow = i.eq(0); + t._upArrowEventHandler = new r.UserEvents(t._upArrow, { + release: f + }); + t._downArrow = i.eq(1); + t._downArrowEventHandler = new r.UserEvents(t._downArrow, { + release: f + }) + }, + _blur: function() { + var n = this; + n._toggleText(!0); + n._change(n.element.val()) + }, + _click: function(n) { + var t = this; + clearTimeout(t._focusing); + t._focusing = setTimeout(function() { + var o = n.target, + l = y(o)[0], + s = o.value.substring(0, l), + h = t._format(t.options.format), + i = h[","], + r, c, u, e = 0; + i && (c = new RegExp("\\" + i, "g"), u = new RegExp("([\\d\\" + i + "]+)(\\" + h[f] + ")?(\\d+)?")); + u && (r = u.exec(s)); + r && (e = r[0].replace(c, "").length, s.indexOf("(") != -1 && t._value < 0 && e++); + t._focusin(); + y(t.element[0], e) + }) + }, + _change: function(n) { + var t = this; + t._update(n); + n = t._value; + t._old != n && (t._old = n, t.trigger(h), t.element.trigger(h)) + }, + _culture: function(n) { + return n || ht(this.options.culture) + }, + _focusin: function() { + var n = this; + n._inputWrapper.addClass(nt); + n._toggleText(!1); + n.element[0].focus() + }, + _focusout: function() { + var n = this; + clearTimeout(n._focusing); + n._inputWrapper.removeClass(nt).removeClass(tt); + n._blur() + }, + _format: function(n, t) { + var i = this._culture(t).numberFormat; + return n = n.toLowerCase(), n.indexOf("c") > -1 ? i = i.currency : n.indexOf("p") > -1 && (i = i.percent), i + }, + _input: function() { + var r = this, + u = "k-formatted-value", + t = r.element.addClass(ct).show()[0], + e = t.accessKey, + o = r.wrapper, + i; + i = o.find(f + u); + i[0] || (i = n('<input type="text"/>').insertBefore(t).addClass(u)); + try { + t.setAttribute("type", "text") + } catch (s) { + t.type = "text" + } + i[0].tabIndex = t.tabIndex; + i[0].style.cssText = t.style.cssText; + i.prop("placeholder", r.options.placeholder); + e && (i.attr("accesskey", e), t.accessKey = ""); + r._text = i.addClass(t.className) + }, + _keydown: function(n) { + var t = this, + i = n.keyCode; + i == e.DOWN ? t._step(-1) : i == e.UP ? t._step(1) : i == e.ENTER && t._change(t.element.val()) + }, + _keypress: function(n) { + if (n.which !== 0 && n.keyCode !== e.BACKSPACE && n.keyCode !== e.ENTER) { + var i = this.element, + f = String.fromCharCode(n.which), + r = y(i[0]), + o = r[0], + s = r[1], + u = this.options.min, + t = i.val(); + t = t.substring(0, o) + f + t.substring(s); + (u !== null && u >= 0 && t.charAt(0) === "-" || !this._numericRegex().test(t)) && n.preventDefault() + } + }, + _numericRegex: function() { + var t = this, + u = t.options, + e = t._format(u.format), + n = e[f], + r = u.decimals; + return (n === f && (n = "\\" + n), r === i && (r = e.decimals), r === 0) ? vt : (t._separator !== n && (t._separator = n, t._floatRegExp = new RegExp("^(-)?(((\\d+(" + n + "\\d*)?)|(" + n + "\\d*)))?$")), t._floatRegExp) + }, + _paste: function(n) { + var t = this, + r = n.target, + u = r.value; + setTimeout(function() { + t._parse(r.value) === i && t._update(u) + }) + }, + _option: function(n, i) { + var r = this, + u = r.options; + if (i === t) return u[n]; + (i = r._parse(i), i || n !== "step") && (u[n] = i, r.element.attr("aria-value" + n, i).attr(n, i)) + }, + _spin: function(n, t) { + var i = this; + t = t || 500; + clearTimeout(i._spinning); + i._spinning = setTimeout(function() { + i._spin(n, 50) + }, t); + i._step(n) + }, + _step: function(n) { + var t = this, + i = t.element, + r = t._parse(i.val()) || 0; + ft() != i[0] && t._focusin(); + r += t.options.step * n; + t._update(t._adjust(r)); + t.trigger(d) + }, + _toggleHover: function(t) { + n(t.currentTarget).toggleClass(tt, t.type === "mouseenter") + }, + _toggleText: function(n) { + var t = this; + t._text.toggle(n); + t.element.toggle(!n) + }, + _parse: function(n, t) { + return ot(n, this._culture(t), this.options.format) + }, + _update: function(n) { + var t = this, + s = t.options, + h = s.format, + u = s.decimals, + e = t._culture(), + c = t._format(h, e), + o; + u === i && (u = c.decimals); + n = t._parse(n, e); + o = n !== i; + o && (n = parseFloat(w(n, u))); + t._value = n = t._adjust(n); + t._placeholder(r.toString(n, h, e)); + o ? (n = n.toString(), n.indexOf("e") !== -1 && (n = w(+n, u)), n = n.replace(f, c[f])) : n = ""; + t.element.val(n).attr("aria-valuenow", n) + }, + _placeholder: function(n) { + this._text.val(n); + st || n || this._text.val(this.options.placeholder) + }, + _wrapper: function() { + var i = this, + r = i.element, + u = r[0], + t; + t = r.parents(".k-numerictextbox"); + t.is("span.k-numerictextbox") || (t = r.hide().wrap('<span class="k-numeric-wrap k-state-default" />').parent(), t = t.wrap("<span/>").parent()); + t[0].style.cssText = u.style.cssText; + u.style.width = ""; + i.wrapper = t.addClass("k-widget k-numerictextbox").addClass(u.className).css("display", ""); + i._inputWrapper = n(t[0].firstChild) + }, + _reset: function() { + var t = this, + i = t.element, + r = i.attr("form"), + u = r ? n("#" + r) : i.closest("form"); + u[0] && (t._resetHandler = function() { + setTimeout(function() { + t.value(i[0].value) + }) + }, t._form = u.on("reset", t._resetHandler)) + } + }); + p.plugin(yt) + }(window.kendo.jQuery); +kendo_module({ + id: "menu", + name: "Menu", + category: "web", + description: "The Menu widget displays hierarchical data as a multi-level menu.", + depends: ["popup"] + }), + function(n, t) { + function yi(n, t) { + return n = n.split(" ")[!t + 0] || n, n.replace("top", "up").replace("bottom", "down") + } + + function pi(n, t, r) { + n = n.split(" ")[!t + 0] || n; + var u = { + origin: ["bottom", r ? "right" : "left"], + position: ["top", r ? "right" : "left"] + }, + f = /left|right/.test(n); + return f ? (u.origin = ["top", n], u.position[1] = i.directions[n].reverse) : (u.origin[0] = n, u.position[0] = i.directions[n].reverse), u.origin = u.origin.join(" "), u.position = u.position.join(" "), u + } + + function d(t, i) { + try { + return n.contains(t, i) + } catch (r) { + return !1 + } + } + + function oi(t) { + t = n(t); + t.addClass("k-item").children(pt).addClass(kt); + t.children("a").addClass(k).children(pt).addClass(kt); + t.filter(":not([disabled])").addClass(ui); + t.filter(".k-separator:empty").append(" "); + t.filter("li[disabled]").addClass(y).removeAttr("disabled").attr("aria-disabled", !0); + t.filter("[role]").length || t.attr("role", "menuitem"); + t.children("." + k).length || t.contents().filter(function() { + return !this.nodeName.match(ci) && !(this.nodeType == 3 && !n.trim(this.nodeValue)) + }).wrapAll("<span class='" + k + "'/>"); + b(t); + c(t) + } + + function b(t) { + t = n(t); + t.find("> .k-link > [class*=k-i-arrow]:not(.k-sprite)").remove(); + t.filter(":has(.k-group)").children(".k-link:not(:has([class*=k-i-arrow]:not(.k-sprite)))").each(function() { + var t = n(this), + i = t.parent().parent(); + t.append("<span class='k-icon " + (i.hasClass(h + "-horizontal") ? "k-i-arrow-s" : "k-i-arrow-e") + "'/>") + }) + } + + function c(t) { + t = n(t); + t.filter(".k-first:not(:first-child)").removeClass(bt); + t.filter(".k-last:not(:last-child)").removeClass(wt); + t.filter(":first-child").addClass(bt); + t.filter(":last-child").addClass(wt) + } + var i = window.kendo, + si = i.ui, + hi = i._activeElement, + ft = i.support.touch && i.support.mobileOS, + et = "mousedown", + ot = "click", + f = n.extend, + u = n.proxy, + st = n.each, + o = i.template, + e = i.keys, + g = si.Widget, + ci = /^(ul|a|div)$/i, + r = ".kendoMenu", + pt = "img", + ht = "open", + h = "k-menu", + k = "k-link", + wt = "k-last", + nt = "close", + tt = "timer", + bt = "k-first", + kt = "k-image", + dt = "select", + a = "zIndex", + gt = "activate", + ni = "deactivate", + ti = "touchstart" + r + " MSPointerDown" + r + " pointerdown" + r, + it = i.support.pointers, + rt = i.support.msPointers, + ct = it ? "pointerover" : rt ? "MSPointerOver" : "mouseenter", + ii = it ? "pointerout" : rt ? "MSPointerOut" : "mouseleave", + ri = ft || rt || it, + ut = "kendoPopup", + ui = "k-state-default", + lt = "k-state-hover", + v = "k-state-focused", + y = "k-state-disabled", + at = ".k-group", + p = ":not(.k-list) > .k-item", + li = ".k-item.k-state-disabled", + vt = ".k-item:not(.k-state-disabled)", + ai = ".k-item:not(.k-state-disabled) > .k-link", + fi = ":not(.k-item.k-separator)", + w = fi + ":eq(0)", + ei = fi + ":last", + vi = "div:not(.k-animation-container,.k-list-container)", + s = { + content: o("<div class='k-content k-group' tabindex='-1'>#= content(item) #<\/div>"), + group: o("<ul class='#= groupCssClass(group) #'#= groupAttributes(group) # role='menu' aria-hidden='true'>#= renderItems(data) #<\/ul>"), + itemWrapper: o("<#= tag(item) # class='#= textClass(item) #'#= textAttributes(item) #>#= image(item) ##= sprite(item) ##= text(item) ##= arrow(data) #<\/#= tag(item) #>"), + item: o("<li class='#= wrapperCssClass(group, item) #' role='menuitem' #=item.items ? \"aria-haspopup='true'\": \"\"##=item.enabled === false ? \"aria-disabled='true'\" : ''#>#= itemWrapper(data) ## if (item.items) { ##= subGroup({ items: item.items, menu: menu, group: { expanded: item.expanded } }) ## } else if (item.content || item.contentUrl) { ##= renderContent(data) ## } #<\/li>"), + image: o("<img class='k-image' alt='' src='#= imageUrl #' />"), + arrow: o("<span class='#= arrowClass(item, group) #'><\/span>"), + sprite: o("<span class='k-sprite #= spriteCssClass #'><\/span>"), + empty: o("") + }, + yt = { + wrapperCssClass: function(n, t) { + var i = "k-item", + r = t.index; + return i += t.enabled === !1 ? " k-state-disabled" : " k-state-default", n.firstLevel && r === 0 && (i += " k-first"), r == n.length - 1 && (i += " k-last"), t.cssClass && (i += " " + t.cssClass), i + }, + textClass: function() { + return k + }, + textAttributes: function(n) { + return n.url ? " href='" + n.url + "'" : "" + }, + arrowClass: function(n, t) { + return "k-icon" + (t.horizontal ? " k-i-arrow-s" : " k-i-arrow-e") + }, + text: function(n) { + return n.encoded === !1 ? n.text : i.htmlEncode(n.text) + }, + tag: function(n) { + return n.url ? "a" : "span" + }, + groupAttributes: function(n) { + return n.expanded !== !0 ? " style='display:none'" : "" + }, + groupCssClass: function() { + return "k-group" + }, + content: function(n) { + return n.content ? n.content : " " + } + }, + l = g.extend({ + init: function(t, f) { + var e = this; + g.fn.init.call(e, t, f); + t = e.wrapper = e.element; + f = e.options; + e._initData(f); + e._updateClasses(); + e._animations(f); + e.nextItemZIndex = 100; + e._tabindex(); + e._focusProxy = u(e._focusHandler, e); + t.on(ti, e._focusProxy).on(ot + r, li, !1).on(ot + r, vt, u(e._click, e)).on("keydown" + r, u(e._keydown, e)).on("focus" + r, u(e._focus, e)).on("focus" + r, ".k-content", u(e._focus, e)).on(ti + " " + et + r, ".k-content", u(e._preventClose, e)).on("blur" + r, u(e._removeHoverItem, e)).on("blur" + r, "[tabindex]", u(e._checkActiveElement, e)).on(ct + r, vt, u(e._mouseenter, e)).on(ii + r, vt, u(e._mouseleave, e)).on(ct + r + " " + ii + r + " " + et + r + " " + ot + r, ai, u(e._toggleHover, e)); + f.openOnClick && (e.clicked = !1, e._documentClickHandler = u(e._documentClick, e), n(document).click(e._documentClickHandler)); + t.attr("role", "menubar"); + t[0].id && (e._ariaId = i.format("{0}_mn_active", t[0].id)); + i.notify(e) + }, + events: [ht, nt, gt, ni, dt], + options: { + name: "Menu", + animation: { + open: { + duration: 200 + }, + close: { + duration: 100 + } + }, + orientation: "horizontal", + direction: "default", + openOnClick: !1, + closeOnClick: !0, + hoverDelay: 100 + }, + _initData: function(n) { + var t = this; + n.dataSource && (t.element.empty(), t.append(n.dataSource, t.element)) + }, + setOptions: function(n) { + var t = this.options.animation; + this._animations(n); + n.animation = f(!0, t, n.animation); + "dataSource" in n && this._initData(n); + g.fn.setOptions.call(this, n) + }, + destroy: function() { + var t = this; + g.fn.destroy.call(t); + t.element.off(r); + t._documentClickHandler && n(document).unbind("click", t._documentClickHandler); + i.destroy(t.element) + }, + enable: function(n, t) { + return this._toggleDisabled(n, t !== !1), this + }, + disable: function(n) { + return this._toggleDisabled(n, !1), this + }, + append: function(n, t) { + t = this.element.find(t); + var i = this._insert(n, t, t.length ? t.find("> .k-group, > .k-animation-container > .k-group") : null); + return st(i.items, function() { + i.group.append(this); + b(this) + }), b(t), c(i.group.find(".k-first, .k-last").add(i.items)), this + }, + insertBefore: function(n, t) { + t = this.element.find(t); + var i = this._insert(n, t, t.parent()); + return st(i.items, function() { + t.before(this); + b(this); + c(this) + }), c(t), this + }, + insertAfter: function(n, t) { + t = this.element.find(t); + var i = this._insert(n, t, t.parent()); + return st(i.items, function() { + t.after(this); + b(this); + c(this) + }), c(t), this + }, + _insert: function(t, i, r) { + var c = this, + u, s, e, o; + return i && i.length || (r = c.element), e = n.isPlainObject(t), o = { + firstLevel: r.hasClass(h), + horizontal: r.hasClass(h + "-horizontal"), + expanded: !0, + length: r.children().length + }, i && !r.length && (r = n(l.renderGroup({ + group: o + })).appendTo(i)), e || n.isArray(t) ? u = n(n.map(e ? [t] : t, function(t, i) { + return typeof t == "string" ? n(t).get() : n(l.renderItem({ + group: o, + item: f(t, { + index: i + }) + })).get() + })) : (u = n(t), s = u.find("> ul").addClass("k-group").attr("role", "menu"), u = u.filter("li"), u.add(s.find("> li")).each(function() { + oi(this) + })), { + items: u, + group: r + } + }, + remove: function(n) { + var r; + n = this.element.find(n); + var u = this, + t = n.parentsUntil(u.element, p), + i = n.parent("ul:not(.k-menu)"); + return n.remove(), i && !i.children(p).length && (r = i.parent(".k-animation-container"), r.length ? r.remove() : i.remove()), t.length && (t = t.eq(0), b(t), c(t)), u + }, + open: function(r) { + var u = this, + e = u.options, + s = e.orientation == "horizontal", + o = e.direction, + c = i.support.isRtl(u.wrapper); + return r = u.element.find(r), /^(top|bottom|default)$/.test(o) && (o = c ? s ? (o + " left").replace("default", "bottom") : "left" : s ? (o + " right").replace("default", "bottom") : "right"), r.siblings().find(">.k-popup:visible,>.k-animation-container>.k-popup:visible").each(function() { + var t = n(this).data("kendoPopup"); + t && t.close() + }), r.each(function() { + var i = n(this); + clearTimeout(i.data(tt)); + i.data(tt, setTimeout(function() { + var r = i.find(".k-group:first:hidden"), + l; + if (r[0] && u.trigger(ht, { + item: i[0] + }) === !1) { + !r.find(".k-group")[0] && r.children(".k-item").length > 1 ? setTimeout(function() { + r.css({ + maxHeight: n(window).height(), + overflow: "auto" + }) + }) : r.css({ + maxHeight: "", + overflow: "" + }); + i.data(a, i.css(a)); + i.css(a, u.nextItemZIndex++); + l = r.data(ut); + var y = i.parent().hasClass(h), + b = y && s, + v = pi(o, y, c), + p = e.animation.open.effects, + w = p !== t ? p : "slideIn:" + yi(o, y); + l ? (l = r.data(ut), l.options.origin = v.origin, l.options.position = v.position, l.options.animation.open.effects = w) : l = r.kendoPopup({ + activate: function() { + u.trigger(gt, { + item: this.wrapper.parent() + }) + }, + deactivate: function() { + u.trigger(ni, { + item: this.wrapper.parent() + }) + }, + origin: v.origin, + position: v.position, + collision: e.popupCollision !== t ? e.popupCollision : b ? "fit" : "fit flip", + anchor: i, + appendTo: i, + animation: { + open: f(!0, { + effects: w + }, e.animation.open), + close: e.animation.close + }, + close: function(n) { + var t = n.sender.wrapper.parent(); + u.trigger(nt, { + item: t[0] + }) ? n.preventDefault() : (t.css(a, t.data(a)), t.removeData(a), ri && (t.removeClass(lt), u._removeHoverItem())) + } + }).data(ut); + r.removeAttr("aria-hidden"); + l.open() + } + }, u.options.hoverDelay)) + }), u + }, + close: function(t) { + var i = this, + r = i.element; + return t = r.find(t), t.length || (t = r.find(">.k-item")), t.each(function() { + var t = n(this); + i._isRootItem(t) && (i.clicked = !1); + clearTimeout(t.data(tt)); + t.data(tt, setTimeout(function() { + var n = t.find(".k-group:not(.k-list-container):not(.k-calendar-container):first:visible").data(ut); + n && (n.close(), n.element.attr("aria-hidden", !0)) + }, i.options.hoverDelay)) + }), i + }, + _toggleDisabled: function(t, i) { + this.element.find(t).each(function() { + n(this).toggleClass(ui, i).toggleClass(y, !i).attr("aria-disabled", !i) + }) + }, + _toggleHover: function(t) { + var r = n(i.eventTarget(t) || t.target).closest(p), + u = t.type == ct || et.indexOf(t.type) !== -1; + r.parents("li." + y).length || r.toggleClass(lt, u || t.type == "mousedown" || t.type == "click"); + this._removeHoverItem() + }, + _preventClose: function() { + this.options.closeOnClick || (this._closurePrevented = !0) + }, + _checkActiveElement: function(t) { + var u = this, + f = n(t ? t.currentTarget : this._hoverItem()), + r = u._findRootParent(f)[0]; + this._closurePrevented || setTimeout(function() { + document.hasFocus() && (d(r, i._activeElement()) || !t || d(r, t.currentTarget)) || u.close(r) + }, 0); + this._closurePrevented = !1 + }, + _removeHoverItem: function() { + var n = this._hoverItem(); + n && n.hasClass(v) && (n.removeClass(v), this._oldHoverItem = null) + }, + _updateClasses: function() { + var n = this.element, + t; + n.addClass("k-widget k-reset k-header " + h).addClass(h + "-" + this.options.orientation); + n.find("li > ul").addClass("k-group").attr("role", "menu").attr("aria-hidden", n.is(":visible")).end().find("li > div").addClass("k-content").attr("tabindex", "-1"); + t = n.find("> li,.k-group > li"); + t.each(function() { + oi(this) + }) + }, + _mouseenter: function(t) { + var i = this, + r = n(t.currentTarget), + f = r.children(".k-animation-container").length || r.children(at).length; + t.delegateTarget == r.parents(".k-menu")[0] && (i.options.openOnClick && !i.clicked || ft || !d(t.currentTarget, t.relatedTarget) && f && i.open(r), (i.options.openOnClick && i.clicked || ri) && r.siblings().each(u(function(n, t) { + i.close(t) + }, i))) + }, + _mouseleave: function(t) { + var r = this, + i = n(t.currentTarget), + u = i.children(".k-animation-container").length || i.children(at).length; + if (i.parentsUntil(".k-animation-container", ".k-list-container,.k-calendar-container")[0]) { + t.stopImmediatePropagation(); + return + } + r.options.openOnClick || ft || (it || rt) && t.originalEvent.pointerType == t.originalEvent.MSPOINTER_TYPE_TOUCH || d(t.currentTarget, t.relatedTarget || t.target) || !u || r.close(i) + }, + _click: function(t) { + var r = this, + c, f = r.options, + e = n(i.eventTarget(t)), + o = e[0] ? e[0].nodeName.toUpperCase() : "", + v = o == "INPUT" || o == "SELECT" || o == "BUTTON" || o == "LABEL", + l = e.closest("." + k), + u = e.closest(p), + w = l.attr("href"), + s, b, a = !!w && w !== n("<a href='#' />").attr("href"); + if (!u.children(vi)[0]) { + if (u.hasClass(y)) { + t.preventDefault(); + return + } + if (t.handled || !r.trigger(dt, { + item: u[0] + }) || v || t.preventDefault(), t.handled = !0, s = u.children(at + ",.k-animation-container"), b = s.is(":visible"), f.closeOnClick && !a && (!s.length || f.openOnClick && b)) { + u.removeClass(lt).css("height"); + r._oldHoverItem = r._findRootParent(u); + r.close(l.parentsUntil(r.element, p)); + r.clicked = !1; + "MSPointerUp".indexOf(t.type) != -1 && t.preventDefault(); + return + }(a && t.enterKey && l[0].click(), u.parent().hasClass(h) && f.openOnClick || i.support.touch) && (a || v || t.preventDefault(), r.clicked = !0, c = s.is(":visible") ? nt : ht, f.closeOnClick || c != nt) && r[c](u) + } + }, + _documentClick: function(n) { + d(this.element[0], n.target) || (this.clicked = !1) + }, + _focus: function(t) { + var i = this, + r = t.target, + u = i._hoverItem(), + f = hi(); + if (r != i.wrapper[0] && !n(r).is(":kendoFocusable")) { + t.stopPropagation(); + n(r).closest(".k-content").closest(".k-group").closest(".k-item").addClass(v); + i.wrapper.focus(); + return + } + f === t.currentTarget && (u.length ? i._moveHover([], u) : i._oldHoverItem || i._moveHover([], i.wrapper.children().first())) + }, + _keydown: function(n) { + var t = this, + f = n.keyCode, + r = t._oldHoverItem, + u, o, s, h = i.support.isRtl(t.wrapper); + if (n.target == n.currentTarget || f == e.ESC) { + if (r || (r = t._oldHoverItem = t._hoverItem()), o = t._itemBelongsToVertival(r), s = t._itemHasChildren(r), f == e.RIGHT) u = t[h ? "_itemLeft" : "_itemRight"](r, o, s); + else if (f == e.LEFT) u = t[h ? "_itemRight" : "_itemLeft"](r, o, s); + else if (f == e.DOWN) u = t._itemDown(r, o, s); + else if (f == e.UP) u = t._itemUp(r, o, s); + else if (f == e.ESC) u = t._itemEsc(r, o); + else if (f == e.ENTER || f == e.SPACEBAR) u = r.children(".k-link"), u.length > 0 && (t._click({ + target: u[0], + preventDefault: function() {}, + enterKey: !0 + }), t._moveHover(r, t._findRootParent(r))); + else if (f == e.TAB) { + u = t._findRootParent(r); + t._moveHover(r, u); + t._checkActiveElement(); + return + } + u && u[0] && (n.preventDefault(), n.stopPropagation()) + } + }, + _hoverItem: function() { + return this.wrapper.find(".k-item.k-state-hover,.k-item.k-state-focused").filter(":visible") + }, + _itemBelongsToVertival: function(n) { + var t = this.wrapper.hasClass("k-menu-vertical"); + return n.length ? n.parent().hasClass("k-group") || t : t + }, + _itemHasChildren: function(n) { + return n.length ? n.children("ul.k-group, div.k-animation-container").length > 0 : !1 + }, + _moveHover: function(n, t) { + var r = this, + i = r._ariaId; + n.length && t.length && (n.removeClass(v), n[0].id === i && n.removeAttr("id")); + t.length && (t[0].id && (i = t[0].id), t.addClass(v), r._oldHoverItem = t, i && (r.element.removeAttr("aria-activedescendant"), t.attr("id", i), r.element.attr("aria-activedescendant", i))) + }, + _findRootParent: function(n) { + return n.parent().hasClass("k-menu") ? n : n.parentsUntil(".k-menu", "li.k-item").last() + }, + _isRootItem: function(n) { + return n.parent().hasClass("k-menu") + }, + _itemRight: function(n, t, i) { + var u = this, + r, f; + if (!n.hasClass(y)) return t ? i ? (u.open(n), r = n.find(".k-group").children().first()) : u.options.orientation == "horizontal" && (f = u._findRootParent(n), u.close(f), r = f.nextAll(w)) : (r = n.nextAll(w), r.length || (r = n.prevAll(ei))), r && !r.length ? r = u.wrapper.children(".k-item").first() : r || (r = []), u._moveHover(n, r), r + }, + _itemLeft: function(n, t) { + var r = this, + i; + return t ? (i = n.parent().closest(".k-item"), r.close(i), r._isRootItem(i) && r.options.orientation == "horizontal" && (i = i.prevAll(w))) : (i = n.prevAll(w), i.length || (i = n.nextAll(ei))), i.length || (i = r.wrapper.children(".k-item").last()), r._moveHover(n, i), i + }, + _itemDown: function(n, t, i) { + var u = this, + r; + if (t) r = n.nextAll(w); + else { + if (!i || n.hasClass(y)) return; + u.open(n); + r = n.find(".k-group").children().first() + } + return !r.length && n.length ? r = n.parent().children().first() : n.length || (r = u.wrapper.children(".k-item").first()), u._moveHover(n, r), r + }, + _itemUp: function(n, t) { + var r = this, + i; + if (t) i = n.prevAll(w); + else return; + return !i.length && n.length ? i = n.parent().children().last() : n.length || (i = r.wrapper.children(".k-item").last()), r._moveHover(n, i), i + }, + _itemEsc: function(n, t) { + var r = this, + i; + if (t) i = n.parent().closest(".k-item"), r.close(i), r._moveHover(n, i); + else return n; + return i + }, + _focusHandler: function(t) { + var u = this, + r = n(i.eventTarget(t)).closest(p); + setTimeout(function() { + u._moveHover([], r); + r.children(".k-content")[0] && r.parent().closest(".k-item").removeClass(v) + }, 200) + }, + _animations: function(n) { + n && "animation" in n && !n.animation && (n.animation = { + open: { + effects: {} + }, + close: { + hide: !0, + effects: {} + } + }) + } + }); + f(l, { + renderItem: function(n) { + n = f({ + menu: {}, + group: {} + }, n); + var i = s.empty, + t = n.item; + return s.item(f(n, { + image: t.imageUrl ? s.image : i, + sprite: t.spriteCssClass ? s.sprite : i, + itemWrapper: s.itemWrapper, + renderContent: l.renderContent, + arrow: t.items || t.content ? s.arrow : i, + subGroup: l.renderGroup + }, yt)) + }, + renderGroup: function(n) { + return s.group(f({ + renderItems: function(n) { + for (var r = "", t = 0, i = n.items, u = i ? i.length : 0, e = f({ + length: u + }, n.group); t < u; t++) r += l.renderItem(f(n, { + group: e, + item: f({ + index: t + }, i[t]) + })); + return r + } + }, n, yt)) + }, + renderContent: function(n) { + return s.content(f(n, yt)) + } + }); + i.ui.plugin(l) + }(window.kendo.jQuery); +kendo_module({ + id: "filtermenu", + name: "Filtering Menu", + category: "framework", + depends: ["datepicker", "numerictextbox", "dropdownlist"], + advanced: !0 + }), + function(n) { + function c(t, i) { + t.filters && (t.filters = n.grep(t.filters, function(n) { + return c(n, i), n.filters ? n.filters.length : n.field != i + })) + } + + function l(n) { + var i, u, t, f, e, r; + if (n && n.length) + for (r = [], i = 0, u = n.length; i < u; i++) t = n[i], e = t.text || t.value || t, f = t.value == null ? t.text || t : t.value, r[i] = { + text: e, + value: f + }; + return r + } + + function d(t, i) { + return n.grep(t, function(t) { + return t.filters ? (t.filters = n.grep(t.filters, function(n) { + return n.field != i + }), t.filters.length) : t.field != i + }) + } + var t = window.kendo, + s = t.ui, + i = n.proxy, + u = "kendoPopup", + h = "init", + r = ".kendoFilterMenu", + f = "Is equal to", + e = "Is not equal to", + a = { + number: "numerictextbox", + date: "datepicker" + }, + v = { + string: "text", + number: "number", + date: "date" + }, + y = t.isFunction, + o = s.Widget, + p = '<div><div class="k-filter-help-text">#=messages.info#<\/div><label><input type="radio" data-#=ns#bind="checked: filters[0].value" value="true" name="filters[0].value"/>#=messages.isTrue#<\/label><label><input type="radio" data-#=ns#bind="checked: filters[0].value" value="false" name="filters[0].value"/>#=messages.isFalse#<\/label><div><button type="submit" class="k-button">#=messages.filter#<\/button><button type="reset" class="k-button">#=messages.clear#<\/button><\/div><\/div>', + w = '<div><div class="k-filter-help-text">#=messages.info#<\/div><select data-#=ns#bind="value: filters[0].operator" data-#=ns#role="dropdownlist">#for(var op in operators){#<option value="#=op#">#=operators[op]#<\/option>#}#<\/select>#if(values){#<select data-#=ns#bind="value:filters[0].value" data-#=ns#text-field="text" data-#=ns#value-field="value" data-#=ns#source=\'#=kendo.stringify(values).replace(/\'/g,"&\\#39;")#\' data-#=ns#role="dropdownlist" data-#=ns#option-label="#=messages.selectValue#"><\/select>#}else{#<input data-#=ns#bind="value:filters[0].value" class="k-textbox" type="text" #=role ? "data-" + ns + "role=\'" + role + "\'" : ""# />#}##if(extra){#<select class="k-filter-and" data-#=ns#bind="value: logic" data-#=ns#role="dropdownlist"><option value="and">#=messages.and#<\/option><option value="or">#=messages.or#<\/option><\/select><select data-#=ns#bind="value: filters[1].operator" data-#=ns#role="dropdownlist">#for(var op in operators){#<option value="#=op#">#=operators[op]#<\/option>#}#<\/select>#if(values){#<select data-#=ns#bind="value:filters[1].value" data-#=ns#text-field="text" data-#=ns#value-field="value" data-#=ns#source=\'#=kendo.stringify(values).replace(/\'/g,"&\\#39;")#\' data-#=ns#role="dropdownlist" data-#=ns#option-label="#=messages.selectValue#"><\/select>#}else{#<input data-#=ns#bind="value: filters[1].value" class="k-textbox" type="text" #=role ? "data-" + ns + "role=\'" + role + "\'" : ""#/>#}##}#<div><button type="submit" class="k-button">#=messages.filter#<\/button><button type="reset" class="k-button">#=messages.clear#<\/button><\/div><\/div>', + b = '<div data-#=ns#role="view" data-#=ns#init-widgets="false" class="k-grid-filter-menu"><div data-#=ns#role="header" class="k-header"><button class="k-button k-cancel">#=messages.cancel#<\/button>#=field#<button type="submit" class="k-button k-submit">#=messages.filter#<\/button><\/div><form class="k-filter-menu k-mobile-list k-secondary"><ul class="k-filter-help-text"><li><span class="k-link">#=messages.info#<\/span><ul><li class="k-item"><label class="k-label">#=messages.operator#<select data-#=ns#bind="value: filters[0].operator">#for(var op in operators){#<option value="#=op#">#=operators[op]#<\/option>#}#<\/select><\/label><\/li><li class="k-item"><label class="k-label">#=messages.value##if(values){#<select data-#=ns#bind="value:filters[0].value"><option value="">#=messages.selectValue#<\/option>#for(var val in values){#<option value="#=values[val].value#">#=values[val].text#<\/option>#}#<\/select>#}else{#<input data-#=ns#bind="value:filters[0].value" class="k-textbox" type="#=inputType#" #=useRole ? "data-" + ns + "role=\'" + role + "\'" : ""# />#}#<\/label><\/li>#if(extra){#<\/ul><ul class="k-filter-help-text"><li><span class="k-link"><\/span><li class="k-item"><label class="k-label"><input type="radio" name="logic" class="k-check" data-#=ns#bind="checked: logic" value="and" />#=messages.and#<\/label><\/li><li class="k-item"><label class="k-label"><input type="radio" name="logic" class="k-check" data-#=ns#bind="checked: logic" value="or" />#=messages.or#<\/label><\/li><\/ul><ul class="k-filter-help-text"><li><span class="k-link"><\/span><li class="k-item"><label class="k-label">#=messages.operator#<select data-#=ns#bind="value: filters[1].operator">#for(var op in operators){#<option value="#=op#">#=operators[op]#<\/option>#}#<\/select><\/label><\/li><li class="k-item"><label class="k-label">#=messages.value##if(values){#<select data-#=ns#bind="value:filters[1].value"><option value="">#=messages.selectValue#<\/option>#for(var val in values){#<option value="#=values[val].value#">#=values[val].text#<\/option>#}#<\/select>#}else{#<input data-#=ns#bind="value:filters[1].value" class="k-textbox" type="#=inputType#" #=useRole ? "data-" + ns + "role=\'" + role + "\'" : ""# />#}#<\/label><\/li>#}#<\/ul><\/li><li class="k-button-container"><button type="reset" class="k-button">#=messages.clear#<\/button><\/li><\/ul><\/div><\/form><\/div>', + k = '<div data-#=ns#role="view" data-#=ns#init-widgets="false" class="k-grid-filter-menu"><div data-#=ns#role="header" class="k-header"><button class="k-button k-cancel">#=messages.cancel#<\/button>#=field#<button type="submit" class="k-button k-submit">#=messages.filter#<\/button><\/div><form class="k-filter-menu k-mobile-list k-secondary"><ul class="k-filter-help-text"><li><span class="k-link">#=messages.info#<\/span><ul><li class="k-item"><label class="k-label"><input class="k-check" type="radio" data-#=ns#bind="checked: filters[0].value" value="true" name="filters[0].value"/>#=messages.isTrue#<\/label><\/li><li class="k-item"><label class="k-label"><input class="k-check" type="radio" data-#=ns#bind="checked: filters[0].value" value="false" name="filters[0].value"/>#=messages.isFalse#<\/label><\/li><\/ul><\/li><li class="k-button-container"><button type="reset" class="k-button">#=messages.clear#<\/button><\/li><\/ul><\/form><\/div>', + g = o.extend({ + init: function(u, f) { + var e = this, + h = "string", + l, a, c, s; + if (o.fn.init.call(e, u, f), l = e.operators = f.operators || {}, u = e.element, f = e.options, !f.appendToElement) { + c = u.addClass("k-with-icon k-filterable").find(".k-grid-filter"); + c[0] || (c = u.prepend('<a class="k-grid-filter" href="#"><span class="k-icon k-filter"/><\/a>').find(".k-grid-filter")); + c.attr("tabindex", -1).on("click" + r, i(e._click, e)) + } + e.link = c || n(); + e.dataSource = f.dataSource; + e.field = f.field || u.attr(t.attr("field")); + e.model = e.dataSource.reader.model; + e._parse = function(n) { + return n + "" + }; + e.model && e.model.fields && (s = e.model.fields[e.field], s && (h = s.type || "string", s.parse && (e._parse = i(s.parse, s)))); + f.values && (h = "enums"); + e.type = h; + l = l[h] || f.operators[h]; + for (a in l) break; + e._defaultFilter = function() { + return { + field: e.field, + operator: a || "eq", + value: "" + } + }; + e._refreshHandler = i(e.refresh, e); + e.dataSource.bind("change", e._refreshHandler); + f.appendToElement ? e._init() : e.refresh() + }, + _init: function() { + var u = this, + f = u.options.ui, + o = y(f), + e; + u.pane = u.options.pane; + u.pane && (u._isMobile = !0); + o || (e = f || a[u.type]); + u._isMobile ? u._createMobileForm(e) : u._createForm(e); + u.form.on("submit" + r, i(u._submit, u)).on("reset" + r, i(u._reset, u)); + o && u.form.find(".k-textbox").removeClass("k-textbox").each(function() { + f(n(this)) + }); + u.form.find("[" + t.attr("role") + "=numerictextbox]").removeClass("k-textbox").end().find("[" + t.attr("role") + "=datetimepicker]").removeClass("k-textbox").end().find("[" + t.attr("role") + "=timepicker]").removeClass("k-textbox").end().find("[" + t.attr("role") + "=datepicker]").removeClass("k-textbox"); + u.refresh(); + u.trigger(h, { + field: u.field, + container: u.form + }) + }, + _createForm: function(f) { + var e = this, + o = e.options, + h = e.operators || {}, + s = e.type; + h = h[s] || o.operators[s]; + e.form = n('<form class="k-filter-menu k-secondary"/>').html(t.template(s === "boolean" ? p : w)({ + field: e.field, + format: o.format, + ns: t.ns, + messages: o.messages, + extra: o.extra, + operators: h, + type: s, + role: f, + values: l(o.values) + })); + o.appendToElement ? (e.element.append(e.form), e.popup = e.element.closest(".k-popup").data(u)) : e.popup = e.form[u]({ + anchor: e.link, + open: i(e._open, e), + activate: i(e._activate, e), + close: e.options.closeCallback + }).data(u); + e.form.on("keydown" + r, i(e._keydown, e)) + }, + _createMobileForm: function(i) { + var r = this, + f = r.options, + e = r.operators || {}, + u = r.type; + e = e[u] || f.operators[u]; + r.form = n("<div />").html(t.template(u === "boolean" ? k : b)({ + field: r.field, + format: f.format, + ns: t.ns, + messages: f.messages, + extra: f.extra, + operators: e, + type: u, + role: i, + useRole: !t.support.input.date && u === "date" || u === "number", + inputType: v[u], + values: l(f.values) + })); + r.view = r.pane.append(r.form.html()); + r.form = r.view.element.find("form"); + r.view.element.on("click", ".k-submit", function(n) { + r.form.submit(); + n.preventDefault() + }).on("click", ".k-cancel", function(n) { + r._closeForm(); + n.preventDefault() + }) + }, + refresh: function() { + var n = this, + i = n.dataSource.filter() || { + filters: [], + logic: "and" + }; + n.filterModel = t.observable({ + logic: "and", + filters: [n._defaultFilter(), n._defaultFilter()] + }); + n.form && t.bind(n.form.children().first(), n.filterModel); + n._bind(i) ? n.link.addClass("k-state-active") : n.link.removeClass("k-state-active") + }, + destroy: function() { + var n = this; + o.fn.destroy.call(n); + n.form && (t.unbind(n.form), t.destroy(n.form), n.form.unbind(r), n.popup && n.popup.destroy()); + n.view && n.view.purge(); + n.link.unbind(r); + n._refreshHandler && n.dataSource.unbind("change", n._refreshHandler) + }, + _bind: function(n) { + for (var i = this, s = n.filters, f = !1, o = 0, e = i.filterModel, r, t, u = 0, h = s.length; u < h; u++) t = s[u], t.field == i.field ? (e.set("logic", n.logic), r = e.filters[o], r || (e.filters.push({ + field: i.field + }), r = e.filters[o]), r.set("value", i._parse(t.value)), r.set("operator", t.operator), o++, f = !0) : t.filters && (f = f || i._bind(t)); + return f + }, + _merge: function(t) { + var f = this, + s = t.logic || "and", + r = t.filters, + e, i = f.dataSource.filter() || { + filters: [], + logic: "and" + }, + u, o; + for (c(i, f.field), r = n.grep(r, function(n) { + return n.value !== "" && n.value != null + }), u = 0, o = r.length; u < o; u++) e = r[u], e.value = f._parse(e.value); + return r.length && (i.filters.length ? (t.filters = r, i.logic !== "and" && (i.filters = [{ + logic: i.logic, + filters: i.filters + }], i.logic = "and"), r.length > 1 ? i.filters.push(t) : i.filters.push(r[0])) : (i.filters = r, i.logic = s)), i + }, + filter: function(n) { + n = this._merge(n); + n.filters.length && this.dataSource.filter(n) + }, + clear: function() { + var i = this, + t = i.dataSource.filter() || { + filters: [] + }; + t.filters = n.grep(t.filters, function(n) { + return n.filters ? (n.filters = d(n.filters, i.field), n.filters.length) : n.field != i.field + }); + t.filters.length || (t = null); + i.dataSource.filter(t) + }, + _submit: function(n) { + n.preventDefault(); + n.stopPropagation(); + this.filter(this.filterModel.toJSON()); + this._closeForm() + }, + _reset: function() { + this.clear(); + this._closeForm() + }, + _closeForm: function() { + this._isMobile ? this.pane.navigate("", this.options.animations.right) : this.popup.close() + }, + _click: function(n) { + n.preventDefault(); + n.stopPropagation(); + this.popup || this.pane || this._init(); + this._isMobile ? this.pane.navigate(this.view, this.options.animations.left) : this.popup.toggle() + }, + _open: function() { + var t; + n(".k-filter-menu").not(this.form).each(function() { + t = n(this).data(u); + t && t.close() + }) + }, + _activate: function() { + this.form.find(":kendoFocusable:first").focus() + }, + _keydown: function(n) { + n.keyCode == t.keys.ESC && this.popup.close() + }, + events: [h], + options: { + name: "FilterMenu", + extra: !0, + appendToElement: !1, + type: "string", + operators: { + string: { + eq: f, + neq: e, + startswith: "Starts with", + contains: "Contains", + doesnotcontain: "Does not contain", + endswith: "Ends with" + }, + number: { + eq: f, + neq: e, + gte: "Is greater than or equal to", + gt: "Is greater than", + lte: "Is less than or equal to", + lt: "Is less than" + }, + date: { + eq: f, + neq: e, + gte: "Is after or equal to", + gt: "Is after", + lte: "Is before or equal to", + lt: "Is before" + }, + enums: { + eq: f, + neq: e + } + }, + messages: { + info: "Show items with value that:", + isTrue: "is true", + isFalse: "is false", + filter: "Filter", + clear: "Clear", + and: "And", + or: "Or", + selectValue: "-Select value-", + operator: "Operator", + value: "Value", + cancel: "Cancel" + }, + animations: { + left: "slide", + right: "slide:right" + } + } + }); + s.plugin(g) + }(window.kendo.jQuery); +kendo_module({ + id: "panelbar", + name: "PanelBar", + category: "web", + description: "The PanelBar widget displays hierarchical data as a multi-level expandable panel bar.", + depends: ["core"] + }), + function(n, t) { + function wt(t) { + t = n(t); + t.children(r).children(".k-icon").remove(); + t.filter(":has(.k-panel),:has(.k-content)").children(".k-link:not(:has([class*=k-i-arrow]))").each(function() { + var t = n(this), + i = t.parent(); + t.append("<span class='k-icon " + (i.hasClass(w) ? "k-i-arrow-n k-panelbar-collapse" : "k-i-arrow-s k-panelbar-expand") + "'/>") + }) + } + + function a(t) { + t = n(t); + t.filter(".k-first:not(:first-child)").removeClass(ct); + t.filter(".k-last:not(:last-child)").removeClass(ht); + t.filter(":first-child").addClass(ct); + t.filter(":last-child").addClass(ht) + } + var e = window.kendo, + oi = e.ui, + o = e.keys, + i = n.extend, + ot = n.each, + s = e.template, + nt = oi.Widget, + si = /^(ul|a|div)$/i, + h = ".kendoPanelBar", + bt = "img", + st = "href", + ht = "k-last", + tt = "k-link", + r = "." + tt, + kt = "error", + u = ".k-item", + b = ".k-group:visible", + dt = "k-image", + ct = "k-first", + lt = "expand", + at = "select", + it = "k-content", + gt = "activate", + rt = "collapse", + ni = "mouseenter", + hi = "mouseleave", + ti = "contentLoad", + w = "k-state-active", + v = "> .k-panel", + k = "> .k-content", + ii = "k-state-focused", + f = "k-state-disabled", + d = "k-state-selected", + ut = "." + d, + c = "k-state-highlight", + ft = u + ":not(.k-state-disabled)", + ri = ft + " > .k-link", + ci = u + ".k-state-disabled > .k-link", + ui = "> li > " + ut + ", .k-panel > li > " + ut, + fi = "k-state-default", + vt = "aria-disabled", + g = "aria-expanded", + yt = "aria-hidden", + et = "aria-selected", + y = ":visible", + li = ":empty", + ei = "single", + l = { + content: s("<div role='region' class='k-content'#= contentAttributes(data) #>#= content(item) #<\/div>"), + group: s("<ul role='group' aria-hidden='true' class='#= groupCssClass(group) #'#= groupAttributes(group) #>#= renderItems(data) #<\/ul>"), + itemWrapper: s("<#= tag(item) # class='#= textClass(item, group) #' #= contentUrl(item) ##= textAttributes(item) #>#= image(item) ##= sprite(item) ##= text(item) ##= arrow(data) #<\/#= tag(item) #>"), + item: s("<li role='menuitem' #=aria(item)#class='#= wrapperCssClass(group, item) #'>#= itemWrapper(data) ## if (item.items) { ##= subGroup({ items: item.items, panelBar: panelBar, group: { expanded: item.expanded } }) ## } else if (item.content || item.contentUrl) { ##= renderContent(data) ## } #<\/li>"), + image: s("<img class='k-image' alt='' src='#= imageUrl #' />"), + arrow: s("<span class='#= arrowClass(item) #'><\/span>"), + sprite: s("<span class='k-sprite #= spriteCssClass #'><\/span>"), + empty: s("") + }, + pt = { + aria: function(n) { + var t = ""; + return (n.items || n.content || n.contentUrl) && (t += g + "='" + (n.expanded ? "true" : "false") + "' "), n.enabled === !1 && (t += vt + "='true'"), t + }, + wrapperCssClass: function(n, t) { + var i = "k-item", + r = t.index; + return i += t.enabled === !1 ? " " + f : t.expanded === !0 ? " " + w : " k-state-default", r === 0 && (i += " k-first"), r == n.length - 1 && (i += " k-last"), t.cssClass && (i += " " + t.cssClass), i + }, + textClass: function(n, t) { + var i = tt; + return t.firstLevel && (i += " k-header"), i + }, + textAttributes: function(n) { + return n.url ? " href='" + n.url + "'" : "" + }, + arrowClass: function(n) { + return "k-icon" + (n.expanded ? " k-i-arrow-n k-panelbar-collapse" : " k-i-arrow-s k-panelbar-expand") + }, + text: function(n) { + return n.encoded === !1 ? n.text : e.htmlEncode(n.text) + }, + tag: function(n) { + return n.url || n.contentUrl ? "a" : "span" + }, + groupAttributes: function(n) { + return n.expanded !== !0 ? " style='display:none'" : "" + }, + groupCssClass: function() { + return "k-group k-panel" + }, + contentAttributes: function(n) { + return n.item.expanded !== !0 ? " style='display:none'" : "" + }, + content: function(n) { + return n.content ? n.content : n.contentUrl ? "" : " " + }, + contentUrl: function(n) { + return n.contentUrl ? 'href="' + n.contentUrl + '"' : "" + } + }, + p = nt.extend({ + init: function(t, i) { + var r = this, + u; + nt.fn.init.call(r, t, i); + t = r.wrapper = r.element.addClass("k-widget k-reset k-header k-panelbar"); + i = r.options; + t[0].id && (r._itemId = t[0].id + "_pb_active"); + r._tabindex(); + r._initData(i); + r._updateClasses(); + r._animations(i); + t.on("click" + h, ri, function(t) { + r._click(n(t.currentTarget)) && t.preventDefault() + }).on(ni + h + " " + hi + h, ri, r._toggleHover).on("click" + h, ci, !1).on("keydown" + h, n.proxy(r._keydown, r)).on("focus" + h, function() { + var n = r.select(); + r._current(n[0] ? n : r._first()) + }).on("blur" + h, function() { + r._current(null) + }).attr("role", "menu"); + u = t.find("li." + w + " > ." + it); + u[0] && r.expand(u.parent(), !1); + e.notify(r) + }, + events: [lt, rt, at, gt, kt, ti], + options: { + name: "PanelBar", + animation: { + expand: { + effects: "expand:vertical", + duration: 200 + }, + collapse: { + duration: 200 + } + }, + expandMode: "multiple" + }, + destroy: function() { + nt.fn.destroy.call(this); + this.element.off(h); + e.destroy(this.element) + }, + _initData: function(n) { + var t = this; + n.dataSource && (t.element.empty(), t.append(n.dataSource, t.element)) + }, + setOptions: function(n) { + var t = this.options.animation; + this._animations(n); + n.animation = i(!0, t, n.animation); + "dataSource" in n && this._initData(n); + nt.fn.setOptions.call(this, n) + }, + expand: function(t, i) { + var r = this, + u = {}; + return i = i !== !1, t = this.element.find(t), t.each(function(e, o) { + o = n(o); + var s = o.find(v).add(o.find(k)); + if (!o.hasClass(f) && s.length > 0) { + if (r.options.expandMode == ei && r._collapseAllExpanded(o)) return r; + t.find("." + c).removeClass(c); + o.addClass(c); + i || (u = r.options.animation, r.options.animation = { + expand: { + effects: {} + }, + collapse: { + hide: !0, + effects: {} + } + }); + r._triggerEvent(lt, o) || r._toggleItem(o, !1); + i || (r.options.animation = u) + } + }), r + }, + collapse: function(t, i) { + var r = this, + u = {}; + return i = i !== !1, t = r.element.find(t), t.each(function(t, e) { + e = n(e); + var o = e.find(v).add(e.find(k)); + !e.hasClass(f) && o.is(y) && (e.removeClass(c), i || (u = r.options.animation, r.options.animation = { + expand: { + effects: {} + }, + collapse: { + hide: !0, + effects: {} + } + }), r._triggerEvent(rt, e) || r._toggleItem(e, !0), i || (r.options.animation = u)) + }), r + }, + _toggleDisabled: function(n, t) { + n = this.element.find(n); + n.toggleClass(fi, t).toggleClass(f, !t).attr(vt, !t) + }, + select: function(i) { + var u = this; + return i === t ? u.element.find(ui).parent() : (u.element.find(i).each(function() { + var t = n(this), + i = t.children(r); + if (t.hasClass(f)) return u; + u._triggerEvent(at, t) || u._updateSelected(i) + }), u) + }, + enable: function(n, t) { + return this._toggleDisabled(n, t !== !1), this + }, + disable: function(n) { + return this._toggleDisabled(n, !1), this + }, + append: function(n, t) { + t = this.element.find(t); + var i = this._insert(n, t, t.length ? t.find(v) : null); + return ot(i.items, function() { + i.group.append(this); + a(this) + }), wt(t), a(i.group.find(".k-first, .k-last")), i.group.height("auto"), this + }, + insertBefore: function(n, t) { + t = this.element.find(t); + var i = this._insert(n, t, t.parent()); + return ot(i.items, function() { + t.before(this); + a(this) + }), a(t), i.group.height("auto"), this + }, + insertAfter: function(n, t) { + t = this.element.find(t); + var i = this._insert(n, t, t.parent()); + return ot(i.items, function() { + t.after(this); + a(this) + }), a(t), i.group.height("auto"), this + }, + remove: function(n) { + n = this.element.find(n); + var r = this, + t = n.parentsUntil(r.element, u), + i = n.parent("ul"); + return n.remove(), !i || i.hasClass("k-panelbar") || i.children(u).length || i.remove(), t.length && (t = t.eq(0), wt(t), a(t)), r + }, + reload: function(t) { + var i = this; + t = i.element.find(t); + t.each(function() { + var t = n(this); + i._ajaxRequest(t, t.children("." + it), !t.is(y)) + }) + }, + _first: function() { + return this.element.children(ft).first() + }, + _last: function() { + var n = this.element.children(ft).last(), + t = n.children(b); + return t[0] ? t.children(ft).last() : n + }, + _current: function(n) { + var i = this, + u = i._focused, + f = i._itemId; + if (n === t) return u; + i.element.removeAttr("aria-activedescendant"); + u && (u[0].id === f && u.removeAttr("id"), u.children(r).removeClass(ii)); + n && (f = n[0].id || f, n.attr("id", f).children(r).addClass(ii), i.element.attr("aria-activedescendant", f)); + i._focused = n + }, + _keydown: function(n) { + var t = this, + i = n.keyCode, + u = t._current(); + n.target == n.currentTarget && (i == o.DOWN || i == o.RIGHT ? (t._current(t._nextItem(u)), n.preventDefault()) : i == o.UP || i == o.LEFT ? (t._current(t._prevItem(u)), n.preventDefault()) : i == o.ENTER || i == o.SPACEBAR ? (t._click(u.children(r)), n.preventDefault()) : i == o.HOME ? (t._current(t._first()), n.preventDefault()) : i == o.END && (t._current(t._last()), n.preventDefault())) + }, + _nextItem: function(n) { + if (!n) return this._first(); + var i = n.children(b), + t = n.next(); + return i[0] && (t = i.children("." + ct)), t[0] || (t = n.parent(b).parent(u).next()), t[0] && t.is(":visible") || (t = this._first()), t.hasClass(f) && (t = this._nextItem(t)), t + }, + _prevItem: function(n) { + if (!n) return this._last(); + var t = n.prev(), + i; + if (t[0]) + for (i = t; i[0];) i = i.children(b).children("." + ht), i[0] && (t = i); + else t = n.parent(b).parent(u), t[0] || (t = this._last()); + return t.hasClass(f) && (t = this._prevItem(t)), t + }, + _insert: function(t, r, u) { + var s = this, + f, h = n.isPlainObject(t), + e = r && r[0], + o; + return e || (u = s.element), o = { + firstLevel: u.hasClass("k-panelbar"), + expanded: u.parent().hasClass(w), + length: u.children().length + }, e && !u.length && (u = n(p.renderGroup({ + group: o + })).appendTo(r)), h || n.isArray(t) ? (f = n.map(h ? [t] : t, function(t, r) { + return typeof t == "string" ? n(t) : n(p.renderItem({ + group: o, + item: i(t, { + index: r + }) + })) + }), e && r.attr(g, !1)) : (f = n(t), s._updateItemsClasses(f)), { + items: f, + group: u + } + }, + _toggleHover: function(t) { + var i = n(t.currentTarget); + i.parents("li." + f).length || i.toggleClass("k-state-hover", t.type == ni) + }, + _updateClasses: function() { + var i = this, + r, t; + r = i.element.find("li > ul").not(function() { + return n(this).parentsUntil(".k-panelbar", "div").length + }).addClass("k-group k-panel").attr("role", "group"); + r.parent().attr(g, !1).not("." + w).children("ul").attr(yt, !0).hide(); + t = i.element.add(r).children(); + i._updateItemsClasses(t); + wt(t); + a(t) + }, + _updateItemsClasses: function(n) { + for (var i = n.length, t = 0; t < i; t++) this._updateItemClasses(n[t], t) + }, + _updateItemClasses: function(t, i) { + var s = this._selected, + f = this.options.contentUrls, + h = f && f[i], + c = this.element[0], + o, u; + t = n(t).addClass("k-item").attr("role", "menuitem"); + e.support.browser.msie && t.css("list-style-position", "inside").css("list-style-position", ""); + t.children(bt).addClass(dt); + u = t.children("a").addClass(tt); + u[0] && (u.attr("href", h), u.children(bt).addClass(dt)); + t.filter(":not([disabled]):not([class*=k-state])").addClass("k-state-default"); + t.filter("li[disabled]").addClass("k-state-disabled").attr(vt, !0).removeAttr("disabled"); + t.children("div").addClass(it).attr("role", "region").attr(yt, !0).hide().parent().attr(g, !1); + u = t.children(ut); + u[0] && (s && s.removeAttr(et).children(ut).removeClass(d), u.addClass(d), this._selected = t.attr(et, !0)); + t.children(r)[0] || (o = "<span class='" + tt + "'/>", f && f[i] && t[0].parentNode == c && (o = '<a class="k-link k-header" href="' + f[i] + '"/>'), t.contents().filter(function() { + return !this.nodeName.match(si) && !(this.nodeType == 3 && !n.trim(this.nodeValue)) + }).wrapAll(o)); + t.parent(".k-panelbar")[0] && t.children(r).addClass("k-header") + }, + _click: function(n) { + var t = this, + a = t.element, + i, o, s, l, h, e, c; + if (!n.parents("li." + f).length) return n.closest(".k-widget")[0] != a[0] ? void 0 : (h = n.closest(r), e = h.closest(u), t._updateSelected(h), o = e.find(v).add(e.find(k)), s = h.attr(st), l = s && (s.charAt(s.length - 1) == "#" || s.indexOf("#" + t.element[0].id + "-") != -1), i = !!(l || o.length), o.data("animating")) ? i : (t._triggerEvent(at, e) && (i = !0), i === !1) ? void 0 : t.options.expandMode == ei && t._collapseAllExpanded(e) ? i : (o.length && (c = o.is(y), t._triggerEvent(c ? rt : lt, e) || (i = t._toggleItem(e, c))), i) + }, + _toggleItem: function(n, i) { + var e = this, + o = n.find(v), + s = n.find(r), + h = s.attr(st), + f, u; + return o.length ? (this._toggleGroup(o, i), f = !0) : (u = n.children("." + it), u.length && (f = !0, u.is(li) && h !== t ? e._ajaxRequest(n, u, i) : e._toggleGroup(u, i))), f + }, + _toggleGroup: function(n, t) { + var e = this, + o = e.options.animation, + r = o.expand, + f = i({}, o.collapse), + s = f && "effects" in f; + n.is(y) == t && (n.parent().attr(g, !t).attr(yt, t).toggleClass(fi, t).toggleClass(w, !t).find("> .k-link > .k-icon").toggleClass("k-i-arrow-n", !t).toggleClass("k-panelbar-collapse", !t).toggleClass("k-i-arrow-s", t).toggleClass("k-panelbar-expand", t), r = t ? i(s ? f : i({ + reverse: !0 + }, r), { + hide: !0 + }) : i({ + complete: function(n) { + e._triggerEvent(gt, n.closest(u)) + } + }, r), n.kendoStop(!0, !0).kendoAnimate(r)) + }, + _collapseAllExpanded: function(t) { + var e = this, + o, i = !1, + f; + if (t.children(r).hasClass("k-header")) return f = t.find(v).add(t.find(k)), f.is(y) && (i = !0), f.is(y) || f.length === 0 || (o = n(e.element).children(), o.find(v).add(o.find(k)).filter(function() { + return n(this).is(y) + }).each(function(t, r) { + r = n(r); + i = e._triggerEvent(rt, r.closest(u)); + i || e._toggleGroup(r, !0) + })), i + }, + _ajaxRequest: function(t, i, u) { + var f = this, + e = t.find(".k-panelbar-collapse, .k-panelbar-expand"), + s = t.find(r), + h = setTimeout(function() { + e.addClass("k-loading") + }, 100), + o = s.attr(st); + n.ajax({ + type: "GET", + cache: !1, + url: o, + dataType: "html", + data: {}, + error: function(n, t) { + e.removeClass("k-loading"); + f.trigger(kt, { + xhr: n, + status: t + }) && this.complete() + }, + complete: function() { + clearTimeout(h); + e.removeClass("k-loading") + }, + success: function(n) { + try { + i.html(n) + } catch (e) { + var r = window.console; + r && r.error && r.error(e.name + ": " + e.message + " in " + o); + this.error(this.xhr, "error") + } + f._toggleGroup(i, u); + f.trigger(ti, { + item: t[0], + contentElement: i[0] + }) + } + }) + }, + _triggerEvent: function(n, t) { + var i = this; + return i.trigger(n, { + item: t[0] + }) + }, + _updateSelected: function(n) { + var t = this, + i = t.element, + r = n.parent(u), + f = t._selected; + f && f.removeAttr(et); + t._selected = r.attr(et, !0); + i.find(ui).removeClass(d); + i.find("> ." + c + ", .k-panel > ." + c).removeClass(c); + n.addClass(d); + n.parentsUntil(i, u).filter(":has(.k-header)").addClass(c); + t._current(r) + }, + _animations: function(n) { + n && "animation" in n && !n.animation && (n.animation = { + expand: { + effects: {} + }, + collapse: { + hide: !0, + effects: {} + } + }) + } + }); + i(p, { + renderItem: function(n) { + n = i({ + panelBar: {}, + group: {} + }, n); + var r = l.empty, + t = n.item; + return l.item(i(n, { + image: t.imageUrl ? l.image : r, + sprite: t.spriteCssClass ? l.sprite : r, + itemWrapper: l.itemWrapper, + renderContent: p.renderContent, + arrow: t.items || t.content || t.contentUrl ? l.arrow : r, + subGroup: p.renderGroup + }, pt)) + }, + renderGroup: function(n) { + return l.group(i({ + renderItems: function(n) { + for (var u = "", t = 0, r = n.items, f = r ? r.length : 0, e = i({ + length: f + }, n.group); t < f; t++) u += p.renderItem(i(n, { + group: e, + item: i({ + index: t + }, r[t]) + })); + return u + } + }, n, pt)) + }, + renderContent: function(n) { + return l.content(i(n, pt)) + } + }); + e.ui.plugin(p) + }(window.kendo.jQuery); +kendo_module({ + id: "timepicker", + name: "TimePicker", + category: "web", + description: "The TimePicker widget allows the end user to select a value from a list of predefined values or to type a new value.", + depends: ["popup"] + }), + function(n, t) { + function ui(n, t, i) { + var u = n.getTimezoneOffset(), + r; + n.setTime(n.getTime() + t); + i || (r = n.getTimezoneOffset() - u, n.setTime(n.getTime() + r * h)) + } + + function fi() { + var n = new u, + t = new u(n.getFullYear(), n.getMonth(), n.getDate(), 0, 0, 0), + i = new u(n.getFullYear(), n.getMonth(), n.getDate(), 12, 0, 0); + return -1 * (t.getTimezoneOffset() - i.getTimezoneOffset()) + } + + function e(n) { + return n.getHours() * 60 * h + n.getMinutes() * h + n.getSeconds() * 1e3 + n.getMilliseconds() + } + + function kt(n, t, i) { + var u = e(t), + f = e(i), + r; + return !n || u == f ? !0 : (r = e(n), u > r && (r += s), f < u && (f += s), r >= u && r <= f) + } + + function gt(n) { + var t = n.parseFormats; + n.format = ii(n.format || r.getCulture(n.culture).calendars.standard.patterns.t); + t = bt(t) ? t : [t]; + t.splice(0, 0, n.format); + n.parseFormats = t + } + + function ni(n) { + n.preventDefault() + } + var r = window.kendo, + o = r.keys, + ti = r._activeElement, + ii = r._extractFormat, + l = r.support, + tt = l.browser, + p = r.ui, + a = p.Widget, + it = "open", + rt = "close", + w = "change", + i = ".kendoTimePicker", + ut = "click" + i, + b = "k-state-default", + ft = "disabled", + et = "readonly", + k = "li", + ot = "<span/>", + st = "k-state-focused", + d = "k-state-hover", + ri = "mouseenter" + i + " mouseleave" + i, + ht = "mousedown" + i, + h = 6e4, + s = 864e5, + ct = "k-state-selected", + g = "k-state-disabled", + lt = "aria-selected", + at = "aria-expanded", + vt = "aria-hidden", + yt = "aria-disabled", + pt = "aria-readonly", + wt = "aria-activedescendant", + v = "id", + bt = n.isArray, + nt = n.extend, + y = n.proxy, + u = Date, + f = new u, + c, dt; + f = new u(f.getFullYear(), f.getMonth(), f.getDate(), 0, 0, 0); + c = function(t) { + var u = this, + f = t.id; + u.options = t; + u.ul = n('<ul tabindex="-1" role="listbox" aria-hidden="true" unselectable="on" class="k-list k-reset"/>').css({ + overflow: l.kineticScrollNeeded ? "" : "auto" + }).on(ut, k, y(u._click, u)).on("mouseenter" + i, k, function() { + n(this).addClass(d) + }).on("mouseleave" + i, k, function() { + n(this).removeClass(d) + }); + u.list = n("<div class='k-list-container'/>").append(u.ul).on(ht, ni); + f && (u._timeViewID = f + "_timeview", u._optionID = f + "_option_selected", u.ul.attr(v, u._timeViewID)); + u._popup(); + u.template = r.template('<li tabindex="-1" role="option" class="k-item" unselectable="on">#=data#<\/li>', { + useWithBlock: !1 + }) + }; + c.prototype = { + current: function(i) { + var r = this, + u = r.options.active; + if (i !== t) r._current && r._current.removeClass(ct).removeAttr(lt).removeAttr(v), i && (i = n(i).addClass(ct).attr(v, r._optionID).attr(lt, !0), r.scroll(i[0])), r._current = i, u && u(i); + else return r._current + }, + close: function() { + this.popup.close() + }, + destroy: function() { + var n = this; + n.ul.off(i); + n.list.off(i); + n._touchScroller && n._touchScroller.destroy(); + n.popup.destroy() + }, + open: function() { + var n = this; + n.ul[0].firstChild || n.bind(); + n.popup.open(); + n._current && n.scroll(n._current[0]) + }, + dataBind: function(n) { + for (var i = this, t = i.options, s = t.format, h = r.toString, c = i.template, e = n.length, u = 0, f, o = ""; u < e; u++) f = n[u], kt(f, t.min, t.max) && (o += c(h(f, s, t.culture))); + i._html(o, e) + }, + refresh: function() { + var l = this, + i = l.options, + g = i.format, + y = fi(), + p = y < 0, + w = i.min, + b = i.max, + a = e(w), + n = e(b), + o = i.interval * h, + nt = r.toString, + tt = l.template, + t = new u(+w), + it = t.getDate(), + v, k, c = 0, + f, d = ""; + for (f = p ? (s + y * h) / o : s / o, a != n && (a > n && (n += s), f = (n - a) / o + 1), k = parseInt(f, 10); c < f; c++) c && ui(t, o, p), n && k == c && (v = e(t), it < t.getDate() && (v += s), v > n && (t = new u(+b))), d += tt(nt(t, g, i.culture)); + l._html(d, f) + }, + bind: function() { + var n = this, + t = n.options.dates; + t && t[0] ? n.dataBind(t) : n.refresh() + }, + _html: function(n, t) { + var i = this; + i.ul[0].innerHTML = n; + i._height(t); + i.current(null); + i.select(i._value) + }, + scroll: function(n) { + if (n) { + var i = this.ul[0], + t = n.offsetTop, + f = n.offsetHeight, + r = i.scrollTop, + e = i.clientHeight, + o = t + f, + s = this._touchScroller, + u; + s ? (u = this.list.height(), t > u && (t = t - u + f), s.scrollTo(0, -t)) : i.scrollTop = r > t ? t : o > r + e ? o - e : r + } + }, + select: function(t) { + var i = this, + f = i.options, + u = i._current; + t instanceof Date && (t = r.toString(t, f.format, f.culture)); + typeof t == "string" && (u && u.text() === t ? t = u : (t = n.grep(i.ul[0].childNodes, function(n) { + return (n.textContent || n.innerText) == t + }), t = t[0] ? t : null)); + i.current(t) + }, + setOptions: function(n) { + var t = this.options; + this.options = nt(t, n, { + active: t.active, + change: t.change, + close: t.close, + open: t.open + }); + this.bind() + }, + toggle: function() { + var n = this; + n.popup.visible() ? n.close() : n.open() + }, + value: function(n) { + var t = this; + t._value = n; + t.ul[0].firstChild && t.select(n) + }, + _click: function(t) { + var i = this, + r = n(t.currentTarget); + t.isDefaultPrevented() || (i.select(r), i.options.change(r.text(), !0), i.close()) + }, + _height: function(n) { + if (n) { + var t = this, + i = t.list, + u = i.parent(".k-animation-container"), + r = t.options.height; + i.add(u).show().height(t.ul[0].scrollHeight > r ? r : "auto").hide() + } + }, + _parse: function(n) { + var o = this, + s = o.options, + t = o._value || f, + i, e; + return n instanceof u ? n : (n != null && (i = n.indexOf(":"), i == -1 ? n = n.length <= 2 ? n + ":00" : n.slice(2).length == 1 ? n.slice(0, 2) + ":" + n.slice(2) + "0" : n.slice(0, 2) + ":" + n.slice(2) : i == 0 ? n = "00" + n : (e = n.split(":"), e[1].length == 0 ? n = n + "00" : e[1].length == 1 && (n = n + "0"))), n = r.parseDate(n, s.parseFormats, s.culture), n && (n = new u(t.getFullYear(), t.getMonth(), t.getDate(), n.getHours(), n.getMinutes(), n.getSeconds(), n.getMilliseconds())), n) + }, + _adjustListWidth: function() { + var t = this.list, + i = t[0].style.width, + r = this.options.anchor, + n, u; + (t.data("width") || !i) && (n = window.getComputedStyle ? window.getComputedStyle(r[0], null) : 0, u = n ? parseFloat(n.width) : r.outerWidth(), n && (tt.mozilla || tt.msie) && (u += parseFloat(n.paddingLeft) + parseFloat(n.paddingRight) + parseFloat(n.borderLeftWidth) + parseFloat(n.borderRightWidth)), i = u - (t.outerWidth() - t.width()), t.css({ + fontFamily: r.css("font-family"), + width: i + }).data("width", i)) + }, + _popup: function() { + var t = this, + i = t.list, + n = t.options, + u = n.anchor; + t.popup = new p.Popup(i, nt(n.popup, { + anchor: u, + open: n.open, + close: n.close, + animation: n.animation, + isRtl: l.isRtl(n.anchor) + })); + t._touchScroller = r.touchScroller(t.popup.element) + }, + move: function(n) { + var i = this, + r = n.keyCode, + f = i.ul[0], + t = i._current, + u = r === o.DOWN; + if (r === o.UP || u) { + if (n.altKey) { + i.toggle(u); + return + } + t = u ? t ? t[0].nextSibling : f.firstChild : t ? t[0].previousSibling : f.lastChild; + t && i.select(t); + i.options.change(i._current.text()); + n.preventDefault() + } else(r === o.ENTER || r === o.TAB || r === o.ESC) && (n.preventDefault(), t && i.options.change(t.text(), !0), i.close()) + } + }; + c.getMilliseconds = e; + r.TimeView = c; + dt = a.extend({ + init: function(n, t) { + var i = this, + f, u, e; + a.fn.init.call(i, n, t); + n = i.element; + t = i.options; + gt(t); + i._wrapper(); + i.timeView = u = new c(nt({}, t, { + id: n.attr(v), + anchor: i.wrapper, + format: t.format, + change: function(t, r) { + r ? i._change(t) : n.val(t) + }, + open: function(t) { + i.timeView._adjustListWidth(); + i.trigger(it) ? t.preventDefault() : (n.attr(at, !0), f.attr(vt, !1)) + }, + close: function(t) { + i.trigger(rt) ? t.preventDefault() : (n.attr(at, !1), f.attr(vt, !0)) + }, + active: function(t) { + n.removeAttr(wt); + t && n.attr(wt, u._optionID) + } + })); + f = u.ul; + i._icon(); + i._reset(); + try { + n[0].setAttribute("type", "text") + } catch (o) { + n[0].type = "text" + } + n.addClass("k-input").attr({ + role: "combobox", + "aria-expanded": !1, + "aria-owns": u._timeViewID + }); + e = n.is("[disabled]"); + e ? i.enable(!1) : i.readonly(n.is("[readonly]")); + i._old = i._update(t.value || i.element.val()); + i._oldText = n.val(); + r.notify(i) + }, + options: { + name: "TimePicker", + min: f, + max: f, + format: "", + dates: [], + parseFormats: [], + value: null, + interval: 30, + height: 200, + animation: {} + }, + events: [it, rt, w], + setOptions: function(n) { + var t = this, + i = t._value; + a.fn.setOptions.call(t, n); + n = t.options; + gt(n); + t.timeView.setOptions(n); + i && t.element.val(r.toString(i, n.format, n.culture)) + }, + dataBind: function(n) { + bt(n) && this.timeView.dataBind(n) + }, + _editable: function(n) { + var t = this, + r = n.disable, + u = n.readonly, + o = t._arrow.off(i), + f = t.element.off(i), + e = t._inputWrapper.off(i); + if (u || r) e.addClass(r ? g : b).removeClass(r ? b : g), f.attr(ft, r).attr(et, u).attr(yt, r).attr(pt, u); + else { + e.addClass(b).removeClass(g).on(ri, t._toggleHover); + f.removeAttr(ft).removeAttr(et).attr(yt, !1).attr(pt, !1).on("keydown" + i, y(t._keydown, t)).on("blur" + i, y(t._blur, t)).on("focus" + i, function() { + t._inputWrapper.addClass(st) + }); + o.on(ut, y(t._click, t)).on(ht, ni) + } + }, + readonly: function(n) { + this._editable({ + readonly: n === t ? !0 : n, + disable: !1 + }) + }, + enable: function(n) { + this._editable({ + readonly: !1, + disable: !(n = n === t ? !0 : n) + }) + }, + destroy: function() { + var n = this; + a.fn.destroy.call(n); + n.timeView.destroy(); + n.element.off(i); + n._arrow.off(i); + n._inputWrapper.off(i); + n._form && n._form.off("reset", n._resetHandler) + }, + close: function() { + this.timeView.close() + }, + open: function() { + this.timeView.open() + }, + min: function(n) { + return this._option("min", n) + }, + max: function(n) { + return this._option("max", n) + }, + value: function(n) { + var i = this; + if (n === t) return i._value; + i._old = i._update(n); + i._old === null && i.element.val(""); + i._oldText = i.element.val() + }, + _blur: function() { + var n = this, + t = n.element.val(); + n.close(); + t !== n._oldText && n._change(t); + n._inputWrapper.removeClass(st) + }, + _click: function() { + var n = this, + t = n.element; + n.timeView.toggle(); + l.touch || t[0] === ti() || t.focus() + }, + _change: function(n) { + var t = this; + n = t._update(n); + t._old != +n && (t._old = n, t._oldText = t.element.val(), t.trigger(w), t.element.trigger(w)) + }, + _icon: function() { + var i = this, + r = i.element, + t; + t = r.next("span.k-select"); + t[0] || (t = n('<span unselectable="on" class="k-select"><span unselectable="on" class="k-icon k-i-clock">select<\/span><\/span>').insertAfter(r)); + i._arrow = t.attr({ + role: "button", + "aria-controls": i.timeView._timeViewID + }) + }, + _keydown: function(n) { + var t = this, + u = n.keyCode, + i = t.timeView, + r = t.element.val(); + i.popup.visible() || n.altKey ? i.move(n) : u === o.ENTER && r !== t._oldText && t._change(r) + }, + _option: function(n, i) { + var r = this, + f = r.options; + if (i === t) return f[n]; + (i = r.timeView._parse(i), i) && (i = new u(+i), f[n] = i, r.timeView.options[n] = i, r.timeView.bind()) + }, + _toggleHover: function(t) { + n(t.currentTarget).toggleClass(d, t.type === "mouseenter") + }, + _update: function(n) { + var i = this, + u = i.options, + f = i.timeView, + t = f._parse(n); + return kt(t, u.min, u.max) || (t = null), i._value = t, i.element.val(t ? r.toString(t, u.format, u.culture) : n), f.value(t), t + }, + _wrapper: function() { + var r = this, + i = r.element, + t; + t = i.parents(".k-timepicker"); + t[0] || (t = i.wrap(ot).parent().addClass("k-picker-wrap k-state-default"), t = t.wrap(ot).parent()); + t[0].style.cssText = i[0].style.cssText; + r.wrapper = t.addClass("k-widget k-timepicker k-header").addClass(i[0].className); + i.css({ + width: "100%", + height: i[0].style.height + }); + r._inputWrapper = n(t[0].firstChild) + }, + _reset: function() { + var t = this, + i = t.element, + r = i.attr("form"), + u = r ? n("#" + r) : i.closest("form"); + u[0] && (t._resetHandler = function() { + t.value(i[0].defaultValue) + }, t._form = u.on("reset", t._resetHandler)) + } + }); + p.plugin(dt) + }(window.kendo.jQuery); +kendo_module({ + id: "window", + name: "Window", + category: "web", + description: "The Window widget displays content in a modal or non-modal HTML window.", + depends: ["draganddrop"] + }), + function(n, t) { + function rt(n) { + return typeof n != "undefined" + } + + function o(n, t, i) { + return Math.max(Math.min(parseInt(n, 10), i === Infinity ? i : parseInt(i, 10)), parseInt(t, 10)) + } + + function ii(n, t) { + return function() { + var i = this, + r = i.wrapper, + f = r[0].style, + o = i.options; + if (!o.isMaximized && !o.isMinimized) return i.restoreOptions = { + width: f.width, + height: f.height + }, r.children(h).hide().end().children(e).find(gt).parent().hide().eq(0).before(u.action({ + name: "Restore" + })), t.call(i), n == "maximize" ? i.wrapper.children(e).find(st).parent().hide() : i.wrapper.children(e).find(st).parent().show(), i + } + } + + function ri(n) { + var t = this; + t.owner = n; + t._draggable = new ht(n.wrapper, { + filter: h, + group: n.wrapper.id + "-resizing", + dragstart: f(t.dragstart, t), + drag: f(t.drag, t), + dragend: f(t.dragend, t) + }) + } + + function ui(n, t) { + var i = this; + i.owner = n; + i._draggable = new ht(n.wrapper, { + filter: t, + group: n.wrapper.id + "-moving", + dragstart: f(i.dragstart, i), + drag: f(i.drag, i), + dragend: f(i.dragend, i), + dragcancel: f(i.dragcancel, i) + }); + i._draggable.userEvents.stopPropagation = !1 + } + var i = window.kendo, + d = i.ui.Widget, + ht = i.ui.Draggable, + ct = n.isPlainObject, + fi = i._activeElement, + f = n.proxy, + l = n.extend, + ut = n.each, + s = i.template, + g = "body", + u, r = ".kendoWindow", + a = ".k-window", + ft = ".k-window-title", + e = ft + "bar", + v = ".k-window-content", + h = ".k-resize-handle", + nt = ".k-overlay", + w = "k-content-frame", + lt = "k-loading", + at = "k-state-hover", + vt = "k-state-focused", + yt = "k-window-maximized", + y = ":visible", + tt = "hidden", + p = "cursor", + et = "open", + ot = "activate", + pt = "deactivate", + wt = "close", + it = "refresh", + bt = "dragstart", + kt = "dragend", + dt = "error", + c = "overflow", + b = "zIndex", + gt = ".k-window-actions .k-i-minimize,.k-window-actions .k-i-maximize", + ni = ".k-i-pin", + ti = ".k-i-unpin", + st = ni + "," + ti, + k = ".k-window-titlebar .k-window-action", + ei = i.isLocalUrl, + oi = d.extend({ + init: function(u, o) { + var s = this, + h, w = {}, + g, nt, c, it = !1, + l, b, ut = o && o.actions && !o.actions.length, + p; + d.fn.init.call(s, u, o); + o = s.options; + c = o.position; + u = s.element; + l = o.content; + ut && (o.actions = []); + s.appendTo = n(o.appendTo); + s._animations(); + l && !ct(l) && (l = o.content = { + url: l + }); + u.find("script").filter(function() { + return !this.type || this.type.toLowerCase().indexOf("script") >= 0 + }).remove(); + u.parent().is(s.appendTo) || c.top !== t && c.left !== t || (u.is(y) ? (w = u.offset(), it = !0) : (g = u.css("visibility"), nt = u.css("display"), u.css({ + visibility: tt, + display: "" + }), w = u.offset(), u.css({ + visibility: g, + display: nt + })), c.top === t && (c.top = w.top), c.left === t && (c.left = w.left)); + rt(o.visible) && o.visible !== null || (o.visible = u.is(y)); + h = s.wrapper = u.closest(a); + u.is(".k-content") && h[0] || (u.addClass("k-window-content k-content"), s._createWindow(u, o), h = s.wrapper = u.closest(a), s._dimensions()); + s._position(); + o.pinned && s.pin(!0); + l && s.refresh(l); + o.visible && s.toFront(); + b = h.children(v); + s._tabindex(b); + o.visible && o.modal && s._overlay(h.is(y)).css({ + opacity: .5 + }); + h.on("mouseenter" + r, k, function() { + n(this).addClass(at) + }).on("mouseleave" + r, k, function() { + n(this).removeClass(at) + }).on("click" + r, "> " + k, f(s._windowActionHandler, s)); + b.on("keydown" + r, f(s._keydown, s)).on("focus" + r, function() { + h.addClass(vt) + }).on("blur" + r, function() { + h.removeClass(vt) + }); + this._resizable(); + this._draggable(); + p = u.attr("id"); + p && (p = p + "_wnd_title", h.children(e).children(ft).attr("id", p), b.attr({ + role: "dialog", + "aria-labelledby": p + })); + h.add(h.children(".k-resize-handle," + e)).on("mousedown" + r, f(s.toFront, s)); + s.touchScroller = i.touchScroller(u); + s._resizeHandler = function(n) { + return s._onDocumentResize(n) + }; + n(window).on("resize", s._resizeHandler); + o.visible && (s.trigger(et), s.trigger(ot)); + i.notify(s) + }, + _dimensions: function() { + var i = this, + t = i.wrapper, + n = i.options, + r = n.width, + u = n.height, + f = n.maxHeight; + i.title(n.title); + ut(["minWidth", "minHeight", "maxWidth", "maxHeight"], function(i, r) { + var u = n[r]; + u && u != Infinity && t.css(r, u) + }); + f && f != Infinity && i.element.css("maxHeight", f); + r && (r.toString().indexOf("%") > 0 ? t.width(r) : t.width(o(r, n.minWidth, n.maxWidth))); + u && (u.toString().indexOf("%") > 0 ? t.height(u) : t.height(o(u, n.minHeight, n.maxHeight))); + n.visible || t.hide() + }, + _position: function() { + var t = this, + i = t.wrapper, + n = t.options.position; + n.top === 0 && (n.top = n.top.toString()); + n.left === 0 && (n.left = n.left.toString()); + i.css({ + top: n.top || "", + left: n.left || "" + }) + }, + _animations: function() { + var n = this.options; + n.animation === !1 && (n.animation = { + open: { + effects: {} + }, + close: { + hide: !0, + effects: {} + } + }) + }, + _resize: function() { + i.resize(this.element.children()) + }, + _resizable: function() { + var i = this.options.resizable, + t = this.wrapper; + if (this.resizing && (t.off("dblclick" + r).children(h).remove(), this.resizing.destroy(), this.resizing = null), i) { + t.on("dblclick" + r, e, f(function(t) { + n(t.target).closest(".k-window-action").length || this.toggleMaximization() + }, this)); + ut("n e s w se sw ne nw".split(" "), function(n, i) { + t.append(u.resizeHandle(i)) + }); + this.resizing = new ri(this) + } + }, + _draggable: function() { + var n = this.options.draggable; + this.dragging && (this.dragging.destroy(), this.dragging = null); + n && (this.dragging = new ui(this, n.dragHandle || e)) + }, + setOptions: function(n) { + var t = this; + d.fn.setOptions.call(t, n); + t._animations(); + t._dimensions(); + t._position(); + t._resizable(); + t._draggable() + }, + events: [et, ot, pt, wt, it, "resize", bt, kt, dt], + options: { + name: "Window", + animation: { + open: { + effects: { + zoom: { + direction: "in" + }, + fade: { + direction: "in" + } + }, + duration: 350 + }, + close: { + effects: { + zoom: { + direction: "out", + properties: { + scale: .7 + } + }, + fade: { + direction: "out" + } + }, + duration: 350, + hide: !0 + } + }, + title: "", + actions: ["Close"], + autoFocus: !0, + modal: !1, + resizable: !0, + draggable: !0, + minWidth: 90, + minHeight: 50, + maxWidth: Infinity, + maxHeight: Infinity, + pinned: !1, + position: {}, + content: null, + visible: null, + height: null, + width: null, + appendTo: "body" + }, + _closable: function() { + return n.inArray("close", n.map(this.options.actions, function(n) { + return n.toLowerCase() + })) > -1 + }, + _keydown: function(n) { + var u = this, + h = u.options, + f = i.keys, + e = n.keyCode, + t = u.wrapper, + c, r, s = 10, + p = u.options.isMaximized, + v, y, l, a; + n.target != n.currentTarget || u._closing || (e == f.ESC && u._closable() && u._close(!0), !h.draggable || n.ctrlKey || p || (c = i.getOffset(t), e == f.UP ? r = t.css("top", c.top - s) : e == f.DOWN ? r = t.css("top", c.top + s) : e == f.LEFT ? r = t.css("left", c.left - s) : e == f.RIGHT && (r = t.css("left", c.left + s))), h.resizable && n.ctrlKey && !p && (e == f.UP ? (r = !0, y = t.height() - s) : e == f.DOWN && (r = !0, y = t.height() + s), e == f.LEFT ? (r = !0, v = t.width() - s) : e == f.RIGHT && (r = !0, v = t.width() + s), r && (l = o(v, h.minWidth, h.maxWidth), a = o(y, h.minHeight, h.maxHeight), isNaN(l) || (t.width(l), u.options.width = l + "px"), isNaN(a) || (t.height(a), u.options.height = a + "px"), u.resize())), r && n.preventDefault()) + }, + _overlay: function(t) { + var i = this.appendTo.children(nt), + r = this.wrapper; + return i.length || (i = n("<div class='k-overlay' />")), i.insertBefore(r[0]).toggle(t).css(b, parseInt(r.css(b), 10) - 1), i + }, + _windowActionHandler: function(t) { + var r = n(t.target).closest(".k-window-action").find(".k-icon"), + i = this; + i._closing || ut({ + "k-i-close": function() { + i._close(!0) + }, + "k-i-maximize": i.maximize, + "k-i-minimize": i.minimize, + "k-i-restore": i.restore, + "k-i-refresh": i.refresh, + "k-i-pin": i.pin, + "k-i-unpin": i.unpin + }, function(n, u) { + if (r.hasClass(n)) return t.preventDefault(), u.call(i), !1 + }) + }, + _modals: function() { + var t = this; + return n(a).filter(function() { + var i = n(this), + r = t._object(i).options; + return r.modal && r.visible && i.is(y) + }).sort(function(t, i) { + return +n(t).css("zIndex") - +n(i).css("zIndex") + }) + }, + _object: function(n) { + var t = n.children(v); + return t.data("kendoWindow") || t.data("kendo" + this.options.name) + }, + center: function() { + var t = this, + e = t.options.position, + r = t.wrapper, + i = n(window), + o = 0, + s = 0, + u, f; + return t.options.isMaximized ? t : (t.options.pinned || (o = i.scrollTop(), s = i.scrollLeft()), f = s + Math.max(0, (i.width() - r.width()) / 2), u = o + Math.max(0, (i.height() - r.height()) / 2), r.css({ + left: f, + top: u + }), e.top = u, e.left = f, t) + }, + title: function(n) { + var i = this, + r = i.wrapper, + s = i.options, + t = r.children(e), + f = t.children(ft), + o = t.outerHeight(); + return arguments.length ? (n === !1 ? (r.addClass("k-window-titleless"), t.remove()) : (t.length || r.prepend(u.titlebar(l(u, s))), r.css("padding-top", o), t.css("margin-top", -o)), f.text(n), i.options.title = n, i) : f.text() + }, + content: function(n) { + var t = this.wrapper.children(v), + r = t.children(".km-scroll-container"); + return (t = r[0] ? r : t, !rt(n)) ? t.html() : (i.destroy(this.element.children()), t.html(n), this) + }, + open: function() { + var t = this, + f = t.wrapper, + r = t.options, + e = r.animation.open, + s = f.children(v), + h = s.css(c), + u, o; + return t.trigger(et) || (t._closing && f.kendoStop(!0, !0), t._closing = !1, t.toFront(), r.autoFocus && t.element.focus(), r.visible = !0, r.modal && (u = t._overlay(!1), u.kendoStop(!0, !0), e.duration && i.effects.Fade ? (o = i.fx(u).fadeIn(), o.duration(e.duration || 0), o.endValue(.5), o.play()) : u.css("opacity", .5), u.show()), f.is(y) || (s.css(c, tt), f.show().kendoStop().kendoAnimate({ + effects: e.effects, + duration: e.duration, + complete: function() { + r.autoFocus && t.element.focus(); + t.trigger(ot); + s.css(c, h) + } + }))), r.isMaximized && (t._documentScrollTop = n(document).scrollTop(), n("html, body").css(c, tt)), t + }, + _removeOverlay: function(r) { + var f = this._modals(), + e = this.options, + s = e.modal && !f.length, + h = e.modal ? this._overlay(!0) : n(t), + o = e.animation.close, + u; + s ? !r && o.duration && i.effects.Fade ? (u = i.fx(h).fadeOut(), u.duration(o.duration || 0), u.startValue(.5), u.play()) : this._overlay(!1).remove() : f.length && this._object(f.last())._overlay(!0) + }, + _close: function(t) { + var i = this, + r = i.wrapper, + u = i.options, + e = u.animation.open, + f = u.animation.close; + r.is(y) && !i.trigger(wt, { + userTriggered: !!t + }) && (i._closing = !0, u.visible = !1, n(a).each(function(t, i) { + var u = n(i).children(v); + i != r && u.find("> ." + w).length > 0 && u.children(nt).remove() + }), this._removeOverlay(), r.kendoStop().kendoAnimate({ + effects: f.effects || e.effects, + reverse: f.reverse === !0, + duration: f.duration, + complete: function() { + r.hide().css("opacity", ""); + i.trigger(pt); + var n = i._object(i._modals().last()); + n && n.toFront() + } + })); + i.options.isMaximized && (n("html, body").css(c, ""), i._documentScrollTop && i._documentScrollTop > 0 && n(document).scrollTop(i._documentScrollTop)) + }, + close: function() { + return this._close(!1), this + }, + _actionable: function(t) { + return n(t).is(k + "," + k + " .k-icon,:input,a") + }, + _shouldFocus: function(t) { + var r = fi(), + i = this.element; + return this.options.autoFocus && !n(r).is(i) && !this._actionable(t) && (!i.find(r).length || !i.find(t).length) + }, + toFront: function(t) { + var r = this, + i = r.wrapper, + s = i[0], + f = +i.css(b), + h = f, + c = t && t.target || null, + e, o; + return n(a).each(function(t, i) { + var r = n(i), + e = r.css(b), + o = r.children(v); + isNaN(e) || (f = Math.max(+e, f)); + i != s && o.find("> ." + w).length > 0 && o.append(u.overlay) + }), (!i[0].style.zIndex || h < f) && i.css(b, f + 2), r.element.find("> .k-overlay").remove(), r._shouldFocus(c) && (r.element.focus(), e = n(window).scrollTop(), o = parseInt(i.position().top, 10), o > 0 && o < e && (e > 0 ? n(window).scrollTop(o) : i.css("top", e))), r + }, + toggleMaximization: function() { + return this._closing ? this : this[this.options.isMaximized ? "restore" : "maximize"]() + }, + restore: function() { + var t = this, + i = t.options, + u = i.minHeight, + r = t.restoreOptions; + return !i.isMaximized && !i.isMinimized ? t : (u && u != Infinity && t.wrapper.css("min-height", u), t.wrapper.css({ + position: i.pinned ? "fixed" : "absolute", + left: r.left, + top: r.top, + width: r.width, + height: r.height + }).removeClass(yt).find(".k-window-content,.k-resize-handle").show().end().find(".k-window-titlebar .k-i-restore").parent().remove().end().end().find(gt).parent().show().end().end().find(st).parent().show(), t.options.width = r.width, t.options.height = r.height, n("html, body").css(c, ""), this._documentScrollTop && this._documentScrollTop > 0 && n(document).scrollTop(this._documentScrollTop), i.isMaximized = i.isMinimized = !1, t.resize(), t) + }, + maximize: ii("maximize", function() { + var t = this, + i = t.wrapper, + r = i.position(); + l(t.restoreOptions, { + left: r.left, + top: r.top + }); + i.css({ + left: 0, + top: 0, + position: "fixed" + }).addClass(yt); + this._documentScrollTop = n(document).scrollTop(); + n("html, body").css(c, tt); + t.options.isMaximized = !0; + t._onDocumentResize() + }), + minimize: ii("minimize", function() { + var n = this; + n.wrapper.css({ + height: "", + minHeight: "" + }); + n.element.hide(); + n.options.isMinimized = !0 + }), + pin: function(t) { + var i = this, + u = n(window), + r = i.wrapper, + f = parseInt(r.css("top"), 10), + o = parseInt(r.css("left"), 10); + !t && (i.options.pinned || i.options.isMaximized) || (r.css({ + position: "fixed", + top: f - u.scrollTop(), + left: o - u.scrollLeft() + }), r.children(e).find(ni).addClass("k-i-unpin").removeClass("k-i-pin"), i.options.pinned = !0) + }, + unpin: function() { + var t = this, + r = n(window), + i = t.wrapper, + u = parseInt(i.css("top"), 10), + f = parseInt(i.css("left"), 10); + t.options.pinned && !t.options.isMaximized && (i.css({ + position: "", + top: u + r.scrollTop(), + left: f + r.scrollLeft() + }), i.children(e).find(ti).addClass("k-i-pin").removeClass("k-i-unpin"), t.options.pinned = !1) + }, + _onDocumentResize: function() { + var t = this, + u = t.wrapper, + f = n(window), + i, r; + t.options.isMaximized && (i = f.width(), r = f.height() - parseInt(u.css("padding-top"), 10), u.css({ + width: i, + height: r + }), t.options.width = i, t.options.height = r, t.resize()) + }, + refresh: function(t) { + var i = this, + e = i.options, + o = n(i.element), + h, f, c; + if (ct(t) || (t = { + url: t + }), t = l({}, e.content, t), f = rt(e.iframe) ? e.iframe : t.iframe, c = t.url, c) + if (rt(f) || (f = !ei(c)), f) { + h = o.find("." + w)[0]; + h ? h.src = c || h.src : o.html(u.contentFrame(l({}, e, { + content: t + }))); + o.find("." + w).unbind("load" + r).on("load" + r, function() { + i.trigger(it) + }) + } else i._ajaxRequest(t); + else t.template && i.content(s(t.template)({})), i.trigger(it); + return o.toggleClass("k-window-iframecontent", f), i + }, + _ajaxRequest: function(t) { + var i = this, + r = t.template, + u = i.wrapper.find(".k-window-titlebar .k-i-refresh"), + f = setTimeout(function() { + u.addClass(lt) + }, 100); + n.ajax(l({ + type: "GET", + dataType: "html", + cache: !1, + error: function(n, t) { + i.trigger(dt, { + status: t, + xhr: n + }) + }, + complete: function() { + clearTimeout(f); + u.removeClass(lt) + }, + success: function(n) { + r && (n = s(r)(n || {})); + i.content(n); + i.element.prop("scrollTop", 0); + i.trigger(it) + } + }, t)) + }, + destroy: function() { + var t = this.wrapper; + d.fn.destroy.call(this); + i.destroy(t); + this.resizing && this.resizing.destroy(); + this.dragging && this.dragging.destroy(); + this.element.children("iframe").remove(); + t.find(".k-resize-handle,.k-window-titlebar").off(r); + t.remove().off(r); + n(window).off("resize", this._resizeHandler); + this._removeOverlay(!0) + }, + _createWindow: function() { + var e = this, + t = e.element, + f = e.options, + o, r, s = i.support.isRtl(t); + f.scrollable === !1 && t.attr("style", "overflow:hidden;"); + r = n(u.wrapper(f)); + f.title !== !1 && r.append(u.titlebar(l(u, f))); + o = t.find("iframe:not(.k-content)").map(function() { + var n = this.getAttribute("src"); + return this.src = "", n + }); + r.toggleClass("k-rtl", s).appendTo(e.appendTo).append(t).find("iframe:not(.k-content)").each(function(n) { + this.src = o[n] + }); + r.find(".k-window-title").css(s ? "left" : "right", r.find(".k-window-actions").outerWidth() + 10); + t.show(); + t.find("[data-role=editor]").each(function() { + var t = n(this).data("kendoEditor"); + t && t.refresh() + }) + } + }); + u = { + wrapper: s("<div class='k-widget k-window' />"), + action: s("<a role='button' href='\\#' class='k-window-action k-link'><span role='presentation' class='k-icon k-i-#= name.toLowerCase() #'>#= name #<\/span><\/a>"), + titlebar: s("<div class='k-window-titlebar k-header'> <span class='k-window-title'>#= title #<\/span><div class='k-window-actions'># for (var i = 0; i < actions.length; i++) { ##= action({ name: actions[i] }) ## } #<\/div><\/div>"), + overlay: "<div class='k-overlay' />", + contentFrame: s("<iframe frameborder='0' title='#= title #' class='" + w + "' src='#= content.url #'>This page requires frames in order to show content<\/iframe>"), + resizeHandle: s("<div class='k-resize-handle k-resize-#= data #'><\/div>") + }; + ri.prototype = { + dragstart: function(t) { + var r = this, + e = r.owner, + f = e.wrapper; + r.elementPadding = parseInt(e.wrapper.css("padding-top"), 10); + r.initialCursorPosition = i.getOffset(f, "position"); + r.resizeDirection = t.currentTarget.prop("className").replace("k-resize-handle k-resize-", ""); + r.initialSize = { + width: f.width(), + height: f.height() + }; + r.containerOffset = i.getOffset(e.appendTo); + f.append(u.overlay).children(h).not(t.currentTarget).hide(); + n(g).css(p, t.currentTarget.css(p)) + }, + drag: function(n) { + var u = this, + f = u.owner, + e = f.wrapper, + t = f.options, + s = u.resizeDirection, + h = u.containerOffset, + c = u.initialCursorPosition, + v = u.initialSize, + i, r, l, a, y = Math.max(n.x.location, h.left), + p = Math.max(n.y.location, h.top); + s.indexOf("e") >= 0 ? (i = y - c.left, e.width(o(i, t.minWidth, t.maxWidth))) : s.indexOf("w") >= 0 && (a = c.left + v.width, i = o(a - y, t.minWidth, t.maxWidth), e.css({ + left: a - i - h.left, + width: i + })); + s.indexOf("s") >= 0 ? (r = p - c.top - u.elementPadding, e.height(o(r, t.minHeight, t.maxHeight))) : s.indexOf("n") >= 0 && (l = c.top + v.height, r = o(l - p, t.minHeight, t.maxHeight), e.css({ + top: l - r - h.top, + height: r + })); + i && (f.options.width = i + "px"); + r && (f.options.height = r + "px"); + f.resize() + }, + dragend: function(t) { + var i = this, + r = i.owner, + u = r.wrapper; + return u.find(nt).remove().end().children(h).not(t.currentTarget).show(), n(g).css(p, ""), r.touchScroller && r.touchScroller.reset(), t.keyCode == 27 && u.css(i.initialCursorPosition).css(i.initialSize), !1 + }, + destroy: function() { + this._draggable.destroy() + } + }; + ui.prototype = { + dragstart: function(t) { + var r = this.owner, + f = r.element, + e = f.find(".k-window-actions"), + o = i.getOffset(r.appendTo); + r.trigger(bt); + r.initialWindowPosition = i.getOffset(r.wrapper, "position"); + r.startPosition = { + left: t.x.client - r.initialWindowPosition.left, + top: t.y.client - r.initialWindowPosition.top + }; + r.minLeftPosition = e.length > 0 ? e.outerWidth() + parseInt(e.css("right"), 10) - f.outerWidth() : 20 - f.outerWidth(); + r.minLeftPosition -= o.left; + r.minTopPosition = -o.top; + r.wrapper.append(u.overlay).children(h).hide(); + n(g).css(p, t.currentTarget.css(p)) + }, + drag: function(t) { + var i = this.owner, + r = i.options.position, + u = Math.max(t.y.client - i.startPosition.top, i.minTopPosition), + f = Math.max(t.x.client - i.startPosition.left, i.minLeftPosition), + e = { + left: f, + top: u + }; + n(i.wrapper).css(e); + r.top = u; + r.left = f + }, + _finishDrag: function() { + var t = this.owner; + t.wrapper.children(h).toggle(!t.options.isMinimized).end().find(nt).remove(); + n(g).css(p, "") + }, + dragcancel: function(n) { + this._finishDrag(); + n.currentTarget.closest(a).css(this.owner.initialWindowPosition) + }, + dragend: function() { + return this._finishDrag(), this.owner.trigger(kt), !1 + }, + destroy: function() { + this._draggable.destroy() + } + }; + i.ui.plugin(oi) + }(window.kendo.jQuery); +! function(n) { + return n(["./kendo.data.min", "./kendo.combobox.min", "./kendo.multiselect.min", "./kendo.validator.min"], function() { + ! function(n, t) { + function u(t, i, r, u) { + var f = {}; + return t.sort ? (f[this.options.prefix + "sort"] = n.map(t.sort, function(n) { + return n.field + "-" + n.dir + }).join("~"), delete t.sort) : f[this.options.prefix + "sort"] = "", t.page && (f[this.options.prefix + "page"] = t.page, delete t.page), t.pageSize && (f[this.options.prefix + "pageSize"] = t.pageSize, delete t.pageSize), t.group ? (f[this.options.prefix + "group"] = n.map(t.group, function(n) { + return n.field + "-" + n.dir + }).join("~"), delete t.group) : f[this.options.prefix + "group"] = "", t.aggregate && (f[this.options.prefix + "aggregate"] = n.map(t.aggregate, function(n) { + return n.field + "-" + n.aggregate + }).join("~"), delete t.aggregate), t.filter ? (f[this.options.prefix + "filter"] = o(t.filter, r), delete t.filter) : (f[this.options.prefix + "filter"] = "", delete t.filter), delete t.take, delete t.skip, e(f, t, "", u), f + } + + function c(n) { + var t = i.culture().numberFormat[h]; + return ("" + n).replace(h, t) + } + + function l(n, t) { + return n instanceof Date ? n = t ? i.stringify(n).replace(/"/g, "") : i.format("{0:G}", n) : "number" == typeof n && (n = c(n)), n + } + + function f(n, i, r, u, f, o) { + b(i) ? a(n, i, f, o) : k(i) ? e(n, i, f, o) : n[f] === t && (n[f] = r[u] = l(i, o)) + } + + function e(n, t, i, r) { + var u, e, o; + for (u in t) e = i ? i + "." + u : u, o = t[u], f(n, o, t, u, e, r) + } + + function a(n, t, i, r) { + for (var s, o, h, u = 0, e = 0; u < t.length; u++) s = t[u], o = "[" + e + "]", h = i + o, f(n, s, t, o, h, r), e++ + } + + function o(i, r) { + return i.filters ? n.map(i.filters, function(n) { + var i = n.filters && n.filters.length > 1, + t = o(n, r); + return t && i && (t = "(" + t + ")"), t + }).join("~" + i.logic + "~") : i.field ? i.field + "~" + i.operator + "~" + v(i.value, r) : t + } + + function v(n, t) { + if ("string" == typeof n) { + if (!(n.indexOf("Date(") > -1)) return n = n.replace(w, "''"), t && (n = encodeURIComponent(n)), "'" + n + "'"; + n = new Date(parseInt(n.replace(/^\/Date\((.*?)\)\/$/, "$1"), 10)) + } + return n && n.getTime ? "datetime'" + i.format("{0:yyyy-MM-ddTHH-mm-ss}", n) + "'" : n + } + + function s(i) { + return { + value: t !== i.Key ? i.Key : i.value, + field: i.Member || i.field, + hasSubgroups: i.HasSubgroups || i.hasSubgroups || !1, + aggregates: p(i.Aggregates || i.aggregates), + items: i.HasSubgroups ? n.map(i.Items || i.items, s) : i.Items || i.items + } + } + + function y(n) { + var t = {}; + return t[n.AggregateMethodName.toLowerCase()] = n.Value, t + } + + function p(n) { + var t, i, r, u = {}; + for (t in n) { + u = {}; + r = n[t]; + for (i in r) u[i.toLowerCase()] = r[i]; + n[t] = u + } + return n + } + var i = window.kendo, + w = /'/gi, + r = n.extend, + b = n.isArray, + k = n.isPlainObject, + h = "."; + r(!0, i.data, { + schemas: { + "aspnetmvc-ajax": { + groups: function(t) { + return n.map(this.data(t), s) + }, + aggregates: function(n) { + n = n.d || n; + for (var t, u = {}, e = n.AggregateResults || [], i = 0, f = e.length; f > i; i++) t = e[i], u[t.Member] = r(!0, u[t.Member], y(t)); + return u + } + } + } + }); + r(!0, i.data, { + transports: { + "aspnetmvc-ajax": i.data.RemoteTransport.extend({ + init: function(n) { + var t = this, + f = (n || {}).stringifyDates; + i.data.RemoteTransport.fn.init.call(this, r(!0, {}, this.options, n, { + parameterMap: function(n, i) { + return u.call(t, n, i, !1, f) + } + })) + }, + read: function(n) { + var t = this.options.data, + r = this.options.read.url; + t ? (r && (this.options.data = null), !t.Data.length && r ? i.data.RemoteTransport.fn.read.call(this, n) : n.success(t)) : i.data.RemoteTransport.fn.read.call(this, n) + }, + options: { + read: { + type: "POST" + }, + update: { + type: "POST" + }, + create: { + type: "POST" + }, + destroy: { + type: "POST" + }, + parameterMap: u, + prefix: "" + } + }) + } + }); + r(!0, i.data, { + transports: { + "aspnetmvc-server": i.data.RemoteTransport.extend({ + init: function(n) { + var t = this; + i.data.RemoteTransport.fn.init.call(this, r(n, { + parameterMap: function(n, i) { + return u.call(t, n, i, !0) + } + })) + }, + read: function(t) { + var r, i, u = this.options.prefix, + f = [u + "sort", u + "page", u + "pageSize", u + "group", u + "aggregate", u + "filter"], + e = RegExp("(" + f.join("|") + ")=[^&]*&?", "g"); + i = location.search.replace(e, "").replace("?", ""); + i.length && !/&$/.test(i) && (i += "&"); + t = this.setup(t, "read"); + r = t.url; + r.indexOf("?") >= 0 ? (i = i.replace(/(.*?=.*?)&/g, function(n) { + return r.indexOf(n.substr(0, n.indexOf("="))) >= 0 ? "" : n + }), r += "&" + i) : r += "?" + i; + r += n.map(t.data, function(n, t) { + return t + "=" + n + }).join("&"); + location.href = r + } + }) + } + }) + }(window.kendo.jQuery), + function(n) { + var i = window.kendo, + t = i.ui; + t && t.ComboBox && (t.ComboBox.requestData = function(t) { + var i = n(t).data("kendoComboBox"), + u = i.dataSource.filter(), + r = i.input.val(); + return u || (r = ""), { + text: r + } + }) + }(window.kendo.jQuery), + function(n) { + var i = window.kendo, + t = i.ui; + t && t.MultiSelect && (t.MultiSelect.requestData = function(t) { + var i = n(t).data("kendoMultiSelect"), + r = i.input.val(); + return { + text: r !== i.options.placeholder ? r : "" + } + }) + }(window.kendo.jQuery), + function(n) { + var t = window.kendo, + i = (t.ui, n.extend), + r = n.isFunction; + i(!0, t.data, { + schemas: { + "imagebrowser-aspnetmvc": { + data: function(n) { + return n || [] + }, + model: { + id: "name", + fields: { + name: { + field: "Name" + }, + size: { + field: "Size" + }, + type: { + field: "EntryType", + parse: function(n) { + return 0 == n ? "f" : "d" + } + } + } + } + } + } + }); + i(!0, t.data, { + transports: { + "imagebrowser-aspnetmvc": t.data.RemoteTransport.extend({ + init: function(i) { + t.data.RemoteTransport.fn.init.call(this, n.extend(!0, {}, this.options, i)) + }, + _call: function(i, u) { + u.data = n.extend({}, u.data, { + path: this.options.path() + }); + r(this.options[i]) ? this.options[i].call(this, u) : t.data.RemoteTransport.fn[i].call(this, u) + }, + read: function(n) { + this._call("read", n) + }, + create: function(n) { + this._call("create", n) + }, + destroy: function(n) { + this._call("destroy", n) + }, + update: function() {}, + options: { + read: { + type: "POST" + }, + update: { + type: "POST" + }, + create: { + type: "POST" + }, + destroy: { + type: "POST" + }, + parameterMap: function(n, t) { + return "read" != t && (n.EntryType = "f" === n.EntryType ? 0 : 1), n + } + } + }) + } + }) + }(window.kendo.jQuery), + function(n) { + function r() { + var n, i = {}; + for (n in t) i["mvc" + n] = s(n); + return i + } + + function u() { + var n, i = {}; + for (n in t) i["mvc" + n] = h(n); + return i + } + + function f(n, t) { + var u, i, r, f = {}, + e = n.data(), + o = t.length; + for (r in e) i = r.toLowerCase(), u = i.indexOf(t), u > -1 && (i = i.substring(u + o, r.length), i && (f[i] = e[r])); + return f + } + + function e(t) { + for (var u = t.Fields || [], f = {}, i = 0, r = u.length; r > i; i++) n.extend(!0, f, o(u[i])); + return f + } + + function o(n) { + for (var i, f, o = {}, s = {}, u = n.FieldName, r = n.ValidationRules, t = 0, e = r.length; e > t; t++) i = r[t].ValidationType, f = r[t].ValidationParameters, o[u + i] = l(u, i, f), s[u + i] = c(r[t].ErrorMessage); + return { + rules: o, + messages: s + } + } + + function s(n) { + return function(t) { + return t.attr("data-val-" + n) + } + } + + function h(n) { + return function(i) { + return i.filter("[data-val-" + n + "]").length ? t[n](i, f(i, n)) : !0 + } + } + + function c(n) { + return function() { + return n + } + } + + function l(n, i, r) { + return function(u) { + return u.filter("[name=" + n + "]").length ? t[i](u, r) : !0 + } + } + + function a(n, t) { + return "string" == typeof t && (t = RegExp("^(?:" + t + ")$")), t.test(n) + } + var i = /("|\%|'|\[|\]|\$|\.|\,|\:|\;|\+|\*|\&|\!|\#|\(|\)|<|>|\=|\?|\@|\^|\{|\}|\~|\/|\||`)/g, + t = { + required: function(n) { + var f, t, r = n.val(), + u = n.filter("[type=checkbox]"); + return u.length && (f = u[0].name.replace(i, "\\$1"), t = u.next("input:hidden[name='" + f + "']"), r = t.length ? t.val() : "checked" === n.attr("checked")), !("" === r || !r) + }, + number: function(n) { + return "" === n.val() || null !== kendo.parseFloat(n.val()) + }, + regex: function(n, t) { + return "" !== n.val() ? a(n.val(), t.pattern) : !0 + }, + range: function(n, t) { + return "" !== n.val() ? this.min(n, t) && this.max(n, t) : !0 + }, + min: function(n, t) { + var i = parseFloat(t.min) || 0, + r = kendo.parseFloat(n.val()); + return r >= i + }, + max: function(n, t) { + var i = parseFloat(t.max) || 0, + r = kendo.parseFloat(n.val()); + return i >= r + }, + date: function(n) { + return "" === n.val() || null !== kendo.parseDate(n.val()) + }, + length: function(t, i) { + if ("" !== t.val()) { + var r = n.trim(t.val()).length; + return (!i.min || r >= (i.min || 0)) && (!i.max || r <= (i.max || 0)) + } + return !0 + } + }; + n.extend(!0, kendo.ui.validator, { + rules: u(), + messages: r(), + messageLocators: { + mvcLocator: { + locate: function(n, t) { + return t = t.replace(i, "\\$1"), n.find(".field-validation-valid[data-valmsg-for=" + t + "], .field-validation-error[data-valmsg-for=" + t + "]") + }, + decorate: function(n, t) { + n.addClass("field-validation-error").attr("data-valmsg-for", t || "") + } + }, + mvcMetadataLocator: { + locate: function(n, t) { + return t = t.replace(i, "\\$1"), n.find("#" + t + "_validationMessage.field-validation-valid") + }, + decorate: function(n, t) { + n.addClass("field-validation-error").attr("id", t + "_validationMessage") + } + } + }, + ruleResolvers: { + mvcMetaDataResolver: { + resolve: function(t) { + var i, r = window.mvcClientValidationMetadata || []; + if (r.length) + for (t = n(t), i = 0; i < r.length; i++) + if (r[i].FormId == t.attr("id")) return e(r[i]); + return {} + } + } + } + }) + }(window.kendo.jQuery) + }) +}("function" == typeof define && define.amd ? define : function(n, t) { + return t() +}); +! function(n) { + return n([], function() { + ! function(n) { + var t = n.kendo || (n.kendo = { + cultures: {} + }); + t.cultures["pl-PL"] = { + name: "pl-PL", + numberFormat: { + pattern: ["-n"], + decimals: 2, + ",": " ", + ".": ",", + groupSize: [3], + percent: { + pattern: ["-n%", "n%"], + decimals: 2, + ",": " ", + ".": ",", + groupSize: [3], + symbol: "%" + }, + currency: { + pattern: ["-n $", "n $"], + decimals: 2, + ",": " ", + ".": ",", + groupSize: [3], + symbol: "zł" + } + }, + calendars: { + standard: { + days: { + names: ["niedziela", "poniedziałek", "wtorek", "środa", "czwartek", "piątek", "sobota"], + namesAbbr: ["N", "Pn", "Wt", "Śr", "Cz", "Pt", "So"], + namesShort: ["N", "Pn", "Wt", "Śr", "Cz", "Pt", "So"] + }, + months: { + names: ["styczeń", "luty", "marzec", "kwiecień", "maj", "czerwiec", "lipiec", "sierpień", "wrzesień", "październik", "listopad", "grudzień", ""], + namesAbbr: ["sty", "lut", "mar", "kwi", "maj", "cze", "lip", "sie", "wrz", "paź", "lis", "gru", ""] + }, + AM: [""], + PM: [""], + patterns: { + d: "yyyy-MM-dd", + D: "d MMMM yyyy", + F: "d MMMM yyyy HH:mm:ss", + g: "yyyy-MM-dd HH:mm", + G: "yyyy-MM-dd HH:mm:ss", + m: "d MMMM", + M: "d MMMM", + s: "yyyy'-'MM'-'dd'T'HH':'mm':'ss", + t: "HH:mm", + T: "HH:mm:ss", + u: "yyyy'-'MM'-'dd HH':'mm':'ss'Z'", + y: "MMMM yyyy", + Y: "MMMM yyyy" + }, + "/": "-", + ":": ":", + firstDay: 1 + } + } + } + }(this) + }) +}("function" == typeof define && define.amd ? define : function(n, t) { + return t() +}), +function() { + function n(n) { + return function() { + return n + } + }(function(t) { + var u = this || eval("this"), + r = u.document, + e = u.navigator, + i = u.jQuery, + f = u.JSON; + (function(n) { + "function" == typeof require && "object" == typeof exports && "object" == typeof module ? n(module.exports || exports) : "function" == typeof define && define.amd ? define(["exports"], n) : n(u.ko = {}) + })(function(o) { + function c(n, t, i, r) { + s.d[n] = { + init: function(n) { + return s.a.f.set(n, a, {}), { + controlsDescendantBindings: !0 + } + }, + update: function(n, u, f, e, o) { + f = s.a.f.get(n, a); + u = s.a.c(u()); + e = !i != !u; + var h = !f.fb; + (h || t || e !== f.vb) && (h && (f.fb = s.a.Oa(s.e.childNodes(n), !0)), e ? (h || s.e.P(n, s.a.Oa(f.fb)), s.Ja(r ? r(o, u) : o, n)) : s.e.ba(n), f.vb = e) + } + }; + s.g.S[n] = !1; + s.e.L[n] = !0 + } + + function v(n, t, i) { + i && t !== s.h.n(n) && s.h.W(n, t); + t !== s.h.n(n) && s.q.I(s.a.Ga, null, [n, "change"]) + } + var s = "undefined" != typeof o ? o : {}, + y, h, l, a; + s.b = function(n, t) { + for (var i = n.split("."), r = s, u = 0; u < i.length - 1; u++) r = r[i[u]]; + r[i[i.length - 1]] = t + }; + s.r = function(n, t, i) { + n[t] = i + }; + s.version = "2.3.0"; + s.b("version", s.version); + s.a = function() { + function o(n, t) { + for (var i in n) n.hasOwnProperty(i) && t(i, n[i]) + } + + function h(n, t) { + if ("input" !== s.a.u(n) || !n.type || "click" != t.toLowerCase()) return !1; + var i = n.type; + return "checkbox" == i || "radio" == i + } + var c = {}, + l = {}, + a, n; + return c[e && /Firefox\/2/i.test(e.userAgent) ? "KeyboardEvent" : "UIEvents"] = ["keyup", "keydown", "keypress"], c.MouseEvents = "click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave".split(" "), o(c, function(n, t) { + if (t.length) + for (var i = 0, r = t.length; i < r; i++) l[t[i]] = n + }), a = { + propertychange: !0 + }, n = r && function() { + for (var n = 3, i = r.createElement("div"), u = i.getElementsByTagName("i"); i.innerHTML = "<!--[if gt IE " + ++n + "]><i><\/i><![endif]-->", u[0];); + return 4 < n ? n : t + }(), { + Ta: ["authenticity_token", /^__RequestVerificationToken(_.*)?$/], + p: function(n, t) { + for (var i = 0, r = n.length; i < r; i++) t(n[i]) + }, + k: function(n, t) { + if ("function" == typeof Array.prototype.indexOf) return Array.prototype.indexOf.call(n, t); + for (var i = 0, r = n.length; i < r; i++) + if (n[i] === t) return i; + return -1 + }, + La: function(n, t, i) { + for (var r = 0, u = n.length; r < u; r++) + if (t.call(i, n[r])) return n[r]; + return null + }, + ka: function(n, t) { + var i = s.a.k(n, t); + 0 <= i && n.splice(i, 1) + }, + Ma: function(n) { + n = n || []; + for (var i = [], t = 0, r = n.length; t < r; t++) 0 > s.a.k(i, n[t]) && i.push(n[t]); + return i + }, + Z: function(n, t) { + n = n || []; + for (var r = [], i = 0, u = n.length; i < u; i++) r.push(t(n[i])); + return r + }, + Y: function(n, t) { + n = n || []; + for (var r = [], i = 0, u = n.length; i < u; i++) t(n[i]) && r.push(n[i]); + return r + }, + R: function(n, t) { + if (t instanceof Array) n.push.apply(n, t); + else + for (var i = 0, r = t.length; i < r; i++) n.push(t[i]); + return n + }, + ja: function(n, t, i) { + var r = n.indexOf ? n.indexOf(t) : s.a.k(n, t); + 0 > r ? i && n.push(t) : i || n.splice(r, 1) + }, + extend: function(n, t) { + if (t) + for (var i in t) t.hasOwnProperty(i) && (n[i] = t[i]); + return n + }, + w: o, + oa: function(n) { + for (; n.firstChild;) s.removeNode(n.firstChild) + }, + Mb: function(n) { + n = s.a.N(n); + for (var i = r.createElement("div"), t = 0, u = n.length; t < u; t++) i.appendChild(s.H(n[t])); + return i + }, + Oa: function(n, t) { + for (var r, i = 0, f = n.length, u = []; i < f; i++) r = n[i].cloneNode(!0), u.push(t ? s.H(r) : r); + return u + }, + P: function(n, t) { + if (s.a.oa(n), t) + for (var i = 0, r = t.length; i < r; i++) n.appendChild(t[i]) + }, + eb: function(n, t) { + var r = n.nodeType ? [n] : n; + if (0 < r.length) { + for (var f = r[0], e = f.parentNode, i = 0, u = t.length; i < u; i++) e.insertBefore(t[i], f); + for (i = 0, u = r.length; i < u; i++) s.removeNode(r[i]) + } + }, + hb: function(t, i) { + 7 > n ? t.setAttribute("selected", i) : t.selected = i + }, + F: function(n) { + return null === n || n === t ? "" : n.trim ? n.trim() : n.toString().replace(/^[\s\xa0]+|[\s\xa0]+$/g, "") + }, + Wb: function(n, t) { + for (var r, u = [], f = (n || "").split(t), i = 0, e = f.length; i < e; i++) r = s.a.F(f[i]), "" !== r && u.push(r); + return u + }, + Tb: function(n, t) { + return n = n || "", t.length > n.length ? !1 : n.substring(0, t.length) === t + }, + yb: function(n, t) { + if (t.compareDocumentPosition) return 16 == (t.compareDocumentPosition(n) & 16); + for (; null != n;) { + if (n == t) return !0; + n = n.parentNode + } + return !1 + }, + aa: function(n) { + return s.a.yb(n, n.ownerDocument) + }, + pb: function(n) { + return !!s.a.La(n, s.a.aa) + }, + u: function(n) { + return n && n.tagName && n.tagName.toLowerCase() + }, + o: function(t, r, u) { + var o = n && a[r], + f, e, c; + if (o || "undefined" == typeof i) + if (o || "function" != typeof t.addEventListener) + if ("undefined" != typeof t.attachEvent) f = function(n) { + u.call(t, n) + }, e = "on" + r, t.attachEvent(e, f), s.a.C.ia(t, function() { + t.detachEvent(e, f) + }); + else throw Error("Browser doesn't support addEventListener or attachEvent"); + else t.addEventListener(r, u, !1); + else h(t, r) && (c = u, u = function(n, t) { + var i = this.checked; + t && (this.checked = !0 !== t.sb); + c.call(this, n); + this.checked = i + }), i(t).bind(r, u) + }, + Ga: function(n, t) { + if (!n || !n.nodeType) throw Error("element must be a DOM node when calling triggerEvent"); + if ("undefined" != typeof i) { + var f = []; + h(n, t) && f.push({ + sb: n.checked + }); + i(n).trigger(t, f) + } else if ("function" == typeof r.createEvent) + if ("function" == typeof n.dispatchEvent) f = r.createEvent(l[t] || "HTMLEvents"), f.initEvent(t, !0, !0, u, 0, 0, 0, 0, 0, !1, !1, !1, !1, 0, n), n.dispatchEvent(f); + else throw Error("The supplied element doesn't support dispatchEvent"); + else if ("undefined" != typeof n.fireEvent) h(n, t) && (n.checked = !0 !== n.checked), n.fireEvent("on" + t); + else throw Error("Browser doesn't support triggering events"); + }, + c: function(n) { + return s.T(n) ? n() : n + }, + ya: function(n) { + return s.T(n) ? n.t() : n + }, + ga: function(n, t, i) { + if (t) { + var r = /\S+/g, + u = n.className.match(r) || []; + s.a.p(t.match(r), function(n) { + s.a.ja(u, n, i) + }); + n.className = u.join(" ") + } + }, + ib: function(n, i) { + var u = s.a.c(i), + f; + (null === u || u === t) && (u = ""); + f = s.e.firstChild(n); + !f || 3 != f.nodeType || s.e.nextSibling(f) ? s.e.P(n, [r.createTextNode(u)]) : f.data = u; + s.a.Bb(n) + }, + gb: function(t, i) { + if (t.name = i, 7 >= n) try { + t.mergeAttributes(r.createElement("<input name='" + t.name + "'/>"), !1) + } catch (u) {} + }, + Bb: function(t) { + 9 <= n && (t = 1 == t.nodeType ? t : t.parentNode, t.style && (t.style.zoom = t.style.zoom)) + }, + zb: function(t) { + if (n) { + var i = t.style.width; + t.style.width = 0; + t.style.width = i + } + }, + Qb: function(n, t) { + n = s.a.c(n); + t = s.a.c(t); + for (var r = [], i = n; i <= t; i++) r.push(i); + return r + }, + N: function(n) { + for (var i = [], t = 0, r = n.length; t < r; t++) i.push(n[t]); + return i + }, + Ub: 6 === n, + Vb: 7 === n, + ca: n, + Ua: function(n, t) { + for (var r = s.a.N(n.getElementsByTagName("input")).concat(s.a.N(n.getElementsByTagName("textarea"))), f = "string" == typeof t ? function(n) { + return n.name === t + } : function(n) { + return t.test(n.name) + }, u = [], i = r.length - 1; 0 <= i; i--) f(r[i]) && u.push(r[i]); + return u + }, + Nb: function(n) { + return "string" == typeof n && (n = s.a.F(n)) ? f && f.parse ? f.parse(n) : new Function("return " + n)() : null + }, + Ca: function(n, t, i) { + if (!f || !f.stringify) throw Error("Cannot find JSON.stringify(). Some browsers (e.g., IE < 8) don't support it natively, but you can overcome this by adding a script reference to json2.js, downloadable from http://www.json.org/json2.js"); + return f.stringify(s.a.c(n), t, i) + }, + Ob: function(n, t, i) { + var v, e, h, f, u, c; + i = i || {}; + var l = i.params || {}, + a = i.includeFields || this.Ta, + v = n; + if ("object" == typeof n && "form" === s.a.u(n)) + for (v = n.action, e = a.length - 1; 0 <= e; e--) + for (h = s.a.Ua(n, a[e]), f = h.length - 1; 0 <= f; f--) l[h[f].name] = h[f].value; + t = s.a.c(t); + u = r.createElement("form"); + u.style.display = "none"; + u.action = v; + u.method = "post"; + for (c in t) n = r.createElement("input"), n.name = c, n.value = s.a.Ca(s.a.c(t[c])), u.appendChild(n); + o(l, function(n, t) { + var i = r.createElement("input"); + i.name = n; + i.value = t; + u.appendChild(i) + }); + r.body.appendChild(u); + i.submitter ? i.submitter(u) : u.submit(); + setTimeout(function() { + u.parentNode.removeChild(u) + }, 0) + } + } + }(); + s.b("utils", s.a); + s.b("utils.arrayForEach", s.a.p); + s.b("utils.arrayFirst", s.a.La); + s.b("utils.arrayFilter", s.a.Y); + s.b("utils.arrayGetDistinctValues", s.a.Ma); + s.b("utils.arrayIndexOf", s.a.k); + s.b("utils.arrayMap", s.a.Z); + s.b("utils.arrayPushAll", s.a.R); + s.b("utils.arrayRemoveItem", s.a.ka); + s.b("utils.extend", s.a.extend); + s.b("utils.fieldsIncludedWithJsonPost", s.a.Ta); + s.b("utils.getFormFields", s.a.Ua); + s.b("utils.peekObservable", s.a.ya); + s.b("utils.postJson", s.a.Ob); + s.b("utils.parseJson", s.a.Nb); + s.b("utils.registerEventHandler", s.a.o); + s.b("utils.stringifyJson", s.a.Ca); + s.b("utils.range", s.a.Qb); + s.b("utils.toggleDomNodeCssClass", s.a.ga); + s.b("utils.triggerEvent", s.a.Ga); + s.b("utils.unwrapObservable", s.a.c); + s.b("utils.objectForEach", s.a.w); + s.b("utils.addOrRemoveItem", s.a.ja); + s.b("unwrap", s.a.c); + Function.prototype.bind || (Function.prototype.bind = function(n) { + var i = this, + t = Array.prototype.slice.call(arguments); + return n = t.shift(), + function() { + return i.apply(n, t.concat(Array.prototype.slice.call(arguments))) + } + }); + s.a.f = new function() { + var r = 0, + n = "__ko__" + (new Date).getTime(), + i = {}; + return { + get: function(n, i) { + var r = s.a.f.pa(n, !1); + return r === t ? t : r[i] + }, + set: function(n, i, r) { + (r !== t || s.a.f.pa(n, !1) !== t) && (s.a.f.pa(n, !0)[i] = r) + }, + pa: function(u, f) { + var e = u[n]; + if (!e || "null" === e || !i[e]) { + if (!f) return t; + e = u[n] = "ko" + r++; + i[e] = {} + } + return i[e] + }, + clear: function(t) { + var r = t[n]; + return r ? (delete i[r], t[n] = null, !0) : !1 + } + } + }; + s.b("utils.domData", s.a.f); + s.b("utils.domData.clear", s.a.f.clear); + s.a.C = new function() { + function n(n, i) { + var r = s.a.f.get(n, u); + return r === t && i && (r = [], s.a.f.set(n, u, r)), r + } + + function r(t) { + var u = n(t, !1), + e; + if (u) + for (u = u.slice(0), e = 0; e < u.length; e++) u[e](t); + if (s.a.f.clear(t), "function" == typeof i && "function" == typeof i.cleanData && i.cleanData([t]), f[t.nodeType]) + for (u = t.firstChild; t = u;) u = t.nextSibling, 8 === t.nodeType && r(t) + } + var u = "__ko_domNodeDisposal__" + (new Date).getTime(), + e = { + 1: !0, + 8: !0, + 9: !0 + }, + f = { + 1: !0, + 9: !0 + }; + return { + ia: function(t, i) { + if ("function" != typeof i) throw Error("Callback must be a function"); + n(t, !0).push(i) + }, + cb: function(i, r) { + var f = n(i, !1); + f && (s.a.ka(f, r), 0 == f.length && s.a.f.set(i, u, t)) + }, + H: function(n) { + var t, i, u; + if (e[n.nodeType] && (r(n), f[n.nodeType])) + for (t = [], s.a.R(t, n.getElementsByTagName("*")), i = 0, u = t.length; i < u; i++) r(t[i]); + return n + }, + removeNode: function(n) { + s.H(n); + n.parentNode && n.parentNode.removeChild(n) + } + } + }; + s.H = s.a.C.H; + s.removeNode = s.a.C.removeNode; + s.b("cleanNode", s.H); + s.b("removeNode", s.removeNode); + s.b("utils.domNodeDisposal", s.a.C); + s.b("utils.domNodeDisposal.addDisposeCallback", s.a.C.ia); + s.b("utils.domNodeDisposal.removeDisposeCallback", s.a.C.cb), + function() { + s.a.xa = function(n) { + var t, f; + if ("undefined" != typeof i) { + if (i.parseHTML) t = i.parseHTML(n) || []; + else if ((t = i.clean([n])) && t[0]) { + for (n = t[0]; n.parentNode && 11 !== n.parentNode.nodeType;) n = n.parentNode; + n.parentNode && n.parentNode.removeChild(n) + } + } else { + for (f = s.a.F(n).toLowerCase(), t = r.createElement("div"), f = f.match(/^<(thead|tbody|tfoot)/) && [1, "<table>", "<\/table>"] || !f.indexOf("<tr") && [2, "<table><tbody>", "<\/tbody><\/table>"] || (!f.indexOf("<td") || !f.indexOf("<th")) && [3, "<table><tbody><tr>", "<\/tr><\/tbody><\/table>"] || [0, "", ""], n = "ignored<div>" + f[1] + n + f[2] + "<\/div>", "function" == typeof u.innerShiv ? t.appendChild(u.innerShiv(n)) : t.innerHTML = n; f[0]--;) t = t.lastChild; + t = s.a.N(t.lastChild.childNodes) + } + return t + }; + s.a.fa = function(n, r) { + if (s.a.oa(n), r = s.a.c(r), null !== r && r !== t) + if ("string" != typeof r && (r = r.toString()), "undefined" != typeof i) i(n).html(r); + else + for (var f = s.a.xa(r), u = 0; u < f.length; u++) n.appendChild(f[u]) + } + }(); + s.b("utils.parseHtmlFragment", s.a.xa); + s.b("utils.setHtml", s.a.fa); + s.s = function() { + function i(n, t) { + var r; + if (n) + if (8 == n.nodeType) r = s.s.$a(n.nodeValue), null != r && t.push({ + xb: n, + Kb: r + }); + else if (1 == n.nodeType) + for (var r = 0, u = n.childNodes, f = u.length; r < f; r++) i(u[r], t) + } + var n = {}; + return { + va: function(t) { + if ("function" != typeof t) throw Error("You can only pass a function to ko.memoization.memoize()"); + var i = (4294967296 * (1 + Math.random()) | 0).toString(16).substring(1) + (4294967296 * (1 + Math.random()) | 0).toString(16).substring(1); + return n[i] = t, "<!--[ko_memo:" + i + "]-->" + }, + mb: function(i, r) { + var u = n[i]; + if (u === t) throw Error("Couldn't find any memo with ID " + i + ". Perhaps it's already been unmemoized."); + try { + return u.apply(null, r || []), !0 + } finally { + delete n[i] + } + }, + nb: function(n, t) { + var f = [], + u, o, r, e; + for (i(n, f), u = 0, o = f.length; u < o; u++) r = f[u].xb, e = [r], t && s.a.R(e, t), s.s.mb(f[u].Kb, e), r.nodeValue = "", r.parentNode && r.parentNode.removeChild(r) + }, + $a: function(n) { + return (n = n.match(/^\[ko_memo\:(.*?)\]$/)) ? n[1] : null + } + } + }(); + s.b("memoization", s.s); + s.b("memoization.memoize", s.s.va); + s.b("memoization.unmemoize", s.s.mb); + s.b("memoization.parseMemoText", s.s.$a); + s.b("memoization.unmemoizeDomNodeAndDescendants", s.s.nb); + s.Sa = { + throttle: function(n, t) { + n.throttleEvaluation = t; + var i = null; + return s.j({ + read: n, + write: function(r) { + clearTimeout(i); + i = setTimeout(function() { + n(r) + }, t) + } + }) + }, + notify: function(t, i) { + return t.equalityComparer = "always" == i ? n(!1) : s.m.fn.equalityComparer, t + } + }; + s.b("extenders", s.Sa); + s.kb = function(n, t, i) { + this.target = n; + this.la = t; + this.wb = i; + s.r(this, "dispose", this.B) + }; + s.kb.prototype.B = function() { + this.Hb = !0; + this.wb() + }; + s.V = function() { + this.G = {}; + s.a.extend(this, s.V.fn); + s.r(this, "subscribe", this.Da); + s.r(this, "extend", this.extend); + s.r(this, "getSubscriptionsCount", this.Db) + }; + s.V.fn = { + Da: function(n, t, i) { + i = i || "change"; + var r = new s.kb(this, t ? n.bind(t) : n, function() { + s.a.ka(this.G[i], r) + }.bind(this)); + return this.G[i] || (this.G[i] = []), this.G[i].push(r), r + }, + notifySubscribers: function(n, t) { + t = t || "change"; + this.G[t] && s.q.I(function() { + s.a.p(this.G[t].slice(0), function(t) { + t && !0 !== t.Hb && t.la(n) + }) + }, this) + }, + Db: function() { + var n = 0; + return s.a.w(this.G, function(t, i) { + n += i.length + }), n + }, + extend: function(n) { + var t = this; + return n && s.a.w(n, function(n, i) { + var r = s.Sa[n]; + "function" == typeof r && (t = r(t, i)) + }), t + } + }; + s.Wa = function(n) { + return null != n && "function" == typeof n.Da && "function" == typeof n.notifySubscribers + }; + s.b("subscribable", s.V); + s.b("isSubscribable", s.Wa); + s.q = function() { + var n = []; + return { + rb: function(t) { + n.push({ + la: t, + Ra: [] + }) + }, + end: function() { + n.pop() + }, + bb: function(t) { + if (!s.Wa(t)) throw Error("Only subscribable things can act as dependencies"); + if (0 < n.length) { + var i = n[n.length - 1]; + !i || 0 <= s.a.k(i.Ra, t) || (i.Ra.push(t), i.la(t)) + } + }, + I: function(t, i, r) { + try { + return n.push(null), t.apply(i, r || []) + } finally { + n.pop() + } + } + } + }(); + y = { + undefined: !0, + boolean: !0, + number: !0, + string: !0 + }; + s.m = function(n) { + function t() { + return 0 < arguments.length ? (t.equalityComparer && t.equalityComparer(i, arguments[0]) || (t.K(), i = arguments[0], t.J()), this) : (s.q.bb(t), i) + } + var i = n; + return s.V.call(t), t.t = function() { + return i + }, t.J = function() { + t.notifySubscribers(i) + }, t.K = function() { + t.notifySubscribers(i, "beforeChange") + }, s.a.extend(t, s.m.fn), s.r(t, "peek", t.t), s.r(t, "valueHasMutated", t.J), s.r(t, "valueWillMutate", t.K), t + }; + s.m.fn = { + equalityComparer: function(n, t) { + return null === n || typeof n in y ? n === t : !1 + } + }; + h = s.m.Pb = "__ko_proto__"; + s.m.fn[h] = s.m; + s.qa = function(n, i) { + return null === n || n === t || n[h] === t ? !1 : n[h] === i ? !0 : s.qa(n[h], i) + }; + s.T = function(n) { + return s.qa(n, s.m) + }; + s.Xa = function(n) { + return "function" == typeof n && n[h] === s.m || "function" == typeof n && n[h] === s.j && n.Eb ? !0 : !1 + }; + s.b("observable", s.m); + s.b("isObservable", s.T); + s.b("isWriteableObservable", s.Xa); + s.U = function(n) { + if (n = n || [], "object" != typeof n || !("length" in n)) throw Error("The argument passed when initializing an observable array must be an array, or null, or undefined."); + return n = s.m(n), s.a.extend(n, s.U.fn), n + }; + s.U.fn = { + remove: function(n) { + for (var u, r = this.t(), i = [], f = "function" == typeof n ? n : function(t) { + return t === n + }, t = 0; t < r.length; t++) u = r[t], f(u) && (0 === i.length && this.K(), i.push(u), r.splice(t, 1), t--); + return i.length && this.J(), i + }, + removeAll: function(n) { + if (n === t) { + var i = this.t(), + r = i.slice(0); + return this.K(), i.splice(0, i.length), this.J(), r + } + return n ? this.remove(function(t) { + return 0 <= s.a.k(n, t) + }) : [] + }, + destroy: function(n) { + var i = this.t(), + r = "function" == typeof n ? n : function(t) { + return t === n + }, + t; + for (this.K(), t = i.length - 1; 0 <= t; t--) r(i[t]) && (i[t]._destroy = !0); + this.J() + }, + destroyAll: function(i) { + return i === t ? this.destroy(n(!0)) : i ? this.destroy(function(n) { + return 0 <= s.a.k(i, n) + }) : [] + }, + indexOf: function(n) { + var t = this(); + return s.a.k(t, n) + }, + replace: function(n, t) { + var i = this.indexOf(n); + 0 <= i && (this.K(), this.t()[i] = t, this.J()) + } + }; + s.a.p("pop push reverse shift sort splice unshift".split(" "), function(n) { + s.U.fn[n] = function() { + var t = this.t(); + return this.K(), t = t[n].apply(t, arguments), this.J(), t + } + }); + s.a.p(["slice"], function(n) { + s.U.fn[n] = function() { + var t = this(); + return t[n].apply(t, arguments) + } + }); + s.b("observableArray", s.U); + s.j = function(i, r, u) { + function w() { + s.a.p(o, function(n) { + n.B() + }); + o = [] + } + + function nt() { + var n = f.throttleEvaluation; + n && 0 <= n ? (clearTimeout(d), d = setTimeout(c, n)) : c() + } + + function c() { + var n, u, i; + if (!y) + if (a && p()) h(); + else { + y = !0; + try { + for (n = s.a.Z(o, function(n) { + return n.target + }), s.q.rb(function(i) { + var r; + 0 <= (r = s.a.k(n, i)) ? n[r] = t : o.push(i.Da(nt)) + }), u = e.call(r), i = n.length - 1; 0 <= i; i--) n[i] && o.splice(i, 1)[0].B(); + a = !0; + f.notifySubscribers(l, "beforeChange"); + l = u; + f.notifySubscribers(l) + } finally { + s.q.end(); + y = !1 + } + o.length || h() + } + } + + function f() { + if (0 < arguments.length) { + if ("function" == typeof k) k.apply(r, arguments); + else throw Error("Cannot write a value to a ko.computed unless you specify a 'write' option. If you wish to read the current value, don't pass any parameters."); + return this + } + return a || c(), s.q.bb(f), l + } + + function b() { + return !a || 0 < o.length + } + var l, a = !1, + y = !1, + e = i, + g, p; + if (e && "object" == typeof e ? (u = e, e = u.read) : (u = u || {}, e || (e = u.read)), "function" != typeof e) throw Error("Pass a function that returns the value of the ko.computed"); + var k = u.write, + v = u.disposeWhenNodeIsRemoved || u.$ || null, + p = u.disposeWhen || u.Qa || n(!1), + h = w, + o = [], + d = null; + return r || (r = u.owner), f.t = function() { + return a || c(), l + }, f.Cb = function() { + return o.length + }, f.Eb = "function" == typeof u.write, f.B = function() { + h() + }, f.ta = b, s.V.call(f), s.a.extend(f, s.j.fn), s.r(f, "peek", f.t), s.r(f, "dispose", f.B), s.r(f, "isActive", f.ta), s.r(f, "getDependenciesCount", f.Cb), !0 !== u.deferEvaluation && c(), v && b() && (h = function() { + s.a.C.cb(v, h); + w() + }, s.a.C.ia(v, h), g = p, p = function() { + return !s.a.aa(v) || g() + }), f + }; + s.Gb = function(n) { + return s.qa(n, s.j) + }; + o = s.m.Pb; + s.j[o] = s.m; + s.j.fn = {}; + s.j.fn[o] = s.j; + s.b("dependentObservable", s.j); + s.b("computed", s.j); + s.b("isComputed", s.Gb), + function() { + function n(u, f, e) { + if (e = e || new i, u = f(u), "object" != typeof u || null === u || u === t || u instanceof Date || u instanceof String || u instanceof Number || u instanceof Boolean) return u; + var o = u instanceof Array ? [] : {}; + return e.save(u, o), r(u, function(i) { + var r = f(u[i]), + s; + switch (typeof r) { + case "boolean": + case "number": + case "string": + case "function": + o[i] = r; + break; + case "object": + case "undefined": + s = e.get(r); + o[i] = s !== t ? s : n(r, f, e) + } + }), o + } + + function r(n, t) { + if (n instanceof Array) { + for (var i = 0; i < n.length; i++) t(i); + "function" == typeof n.toJSON && t("toJSON") + } else + for (i in n) t(i) + } + + function i() { + this.keys = []; + this.Ha = [] + } + s.lb = function(t) { + if (0 == arguments.length) throw Error("When calling ko.toJS, pass the object you want to convert."); + return n(t, function(n) { + for (var t = 0; s.T(n) && 10 > t; t++) n = n(); + return n + }) + }; + s.toJSON = function(n, t, i) { + return n = s.lb(n), s.a.Ca(n, t, i) + }; + i.prototype = { + save: function(n, t) { + var i = s.a.k(this.keys, n); + 0 <= i ? this.Ha[i] = t : (this.keys.push(n), this.Ha.push(t)) + }, + get: function(n) { + return n = s.a.k(this.keys, n), 0 <= n ? this.Ha[n] : t + } + } + }(); + s.b("toJS", s.lb); + s.b("toJSON", s.toJSON), + function() { + s.h = { + n: function(n) { + switch (s.a.u(n)) { + case "option": + return !0 === n.__ko__hasDomDataOptionValue__ ? s.a.f.get(n, s.d.options.wa) : 7 >= s.a.ca ? n.getAttributeNode("value") && n.getAttributeNode("value").specified ? n.value : n.text : n.value; + case "select": + return 0 <= n.selectedIndex ? s.h.n(n.options[n.selectedIndex]) : t; + default: + return n.value + } + }, + W: function(n, i) { + switch (s.a.u(n)) { + case "option": + switch (typeof i) { + case "string": + s.a.f.set(n, s.d.options.wa, t); + "__ko__hasDomDataOptionValue__" in n && delete n.__ko__hasDomDataOptionValue__; + n.value = i; + break; + default: + s.a.f.set(n, s.d.options.wa, i); + n.__ko__hasDomDataOptionValue__ = !0; + n.value = "number" == typeof i ? i : "" + } + break; + case "select": + "" === i && (i = t); + (null === i || i === t) && (n.selectedIndex = -1); + for (var r = n.options.length - 1; 0 <= r; r--) + if (s.h.n(n.options[r]) == i) { + n.selectedIndex = r; + break + } + 1 < n.size || -1 !== n.selectedIndex || (n.selectedIndex = 0); + break; + default: + (null === i || i === t) && (i = ""); + n.value = i + } + } + } + }(); + s.b("selectExtensions", s.h); + s.b("selectExtensions.readValue", s.h.n); + s.b("selectExtensions.writeValue", s.h.W); + s.g = function() { + function n(n, i) { + for (var r = null; n != r;) r = n, n = n.replace(t, function(n, t) { + return i[t] + }); + return n + } + var t = /\@ko_token_(\d+)\@/g, + i = ["true", "false", "null", "undefined"], + r = /^(?:[$_a-z][$\w]*|(.+)(\.\s*[$_a-z][$\w]*|\[.+\]))$/i; + return { + S: [], + da: function(t) { + var i = s.a.F(t), + f, e, r, u; + if (3 > i.length) return []; + for ("{" === i.charAt(0) && (i = i.substring(1, i.length - 1)), t = [], f = null, r = 0; r < i.length; r++) + if (u = i.charAt(r), null === f) switch (u) { + case '"': + case "'": + case "/": + f = r; + e = u + } else if (u == e && "\\" !== i.charAt(r - 1)) { + u = i.substring(f, r + 1); + t.push(u); + var c = "@ko_token_" + (t.length - 1) + "@", + i = i.substring(0, f) + c + i.substring(r + 1), + r = r - (u.length - c.length), + f = null + } + e = f = null; + for (var o = 0, h = null, r = 0; r < i.length; r++) { + if (u = i.charAt(r), null === f) switch (u) { + case "{": + f = r; + h = u; + e = "}"; + break; + case "(": + f = r; + h = u; + e = ")"; + break; + case "[": + f = r; + h = u; + e = "]" + } + u === h ? o++ : u === e && (o--, 0 === o && (u = i.substring(f, r + 1), t.push(u), c = "@ko_token_" + (t.length - 1) + "@", i = i.substring(0, f) + c + i.substring(r + 1), r -= u.length - c.length, f = null)) + } + for (e = [], i = i.split(","), f = 0, r = i.length; f < r; f++) o = i[f], h = o.indexOf(":"), 0 < h && h < o.length - 1 ? (u = o.substring(h + 1), e.push({ + key: n(o.substring(0, h), t), + value: n(u, t) + })) : e.push({ + unknown: n(o, t) + }); + return e + }, + ea: function(n) { + var e = "string" == typeof n ? s.g.da(n) : n, + f = [], + t, h, o, u; + for (n = [], h = 0; t = e[h]; h++) + if (0 < f.length && f.push(","), t.key) { + n: { + o = t.key;u = s.a.F(o); + switch (u.length && u.charAt(0)) { + case "'": + case '"': + break n; + default: + o = "'" + u + "'" + } + } + t = t.value;f.push(o);f.push(":");f.push(t);t = s.a.F(t);0 <= s.a.k(i, s.a.F(t).toLowerCase()) ? t = !1 : (u = t.match(r), t = null === u ? !1 : u[1] ? "Object(" + u[1] + ")" + u[2] : t);t && (0 < n.length && n.push(", "), n.push(o + " : function(__ko_value) { " + t + " = __ko_value; }")) + } + else t.unknown && f.push(t.unknown); + return e = f.join(""), 0 < n.length && (e = e + ", '_ko_property_writers' : { " + n.join("") + " } "), e + }, + Jb: function(n, t) { + for (var i = 0; i < n.length; i++) + if (s.a.F(n[i].key) == t) return !0; + return !1 + }, + ha: function(n, t, i, r, u) { + n && s.T(n) ? !s.Xa(n) || u && n.t() === r || n(r) : (n = t()._ko_property_writers) && n[i] && n[i](r) + } + } + }(); + s.b("expressionRewriting", s.g); + s.b("expressionRewriting.bindingRewriteValidators", s.g.S); + s.b("expressionRewriting.parseObjectLiteral", s.g.da); + s.b("expressionRewriting.preProcessBindings", s.g.ea); + s.b("jsonExpressionRewriting", s.g); + s.b("jsonExpressionRewriting.insertPropertyAccessorsIntoJson", s.g.ea), + function() { + function n(n) { + return 8 == n.nodeType && (i ? n.text : n.nodeValue).match(e) + } + + function t(n) { + return 8 == n.nodeType && (i ? n.text : n.nodeValue).match(o) + } + + function u(i, r) { + for (var u = i, f = 1, e = []; u = u.nextSibling;) { + if (t(u) && (f--, 0 === f)) return e; + e.push(u); + n(u) && f++ + } + if (!r) throw Error("Cannot find closing comment tag to match: " + i.nodeValue); + return null + } + + function f(n, t) { + var i = u(n, t); + return i ? 0 < i.length ? i[i.length - 1].nextSibling : n.nextSibling : null + } + var i = r && "<!--test-->" === r.createComment("test").text, + e = i ? /^\x3c!--\s*ko(?:\s+(.+\s*\:[\s\S]*))?\s*--\x3e$/ : /^\s*ko(?:\s+(.+\s*\:[\s\S]*))?\s*$/, + o = i ? /^\x3c!--\s*\/ko\s*--\x3e$/ : /^\s*\/ko\s*$/, + h = { + ul: !0, + ol: !0 + }; + s.e = { + L: {}, + childNodes: function(t) { + return n(t) ? u(t) : t.childNodes + }, + ba: function(t) { + if (n(t)) { + t = s.e.childNodes(t); + for (var i = 0, r = t.length; i < r; i++) s.removeNode(t[i]) + } else s.a.oa(t) + }, + P: function(t, i) { + if (n(t)) { + s.e.ba(t); + for (var u = t.nextSibling, r = 0, f = i.length; r < f; r++) u.parentNode.insertBefore(i[r], u) + } else s.a.P(t, i) + }, + ab: function(t, i) { + n(t) ? t.parentNode.insertBefore(i, t.nextSibling) : t.firstChild ? t.insertBefore(i, t.firstChild) : t.appendChild(i) + }, + Va: function(t, i, r) { + r ? n(t) ? t.parentNode.insertBefore(i, r.nextSibling) : r.nextSibling ? t.insertBefore(i, r.nextSibling) : t.appendChild(i) : s.e.ab(t, i) + }, + firstChild: function(i) { + return n(i) ? !i.nextSibling || t(i.nextSibling) ? null : i.nextSibling : i.firstChild + }, + nextSibling: function(i) { + return n(i) && (i = f(i)), i.nextSibling && t(i.nextSibling) ? null : i.nextSibling + }, + ob: function(t) { + return (t = n(t)) ? t[1] : null + }, + Za: function(i) { + var o, r, u, e; + if (h[s.a.u(i)] && (o = i.firstChild, o)) + do + if (1 === o.nodeType) { + if (r = o.firstChild, u = null, r) + do u ? u.push(r) : n(r) ? (e = f(r, !0), e ? r = e : u = [r]) : t(r) && (u = [r]); while (r = r.nextSibling); + if (r = u) + for (u = o.nextSibling, e = 0; e < r.length; e++) u ? i.insertBefore(r[e], u) : i.appendChild(r[e]) + } + while (o = o.nextSibling) + } + } + }(); + s.b("virtualElements", s.e); + s.b("virtualElements.allowedBindings", s.e.L); + s.b("virtualElements.emptyNode", s.e.ba); + s.b("virtualElements.insertAfter", s.e.Va); + s.b("virtualElements.prepend", s.e.ab); + s.b("virtualElements.setDomNodeChildren", s.e.P), + function() { + s.M = function() { + this.Na = {} + }; + s.a.extend(s.M.prototype, { + nodeHasBindings: function(n) { + switch (n.nodeType) { + case 1: + return null != n.getAttribute("data-bind"); + case 8: + return null != s.e.ob(n); + default: + return !1 + } + }, + getBindings: function(n, t) { + var i = this.getBindingsString(n, t); + return i ? this.parseBindingsString(i, t, n) : null + }, + getBindingsString: function(n) { + switch (n.nodeType) { + case 1: + return n.getAttribute("data-bind"); + case 8: + return s.e.ob(n); + default: + return null + } + }, + parseBindingsString: function(n, t, i) { + var r, f, e, o; + try { + return (r = this.Na[n]) || (f = this.Na, o = "with($context){with($data||{}){return{" + s.g.ea(n) + "}}}", e = new Function("$context", "$element", o), r = f[n] = e), r(t, i) + } catch (u) { + throw u.message = "Unable to parse bindings.\nBindings value: " + n + "\nMessage: " + u.message, u; + } + } + }); + s.M.instance = new s.M + }(); + s.b("bindingProvider", s.M), + function() { + function n(n, t, r) { + for (var u = s.e.firstChild(t); t = u;) u = s.e.nextSibling(t), i(n, t, r) + } + + function i(t, i, u) { + var e = !0, + f = 1 === i.nodeType; + f && s.e.Za(i); + (f && u || s.M.instance.nodeHasBindings(i)) && (e = r(i, null, t, u).Sb); + e && n(t, i, !f) + } + + function r(n, i, r, u) { + function c(n) { + return function() { + return e[n] + } + } + + function l() { + return e + } + var o = 0, + e, h, a = s.a.f.get(n, f); + if (!i) { + if (a) throw Error("You cannot apply bindings multiple times to the same element."); + s.a.f.set(n, f, !0) + } + return s.j(function() { + var f = r && r instanceof s.A ? r : new s.A(s.a.c(r)), + v = f.$data; + !a && u && s.jb(n, f); + (e = ("function" == typeof i ? i(f, n) : i) || s.M.instance.getBindings(n, f)) && (0 === o && (o = 1, s.a.w(e, function(i) { + var r = s.d[i]; + if (r && 8 === n.nodeType && !s.e.L[i]) throw Error("The binding '" + i + "' cannot be used with virtual elements"); + if (r && "function" == typeof r.init && (r = r.init(n, c(i), l, v, f)) && r.controlsDescendantBindings) { + if (h !== t) throw Error("Multiple bindings (" + h + " and " + i + ") are trying to control descendant bindings of the same element. You cannot use these bindings together on the same element."); + h = i + } + }), o = 2), 2 === o && s.a.w(e, function(t) { + var i = s.d[t]; + i && "function" == typeof i.update && i.update(n, c(t), l, v, f) + })) + }, null, { + $: n + }), { + Sb: h === t + } + } + s.d = {}; + s.A = function(n, t, i) { + t ? (s.a.extend(this, t), this.$parentContext = t, this.$parent = t.$data, this.$parents = (t.$parents || []).slice(0), this.$parents.unshift(this.$parent)) : (this.$parents = [], this.$root = n, this.ko = s); + this.$data = n; + i && (this[i] = n) + }; + s.A.prototype.createChildContext = function(n, t) { + return new s.A(n, this, t) + }; + s.A.prototype.extend = function(n) { + var t = s.a.extend(new s.A, this); + return s.a.extend(t, n) + }; + var f = "__ko_boundElement"; + s.jb = function(n, t) { + if (2 == arguments.length) s.a.f.set(n, "__ko_bindingContext__", t); + else return s.a.f.get(n, "__ko_bindingContext__") + }; + s.Ka = function(n, t, i) { + return 1 === n.nodeType && s.e.Za(n), r(n, t, i, !0) + }; + s.Ja = function(t, i) { + 1 !== i.nodeType && 8 !== i.nodeType || n(t, i, !0) + }; + s.Ia = function(n, t) { + if (t && 1 !== t.nodeType && 8 !== t.nodeType) throw Error("ko.applyBindings: first parameter should be your view model; second parameter should be a DOM node"); + t = t || u.document.body; + i(n, t, !0) + }; + s.na = function(n) { + switch (n.nodeType) { + case 1: + case 8: + var i = s.jb(n); + if (i) return i; + if (n.parentNode) return s.na(n.parentNode) + } + return t + }; + s.ub = function(n) { + return (n = s.na(n)) ? n.$data : t + }; + s.b("bindingHandlers", s.d); + s.b("applyBindings", s.Ia); + s.b("applyBindingsToDescendants", s.Ja); + s.b("applyBindingsToNode", s.Ka); + s.b("contextFor", s.na); + s.b("dataFor", s.ub) + }(); + l = { + "class": "className", + "for": "htmlFor" + }; + s.d.attr = { + update: function(n, i) { + var r = s.a.c(i()) || {}; + s.a.w(r, function(i, r) { + r = s.a.c(r); + var u = !1 === r || null === r || r === t; + u && n.removeAttribute(i); + 8 >= s.a.ca && i in l ? (i = l[i], u ? n.removeAttribute(i) : n[i] = r) : u || n.setAttribute(i, r.toString()); + "name" === i && s.a.gb(n, u ? "" : r.toString()) + }) + } + }; + s.d.checked = { + init: function(t, i, r) { + s.a.o(t, "click", function() { + var u, n, f; + if ("checkbox" == t.type) u = t.checked; + else if ("radio" == t.type && t.checked) u = t.value; + else return; + n = i(); + f = s.a.c(n); + "checkbox" == t.type && f instanceof Array ? s.a.ja(n, t.value, t.checked) : s.g.ha(n, r, "checked", u, !0) + }); + "radio" != t.type || t.name || s.d.uniqueName.init(t, n(!0)) + }, + update: function(n, t) { + var i = s.a.c(t()); + "checkbox" == n.type ? n.checked = i instanceof Array ? 0 <= s.a.k(i, n.value) : i : "radio" == n.type && (n.checked = n.value == i) + } + }; + s.d.css = { + update: function(n, t) { + var i = s.a.c(t()); + "object" == typeof i ? s.a.w(i, function(t, i) { + i = s.a.c(i); + s.a.ga(n, t, i) + }) : (i = String(i || ""), s.a.ga(n, n.__ko__cssValue, !1), n.__ko__cssValue = i, s.a.ga(n, i, !0)) + } + }; + s.d.enable = { + update: function(n, t) { + var i = s.a.c(t()); + i && n.disabled ? n.removeAttribute("disabled") : i || n.disabled || (n.disabled = !0) + } + }; + s.d.disable = { + update: function(n, t) { + s.d.enable.update(n, function() { + return !s.a.c(t()) + }) + } + }; + s.d.event = { + init: function(n, t, i, r) { + var u = t() || {}; + s.a.w(u, function(u) { + "string" == typeof u && s.a.o(n, u, function(n) { + var e, o = t()[u], + h, f; + if (o) { + h = i(); + try { + f = s.a.N(arguments); + f.unshift(r); + e = o.apply(r, f) + } finally { + !0 !== e && (n.preventDefault ? n.preventDefault() : n.returnValue = !1) + }!1 === h[u + "Bubble"] && (n.cancelBubble = !0, n.stopPropagation && n.stopPropagation()) + } + }) + }) + } + }; + s.d.foreach = { + Ya: function(n) { + return function() { + var i = n(), + t = s.a.ya(i); + return !t || "number" == typeof t.length ? { + foreach: i, + templateEngine: s.D.sa + } : (s.a.c(i), { + foreach: t.data, + as: t.as, + includeDestroyed: t.includeDestroyed, + afterAdd: t.afterAdd, + beforeRemove: t.beforeRemove, + afterRender: t.afterRender, + beforeMove: t.beforeMove, + afterMove: t.afterMove, + templateEngine: s.D.sa + }) + } + }, + init: function(n, t) { + return s.d.template.init(n, s.d.foreach.Ya(t)) + }, + update: function(n, t, i, r, u) { + return s.d.template.update(n, s.d.foreach.Ya(t), i, r, u) + } + }; + s.g.S.foreach = !1; + s.e.L.foreach = !0; + s.d.hasfocus = { + init: function(n, t, i) { + function r(r) { + var u, f; + if (n.__ko_hasfocusUpdating = !0, u = n.ownerDocument, "activeElement" in u) { + try { + f = u.activeElement + } catch (e) { + f = u.body + } + r = f === n + } + u = t(); + s.g.ha(u, i, "hasfocus", r, !0); + n.__ko_hasfocusLastValue = r; + n.__ko_hasfocusUpdating = !1 + } + var u = r.bind(null, !0), + f = r.bind(null, !1); + s.a.o(n, "focus", u); + s.a.o(n, "focusin", u); + s.a.o(n, "blur", f); + s.a.o(n, "focusout", f) + }, + update: function(n, t) { + var i = !!s.a.c(t()); + n.__ko_hasfocusUpdating || n.__ko_hasfocusLastValue === i || (i ? n.focus() : n.blur(), s.q.I(s.a.Ga, null, [n, i ? "focusin" : "focusout"])) + } + }; + s.d.hasFocus = s.d.hasfocus; + s.d.html = { + init: function() { + return { + controlsDescendantBindings: !0 + } + }, + update: function(n, t) { + s.a.fa(n, t()) + } + }; + a = "__ko_withIfBindingData"; + c("if"); + c("ifnot", !1, !0); + c("with", !0, !1, function(n, t) { + return n.createChildContext(t) + }); + s.d.options = { + init: function(n) { + if ("select" !== s.a.u(n)) throw Error("options binding applies only to SELECT elements"); + for (; 0 < n.length;) n.remove(0); + return { + controlsDescendantBindings: !0 + } + }, + update: function(n, i, u) { + function a(n, t, i) { + var r = typeof t; + return "function" == r ? t(n) : "string" == r ? n[t] : i + } + + function y(n, t) { + if (e) { + var i = 0 <= s.a.k(e, s.h.n(t[0])); + s.a.hb(t[0], i) + } + } + var p = 0 == n.length, + h = !p && n.multiple ? n.scrollTop : null, + l; + i = s.a.c(i()); + var f = u(), + w = f.optionsIncludeDestroyed, + c = {}, + o, e; + n.multiple ? e = s.a.Z(n.selectedOptions || s.a.Y(n.childNodes, function(n) { + return n.tagName && "option" === s.a.u(n) && n.selected + }), function(n) { + return s.h.n(n) + }) : 0 <= n.selectedIndex && (e = [s.h.n(n.options[n.selectedIndex])]); + i ? ("undefined" == typeof i.length && (i = [i]), l = s.a.Y(i, function(n) { + return w || n === t || null === n || !s.a.c(n._destroy) + }), "optionsCaption" in f && (o = s.a.c(f.optionsCaption), null !== o && o !== t && l.unshift(c))) : i = []; + u = y; + f.optionsAfterRender && (u = function(n, i) { + y(0, i); + s.q.I(f.optionsAfterRender, null, [i[0], n !== c ? n : t]) + }); + s.a.Aa(n, l, function(n, i, u) { + return u.length && (e = u[0].selected && [s.h.n(u[0])]), i = r.createElement("option"), n === c ? (s.a.fa(i, o), s.h.W(i, t)) : (u = a(n, f.optionsValue, n), s.h.W(i, s.a.c(u)), n = a(n, f.optionsText, u), s.a.ib(i, n)), [i] + }, null, u); + e = null; + p && "value" in f && v(n, s.a.ya(f.value), !0); + s.a.zb(n); + h && 20 < Math.abs(h - n.scrollTop) && (n.scrollTop = h) + } + }; + s.d.options.wa = "__ko.optionValueDomData__"; + s.d.selectedOptions = { + init: function(n, t, i) { + s.a.o(n, "change", function() { + var u = t(), + r = []; + s.a.p(n.getElementsByTagName("option"), function(n) { + n.selected && r.push(s.h.n(n)) + }); + s.g.ha(u, i, "selectedOptions", r) + }) + }, + update: function(n, t) { + if ("select" != s.a.u(n)) throw Error("values binding applies only to SELECT elements"); + var i = s.a.c(t()); + i && "number" == typeof i.length && s.a.p(n.getElementsByTagName("option"), function(n) { + var t = 0 <= s.a.k(i, s.h.n(n)); + s.a.hb(n, t) + }) + } + }; + s.d.style = { + update: function(n, t) { + var i = s.a.c(t() || {}); + s.a.w(i, function(t, i) { + i = s.a.c(i); + n.style[t] = i || "" + }) + } + }; + s.d.submit = { + init: function(n, t, i, r) { + if ("function" != typeof t()) throw Error("The value for a submit binding must be a function"); + s.a.o(n, "submit", function(i) { + var u, f = t(); + try { + u = f.call(r, n) + } finally { + !0 !== u && (i.preventDefault ? i.preventDefault() : i.returnValue = !1) + } + }) + } + }; + s.d.text = { + update: function(n, t) { + s.a.ib(n, t()) + } + }; + s.e.L.text = !0; + s.d.uniqueName = { + init: function(n, t) { + if (t()) { + var i = "ko_unique_" + ++s.d.uniqueName.tb; + s.a.gb(n, i) + } + } + }; + s.d.uniqueName.tb = 0; + s.d.value = { + init: function(n, t, i) { + function f() { + e = !1; + var r = t(), + u = s.h.n(n); + s.g.ha(r, i, "value", u) + } + var r = ["change"], + u = i().valueUpdate, + e = !1; + u && ("string" == typeof u && (u = [u]), s.a.R(r, u), r = s.a.Ma(r)); + !s.a.ca || "input" != n.tagName.toLowerCase() || "text" != n.type || "off" == n.autocomplete || n.form && "off" == n.form.autocomplete || -1 != s.a.k(r, "propertychange") || (s.a.o(n, "propertychange", function() { + e = !0 + }), s.a.o(n, "blur", function() { + e && f() + })); + s.a.p(r, function(t) { + var i = f; + s.a.Tb(t, "after") && (i = function() { + setTimeout(f, 0) + }, t = t.substring(5)); + s.a.o(n, t, i) + }) + }, + update: function(n, t) { + var u = "select" === s.a.u(n), + r = s.a.c(t()), + i = s.h.n(n); + r !== i && (i = function() { + s.h.W(n, r) + }, i(), u && setTimeout(i, 0)); + u && 0 < n.length && v(n, r, !1) + } + }; + s.d.visible = { + update: function(n, t) { + var i = s.a.c(t()), + r = "none" != n.style.display; + i && !r ? n.style.display = "" : !i && r && (n.style.display = "none") + } + }, + function(n) { + s.d[n] = { + init: function(t, i, r, u) { + return s.d.event.init.call(this, t, function() { + var t = {}; + return t[n] = i(), t + }, r, u) + } + } + }("click"); + s.v = function() {}; + s.v.prototype.renderTemplateSource = function() { + throw Error("Override renderTemplateSource"); + }; + s.v.prototype.createJavaScriptEvaluatorBlock = function() { + throw Error("Override createJavaScriptEvaluatorBlock"); + }; + s.v.prototype.makeTemplateSource = function(n, t) { + if ("string" == typeof n) { + t = t || r; + var i = t.getElementById(n); + if (!i) throw Error("Cannot find template with ID " + n); + return new s.l.i(i) + } + if (1 == n.nodeType || 8 == n.nodeType) return new s.l.Q(n); + throw Error("Unknown template type: " + n); + }; + s.v.prototype.renderTemplate = function(n, t, i, r) { + return n = this.makeTemplateSource(n, r), this.renderTemplateSource(n, t, i) + }; + s.v.prototype.isTemplateRewritten = function(n, t) { + return !1 === this.allowTemplateRewriting ? !0 : this.makeTemplateSource(n, t).data("isRewritten") + }; + s.v.prototype.rewriteTemplate = function(n, t, i) { + n = this.makeTemplateSource(n, i); + t = t(n.text()); + n.text(t); + n.data("isRewritten", !0) + }; + s.b("templateEngine", s.v); + s.Ea = function() { + function n(n, t, i, r) { + var o, f, u, e; + for (n = s.g.da(n), o = s.g.S, f = 0; f < n.length; f++) + if (u = n[f].key, o.hasOwnProperty(u)) + if (e = o[u], "function" == typeof e) { + if (u = e(n[f].value)) throw Error(u); + } else if (!e) throw Error("This template engine does not support the '" + u + "' binding within its templates"); + return i = "ko.__tr_ambtns(function($context,$element){return(function(){return{ " + s.g.ea(n) + " } })()},'" + i.toLowerCase() + "')", r.createJavaScriptEvaluatorBlock(i) + t + } + var t = /(<([a-z]+\d*)(?:\s+(?!data-bind\s*=\s*)[a-z0-9\-]+(?:=(?:\"[^\"]*\"|\'[^\']*\'))?)*\s+)data-bind\s*=\s*(["'])([\s\S]*?)\3/gi, + i = /\x3c!--\s*ko\b\s*([\s\S]*?)\s*--\x3e/g; + return { + Ab: function(n, t, i) { + t.isTemplateRewritten(n, i) || t.rewriteTemplate(n, function(n) { + return s.Ea.Lb(n, t) + }, i) + }, + Lb: function(r, u) { + return r.replace(t, function(t, i, r, f, e) { + return n(e, i, r, u) + }).replace(i, function(t, i) { + return n(i, "<!-- ko -->", "#comment", u) + }) + }, + qb: function(n, t) { + return s.s.va(function(i, r) { + var u = i.nextSibling; + u && u.nodeName.toLowerCase() === t && s.Ka(u, n, r) + }) + } + } + }(); + s.b("__tr_ambtns", s.Ea.qb), + function() { + s.l = {}; + s.l.i = function(n) { + this.i = n + }; + s.l.i.prototype.text = function() { + var n = s.a.u(this.i), + n = "script" === n ? "text" : "textarea" === n ? "value" : "innerHTML", + t; + if (0 == arguments.length) return this.i[n]; + t = arguments[0]; + "innerHTML" === n ? s.a.fa(this.i, t) : this.i[n] = t + }; + s.l.i.prototype.data = function(n) { + if (1 === arguments.length) return s.a.f.get(this.i, "templateSourceData_" + n); + s.a.f.set(this.i, "templateSourceData_" + n, arguments[1]) + }; + s.l.Q = function(n) { + this.i = n + }; + s.l.Q.prototype = new s.l.i; + s.l.Q.prototype.text = function() { + if (0 == arguments.length) { + var n = s.a.f.get(this.i, "__ko_anon_template__") || {}; + return n.Fa === t && n.ma && (n.Fa = n.ma.innerHTML), n.Fa + } + s.a.f.set(this.i, "__ko_anon_template__", { + Fa: arguments[0] + }) + }; + s.l.i.prototype.nodes = function() { + if (0 == arguments.length) return (s.a.f.get(this.i, "__ko_anon_template__") || {}).ma; + s.a.f.set(this.i, "__ko_anon_template__", { + ma: arguments[0] + }) + }; + s.b("templateSources", s.l); + s.b("templateSources.domElement", s.l.i); + s.b("templateSources.anonymousTemplate", s.l.Q) + }(), + function() { + function r(n, t, i) { + var r; + for (t = s.e.nextSibling(t); n && (r = n) !== t;) n = s.e.nextSibling(r), 1 !== r.nodeType && 8 !== r.nodeType || i(r) + } + + function u(n, t) { + if (n.length) { + var i = n[0], + u = n[n.length - 1]; + r(i, u, function(n) { + s.Ia(t, n) + }); + r(i, u, function(n) { + s.s.nb(n, [t]) + }) + } + } + + function n(n) { + return n.nodeType ? n : 0 < n.length ? n[0] : null + } + + function f(t, r, f, e, o) { + o = o || {}; + var h = t && n(t), + h = h && h.ownerDocument, + c = o.templateEngine || i; + if (s.Ea.Ab(f, c, h), f = c.renderTemplate(f, e, o, h), "number" != typeof f.length || 0 < f.length && "number" != typeof f[0].nodeType) throw Error("Template engine must return an array of DOM nodes"); + h = !1; + switch (r) { + case "replaceChildren": + s.e.P(t, f); + h = !0; + break; + case "replaceNode": + s.a.eb(t, f); + h = !0; + break; + case "ignoreTargetNode": + break; + default: + throw Error("Unknown renderMode: " + r); + } + return h && (u(f, e), o.afterRender && s.q.I(o.afterRender, null, [f, e.$data])), f + } + var i; + s.Ba = function(n) { + if (n != t && !(n instanceof s.v)) throw Error("templateEngine must inherit from ko.templateEngine"); + i = n + }; + s.za = function(r, u, e, o, h) { + if (e = e || {}, (e.templateEngine || i) == t) throw Error("Set a template engine before calling renderTemplate"); + if (h = h || "replaceChildren", o) { + var c = n(o); + return s.j(function() { + var t = u && u instanceof s.A ? u : new s.A(s.a.c(u)), + i = "function" == typeof r ? r(t.$data, t) : r, + t = f(o, h, i, t, e); + "replaceNode" == h && (o = t, c = n(o)) + }, null, { + Qa: function() { + return !c || !s.a.aa(c) + }, + $: c && "replaceNode" == h ? c.parentNode : c + }) + } + return s.s.va(function(n) { + s.za(r, u, e, n, "replaceNode") + }) + }; + s.Rb = function(n, i, r, e, o) { + function c(n, t) { + u(t, h); + r.afterRender && r.afterRender(t, n) + } + + function l(t, i) { + h = o.createChildContext(s.a.c(t), r.as); + h.$index = i; + var u = "function" == typeof n ? n(t, h) : n; + return f(null, "ignoreTargetNode", u, h, r) + } + var h; + return s.j(function() { + var n = s.a.c(i) || []; + "undefined" == typeof n.length && (n = [n]); + n = s.a.Y(n, function(n) { + return r.includeDestroyed || n === t || null === n || !s.a.c(n._destroy) + }); + s.q.I(s.a.Aa, null, [e, n, l, r, c]) + }, null, { + $: e + }) + }; + s.d.template = { + init: function(n, t) { + var i = s.a.c(t()); + return "string" == typeof i || i.name || 1 != n.nodeType && 8 != n.nodeType || (i = 1 == n.nodeType ? n.childNodes : s.e.childNodes(n), i = s.a.Mb(i), new s.l.Q(n).nodes(i)), { + controlsDescendantBindings: !0 + } + }, + update: function(n, i, r, u, f) { + i = s.a.c(i()); + r = {}; + u = !0; + var e, o = null; + "string" != typeof i && (r = i, i = s.a.c(r.name), "if" in r && (u = s.a.c(r["if"])), u && "ifnot" in r && (u = !s.a.c(r.ifnot)), e = s.a.c(r.data)); + "foreach" in r ? o = s.Rb(i || n, u && r.foreach || [], r, n, f) : u ? (f = "data" in r ? f.createChildContext(e, r.as) : f, o = s.za(i || n, f, r, n)) : s.e.ba(n); + f = o; + (e = s.a.f.get(n, "__ko__templateComputedDomDataKey__")) && "function" == typeof e.B && e.B(); + s.a.f.set(n, "__ko__templateComputedDomDataKey__", f && f.ta() ? f : t) + } + }; + s.g.S.template = function(n) { + return n = s.g.da(n), 1 == n.length && n[0].unknown || s.g.Jb(n, "name") ? null : "This template engine does not support anonymous templates nested within its templates" + }; + s.e.L.template = !0 + }(); + s.b("setTemplateEngine", s.Ba); + s.b("renderTemplate", s.za); + s.a.Pa = function() { + function n(n, t, i, r, u) { + for (var o = Math.min, l = Math.max, s = [], a = n.length, f, h = t.length, c = h - a || 1, w = a + h + 1, v, p, b, y, e = 0; e <= a; e++) + for (p = v, s.push(v = []), b = o(h, e + c), f = l(0, e - 1); f <= b; f++) v[f] = f ? e ? n[e - 1] === t[f - 1] ? p[f - 1] : o(p[f] || w, v[f - 1] || w) + 1 : f + 1 : e + 1; + for (o = [], l = [], c = [], e = a, f = h; e || f;) h = s[e][f] - 1, f && h === s[e][f - 1] ? l.push(o[o.length] = { + status: i, + value: t[--f], + index: f + }) : e && h === s[e - 1][f] ? c.push(o[o.length] = { + status: r, + value: n[--e], + index: e + }) : (o.push({ + status: "retained", + value: t[--f] + }), --e); + if (l.length && c.length) + for (n = 10 * a, t = i = 0; + (u || t < n) && (y = l[i]); i++) { + for (r = 0; s = c[r]; r++) + if (y.value === s.value) { + y.moved = s.index; + s.moved = y.index; + c.splice(r, 1); + t = r = 0; + break + } + t += r + } + return o.reverse() + } + return function(t, i, r) { + return t = t || [], i = i || [], t.length <= i.length ? n(t, i, "added", "deleted", r) : n(i, t, "deleted", "added", r) + } + }(); + s.b("utils.compareArrays", s.a.Pa), + function() { + function n(n) { + for (; n.length && !s.a.aa(n[0]);) n.splice(0, 1); + if (1 < n.length) { + for (var t = n[0], r = n[n.length - 1], i = [t]; t !== r;) { + if (t = t.nextSibling, !t) return; + i.push(t) + } + Array.prototype.splice.apply(n, [0, n.length].concat(i)) + } + return n + } + + function i(i, r, u, f, e) { + var o = []; + return i = s.j(function() { + var t = r(u, e, n(o)) || []; + 0 < o.length && (s.a.eb(o, t), f && s.q.I(f, null, [u, t, e])); + o.splice(0, o.length); + s.a.R(o, t) + }, null, { + $: i, + Qa: function() { + return !s.a.pb(o) + } + }), { + O: o, + j: i.ta() ? i : t + } + } + s.a.Aa = function(r, u, f, e, o) { + function rt(t, i) { + h = k[i]; + nt !== i && (it[t] = h); + h.ra(nt++); + n(h.O); + g.push(h); + p.push(h) + } + + function v(n, t) { + if (n) + for (var i = 0, r = t.length; i < r; i++) t[i] && s.a.p(t[i].O, function(r) { + n(r, i, t[i].X) + }) + } + var c, y, ut; + u = u || []; + e = e || {}; + var y = s.a.f.get(r, "setDomNodeChildrenFromArrayMapping_lastMappingResult") === t, + k = s.a.f.get(r, "setDomNodeChildrenFromArrayMapping_lastMappingResult") || [], + d = s.a.Z(k, function(n) { + return n.X + }), + l = s.a.Pa(d, u, e.dontLimitMoves), + g = [], + a = 0, + nt = 0, + tt = [], + p = []; + u = []; + for (var it = [], d = [], h, c = 0, w, b; w = l[c]; c++) switch (b = w.moved, w.status) { + case "deleted": + b === t && (h = k[a], h.j && h.j.B(), tt.push.apply(tt, n(h.O)), e.beforeRemove && (u[c] = h, p.push(h))); + a++; + break; + case "retained": + rt(c, a++); + break; + case "added": + b !== t ? rt(c, b) : (h = { + X: w.value, + ra: s.m(nt++) + }, g.push(h), p.push(h), y || (d[c] = h)) + } + for (v(e.beforeMove, it), s.a.p(tt, e.beforeRemove ? s.H : s.removeNode), c = 0, y = s.e.firstChild(r); h = p[c]; c++) { + for (h.O || s.a.extend(h, i(r, f, h.X, o, h.ra)), a = 0; l = h.O[a]; y = l.nextSibling, ut = l, a++) l !== y && s.e.Va(r, l, ut); + !h.Fb && o && (o(h.X, h.O, h.ra), h.Fb = !0) + } + v(e.beforeRemove, u); + v(e.afterMove, it); + v(e.afterAdd, d); + s.a.f.set(r, "setDomNodeChildrenFromArrayMapping_lastMappingResult", g) + } + }(); + s.b("utils.setDomNodeChildrenFromArrayMapping", s.a.Aa); + s.D = function() { + this.allowTemplateRewriting = !1 + }; + s.D.prototype = new s.v; + s.D.prototype.renderTemplateSource = function(n) { + var t = (9 > s.a.ca ? 0 : n.nodes) ? n.nodes() : null; + return t ? s.a.N(t.cloneNode(!0).childNodes) : (n = n.text(), s.a.xa(n)) + }; + s.D.sa = new s.D; + s.Ba(s.D.sa); + s.b("nativeTemplateEngine", s.D), + function() { + s.ua = function() { + var n = this.Ib = function() { + if ("undefined" == typeof i || !i.tmpl) return 0; + try { + if (0 <= i.tmpl.tag.tmpl.open.toString().indexOf("__")) return 2 + } catch (n) {} + return 1 + }(); + this.renderTemplateSource = function(t, u, f) { + if (f = f || {}, 2 > n) throw Error("Your version of jQuery.tmpl is too old. Please upgrade to jQuery.tmpl 1.0.0pre or later."); + var e = t.data("precompiled"); + return e || (e = t.text() || "", e = i.template(null, "{{ko_with $item.koBindingContext}}" + e + "{{/ko_with}}"), t.data("precompiled", e)), t = [u.$data], u = i.extend({ + koBindingContext: u + }, f.templateOptions), u = i.tmpl(e, t, u), u.appendTo(r.createElement("div")), i.fragments = {}, u + }; + this.createJavaScriptEvaluatorBlock = function(n) { + return "{{ko_code ((function() { return " + n + " })()) }}" + }; + this.addTemplate = function(n, t) { + r.write("<script type='text/html' id='" + n + "'>" + t + "<\/script>") + }; + 0 < n && (i.tmpl.tag.ko_code = { + open: "__.push($1 || '');" + }, i.tmpl.tag.ko_with = { + open: "with($1) {", + close: "} " + }) + }; + s.ua.prototype = new s.v; + var n = new s.ua; + 0 < n.Ib && s.Ba(n); + s.b("jqueryTmplTemplateEngine", s.ua) + }() + }) + })() +}(); +! function(n) { + "function" == typeof require && "object" == typeof exports && "object" == typeof module ? n(require("knockout"), require("jquery"), require("kendo")) : "function" == typeof define && define.amd ? define(["knockout", "jquery", "kendo"], n) : n(window.ko, window.jQuery, window.kendo) +}(function(n, t, i, r) { + var y; + i = i || window.kendo; + n.kendo = n.kendo || {}; + n.kendo.BindingFactory = function() { + var u = this, + f; + this.createBinding = function(i) { + if (t()[i.parent || i.name]) { + var r = {}; + r.init = function(n, t, f, e, o) { + var s = u.buildOptions(i, t); + return s.async === !0 || i.async === !0 && s.async !== !1 ? (setTimeout(function() { + r.setup(n, s, o) + }, 0), void 0) : (r.setup(n, s, o), s && s.useKOTemplates ? { + controlsDescendantBindings: !0 + } : void 0) + }; + r.setup = function(r, f, e) { + var o, s = t(r); + u.setupTemplates(i.templates, f, r, e); + o = u.getWidget(i, f, s); + u.handleEvents(f, i, r, o, e); + u.watchValues(o, f, i, r); + o.destroy && n.utils.domNodeDisposal.addDisposeCallback(r, function() { + o.destroy() + }) + }; + r.options = {}; + r.widgetConfig = i; + n.bindingHandlers[i.bindingName || i.name] = r + } + }; + this.buildOptions = function(t, r) { + var f = t.defaultOption, + e = n.utils.extend({}, n.bindingHandlers[t.name].options), + u = n.utils.unwrapObservable(r()); + return u instanceof i.data.DataSource || "object" != typeof u || null === u || f && !(f in u) ? e[f] = r() : n.utils.extend(e, u), e + }; + f = function(t, i) { + return function(r) { + return n.renderTemplate(t, i.createChildContext(r._raw && r._raw() || r)) + } + }; + this.setupTemplates = function(t, i, r, u) { + var e, h, o, s; + if (t && i && i.useKOTemplates) { + for (e = 0, h = t.length; h > e; e++) o = t[e], i[o] && (i[o] = f(i[o], u)); + s = i.dataBound; + i.dataBound = function() { + n.memoization.unmemoizeDomNodeAndDescendants(r); + s && s.apply(this, arguments) + } + } + }; + this.unwrapOneLevel = function(t) { + var r, u = {}; + if (t) + if (t instanceof i.data.DataSource) u = t; + else if ("object" == typeof t) + for (r in t) u[r] = n.utils.unwrapObservable(t[r]); + return u + }; + this.getWidget = function(t, i, r) { + var u, f; + return t.parent ? (f = r.closest("[data-bind*='" + t.parent + ":']"), u = f.length ? f.data(t.parent) : null) : u = r[t.name](this.unwrapOneLevel(i)).data(t.name), n.isObservable(i.widget) && i.widget(u), u + }; + this.watchValues = function(n, t, i, r) { + var f, e = i.watch; + if (e) + for (f in e) e.hasOwnProperty(f) && u.watchOneValue(f, n, t, i, r) + }; + this.watchOneValue = function(i, u, f, e, o) { + var s = n.computed({ + read: function() { + var a, l, s = e.watch[i], + h = n.utils.unwrapObservable(f[i]), + c = e.parent ? [o] : []; + t.isArray(s) ? s = u[h ? s[0] : s[1]] : "string" == typeof s ? s = u[s] : l = !0; + s && f[i] !== r && (l ? c.push(h, f) : (a = s.apply(u, c), c.push(h)), (l || a !== h) && s.apply(u, c)) + }, + disposeWhenNodeIsRemoved: o + }).extend({ + throttle: f.throttle || 0 === f.throttle ? f.throttle : 1 + }); + n.isObservable(f[i]) || s.dispose() + }; + this.handleEvents = function(n, t, i, r, f) { + var o, e, s = t.events; + if (s) + for (o in s) s.hasOwnProperty(o) && (e = s[o], "string" == typeof e && (e = { + value: e, + writeTo: e + }), u.handleOneEvent(o, e, n, i, r, t.childProp, f)) + }; + this.handleOneEvent = function(t, i, r, u, f, e, o) { + var s = "function" == typeof i ? i : r[i.call]; + "function" == typeof i ? s = s.bind(o.$data, r) : i.call && "function" == typeof r[i.call] ? s = r[i.call].bind(o.$data, o.$data) : i.writeTo && n.isWriteableObservable(r[i.writeTo]) && (s = function(n) { + var t, f; + e && n[e] && n[e] !== u || (t = i.value, f = "string" == typeof t && this[t] ? this[t](e && u) : t, r[i.writeTo](f)) + }); + s && f.bind(t, s) + } + }; + n.kendo.bindingFactory = new n.kendo.BindingFactory; + n.kendo.setDataSource = function(t, r, u) { + var f, e; + return r instanceof i.data.DataSource ? (t.setDataSource(r), void 0) : (u && u.useKOTemplates || (f = n.mapping && r && r.__ko_mapping__, e = r && f ? n.mapping.toJS(r) : n.toJS(r)), t.dataSource.data(e || r), void 0) + }, + function() { + var n = i.data.ObservableArray.fn.wrap; + i.data.ObservableArray.fn.wrap = function(t) { + var i = n.apply(this, arguments); + return i._raw = function() { + return t + }, i + } + }(); + var c = function(t) { + return function(i) { + i && (n.utils.extend(this.options[t], i), this.redraw(), this.value(.001 + this.value())) + } + }, + f = n.kendo.bindingFactory.createBinding.bind(n.kendo.bindingFactory), + d = "clicked", + s = "close", + p = "collapse", + g = "content", + w = "data", + e = "enable", + b = "expand", + l = "expanded", + rt = "error", + ut = "info", + o = "isOpen", + a = "max", + v = "min", + h = "open", + nt = "search", + tt = "selected", + ft = "success", + it = "size", + u = "value", + k = "values", + et = "warning"; + f({ + name: "kendoAutoComplete", + events: { + change: u, + open: { + writeTo: o, + value: !0 + }, + close: { + writeTo: o, + value: !1 + } + }, + watch: { + enabled: e, + search: [nt, s], + data: function(t) { + n.kendo.setDataSource(this, t) + }, + value: u + } + }); + f({ + name: "kendoButton", + defaultOption: d, + events: { + click: { + call: d + } + }, + watch: { + enabled: e + } + }); + f({ + name: "kendoCalendar", + defaultOption: u, + events: { + change: u + }, + watch: { + max: a, + min: v, + value: u + } + }); + f({ + name: "kendoColorPicker", + events: { + change: u, + open: { + writeTo: o, + value: !0 + }, + close: { + writeTo: o, + value: !1 + } + }, + watch: { + enabled: e, + value: u, + color: u, + palette: "palette" + } + }); + f({ + name: "kendoComboBox", + events: { + change: u, + open: { + writeTo: o, + value: !0 + }, + close: { + writeTo: o, + value: !1 + } + }, + watch: { + enabled: e, + isOpen: [h, s], + data: function(t) { + n.kendo.setDataSource(this, t) + }, + value: u + } + }); + f({ + name: "kendoDatePicker", + defaultOption: u, + events: { + change: u, + open: { + writeTo: o, + value: !0 + }, + close: { + writeTo: o, + value: !1 + } + }, + watch: { + enabled: e, + max: a, + min: v, + value: u, + isOpen: [h, s] + } + }); + f({ + name: "kendoDateTimePicker", + defaultOption: u, + events: { + change: u, + open: { + writeTo: o, + value: !0 + }, + close: { + writeTo: o, + value: !1 + } + }, + watch: { + enabled: e, + max: a, + min: v, + value: u, + isOpen: [h, s] + } + }); + f({ + name: "kendoDropDownList", + events: { + change: u, + open: { + writeTo: o, + value: !0 + }, + close: { + writeTo: o, + value: !1 + } + }, + watch: { + enabled: e, + isOpen: [h, s], + data: function(t) { + n.kendo.setDataSource(this, t); + t.length && this.options.optionLabel && this.select() < 0 && this.select(0) + }, + value: u + } + }); + f({ + name: "kendoEditor", + defaultOption: u, + events: { + change: u + }, + watch: { + enabled: e, + value: u + } + }); + f({ + name: "kendoGrid", + defaultOption: w, + watch: { + data: function(t, i) { + n.kendo.setDataSource(this, t, i) + } + }, + templates: ["rowTemplate", "altRowTemplate"] + }); + f({ + name: "kendoListView", + defaultOption: w, + watch: { + data: function(t, i) { + n.kendo.setDataSource(this, t, i) + } + }, + templates: ["template"] + }); + f({ + name: "kendoMaskedTextBox", + defaultOption: u, + events: { + change: u + }, + watch: { + enabled: e, + isReadOnly: "readonly", + value: u + } + }); + f({ + name: "kendoMenu", + async: !0 + }); + f({ + name: "kendoMenuItem", + parent: "kendoMenu", + watch: { + enabled: e, + isOpen: [h, s] + }, + async: !0 + }); + f({ + name: "kendoMultiSelect", + events: { + change: u, + open: { + writeTo: o, + value: !0 + }, + close: { + writeTo: o, + value: !1 + } + }, + watch: { + enabled: e, + search: [nt, s], + data: function(t) { + n.kendo.setDataSource(this, t) + }, + value: u + } + }); + y = function(n, t) { + t || 0 === t ? this.show(t, n) : this.hide() + }; + f({ + name: "kendoNotification", + watch: { + error: function(n) { + y.call(this, rt, n) + }, + info: function(n) { + y.call(this, ut, n) + }, + success: function(n) { + y.call(this, ft, n) + }, + warning: function(n) { + y.call(this, et, n) + } + } + }); + f({ + name: "kendoNumericTextBox", + defaultOption: u, + events: { + change: u + }, + watch: { + enabled: e, + value: u, + max: function(n) { + this.options.max = n; + var t = this.value(); + (t || 0 === t) && t > n && this.value(n) + }, + min: function(n) { + this.options.min = n; + var t = this.value(); + (t || 0 === t) && n > t && this.value(n) + } + } + }); + f({ + name: "kendoPanelBar", + async: !0 + }); + f({ + name: "kendoPanelItem", + parent: "kendoPanelBar", + watch: { + enabled: e, + expanded: [b, p], + selected: ["select"] + }, + childProp: "item", + events: { + expand: { + writeTo: l, + value: !0 + }, + collapse: { + writeTo: l, + value: !1 + }, + select: { + writeTo: tt, + value: u + } + }, + async: !0 + }); + f({ + name: "kendoProgressBar", + defaultOption: u, + events: { + change: u + }, + watch: { + enabled: e, + value: u + } + }); + f({ + name: "kendoRangeSlider", + defaultOption: k, + events: { + change: k + }, + watch: { + values: k, + enabled: e + } + }); + f({ + async: !0, + name: "kendoScheduler", + watch: { + data: function(t, i) { + n.kendo.setDataSource(this, t, i) + } + } + }); + f({ + name: "kendoSlider", + defaultOption: u, + events: { + change: u + }, + watch: { + value: u, + enabled: e + } + }); + f({ + name: "kendoSortable", + defaultOption: w, + events: { + end: function(i, r) { + var u = "__ko_kendo_sortable_data__", + f = "receive" !== r.action ? n.dataFor(r.item[0]) : r.draggableEvent[u], + o = i.data, + e = i.data; + ("sort" === r.action || "remove" === r.action) && (e.splice(r.oldIndex, 1), "remove" === r.action && (r.draggableEvent[u] = f)); + ("sort" === r.action || "receive" === r.action) && (e.splice(r.newIndex, 0, f), delete r.draggableEvent[u], t(r.draggableEvent.target).hide(), r.preventDefault()); + o.valueHasMutated() + } + } + }); + f({ + name: "kendoSplitter", + async: !0 + }); + f({ + name: "kendoSplitterPane", + parent: "kendoSplitter", + watch: { + max: a, + min: v, + size: it, + expanded: [b, p] + }, + childProp: "pane", + events: { + collapse: { + writeTo: l, + value: !1 + }, + expand: { + writeTo: l, + value: !0 + }, + resize: it + }, + async: !0 + }); + f({ + name: "kendoTabStrip", + async: !0 + }); + f({ + name: "kendoTab", + parent: "kendoTabStrip", + watch: { + enabled: e + }, + childProp: "item", + async: !0 + }); + f({ + name: "kendoTooltip", + events: {}, + watch: { + content: g, + filter: "filter" + } + }); + f({ + name: "kendoTimePicker", + defaultOption: u, + events: { + change: u + }, + watch: { + max: a, + min: v, + value: u, + enabled: e, + isOpen: [h, s] + } + }); + f({ + name: "kendoTreeView", + async: !0 + }); + f({ + name: "kendoTreeItem", + parent: "kendoTreeView", + watch: { + enabled: e, + expanded: [b, p], + selected: function(n, t) { + t ? this.select(n) : this.select()[0] == n && this.select(null) + } + }, + childProp: "node", + events: { + collapse: { + writeTo: l, + value: !1 + }, + expand: { + writeTo: l, + value: !0 + }, + select: { + writeTo: tt, + value: !0 + } + }, + async: !0 + }); + f({ + name: "kendoUpload", + watch: { + enabled: e + } + }); + f({ + async: !0, + name: "kendoWindow", + events: { + open: { + writeTo: o, + value: !0 + }, + close: { + writeTo: o, + value: !1 + } + }, + watch: { + content: g, + title: "title", + isOpen: [h, s] + } + }); + f({ + name: "kendoChart", + watch: { + data: function(t) { + n.kendo.setDataSource(this, t) + } + } + }); + f({ + name: "kendoLinearGauge", + defaultOption: u, + watch: { + value: u, + gaugeArea: c("gaugeArea"), + pointer: c("pointer"), + scale: c("scale") + } + }); + f({ + name: "kendoRadialGauge", + defaultOption: u, + watch: { + value: u, + gaugeArea: c("gaugeArea"), + pointer: c("pointer"), + scale: c("scale") + } + }) +}); +Raphael = function() { + function n() { + var r; + if (n.is(arguments[0], et)) { + for (var i = arguments[0], f = rr[b](n, i.splice(0, 3 + n.is(i[0], nt))), e = f.set(), u = 0, o = i[t]; u < o; u++) r = i[u] || {}, ku.test(r.type) && e[a](f[r.type]().attr(r)); + return e + } + return rr[b](n, arguments) + } + + function y() {} + + function si(t) { + var u, i; + return n.vml ? (u = /^\s+|\s+$/g, si = ut(function(n) { + var f, t, i; + n = (n + r)[w](u, r); + try { + t = new st.ActiveXObject("htmlfile"); + t.write("<body>"); + t.close(); + f = t.body + } catch (e) { + f = st.createPopup().document.body + } + t = f.createTextRange(); + try { + return f.style.color = n, i = t.queryCommandValue("ForeColor"), i = (i & 255) << 16 | i & 65280 | (i & 16711680) >>> 16, "#" + ("000000" + i[d](16)).slice(-6) + } catch (o) { + return "none" + } + })) : (i = c.createElement("i"), i.title = "Raphaël Colour Picker", i.style.display = "none", c.body[o](i), si = ut(function(n) { + return i.style.color = n, c.defaultView.getComputedStyle(i, r).getPropertyValue("color") + })), si(t) + } + + function nf() { + return "hsb(" + [this.h, this.s, this.b] + ")" + } + + function tf() { + return this.hex + } + + function ut(n, r, u) { + function f() { + var c = Array[i].slice.call(arguments, 0), + e = c[tt]("►"), + o = f.cache = f.cache || {}, + h = f.count = f.count || []; + return o[s](e) ? u ? u(o[e]) : o[e] : (h[t] >= 1e3 && delete o[h.shift()], h[a](e), o[e] = n[b](r, c), u ? u(o[e]) : o[e]) + } + return f + } + + function ci(i) { + var f = [], + r, e, u, o; + for (n.is(i, et) && n.is(i && i[0], et) || (i = n.parsePathString(i)), r = 0, e = i[t]; r < e; r++) + for (f[r] = [], u = 0, o = i[r][t]; u < o; u++) f[r][u] = i[r][u]; + return f[d] = n._path2string, f + } + + function li(n, t, i, r) { + return [n, t, i, r, i, r] + } + + function vr(n, t, i, r, u, f) { + var e = 1 / 3, + o = 2 / 3; + return [e * n + o * i, e * t + o * r, e * u + o * i, e * f + o * r, u, f] + } + + function yr(n, i, r, u, f, o, s, h, c, l) { + var y = e.PI, + it = y * 120 / 180, + g = y / 180 * (+f || 0), + b = [], + a, nt = ut(function(n, t, i) { + var r = n * e.cos(i) - t * e.sin(i); + return n = n * e.sin(i) + t * e.cos(i), { + x: r, + y: n + } + }), + d, w, v; + if (l ? (v = l[0], a = l[1], o = l[2], w = l[3]) : (a = nt(n, i, -g), n = a.x, i = a.y, a = nt(h, c, -g), h = a.x, c = a.y, e.cos(y / 180 * f), e.sin(y / 180 * f), a = (n - h) / 2, v = (i - c) / 2, w = a * a / (r * r) + v * v / (u * u), w > 1 && (w = e.sqrt(w), r = w * r, u = w * u), w = r * r, d = u * u, w = (o == s ? -1 : 1) * e.sqrt(e.abs((w * d - w * v * v - d * a * a) / (w * v * v + d * a * a))), o = w * r * v / u + (n + h) / 2, w = w * -u * a / r + (i + c) / 2, v = e.asin(((i - w) / u).toFixed(7)), a = e.asin(((c - w) / u).toFixed(7)), v = n < o ? y - v : v, a = h < o ? y - a : a, v < 0 && (v = y * 2 + v), a < 0 && (a = y * 2 + a), s && v > a && (v -= y * 2), !s && a > v && (a -= y * 2)), y = a - v, e.abs(y) > it && (b = a, y = h, d = c, a = v + it * (s && a > v ? 1 : -1), h = o + r * e.cos(a), c = w + u * e.sin(a), b = yr(h, c, r, u, f, 0, s, y, d, [a, b, o, w])), y = a - v, f = e.cos(v), o = e.sin(v), s = e.cos(a), a = e.sin(a), y = e.tan(y / 4), r = 4 / 3 * r * y, y = 4 / 3 * u * y, u = [n, i], n = [n + r * o, i - y * f], i = [h + r * a, c - y * s], h = [h, c], n[0] = 2 * u[0] - n[0], n[1] = 2 * u[1] - n[1], l) return [n, i, h][k](b); + for (b = [n, i, h][k](b)[tt]()[p](","), l = [], h = 0, c = b[t]; h < c; h++) l[h] = h % 2 ? nt(b[h - 1], b[h], g).y : nt(b[h], b[h + 1], g).x; + return l + } + + function ii(n, t, i, r, u, f, e, o, s) { + var h = 1 - s; + return { + x: l(h, 3) * n + l(h, 2) * 3 * s * i + h * 3 * s * s * u + l(s, 3) * e, + y: l(h, 3) * t + l(h, 2) * 3 * s * r + h * 3 * s * s * f + l(s, 3) * o + } + } + + function wr(t, i, r, u) { + if (n.is(t, wt) || n.is(t, "object")) { + if (t = n.is(t, wt) ? c.getElementById(t) : t, t.tagName) return i == null ? { + container: t, + width: t.style.pixelWidth || t.offsetWidth, + height: t.style.pixelHeight || t.offsetHeight + } : { + container: t, + width: i, + height: r + } + } else return { + container: 1, + x: t, + y: i, + width: r, + height: u + } + } + + function nr(n, t) { + var r = this; + for (var i in t) + if (t[s](i) && !(i in n)) switch (typeof t[i]) { + case "function": + (function(t) { + n[i] = n === r ? t : function() { + return t[b](r, arguments) + } + })(t[i]); + break; + case "object": + n[i] = n[i] || {}; + nr.call(this, n[i], t[i]); + break; + default: + n[i] = t[i] + } + } + + function gt(n, t) { + n == t.top && (t.top = n.prev); + n == t.bottom && (t.bottom = n.next); + n.next && (n.next.prev = n.prev); + n.prev && (n.prev.next = n.next) + } + + function br(n, t) { + t.top !== n && (gt(n, t), n.next = null, n.prev = t.top, t.top.next = n, t.top = n) + } + + function kr(n, t) { + t.bottom !== n && (gt(n, t), n.next = t.bottom, n.prev = null, t.bottom.prev = n, t.bottom = n) + } + + function dr(n, t, i) { + gt(n, i); + t == i.top && (i.top = n); + t.next && (t.next.prev = n); + n.next = t.next; + n.prev = t; + t.next = n + } + + function gr(n, t, i) { + gt(n, i); + t == i.bottom && (i.bottom = n); + t.prev && (t.prev.next = n); + n.prev = t.prev; + t.prev = n; + n.next = t + } + + function nu(n) { + return function() { + throw new Error("Raphaël: you are calling to method “" + n + "” of removed object"); + } + } + + function cf() { + this.returnValue = !1 + } + + function lf() { + return this.originalEvent.preventDefault() + } + + function af() { + this.cancelBubble = !0 + } + + function vf() { + return this.originalEvent.stopPropagation() + } + + function vu() { + return this.x + g + this.y + } + + function fr(t, i) { + return function(r, u, f) { + r = ai(r); + for (var o, s, e, l, h = "", a = {}, c = 0, v = 0, y = r.length; v < y; v++) { + if (e = r[v], e[0] == "M") o = +e[1], s = +e[2]; + else { + if (l = yf(o, s, e[1], e[2], e[3], e[4], e[5], e[6]), c + l > u) { + if (i && !a.start) { + if (o = ur(o, s, e[1], e[2], e[3], e[4], e[5], e[6], u - c), h += ["C", o.start.x, o.start.y, o.m.x, o.m.y, o.x, o.y], f) return h; + a.start = h; + h = ["M", o.x, o.y + "C", o.n.x, o.n.y, o.end.x, o.end.y, e[5], e[6]][tt](); + c += l; + o = +e[5]; + s = +e[6]; + continue + } + if (!t && !i) return o = ur(o, s, e[1], e[2], e[3], e[4], e[5], e[6], u - c), { + x: o.x, + y: o.y, + alpha: o.alpha + } + } + c += l; + o = +e[5]; + s = +e[6] + } + h += e + } + return a.end = h, o = t ? c : i ? a : n.findDotsAtSegment(o, s, e[1], e[2], e[3], e[4], e[5], e[6], 1), o.alpha && (o = { + x: o.x, + y: o.y, + alpha: o.alpha + }), o + } + } + + function pu() { + var et = +new Date, + p, l, i, ut, k, ft; + for (p in rt) + if (p != "length" && rt[s](p)) + if (l = rt[p], l.stop || l.el.removed) delete rt[p], rt[t]--; + else { + var w = et - l.start, + a = l.ms, + u = l.easing, + o = l.from, + f = l.diff, + h = l.to, + b = l.t, + d = l.prev || 0, + c = l.el, + y = l.callback, + it = {}, + e; + if (w < a) { + y = n.easing_formulas[u] ? n.easing_formulas[u](w / a) : w / a; + for (i in o) + if (o[s](i)) { + switch (di[i]) { + case "along": + e = y * a * f[i]; + h.back && (e = h.len - e); + u = vi(h[i], e); + c.translate(f.sx - f.x || 0, f.sy - f.y || 0); + f.x = u.x; + f.y = u.y; + c.translate(u.x - f.sx, u.y - f.sy); + h.rot && c.rotate(f.r + u.alpha, u.x, u.y); + break; + case nt: + e = +o[i] + y * a * f[i]; + break; + case "colour": + e = "rgb(" + [or(v(o[i].r + y * a * f[i].r)), or(v(o[i].g + y * a * f[i].g)), or(v(o[i].b + y * a * f[i].b))][tt](",") + ")"; + break; + case "path": + for (e = [], u = 0, ut = o[i][t]; u < ut; u++) { + for (e[u] = [o[i][u][0]], k = 1, ft = o[i][u][t]; k < ft; k++) e[u][k] = +o[i][u][k] + y * a * f[i][u][k]; + e[u] = e[u][tt](g) + } + e = e[tt](g); + break; + case "csv": + switch (i) { + case "translation": + e = f[i][0] * (w - d); + u = f[i][1] * (w - d); + b.x += e; + b.y += u; + e = e + g + u; + break; + case "rotation": + e = +o[i][0] + y * a * f[i][0]; + o[i][1] && (e += "," + o[i][1] + "," + o[i][2]); + break; + case "scale": + e = [+o[i][0] + y * a * f[i][0], +o[i][1] + y * a * f[i][1], 2 in h[i] ? h[i][2] : r, 3 in h[i] ? h[i][3] : r][tt](g); + break; + case "clip-rect": + for (e = [], u = 4; u--;) e[u] = +o[i][u] + y * a * f[i][u] + } + } + it[i] = e + } + c.attr(it); + c._run && c._run.call(c) + } else h.along && (u = vi(h.along, h.len * !h.back), c.translate(f.sx - (f.x || 0) + u.x - f.sx, f.sy - (f.y || 0) + u.y - f.sy), h.rot && c.rotate(f.r + u.alpha, u.x, u.y)), (b.x || b.y) && c.translate(-b.x, -b.y), h.scale && (h.scale += r), c.attr(h), delete rt[p], rt[t]--, c.in_animation = null, n.is(y, "function") && y.call(c); + l.prev = w + } + n.svg && c && c.paper && c.paper.safari(); + rt[t] && st.setTimeout(pu) + } + + function or(n) { + return ht(lt(n, 255), 0) + } + + function yi(n, t) { + if (n == null) return { + x: this._.tx, + y: this._.ty, + toString: vu + }; + this._.tx += +n; + this._.ty += +t; + switch (this.type) { + case "circle": + case "ellipse": + this.attr({ + cx: +n + this.attrs.cx, + cy: +t + this.attrs.cy + }); + break; + case "rect": + case "image": + case "text": + this.attr({ + x: +n + this.attrs.x, + y: +t + this.attrs.y + }); + break; + case "path": + var i = gi(this.attrs.path); + i[0][1] += +n; + i[0][2] += +t; + this.attr({ + path: i + }) + } + return this + } + + function wu(t) { + return function(i, r, f, e) { + var o = { + back: t + }; + return n.is(f, "function") ? e = f : o.rot = f, i && i.constructor == u && (i = i.attrs.path), i && (o.along = i), this.animate(o, r, e) + } + } + + function ct(n) { + if (this.items = [], this[t] = 0, this.type = "set", n) + for (var i = 0, r = n[t]; i < r; i++) n[i] && (n[i].constructor == u || n[i].constructor == ct) && (this[this.items[t]] = this.items[this.items[t]] = n[i], this[t]++) + } + var bt, lr, ar, ti, gi, dt, tr, f, cu, it, au, ur, rt, pi, bu; + n.version = "1.4.3"; + var ft = /[, ]+/, + ku = /^(circle|rect|path|ellipse|text|image)$/, + i = "prototype", + s = "hasOwnProperty", + c = document, + st = window, + sr = { + was: Object[i][s].call(st, "Raphael"), + is: st.Raphael + }; + var o = "appendChild", + b = "apply", + k = "concat", + wi = "createTouch" in c, + r = "", + g = " ", + p = "split", + hr = "click dblclick mousedown mousemove mouseout mouseover mouseup touchstart touchmove touchend orientationchange touchcancel gesturestart gesturechange gestureend" [p](g), + bi = { + mousedown: "touchstart", + mousemove: "touchmove", + mouseup: "touchend" + }, + tt = "join", + t = "length", + yt = String[i].toLowerCase, + e = Math, + ht = e.max, + lt = e.min, + nt = "number", + wt = "string", + et = "array", + d = "toString", + at = "fill", + du = Object[i][d], + l = e.pow, + a = "push", + kt = /^(?=[\da-f]$)/, + cr = /^url\(['"]?([^\)]+?)['"]?\)$/i, + gu = /^\s*((#[a-f\d]{6})|(#[a-f\d]{3})|rgba?\(\s*([\d\.]+\s*,\s*[\d\.]+\s*,\s*[\d\.]+(?:\s*,\s*[\d\.]+)?)\s*\)|rgba?\(\s*([\d\.]+%\s*,\s*[\d\.]+%\s*,\s*[\d\.]+%(?:\s*,\s*[\d\.]+%))\s*\)|hs[bl]\(\s*([\d\.]+\s*,\s*[\d\.]+\s*,\s*[\d\.]+)\s*\)|hs[bl]\(\s*([\d\.]+%\s*,\s*[\d\.]+%\s*,\s*[\d\.]+%)\s*\))\s*$/i, + v = e.round, + ot = "setAttribute", + h = parseFloat, + pt = parseInt, + ki = " progid:DXImageTransform.Microsoft", + ei = String[i].toUpperCase, + oi = { + blur: 0, + "clip-rect": "0 0 1e9 1e9", + cursor: "default", + cx: 0, + cy: 0, + fill: "#fff", + "fill-opacity": 1, + font: '10px "Arial"', + "font-family": '"Arial"', + "font-size": "10", + "font-style": "normal", + "font-weight": 400, + gradient: 0, + height: 0, + href: "http://raphaeljs.com/", + opacity: 1, + path: "M0,0", + r: 0, + rotation: 0, + rx: 0, + ry: 0, + scale: "1 1", + src: "", + stroke: "#000", + "stroke-dasharray": "", + "stroke-linecap": "butt", + "stroke-linejoin": "butt", + "stroke-miterlimit": 0, + "stroke-opacity": 1, + "stroke-width": 1, + target: "_blank", + "text-anchor": "middle", + title: "Raphael", + translation: "0 0", + width: 0, + x: 0, + y: 0 + }, + di = { + along: "along", + blur: nt, + "clip-rect": "csv", + cx: nt, + cy: nt, + fill: "colour", + "fill-opacity": nt, + "font-size": nt, + height: nt, + opacity: nt, + path: "path", + r: nt, + rotation: "csv", + rx: nt, + ry: nt, + scale: "csv", + stroke: "colour", + "stroke-opacity": nt, + "stroke-width": nt, + translation: "csv", + width: nt, + x: nt, + y: nt + }, + w = "replace"; + if (n.type = st.SVGAngle || c.implementation.hasFeature("http://www.w3.org/TR/SVG11/feature#BasicStructure", "1.1") ? "SVG" : "VML", n.type == "VML") { + if (bt = c.createElement("div"), bt.innerHTML = "<!--[if vml]><br><br><![endif]-->", bt.childNodes[t] != 2) return n.type = null; + bt = null + } + n.svg = !(n.vml = n.type == "VML"); + y[i] = n[i]; + n._id = 0; + n._oid = 0; + n.fn = {}; + n.is = function(n, t) { + return t = yt.call(t), t == "object" && n === Object(n) || t == "undefined" && typeof n == t || t == "null" && n == null || yt.call(du.call(n).slice(8, -1)) == t + }; + n.setWindow = function(n) { + st = n; + c = st.document + }; + n.hsb2rgb = ut(function(t, i, r) { + var u; + if (n.is(t, "object") && "h" in t && "s" in t && "b" in t && (r = t.b, i = t.s, t = t.h), r == 0) return { + r: 0, + g: 0, + b: 0, + hex: "#000" + }; + (t > 1 || i > 1 || r > 1) && (t /= 255, i /= 255, r /= 255); + u = ~~(t * 6); + t = t * 6 - u; + var f = r * (1 - i), + o = r * (1 - i * t), + e = r * (1 - i * (1 - t)); + return t = [r, o, f, f, e, r, r][u], i = [e, r, r, o, f, f, e][u], u = [f, f, e, r, r, o, f][u], t *= 255, i *= 255, u *= 255, r = { + r: t, + g: i, + b: u, + toString: tf + }, t = (~~t)[d](16), i = (~~i)[d](16), u = (~~u)[d](16), t = t[w](kt, "0"), i = i[w](kt, "0"), u = u[w](kt, "0"), r.hex = "#" + t + i + u, r + }, n); + n.rgb2hsb = ut(function(t, i, r) { + var f, u, e, o; + return (n.is(t, "object") && "r" in t && "g" in t && "b" in t && (r = t.b, i = t.g, t = t.r), n.is(t, wt) && (f = n.getRGB(t), t = f.r, i = f.g, r = f.b), (t > 1 || i > 1 || r > 1) && (t /= 255, i /= 255, r /= 255), u = ht(t, i, r), e = lt(t, i, r), f = u, e == u) ? { + h: 0, + s: 0, + b: u + } : (o = u - e, e = o / u, t = t == u ? (i - r) / o : i == u ? 2 + (r - t) / o : 4 + (t - i) / o, t /= 6, t < 0 && t++, t > 1 && t--, { + h: t, + s: e, + b: f, + toString: nf + }) + }, n); + var rf = /,?([achlmqrstvxz]),?/gi, + hi = /\s*,\s*/, + uf = { + hs: 1, + rg: 1 + }; + n._path2string = function() { + return this.join(",")[w](rf, "$1") + }; + n.getRGB = ut(function(t) { + if (!t || (t += r).indexOf("-") + 1) return { + r: -1, + g: -1, + b: -1, + hex: "none", + error: 1 + }; + if (t == "none") return { + r: -1, + g: -1, + b: -1, + hex: "none" + }; + uf[s](t.substring(0, 2)) || t.charAt() == "#" || (t = si(t)); + var i, u, f, o, e; + return (t = t.match(gu)) ? (t[2] && (f = pt(t[2].substring(5), 16), u = pt(t[2].substring(3, 5), 16), i = pt(t[2].substring(1, 3), 16)), t[3] && (f = pt((e = t[3].charAt(3)) + e, 16), u = pt((e = t[3].charAt(2)) + e, 16), i = pt((e = t[3].charAt(1)) + e, 16)), t[4] && (t = t[4][p](hi), i = h(t[0]), u = h(t[1]), f = h(t[2]), o = h(t[3])), t[5] && (t = t[5][p](hi), i = h(t[0]) * 2.55, u = h(t[1]) * 2.55, f = h(t[2]) * 2.55, o = h(t[3])), t[6]) ? (t = t[6][p](hi), i = h(t[0]), u = h(t[1]), f = h(t[2]), n.hsb2rgb(i, u, f)) : t[7] ? (t = t[7][p](hi), i = h(t[0]) * 2.55, u = h(t[1]) * 2.55, f = h(t[2]) * 2.55, n.hsb2rgb(i, u, f)) : (t = { + r: i, + g: u, + b: f + }, i = (~~i)[d](16), u = (~~u)[d](16), f = (~~f)[d](16), i = i[w](kt, "0"), u = u[w](kt, "0"), f = f[w](kt, "0"), t.hex = "#" + i + u + f, isFinite(h(o)) && (t.o = o), t) : { + r: -1, + g: -1, + b: -1, + hex: "none", + error: 1 + } + }, n); + n.getColor = function(n) { + n = this.getColor.start = this.getColor.start || { + h: 0, + s: 1, + b: n || .75 + }; + var t = this.hsb2rgb(n.h, n.s, n.b); + return n.h += .075, n.h > 1 && (n.h = 0, n.s -= .2, n.s <= 0 && (this.getColor.start = { + h: 0, + s: 1, + b: n.b + })), t.hex + }; + n.getColor.reset = function() { + delete this.start + }; + lr = /([achlmqstvz])[\s,]*((-?\d*\.?\d*(?:e[-+]?\d+)?\s*,?\s*)+)/ig; + ar = /(-?\d*\.?\d*(?:e[-+]?\d+)?)\s*,?\s*/ig; + n.parsePathString = ut(function(i) { + if (!i) return null; + var f = { + a: 7, + c: 6, + h: 1, + l: 2, + m: 2, + q: 4, + s: 4, + t: 2, + v: 1, + z: 0 + }, + u = []; + return n.is(i, et) && n.is(i[0], et) && (u = ci(i)), u[t] || (i + r)[w](lr, function(n, i, r) { + var e = []; + for (n = yt.call(i), r[w](ar, function(n, t) { + t && e[a](+t) + }), n == "m" && e[t] > 2 && (u[a]([i][k](e.splice(0, 2))), n = "l", i = i == "m" ? "l" : "L"); e[t] >= f[n];) + if (u[a]([i][k](e.splice(0, f[n]))), !f[n]) break + }), u[d] = n._path2string, u + }); + n.findDotsAtSegment = function(n, t, i, r, u, f, o, s, h) { + var c = 1 - h, + w = l(c, 3) * n + l(c, 2) * 3 * h * i + c * 3 * h * h * u + l(h, 3) * o; + c = l(c, 3) * t + l(c, 2) * 3 * h * r + c * 3 * h * h * f + l(h, 3) * s; + var a = n + 2 * h * (i - n) + h * h * (u - 2 * i + n), + v = t + 2 * h * (r - t) + h * h * (f - 2 * r + t), + y = i + 2 * h * (u - i) + h * h * (o - 2 * u + i), + p = r + 2 * h * (f - r) + h * h * (s - 2 * f + r); + return n = (1 - h) * n + h * i, t = (1 - h) * t + h * r, u = (1 - h) * u + h * o, f = (1 - h) * f + h * s, s = 90 - e.atan((a - y) / (v - p)) * 180 / e.PI, (a > y || v < p) && (s += 180), { + x: w, + y: c, + m: { + x: a, + y: v + }, + n: { + x: y, + y: p + }, + start: { + x: n, + y: t + }, + end: { + x: u, + y: f + }, + alpha: s + } + }; + ti = ut(function(n) { + if (!n) return { + x: 0, + y: 0, + width: 0, + height: 0 + }; + n = ai(n); + for (var r = 0, e = 0, u = [], f = [], i, o = 0, s = n[t]; o < s; o++) i = n[o], i[0] == "M" ? (r = i[1], e = i[2], u[a](r), f[a](e)) : (r = ff(r, e, i[1], i[2], i[3], i[4], i[5], i[6]), u = u[k](r.min.x, r.max.x), f = f[k](r.min.y, r.max.y), r = i[5], e = i[6]); + return n = lt[b](0, u), i = lt[b](0, f), { + x: n, + y: i, + width: ht[b](0, u) - n, + height: ht[b](0, f) - i + } + }); + gi = ut(function(i) { + var v, u, r, h, y; + n.is(i, et) && n.is(i && i[0], et) || (i = n.parsePathString(i)); + var e = [], + s = 0, + o = 0, + c = 0, + l = 0, + f = 0; + for (i[0][0] == "M" && (s = i[0][1], o = i[0][2], c = s, l = o, f++, e[a](["M", s, o])), f = f, v = i[t]; f < v; f++) { + if (u = e[f] = [], r = i[f], r[0] != yt.call(r[0])) { + u[0] = yt.call(r[0]); + switch (u[0]) { + case "a": + u[1] = r[1]; + u[2] = r[2]; + u[3] = r[3]; + u[4] = r[4]; + u[5] = r[5]; + u[6] = +(r[6] - s).toFixed(3); + u[7] = +(r[7] - o).toFixed(3); + break; + case "v": + u[1] = +(r[1] - o).toFixed(3); + break; + case "m": + c = r[1]; + l = r[2]; + default: + for (h = 1, y = r[t]; h < y; h++) u[h] = +(r[h] - (h % 2 ? s : o)).toFixed(3) + } + } else + for (e[f] = [], r[0] == "m" && (c = r[1] + s, l = r[2] + o), u = 0, h = r[t]; u < h; u++) e[f][u] = r[u]; + r = e[f][t]; + switch (e[f][0]) { + case "z": + s = c; + o = l; + break; + case "h": + s += +e[f][r - 1]; + break; + case "v": + o += +e[f][r - 1]; + break; + default: + s += +e[f][r - 2]; + o += +e[f][r - 1] + } + } + return e[d] = n._path2string, e + }, 0, ci); + dt = ut(function(i) { + var v, u, r, e, c; + n.is(i, et) && n.is(i && i[0], et) || (i = n.parsePathString(i)); + var h = [], + o = 0, + s = 0, + l = 0, + a = 0, + f = 0; + for (i[0][0] == "M" && (o = +i[0][1], s = +i[0][2], l = o, a = s, f++, h[0] = ["M", o, s]), f = f, v = i[t]; f < v; f++) { + if (u = h[f] = [], r = i[f], r[0] != ei.call(r[0])) { + u[0] = ei.call(r[0]); + switch (u[0]) { + case "A": + u[1] = r[1]; + u[2] = r[2]; + u[3] = r[3]; + u[4] = r[4]; + u[5] = r[5]; + u[6] = +(r[6] + o); + u[7] = +(r[7] + s); + break; + case "V": + u[1] = +r[1] + s; + break; + case "H": + u[1] = +r[1] + o; + break; + case "M": + l = +r[1] + o; + a = +r[2] + s; + default: + for (e = 1, c = r[t]; e < c; e++) u[e] = +r[e] + (e % 2 ? o : s) + } + } else + for (e = 0, c = r[t]; e < c; e++) h[f][e] = r[e]; + switch (u[0]) { + case "Z": + o = l; + s = a; + break; + case "H": + o = u[1]; + break; + case "V": + s = u[1]; + break; + default: + o = h[f][h[f][t] - 2]; + s = h[f][h[f][t] - 1] + } + } + return h[d] = n._path2string, h + }, null, ci); + var ff = ut(function(n, t, i, r, u, f, o, s) { + var c = u - 2 * i + n - (o - 2 * u + i), + l = 2 * (i - n) - 2 * (u - i), + p = n - i, + h = (-l + e.sqrt(l * l - 4 * c * p)) / 2 / c, + v, y; + return c = (-l - e.sqrt(l * l - 4 * c * p)) / 2 / c, v = [t, s], y = [n, o], e.abs(h) > 1e12 && (h = .5), e.abs(c) > 1e12 && (c = .5), h > 0 && h < 1 && (h = ii(n, t, i, r, u, f, o, s, h), y[a](h.x), v[a](h.y)), c > 0 && c < 1 && (h = ii(n, t, i, r, u, f, o, s, c), y[a](h.x), v[a](h.y)), c = f - 2 * r + t - (s - 2 * f + r), l = 2 * (r - t) - 2 * (f - r), p = t - r, h = (-l + e.sqrt(l * l - 4 * c * p)) / 2 / c, c = (-l - e.sqrt(l * l - 4 * c * p)) / 2 / c, e.abs(h) > 1e12 && (h = .5), e.abs(c) > 1e12 && (c = .5), h > 0 && h < 1 && (h = ii(n, t, i, r, u, f, o, s, h), y[a](h.x), v[a](h.y)), c > 0 && c < 1 && (h = ii(n, t, i, r, u, f, o, s, c), y[a](h.x), v[a](h.y)), { + min: { + x: lt[b](0, y), + y: lt[b](0, v) + }, + max: { + x: ht[b](0, y), + y: ht[b](0, v) + } + } + }), + ai = ut(function(n, i) { + function a(n, t) { + var i; + if (!n) return ["C", t.x, t.y, t.x, t.y, t.x, t.y]; + n[0] in { + T: 1, + Q: 1 + } || (t.qx = t.qy = null); + switch (n[0]) { + case "M": + t.X = n[1]; + t.Y = n[2]; + break; + case "A": + n = ["C"][k](yr[b](0, [t.x, t.y][k](n.slice(1)))); + break; + case "S": + i = t.x + (t.x - (t.bx || t.x)); + t = t.y + (t.y - (t.by || t.y)); + n = ["C", i, t][k](n.slice(1)); + break; + case "T": + t.qx = t.x + (t.x - (t.qx || t.x)); + t.qy = t.y + (t.y - (t.qy || t.y)); + n = ["C"][k](vr(t.x, t.y, t.qx, t.qy, n[1], n[2])); + break; + case "Q": + t.qx = n[1]; + t.qy = n[2]; + n = ["C"][k](vr(t.x, t.y, n[1], n[2], n[3], n[4])); + break; + case "L": + n = ["C"][k](li(t.x, t.y, n[1], n[2])); + break; + case "H": + n = ["C"][k](li(t.x, t.y, n[1], t.y)); + break; + case "V": + n = ["C"][k](li(t.x, t.y, t.x, n[1])); + break; + case "Z": + n = ["C"][k](li(t.x, t.y, t.X, t.Y)) + } + return n + } + + function v(n, i) { + if (n[i][t] > 7) { + n[i].shift(); + for (var u = n[i]; u[t];) n.splice(i++, 0, ["C"][k](u.splice(0, 6))); + n.splice(i, 1); + s = ht(f[t], r && r[t] || 0) + } + } + + function y(n, i, u, e, o) { + n && i && n[o][0] == "M" && i[o][0] != "M" && (i.splice(o, 0, ["M", e.x, e.y]), u.bx = 0, u.by = 0, u.x = n[o][1], u.y = n[o][2], s = ht(f[t], r && r[t] || 0)) + } + var f = dt(n), + r = i && dt(i), + u, s; + for (n = { + x: 0, + y: 0, + bx: 0, + by: 0, + X: 0, + Y: 0, + qx: null, + qy: null + }, i = { + x: 0, + y: 0, + bx: 0, + by: 0, + X: 0, + Y: 0, + qx: null, + qy: null + }, u = 0, s = ht(f[t], r && r[t] || 0); u < s; u++) { + f[u] = a(f[u], n); + v(f, u); + r && (r[u] = a(r[u], i)); + r && v(r, u); + y(f, r, n, i, u); + y(r, f, i, n, u); + var e = f[u], + o = r && r[u], + c = e[t], + l = r && o[t]; + n.x = e[c - 2]; + n.y = e[c - 1]; + n.bx = h(e[c - 4]) || n.x; + n.by = h(e[c - 3]) || n.y; + i.bx = r && (h(o[l - 4]) || i.x); + i.by = r && (h(o[l - 3]) || i.y); + i.x = r && o[l - 2]; + i.y = r && o[l - 1] + } + return r ? [f, r] : f + }, null, ci), + pr = ut(function(i) { + for (var r, f, e = [], u = 0, o = i[t]; u < o; u++) { + if (r = {}, f = i[u].match(/^([^:]*):?([\d\.]*)/), r.color = n.getRGB(f[1]), r.color.error) return null; + r.color = r.color.hex; + f[2] && (r.offset = f[2] + "%"); + e[a](r) + } + for (u = 1, o = e[t] - 1; u < o; u++) + if (!e[u].offset) { + for (i = h(e[u - 1].offset || 0), f = 0, r = u + 1; r < o; r++) + if (e[r].offset) { + f = e[r].offset; + break + } + for (f || (f = 100, r = o), f = h(f), f = (f - i) / (r - u + 1); u < r; u++) i += f, e[u].offset = i + "%" + } + return e + }); + if (tr = /^r(?:\(([^,]+?)\s*,\s*([^\)]+?)\))?/, n.svg) { + y[i].svgns = "http://www.w3.org/2000/svg"; + y[i].xlink = "http://www.w3.org/1999/xlink"; + v = function(n) { + return +n + (~~n === n) * .5 + }; + f = function(n, t) { + if (t) + for (var u in t) t[s](u) && n[ot](u, t[u] + r); + else return n = c.createElementNS(y[i].svgns, n), n.style.webkitTapHighlightColor = "rgba(0,0,0,0)", n + }; + n[d] = function() { + return "Your browser supports SVG.\nYou are running Raphaël " + this.version + }; + var tu = function(n, t) { + var i = f("path"); + return t.canvas && t.canvas[o](i), t = new u(i, t), t.type = "path", vt(t, { + fill: "none", + stroke: "#000", + path: n + }), t + }, + ri = function(i, u, s) { + var b = "linear", + k = .5, + y = .5, + g = i.style, + a, v, nt; + if (u = (u + r)[w](tr, function(n, t, i) { + return b = "radial", t && i && (k = h(t), y = h(i), n = (y > .5) * 2 - 1, l(k - .5, 2) + l(y - .5, 2) > .25 && (y = e.sqrt(.25 - l(k - .5, 2)) * n + .5) && y != .5 && (y = y.toFixed(5) - 1e-5 * n)), r + }), u = u[p](/\s*\-\s*/), b == "linear") { + if (a = u.shift(), a = -h(a), isNaN(a)) return null; + a = [0, 0, e.cos(a * e.PI / 180), e.sin(a * e.PI / 180)]; + v = 1 / (ht(e.abs(a[2]), e.abs(a[3])) || 1); + a[2] *= v; + a[3] *= v; + a[2] < 0 && (a[0] = -a[2], a[2] = 0); + a[3] < 0 && (a[1] = -a[3], a[3] = 0) + } + if (u = pr(u), !u) return null; + for (v = i.getAttribute(at), (v = v.match(/^url\(#(.*)\)$/)) && s.defs.removeChild(c.getElementById(v[1])), v = f(b + "Gradient"), v.id = "r" + (n._id++)[d](36), f(v, b == "radial" ? { + fx: k, + fy: y + } : { + x1: a[0], + y1: a[1], + x2: a[2], + y2: a[3] + }), s.defs[o](v), s = 0, a = u[t]; s < a; s++) nt = f("stop"), f(nt, { + offset: u[s].offset ? u[s].offset : s ? "100%" : "0%", + "stop-color": u[s].color || "#fff" + }), v[o](nt); + return f(i, { + fill: "url(#" + v.id + ")", + opacity: 1, + "fill-opacity": 1 + }), g.fill = r, g.opacity = 1, g.fillOpacity = 1 + }, + ir = function(t) { + var i = t.getBBox(); + f(t.pattern, { + patternTransform: n.format("translate({0},{1})", i.x, i.y) + }) + }, + vt = function(i, u) { + function et(n, i) { + var e, o, r; + if (i = st[yt.call(i)]) { + for (e = n.attrs["stroke-width"] || "1", n = { + round: e, + square: e, + butt: 0 + }[n.attrs["stroke-linecap"] || u["stroke-linecap"]] || 0, o = [], r = i[t]; r--;) o[r] = i[r] * e + (r % 2 ? 1 : -1) * n; + f(l, { + "stroke-dasharray": o[tt](",") + }) + } + } + var st = { + "": [0], + none: [0], + "-": [3, 1], + ".": [1, 1], + "-.": [3, 1, 1, 1], + "-..": [3, 1, 1, 1, 1, 1], + ". ": [1, 3], + "- ": [4, 3], + "--": [8, 3], + "- .": [4, 3, 1, 3], + "--.": [8, 3, 1, 3], + "--..": [8, 3, 1, 3, 1, 3] + }, + l = i.node, + b = i.attrs, + rt = i.rotate(), + k, y, e, a, it, nt, ut; + u[s]("rotation") && (rt = u.rotation); + k = (rt + r)[p](ft); + k.length - 1 ? (k[1] = +k[1], k[2] = +k[2]) : k = null; + h(rt) && i.rotate(0, !0); + for (y in u) + if (u[s](y) && oi[s](y)) { + e = u[y]; + b[y] = e; + switch (y) { + case "blur": + i.blur(e); + break; + case "rotation": + i.rotate(e, !0); + break; + case "href": + case "title": + case "target": + a = l.parentNode; + yt.call(a.tagName) != "a" && (it = f("a"), a.insertBefore(it, l), it[o](l), a = it); + a.setAttributeNS(i.paper.xlink, y, e); + break; + case "cursor": + l.style.cursor = e; + break; + case "clip-rect": + a = (e + r)[p](ft); + a[t] == 4 && (i.clip && i.clip.parentNode.parentNode.removeChild(i.clip.parentNode), nt = f("clipPath"), it = f("rect"), nt.id = "r" + (n._id++)[d](36), f(it, { + x: a[0], + y: a[1], + width: a[2], + height: a[3] + }), nt[o](it), i.paper.defs[o](nt), f(l, { + "clip-path": "url(#" + nt.id + ")" + }), i.clip = it); + e || ((e = c.getElementById(l.getAttribute("clip-path")[w](/(^url\(#|\)$)/g, r))) && e.parentNode.removeChild(e), f(l, { + "clip-path": r + }), delete i.clip); + break; + case "path": + i.type == "path" && f(l, { + d: e ? b.path = dt(e) : "M0,0" + }); + break; + case "width": + if (l[ot](y, e), b.fx) y = "x", e = b.x; + else break; + case "x": + b.fx && (e = -b.x - (b.width || 0)); + case "rx": + if (y == "rx" && i.type == "rect") break; + case "cx": + k && (y == "x" || y == "cx") && (k[1] += e - b[y]); + l[ot](y, v(e)); + i.pattern && ir(i); + break; + case "height": + if (l[ot](y, e), b.fy) y = "y", e = b.y; + else break; + case "y": + b.fy && (e = -b.y - (b.height || 0)); + case "ry": + if (y == "ry" && i.type == "rect") break; + case "cy": + k && (y == "y" || y == "cy") && (k[2] += e - b[y]); + l[ot](y, v(e)); + i.pattern && ir(i); + break; + case "r": + i.type == "rect" ? f(l, { + rx: e, + ry: e + }) : l[ot](y, e); + break; + case "src": + i.type == "image" && l.setAttributeNS(i.paper.xlink, "href", e); + break; + case "stroke-width": + l.style.strokeWidth = e; + l[ot](y, e); + b["stroke-dasharray"] && et(i, b["stroke-dasharray"]); + break; + case "stroke-dasharray": + et(i, e); + break; + case "translation": + e = (e + r)[p](ft); + e[0] = +e[0] || 0; + e[1] = +e[1] || 0; + k && (k[1] += e[0], k[2] += e[1]); + yi.call(i, e[0], e[1]); + break; + case "scale": + e = (e + r)[p](ft); + i.scale(+e[0] || 1, +e[1] || +e[0] || 1, isNaN(h(e[2])) ? null : +e[2], isNaN(h(e[3])) ? null : +e[3]); + break; + case at: + if (a = (e + r).match(cr)) { + nt = f("pattern"); + ut = f("image"); + nt.id = "r" + (n._id++)[d](36); + f(nt, { + x: 0, + y: 0, + patternUnits: "userSpaceOnUse", + height: 1, + width: 1 + }); + f(ut, { + x: 0, + y: 0 + }); + ut.setAttributeNS(i.paper.xlink, "href", a[1]); + nt[o](ut); + e = c.createElement("img"); + e.style.cssText = "position:absolute;left:-9999em;top-9999em"; + e.onload = function() { + f(nt, { + width: this.offsetWidth, + height: this.offsetHeight + }); + f(ut, { + width: this.offsetWidth, + height: this.offsetHeight + }); + c.body.removeChild(this); + i.paper.safari() + }; + c.body[o](e); + e.src = a[1]; + i.paper.defs[o](nt); + l.style.fill = "url(#" + nt.id + ")"; + f(l, { + fill: "url(#" + nt.id + ")" + }); + i.pattern = nt; + i.pattern && ir(i); + break + } + if (a = n.getRGB(e), a.error) { + if (({ + circle: 1, + ellipse: 1 + }[s](i.type) || (e + r).charAt() != "r") && ri(l, e, i.paper)) { + b.gradient = e; + b.fill = "none"; + break + } + } else delete u.gradient, delete b.gradient, !n.is(b.opacity, "undefined") && n.is(u.opacity, "undefined") && f(l, { + opacity: b.opacity + }), !n.is(b["fill-opacity"], "undefined") && n.is(u["fill-opacity"], "undefined") && f(l, { + "fill-opacity": b["fill-opacity"] + }); + a[s]("o") && f(l, { + "fill-opacity": a.o / 100 + }); + case "stroke": + a = n.getRGB(e); + l[ot](y, a.hex); + y == "stroke" && a[s]("o") && f(l, { + "stroke-opacity": a.o / 100 + }); + break; + case "gradient": + ({ + circle: 1, + ellipse: 1 + }[s](i.type) || (e + r).charAt() != "r") && ri(l, e, i.paper); + break; + case "opacity": + case "fill-opacity": + if (b.gradient) { + (a = c.getElementById(l.getAttribute(at)[w](/^url\(#|\)$/g, r))) && (a = a.getElementsByTagName("stop"), a[a[t] - 1][ot]("stop-opacity", e)); + break + } + default: + y == "font-size" && (e = pt(e, 10) + "px"); + a = y[w](/(\-.)/g, function(n) { + return ei.call(n.substring(1)) + }); + l.style[a] = e; + l[ot](y, e) + } + } + ef(i, u); + k ? i.rotate(k.join(g)) : h(rt) && i.rotate(rt, !0) + }, + iu = 1.2, + ef = function(n, i) { + var u, l, a; + if (!(n.type != "text" || !(i[s]("text") || i[s]("font") || i[s]("font-size") || i[s]("x") || i[s]("y")))) { + var h = n.attrs, + e = n.node, + v = e.firstChild ? pt(c.defaultView.getComputedStyle(e.firstChild, r).getPropertyValue("font-size"), 10) : 10; + if (i[s]("text")) { + for (h.text = i.text; e.firstChild;) e.removeChild(e.firstChild); + for (i = (i.text + r)[p]("\n"), u = 0, l = i[t]; u < l; u++) i[u] && (a = f("tspan"), u && f(a, { + dy: v * iu, + x: h.x + }), a[o](c.createTextNode(i[u])), e[o](a)) + } else + for (i = e.getElementsByTagName("tspan"), u = 0, l = i[t]; u < l; u++) u && f(i[u], { + dy: v * iu, + x: h.x + }); + f(e, { + y: h.y + }); + n = n.getBBox(); + (n = h.y - (n.y + n.height / 2)) && isFinite(n) && f(e, { + y: h.y + n + }) + } + }, + u = function(t, i) { + this[0] = t; + this.id = n._oid++; + this.node = t; + t.raphael = this; + this.paper = i; + this.attrs = this.attrs || {}; + this.transformations = []; + this._ = { + tx: 0, + ty: 0, + rt: { + deg: 0, + cx: 0, + cy: 0 + }, + sx: 1, + sy: 1 + }; + i.bottom || (i.bottom = this); + (this.prev = i.top) && (i.top.next = this); + i.top = this; + this.next = null + }; + u[i].rotate = function(i, u, e) { + if (this.removed) return this; + if (i == null) return this._.rt.cx ? [this._.rt.deg, this._.rt.cx, this._.rt.cy][tt](g) : this._.rt.deg; + var o = this.getBBox(); + return i = (i + r)[p](ft), i[t] - 1 && (u = h(i[1]), e = h(i[2])), i = h(i[0]), u != null ? this._.rt.deg = i : this._.rt.deg += i, e == null && (u = null), this._.rt.cx = u, this._.rt.cy = e, u = u == null ? o.x + o.width / 2 : u, e = e == null ? o.y + o.height / 2 : e, this._.rt.deg ? (this.transformations[0] = n.format("rotate({0} {1} {2})", this._.rt.deg, u, e), this.clip && f(this.clip, { + transform: n.format("rotate({0} {1} {2})", -this._.rt.deg, u, e) + })) : (this.transformations[0] = r, this.clip && f(this.clip, { + transform: r + })), f(this.node, { + transform: this.transformations[tt](g) + }), this + }; + u[i].hide = function() { + return this.removed || (this.node.style.display = "none"), this + }; + u[i].show = function() { + return this.removed || (this.node.style.display = ""), this + }; + u[i].remove = function() { + if (!this.removed) { + gt(this, this.paper); + this.node.parentNode.removeChild(this.node); + for (var n in this) delete this[n]; + this.removed = !0 + } + }; + u[i].getBBox = function() { + var r, n, i, u, t; + if (this.removed) return this; + if (this.type == "path") return ti(this.attrs.path); + this.node.style.display == "none" && (this.show(), r = !0); + n = {}; + try { + n = this.node.getBBox() + } catch (f) {} finally { + n = n || {} + } + if (this.type == "text") + for (n = { + x: n.x, + y: Infinity, + width: 0, + height: 0 + }, i = 0, u = this.node.getNumberOfChars(); i < u; i++) t = this.node.getExtentOfChar(i), t.y < n.y && (n.y = t.y), t.y + t.height - n.y > n.height && (n.height = t.y + t.height - n.y), t.x + t.width - n.x > n.width && (n.width = t.x + t.width - n.x); + return r && this.hide(), n + }; + u[i].attr = function(t, i) { + var r, u; + if (this.removed) return this; + if (t == null) { + t = {}; + for (r in this.attrs) this.attrs[s](r) && (t[r] = this.attrs[r]); + return this._.rt.deg && (t.rotation = this.rotate()), (this._.sx != 1 || this._.sy != 1) && (t.scale = this.scale()), t.gradient && t.fill == "none" && (t.fill = t.gradient) && delete t.gradient, t + } + if (i == null && n.is(t, wt)) return t == "translation" ? yi.call(this) : t == "rotation" ? this.rotate() : t == "scale" ? this.scale() : t == at && this.attrs.fill == "none" && this.attrs.gradient ? this.attrs.gradient : this.attrs[t]; + if (i == null && n.is(t, et)) { + for (i = {}, r = 0, u = t.length; r < u; r++) i[t[r]] = this.attr(t[r]); + return i + } + return i != null ? (r = {}, r[t] = i, vt(this, r)) : t != null && n.is(t, "object") && vt(this, t), this + }; + u[i].toFront = function() { + if (this.removed) return this; + this.node.parentNode[o](this.node); + var n = this.paper; + return n.top != this && br(this, n), this + }; + u[i].toBack = function() { + return this.removed ? this : (this.node.parentNode.firstChild != this.node && (this.node.parentNode.insertBefore(this.node, this.node.parentNode.firstChild), kr(this, this.paper)), this) + }; + u[i].insertAfter = function(n) { + if (this.removed) return this; + var t = n.node; + return t.nextSibling ? t.parentNode.insertBefore(this.node, t.nextSibling) : t.parentNode[o](this.node), dr(this, n, this.paper), this + }; + u[i].insertBefore = function(n) { + if (this.removed) return this; + var t = n.node; + return t.parentNode.insertBefore(this.node, t), gr(this, n, this.paper), this + }; + u[i].blur = function(t) { + var i = this, + r, u; + t != 0 ? (r = f("filter"), u = f("feGaussianBlur"), i.attrs.blur = t, r.id = "r" + (n._id++)[d](36), f(u, { + stdDeviation: +t || 1.5 + }), r.appendChild(u), i.paper.defs.appendChild(r), i._blur = r, f(i.node, { + filter: "url(#" + r.id + ")" + })) : (i._blur && (i._blur.parentNode.removeChild(i._blur), delete i._blur, delete i.attrs.blur), i.node.removeAttribute("filter")) + }; + var ru = function(n, t, i, r) { + t = v(t); + i = v(i); + var e = f("circle"); + return n.canvas && n.canvas[o](e), n = new u(e, n), n.attrs = { + cx: t, + cy: i, + r: r, + fill: "none", + stroke: "#000" + }, n.type = "circle", f(e, n.attrs), n + }, + uu = function(n, t, i, r, e, s) { + t = v(t); + i = v(i); + var h = f("rect"); + return n.canvas && n.canvas[o](h), n = new u(h, n), n.attrs = { + x: t, + y: i, + width: r, + height: e, + r: s || 0, + rx: s || 0, + ry: s || 0, + fill: "none", + stroke: "#000" + }, n.type = "rect", f(h, n.attrs), n + }, + fu = function(n, t, i, r, e) { + t = v(t); + i = v(i); + var s = f("ellipse"); + return n.canvas && n.canvas[o](s), n = new u(s, n), n.attrs = { + cx: t, + cy: i, + rx: r, + ry: e, + fill: "none", + stroke: "#000" + }, n.type = "ellipse", f(s, n.attrs), n + }, + eu = function(n, t, i, r, e, s) { + var h = f("image"); + return f(h, { + x: i, + y: r, + width: e, + height: s, + preserveAspectRatio: "none" + }), h.setAttributeNS(n.xlink, "href", t), n.canvas && n.canvas[o](h), n = new u(h, n), n.attrs = { + x: i, + y: r, + width: e, + height: s, + src: t + }, n.type = "image", n + }, + ou = function(n, t, i, r) { + var e = f("text"); + return f(e, { + x: t, + y: i, + "text-anchor": "middle" + }), n.canvas && n.canvas[o](e), n = new u(e, n), n.attrs = { + x: t, + y: i, + "text-anchor": "middle", + text: r, + font: oi.font, + stroke: "none", + fill: "#000" + }, n.type = "text", vt(n, n.attrs), n + }, + su = function(n, t) { + return this.width = n || this.width, this.height = t || this.height, this.canvas[ot]("width", this.width), this.canvas[ot]("height", this.height), this + }, + rr = function() { + var i = wr[b](0, arguments), + t = i && i.container, + e = i.x, + s = i.y, + u = i.width, + r; + if (i = i.height, !t) throw new Error("SVG container not found."); + return r = f("svg"), e = e || 0, s = s || 0, u = u || 512, i = i || 342, f(r, { + xmlns: "http://www.w3.org/2000/svg", + version: 1.1, + width: u, + height: i + }), t == 1 ? (r.style.cssText = "position:absolute;left:" + e + "px;top:" + s + "px", c.body[o](r)) : t.firstChild ? t.insertBefore(r, t.firstChild) : t[o](r), t = new y, t.width = u, t.height = i, t.canvas = r, nr.call(t, t, n.fn), t.clear(), t + }; + y[i].clear = function() { + for (var n = this.canvas; n.firstChild;) n.removeChild(n.firstChild); + this.bottom = this.top = null; + (this.desc = f("desc"))[o](c.createTextNode("Created with Raphaël")); + n[o](this.desc); + n[o](this.defs = f("defs")) + }; + y[i].remove = function() { + this.canvas.parentNode && this.canvas.parentNode.removeChild(this.canvas); + for (var n in this) this[n] = nu(n) + } + } + if (n.vml) { + var hu = { + M: "m", + L: "l", + C: "c", + Z: "x", + m: "t", + l: "r", + c: "v", + z: "x" + }, + of = /([clmz]),?([^clmz]*)/gi, + sf = /-?[^,\s-]+/g, + ui = 1e3 + g + 1e3, + ni = 10, + fi = { + path: 1, + rect: 1 + }, + hf = function(n) { + var i = /[ahqstv]/ig, + u = dt, + f, e, h, o, s; + if ((n + r).match(i) && (u = ai), i = /[clmz]/g, u == dt && !(n + r).match(i)) return (n + r)[w]( of , function(n, i, r) { + var u = [], + e = yt.call(i) == "m", + f = hu[i]; + return r[w](sf, function(n) { + e && u[t] == 2 && (f += u + hu[i == "m" ? "l" : "L"], u = []); + u[a](v(n * ni)) + }), f + u + }); + for (i = u(n), n = [], e = 0, h = i[t]; e < h; e++) { + for (u = i[e], f = yt.call(i[e][0]), f == "z" && (f = "x"), o = 1, s = u[t]; o < s; o++) f += v(u[o] * ni) + (o != s - 1 ? "," : r); + n[a](f) + } + return n[tt](g) + }; + n[d] = function() { + return "Your browser doesn’t support SVG. Falling down to VML.\nYou are running Raphaël " + this.version + }; + tu = function(n, t) { + var f = it("group"), + i, e; + return f.style.cssText = "position:absolute;left:0;top:0;width:" + t.width + "px;height:" + t.height + "px", f.coordsize = t.coordsize, f.coordorigin = t.coordorigin, i = it("shape"), e = i.style, e.width = t.width + "px", e.height = t.height + "px", i.coordsize = ui, i.coordorigin = t.coordorigin, f[o](i), i = new u(i, f, t), e = { + fill: "none", + stroke: "#000" + }, n && (e.path = n), i.isAbsolute = !0, i.type = "path", i.path = [], i.Path = r, vt(i, e), t.canvas[o](f), i + }; + vt = function(i, u) { + var y, b, k, d; + i.attrs = i.attrs || {}; + var a = i.node, + e = i.attrs, + f = a.style, + l; + l = (u.x != e.x || u.y != e.y || u.width != e.width || u.height != e.height || u.r != e.r) && i.type == "rect"; + y = i; + for (b in u) u[s](b) && (e[b] = u[b]); + if (l && (e.path = lu(e.x, e.y, e.width, e.height, e.r), i.X = e.x, i.Y = e.y, i.W = e.width, i.H = e.height), u.href && (a.href = u.href), u.title && (a.title = u.title), u.target && (a.target = u.target), u.cursor && (f.cursor = u.cursor), "blur" in u && i.blur(u.blur), (u.path && i.type == "path" || l) && (a.path = hf(e.path)), u.rotation != null && i.rotate(u.rotation, !0), u.translation && (l = (u.translation + r)[p](ft), yi.call(i, l[0], l[1]), i._.rt.cx != null && (i._.rt.cx += +l[0], i._.rt.cy += +l[1], i.setBox(i.attrs, l[0], l[1]))), u.scale && (l = (u.scale + r)[p](ft), i.scale(+l[0] || 1, +l[1] || +l[0] || 1, +l[2] || null, +l[3] || null)), "clip-rect" in u && (l = (u["clip-rect"] + r)[p](ft), l[t] == 4 && (l[2] = +l[2] + +l[0], l[3] = +l[3] + +l[1], b = a.clipRect || c.createElement("div"), k = b.style, d = a.parentNode, k.clip = n.format("rect({1}px {2}px {3}px {0}px)", l), a.clipRect || (k.position = "absolute", k.top = 0, k.left = 0, k.width = i.paper.width + "px", k.height = i.paper.height + "px", d.parentNode.insertBefore(b, d), b[o](d), a.clipRect = b)), u["clip-rect"] || a.clipRect && (a.clipRect.style.clip = r)), i.type == "image" && u.src && (a.src = u.src), i.type == "image" && u.opacity && (a.filterOpacity = ki + ".Alpha(opacity=" + u.opacity * 100 + ")", f.filter = (a.filterMatrix || r) + (a.filterOpacity || r)), u.font && (f.font = u.font), u["font-family"] && (f.fontFamily = '"' + u["font-family"][p](",")[0][w](/^['"]+|['"]+$/g, r) + '"'), u["font-size"] && (f.fontSize = u["font-size"]), u["font-weight"] && (f.fontWeight = u["font-weight"]), u["font-style"] && (f.fontStyle = u["font-style"]), (u.opacity != null || u["stroke-width"] != null || u.fill != null || u.stroke != null || u["stroke-width"] != null || u["stroke-opacity"] != null || u["fill-opacity"] != null || u["stroke-dasharray"] != null || u["stroke-miterlimit"] != null || u["stroke-linejoin"] != null || u["stroke-linecap"] != null) && (a = i.shape || a, f = a.getElementsByTagName(at) && a.getElementsByTagName(at)[0], l = !1, f || (l = f = it(at)), ("fill-opacity" in u || "opacity" in u) && (i = ((+e["fill-opacity"] + 1 || 2) - 1) * ((+e.opacity + 1 || 2) - 1) * ((+n.getRGB(u.fill).o + 1 || 2) - 1), i < 0 && (i = 0), i > 1 && (i = 1), f.opacity = i), u.fill && (f.on = !0), (f.on == null || u.fill == "none") && (f.on = !1), f.on && u.fill && ((i = u.fill.match(cr)) ? (f.src = i[1], f.type = "tile") : (f.color = n.getRGB(u.fill).hex, f.src = r, f.type = "solid", n.getRGB(u.fill).error && (y.type in { + circle: 1, + ellipse: 1 + } || (u.fill + r).charAt() != "r") && ri(y, u.fill) && (e.fill = "none", e.gradient = u.fill))), l && a[o](f), f = a.getElementsByTagName("stroke") && a.getElementsByTagName("stroke")[0], l = !1, f || (l = f = it("stroke")), (u.stroke && u.stroke != "none" || u["stroke-width"] || u["stroke-opacity"] != null || u["stroke-dasharray"] || u["stroke-miterlimit"] || u["stroke-linejoin"] || u["stroke-linecap"]) && (f.on = !0), (u.stroke == "none" || f.on == null || u.stroke == 0 || u["stroke-width"] == 0) && (f.on = !1), i = n.getRGB(u.stroke), f.on && u.stroke && (f.color = i.hex), i = ((+e["stroke-opacity"] + 1 || 2) - 1) * ((+e.opacity + 1 || 2) - 1) * ((+i.o + 1 || 2) - 1), b = (h(u["stroke-width"]) || 1) * .75, i < 0 && (i = 0), i > 1 && (i = 1), u["stroke-width"] == null && (b = e["stroke-width"]), u["stroke-width"] && (f.weight = b), b && b < 1 && (i *= b) && (f.weight = 1), f.opacity = i, u["stroke-linejoin"] && (f.joinstyle = u["stroke-linejoin"] || "miter"), f.miterlimit = u["stroke-miterlimit"] || 8, u["stroke-linecap"] && (f.endcap = u["stroke-linecap"] == "butt" ? "flat" : u["stroke-linecap"] == "square" ? "square" : "round"), u["stroke-dasharray"] && (i = { + "-": "shortdash", + ".": "shortdot", + "-.": "shortdashdot", + "-..": "shortdashdotdot", + ". ": "dot", + "- ": "dash", + "--": "longdash", + "- .": "dashdot", + "--.": "longdashdot", + "--..": "longdashdotdot" + }, f.dashstyle = i[s](u["stroke-dasharray"]) ? i[u["stroke-dasharray"]] : r), l && a[o](f)), y.type == "text") { + f = y.paper.span.style; + e.font && (f.font = e.font); + e["font-family"] && (f.fontFamily = e["font-family"]); + e["font-size"] && (f.fontSize = e["font-size"]); + e["font-weight"] && (f.fontWeight = e["font-weight"]); + e["font-style"] && (f.fontStyle = e["font-style"]); + y.node.string && (y.paper.span.innerHTML = (y.node.string + r)[w](/</g, "<")[w](/&/g, "&")[w](/\n/g, "<br>")); + y.W = e.w = y.paper.span.offsetWidth; + y.H = e.h = y.paper.span.offsetHeight; + y.X = e.x; + y.Y = e.y + v(y.H / 2); + switch (e["text-anchor"]) { + case "start": + y.node.style["v-text-align"] = "left"; + y.bbx = v(y.W / 2); + break; + case "end": + y.node.style["v-text-align"] = "right"; + y.bbx = -v(y.W / 2); + break; + default: + y.node.style["v-text-align"] = "center" + } + } + }; + ri = function(n, i) { + var s, c, o, u, f, v; + if ((n.attrs = n.attrs || {}, s = "linear", c = ".5 .5", n.attrs.gradient = i, i = (i + r)[w](tr, function(n, t, i) { + return s = "radial", t && i && (t = h(t), i = h(i), l(t - .5, 2) + l(i - .5, 2) > .25 && (i = e.sqrt(.25 - l(t - .5, 2)) * ((i > .5) * 2 - 1) + .5), c = t + g + i), r + }), i = i[p](/\s*\-\s*/), s == "linear" && (o = i.shift(), o = -h(o), isNaN(o))) || (u = pr(i), !u)) return null; + if (n = n.shape || n.node, i = n.getElementsByTagName(at)[0] || it(at), i.parentNode || n.appendChild(i), u[t]) { + for (i.on = !0, i.method = "none", i.color = u[0].color, i.color2 = u[u[t] - 1].color, n = [], f = 0, v = u[t]; f < v; f++) u[f].offset && n[a](u[f].offset + g + u[f].color); + i.colors && (i.colors.value = n[t] ? n[tt]() : "0% " + i.color); + s == "radial" ? (i.type = "gradientradial", i.focus = "100%", i.focussize = c, i.focusposition = c) : (i.type = "gradient", i.angle = (270 - o) % 360) + } + return 1 + }; + u = function(t, i, r) { + this[0] = t; + this.id = n._oid++; + this.node = t; + t.raphael = this; + this.Y = this.X = 0; + this.attrs = {}; + this.Group = i; + this.paper = r; + this._ = { + tx: 0, + ty: 0, + rt: { + deg: 0 + }, + sx: 1, + sy: 1 + }; + r.bottom || (r.bottom = this); + (this.prev = r.top) && (r.top.next = this); + r.top = this; + this.next = null + }; + u[i].rotate = function(n, i, u) { + return this.removed ? this : n == null ? this._.rt.cx ? [this._.rt.deg, this._.rt.cx, this._.rt.cy][tt](g) : this._.rt.deg : (n = (n + r)[p](ft), n[t] - 1 && (i = h(n[1]), u = h(n[2])), n = h(n[0]), i != null ? this._.rt.deg = n : this._.rt.deg += n, u == null && (i = null), this._.rt.cx = i, this._.rt.cy = u, this.setBox(this.attrs, i, u), this.Group.style.rotation = this._.rt.deg, this) + }; + u[i].setBox = function(n, t, i) { + var c, e, o, u, h, f; + if (this.removed) return this; + c = this.Group.style; + e = this.shape && this.shape.style || this.node.style; + n = n || {}; + for (o in n) n[s](o) && (this.attrs[o] = n[o]); + t = t || this._.rt.cx; + i = i || this._.rt.cy; + u = this.attrs; + switch (this.type) { + case "circle": + n = u.cx - u.r; + o = u.cy - u.r; + h = u = u.r * 2; + break; + case "ellipse": + n = u.cx - u.rx; + o = u.cy - u.ry; + h = u.rx * 2; + u = u.ry * 2; + break; + case "image": + n = +u.x; + o = +u.y; + h = u.width || 0; + u = u.height || 0; + break; + case "text": + this.textpath.v = ["m", v(u.x), ", ", v(u.y - 2), "l", v(u.x) + 1, ", ", v(u.y - 2)][tt](r); + n = u.x - v(this.W / 2); + o = u.y - this.H / 2; + h = this.W; + u = this.H; + break; + case "rect": + case "path": + this.attrs.path ? (u = ti(this.attrs.path), n = u.x, o = u.y, h = u.width, u = u.height) : (o = n = 0, h = this.paper.width, u = this.paper.height); + break; + default: + o = n = 0; + h = this.paper.width; + u = this.paper.height + } + t = t == null ? n + h / 2 : t; + i = i == null ? o + u / 2 : i; + t = t - this.paper.width / 2; + i = i - this.paper.height / 2; + c.left != (f = t + "px") && (c.left = f); + c.top != (f = i + "px") && (c.top = f); + this.X = fi[s](this.type) ? -t : n; + this.Y = fi[s](this.type) ? -i : o; + this.W = h; + this.H = u; + fi[s](this.type) ? (e.left != (f = -t * ni + "px") && (e.left = f), e.top != (f = -i * ni + "px") && (e.top = f)) : this.type == "text" ? (e.left != (f = -t + "px") && (e.left = f), e.top != (f = -i + "px") && (e.top = f)) : (c.width != (f = this.paper.width + "px") && (c.width = f), c.height != (f = this.paper.height + "px") && (c.height = f), e.left != (f = n - t + "px") && (e.left = f), e.top != (f = o - i + "px") && (e.top = f), e.width != (f = h + "px") && (e.width = f), e.height != (f = u + "px") && (e.height = f)) + }; + u[i].hide = function() { + return this.removed || (this.Group.style.display = "none"), this + }; + u[i].show = function() { + return this.removed || (this.Group.style.display = "block"), this + }; + u[i].getBBox = function() { + return this.removed ? this : fi[s](this.type) ? ti(this.attrs.path) : { + x: this.X + (this.bbx || 0), + y: this.Y, + width: this.W, + height: this.H + } + }; + u[i].remove = function() { + if (!this.removed) { + gt(this, this.paper); + this.node.parentNode.removeChild(this.node); + this.Group.parentNode.removeChild(this.Group); + this.shape && this.shape.parentNode.removeChild(this.shape); + for (var n in this) delete this[n]; + this.removed = !0 + } + }; + u[i].attr = function(i, u) { + var e, f; + if (this.removed) return this; + if (i == null) { + i = {}; + for (e in this.attrs) this.attrs[s](e) && (i[e] = this.attrs[e]); + return this._.rt.deg && (i.rotation = this.rotate()), (this._.sx != 1 || this._.sy != 1) && (i.scale = this.scale()), i.gradient && i.fill == "none" && (i.fill = i.gradient) && delete i.gradient, i + } + if (u == null && n.is(i, wt)) return i == "translation" ? yi.call(this) : i == "rotation" ? this.rotate() : i == "scale" ? this.scale() : i == at && this.attrs.fill == "none" && this.attrs.gradient ? this.attrs.gradient : this.attrs[i]; + if (this.attrs && u == null && n.is(i, et)) { + for (f = {}, e = 0, u = i[t]; e < u; e++) f[i[e]] = this.attr(i[e]); + return f + } + return u != null && (f = {}, f[i] = u), u == null && n.is(i, "object") && (f = i), f && (f.text && this.type == "text" && (this.node.string = f.text), vt(this, f), f.gradient && ({ + circle: 1, + ellipse: 1 + }[s](this.type) || (f.gradient + r).charAt() != "r") && ri(this, f.gradient), (!fi[s](this.type) || this._.rt.deg) && this.setBox(this.attrs)), this + }; + u[i].toFront = function() { + return this.removed || this.Group.parentNode[o](this.Group), this.paper.top != this && br(this, this.paper), this + }; + u[i].toBack = function() { + return this.removed ? this : (this.Group.parentNode.firstChild != this.Group && (this.Group.parentNode.insertBefore(this.Group, this.Group.parentNode.firstChild), kr(this, this.paper)), this) + }; + u[i].insertAfter = function(n) { + return this.removed ? this : (n.Group.nextSibling ? n.Group.parentNode.insertBefore(this.Group, n.Group.nextSibling) : n.Group.parentNode[o](this.Group), dr(this, n, this.paper), this) + }; + u[i].insertBefore = function(n) { + return this.removed ? this : (n.Group.parentNode.insertBefore(this.Group, n.Group), gr(this, n, this.paper), this) + }; + cu = / progid:\S+Blur\([^\)]+\)/g; + u[i].blur = function(n) { + var t = this.node.style, + i = t.filter; + i = i.replace(cu, ""); + n != 0 ? (this.attrs.blur = n, t.filter = i + ki + ".Blur(pixelradius=" + (+n || 1.5) + ")", t.margin = Raphael.format("-{0}px 0 0 -{0}px", Math.round(+n || 1.5))) : (t.filter = i, t.margin = 0, delete this.attrs.blur) + }; + ru = function(n, t, i, r) { + var e = it("group"), + f = it("oval"); + return e.style.cssText = "position:absolute;left:0;top:0;width:" + n.width + "px;height:" + n.height + "px", e.coordsize = ui, e.coordorigin = n.coordorigin, e[o](f), f = new u(f, e, n), f.type = "circle", vt(f, { + stroke: "#000", + fill: "none" + }), f.attrs.cx = t, f.attrs.cy = i, f.attrs.r = r, f.setBox({ + x: t - r, + y: i - r, + width: r * 2, + height: r * 2 + }), n.canvas[o](e), f + }; + + function lu(t, i, r, u, f) { + return f ? n.format("M{0},{1}l{2},0a{3},{3},0,0,1,{3},{3}l0,{5}a{3},{3},0,0,1,{4},{3}l{6},0a{3},{3},0,0,1,{4},{4}l0,{7}a{3},{3},0,0,1,{3},{4}z", t + f, i, r - f * 2, f, -f, u - f * 2, f * 2 - r, f * 2 - u) : n.format("M{0},{1}l{2},0,0,{3},{4},0z", t, i, r, u, -r) + } + uu = function(n, t, i, r, u, f) { + var o = lu(t, i, r, u, f), + e; + return n = n.path(o), e = n.attrs, n.X = e.x = t, n.Y = e.y = i, n.W = e.width = r, n.H = e.height = u, e.r = f, e.path = o, n.type = "rect", n + }; + fu = function(n, t, i, r, f) { + var s = it("group"), + e = it("oval"); + return s.style.cssText = "position:absolute;left:0;top:0;width:" + n.width + "px;height:" + n.height + "px", s.coordsize = ui, s.coordorigin = n.coordorigin, s[o](e), e = new u(e, s, n), e.type = "ellipse", vt(e, { + stroke: "#000" + }), e.attrs.cx = t, e.attrs.cy = i, e.attrs.rx = r, e.attrs.ry = f, e.setBox({ + x: t - r, + y: i - f, + width: r * 2, + height: f * 2 + }), n.canvas[o](s), e + }; + eu = function(n, t, i, r, f, e) { + var h = it("group"), + s = it("image"); + return h.style.cssText = "position:absolute;left:0;top:0;width:" + n.width + "px;height:" + n.height + "px", h.coordsize = ui, h.coordorigin = n.coordorigin, s.src = t, h[o](s), s = new u(s, h, n), s.type = "image", s.attrs.src = t, s.attrs.x = i, s.attrs.y = r, s.attrs.w = f, s.attrs.h = e, s.setBox({ + x: i, + y: r, + width: f, + height: e + }), n.canvas[o](h), s + }; + ou = function(t, i, f, e) { + var h = it("group"), + c = it("shape"), + s = c.style, + l = it("path"), + a = it("textpath"); + return h.style.cssText = "position:absolute;left:0;top:0;width:" + t.width + "px;height:" + t.height + "px", h.coordsize = ui, h.coordorigin = t.coordorigin, l.v = n.format("m{0},{1}l{2},{1}", v(i * 10), v(f * 10), v(i * 10) + 1), l.textpathok = !0, s.width = t.width, s.height = t.height, a.string = e + r, a.on = !0, c[o](a), c[o](l), h[o](c), s = new u(a, h, t), s.shape = c, s.textpath = l, s.type = "text", s.attrs.text = e, s.attrs.x = i, s.attrs.y = f, s.attrs.w = 1, s.attrs.h = 1, vt(s, { + font: oi.font, + stroke: "none", + fill: "#000" + }), s.setBox(), t.canvas[o](h), s + }; + su = function(n, t) { + var i = this.canvas.style; + return n == +n && (n += "px"), t == +t && (t += "px"), i.width = n, i.height = t, i.clip = "rect(0 " + n + " " + t + " 0)", this + }; + c.createStyleSheet().addRule(".rvml", "behavior:url(#default#VML)"); + try { + c.namespaces.rvml || c.namespaces.add("rvml", "urn:schemas-microsoft-com:vml"); + it = function(n) { + return c.createElement("<rvml:" + n + ' class="rvml">') + } + } catch (pf) { + it = function(n) { + return c.createElement("<" + n + ' xmlns="urn:schemas-microsoft.com:vml" class="rvml">') + } + } + rr = function() { + var i = wr[b](0, arguments), + r = i.container, + u = i.height, + f = i.width, + h = i.x; + if (i = i.y, !r) throw new Error("VML container not found."); + var t = new y, + e = t.canvas = c.createElement("div"), + s = e.style; + return h = h || 0, i = i || 0, f = f || 512, u = u || 342, f == +f && (f += "px"), u == +u && (u += "px"), t.width = 1e3, t.height = 1e3, t.coordsize = ni * 1e3 + g + ni * 1e3, t.coordorigin = "0 0", t.span = c.createElement("span"), t.span.style.cssText = "position:absolute;left:-9999em;top:-9999em;padding:0;margin:0;line-height:1;display:inline;", e[o](t.span), s.cssText = n.format("width:{0};height:{1};display:inline-block;position:relative;clip:rect(0 {0} {1} 0);overflow:hidden", f, u), r == 1 ? (c.body[o](e), s.left = h + "px", s.top = i + "px", s.position = "absolute") : r.firstChild ? r.insertBefore(e, r.firstChild) : r[o](e), nr.call(t, t, n.fn), t + }; + y[i].clear = function() { + this.canvas.innerHTML = r; + this.span = c.createElement("span"); + this.span.style.cssText = "position:absolute;left:-9999em;top:-9999em;padding:0;margin:0;line-height:1;display:inline;"; + this.canvas[o](this.span); + this.bottom = this.top = null + }; + y[i].remove = function() { + this.canvas.parentNode.removeChild(this.canvas); + for (var n in this) this[n] = nu(n); + return !0 + } + } + for (y[i].safari = /^Apple|^Google/.test(st.navigator.vendor) && (!(st.navigator.userAgent.indexOf("Version/4.0") + 1) || st.navigator.platform.slice(0, 2) == "iP") ? function() { + var n = this.rect(-99, -99, this.width + 99, this.height + 99); + st.setTimeout(function() { + n.remove() + }) + } : function() {}, au = function() { + return c.addEventListener ? function(n, t, i, r) { + function f(u) { + if (wi && bi[s](t)) + for (var f = 0, e = u.targetTouches && u.targetTouches.length; f < e; f++) + if (u.targetTouches[f].target == n) { + e = u; + u = u.targetTouches[f]; + u.originalEvent = e; + u.preventDefault = lf; + u.stopPropagation = vf; + break + } + return i.call(r, u) + } + var u = wi && bi[t] ? bi[t] : t; + return n.addEventListener(u, f, !1), + function() { + return n.removeEventListener(u, f, !1), !0 + } + } : c.attachEvent ? function(n, t, i, r) { + function u(n) { + return n = n || st.event, n.preventDefault = n.preventDefault || cf, n.stopPropagation = n.stopPropagation || af, i.call(r, n) + } + + function f() { + return n.detachEvent("on" + t, u), !0 + } + return n.attachEvent("on" + t, u), f + } : void 0 + }(), bt = hr[t]; bt--;)(function(r) { + n[r] = u[i][r] = function(t) { + return n.is(t, "function") && (this.events = this.events || [], this.events.push({ + name: r, + f: t, + unbind: au(this.shape || this.node || c, r, t, this) + })), this + }; + n["un" + r] = u[i]["un" + r] = function(n) { + for (var i = this.events, u = i[t]; u--;) + if (i[u].name == r && i[u].f == n) return i[u].unbind(), i.splice(u, 1), i.length || delete this.events, this; + return this + } + })(hr[bt]); + u[i].hover = function(n, t) { + return this.mouseover(n).mouseout(t) + }; + u[i].unhover = function(n, t) { + return this.unmouseover(n).unmouseout(t) + }; + u[i].drag = function(n, t, i) { + function u(t) { + var u = t.clientX, + f = t.clientY, + e, i; + if (wi) { + for (e = t.touches.length; e--;) + if (i = t.touches[e], i.identifier == r._drag.id) { + u = i.clientX; + f = i.clientY; + (t.originalEvent ? t.originalEvent : t).preventDefault(); + break + } + } else t.preventDefault(); + n && n.call(r, u - r._drag.x, f - r._drag.y, u, f) + } + + function f() { + r._drag = {}; + Raphael.unmousemove(u).unmouseup(f); + i && i.call(r) + } + this._drag = {}; + var r = this.mousedown(function(n) { + (n.originalEvent ? n.originalEvent : n).preventDefault(); + this._drag.x = n.clientX; + this._drag.y = n.clientY; + this._drag.id = n.identifier; + t && t.call(this, n.clientX, n.clientY); + Raphael.mousemove(u).mouseup(f) + }); + return this + }; + y[i].circle = function(n, t, i) { + return ru(this, n || 0, t || 0, i || 0) + }; + y[i].rect = function(n, t, i, r, u) { + return uu(this, n || 0, t || 0, i || 0, r || 0, u || 0) + }; + y[i].ellipse = function(n, t, i, r) { + return fu(this, n || 0, t || 0, i || 0, r || 0) + }; + y[i].path = function(t) { + return !t || n.is(t, wt) || n.is(t[0], et) || (t += r), tu(n.format[b](n, arguments), this) + }; + y[i].image = function(n, t, i, r, u) { + return eu(this, n || "about:blank", t || 0, i || 0, r || 0, u || 0) + }; + y[i].text = function(n, t, i) { + return ou(this, n || 0, t || 0, i || r) + }; + y[i].set = function(n) { + return arguments[t] > 1 && (n = Array[i].splice.call(arguments, 0, arguments[t])), new ct(n) + }; + y[i].setSize = su; + y[i].top = y[i].bottom = null; + y[i].raphael = n; + u[i].resetScale = function() { + if (this.removed) return this; + this._.sx = 1; + this._.sy = 1; + this.attrs.scale = "1 1" + }; + u[i].scale = function(n, i, u, f) { + var a, o, h, nt, it, l, s, w; + if (this.removed) return this; + if (n == null && i == null) return { + x: this._.sx, + y: this._.sy, + toString: vu + }; + if (i = i || n, +i || (i = n), h = this.attrs, n != 0) { + var c = this.getBBox(), + v = c.x + c.width / 2, + p = c.y + c.height / 2; + a = n / this._.sx; + o = i / this._.sy; + u = +u || u == 0 ? u : v; + f = +f || f == 0 ? f : p; + c = ~~(n / e.abs(n)); + var y = ~~(i / e.abs(i)), + rt = this.node.style, + d = u + (v - u) * a; + p = f + (p - f) * o; + switch (this.type) { + case "rect": + case "image": + nt = h.width * c * a; + it = h.height * y * o; + this.attr({ + height: it, + r: h.r * lt(c * a, y * o), + width: nt, + x: d - nt / 2, + y: p - it / 2 + }); + break; + case "circle": + case "ellipse": + this.attr({ + rx: h.rx * c * a, + ry: h.ry * y * o, + r: h.r * lt(c * a, y * o), + cx: d, + cy: p + }); + break; + case "text": + this.attr({ + x: d, + y: p + }); + break; + case "path": + v = gi(h.path); + for (var ut = !0, b = 0, ft = v[t]; b < ft; b++) + if (l = v[b], s = ei.call(l[0]), !(s == "M" && ut)) + if (ut = !1, s == "A") l[v[b][t] - 2] *= a, l[v[b][t] - 1] *= o, l[1] *= c * a, l[2] *= y * o, l[5] = +!(c + y ? !+l[5] : +l[5]); + else if (s == "H") + for (s = 1, w = l[t]; s < w; s++) l[s] *= a; + else if (s == "V") + for (s = 1, w = l[t]; s < w; s++) l[s] *= o; + else + for (s = 1, w = l[t]; s < w; s++) l[s] *= s % 2 ? a : o; + o = ti(v); + a = d - o.x - o.width / 2; + o = p - o.y - o.height / 2; + v[0][1] += a; + v[0][2] += o; + this.attr({ + path: v + }) + } + this.type in { + text: 1, + image: 1 + } && (c != 1 || y != 1) ? this.transformations ? (this.transformations[2] = "scale(" [k](c, ",", y, ")"), this.node[ot]("transform", this.transformations[tt](g)), a = c == -1 ? -h.x - (nt || 0) : h.x, o = y == -1 ? -h.y - (it || 0) : h.y, this.attr({ + x: a, + y: o + }), h.fx = c - 1, h.fy = y - 1) : (this.node.filterMatrix = ki + ".Matrix(M11=" [k](c, ", M12=0, M21=0, M22=", y, ", Dx=0, Dy=0, sizingmethod='auto expand', filtertype='bilinear')"), rt.filter = (this.node.filterMatrix || r) + (this.node.filterOpacity || r)) : this.transformations ? (this.transformations[2] = r, this.node[ot]("transform", this.transformations[tt](g)), h.fx = 0, h.fy = 0) : (this.node.filterMatrix = r, rt.filter = (this.node.filterMatrix || r) + (this.node.filterOpacity || r)); + h.scale = [n, i, u, f][tt](g); + this._.sx = n; + this._.sy = i + } + return this + }; + u[i].clone = function() { + if (this.removed) return null; + var n = this.attr(); + return delete n.scale, delete n.translation, this.paper[this.type]().attr(n) + }; + ur = ut(function(t, i, r, u, f, e, o, s, h) { + for (var y, a, v = 0, c = 0; c < 1.001; c += .001) { + if (a = n.findDotsAtSegment(t, i, r, u, f, e, o, s, c), c && (v += l(l(y.x - a.x, 2) + l(y.y - a.y, 2), .5)), v >= h) return a; + y = a + } + }); + var yf = ut(function(n, t, i, r, u, f, e, o) { + for (var h, c = { + x: 0, + y: 0 + }, a = 0, s = 0; s < 1.01; s += .01) h = ii(n, t, i, r, u, f, e, o, s), s && (a += l(l(c.x - h.x, 2) + l(c.y - h.y, 2), .5)), c = h; + return a + }), + yu = fr(1), + vi = fr(), + er = fr(0, 1); + u[i].getTotalLength = function() { + if (this.type == "path") return this.node.getTotalLength ? this.node.getTotalLength() : yu(this.attrs.path) + }; + u[i].getPointAtLength = function(n) { + if (this.type == "path") return vi(this.attrs.path, n) + }; + u[i].getSubpath = function(n, t) { + if (this.type == "path") return e.abs(this.getTotalLength() - t) < 1e-6 ? er(this.attrs.path, n).end : (t = er(this.attrs.path, t, 1), n ? er(t, n).end : t) + }; + n.easing_formulas = { + linear: function(n) { + return n + }, + "<": function(n) { + return l(n, 3) + }, + ">": function(n) { + return l(n - 1, 3) + 1 + }, + "<>": function(n) { + return (n *= 2, n < 1) ? l(n, 3) / 2 : (n -= 2, (l(n, 3) + 2) / 2) + }, + backIn: function(n) { + var t = 1.70158; + return n * n * ((t + 1) * n - t) + }, + backOut: function(n) { + n -= 1; + var t = 1.70158; + return n * n * ((t + 1) * n + t) + 1 + }, + elastic: function(n) { + if (n == 0 || n == 1) return n; + var t = .3, + i = t / 4; + return l(2, -10 * n) * e.sin((n - i) * 2 * e.PI / t) + 1 + }, + bounce: function(n) { + var i = 7.5625, + t = 2.75; + return n < 1 / t ? n = i * n * n : n < 2 / t ? (n -= 1.5 / t, n = i * n * n + .75) : n < 2.5 / t ? (n -= 2.25 / t, n = i * n * n + .9375) : (n -= 2.625 / t, n = i * n * n + .984375), n + } + }; + rt = { + length: 0 + }; + u[i].animateWith = function(n, t, i, r, u) { + return rt[n.id] && (t.start = rt[n.id].start), this.animate(t, i, r, u) + }; + u[i].animateAlong = wu(); + u[i].animateAlongBack = wu(1); + u[i].onAnimation = function(n) { + return this._run = n || 0, this + }; + u[i].animate = function(i, u, f, e) { + var o, w, k; + (n.is(f, "function") || !f) && (e = f || null); + var l = {}, + y = {}, + a = {}; + for (o in i) + if (i[s](o) && di[s](o)) { + l[o] = this.attr(o); + l[o] == null && (l[o] = oi[o]); + y[o] = i[o]; + switch (di[o]) { + case "along": + var c = yu(i[o]), + v = vi(i[o], c * !!i.back), + b = this.getBBox(); + a[o] = c / u; + a.tx = b.x; + a.ty = b.y; + a.sx = v.x; + a.sy = v.y; + y.rot = i.rot; + y.back = i.back; + y.len = c; + i.rot && (a.r = h(this.rotate()) || 0); + break; + case nt: + a[o] = (y[o] - l[o]) / u; + break; + case "colour": + l[o] = n.getRGB(l[o]); + c = n.getRGB(y[o]); + a[o] = { + r: (c.r - l[o].r) / u, + g: (c.g - l[o].g) / u, + b: (c.b - l[o].b) / u + }; + break; + case "path": + for (c = ai(l[o], y[o]), l[o] = c[0], v = c[1], a[o] = [], c = 0, b = l[o][t]; c < b; c++) + for (a[o][c] = [0], w = 1, k = l[o][c][t]; w < k; w++) a[o][c][w] = (v[c][w] - l[o][c][w]) / u; + break; + case "csv": + v = (i[o] + r)[p](ft); + c = (l[o] + r)[p](ft); + switch (o) { + case "translation": + l[o] = [0, 0]; + a[o] = [v[0] / u, v[1] / u]; + break; + case "rotation": + l[o] = c[1] == v[1] && c[2] == v[2] ? c : [0, v[1], v[2]]; + a[o] = [(v[0] - l[o][0]) / u, 0, 0]; + break; + case "scale": + i[o] = v; + l[o] = (l[o] + r)[p](ft); + a[o] = [(v[0] - l[o][0]) / u, (v[1] - l[o][1]) / u, 0, 0]; + break; + case "clip-rect": + for (l[o] = (l[o] + r)[p](ft), a[o] = [], c = 4; c--;) a[o][c] = (v[c] - l[o][c]) / u + } + y[o] = v + } + } + return this.stop(), this.in_animation = 1, rt[this.id] = { + start: i.start || +new Date, + ms: u, + easing: f, + from: l, + diff: a, + to: y, + el: this, + callback: e, + t: { + x: 0, + y: 0 + } + }, ++rt[t] == 1 && pu(), this + }; + u[i].stop = function() { + return rt[this.id] && rt[t]--, delete rt[this.id], this + }; + u[i].translate = function(n, t) { + return this.attr({ + translation: n + " " + t + }) + }; + u[i][d] = function() { + return "Raphaël’s object" + }; + n.ae = rt; + ct[i][a] = function() { + for (var n, i, r = 0, f = arguments[t]; r < f; r++)(n = arguments[r]) && (n.constructor == u || n.constructor == ct) && (i = this.items[t], this[i] = this.items[i] = n, this[t]++); + return this + }; + ct[i].pop = function() { + return delete this[this[t]--], this.items.pop() + }; + for (pi in u[i]) u[i][s](pi) && (ct[i][pi] = function(n) { + return function() { + for (var i = 0, r = this.items[t]; i < r; i++) this.items[i][n][b](this.items[i], arguments); + return this + } + }(pi)); + return ct[i].attr = function(i, r) { + var u, f; + if (i && n.is(i, et) && n.is(i[0], "object")) + for (r = 0, u = i[t]; r < u; r++) this.items[r].attr(i[r]); + else + for (u = 0, f = this.items[t]; u < f; u++) this.items[u].attr(i, r); + return this + }, ct[i].animate = function(i, r, u, f) { + (n.is(u, "function") || !u) && (f = u || null); + var s = this.items[t], + o = s, + h, c = this, + e; + for (f && (e = function() { + --s || f.call(c) + }), u = n.is(u, wt) ? u : e, h = this.items[--o].animate(i, r, u, e); o--;) this.items[o].animateWith(h, i, r, u, e); + return this + }, ct[i].insertAfter = function(n) { + for (var i = this.items[t]; i--;) this.items[i].insertAfter(n); + return this + }, ct[i].getBBox = function() { + for (var n, i = [], r = [], u = [], f = [], e = this.items[t]; e--;) n = this.items[e].getBBox(), i[a](n.x), r[a](n.y), u[a](n.x + n.width), f[a](n.y + n.height); + return i = lt[b](0, i), r = lt[b](0, r), { + x: i, + y: r, + width: ht[b](0, u) - i, + height: ht[b](0, f) - r + } + }, ct[i].clone = function(n) { + n = new ct; + for (var i = 0, r = this.items[t]; i < r; i++) n[a](this.items[i].clone()); + return n + }, n.registerFont = function(n) { + var i, t, u, r, f; + if (!n.face) return n; + this.fonts = this.fonts || {}; + i = { + w: n.w, + face: {}, + glyphs: {} + }; + t = n.face["font-family"]; + for (u in n.face) n.face[s](u) && (i.face[u] = n.face[u]); + if (this.fonts[t] ? this.fonts[t][a](i) : this.fonts[t] = [i], !n.svg) { + i.face["units-per-em"] = pt(n.face["units-per-em"], 10); + for (r in n.glyphs) + if (n.glyphs[s](r) && (t = n.glyphs[r], i.glyphs[r] = { + w: t.w, + k: {}, + d: t.d && "M" + t.d[w](/[mlcxtrv]/g, function(n) { + return { + l: "L", + c: "C", + x: "z", + t: "m", + r: "l", + v: "c" + }[n] || "M" + }) + "z" + }, t.k)) + for (f in t.k) t[s](f) && (i.glyphs[r].k[f] = t.k[f]) + } + return n + }, y[i].getFont = function(i, u, f, e) { + var h, o, c; + if (e = e || "normal", f = f || "normal", u = +u || { + normal: 400, + bold: 700, + lighter: 300, + bolder: 800 + }[u] || 400, n.fonts) { + if (h = n.fonts[i], !h) { + i = new RegExp("(^|\\s)" + i[w](/[^\w\d\s+!~.:_-]/g, r) + "(\\s|$)", "i"); + for (o in n.fonts) + if (n.fonts[s](o) && i.test(o)) { + h = n.fonts[o]; + break + } + } + if (h) + for (o = 0, i = h[t]; o < i; o++) + if (c = h[o], c.face["font-weight"] == u && (c.face["font-style"] == f || !c.face["font-style"]) && c.face["font-stretch"] == e) break; + return c + } + }, y[i].print = function(i, u, f, e, o, s) { + var h, b, l, v; + s = s || "middle"; + var y = this.set(), + c = (f + r)[p](r), + w = 0; + if (n.is(e, f) && (e = this.getFont(e)), e) { + for (f = (o || 16) / e.face["units-per-em"], h = e.face.bbox.split(ft), o = +h[0], s = +h[1] + (s == "baseline" ? h[3] - h[1] + +e.face.descent : (h[3] - h[1]) / 2), h = 0, b = c[t]; h < b; h++) l = h && e.glyphs[c[h - 1]] || {}, v = e.glyphs[c[h]], w += h ? (l.w || e.w) + (l.k && l.k[c[h]] || 0) : 0, v && v.d && y[a](this.path(v.d).attr({ + fill: "#000", + stroke: "none", + translation: [w, 0] + })); + y.scale(f, f, o, s).translate(i - o, u - s) + } + return y + }, bu = /\{(\d+)\}/g, n.format = function(i, u) { + var f = n.is(u, et) ? [0][k](u) : arguments; + return i && n.is(i, wt) && f[t] - 1 && (i = i[w](bu, function(n, t) { + return f[++t] == null ? r : f[t] + })), i || r + }, n.ninja = function() { + return sr.was ? Raphael = sr.is : delete Raphael, n + }, n.el = u[i], n +}(); +dateTimeFromServer = new Date; +dateTimeFromClient = new Date; +$(document).ready(function() { + function n(n) { + return n < 10 ? "0" + n.toString() : n.toString() + } + $(".multiMenu").hover(function() { + mouse_is_inside = !0 + }, function() { + mouse_is_inside = !1 + }); + $("body").mouseup(function() { + mouse_is_inside || $(".multiMenu .layer").slideUp(function() { + $(this).parent("div").removeClass("active") + }) + }); + try { + $.ajax({ + url: "/Home/BiezacaDataGodzina", + type: "GET", + async: !1, + cache: !1, + success: function(n) { + dateTimeFromServer = new Date(parseInt(n.substr(6))); + dateTimeFromClient = new Date + } + }) + } catch (t) {} + setInterval(function() { + var u = dateTimeFromServer - dateTimeFromClient, + f = (new Date).getTime(), + r = new Date, + t, i; + r.setTime(f + u); + t = r; + t.setDate(t.getDate()); + var e = t.getDate(), + o = t.getMonth() + 1, + s = t.getFullYear(), + h = n(e) + " - " + n(o) + " - " + s; + $("#date").html(h); + i = r; + i.setDate(i.getDate()); + var c = i.getHours(), + l = i.getMinutes(), + a = n(c) + ":" + n(l); + $("#time").html(a) + }, 1e3); + $(".showDetails").click(function() { + $(this).prev(".details").slideToggle(); + $(this).find(".gui").toggleClass("icoDArrDown icoDArrUp"); + $(this).toggleClass("act") + }); + indirectStation() +}); +mouse_is_inside = !1, + function(n) { + n.cookies = { + render: function(t) { + var i = ""; + i += '<div id="cookiesBar"><div id="cookiesBarWrap"><p>' + C_Cookie_Tekst_1; + i += t.privacyPolicy ? ' <a href="' + t.cookiesPageURL + '" title="' + C_Cookie_PolitykaPrywatnosciTitle + '">' + C_Cookie_PolitykaPrywatnosci + "<\/a>.<\/p>" : ' <a href="' + t.cookiesPageURL + '" title="' + C_Cookie_RegulaminSerwisu + '">' + C_Cookie_RegulaminSerwisu + "<\/a>.<\/p>"; + i += "<p>" + C_Cookie_Tekst_2 + '<\/p><a id="cookiesBarClose" href="#" title="' + C_Cookie_Zamknij + '">' + C_Cookie_Zamknij + "<\/a><\/div><\/div>"; + n.cookie("cookie") || (n("body").append(i), n.fn.delegate ? n("#cookiesBar").delegate("#cookiesBarClose", "click", function(t) { + n.cookies.closeCallback(t) + }) : n("#cookiesBarClose").bind("click", function(t) { + n.cookies.closeCallback(t) + })) + }, + closeCallback: function(t) { + return n("#cookiesBar").fadeOut(), n.cookie("cookie") || n.cookie("cookie", !0, { + path: "/", + expires: 30 + }), t.preventDefault(), !1 + } + } + }(jQuery); +String.prototype.replaceAll = function(n, t) { + return this.split(n).join(t) +}; +$.ajaxSetup({ + headers: { + "X-Kendo-Ui-Version": "r3-2016-sp2" + } +}); +! function(n) { + function i() { + var i = document.createElement("smartbanner"), + n = { + WebkitTransition: "webkitTransitionEnd", + MozTransition: "transitionend", + OTransition: "oTransitionEnd otransitionend", + transition: "transitionend" + }; + for (var t in n) + if (i.style[t] !== undefined) return { + end: n[t] + }; + return !1 + } + var t = function(t) { + var f, i, r, u; + if ((this.origHtmlMargin = parseFloat(n("html").css("margin-top")), this.options = n.extend({}, n.smartbanner.defaults, t), f = navigator.standalone, i = navigator.userAgent, this.options.force ? this.type = this.options.force : i.match(/Windows Phone 8/i) != null && i.match(/Touch/i) !== null ? this.type = "windows" : i.match(/iPhone|iPod/i) != null || i.match(/iPad/) && this.options.iOSUniversalApp ? i.match(/Safari/i) != null && (i.match(/CriOS/i) != null || window.Number(i.substr(i.indexOf("OS ") + 3, 3).replace("_", ".")) < 6) && (this.type = "ios") : i.match(/\bSilk\/(.*\bMobile Safari\b)?/) || i.match(/\bKF\w/) || i.match("Kindle Fire") ? this.type = "kindle" : i.match(/Android/i) != null && (this.type = "android"), this.type && !f && !this.getCookie("sb-closed") && !this.getCookie("sb-installed")) && (this.scale = this.options.scale == "auto" ? n(window).width() / window.screen.width : this.options.scale, this.scale < 1 && (this.scale = 1), r = n(this.type == "android" ? 'meta[name="google-play-app"]' : this.type == "ios" ? 'meta[name="apple-itunes-app"]' : this.type == "kindle" ? 'meta[name="kindle-fire-app"]' : 'meta[name="msApplication-ID"]'), r.length != 0)) { + if (this.type == "windows") this.appId = n('meta[name="msApplication-PackageFamilyName"]').attr("content"); + else if (u = /app-id=([^\s,]+)/.exec(r.attr("content")), u) this.appId = u[1]; + else return; + this.title = this.options.title ? this.options.title : r.data("title") || n("title").text().replace(/\s*[|\-·].*$/, ""); + this.author = this.options.author ? this.options.author : r.data("author") || (n('meta[name="author"]').length ? n('meta[name="author"]').attr("content") : window.location.hostname); + this.iconUrl = r.data("icon-url"); + this.price = r.data("price"); + this.create(); + this.show(); + this.listen() + } + }; + (t.prototype = { + constructor: t, + create: function() { + var t, i = this.options.url ? this.options.url : (this.type == "windows" ? "ms-windows-store:navigate?appid=" : this.type == "android" ? "market://details?id=" : this.type == "kindle" ? "amzn://apps/android?asin=" : "https://itunes.apple.com/" + this.options.appStoreLanguage + "/app/id") + this.appId, + u = this.price || this.options.price, + e = u ? u + " - " + (this.type == "android" ? this.options.inGooglePlay : this.type == "kindle" ? this.options.inAmazonAppStore : this.type == "ios" ? this.options.inAppStore : this.options.inWindowsStore) : "", + f = this.options.iconGloss === null ? this.type == "ios" : this.options.iconGloss, + r; + this.type == "android" && this.options.GooglePlayParams && (i = i + "&referrer=" + this.options.GooglePlayParams); + r = '<div id="smartbanner" class="' + this.type + '"><div class="sb-container"><a href="#" class="sb-close">×<\/a><span class="sb-icon"><\/span><div class="sb-info"><strong>' + this.title + "<\/strong><span>" + this.author + "<\/span><span>" + e + '<\/span><\/div><a href="' + i + '" class="sb-button"><span>' + this.options.button + "<\/span><\/a><\/div><\/div>"; + this.options.layer ? n(this.options.appendToSelector).append(r) : n(this.options.appendToSelector).prepend(r); + this.options.icon ? t = this.options.icon : this.iconUrl ? t = this.iconUrl : n('link[rel="apple-touch-icon-precomposed"]').length > 0 ? (t = n('link[rel="apple-touch-icon-precomposed"]').attr("href"), this.options.iconGloss === null && (f = !1)) : n('link[rel="apple-touch-icon"]').length > 0 ? t = n('link[rel="apple-touch-icon"]').attr("href") : n('meta[name="msApplication-TileImage"]').length > 0 ? t = n('meta[name="msApplication-TileImage"]').attr("content") : n('meta[name="msapplication-TileImage"]').length > 0 && (t = n('meta[name="msapplication-TileImage"]').attr("content")); + t ? (n("#smartbanner .sb-icon").css("background-image", "url(" + t + ")"), f && n("#smartbanner .sb-icon").addClass("gloss")) : n("#smartbanner").addClass("no-icon"); + this.bannerHeight = n("#smartbanner").outerHeight() + 2; + this.scale > 1 && (n("#smartbanner").css("top", parseFloat(n("#smartbanner").css("top")) * this.scale).css("height", parseFloat(n("#smartbanner").css("height")) * this.scale).hide(), n("#smartbanner .sb-container").css("-webkit-transform", "scale(" + this.scale + ")").css("-msie-transform", "scale(" + this.scale + ")").css("-moz-transform", "scale(" + this.scale + ")").css("width", n(window).width() / this.scale)); + n("#smartbanner").css("position", this.options.layer ? "absolute" : "static") + }, + listen: function() { + n("#smartbanner .sb-close").on("click", n.proxy(this.close, this)); + n("#smartbanner .sb-button").on("click", n.proxy(this.install, this)) + }, + show: function(t) { + var i = n("#smartbanner"), + r; + i.stop(); + this.options.layer ? (i.animate({ + top: 0, + display: "block" + }, this.options.speedIn).addClass("shown").show(), n(this.pushSelector).animate({ + paddingTop: this.origHtmlMargin + this.bannerHeight * this.scale + }, this.options.speedIn, "swing", t)) : n.support.transition ? (i.animate({ + top: 0 + }, this.options.speedIn).addClass("shown"), r = function() { + n("html").removeClass("sb-animation"); + t && t() + }, n(this.pushSelector).addClass("sb-animation").one(n.support.transition.end, r).emulateTransitionEnd(this.options.speedIn).css("margin-top", this.origHtmlMargin + this.bannerHeight * this.scale)) : i.slideDown(this.options.speedIn).addClass("shown") + }, + hide: function(t) { + var i = n("#smartbanner"), + r; + i.stop(); + this.options.layer ? (i.animate({ + top: -1 * this.bannerHeight * this.scale, + display: "block" + }, this.options.speedIn).removeClass("shown"), n(this.pushSelector).animate({ + paddingTop: this.origHtmlMargin + }, this.options.speedIn, "swing", t)) : n.support.transition ? (this.type !== "android" ? i.css("top", -1 * this.bannerHeight * this.scale).removeClass("shown") : i.css({ + display: "none" + }).removeClass("shown"), r = function() { + n("html").removeClass("sb-animation"); + t && t() + }, n(this.pushSelector).addClass("sb-animation").one(n.support.transition.end, r).emulateTransitionEnd(this.options.speedOut).css("margin-top", this.origHtmlMargin)) : i.slideUp(this.options.speedOut).removeClass("shown") + }, + close: function(n) { + n.preventDefault(); + this.hide(); + this.setCookie("sb-closed", "true", this.options.daysHidden) + }, + install: function() { + this.options.hideOnInstall && this.hide(); + this.setCookie("sb-installed", "true", this.options.daysReminder) + }, + setCookie: function(n, t, i) { + var r = new Date; + r.setDate(r.getDate() + i); + t = encodeURI(t) + (i == null ? "" : "; expires=" + r.toUTCString()); + document.cookie = n + "=" + t + "; path=/;" + }, + getCookie: function(n) { + for (var r, u, i = document.cookie.split(";"), t = 0; t < i.length; t++) + if (r = i[t].substr(0, i[t].indexOf("=")), u = i[t].substr(i[t].indexOf("=") + 1), r = r.replace(/^\s+|\s+$/g, ""), r == n) return decodeURI(u); + return null + }, + switchType: function() { + var t = this; + this.hide(function() { + t.type = t.type == "android" ? "ios" : "android"; + var i = n(t.type == "android" ? 'meta[name="google-play-app"]' : 'meta[name="apple-itunes-app"]').attr("content"); + t.appId = /app-id=([^\s,]+)/.exec(i)[1]; + n("#smartbanner").detach(); + t.create(); + t.show() + }) + } + }, n.smartbanner = function(i) { + var u = n(window), + r = u.data("smartbanner"), + f = typeof i == "object" && i; + r || u.data("smartbanner", r = new t(f)); + typeof i == "string" && r[i]() + }, n.smartbanner.defaults = { + title: null, + author: null, + price: "FREE", + appStoreLanguage: "us", + inAppStore: "On the App Store", + inGooglePlay: "In Google Play", + inAmazonAppStore: "In the Amazon Appstore", + inWindowsStore: "In the Windows Store", + GooglePlayParams: null, + icon: null, + iconGloss: null, + button: "VIEW", + url: null, + scale: "auto", + speedIn: 300, + speedOut: 400, + daysHidden: 15, + daysReminder: 90, + force: null, + hideOnInstall: !0, + layer: !1, + iOSUniversalApp: !0, + appendToSelector: "body", + pushSelector: "html" + }, n.smartbanner.Constructor = t, n.support.transition === undefined) && (n.fn.emulateTransitionEnd = function(t) { + var i = !1, + u = this, + r; + n(this).one(n.support.transition.end, function() { + i = !0 + }); + return r = function() { + i || n(u).trigger(n.support.transition.end) + }, setTimeout(r, t), this + }, n(function() { + n.support.transition = i() + }):) +}(window.jQuery) diff --git a/research/PDP.js b/research/PDP.js deleted file mode 100644 index de93300d8928bfdde2c16db8977576cacea529ab..0000000000000000000000000000000000000000 --- a/research/PDP.js +++ /dev/null @@ -1 +0,0 @@ -function draw_clock(){var n,r,t;for(canvas=Raphael("analog",100,100),n=canvas.circle(25,25,23),n.attr({fill:"#F9F9F9",stroke:"#003A7D","stroke-width":"2"}),i=0;i<12;i++){var u=25+Math.round(18*Math.cos(30*i*Math.PI/180)),f=25+Math.round(18*Math.sin(30*i*Math.PI/180)),e=25+Math.round(22*Math.cos(30*i*Math.PI/180)),o=25+Math.round(22*Math.sin(30*i*Math.PI/180));r=canvas.path("M"+u+" "+f+"L"+e+" "+o)}hour_hand=canvas.path("M 25 25 L 25 15");hour_hand.attr({stroke:"#003A7D","stroke-width":2});minute_hand=canvas.path("M 25 25 L 25 10");minute_hand.attr({stroke:"#444444","stroke-width":1});second_hand=canvas.path("M 25 30 L 25 8");second_hand.attr({stroke:"#003A7D","stroke-width":.5});t=canvas.circle(25,25,1);t.attr("fill","#003A7D");update_clock();setInterval("update_clock()",1e3)}function update_clock(){var r=dateTimeFromServer-dateTimeFromClient,u=(new Date).getTime(),t=new Date;t.setTime(u+r);var n=t,f=n.getHours(),i=n.getMinutes(),e=n.getSeconds();hour_hand.rotate(30*f+i/2.5,25,25);minute_hand.rotate(6*i,25,25);second_hand.rotate(6*e,25,25)}function indirectStation(){var i=$(".route ").find(".subRow").length,n=$("#indirect"),r=$("#newIndirect"),u='<div class="row btnRow"><button id="newIndirect" class="k-button k-button-get">'+C_DodajStacjePosrednia+"<\/button><\/div>",t=$("#switchParamsMode").parent();i>0?(n.attr("enable","false").addClass("k-state-disabled"),n.text(C_PrzezStacjePosrednia),t.show(),r||$(".route .container").append(u)):(n.removeAttr("enable").removeClass("k-state-disabled"),n.text(C_DodajStacjePosrednia),$("#newIndirect").parent(".btnRow").remove(),t.hide())}function countChecks(n){var r=n.closest(".layer").find("ul input:checkbox").length,i=n.closest(".layer").find("ul input:checkbox:checked").length,t=n.closest(".multiMenu").find(".num");t.html("");r===i?(t.html(""),t.append("wszyscy")):t.append("<span>wybrano "+i+"<\/span>")}function null2empty(n,t,i){if(!t||t=="")return"";var r=i?i:"";return n+" "+t+" "+r}function minuty2MinGodz(n){n=Math.ceil(n);var t=Math.floor(n/60);return t<10&&(t="0"+t),t+=":",n%60<10&&(t+="0"),t+Math.round(n%60)}function minuty2HHmm(n){var t=Math.floor(n/60),i=n-t*60;return t<10&&(t="0"+t),i<10&&(i="0"+i),t+":"+i}function timeStamp2Tekst(n){return minuty2MinGodz(n.TotalMinutes)}function jsonTime2Time(n,t){return n==""?"":(t=typeof t!="undefined"?t:"yyyy-MM-dd HH:mm",kendo.toString(new Date(parseInt(n.substr(6))),t))}function jsonTime2JsTime(n,t){return n==""?"":(t=typeof t!="undefined"?t:"yyyy-MM-dd HH:mm",new Date(parseInt(n.substr(6))))}function usunPolskieZnaki(n){return n=n.replace(/Ę/g,"E").replace(/ę/g,"e"),n=n.replace(/Ó/g,"O").replace(/o/g,"o"),n=n.replace(/Ą/g,"A").replace(/ą/g,"a"),n=n.replace(/Ś/g,"S").replace(/ś/g,"s"),n=n.replace(/Ł/g,"L").replace(/ł/g,"l"),n=n.replace(/Ż/g,"Z").replace(/ż/g,"z"),n=n.replace(/Ź/g,"Z").replace(/ź/g,"z"),n=n.replace(/Ć/g,"C").replace(/ć/g,"c"),n.replace(/Ń/g,"N").replace(/ń/g,"n")}function generujHashDanych(n){var t="";return t+=n.StacjaPoczatkowaID.toString(),t+=n.LiczbaPrzesiadek.toString(),t+=Date.parse(n.Odjazd),t+=Date.parse(n.Przyjazd),t+n.Pociagi[0].ZamowienieSKRJID.toString()}var dateTimeFromServer,dateTimeFromClient,mouse_is_inside;(function(n,t){function dt(n){var t=n.length,r=i.type(n);return i.isWindow(n)?!1:1===n.nodeType&&t?!0:"array"===r||"function"!==r&&(0===t||"number"==typeof t&&t>0&&t-1 in n)}function kf(n){var t=gt[n]={};return i.each(n.match(s)||[],function(n,i){t[i]=!0}),t}function ir(n,r,u,f){if(i.acceptData(n)){var s,h,c=i.expando,a="string"==typeof r,l=n.nodeType,o=l?i.cache:n,e=l?n[c]:n[c]&&c;if(e&&o[e]&&(f||o[e].data)||!a||u!==t)return e||(l?n[c]=e=b.pop()||i.guid++:e=c),o[e]||(o[e]={},l||(o[e].toJSON=i.noop)),("object"==typeof r||"function"==typeof r)&&(f?o[e]=i.extend(o[e],r):o[e].data=i.extend(o[e].data,r)),s=o[e],f||(s.data||(s.data={}),s=s.data),u!==t&&(s[i.camelCase(r)]=u),a?(h=s[r],null==h&&(h=s[i.camelCase(r)])):h=s,h}}function rr(n,t,r){if(i.acceptData(n)){var o,h,e,s=n.nodeType,u=s?i.cache:n,f=s?n[i.expando]:i.expando;if(u[f]){if(t&&(e=r?u[f]:u[f].data)){for(i.isArray(t)?t=t.concat(i.map(t,i.camelCase)):(t in e)?t=[t]:(t=i.camelCase(t),t=(t in e)?[t]:t.split(" ")),o=0,h=t.length;h>o;o++)delete e[t[o]];if(!(r?ni:i.isEmptyObject)(e))return}(r||(delete u[f].data,ni(u[f])))&&(s?i.cleanData([n],!0):i.support.deleteExpando||u!=u.window?delete u[f]:u[f]=null)}}}function ur(n,r,u){if(u===t&&1===n.nodeType){var f="data-"+r.replace(tr,"-$1").toLowerCase();if(u=n.getAttribute(f),"string"==typeof u){try{u="true"===u?!0:"false"===u?!1:"null"===u?null:+u+""===u?+u:nr.test(u)?i.parseJSON(u):u}catch(e){}i.data(n,r,u)}else u=t}return u}function ni(n){for(var t in n)if(("data"!==t||!i.isEmptyObject(n[t]))&&"toJSON"!==t)return!1;return!0}function ht(){return!0}function d(){return!1}function cr(n,t){do n=n[t];while(n&&1!==n.nodeType);return n}function lr(n,t,r){if(t=t||0,i.isFunction(t))return i.grep(n,function(n,i){var u=!!t.call(n,i,n);return u===r});if(t.nodeType)return i.grep(n,function(n){return n===t===r});if("string"==typeof t){var u=i.grep(n,function(n){return 1===n.nodeType});if(fe.test(t))return i.filter(t,u,!r);t=i.filter(t,u)}return i.grep(n,function(n){return i.inArray(n,t)>=0===r})}function ar(n){var i=vr.split("|"),t=n.createDocumentFragment();if(t.createElement)while(i.length)t.createElement(i.pop());return t}function ye(n,t){return n.getElementsByTagName(t)[0]||n.appendChild(n.ownerDocument.createElement(t))}function dr(n){var t=n.getAttributeNode("type");return n.type=(t&&t.specified)+"/"+n.type,n}function gr(n){var t=le.exec(n.type);return t?n.type=t[1]:n.removeAttribute("type"),n}function si(n,t){for(var u,r=0;null!=(u=n[r]);r++)i._data(u,"globalEval",!t||i._data(t[r],"globalEval"))}function nu(n,t){if(1===t.nodeType&&i.hasData(n)){var u,f,o,s=i._data(n),r=i._data(t,s),e=s.events;if(e){delete r.handle;r.events={};for(u in e)for(f=0,o=e[u].length;o>f;f++)i.event.add(t,u,e[u][f])}r.data&&(r.data=i.extend({},r.data))}}function pe(n,t){var r,f,u;if(1===t.nodeType){if(r=t.nodeName.toLowerCase(),!i.support.noCloneEvent&&t[i.expando]){u=i._data(t);for(f in u.events)i.removeEvent(t,f,u.handle);t.removeAttribute(i.expando)}"script"===r&&t.text!==n.text?(dr(t).text=n.text,gr(t)):"object"===r?(t.parentNode&&(t.outerHTML=n.outerHTML),i.support.html5Clone&&n.innerHTML&&!i.trim(t.innerHTML)&&(t.innerHTML=n.innerHTML)):"input"===r&&ei.test(n.type)?(t.defaultChecked=t.checked=n.checked,t.value!==n.value&&(t.value=n.value)):"option"===r?t.defaultSelected=t.selected=n.defaultSelected:("input"===r||"textarea"===r)&&(t.defaultValue=n.defaultValue)}}function u(n,r){var s,e,h=0,f=typeof n.getElementsByTagName!==o?n.getElementsByTagName(r||"*"):typeof n.querySelectorAll!==o?n.querySelectorAll(r||"*"):t;if(!f)for(f=[],s=n.childNodes||n;null!=(e=s[h]);h++)!r||i.nodeName(e,r)?f.push(e):i.merge(f,u(e,r));return r===t||r&&i.nodeName(n,r)?i.merge([n],f):f}function we(n){ei.test(n.type)&&(n.defaultChecked=n.checked)}function fu(n,t){if(t in n)return t;for(var r=t.charAt(0).toUpperCase()+t.slice(1),u=t,i=uu.length;i--;)if(t=uu[i]+r,t in n)return t;return u}function ut(n,t){return n=t||n,"none"===i.css(n,"display")||!i.contains(n.ownerDocument,n)}function eu(n,t){for(var f,r,o,e=[],u=0,s=n.length;s>u;u++)r=n[u],r.style&&(e[u]=i._data(r,"olddisplay"),f=r.style.display,t?(e[u]||"none"!==f||(r.style.display=""),""===r.style.display&&ut(r)&&(e[u]=i._data(r,"olddisplay",cu(r.nodeName)))):e[u]||(o=ut(r),(f&&"none"!==f||!o)&&i._data(r,"olddisplay",o?f:i.css(r,"display"))));for(u=0;s>u;u++)r=n[u],r.style&&(t&&"none"!==r.style.display&&""!==r.style.display||(r.style.display=t?e[u]||"":"none"));return n}function ou(n,t,i){var r=ge.exec(t);return r?Math.max(0,r[1]-(i||0))+(r[2]||"px"):t}function su(n,t,r,u,f){for(var e=r===(u?"border":"content")?4:"width"===t?1:0,o=0;4>e;e+=2)"margin"===r&&(o+=i.css(n,r+p[e],!0,f)),u?("content"===r&&(o-=i.css(n,"padding"+p[e],!0,f)),"margin"!==r&&(o-=i.css(n,"border"+p[e]+"Width",!0,f))):(o+=i.css(n,"padding"+p[e],!0,f),"padding"!==r&&(o+=i.css(n,"border"+p[e]+"Width",!0,f)));return o}function hu(n,t,r){var e=!0,u="width"===t?n.offsetWidth:n.offsetHeight,f=v(n),o=i.support.boxSizing&&"border-box"===i.css(n,"boxSizing",!1,f);if(0>=u||null==u){if(u=y(n,t,f),(0>u||null==u)&&(u=n.style[t]),ct.test(u))return u;e=o&&(i.support.boxSizingReliable||u===n.style[t]);u=parseFloat(u)||0}return u+su(n,t,r||(o?"border":"content"),e,f)+"px"}function cu(n){var u=r,t=iu[n];return t||(t=lu(n,u),"none"!==t&&t||(rt=(rt||i("<iframe frameborder='0' width='0' height='0'/>").css("cssText","display:block !important")).appendTo(u.documentElement),u=(rt[0].contentWindow||rt[0].contentDocument).document,u.write("<!doctype html><html><body>"),u.close(),t=lu(n,u),rt.detach()),iu[n]=t),t}function lu(n,t){var r=i(t.createElement(n)).appendTo(t.body),u=i.css(r[0],"display");return r.remove(),u}function ci(n,t,r,u){var f;if(i.isArray(t))i.each(t,function(t,i){r||ro.test(n)?u(n,i):ci(n+"["+("object"==typeof i?t:"")+"]",i,r,u)});else if(r||"object"!==i.type(t))u(n,t);else for(f in t)ci(n+"["+f+"]",t[f],r,u)}function ku(n){return function(t,r){"string"!=typeof t&&(r=t,t="*");var u,f=0,e=t.toLowerCase().match(s)||[];if(i.isFunction(r))while(u=e[f++])"+"===u[0]?(u=u.slice(1)||"*",(n[u]=n[u]||[]).unshift(r)):(n[u]=n[u]||[]).push(r)}}function du(n,r,u,f){function o(h){var c;return e[h]=!0,i.each(n[h]||[],function(n,i){var h=i(r,u,f);return"string"!=typeof h||s||e[h]?s?!(c=h):t:(r.dataTypes.unshift(h),o(h),!1)}),c}var e={},s=n===vi;return o(r.dataTypes[0])||!e["*"]&&o("*")}function yi(n,r){var f,u,e=i.ajaxSettings.flatOptions||{};for(u in r)r[u]!==t&&((e[u]?n:f||(f={}))[u]=r[u]);return f&&i.extend(!0,n,f),n}function co(n,i,r){var s,o,e,u,h=n.contents,f=n.dataTypes,c=n.responseFields;for(u in c)u in r&&(i[c[u]]=r[u]);while("*"===f[0])f.shift(),o===t&&(o=n.mimeType||i.getResponseHeader("Content-Type"));if(o)for(u in h)if(h[u]&&h[u].test(o)){f.unshift(u);break}if(f[0]in r)e=f[0];else{for(u in r){if(!f[0]||n.converters[u+" "+f[0]]){e=u;break}s||(s=u)}e=e||s}return e?(e!==f[0]&&f.unshift(e),r[e]):t}function lo(n,t){var o,r,i,e,u={},h=0,s=n.dataTypes.slice(),f=s[0];if(n.dataFilter&&(t=n.dataFilter(t,n.dataType)),s[1])for(i in n.converters)u[i.toLowerCase()]=n.converters[i];for(;r=s[++h];)if("*"!==r){if("*"!==f&&f!==r){if(i=u[f+" "+r]||u["* "+r],!i)for(o in u)if(e=o.split(" "),e[1]===r&&(i=u[f+" "+e[0]]||u["* "+e[0]])){i===!0?i=u[o]:u[o]!==!0&&(r=e[0],s.splice(h--,0,r));break}if(i!==!0)if(i&&n.throws)t=i(t);else try{t=i(t)}catch(c){return{state:"parsererror",error:i?c:"No conversion from "+f+" to "+r}}}f=r}return{state:"success",data:t}}function nf(){try{return new n.XMLHttpRequest}catch(t){}}function ao(){try{return new n.ActiveXObject("Microsoft.XMLHTTP")}catch(t){}}function tf(){return setTimeout(function(){tt=t}),tt=i.now()}function wo(n,t){i.each(t,function(t,i){for(var u=(ft[t]||[]).concat(ft["*"]),r=0,f=u.length;f>r;r++)if(u[r].call(n,t,i))return})}function rf(n,t,r){var h,e,o=0,l=yt.length,f=i.Deferred().always(function(){delete c.elem}),c=function(){if(e)return!1;for(var s=tt||tf(),t=Math.max(0,u.startTime+u.duration-s),h=t/u.duration||0,i=1-h,r=0,o=u.tweens.length;o>r;r++)u.tweens[r].run(i);return f.notifyWith(n,[u,i,t]),1>i&&o?t:(f.resolveWith(n,[u]),!1)},u=f.promise({elem:n,props:i.extend({},t),opts:i.extend(!0,{specialEasing:{}},r),originalProperties:t,originalOptions:r,startTime:tt||tf(),duration:r.duration,tweens:[],createTween:function(t,r){var f=i.Tween(n,u.opts,t,r,u.opts.specialEasing[t]||u.opts.easing);return u.tweens.push(f),f},stop:function(t){var i=0,r=t?u.tweens.length:0;if(e)return this;for(e=!0;r>i;i++)u.tweens[i].run(1);return t?f.resolveWith(n,[u,t]):f.rejectWith(n,[u,t]),this}}),s=u.props;for(bo(s,u.opts.specialEasing);l>o;o++)if(h=yt[o].call(u,n,s,u.opts))return h;return wo(u,s),i.isFunction(u.opts.start)&&u.opts.start.call(n,u),i.fx.timer(i.extend(c,{elem:n,anim:u,queue:u.opts.queue})),u.progress(u.opts.progress).done(u.opts.done,u.opts.complete).fail(u.opts.fail).always(u.opts.always)}function bo(n,t){var u,f,r,e,o;for(r in n)if(f=i.camelCase(r),e=t[f],u=n[r],i.isArray(u)&&(e=u[1],u=n[r]=u[0]),r!==f&&(n[f]=u,delete n[r]),o=i.cssHooks[f],o&&"expand"in o){u=o.expand(u);delete n[f];for(r in u)r in n||(n[r]=u[r],t[r]=e)}else t[f]=e}function ko(n,t,r){var u,o,w,a,s,v,l,f,b,h=this,e=n.style,y={},p=[],c=n.nodeType&&ut(n);r.queue||(f=i._queueHooks(n,"fx"),null==f.unqueued&&(f.unqueued=0,b=f.empty.fire,f.empty.fire=function(){f.unqueued||b()}),f.unqueued++,h.always(function(){h.always(function(){f.unqueued--;i.queue(n,"fx").length||f.empty.fire()})}));1===n.nodeType&&("height"in t||"width"in t)&&(r.overflow=[e.overflow,e.overflowX,e.overflowY],"inline"===i.css(n,"display")&&"none"===i.css(n,"float")&&(i.support.inlineBlockNeedsLayout&&"inline"!==cu(n.nodeName)?e.zoom=1:e.display="inline-block"));r.overflow&&(e.overflow="hidden",i.support.shrinkWrapBlocks||h.always(function(){e.overflow=r.overflow[0];e.overflowX=r.overflow[1];e.overflowY=r.overflow[2]}));for(o in t)if(a=t[o],vo.exec(a)){if(delete t[o],v=v||"toggle"===a,a===(c?"hide":"show"))continue;p.push(o)}if(w=p.length)for(s=i._data(n,"fxshow")||i._data(n,"fxshow",{}),("hidden"in s)&&(c=s.hidden),v&&(s.hidden=!c),c?i(n).show():h.done(function(){i(n).hide()}),h.done(function(){var t;i._removeData(n,"fxshow");for(t in y)i.style(n,t,y[t])}),o=0;w>o;o++)u=p[o],l=h.createTween(u,c?s[u]:0),y[u]=s[u]||i.style(n,u),u in s||(s[u]=l.start,c&&(l.end=l.start,l.start="width"===u||"height"===u?1:0))}function f(n,t,i,r,u){return new f.prototype.init(n,t,i,r,u)}function pt(n,t){var r,i={height:n},u=0;for(t=t?1:0;4>u;u+=2-t)r=p[u],i["margin"+r]=i["padding"+r]=n;return t&&(i.opacity=i.width=n),i}function uf(n){return i.isWindow(n)?n:9===n.nodeType?n.defaultView||n.parentWindow:!1}var et,wi,o=typeof t,r=n.document,ff=n.location,ef=n.jQuery,of=n.$,ot={},b=[],wt="1.9.1",bi=b.concat,bt=b.push,l=b.slice,ki=b.indexOf,sf=ot.toString,it=ot.hasOwnProperty,kt=wt.trim,i=function(n,t){return new i.fn.init(n,t,wi)},st=/[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source,s=/\S+/g,hf=/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g,cf=/^(?:(<[\w\W]+>)[^>]*|#([\w-]*))$/,di=/^<(\w+)\s*\/?>(?:<\/\1>|)$/,lf=/^[\],:{}\s]*$/,af=/(?:^|:|,)(?:\s*\[)+/g,vf=/\\(?:["\\\/bfnrt]|u[\da-fA-F]{4})/g,yf=/"[^"\\\r\n]*"|true|false|null|-?(?:\d+\.|)\d+(?:[eE][+-]?\d+|)/g,pf=/^-ms-/,wf=/-([\da-z])/gi,bf=function(n,t){return t.toUpperCase()},h=function(n){(r.addEventListener||"load"===n.type||"complete"===r.readyState)&&(gi(),i.ready())},gi=function(){r.addEventListener?(r.removeEventListener("DOMContentLoaded",h,!1),n.removeEventListener("load",h,!1)):(r.detachEvent("onreadystatechange",h),n.detachEvent("onload",h))},gt,nr,tr,pi,lt,g,nt,gu,at;i.fn=i.prototype={jquery:wt,constructor:i,init:function(n,u,f){var e,o;if(!n)return this;if("string"==typeof n){if(e="<"===n.charAt(0)&&">"===n.charAt(n.length-1)&&n.length>=3?[null,n,null]:cf.exec(n),!e||!e[1]&&u)return!u||u.jquery?(u||f).find(n):this.constructor(u).find(n);if(e[1]){if(u=u instanceof i?u[0]:u,i.merge(this,i.parseHTML(e[1],u&&u.nodeType?u.ownerDocument||u:r,!0)),di.test(e[1])&&i.isPlainObject(u))for(e in u)i.isFunction(this[e])?this[e](u[e]):this.attr(e,u[e]);return this}if(o=r.getElementById(e[2]),o&&o.parentNode){if(o.id!==e[2])return f.find(n);this.length=1;this[0]=o}return this.context=r,this.selector=n,this}return n.nodeType?(this.context=this[0]=n,this.length=1,this):i.isFunction(n)?f.ready(n):(n.selector!==t&&(this.selector=n.selector,this.context=n.context),i.makeArray(n,this))},selector:"",length:0,size:function(){return this.length},toArray:function(){return l.call(this)},get:function(n){return null==n?this.toArray():0>n?this[this.length+n]:this[n]},pushStack:function(n){var t=i.merge(this.constructor(),n);return t.prevObject=this,t.context=this.context,t},each:function(n,t){return i.each(this,n,t)},ready:function(n){return i.ready.promise().done(n),this},slice:function(){return this.pushStack(l.apply(this,arguments))},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},eq:function(n){var i=this.length,t=+n+(0>n?i:0);return this.pushStack(t>=0&&i>t?[this[t]]:[])},map:function(n){return this.pushStack(i.map(this,function(t,i){return n.call(t,i,t)}))},end:function(){return this.prevObject||this.constructor(null)},push:bt,sort:[].sort,splice:[].splice};i.fn.init.prototype=i.fn;i.extend=i.fn.extend=function(){var u,o,r,e,s,h,n=arguments[0]||{},f=1,l=arguments.length,c=!1;for("boolean"==typeof n&&(c=n,n=arguments[1]||{},f=2),"object"==typeof n||i.isFunction(n)||(n={}),l===f&&(n=this,--f);l>f;f++)if(null!=(s=arguments[f]))for(e in s)u=n[e],r=s[e],n!==r&&(c&&r&&(i.isPlainObject(r)||(o=i.isArray(r)))?(o?(o=!1,h=u&&i.isArray(u)?u:[]):h=u&&i.isPlainObject(u)?u:{},n[e]=i.extend(c,h,r)):r!==t&&(n[e]=r));return n};i.extend({noConflict:function(t){return n.$===i&&(n.$=of),t&&n.jQuery===i&&(n.jQuery=ef),i},isReady:!1,readyWait:1,holdReady:function(n){n?i.readyWait++:i.ready(!0)},ready:function(n){if(n===!0?!--i.readyWait:!i.isReady){if(!r.body)return setTimeout(i.ready);i.isReady=!0;n!==!0&&--i.readyWait>0||(et.resolveWith(r,[i]),i.fn.trigger&&i(r).trigger("ready").off("ready"))}},isFunction:function(n){return"function"===i.type(n)},isArray:Array.isArray||function(n){return"array"===i.type(n)},isWindow:function(n){return null!=n&&n==n.window},isNumeric:function(n){return!isNaN(parseFloat(n))&&isFinite(n)},type:function(n){return null==n?n+"":"object"==typeof n||"function"==typeof n?ot[sf.call(n)]||"object":typeof n},isPlainObject:function(n){if(!n||"object"!==i.type(n)||n.nodeType||i.isWindow(n))return!1;try{if(n.constructor&&!it.call(n,"constructor")&&!it.call(n.constructor.prototype,"isPrototypeOf"))return!1}catch(u){return!1}for(var r in n);return r===t||it.call(n,r)},isEmptyObject:function(n){for(var t in n)return!1;return!0},error:function(n){throw Error(n);},parseHTML:function(n,t,u){if(!n||"string"!=typeof n)return null;"boolean"==typeof t&&(u=t,t=!1);t=t||r;var f=di.exec(n),e=!u&&[];return f?[t.createElement(f[1])]:(f=i.buildFragment([n],t,e),e&&i(e).remove(),i.merge([],f.childNodes))},parseJSON:function(r){return n.JSON&&n.JSON.parse?n.JSON.parse(r):null===r?r:"string"==typeof r&&(r=i.trim(r),r&&lf.test(r.replace(vf,"@").replace(yf,"]").replace(af,"")))?Function("return "+r)():(i.error("Invalid JSON: "+r),t)},parseXML:function(r){var u,f;if(!r||"string"!=typeof r)return null;try{n.DOMParser?(f=new DOMParser,u=f.parseFromString(r,"text/xml")):(u=new ActiveXObject("Microsoft.XMLDOM"),u.async="false",u.loadXML(r))}catch(e){u=t}return u&&u.documentElement&&!u.getElementsByTagName("parsererror").length||i.error("Invalid XML: "+r),u},noop:function(){},globalEval:function(t){t&&i.trim(t)&&(n.execScript||function(t){n.eval.call(n,t)})(t)},camelCase:function(n){return n.replace(pf,"ms-").replace(wf,bf)},nodeName:function(n,t){return n.nodeName&&n.nodeName.toLowerCase()===t.toLowerCase()},each:function(n,t,i){var u,r=0,f=n.length,e=dt(n);if(i){if(e){for(;f>r;r++)if(u=t.apply(n[r],i),u===!1)break}else for(r in n)if(u=t.apply(n[r],i),u===!1)break}else if(e){for(;f>r;r++)if(u=t.call(n[r],r,n[r]),u===!1)break}else for(r in n)if(u=t.call(n[r],r,n[r]),u===!1)break;return n},trim:kt&&!kt.call(" ")?function(n){return null==n?"":kt.call(n)}:function(n){return null==n?"":(n+"").replace(hf,"")},makeArray:function(n,t){var r=t||[];return null!=n&&(dt(Object(n))?i.merge(r,"string"==typeof n?[n]:n):bt.call(r,n)),r},inArray:function(n,t,i){var r;if(t){if(ki)return ki.call(t,n,i);for(r=t.length,i=i?0>i?Math.max(0,r+i):i:0;r>i;i++)if(i in t&&t[i]===n)return i}return-1},merge:function(n,i){var f=i.length,u=n.length,r=0;if("number"==typeof f)for(;f>r;r++)n[u++]=i[r];else while(i[r]!==t)n[u++]=i[r++];return n.length=u,n},grep:function(n,t,i){var u,f=[],r=0,e=n.length;for(i=!!i;e>r;r++)u=!!t(n[r],r),i!==u&&f.push(n[r]);return f},map:function(n,t,i){var u,r=0,e=n.length,o=dt(n),f=[];if(o)for(;e>r;r++)u=t(n[r],r,i),null!=u&&(f[f.length]=u);else for(r in n)u=t(n[r],r,i),null!=u&&(f[f.length]=u);return bi.apply([],f)},guid:1,proxy:function(n,r){var f,u,e;return"string"==typeof r&&(e=n[r],r=n,n=e),i.isFunction(n)?(f=l.call(arguments,2),u=function(){return n.apply(r||this,f.concat(l.call(arguments)))},u.guid=n.guid=n.guid||i.guid++,u):t},access:function(n,r,u,f,e,o,s){var h=0,l=n.length,c=null==u;if("object"===i.type(u)){e=!0;for(h in u)i.access(n,r,h,u[h],!0,o,s)}else if(f!==t&&(e=!0,i.isFunction(f)||(s=!0),c&&(s?(r.call(n,f),r=null):(c=r,r=function(n,t,r){return c.call(i(n),r)})),r))for(;l>h;h++)r(n[h],u,s?f:f.call(n[h],h,r(n[h],u)));return e?n:c?r.call(n):l?r(n[0],u):o},now:function(){return(new Date).getTime()}});i.ready.promise=function(t){if(!et)if(et=i.Deferred(),"complete"===r.readyState)setTimeout(i.ready);else if(r.addEventListener)r.addEventListener("DOMContentLoaded",h,!1),n.addEventListener("load",h,!1);else{r.attachEvent("onreadystatechange",h);n.attachEvent("onload",h);var u=!1;try{u=null==n.frameElement&&r.documentElement}catch(e){}u&&u.doScroll&&function f(){if(!i.isReady){try{u.doScroll("left")}catch(n){return setTimeout(f,50)}gi();i.ready()}}()}return et.promise(t)};i.each("Boolean Number String Function Array Date RegExp Object Error".split(" "),function(n,t){ot["[object "+t+"]"]=t.toLowerCase()});wi=i(r);gt={};i.Callbacks=function(n){n="string"==typeof n?gt[n]||kf(n):i.extend({},n);var o,f,c,s,e,l,r=[],u=!n.once&&[],a=function(t){for(f=n.memory&&t,c=!0,e=l||0,l=0,s=r.length,o=!0;r&&s>e;e++)if(r[e].apply(t[0],t[1])===!1&&n.stopOnFalse){f=!1;break}o=!1;r&&(u?u.length&&a(u.shift()):f?r=[]:h.disable())},h={add:function(){if(r){var t=r.length;(function u(t){i.each(t,function(t,f){var e=i.type(f);"function"===e?n.unique&&h.has(f)||r.push(f):f&&f.length&&"string"!==e&&u(f)})})(arguments);o?s=r.length:f&&(l=t,a(f))}return this},remove:function(){return r&&i.each(arguments,function(n,t){for(var u;(u=i.inArray(t,r,u))>-1;)r.splice(u,1),o&&(s>=u&&s--,e>=u&&e--)}),this},has:function(n){return n?i.inArray(n,r)>-1:!(!r||!r.length)},empty:function(){return r=[],this},disable:function(){return r=u=f=t,this},disabled:function(){return!r},lock:function(){return u=t,f||h.disable(),this},locked:function(){return!u},fireWith:function(n,t){return t=t||[],t=[n,t.slice?t.slice():t],!r||c&&!u||(o?u.push(t):a(t)),this},fire:function(){return h.fireWith(this,arguments),this},fired:function(){return!!c}};return h};i.extend({Deferred:function(n){var u=[["resolve","done",i.Callbacks("once memory"),"resolved"],["reject","fail",i.Callbacks("once memory"),"rejected"],["notify","progress",i.Callbacks("memory")]],f="pending",r={state:function(){return f},always:function(){return t.done(arguments).fail(arguments),this},then:function(){var n=arguments;return i.Deferred(function(f){i.each(u,function(u,e){var s=e[0],o=i.isFunction(n[u])&&n[u];t[e[1]](function(){var n=o&&o.apply(this,arguments);n&&i.isFunction(n.promise)?n.promise().done(f.resolve).fail(f.reject).progress(f.notify):f[s+"With"](this===r?f.promise():this,o?[n]:arguments)})});n=null}).promise()},promise:function(n){return null!=n?i.extend(n,r):r}},t={};return r.pipe=r.then,i.each(u,function(n,i){var e=i[2],o=i[3];r[i[1]]=e.add;o&&e.add(function(){f=o},u[1^n][2].disable,u[2][2].lock);t[i[0]]=function(){return t[i[0]+"With"](this===t?r:this,arguments),this};t[i[0]+"With"]=e.fireWith}),r.promise(t),n&&n.call(t,t),t},when:function(n){var t=0,u=l.call(arguments),r=u.length,e=1!==r||n&&i.isFunction(n.promise)?r:0,f=1===e?n:i.Deferred(),h=function(n,t,i){return function(r){t[n]=this;i[n]=arguments.length>1?l.call(arguments):r;i===o?f.notifyWith(t,i):--e||f.resolveWith(t,i)}},o,c,s;if(r>1)for(o=Array(r),c=Array(r),s=Array(r);r>t;t++)u[t]&&i.isFunction(u[t].promise)?u[t].promise().done(h(t,s,u)).fail(f.reject).progress(h(t,c,o)):--e;return e||f.resolveWith(s,u),f.promise()}});i.support=function(){var u,s,e,f,h,c,l,a,y,v,t=r.createElement("div");if(t.setAttribute("className","t"),t.innerHTML=" <link/><table><\/table><a href='/a'>a<\/a><input type='checkbox'/>",s=t.getElementsByTagName("*"),e=t.getElementsByTagName("a")[0],!s||!e||!s.length)return{};h=r.createElement("select");l=h.appendChild(r.createElement("option"));f=t.getElementsByTagName("input")[0];e.style.cssText="top:1px;float:left;opacity:.5";u={getSetAttribute:"t"!==t.className,leadingWhitespace:3===t.firstChild.nodeType,tbody:!t.getElementsByTagName("tbody").length,htmlSerialize:!!t.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:"/a"===e.getAttribute("href"),opacity:/^0.5/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:!!f.value,optSelected:l.selected,enctype:!!r.createElement("form").enctype,html5Clone:"<:nav><\/:nav>"!==r.createElement("nav").cloneNode(!0).outerHTML,boxModel:"CSS1Compat"===r.compatMode,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0,boxSizingReliable:!0,pixelPosition:!1};f.checked=!0;u.noCloneChecked=f.cloneNode(!0).checked;h.disabled=!0;u.optDisabled=!l.disabled;try{delete t.test}catch(p){u.deleteExpando=!1}f=r.createElement("input");f.setAttribute("value","");u.input=""===f.getAttribute("value");f.value="t";f.setAttribute("type","radio");u.radioValue="t"===f.value;f.setAttribute("checked","t");f.setAttribute("name","t");c=r.createDocumentFragment();c.appendChild(f);u.appendChecked=f.checked;u.checkClone=c.cloneNode(!0).cloneNode(!0).lastChild.checked;t.attachEvent&&(t.attachEvent("onclick",function(){u.noCloneEvent=!1}),t.cloneNode(!0).click());for(v in{submit:!0,change:!0,focusin:!0})t.setAttribute(a="on"+v,"t"),u[v+"Bubbles"]=a in n||t.attributes[a].expando===!1;return t.style.backgroundClip="content-box",t.cloneNode(!0).style.backgroundClip="",u.clearCloneStyle="content-box"===t.style.backgroundClip,i(function(){var e,f,i,h="padding:0;margin:0;border:0;display:block;box-sizing:content-box;-moz-box-sizing:content-box;-webkit-box-sizing:content-box;",s=r.getElementsByTagName("body")[0];s&&(e=r.createElement("div"),e.style.cssText="border:0;width:0;height:0;position:absolute;top:0;left:-9999px;margin-top:1px",s.appendChild(e).appendChild(t),t.innerHTML="<table><tr><td><\/td><td>t<\/td><\/tr><\/table>",i=t.getElementsByTagName("td"),i[0].style.cssText="padding:0;margin:0;border:0;display:none",y=0===i[0].offsetHeight,i[0].style.display="",i[1].style.display="none",u.reliableHiddenOffsets=y&&0===i[0].offsetHeight,t.innerHTML="",t.style.cssText="box-sizing:border-box;-moz-box-sizing:border-box;-webkit-box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%;",u.boxSizing=4===t.offsetWidth,u.doesNotIncludeMarginInBodyOffset=1!==s.offsetTop,n.getComputedStyle&&(u.pixelPosition="1%"!==(n.getComputedStyle(t,null)||{}).top,u.boxSizingReliable="4px"===(n.getComputedStyle(t,null)||{width:"4px"}).width,f=t.appendChild(r.createElement("div")),f.style.cssText=t.style.cssText=h,f.style.marginRight=f.style.width="0",t.style.width="1px",u.reliableMarginRight=!parseFloat((n.getComputedStyle(f,null)||{}).marginRight)),typeof t.style.zoom!==o&&(t.innerHTML="",t.style.cssText=h+"width:1px;padding:1px;display:inline;zoom:1",u.inlineBlockNeedsLayout=3===t.offsetWidth,t.style.display="block",t.innerHTML="<div><\/div>",t.firstChild.style.width="5px",u.shrinkWrapBlocks=3!==t.offsetWidth,u.inlineBlockNeedsLayout&&(s.style.zoom=1)),s.removeChild(e),e=t=i=f=null)}),s=h=c=l=e=f=null,u}();nr=/(?:\{[\s\S]*\}|\[[\s\S]*\])$/;tr=/([A-Z])/g;i.extend({cache:{},expando:"jQuery"+(wt+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(n){return n=n.nodeType?i.cache[n[i.expando]]:n[i.expando],!!n&&!ni(n)},data:function(n,t,i){return ir(n,t,i)},removeData:function(n,t){return rr(n,t)},_data:function(n,t,i){return ir(n,t,i,!0)},_removeData:function(n,t){return rr(n,t,!0)},acceptData:function(n){if(n.nodeType&&1!==n.nodeType&&9!==n.nodeType)return!1;var t=n.nodeName&&i.noData[n.nodeName.toLowerCase()];return!t||t!==!0&&n.getAttribute("classid")===t}});i.fn.extend({data:function(n,r){var e,f,u=this[0],o=0,s=null;if(n===t){if(this.length&&(s=i.data(u),1===u.nodeType&&!i._data(u,"parsedAttrs"))){for(e=u.attributes;e.length>o;o++)f=e[o].name,f.indexOf("data-")||(f=i.camelCase(f.slice(5)),ur(u,f,s[f]));i._data(u,"parsedAttrs",!0)}return s}return"object"==typeof n?this.each(function(){i.data(this,n)}):i.access(this,function(r){return r===t?u?ur(u,n,i.data(u,n)):null:(this.each(function(){i.data(this,n,r)}),t)},null,r,arguments.length>1,null,!0)},removeData:function(n){return this.each(function(){i.removeData(this,n)})}});i.extend({queue:function(n,r,u){var f;return n?(r=(r||"fx")+"queue",f=i._data(n,r),u&&(!f||i.isArray(u)?f=i._data(n,r,i.makeArray(u)):f.push(u)),f||[]):t},dequeue:function(n,t){t=t||"fx";var f=i.queue(n,t),e=f.length,r=f.shift(),u=i._queueHooks(n,t),o=function(){i.dequeue(n,t)};"inprogress"===r&&(r=f.shift(),e--);u.cur=r;r&&("fx"===t&&f.unshift("inprogress"),delete u.stop,r.call(n,o,u));!e&&u&&u.empty.fire()},_queueHooks:function(n,t){var r=t+"queueHooks";return i._data(n,r)||i._data(n,r,{empty:i.Callbacks("once memory").add(function(){i._removeData(n,t+"queue");i._removeData(n,r)})})}});i.fn.extend({queue:function(n,r){var u=2;return"string"!=typeof n&&(r=n,n="fx",u--),u>arguments.length?i.queue(this[0],n):r===t?this:this.each(function(){var t=i.queue(this,n,r);i._queueHooks(this,n);"fx"===n&&"inprogress"!==t[0]&&i.dequeue(this,n)})},dequeue:function(n){return this.each(function(){i.dequeue(this,n)})},delay:function(n,t){return n=i.fx?i.fx.speeds[n]||n:n,t=t||"fx",this.queue(t,function(t,i){var r=setTimeout(t,n);i.stop=function(){clearTimeout(r)}})},clearQueue:function(n){return this.queue(n||"fx",[])},promise:function(n,r){var u,e=1,o=i.Deferred(),f=this,s=this.length,h=function(){--e||o.resolveWith(f,[f])};for("string"!=typeof n&&(r=n,n=t),n=n||"fx";s--;)u=i._data(f[s],n+"queueHooks"),u&&u.empty&&(e++,u.empty.add(h));return h(),o.promise(r)}});var k,fr,ti=/[\t\r\n]/g,df=/\r/g,gf=/^(?:input|select|textarea|button|object)$/i,ne=/^(?:a|area)$/i,er=/^(?:checked|selected|autofocus|autoplay|async|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped)$/i,ii=/^(?:checked|selected)$/i,a=i.support.getSetAttribute,ri=i.support.input;i.fn.extend({attr:function(n,t){return i.access(this,i.attr,n,t,arguments.length>1)},removeAttr:function(n){return this.each(function(){i.removeAttr(this,n)})},prop:function(n,t){return i.access(this,i.prop,n,t,arguments.length>1)},removeProp:function(n){return n=i.propFix[n]||n,this.each(function(){try{this[n]=t;delete this[n]}catch(i){}})},addClass:function(n){var e,t,r,u,o,f=0,h=this.length,c="string"==typeof n&&n;if(i.isFunction(n))return this.each(function(t){i(this).addClass(n.call(this,t,this.className))});if(c)for(e=(n||"").match(s)||[];h>f;f++)if(t=this[f],r=1===t.nodeType&&(t.className?(" "+t.className+" ").replace(ti," "):" ")){for(o=0;u=e[o++];)0>r.indexOf(" "+u+" ")&&(r+=u+" ");t.className=i.trim(r)}return this},removeClass:function(n){var e,t,r,u,o,f=0,h=this.length,c=0===arguments.length||"string"==typeof n&&n;if(i.isFunction(n))return this.each(function(t){i(this).removeClass(n.call(this,t,this.className))});if(c)for(e=(n||"").match(s)||[];h>f;f++)if(t=this[f],r=1===t.nodeType&&(t.className?(" "+t.className+" ").replace(ti," "):"")){for(o=0;u=e[o++];)while(r.indexOf(" "+u+" ")>=0)r=r.replace(" "+u+" "," ");t.className=n?i.trim(r):""}return this},toggleClass:function(n,t){var r=typeof n,u="boolean"==typeof t;return i.isFunction(n)?this.each(function(r){i(this).toggleClass(n.call(this,r,this.className,t),t)}):this.each(function(){if("string"===r)for(var f,c=0,h=i(this),e=t,l=n.match(s)||[];f=l[c++];)e=u?e:!h.hasClass(f),h[e?"addClass":"removeClass"](f);else(r===o||"boolean"===r)&&(this.className&&i._data(this,"__className__",this.className),this.className=this.className||n===!1?"":i._data(this,"__className__")||"")})},hasClass:function(n){for(var i=" "+n+" ",t=0,r=this.length;r>t;t++)if(1===this[t].nodeType&&(" "+this[t].className+" ").replace(ti," ").indexOf(i)>=0)return!0;return!1},val:function(n){var u,r,e,f=this[0];return arguments.length?(e=i.isFunction(n),this.each(function(u){var f,o=i(this);1===this.nodeType&&(f=e?n.call(this,u,o.val()):n,null==f?f="":"number"==typeof f?f+="":i.isArray(f)&&(f=i.map(f,function(n){return null==n?"":n+""})),r=i.valHooks[this.type]||i.valHooks[this.nodeName.toLowerCase()],r&&"set"in r&&r.set(this,f,"value")!==t||(this.value=f))})):f?(r=i.valHooks[f.type]||i.valHooks[f.nodeName.toLowerCase()],r&&"get"in r&&(u=r.get(f,"value"))!==t?u:(u=f.value,"string"==typeof u?u.replace(df,""):null==u?"":u)):void 0}});i.extend({valHooks:{option:{get:function(n){var t=n.attributes.value;return!t||t.specified?n.value:n.text}},select:{get:function(n){for(var e,t,o=n.options,r=n.selectedIndex,u="select-one"===n.type||0>r,s=u?null:[],h=u?r+1:o.length,f=0>r?h:u?r:0;h>f;f++)if(t=o[f],!(!t.selected&&f!==r||(i.support.optDisabled?t.disabled:null!==t.getAttribute("disabled"))||t.parentNode.disabled&&i.nodeName(t.parentNode,"optgroup"))){if(e=i(t).val(),u)return e;s.push(e)}return s},set:function(n,t){var r=i.makeArray(t);return i(n).find("option").each(function(){this.selected=i.inArray(i(this).val(),r)>=0}),r.length||(n.selectedIndex=-1),r}}},attr:function(n,r,u){var f,s,e,h=n.nodeType;if(n&&3!==h&&8!==h&&2!==h)return typeof n.getAttribute===o?i.prop(n,r,u):(s=1!==h||!i.isXMLDoc(n),s&&(r=r.toLowerCase(),f=i.attrHooks[r]||(er.test(r)?fr:k)),u===t?f&&s&&"get"in f&&null!==(e=f.get(n,r))?e:(typeof n.getAttribute!==o&&(e=n.getAttribute(r)),null==e?t:e):null!==u?f&&s&&"set"in f&&(e=f.set(n,u,r))!==t?e:(n.setAttribute(r,u+""),u):(i.removeAttr(n,r),t))},removeAttr:function(n,t){var r,u,e=0,f=t&&t.match(s);if(f&&1===n.nodeType)while(r=f[e++])u=i.propFix[r]||r,er.test(r)?!a&&ii.test(r)?n[i.camelCase("default-"+r)]=n[u]=!1:n[u]=!1:i.attr(n,r,""),n.removeAttribute(a?r:u)},attrHooks:{type:{set:function(n,t){if(!i.support.radioValue&&"radio"===t&&i.nodeName(n,"input")){var r=n.value;return n.setAttribute("type",t),r&&(n.value=r),t}}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(n,r,u){var e,f,s,o=n.nodeType;if(n&&3!==o&&8!==o&&2!==o)return s=1!==o||!i.isXMLDoc(n),s&&(r=i.propFix[r]||r,f=i.propHooks[r]),u!==t?f&&"set"in f&&(e=f.set(n,u,r))!==t?e:n[r]=u:f&&"get"in f&&null!==(e=f.get(n,r))?e:n[r]},propHooks:{tabIndex:{get:function(n){var i=n.getAttributeNode("tabindex");return i&&i.specified?parseInt(i.value,10):gf.test(n.nodeName)||ne.test(n.nodeName)&&n.href?0:t}}}});fr={get:function(n,r){var u=i.prop(n,r),f="boolean"==typeof u&&n.getAttribute(r),e="boolean"==typeof u?ri&&a?null!=f:ii.test(r)?n[i.camelCase("default-"+r)]:!!f:n.getAttributeNode(r);return e&&e.value!==!1?r.toLowerCase():t},set:function(n,t,r){return t===!1?i.removeAttr(n,r):ri&&a||!ii.test(r)?n.setAttribute(!a&&i.propFix[r]||r,r):n[i.camelCase("default-"+r)]=n[r]=!0,r}};ri&&a||(i.attrHooks.value={get:function(n,r){var u=n.getAttributeNode(r);return i.nodeName(n,"input")?n.defaultValue:u&&u.specified?u.value:t},set:function(n,r,u){return i.nodeName(n,"input")?(n.defaultValue=r,t):k&&k.set(n,r,u)}});a||(k=i.valHooks.button={get:function(n,i){var r=n.getAttributeNode(i);return r&&("id"===i||"name"===i||"coords"===i?""!==r.value:r.specified)?r.value:t},set:function(n,i,r){var u=n.getAttributeNode(r);return u||n.setAttributeNode(u=n.ownerDocument.createAttribute(r)),u.value=i+="","value"===r||i===n.getAttribute(r)?i:t}},i.attrHooks.contenteditable={get:k.get,set:function(n,t,i){k.set(n,""===t?!1:t,i)}},i.each(["width","height"],function(n,r){i.attrHooks[r]=i.extend(i.attrHooks[r],{set:function(n,i){return""===i?(n.setAttribute(r,"auto"),i):t}})}));i.support.hrefNormalized||(i.each(["href","src","width","height"],function(n,r){i.attrHooks[r]=i.extend(i.attrHooks[r],{get:function(n){var i=n.getAttribute(r,2);return null==i?t:i}})}),i.each(["href","src"],function(n,t){i.propHooks[t]={get:function(n){return n.getAttribute(t,4)}}}));i.support.style||(i.attrHooks.style={get:function(n){return n.style.cssText||t},set:function(n,t){return n.style.cssText=t+""}});i.support.optSelected||(i.propHooks.selected=i.extend(i.propHooks.selected,{get:function(n){var t=n.parentNode;return t&&(t.selectedIndex,t.parentNode&&t.parentNode.selectedIndex),null}}));i.support.enctype||(i.propFix.enctype="encoding");i.support.checkOn||i.each(["radio","checkbox"],function(){i.valHooks[this]={get:function(n){return null===n.getAttribute("value")?"on":n.value}}});i.each(["radio","checkbox"],function(){i.valHooks[this]=i.extend(i.valHooks[this],{set:function(n,r){return i.isArray(r)?n.checked=i.inArray(i(n).val(),r)>=0:t}})});var ui=/^(?:input|select|textarea)$/i,te=/^key/,ie=/^(?:mouse|contextmenu)|click/,or=/^(?:focusinfocus|focusoutblur)$/,sr=/^([^.]*)(?:\.(.+)|)$/;i.event={global:{},add:function(n,r,u,f,e){var b,p,k,w,c,l,a,v,h,d,g,y=i._data(n);if(y){for(u.handler&&(w=u,u=w.handler,e=w.selector),u.guid||(u.guid=i.guid++),(p=y.events)||(p=y.events={}),(l=y.handle)||(l=y.handle=function(n){return typeof i===o||n&&i.event.triggered===n.type?t:i.event.dispatch.apply(l.elem,arguments)},l.elem=n),r=(r||"").match(s)||[""],k=r.length;k--;)b=sr.exec(r[k])||[],h=g=b[1],d=(b[2]||"").split(".").sort(),c=i.event.special[h]||{},h=(e?c.delegateType:c.bindType)||h,c=i.event.special[h]||{},a=i.extend({type:h,origType:g,data:f,handler:u,guid:u.guid,selector:e,needsContext:e&&i.expr.match.needsContext.test(e),namespace:d.join(".")},w),(v=p[h])||(v=p[h]=[],v.delegateCount=0,c.setup&&c.setup.call(n,f,d,l)!==!1||(n.addEventListener?n.addEventListener(h,l,!1):n.attachEvent&&n.attachEvent("on"+h,l))),c.add&&(c.add.call(n,a),a.handler.guid||(a.handler.guid=u.guid)),e?v.splice(v.delegateCount++,0,a):v.push(a),i.event.global[h]=!0;n=null}},remove:function(n,t,r,u,f){var y,o,h,b,p,a,c,l,e,w,k,v=i.hasData(n)&&i._data(n);if(v&&(a=v.events)){for(t=(t||"").match(s)||[""],p=t.length;p--;)if(h=sr.exec(t[p])||[],e=k=h[1],w=(h[2]||"").split(".").sort(),e){for(c=i.event.special[e]||{},e=(u?c.delegateType:c.bindType)||e,l=a[e]||[],h=h[2]&&RegExp("(^|\\.)"+w.join("\\.(?:.*\\.|)")+"(\\.|$)"),b=y=l.length;y--;)o=l[y],!f&&k!==o.origType||r&&r.guid!==o.guid||h&&!h.test(o.namespace)||u&&u!==o.selector&&("**"!==u||!o.selector)||(l.splice(y,1),o.selector&&l.delegateCount--,c.remove&&c.remove.call(n,o));b&&!l.length&&(c.teardown&&c.teardown.call(n,w,v.handle)!==!1||i.removeEvent(n,e,v.handle),delete a[e])}else for(e in a)i.event.remove(n,e+t[p],r,u,!0);i.isEmptyObject(a)&&(delete v.handle,i._removeData(n,"events"))}},trigger:function(u,f,e,o){var a,v,h,p,l,c,w,b=[e||r],s=it.call(u,"type")?u.type:u,y=it.call(u,"namespace")?u.namespace.split("."):[];if(h=c=e=e||r,3!==e.nodeType&&8!==e.nodeType&&!or.test(s+i.event.triggered)&&(s.indexOf(".")>=0&&(y=s.split("."),s=y.shift(),y.sort()),v=0>s.indexOf(":")&&"on"+s,u=u[i.expando]?u:new i.Event(s,"object"==typeof u&&u),u.isTrigger=!0,u.namespace=y.join("."),u.namespace_re=u.namespace?RegExp("(^|\\.)"+y.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,u.result=t,u.target||(u.target=e),f=null==f?[u]:i.makeArray(f,[u]),l=i.event.special[s]||{},o||!l.trigger||l.trigger.apply(e,f)!==!1)){if(!o&&!l.noBubble&&!i.isWindow(e)){for(p=l.delegateType||s,or.test(p+s)||(h=h.parentNode);h;h=h.parentNode)b.push(h),c=h;c===(e.ownerDocument||r)&&b.push(c.defaultView||c.parentWindow||n)}for(w=0;(h=b[w++])&&!u.isPropagationStopped();)u.type=w>1?p:l.bindType||s,a=(i._data(h,"events")||{})[u.type]&&i._data(h,"handle"),a&&a.apply(h,f),a=v&&h[v],a&&i.acceptData(h)&&a.apply&&a.apply(h,f)===!1&&u.preventDefault();if(u.type=s,!(o||u.isDefaultPrevented()||l._default&&l._default.apply(e.ownerDocument,f)!==!1||"click"===s&&i.nodeName(e,"a")||!i.acceptData(e)||!v||!e[s]||i.isWindow(e))){c=e[v];c&&(e[v]=null);i.event.triggered=s;try{e[s]()}catch(k){}i.event.triggered=t;c&&(e[v]=c)}return u.result}},dispatch:function(n){n=i.event.fix(n);var o,e,r,u,s,h=[],c=l.call(arguments),a=(i._data(this,"events")||{})[n.type]||[],f=i.event.special[n.type]||{};if(c[0]=n,n.delegateTarget=this,!f.preDispatch||f.preDispatch.call(this,n)!==!1){for(h=i.event.handlers.call(this,n,a),o=0;(u=h[o++])&&!n.isPropagationStopped();)for(n.currentTarget=u.elem,s=0;(r=u.handlers[s++])&&!n.isImmediatePropagationStopped();)(!n.namespace_re||n.namespace_re.test(r.namespace))&&(n.handleObj=r,n.data=r.data,e=((i.event.special[r.origType]||{}).handle||r.handler).apply(u.elem,c),e!==t&&(n.result=e)===!1&&(n.preventDefault(),n.stopPropagation()));return f.postDispatch&&f.postDispatch.call(this,n),n.result}},handlers:function(n,r){var e,o,f,s,c=[],h=r.delegateCount,u=n.target;if(h&&u.nodeType&&(!n.button||"click"!==n.type))for(;u!=this;u=u.parentNode||this)if(1===u.nodeType&&(u.disabled!==!0||"click"!==n.type)){for(f=[],s=0;h>s;s++)o=r[s],e=o.selector+" ",f[e]===t&&(f[e]=o.needsContext?i(e,this).index(u)>=0:i.find(e,this,null,[u]).length),f[e]&&f.push(o);f.length&&c.push({elem:u,handlers:f})}return r.length>h&&c.push({elem:this,handlers:r.slice(h)}),c},fix:function(n){if(n[i.expando])return n;var e,o,s,u=n.type,f=n,t=this.fixHooks[u];for(t||(this.fixHooks[u]=t=ie.test(u)?this.mouseHooks:te.test(u)?this.keyHooks:{}),s=t.props?this.props.concat(t.props):this.props,n=new i.Event(f),e=s.length;e--;)o=s[e],n[o]=f[o];return n.target||(n.target=f.srcElement||r),3===n.target.nodeType&&(n.target=n.target.parentNode),n.metaKey=!!n.metaKey,t.filter?t.filter(n,f):n},props:"altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),fixHooks:{},keyHooks:{props:"char charCode key keyCode".split(" "),filter:function(n,t){return null==n.which&&(n.which=null!=t.charCode?t.charCode:t.keyCode),n}},mouseHooks:{props:"button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),filter:function(n,i){var u,o,f,e=i.button,s=i.fromElement;return null==n.pageX&&null!=i.clientX&&(o=n.target.ownerDocument||r,f=o.documentElement,u=o.body,n.pageX=i.clientX+(f&&f.scrollLeft||u&&u.scrollLeft||0)-(f&&f.clientLeft||u&&u.clientLeft||0),n.pageY=i.clientY+(f&&f.scrollTop||u&&u.scrollTop||0)-(f&&f.clientTop||u&&u.clientTop||0)),!n.relatedTarget&&s&&(n.relatedTarget=s===n.target?i.toElement:s),n.which||e===t||(n.which=1&e?1:2&e?3:4&e?2:0),n}},special:{load:{noBubble:!0},click:{trigger:function(){return i.nodeName(this,"input")&&"checkbox"===this.type&&this.click?(this.click(),!1):t}},focus:{trigger:function(){if(this!==r.activeElement&&this.focus)try{return this.focus(),!1}catch(n){}},delegateType:"focusin"},blur:{trigger:function(){return this===r.activeElement&&this.blur?(this.blur(),!1):t},delegateType:"focusout"},beforeunload:{postDispatch:function(n){n.result!==t&&(n.originalEvent.returnValue=n.result)}}},simulate:function(n,t,r,u){var f=i.extend(new i.Event,r,{type:n,isSimulated:!0,originalEvent:{}});u?i.event.trigger(f,null,t):i.event.dispatch.call(t,f);f.isDefaultPrevented()&&r.preventDefault()}};i.removeEvent=r.removeEventListener?function(n,t,i){n.removeEventListener&&n.removeEventListener(t,i,!1)}:function(n,t,i){var r="on"+t;n.detachEvent&&(typeof n[r]===o&&(n[r]=null),n.detachEvent(r,i))};i.Event=function(n,r){return this instanceof i.Event?(n&&n.type?(this.originalEvent=n,this.type=n.type,this.isDefaultPrevented=n.defaultPrevented||n.returnValue===!1||n.getPreventDefault&&n.getPreventDefault()?ht:d):this.type=n,r&&i.extend(this,r),this.timeStamp=n&&n.timeStamp||i.now(),this[i.expando]=!0,t):new i.Event(n,r)};i.Event.prototype={isDefaultPrevented:d,isPropagationStopped:d,isImmediatePropagationStopped:d,preventDefault:function(){var n=this.originalEvent;this.isDefaultPrevented=ht;n&&(n.preventDefault?n.preventDefault():n.returnValue=!1)},stopPropagation:function(){var n=this.originalEvent;this.isPropagationStopped=ht;n&&(n.stopPropagation&&n.stopPropagation(),n.cancelBubble=!0)},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=ht;this.stopPropagation()}};i.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(n,t){i.event.special[n]={delegateType:t,bindType:t,handle:function(n){var u,f=this,r=n.relatedTarget,e=n.handleObj;return(!r||r!==f&&!i.contains(f,r))&&(n.type=e.origType,u=e.handler.apply(this,arguments),n.type=t),u}}});i.support.submitBubbles||(i.event.special.submit={setup:function(){return i.nodeName(this,"form")?!1:(i.event.add(this,"click._submit keypress._submit",function(n){var u=n.target,r=i.nodeName(u,"input")||i.nodeName(u,"button")?u.form:t;r&&!i._data(r,"submitBubbles")&&(i.event.add(r,"submit._submit",function(n){n._submit_bubble=!0}),i._data(r,"submitBubbles",!0))}),t)},postDispatch:function(n){n._submit_bubble&&(delete n._submit_bubble,this.parentNode&&!n.isTrigger&&i.event.simulate("submit",this.parentNode,n,!0))},teardown:function(){return i.nodeName(this,"form")?!1:(i.event.remove(this,"._submit"),t)}});i.support.changeBubbles||(i.event.special.change={setup:function(){return ui.test(this.nodeName)?(("checkbox"===this.type||"radio"===this.type)&&(i.event.add(this,"propertychange._change",function(n){"checked"===n.originalEvent.propertyName&&(this._just_changed=!0)}),i.event.add(this,"click._change",function(n){this._just_changed&&!n.isTrigger&&(this._just_changed=!1);i.event.simulate("change",this,n,!0)})),!1):(i.event.add(this,"beforeactivate._change",function(n){var t=n.target;ui.test(t.nodeName)&&!i._data(t,"changeBubbles")&&(i.event.add(t,"change._change",function(n){!this.parentNode||n.isSimulated||n.isTrigger||i.event.simulate("change",this.parentNode,n,!0)}),i._data(t,"changeBubbles",!0))}),t)},handle:function(n){var i=n.target;return this!==i||n.isSimulated||n.isTrigger||"radio"!==i.type&&"checkbox"!==i.type?n.handleObj.handler.apply(this,arguments):t},teardown:function(){return i.event.remove(this,"._change"),!ui.test(this.nodeName)}});i.support.focusinBubbles||i.each({focus:"focusin",blur:"focusout"},function(n,t){var u=0,f=function(n){i.event.simulate(t,n.target,i.event.fix(n),!0)};i.event.special[t]={setup:function(){0==u++&&r.addEventListener(n,f,!0)},teardown:function(){0==--u&&r.removeEventListener(n,f,!0)}}});i.fn.extend({on:function(n,r,u,f,e){var s,o;if("object"==typeof n){"string"!=typeof r&&(u=u||r,r=t);for(s in n)this.on(s,r,u,n[s],e);return this}if(null==u&&null==f?(f=r,u=r=t):null==f&&("string"==typeof r?(f=u,u=t):(f=u,u=r,r=t)),f===!1)f=d;else if(!f)return this;return 1===e&&(o=f,f=function(n){return i().off(n),o.apply(this,arguments)},f.guid=o.guid||(o.guid=i.guid++)),this.each(function(){i.event.add(this,n,f,u,r)})},one:function(n,t,i,r){return this.on(n,t,i,r,1)},off:function(n,r,u){var f,e;if(n&&n.preventDefault&&n.handleObj)return f=n.handleObj,i(n.delegateTarget).off(f.namespace?f.origType+"."+f.namespace:f.origType,f.selector,f.handler),this;if("object"==typeof n){for(e in n)this.off(e,r,n[e]);return this}return(r===!1||"function"==typeof r)&&(u=r,r=t),u===!1&&(u=d),this.each(function(){i.event.remove(this,n,u,r)})},bind:function(n,t,i){return this.on(n,null,t,i)},unbind:function(n,t){return this.off(n,null,t)},delegate:function(n,t,i,r){return this.on(t,n,i,r)},undelegate:function(n,t,i){return 1===arguments.length?this.off(n,"**"):this.off(t,n||"**",i)},trigger:function(n,t){return this.each(function(){i.event.trigger(n,t,this)})},triggerHandler:function(n,r){var u=this[0];return u?i.event.trigger(n,r,u,!0):t}}),function(n,t){function ti(n){return tr.test(n+"")}function ii(){var n,t=[];return n=function(i,u){return t.push(i+=" ")>r.cacheLength&&delete n[t.shift()],n[i]=u}}function l(n){return n[f]=!0,n}function b(n){var t=s.createElement("div");try{return n(t)}catch(i){return!1}finally{t=null}}function u(n,t,i,r){var y,u,e,l,p,v,w,h,d,b;if((t?t.ownerDocument||t:k)!==s&&it(t),t=t||s,i=i||[],!n||"string"!=typeof n)return i;if(1!==(l=t.nodeType)&&9!==l)return[];if(!c&&!r){if(y=ir.exec(n))if(e=y[1]){if(9===l){if(u=t.getElementById(e),!u||!u.parentNode)return i;if(u.id===e)return i.push(u),i}else if(t.ownerDocument&&(u=t.ownerDocument.getElementById(e))&&et(t,u)&&u.id===e)return i.push(u),i}else{if(y[2])return ut.apply(i,ft.call(t.getElementsByTagName(n),0)),i;if((e=y[3])&&o.getByClassName&&t.getElementsByClassName)return ut.apply(i,ft.call(t.getElementsByClassName(e),0)),i}if(o.qsa&&!a.test(n)){if(w=!0,h=f,d=t,b=9===l&&n,1===l&&"object"!==t.nodeName.toLowerCase()){for(v=yt(n),(w=t.getAttribute("id"))?h=w.replace(fr,"\\$&"):t.setAttribute("id",h),h="[id='"+h+"'] ",p=v.length;p--;)v[p]=h+pt(v[p]);d=ni.test(n)&&t.parentNode||t;b=v.join(",")}if(b)try{return ut.apply(i,ft.call(d.querySelectorAll(b),0)),i}catch(g){}finally{w||t.removeAttribute("id")}}}return lr(n.replace(at,"$1"),t,i,r)}function yi(n,t){var i=t&&n,r=i&&(~t.sourceIndex||li)-(~n.sourceIndex||li);if(r)return r;if(i)while(i=i.nextSibling)if(i===t)return-1;return n?1:-1}function or(n){return function(t){var i=t.nodeName.toLowerCase();return"input"===i&&t.type===n}}function sr(n){return function(t){var i=t.nodeName.toLowerCase();return("input"===i||"button"===i)&&t.type===n}}function g(n){return l(function(t){return t=+t,l(function(i,r){for(var u,f=n([],i.length,t),e=f.length;e--;)i[u=f[e]]&&(i[u]=!(r[u]=i[u]))})})}function yt(n,t){var e,f,s,o,i,h,c,l=hi[n+" "];if(l)return t?0:l.slice(0);for(i=n,h=[],c=r.preFilter;i;){(!e||(f=ki.exec(i)))&&(f&&(i=i.slice(f[0].length)||i),h.push(s=[]));e=!1;(f=di.exec(i))&&(e=f.shift(),s.push({value:e,type:f[0].replace(at," ")}),i=i.slice(e.length));for(o in r.filter)(f=vt[o].exec(i))&&(!c[o]||(f=c[o](f)))&&(e=f.shift(),s.push({value:e,type:o,matches:f}),i=i.slice(e.length));if(!e)break}return t?i.length:i?u.error(n):hi(n,h).slice(0)}function pt(n){for(var t=0,r=n.length,i="";r>t;t++)i+=n[t].value;return i}function ri(n,t,i){var r=t.dir,u=i&&"parentNode"===r,e=wi++;return t.first?function(t,i,f){while(t=t[r])if(1===t.nodeType||u)return n(t,i,f)}:function(t,i,o){var h,s,c,l=v+" "+e;if(o){while(t=t[r])if((1===t.nodeType||u)&&n(t,i,o))return!0}else while(t=t[r])if(1===t.nodeType||u)if(c=t[f]||(t[f]={}),(s=c[r])&&s[0]===l){if((h=s[1])===!0||h===ot)return h===!0}else if(s=c[r]=[l],s[1]=n(t,i,o)||ot,s[1]===!0)return!0}}function ui(n){return n.length>1?function(t,i,r){for(var u=n.length;u--;)if(!n[u](t,i,r))return!1;return!0}:n[0]}function wt(n,t,i,r,u){for(var e,o=[],f=0,s=n.length,h=null!=t;s>f;f++)(e=n[f])&&(!i||i(e,r,u))&&(o.push(e),h&&t.push(f));return o}function fi(n,t,i,r,u,e){return r&&!r[f]&&(r=fi(r)),u&&!u[f]&&(u=fi(u,e)),l(function(f,e,o,s){var l,c,a,p=[],y=[],w=e.length,b=f||cr(t||"*",o.nodeType?[o]:o,[]),v=!n||!f&&t?b:wt(b,p,n,o,s),h=i?u||(f?n:w||r)?[]:e:v;if(i&&i(v,h,o,s),r)for(l=wt(h,y),r(l,[],o,s),c=l.length;c--;)(a=l[c])&&(h[y[c]]=!(v[y[c]]=a));if(f){if(u||n){if(u){for(l=[],c=h.length;c--;)(a=h[c])&&l.push(v[c]=a);u(null,h=[],l,s)}for(c=h.length;c--;)(a=h[c])&&(l=u?dt.call(f,a):p[c])>-1&&(f[l]=!(e[l]=a))}}else h=wt(h===e?h.splice(w,h.length):h),u?u(null,e,h,s):ut.apply(e,h)})}function ei(n){for(var s,u,i,o=n.length,h=r.relative[n[0].type],c=h||r.relative[" "],t=h?1:0,l=ri(function(n){return n===s},c,!0),a=ri(function(n){return dt.call(s,n)>-1},c,!0),e=[function(n,t,i){return!h&&(i||t!==ht)||((s=t).nodeType?l(n,t,i):a(n,t,i))}];o>t;t++)if(u=r.relative[n[t].type])e=[ri(ui(e),u)];else{if(u=r.filter[n[t].type].apply(null,n[t].matches),u[f]){for(i=++t;o>i;i++)if(r.relative[n[i].type])break;return fi(t>1&&ui(e),t>1&&pt(n.slice(0,t-1)).replace(at,"$1"),u,i>t&&ei(n.slice(t,i)),o>i&&ei(n=n.slice(i)),o>i&&pt(n))}e.push(u)}return ui(e)}function hr(n,t){var f=0,i=t.length>0,e=n.length>0,o=function(o,h,c,l,a){var p,d,b,w=[],k=0,y="0",g=o&&[],nt=null!=a,tt=ht,rt=o||e&&r.find.TAG("*",a&&h.parentNode||h),it=v+=null==tt?1:Math.random()||.1;for(nt&&(ht=h!==s&&h,ot=f);null!=(p=rt[y]);y++){if(e&&p){for(d=0;b=n[d++];)if(b(p,h,c)){l.push(p);break}nt&&(v=it,ot=++f)}i&&((p=!b&&p)&&k--,o&&g.push(p))}if(k+=y,i&&y!==k){for(d=0;b=t[d++];)b(g,w,h,c);if(o){if(k>0)while(y--)g[y]||w[y]||(w[y]=bi.call(l));w=wt(w)}ut.apply(l,w);nt&&!o&&w.length>0&&k+t.length>1&&u.uniqueSort(l)}return nt&&(v=it,ht=tt),g};return i?l(o):o}function cr(n,t,i){for(var r=0,f=t.length;f>r;r++)u(n,t[r],i);return i}function lr(n,t,i,u){var o,f,e,h,l,s=yt(n);if(!u&&1===s.length){if(f=s[0]=s[0].slice(0),f.length>2&&"ID"===(e=f[0]).type&&9===t.nodeType&&!c&&r.relative[f[1].type]){if(t=r.find.ID(e.matches[0].replace(p,w),t)[0],!t)return i;n=n.slice(f.shift().value.length)}for(o=vt.needsContext.test(n)?0:f.length;o--;){if(e=f[o],r.relative[h=e.type])break;if((l=r.find[h])&&(u=l(e.matches[0].replace(p,w),ni.test(f[0].type)&&t.parentNode||t))){if(f.splice(o,1),n=u.length&&pt(f),!n)return ut.apply(i,ft.call(u,0)),i;break}}}return bt(n,s)(u,t,c,i,ni.test(n)),i}function pi(){}var nt,ot,r,st,oi,bt,tt,ht,it,s,h,c,a,rt,ct,et,kt,f="sizzle"+-new Date,k=n.document,o={},v=0,wi=0,si=ii(),hi=ii(),ci=ii(),y=typeof t,li=-2147483648,lt=[],bi=lt.pop,ut=lt.push,ft=lt.slice,dt=lt.indexOf||function(n){for(var t=0,i=this.length;i>t;t++)if(this[t]===n)return t;return-1},e="[\\x20\\t\\r\\n\\f]",d="(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+",ai=d.replace("w","w#"),vi="\\["+e+"*("+d+")"+e+"*(?:([*^$|!~]?=)"+e+"*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|("+ai+")|)|)"+e+"*\\]",gt=":("+d+")(?:\\(((['\"])((?:\\\\.|[^\\\\])*?)\\3|((?:\\\\.|[^\\\\()[\\]]|"+vi.replace(3,8)+")*)|.*)\\)|)",at=RegExp("^"+e+"+|((?:^|[^\\\\])(?:\\\\.)*)"+e+"+$","g"),ki=RegExp("^"+e+"*,"+e+"*"),di=RegExp("^"+e+"*([\\x20\\t\\r\\n\\f>+~])"+e+"*"),gi=RegExp(gt),nr=RegExp("^"+ai+"$"),vt={ID:RegExp("^#("+d+")"),CLASS:RegExp("^\\.("+d+")"),NAME:RegExp("^\\[name=['\"]?("+d+")['\"]?\\]"),TAG:RegExp("^("+d.replace("w","w*")+")"),ATTR:RegExp("^"+vi),PSEUDO:RegExp("^"+gt),CHILD:RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+e+"*(even|odd|(([+-]|)(\\d*)n|)"+e+"*(?:([+-]|)"+e+"*(\\d+)|))"+e+"*\\)|)","i"),needsContext:RegExp("^"+e+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+e+"*((?:-\\d)?\\d*)"+e+"*\\)|)(?=[^-]|$)","i")},ni=/[\x20\t\r\n\f]*[+~]/,tr=/^[^{]+\{\s*\[native code/,ir=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,rr=/^(?:input|select|textarea|button)$/i,ur=/^h\d$/i,fr=/'|\\/g,er=/\=[\x20\t\r\n\f]*([^'"\]]*)[\x20\t\r\n\f]*\]/g,p=/\\([\da-fA-F]{1,6}[\x20\t\r\n\f]?|.)/g,w=function(n,t){var i="0x"+t-65536;return i!==i?t:0>i?String.fromCharCode(i+65536):String.fromCharCode(55296|i>>10,56320|1023&i)};try{ft.call(k.documentElement.childNodes,0)[0].nodeType}catch(ar){ft=function(n){for(var t,i=[];t=this[n++];)i.push(t);return i}}oi=u.isXML=function(n){var t=n&&(n.ownerDocument||n).documentElement;return t?"HTML"!==t.nodeName:!1};it=u.setDocument=function(n){var i=n?n.ownerDocument||n:k;return i!==s&&9===i.nodeType&&i.documentElement?(s=i,h=i.documentElement,c=oi(i),o.tagNameNoComments=b(function(n){return n.appendChild(i.createComment("")),!n.getElementsByTagName("*").length}),o.attributes=b(function(n){n.innerHTML="<select><\/select>";var t=typeof n.lastChild.getAttribute("multiple");return"boolean"!==t&&"string"!==t}),o.getByClassName=b(function(n){return n.innerHTML="<div class='hidden e'><\/div><div class='hidden'><\/div>",n.getElementsByClassName&&n.getElementsByClassName("e").length?(n.lastChild.className="e",2===n.getElementsByClassName("e").length):!1}),o.getByName=b(function(n){n.id=f+0;n.innerHTML="<a name='"+f+"'><\/a><div name='"+f+"'><\/div>";h.insertBefore(n,h.firstChild);var t=i.getElementsByName&&i.getElementsByName(f).length===2+i.getElementsByName(f+0).length;return o.getIdNotName=!i.getElementById(f),h.removeChild(n),t}),r.attrHandle=b(function(n){return n.innerHTML="<a href='#'><\/a>",n.firstChild&&typeof n.firstChild.getAttribute!==y&&"#"===n.firstChild.getAttribute("href")})?{}:{href:function(n){return n.getAttribute("href",2)},type:function(n){return n.getAttribute("type")}},o.getIdNotName?(r.find.ID=function(n,t){if(typeof t.getElementById!==y&&!c){var i=t.getElementById(n);return i&&i.parentNode?[i]:[]}},r.filter.ID=function(n){var t=n.replace(p,w);return function(n){return n.getAttribute("id")===t}}):(r.find.ID=function(n,i){if(typeof i.getElementById!==y&&!c){var r=i.getElementById(n);return r?r.id===n||typeof r.getAttributeNode!==y&&r.getAttributeNode("id").value===n?[r]:t:[]}},r.filter.ID=function(n){var t=n.replace(p,w);return function(n){var i=typeof n.getAttributeNode!==y&&n.getAttributeNode("id");return i&&i.value===t}}),r.find.TAG=o.tagNameNoComments?function(n,i){return typeof i.getElementsByTagName!==y?i.getElementsByTagName(n):t}:function(n,t){var i,r=[],f=0,u=t.getElementsByTagName(n);if("*"===n){while(i=u[f++])1===i.nodeType&&r.push(i);return r}return u},r.find.NAME=o.getByName&&function(n,i){return typeof i.getElementsByName!==y?i.getElementsByName(name):t},r.find.CLASS=o.getByClassName&&function(n,i){return typeof i.getElementsByClassName===y||c?t:i.getElementsByClassName(n)},rt=[],a=[":focus"],(o.qsa=ti(i.querySelectorAll))&&(b(function(n){n.innerHTML="<select><option selected=''><\/option><\/select>";n.querySelectorAll("[selected]").length||a.push("\\["+e+"*(?:checked|disabled|ismap|multiple|readonly|selected|value)");n.querySelectorAll(":checked").length||a.push(":checked")}),b(function(n){n.innerHTML="<input type='hidden' i=''/>";n.querySelectorAll("[i^='']").length&&a.push("[*^$]="+e+"*(?:\"\"|'')");n.querySelectorAll(":enabled").length||a.push(":enabled",":disabled");n.querySelectorAll("*,:x");a.push(",.*:")})),(o.matchesSelector=ti(ct=h.matchesSelector||h.mozMatchesSelector||h.webkitMatchesSelector||h.oMatchesSelector||h.msMatchesSelector))&&b(function(n){o.disconnectedMatch=ct.call(n,"div");ct.call(n,"[s!='']:x");rt.push("!=",gt)}),a=RegExp(a.join("|")),rt=RegExp(rt.join("|")),et=ti(h.contains)||h.compareDocumentPosition?function(n,t){var r=9===n.nodeType?n.documentElement:n,i=t&&t.parentNode;return n===i||!(!i||1!==i.nodeType||!(r.contains?r.contains(i):n.compareDocumentPosition&&16&n.compareDocumentPosition(i)))}:function(n,t){if(t)while(t=t.parentNode)if(t===n)return!0;return!1},kt=h.compareDocumentPosition?function(n,t){var r;return n===t?(tt=!0,0):(r=t.compareDocumentPosition&&n.compareDocumentPosition&&n.compareDocumentPosition(t))?1&r||n.parentNode&&11===n.parentNode.nodeType?n===i||et(k,n)?-1:t===i||et(k,t)?1:0:4&r?-1:1:n.compareDocumentPosition?-1:1}:function(n,t){var r,u=0,o=n.parentNode,s=t.parentNode,f=[n],e=[t];if(n===t)return tt=!0,0;if(!o||!s)return n===i?-1:t===i?1:o?-1:s?1:0;if(o===s)return yi(n,t);for(r=n;r=r.parentNode;)f.unshift(r);for(r=t;r=r.parentNode;)e.unshift(r);while(f[u]===e[u])u++;return u?yi(f[u],e[u]):f[u]===k?-1:e[u]===k?1:0},tt=!1,[0,0].sort(kt),o.detectDuplicates=tt,s):s};u.matches=function(n,t){return u(n,null,null,t)};u.matchesSelector=function(n,t){if((n.ownerDocument||n)!==s&&it(n),t=t.replace(er,"='$1']"),!(!o.matchesSelector||c||rt&&rt.test(t)||a.test(t)))try{var i=ct.call(n,t);if(i||o.disconnectedMatch||n.document&&11!==n.document.nodeType)return i}catch(r){}return u(t,s,null,[n]).length>0};u.contains=function(n,t){return(n.ownerDocument||n)!==s&&it(n),et(n,t)};u.attr=function(n,t){var i;return(n.ownerDocument||n)!==s&&it(n),c||(t=t.toLowerCase()),(i=r.attrHandle[t])?i(n):c||o.attributes?n.getAttribute(t):((i=n.getAttributeNode(t))||n.getAttribute(t))&&n[t]===!0?t:i&&i.specified?i.value:null};u.error=function(n){throw Error("Syntax error, unrecognized expression: "+n);};u.uniqueSort=function(n){var r,u=[],t=1,i=0;if(tt=!o.detectDuplicates,n.sort(kt),tt){for(;r=n[t];t++)r===n[t-1]&&(i=u.push(t));while(i--)n.splice(u[i],1)}return n};st=u.getText=function(n){var r,i="",u=0,t=n.nodeType;if(t){if(1===t||9===t||11===t){if("string"==typeof n.textContent)return n.textContent;for(n=n.firstChild;n;n=n.nextSibling)i+=st(n)}else if(3===t||4===t)return n.nodeValue}else for(;r=n[u];u++)i+=st(r);return i};r=u.selectors={cacheLength:50,createPseudo:l,match:vt,find:{},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(n){return n[1]=n[1].replace(p,w),n[3]=(n[4]||n[5]||"").replace(p,w),"~="===n[2]&&(n[3]=" "+n[3]+" "),n.slice(0,4)},CHILD:function(n){return n[1]=n[1].toLowerCase(),"nth"===n[1].slice(0,3)?(n[3]||u.error(n[0]),n[4]=+(n[4]?n[5]+(n[6]||1):2*("even"===n[3]||"odd"===n[3])),n[5]=+(n[7]+n[8]||"odd"===n[3])):n[3]&&u.error(n[0]),n},PSEUDO:function(n){var i,t=!n[5]&&n[2];return vt.CHILD.test(n[0])?null:(n[4]?n[2]=n[4]:t&&gi.test(t)&&(i=yt(t,!0))&&(i=t.indexOf(")",t.length-i)-t.length)&&(n[0]=n[0].slice(0,i),n[2]=t.slice(0,i)),n.slice(0,3))}},filter:{TAG:function(n){return"*"===n?function(){return!0}:(n=n.replace(p,w).toLowerCase(),function(t){return t.nodeName&&t.nodeName.toLowerCase()===n})},CLASS:function(n){var t=si[n+" "];return t||(t=RegExp("(^|"+e+")"+n+"("+e+"|$)"))&&si(n,function(n){return t.test(n.className||typeof n.getAttribute!==y&&n.getAttribute("class")||"")})},ATTR:function(n,t,i){return function(r){var f=u.attr(r,n);return null==f?"!="===t:t?(f+="","="===t?f===i:"!="===t?f!==i:"^="===t?i&&0===f.indexOf(i):"*="===t?i&&f.indexOf(i)>-1:"$="===t?i&&f.slice(-i.length)===i:"~="===t?(" "+f+" ").indexOf(i)>-1:"|="===t?f===i||f.slice(0,i.length+1)===i+"-":!1):!0}},CHILD:function(n,t,i,r,u){var s="nth"!==n.slice(0,3),o="last"!==n.slice(-4),e="of-type"===t;return 1===r&&0===u?function(n){return!!n.parentNode}:function(t,i,h){var a,k,c,l,y,w,b=s!==o?"nextSibling":"previousSibling",p=t.parentNode,g=e&&t.nodeName.toLowerCase(),d=!h&&!e;if(p){if(s){while(b){for(c=t;c=c[b];)if(e?c.nodeName.toLowerCase()===g:1===c.nodeType)return!1;w=b="only"===n&&!w&&"nextSibling"}return!0}if(w=[o?p.firstChild:p.lastChild],o&&d){for(k=p[f]||(p[f]={}),a=k[n]||[],y=a[0]===v&&a[1],l=a[0]===v&&a[2],c=y&&p.childNodes[y];c=++y&&c&&c[b]||(l=y=0)||w.pop();)if(1===c.nodeType&&++l&&c===t){k[n]=[v,y,l];break}}else if(d&&(a=(t[f]||(t[f]={}))[n])&&a[0]===v)l=a[1];else while(c=++y&&c&&c[b]||(l=y=0)||w.pop())if((e?c.nodeName.toLowerCase()===g:1===c.nodeType)&&++l&&(d&&((c[f]||(c[f]={}))[n]=[v,l]),c===t))break;return l-=u,l===r||0==l%r&&l/r>=0}}},PSEUDO:function(n,t){var e,i=r.pseudos[n]||r.setFilters[n.toLowerCase()]||u.error("unsupported pseudo: "+n);return i[f]?i(t):i.length>1?(e=[n,n,"",t],r.setFilters.hasOwnProperty(n.toLowerCase())?l(function(n,r){for(var u,f=i(n,t),e=f.length;e--;)u=dt.call(n,f[e]),n[u]=!(r[u]=f[e])}):function(n){return i(n,0,e)}):i}},pseudos:{not:l(function(n){var i=[],r=[],t=bt(n.replace(at,"$1"));return t[f]?l(function(n,i,r,u){for(var e,o=t(n,null,u,[]),f=n.length;f--;)(e=o[f])&&(n[f]=!(i[f]=e))}):function(n,u,f){return i[0]=n,t(i,null,f,r),!r.pop()}}),has:l(function(n){return function(t){return u(n,t).length>0}}),contains:l(function(n){return function(t){return(t.textContent||t.innerText||st(t)).indexOf(n)>-1}}),lang:l(function(n){return nr.test(n||"")||u.error("unsupported lang: "+n),n=n.replace(p,w).toLowerCase(),function(t){var i;do if(i=c?t.getAttribute("xml:lang")||t.getAttribute("lang"):t.lang)return i=i.toLowerCase(),i===n||0===i.indexOf(n+"-");while((t=t.parentNode)&&1===t.nodeType);return!1}}),target:function(t){var i=n.location&&n.location.hash;return i&&i.slice(1)===t.id},root:function(n){return n===h},focus:function(n){return n===s.activeElement&&(!s.hasFocus||s.hasFocus())&&!!(n.type||n.href||~n.tabIndex)},enabled:function(n){return n.disabled===!1},disabled:function(n){return n.disabled===!0},checked:function(n){var t=n.nodeName.toLowerCase();return"input"===t&&!!n.checked||"option"===t&&!!n.selected},selected:function(n){return n.parentNode&&n.parentNode.selectedIndex,n.selected===!0},empty:function(n){for(n=n.firstChild;n;n=n.nextSibling)if(n.nodeName>"@"||3===n.nodeType||4===n.nodeType)return!1;return!0},parent:function(n){return!r.pseudos.empty(n)},header:function(n){return ur.test(n.nodeName)},input:function(n){return rr.test(n.nodeName)},button:function(n){var t=n.nodeName.toLowerCase();return"input"===t&&"button"===n.type||"button"===t},text:function(n){var t;return"input"===n.nodeName.toLowerCase()&&"text"===n.type&&(null==(t=n.getAttribute("type"))||t.toLowerCase()===n.type)},first:g(function(){return[0]}),last:g(function(n,t){return[t-1]}),eq:g(function(n,t,i){return[0>i?i+t:i]}),even:g(function(n,t){for(var i=0;t>i;i+=2)n.push(i);return n}),odd:g(function(n,t){for(var i=1;t>i;i+=2)n.push(i);return n}),lt:g(function(n,t,i){for(var r=0>i?i+t:i;--r>=0;)n.push(r);return n}),gt:g(function(n,t,i){for(var r=0>i?i+t:i;t>++r;)n.push(r);return n})}};for(nt in{radio:!0,checkbox:!0,file:!0,password:!0,image:!0})r.pseudos[nt]=or(nt);for(nt in{submit:!0,reset:!0})r.pseudos[nt]=sr(nt);bt=u.compile=function(n,t){var r,u=[],e=[],i=ci[n+" "];if(!i){for(t||(t=yt(n)),r=t.length;r--;)i=ei(t[r]),i[f]?u.push(i):e.push(i);i=ci(n,hr(e,u))}return i};r.pseudos.nth=r.pseudos.eq;r.filters=pi.prototype=r.pseudos;r.setFilters=new pi;it();u.attr=i.attr;i.find=u;i.expr=u.selectors;i.expr[":"]=i.expr.pseudos;i.unique=u.uniqueSort;i.text=u.getText;i.isXMLDoc=u.isXML;i.contains=u.contains}(n);var re=/Until$/,ue=/^(?:parents|prev(?:Until|All))/,fe=/^.[^:#\[\.,]*$/,hr=i.expr.match.needsContext,ee={children:!0,contents:!0,next:!0,prev:!0};i.fn.extend({find:function(n){var t,r,f,u=this.length;if("string"!=typeof n)return f=this,this.pushStack(i(n).filter(function(){for(t=0;u>t;t++)if(i.contains(f[t],this))return!0}));for(r=[],t=0;u>t;t++)i.find(n,this[t],r);return r=this.pushStack(u>1?i.unique(r):r),r.selector=(this.selector?this.selector+" ":"")+n,r},has:function(n){var t,r=i(n,this),u=r.length;return this.filter(function(){for(t=0;u>t;t++)if(i.contains(this,r[t]))return!0})},not:function(n){return this.pushStack(lr(this,n,!1))},filter:function(n){return this.pushStack(lr(this,n,!0))},is:function(n){return!!n&&("string"==typeof n?hr.test(n)?i(n,this.context).index(this[0])>=0:i.filter(n,this).length>0:this.filter(n).length>0)},closest:function(n,t){for(var r,f=0,o=this.length,u=[],e=hr.test(n)||"string"!=typeof n?i(n,t||this.context):0;o>f;f++)for(r=this[f];r&&r.ownerDocument&&r!==t&&11!==r.nodeType;){if(e?e.index(r)>-1:i.find.matchesSelector(r,n)){u.push(r);break}r=r.parentNode}return this.pushStack(u.length>1?i.unique(u):u)},index:function(n){return n?"string"==typeof n?i.inArray(this[0],i(n)):i.inArray(n.jquery?n[0]:n,this):this[0]&&this[0].parentNode?this.first().prevAll().length:-1},add:function(n,t){var r="string"==typeof n?i(n,t):i.makeArray(n&&n.nodeType?[n]:n),u=i.merge(this.get(),r);return this.pushStack(i.unique(u))},addBack:function(n){return this.add(null==n?this.prevObject:this.prevObject.filter(n))}});i.fn.andSelf=i.fn.addBack;i.each({parent:function(n){var t=n.parentNode;return t&&11!==t.nodeType?t:null},parents:function(n){return i.dir(n,"parentNode")},parentsUntil:function(n,t,r){return i.dir(n,"parentNode",r)},next:function(n){return cr(n,"nextSibling")},prev:function(n){return cr(n,"previousSibling")},nextAll:function(n){return i.dir(n,"nextSibling")},prevAll:function(n){return i.dir(n,"previousSibling")},nextUntil:function(n,t,r){return i.dir(n,"nextSibling",r)},prevUntil:function(n,t,r){return i.dir(n,"previousSibling",r)},siblings:function(n){return i.sibling((n.parentNode||{}).firstChild,n)},children:function(n){return i.sibling(n.firstChild)},contents:function(n){return i.nodeName(n,"iframe")?n.contentDocument||n.contentWindow.document:i.merge([],n.childNodes)}},function(n,t){i.fn[n]=function(r,u){var f=i.map(this,t,r);return re.test(n)||(u=r),u&&"string"==typeof u&&(f=i.filter(u,f)),f=this.length>1&&!ee[n]?i.unique(f):f,this.length>1&&ue.test(n)&&(f=f.reverse()),this.pushStack(f)}});i.extend({filter:function(n,t,r){return r&&(n=":not("+n+")"),1===t.length?i.find.matchesSelector(t[0],n)?[t[0]]:[]:i.find.matches(n,t)},dir:function(n,r,u){for(var e=[],f=n[r];f&&9!==f.nodeType&&(u===t||1!==f.nodeType||!i(f).is(u));)1===f.nodeType&&e.push(f),f=f[r];return e},sibling:function(n,t){for(var i=[];n;n=n.nextSibling)1===n.nodeType&&n!==t&&i.push(n);return i}});var vr="abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",oe=/ jQuery\d+="(?:null|\d+)"/g,yr=RegExp("<(?:"+vr+")[\\s/>]","i"),fi=/^\s+/,pr=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi,wr=/<([\w:]+)/,br=/<tbody/i,se=/<|&#?\w+;/,he=/<(?:script|style|link)/i,ei=/^(?:checkbox|radio)$/i,ce=/checked\s*(?:[^=]|=\s*.checked.)/i,kr=/^$|\/(?:java|ecma)script/i,le=/^true\/(.*)/,ae=/^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g,e={option:[1,"<select multiple='multiple'>","<\/select>"],legend:[1,"<fieldset>","<\/fieldset>"],area:[1,"<map>","<\/map>"],param:[1,"<object>","<\/object>"],thead:[1,"<table>","<\/table>"],tr:[2,"<table><tbody>","<\/tbody><\/table>"],col:[2,"<table><tbody><\/tbody><colgroup>","<\/colgroup><\/table>"],td:[3,"<table><tbody><tr>","<\/tr><\/tbody><\/table>"],_default:i.support.htmlSerialize?[0,"",""]:[1,"X<div>","<\/div>"]},ve=ar(r),oi=ve.appendChild(r.createElement("div"));e.optgroup=e.option;e.tbody=e.tfoot=e.colgroup=e.caption=e.thead;e.th=e.td;i.fn.extend({text:function(n){return i.access(this,function(n){return n===t?i.text(this):this.empty().append((this[0]&&this[0].ownerDocument||r).createTextNode(n))},null,n,arguments.length)},wrapAll:function(n){if(i.isFunction(n))return this.each(function(t){i(this).wrapAll(n.call(this,t))});if(this[0]){var t=i(n,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&t.insertBefore(this[0]);t.map(function(){for(var n=this;n.firstChild&&1===n.firstChild.nodeType;)n=n.firstChild;return n}).append(this)}return this},wrapInner:function(n){return i.isFunction(n)?this.each(function(t){i(this).wrapInner(n.call(this,t))}):this.each(function(){var t=i(this),r=t.contents();r.length?r.wrapAll(n):t.append(n)})},wrap:function(n){var t=i.isFunction(n);return this.each(function(r){i(this).wrapAll(t?n.call(this,r):n)})},unwrap:function(){return this.parent().each(function(){i.nodeName(this,"body")||i(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(n){(1===this.nodeType||11===this.nodeType||9===this.nodeType)&&this.appendChild(n)})},prepend:function(){return this.domManip(arguments,!0,function(n){(1===this.nodeType||11===this.nodeType||9===this.nodeType)&&this.insertBefore(n,this.firstChild)})},before:function(){return this.domManip(arguments,!1,function(n){this.parentNode&&this.parentNode.insertBefore(n,this)})},after:function(){return this.domManip(arguments,!1,function(n){this.parentNode&&this.parentNode.insertBefore(n,this.nextSibling)})},remove:function(n,t){for(var r,f=0;null!=(r=this[f]);f++)(!n||i.filter(n,[r]).length>0)&&(t||1!==r.nodeType||i.cleanData(u(r)),r.parentNode&&(t&&i.contains(r.ownerDocument,r)&&si(u(r,"script")),r.parentNode.removeChild(r)));return this},empty:function(){for(var n,t=0;null!=(n=this[t]);t++){for(1===n.nodeType&&i.cleanData(u(n,!1));n.firstChild;)n.removeChild(n.firstChild);n.options&&i.nodeName(n,"select")&&(n.options.length=0)}return this},clone:function(n,t){return n=null==n?!1:n,t=null==t?n:t,this.map(function(){return i.clone(this,n,t)})},html:function(n){return i.access(this,function(n){var r=this[0]||{},f=0,o=this.length;if(n===t)return 1===r.nodeType?r.innerHTML.replace(oe,""):t;if(!("string"!=typeof n||he.test(n)||!i.support.htmlSerialize&&yr.test(n)||!i.support.leadingWhitespace&&fi.test(n)||e[(wr.exec(n)||["",""])[1].toLowerCase()])){n=n.replace(pr,"<$1><\/$2>");try{for(;o>f;f++)r=this[f]||{},1===r.nodeType&&(i.cleanData(u(r,!1)),r.innerHTML=n);r=0}catch(s){}}r&&this.empty().append(n)},null,n,arguments.length)},replaceWith:function(n){var t=i.isFunction(n);return t||"string"==typeof n||(n=i(n).not(this).detach()),this.domManip([n],!0,function(n){var r=this.nextSibling,t=this.parentNode;t&&(i(this).remove(),t.insertBefore(n,r))})},detach:function(n){return this.remove(n,!0)},domManip:function(n,r,f){n=bi.apply([],n);var c,e,l,s,y,h,o=0,a=this.length,w=this,b=a-1,v=n[0],p=i.isFunction(v);if(p||!(1>=a||"string"!=typeof v||i.support.checkClone)&&ce.test(v))return this.each(function(i){var u=w.eq(i);p&&(n[0]=v.call(this,i,r?u.html():t));u.domManip(n,r,f)});if(a&&(h=i.buildFragment(n,this[0].ownerDocument,!1,this),c=h.firstChild,1===h.childNodes.length&&(h=c),c)){for(r=r&&i.nodeName(c,"tr"),s=i.map(u(h,"script"),dr),l=s.length;a>o;o++)e=h,o!==b&&(e=i.clone(e,!0,!0),l&&i.merge(s,u(e,"script"))),f.call(r&&i.nodeName(this[o],"table")?ye(this[o],"tbody"):this[o],e,o);if(l)for(y=s[s.length-1].ownerDocument,i.map(s,gr),o=0;l>o;o++)e=s[o],kr.test(e.type||"")&&!i._data(e,"globalEval")&&i.contains(y,e)&&(e.src?i.ajax({url:e.src,type:"GET",dataType:"script",async:!1,global:!1,throws:!0}):i.globalEval((e.text||e.textContent||e.innerHTML||"").replace(ae,"")));h=c=null}return this}});i.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(n,t){i.fn[n]=function(n){for(var u,r=0,f=[],e=i(n),o=e.length-1;o>=r;r++)u=r===o?this:this.clone(!0),i(e[r])[t](u),bt.apply(f,u.get());return this.pushStack(f)}});i.extend({clone:function(n,t,r){var f,h,o,e,s,c=i.contains(n.ownerDocument,n);if(i.support.html5Clone||i.isXMLDoc(n)||!yr.test("<"+n.nodeName+">")?o=n.cloneNode(!0):(oi.innerHTML=n.outerHTML,oi.removeChild(o=oi.firstChild)),!(i.support.noCloneEvent&&i.support.noCloneChecked||1!==n.nodeType&&11!==n.nodeType||i.isXMLDoc(n)))for(f=u(o),s=u(n),e=0;null!=(h=s[e]);++e)f[e]&&pe(h,f[e]);if(t)if(r)for(s=s||u(n),f=f||u(o),e=0;null!=(h=s[e]);e++)nu(h,f[e]);else nu(n,o);return f=u(o,"script"),f.length>0&&si(f,!c&&u(n,"script")),f=s=h=null,o},buildFragment:function(n,t,r,f){for(var h,o,w,s,y,p,l,b=n.length,a=ar(t),c=[],v=0;b>v;v++)if(o=n[v],o||0===o)if("object"===i.type(o))i.merge(c,o.nodeType?[o]:o);else if(se.test(o)){for(s=s||a.appendChild(t.createElement("div")),y=(wr.exec(o)||["",""])[1].toLowerCase(),l=e[y]||e._default,s.innerHTML=l[1]+o.replace(pr,"<$1><\/$2>")+l[2],h=l[0];h--;)s=s.lastChild;if(!i.support.leadingWhitespace&&fi.test(o)&&c.push(t.createTextNode(fi.exec(o)[0])),!i.support.tbody)for(o="table"!==y||br.test(o)?"<table>"!==l[1]||br.test(o)?0:s:s.firstChild,h=o&&o.childNodes.length;h--;)i.nodeName(p=o.childNodes[h],"tbody")&&!p.childNodes.length&&o.removeChild(p);for(i.merge(c,s.childNodes),s.textContent="";s.firstChild;)s.removeChild(s.firstChild);s=a.lastChild}else c.push(t.createTextNode(o));for(s&&a.removeChild(s),i.support.appendChecked||i.grep(u(c,"input"),we),v=0;o=c[v++];)if((!f||-1===i.inArray(o,f))&&(w=i.contains(o.ownerDocument,o),s=u(a.appendChild(o),"script"),w&&si(s),r))for(h=0;o=s[h++];)kr.test(o.type||"")&&r.push(o);return s=null,a},cleanData:function(n,t){for(var r,f,u,e,c=0,s=i.expando,h=i.cache,l=i.support.deleteExpando,a=i.event.special;null!=(r=n[c]);c++)if((t||i.acceptData(r))&&(u=r[s],e=u&&h[u])){if(e.events)for(f in e.events)a[f]?i.event.remove(r,f):i.removeEvent(r,f,e.handle);h[u]&&(delete h[u],l?delete r[s]:typeof r.removeAttribute!==o?r.removeAttribute(s):r[s]=null,b.push(u))}}});var rt,v,y,hi=/alpha\([^)]*\)/i,be=/opacity\s*=\s*([^)]*)/,ke=/^(top|right|bottom|left)$/,de=/^(none|table(?!-c[ea]).+)/,tu=/^margin/,ge=RegExp("^("+st+")(.*)$","i"),ct=RegExp("^("+st+")(?!px)[a-z%]+$","i"),no=RegExp("^([+-])=("+st+")","i"),iu={BODY:"block"},to={position:"absolute",visibility:"hidden",display:"block"},ru={letterSpacing:0,fontWeight:400},p=["Top","Right","Bottom","Left"],uu=["Webkit","O","Moz","ms"];i.fn.extend({css:function(n,r){return i.access(this,function(n,r,u){var e,o,s={},f=0;if(i.isArray(r)){for(o=v(n),e=r.length;e>f;f++)s[r[f]]=i.css(n,r[f],!1,o);return s}return u!==t?i.style(n,r,u):i.css(n,r)},n,r,arguments.length>1)},show:function(){return eu(this,!0)},hide:function(){return eu(this)},toggle:function(n){var t="boolean"==typeof n;return this.each(function(){(t?n:ut(this))?i(this).show():i(this).hide()})}});i.extend({cssHooks:{opacity:{get:function(n,t){if(t){var i=y(n,"opacity");return""===i?"1":i}}}},cssNumber:{columnCount:!0,fillOpacity:!0,fontWeight:!0,lineHeight:!0,opacity:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{float:i.support.cssFloat?"cssFloat":"styleFloat"},style:function(n,r,u,f){if(n&&3!==n.nodeType&&8!==n.nodeType&&n.style){var o,s,e,h=i.camelCase(r),c=n.style;if(r=i.cssProps[h]||(i.cssProps[h]=fu(c,h)),e=i.cssHooks[r]||i.cssHooks[h],u===t)return e&&"get"in e&&(o=e.get(n,!1,f))!==t?o:c[r];if(s=typeof u,"string"===s&&(o=no.exec(u))&&(u=(o[1]+1)*o[2]+parseFloat(i.css(n,r)),s="number"),!(null==u||"number"===s&&isNaN(u)||("number"!==s||i.cssNumber[h]||(u+="px"),i.support.clearCloneStyle||""!==u||0!==r.indexOf("background")||(c[r]="inherit"),e&&"set"in e&&(u=e.set(n,u,f))===t)))try{c[r]=u}catch(l){}}},css:function(n,r,u,f){var h,e,o,s=i.camelCase(r);return r=i.cssProps[s]||(i.cssProps[s]=fu(n.style,s)),o=i.cssHooks[r]||i.cssHooks[s],o&&"get"in o&&(e=o.get(n,!0,u)),e===t&&(e=y(n,r,f)),"normal"===e&&r in ru&&(e=ru[r]),""===u||u?(h=parseFloat(e),u===!0||i.isNumeric(h)?h||0:e):e},swap:function(n,t,i,r){var f,u,e={};for(u in t)e[u]=n.style[u],n.style[u]=t[u];f=i.apply(n,r||[]);for(u in t)n.style[u]=e[u];return f}});n.getComputedStyle?(v=function(t){return n.getComputedStyle(t,null)},y=function(n,r,u){var s,h,c,o=u||v(n),e=o?o.getPropertyValue(r)||o[r]:t,f=n.style;return o&&(""!==e||i.contains(n.ownerDocument,n)||(e=i.style(n,r)),ct.test(e)&&tu.test(r)&&(s=f.width,h=f.minWidth,c=f.maxWidth,f.minWidth=f.maxWidth=f.width=e,e=o.width,f.width=s,f.minWidth=h,f.maxWidth=c)),e}):r.documentElement.currentStyle&&(v=function(n){return n.currentStyle},y=function(n,i,r){var s,e,o,h=r||v(n),u=h?h[i]:t,f=n.style;return null==u&&f&&f[i]&&(u=f[i]),ct.test(u)&&!ke.test(i)&&(s=f.left,e=n.runtimeStyle,o=e&&e.left,o&&(e.left=n.currentStyle.left),f.left="fontSize"===i?"1em":u,u=f.pixelLeft+"px",f.left=s,o&&(e.left=o)),""===u?"auto":u});i.each(["height","width"],function(n,r){i.cssHooks[r]={get:function(n,u,f){return u?0===n.offsetWidth&&de.test(i.css(n,"display"))?i.swap(n,to,function(){return hu(n,r,f)}):hu(n,r,f):t},set:function(n,t,u){var f=u&&v(n);return ou(n,t,u?su(n,r,u,i.support.boxSizing&&"border-box"===i.css(n,"boxSizing",!1,f),f):0)}}});i.support.opacity||(i.cssHooks.opacity={get:function(n,t){return be.test((t&&n.currentStyle?n.currentStyle.filter:n.style.filter)||"")?.01*parseFloat(RegExp.$1)+"":t?"1":""},set:function(n,t){var r=n.style,u=n.currentStyle,e=i.isNumeric(t)?"alpha(opacity="+100*t+")":"",f=u&&u.filter||r.filter||"";r.zoom=1;(t>=1||""===t)&&""===i.trim(f.replace(hi,""))&&r.removeAttribute&&(r.removeAttribute("filter"),""===t||u&&!u.filter)||(r.filter=hi.test(f)?f.replace(hi,e):f+" "+e)}});i(function(){i.support.reliableMarginRight||(i.cssHooks.marginRight={get:function(n,r){return r?i.swap(n,{display:"inline-block"},y,[n,"marginRight"]):t}});!i.support.pixelPosition&&i.fn.position&&i.each(["top","left"],function(n,r){i.cssHooks[r]={get:function(n,u){return u?(u=y(n,r),ct.test(u)?i(n).position()[r]+"px":u):t}}})});i.expr&&i.expr.filters&&(i.expr.filters.hidden=function(n){return 0>=n.offsetWidth&&0>=n.offsetHeight||!i.support.reliableHiddenOffsets&&"none"===(n.style&&n.style.display||i.css(n,"display"))},i.expr.filters.visible=function(n){return!i.expr.filters.hidden(n)});i.each({margin:"",padding:"",border:"Width"},function(n,t){i.cssHooks[n+t]={expand:function(i){for(var r=0,f={},u="string"==typeof i?i.split(" "):[i];4>r;r++)f[n+p[r]+t]=u[r]||u[r-2]||u[0];return f}};tu.test(n)||(i.cssHooks[n+t].set=ou)});var io=/%20/g,ro=/\[\]$/,au=/\r?\n/g,uo=/^(?:submit|button|image|reset|file)$/i,fo=/^(?:input|select|textarea|keygen)/i;i.fn.extend({serialize:function(){return i.param(this.serializeArray())},serializeArray:function(){return this.map(function(){var n=i.prop(this,"elements");return n?i.makeArray(n):this}).filter(function(){var n=this.type;return this.name&&!i(this).is(":disabled")&&fo.test(this.nodeName)&&!uo.test(n)&&(this.checked||!ei.test(n))}).map(function(n,t){var r=i(this).val();return null==r?null:i.isArray(r)?i.map(r,function(n){return{name:t.name,value:n.replace(au,"\r\n")}}):{name:t.name,value:r.replace(au,"\r\n")}}).get()}});i.param=function(n,r){var u,f=[],e=function(n,t){t=i.isFunction(t)?t():null==t?"":t;f[f.length]=encodeURIComponent(n)+"="+encodeURIComponent(t)};if(r===t&&(r=i.ajaxSettings&&i.ajaxSettings.traditional),i.isArray(n)||n.jquery&&!i.isPlainObject(n))i.each(n,function(){e(this.name,this.value)});else for(u in n)ci(u,n[u],r,e);return f.join("&").replace(io,"+")};i.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error contextmenu".split(" "),function(n,t){i.fn[t]=function(n,i){return arguments.length>0?this.on(t,null,n,i):this.trigger(t)}});i.fn.hover=function(n,t){return this.mouseenter(n).mouseleave(t||n)};var w,c,li=i.now(),ai=/\?/,eo=/#.*$/,vu=/([?&])_=[^&]*/,oo=/^(.*?):[ \t]*([^\r\n]*)\r?$/gm,so=/^(?:GET|HEAD)$/,ho=/^\/\//,yu=/^([\w.+-]+:)(?:\/\/([^\/?#:]*)(?::(\d+)|)|)/,pu=i.fn.load,wu={},vi={},bu="*/".concat("*");try{c=ff.href}catch(go){c=r.createElement("a");c.href="";c=c.href}w=yu.exec(c.toLowerCase())||[];i.fn.load=function(n,r,u){if("string"!=typeof n&&pu)return pu.apply(this,arguments);var f,s,h,e=this,o=n.indexOf(" ");return o>=0&&(f=n.slice(o,n.length),n=n.slice(0,o)),i.isFunction(r)?(u=r,r=t):r&&"object"==typeof r&&(h="POST"),e.length>0&&i.ajax({url:n,type:h,dataType:"html",data:r}).done(function(n){s=arguments;e.html(f?i("<div>").append(i.parseHTML(n)).find(f):n)}).complete(u&&function(n,t){e.each(u,s||[n.responseText,t,n])}),this};i.each(["ajaxStart","ajaxStop","ajaxComplete","ajaxError","ajaxSuccess","ajaxSend"],function(n,t){i.fn[t]=function(n){return this.on(t,n)}});i.each(["get","post"],function(n,r){i[r]=function(n,u,f,e){return i.isFunction(u)&&(e=e||f,f=u,u=t),i.ajax({url:n,type:r,dataType:e,data:u,success:f})}});i.extend({active:0,lastModified:{},etag:{},ajaxSettings:{url:c,type:"GET",isLocal:/^(?:about|app|app-storage|.+-extension|file|res|widget):$/.test(w[1]),global:!0,processData:!0,async:!0,contentType:"application/x-www-form-urlencoded; charset=UTF-8",accepts:{"*":bu,text:"text/plain",html:"text/html",xml:"application/xml, text/xml",json:"application/json, text/javascript"},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":n.String,"text html":!0,"text json":i.parseJSON,"text xml":i.parseXML},flatOptions:{url:!0,context:!0}},ajaxSetup:function(n,t){return t?yi(yi(n,i.ajaxSettings),t):yi(i.ajaxSettings,n)},ajaxPrefilter:ku(wu),ajaxTransport:ku(vi),ajax:function(n,r){function k(n,r,s,c){var l,k,w,rt,p,a=r;2!==o&&(o=2,g&&clearTimeout(g),y=t,d=c||"",f.readyState=n>0?4:0,s&&(rt=co(u,f,s)),n>=200&&300>n||304===n?(u.ifModified&&(p=f.getResponseHeader("Last-Modified"),p&&(i.lastModified[e]=p),p=f.getResponseHeader("etag"),p&&(i.etag[e]=p)),204===n?(l=!0,a="nocontent"):304===n?(l=!0,a="notmodified"):(l=lo(u,rt),a=l.state,k=l.data,w=l.error,l=!w)):(w=a,(n||!a)&&(a="error",0>n&&(n=0))),f.status=n,f.statusText=(r||a)+"",l?tt.resolveWith(h,[k,a,f]):tt.rejectWith(h,[f,a,w]),f.statusCode(b),b=t,v&&nt.trigger(l?"ajaxSuccess":"ajaxError",[f,u,l?k:w]),it.fireWith(h,[f,a]),v&&(nt.trigger("ajaxComplete",[f,u]),--i.active||i.event.trigger("ajaxStop")))}"object"==typeof n&&(r=n,n=t);r=r||{};var l,a,e,d,g,v,y,p,u=i.ajaxSetup({},r),h=u.context||u,nt=u.context&&(h.nodeType||h.jquery)?i(h):i.event,tt=i.Deferred(),it=i.Callbacks("once memory"),b=u.statusCode||{},rt={},ut={},o=0,ft="canceled",f={readyState:0,getResponseHeader:function(n){var t;if(2===o){if(!p)for(p={};t=oo.exec(d);)p[t[1].toLowerCase()]=t[2];t=p[n.toLowerCase()]}return null==t?null:t},getAllResponseHeaders:function(){return 2===o?d:null},setRequestHeader:function(n,t){var i=n.toLowerCase();return o||(n=ut[i]=ut[i]||n,rt[n]=t),this},overrideMimeType:function(n){return o||(u.mimeType=n),this},statusCode:function(n){var t;if(n)if(2>o)for(t in n)b[t]=[b[t],n[t]];else f.always(n[f.status]);return this},abort:function(n){var t=n||ft;return y&&y.abort(t),k(0,t),this}};if(tt.promise(f).complete=it.add,f.success=f.done,f.error=f.fail,u.url=((n||u.url||c)+"").replace(eo,"").replace(ho,w[1]+"//"),u.type=r.method||r.type||u.method||u.type,u.dataTypes=i.trim(u.dataType||"*").toLowerCase().match(s)||[""],null==u.crossDomain&&(l=yu.exec(u.url.toLowerCase()),u.crossDomain=!(!l||l[1]===w[1]&&l[2]===w[2]&&(l[3]||("http:"===l[1]?80:443))==(w[3]||("http:"===w[1]?80:443)))),u.data&&u.processData&&"string"!=typeof u.data&&(u.data=i.param(u.data,u.traditional)),du(wu,u,r,f),2===o)return f;v=u.global;v&&0==i.active++&&i.event.trigger("ajaxStart");u.type=u.type.toUpperCase();u.hasContent=!so.test(u.type);e=u.url;u.hasContent||(u.data&&(e=u.url+=(ai.test(e)?"&":"?")+u.data,delete u.data),u.cache===!1&&(u.url=vu.test(e)?e.replace(vu,"$1_="+li++):e+(ai.test(e)?"&":"?")+"_="+li++));u.ifModified&&(i.lastModified[e]&&f.setRequestHeader("If-Modified-Since",i.lastModified[e]),i.etag[e]&&f.setRequestHeader("If-None-Match",i.etag[e]));(u.data&&u.hasContent&&u.contentType!==!1||r.contentType)&&f.setRequestHeader("Content-Type",u.contentType);f.setRequestHeader("Accept",u.dataTypes[0]&&u.accepts[u.dataTypes[0]]?u.accepts[u.dataTypes[0]]+("*"!==u.dataTypes[0]?", "+bu+"; q=0.01":""):u.accepts["*"]);for(a in u.headers)f.setRequestHeader(a,u.headers[a]);if(u.beforeSend&&(u.beforeSend.call(h,f,u)===!1||2===o))return f.abort();ft="abort";for(a in{success:1,error:1,complete:1})f[a](u[a]);if(y=du(vi,u,r,f)){f.readyState=1;v&&nt.trigger("ajaxSend",[f,u]);u.async&&u.timeout>0&&(g=setTimeout(function(){f.abort("timeout")},u.timeout));try{o=1;y.send(rt,k)}catch(et){if(!(2>o))throw et;k(-1,et)}}else k(-1,"No Transport");return f},getScript:function(n,r){return i.get(n,t,r,"script")},getJSON:function(n,t,r){return i.get(n,t,r,"json")}});i.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/(?:java|ecma)script/},converters:{"text script":function(n){return i.globalEval(n),n}}});i.ajaxPrefilter("script",function(n){n.cache===t&&(n.cache=!1);n.crossDomain&&(n.type="GET",n.global=!1)});i.ajaxTransport("script",function(n){if(n.crossDomain){var u,f=r.head||i("head")[0]||r.documentElement;return{send:function(t,i){u=r.createElement("script");u.async=!0;n.scriptCharset&&(u.charset=n.scriptCharset);u.src=n.url;u.onload=u.onreadystatechange=function(n,t){(t||!u.readyState||/loaded|complete/.test(u.readyState))&&(u.onload=u.onreadystatechange=null,u.parentNode&&u.parentNode.removeChild(u),u=null,t||i(200,"success"))};f.insertBefore(u,f.firstChild)},abort:function(){u&&u.onload(t,!0)}}}});pi=[];lt=/(=)\?(?=&|$)|\?\?/;i.ajaxSetup({jsonp:"callback",jsonpCallback:function(){var n=pi.pop()||i.expando+"_"+li++;return this[n]=!0,n}});i.ajaxPrefilter("json jsonp",function(r,u,f){var e,s,o,h=r.jsonp!==!1&&(lt.test(r.url)?"url":"string"==typeof r.data&&!(r.contentType||"").indexOf("application/x-www-form-urlencoded")&<.test(r.data)&&"data");return h||"jsonp"===r.dataTypes[0]?(e=r.jsonpCallback=i.isFunction(r.jsonpCallback)?r.jsonpCallback():r.jsonpCallback,h?r[h]=r[h].replace(lt,"$1"+e):r.jsonp!==!1&&(r.url+=(ai.test(r.url)?"&":"?")+r.jsonp+"="+e),r.converters["script json"]=function(){return o||i.error(e+" was not called"),o[0]},r.dataTypes[0]="json",s=n[e],n[e]=function(){o=arguments},f.always(function(){n[e]=s;r[e]&&(r.jsonpCallback=u.jsonpCallback,pi.push(e));o&&i.isFunction(s)&&s(o[0]);o=s=t}),"script"):t});gu=0;at=n.ActiveXObject&&function(){for(var n in g)g[n](t,!0)};i.ajaxSettings.xhr=n.ActiveXObject?function(){return!this.isLocal&&nf()||ao()}:nf;nt=i.ajaxSettings.xhr();i.support.cors=!!nt&&"withCredentials"in nt;nt=i.support.ajax=!!nt;nt&&i.ajaxTransport(function(r){if(!r.crossDomain||i.support.cors){var u;return{send:function(f,e){var h,s,o=r.xhr();if(r.username?o.open(r.type,r.url,r.async,r.username,r.password):o.open(r.type,r.url,r.async),r.xhrFields)for(s in r.xhrFields)o[s]=r.xhrFields[s];r.mimeType&&o.overrideMimeType&&o.overrideMimeType(r.mimeType);r.crossDomain||f["X-Requested-With"]||(f["X-Requested-With"]="XMLHttpRequest");try{for(s in f)o.setRequestHeader(s,f[s])}catch(c){}o.send(r.hasContent&&r.data||null);u=function(n,f){var s,a,l,c;try{if(u&&(f||4===o.readyState))if(u=t,h&&(o.onreadystatechange=i.noop,at&&delete g[h]),f)4!==o.readyState&&o.abort();else{c={};s=o.status;a=o.getAllResponseHeaders();"string"==typeof o.responseText&&(c.text=o.responseText);try{l=o.statusText}catch(y){l=""}s||!r.isLocal||r.crossDomain?1223===s&&(s=204):s=c.text?200:404}}catch(v){f||e(-1,v)}c&&e(s,l,c,a)};r.async?4===o.readyState?setTimeout(u):(h=++gu,at&&(g||(g={},i(n).unload(at)),g[h]=u),o.onreadystatechange=u):u()},abort:function(){u&&u(t,!0)}}}});var tt,vt,vo=/^(?:toggle|show|hide)$/,yo=RegExp("^(?:([+-])=|)("+st+")([a-z%]*)$","i"),po=/queueHooks$/,yt=[ko],ft={"*":[function(n,t){var o,s,r=this.createTween(n,t),e=yo.exec(t),h=r.cur(),u=+h||0,f=1,c=20;if(e){if(o=+e[2],s=e[3]||(i.cssNumber[n]?"":"px"),"px"!==s&&u){u=i.css(r.elem,n,!0)||o||1;do f=f||".5",u/=f,i.style(r.elem,n,u+s);while(f!==(f=r.cur()/h)&&1!==f&&--c)}r.unit=s;r.start=u;r.end=e[1]?u+(e[1]+1)*o:o}return r}]};i.Animation=i.extend(rf,{tweener:function(n,t){i.isFunction(n)?(t=n,n=["*"]):n=n.split(" ");for(var r,u=0,f=n.length;f>u;u++)r=n[u],ft[r]=ft[r]||[],ft[r].unshift(t)},prefilter:function(n,t){t?yt.unshift(n):yt.push(n)}});i.Tween=f;f.prototype={constructor:f,init:function(n,t,r,u,f,e){this.elem=n;this.prop=r;this.easing=f||"swing";this.options=t;this.start=this.now=this.cur();this.end=u;this.unit=e||(i.cssNumber[r]?"":"px")},cur:function(){var n=f.propHooks[this.prop];return n&&n.get?n.get(this):f.propHooks._default.get(this)},run:function(n){var r,t=f.propHooks[this.prop];return this.pos=r=this.options.duration?i.easing[this.easing](n,this.options.duration*n,0,1,this.options.duration):n,this.now=(this.end-this.start)*r+this.start,this.options.step&&this.options.step.call(this.elem,this.now,this),t&&t.set?t.set(this):f.propHooks._default.set(this),this}};f.prototype.init.prototype=f.prototype;f.propHooks={_default:{get:function(n){var t;return null==n.elem[n.prop]||n.elem.style&&null!=n.elem.style[n.prop]?(t=i.css(n.elem,n.prop,""),t&&"auto"!==t?t:0):n.elem[n.prop]},set:function(n){i.fx.step[n.prop]?i.fx.step[n.prop](n):n.elem.style&&(null!=n.elem.style[i.cssProps[n.prop]]||i.cssHooks[n.prop])?i.style(n.elem,n.prop,n.now+n.unit):n.elem[n.prop]=n.now}}};f.propHooks.scrollTop=f.propHooks.scrollLeft={set:function(n){n.elem.nodeType&&n.elem.parentNode&&(n.elem[n.prop]=n.now)}};i.each(["toggle","show","hide"],function(n,t){var r=i.fn[t];i.fn[t]=function(n,i,u){return null==n||"boolean"==typeof n?r.apply(this,arguments):this.animate(pt(t,!0),n,i,u)}});i.fn.extend({fadeTo:function(n,t,i,r){return this.filter(ut).css("opacity",0).show().end().animate({opacity:t},n,i,r)},animate:function(n,t,r,u){var o=i.isEmptyObject(n),e=i.speed(t,r,u),f=function(){var t=rf(this,i.extend({},n),e);f.finish=function(){t.stop(!0)};(o||i._data(this,"finish"))&&t.stop(!0)};return f.finish=f,o||e.queue===!1?this.each(f):this.queue(e.queue,f)},stop:function(n,r,u){var f=function(n){var t=n.stop;delete n.stop;t(u)};return"string"!=typeof n&&(u=r,r=n,n=t),r&&n!==!1&&this.queue(n||"fx",[]),this.each(function(){var o=!0,t=null!=n&&n+"queueHooks",e=i.timers,r=i._data(this);if(t)r[t]&&r[t].stop&&f(r[t]);else for(t in r)r[t]&&r[t].stop&&po.test(t)&&f(r[t]);for(t=e.length;t--;)e[t].elem!==this||null!=n&&e[t].queue!==n||(e[t].anim.stop(u),o=!1,e.splice(t,1));(o||!u)&&i.dequeue(this,n)})},finish:function(n){return n!==!1&&(n=n||"fx"),this.each(function(){var t,f=i._data(this),r=f[n+"queue"],e=f[n+"queueHooks"],u=i.timers,o=r?r.length:0;for(f.finish=!0,i.queue(this,n,[]),e&&e.cur&&e.cur.finish&&e.cur.finish.call(this),t=u.length;t--;)u[t].elem===this&&u[t].queue===n&&(u[t].anim.stop(!0),u.splice(t,1));for(t=0;o>t;t++)r[t]&&r[t].finish&&r[t].finish.call(this);delete f.finish})}});i.each({slideDown:pt("show"),slideUp:pt("hide"),slideToggle:pt("toggle"),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(n,t){i.fn[n]=function(n,i,r){return this.animate(t,n,i,r)}});i.speed=function(n,t,r){var u=n&&"object"==typeof n?i.extend({},n):{complete:r||!r&&t||i.isFunction(n)&&n,duration:n,easing:r&&t||t&&!i.isFunction(t)&&t};return u.duration=i.fx.off?0:"number"==typeof u.duration?u.duration:u.duration in i.fx.speeds?i.fx.speeds[u.duration]:i.fx.speeds._default,(null==u.queue||u.queue===!0)&&(u.queue="fx"),u.old=u.complete,u.complete=function(){i.isFunction(u.old)&&u.old.call(this);u.queue&&i.dequeue(this,u.queue)},u};i.easing={linear:function(n){return n},swing:function(n){return.5-Math.cos(n*Math.PI)/2}};i.timers=[];i.fx=f.prototype.init;i.fx.tick=function(){var u,n=i.timers,r=0;for(tt=i.now();n.length>r;r++)u=n[r],u()||n[r]!==u||n.splice(r--,1);n.length||i.fx.stop();tt=t};i.fx.timer=function(n){n()&&i.timers.push(n)&&i.fx.start()};i.fx.interval=13;i.fx.start=function(){vt||(vt=setInterval(i.fx.tick,i.fx.interval))};i.fx.stop=function(){clearInterval(vt);vt=null};i.fx.speeds={slow:600,fast:200,_default:400};i.fx.step={};i.expr&&i.expr.filters&&(i.expr.filters.animated=function(n){return i.grep(i.timers,function(t){return n===t.elem}).length});i.fn.offset=function(n){if(arguments.length)return n===t?this:this.each(function(t){i.offset.setOffset(this,n,t)});var r,e,f={top:0,left:0},u=this[0],s=u&&u.ownerDocument;if(s)return r=s.documentElement,i.contains(r,u)?(typeof u.getBoundingClientRect!==o&&(f=u.getBoundingClientRect()),e=uf(s),{top:f.top+(e.pageYOffset||r.scrollTop)-(r.clientTop||0),left:f.left+(e.pageXOffset||r.scrollLeft)-(r.clientLeft||0)}):f};i.offset={setOffset:function(n,t,r){var f=i.css(n,"position");"static"===f&&(n.style.position="relative");var e=i(n),o=e.offset(),l=i.css(n,"top"),a=i.css(n,"left"),v=("absolute"===f||"fixed"===f)&&i.inArray("auto",[l,a])>-1,u={},s={},h,c;v?(s=e.position(),h=s.top,c=s.left):(h=parseFloat(l)||0,c=parseFloat(a)||0);i.isFunction(t)&&(t=t.call(n,r,o));null!=t.top&&(u.top=t.top-o.top+h);null!=t.left&&(u.left=t.left-o.left+c);"using"in t?t.using.call(n,u):e.css(u)}};i.fn.extend({position:function(){if(this[0]){var n,r,t={top:0,left:0},u=this[0];return"fixed"===i.css(u,"position")?r=u.getBoundingClientRect():(n=this.offsetParent(),r=this.offset(),i.nodeName(n[0],"html")||(t=n.offset()),t.top+=i.css(n[0],"borderTopWidth",!0),t.left+=i.css(n[0],"borderLeftWidth",!0)),{top:r.top-t.top-i.css(u,"marginTop",!0),left:r.left-t.left-i.css(u,"marginLeft",!0)}}},offsetParent:function(){return this.map(function(){for(var n=this.offsetParent||r.documentElement;n&&!i.nodeName(n,"html")&&"static"===i.css(n,"position");)n=n.offsetParent;return n||r.documentElement})}});i.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(n,r){var u=/Y/.test(r);i.fn[n]=function(f){return i.access(this,function(n,f,e){var o=uf(n);return e===t?o?r in o?o[r]:o.document.documentElement[f]:n[f]:(o?o.scrollTo(u?i(o).scrollLeft():e,u?e:i(o).scrollTop()):n[f]=e,t)},n,f,arguments.length,null)}});i.each({Height:"height",Width:"width"},function(n,r){i.each({padding:"inner"+n,content:r,"":"outer"+n},function(u,f){i.fn[f]=function(f,e){var o=arguments.length&&(u||"boolean"!=typeof f),s=u||(f===!0||e===!0?"margin":"border");return i.access(this,function(r,u,f){var e;return i.isWindow(r)?r.document.documentElement["client"+n]:9===r.nodeType?(e=r.documentElement,Math.max(r.body["scroll"+n],e["scroll"+n],r.body["offset"+n],e["offset"+n],e["client"+n])):f===t?i.css(r,u,s):i.style(r,u,f,s)},r,o?f:t,o,null)}})});n.jQuery=n.$=i;"function"==typeof define&&define.amd&&define.amd.jQuery&&define("jquery",[],function(){return i})})(window),function(n){function i(n,t){for(var i=window,r=(n||"").split(".");i&&r.length;)i=i[r.shift()];return typeof i=="function"?i:(t.push(n),Function.constructor.apply(null,t))}function r(n){return n==="GET"||n==="POST"}function e(n,t){r(t)||n.setRequestHeader("X-HTTP-Method-Override",t)}function o(t,i,r){var u;r.indexOf("application/x-javascript")===-1&&(u=(t.getAttribute("data-ajax-mode")||"").toUpperCase(),n(t.getAttribute("data-ajax-update")).each(function(t,r){var f;switch(u){case"BEFORE":f=r.firstChild;n("<div />").html(i).contents().each(function(){r.insertBefore(this,f)});break;case"AFTER":n("<div />").html(i).contents().each(function(){r.appendChild(this)});break;default:n(r).html(i)}}))}function u(t,u){var s,h,f,c;(s=t.getAttribute("data-ajax-confirm"),!s||window.confirm(s))&&(h=n(t.getAttribute("data-ajax-loading")),c=t.getAttribute("data-ajax-loading-duration")||0,n.extend(u,{type:t.getAttribute("data-ajax-method")||undefined,url:t.getAttribute("data-ajax-url")||undefined,beforeSend:function(n){var r;return e(n,f),r=i(t.getAttribute("data-ajax-begin"),["xhr"]).apply(this,arguments),r!==!1&&h.show(c),r},complete:function(){h.hide(c);i(t.getAttribute("data-ajax-complete"),["xhr","status"]).apply(this,arguments)},success:function(n,r,u){o(t,n,u.getResponseHeader("Content-Type")||"text/html");i(t.getAttribute("data-ajax-success"),["data","status","xhr"]).apply(this,arguments)},error:i(t.getAttribute("data-ajax-failure"),["xhr","status","error"])}),u.data.push({name:"X-Requested-With",value:"XMLHttpRequest"}),f=u.type.toUpperCase(),r(f)||(u.type="POST",u.data.push({name:"X-HTTP-Method-Override",value:f})),n.ajax(u))}function s(t){var i=n(t).data(f);return!i||!i.validate||i.validate()}var t="unobtrusiveAjaxClick",f="unobtrusiveValidation";n(document).on("click","a[data-ajax=true]",function(n){n.preventDefault();u(this,{url:this.href,type:"GET",data:[]})});n(document).on("click","form[data-ajax=true] input[type=image]",function(i){var r=i.target.name,u=n(i.target),f=u.parents("form")[0],e=u.offset();n(f).data(t,[{name:r+".x",value:Math.round(i.pageX-e.left)},{name:r+".y",value:Math.round(i.pageY-e.top)}]);setTimeout(function(){n(f).removeData(t)},0)});n(document).on("click","form[data-ajax=true] :submit",function(i){var r=i.target.name,u=n(i.target).parents("form")[0];n(u).data(t,r?[{name:r,value:i.target.value}]:[]);setTimeout(function(){n(u).removeData(t)},0)});n(document).on("submit","form[data-ajax=true]",function(i){var r=n(this).data(t)||[];(i.preventDefault(),s(this))&&u(this,{url:this.action,type:this.method||"GET",data:r.concat(n(this).serializeArray())})})}(jQuery),function(n){n.extend(n.fn,{validate:function(t){if(!this.length)return t&&t.debug&&window.console&&console.warn("Nothing selected, can't validate, returning nothing."),void 0;var i=n.data(this[0],"validator");return i?i:(this.attr("novalidate","novalidate"),i=new n.validator(t,this[0]),n.data(this[0],"validator",i),i.settings.onsubmit&&(this.validateDelegate(":submit","click",function(t){i.settings.submitHandler&&(i.submitButton=t.target);n(t.target).hasClass("cancel")&&(i.cancelSubmit=!0);void 0!==n(t.target).attr("formnovalidate")&&(i.cancelSubmit=!0)}),this.submit(function(t){function r(){var r;return i.settings.submitHandler?(i.submitButton&&(r=n("<input type='hidden'/>").attr("name",i.submitButton.name).val(n(i.submitButton).val()).appendTo(i.currentForm)),i.settings.submitHandler.call(i,i.currentForm,t),i.submitButton&&r.remove(),!1):!0}return i.settings.debug&&t.preventDefault(),i.cancelSubmit?(i.cancelSubmit=!1,r()):i.form()?i.pendingRequest?(i.formSubmitted=!0,!1):r():(i.focusInvalid(),!1)})),i)},valid:function(){if(n(this[0]).is("form"))return this.validate().form();var t=!0,i=n(this[0].form).validate();return this.each(function(){t=t&&i.element(this)}),t},removeAttrs:function(t){var i={},r=this;return n.each(t.split(/\s/),function(n,t){i[t]=r.attr(t);r.removeAttr(t)}),i},rules:function(t,i){var r=this[0],o,u,h;if(t){var e=n.data(r.form,"validator").settings,s=e.rules,f=n.validator.staticRules(r);switch(t){case"add":n.extend(f,n.validator.normalizeRule(i));delete f.messages;s[r.name]=f;i.messages&&(e.messages[r.name]=n.extend(e.messages[r.name],i.messages));break;case"remove":return i?(o={},n.each(i.split(/\s/),function(n,t){o[t]=f[t];delete f[t]}),o):(delete s[r.name],f)}}return u=n.validator.normalizeRules(n.extend({},n.validator.classRules(r),n.validator.attributeRules(r),n.validator.dataRules(r),n.validator.staticRules(r)),r),u.required&&(h=u.required,delete u.required,u=n.extend({required:h},u)),u}});n.extend(n.expr[":"],{blank:function(t){return!n.trim(""+n(t).val())},filled:function(t){return!!n.trim(""+n(t).val())},unchecked:function(t){return!n(t).prop("checked")}});n.validator=function(t,i){this.settings=n.extend(!0,{},n.validator.defaults,t);this.currentForm=i;this.init()};n.validator.format=function(t,i){return 1===arguments.length?function(){var i=n.makeArray(arguments);return i.unshift(t),n.validator.format.apply(this,i)}:(arguments.length>2&&i.constructor!==Array&&(i=n.makeArray(arguments).slice(1)),i.constructor!==Array&&(i=[i]),n.each(i,function(n,i){t=t.replace(RegExp("\\{"+n+"\\}","g"),function(){return i})}),t)};n.extend(n.validator,{defaults:{messages:{},groups:{},rules:{},errorClass:"error",validClass:"valid",errorElement:"label",focusInvalid:!0,errorContainer:n([]),errorLabelContainer:n([]),onsubmit:!0,ignore:":hidden",ignoreTitle:!1,onfocusin:function(n){this.lastActive=n;this.settings.focusCleanup&&!this.blockFocusCleanup&&(this.settings.unhighlight&&this.settings.unhighlight.call(this,n,this.settings.errorClass,this.settings.validClass),this.addWrapper(this.errorsFor(n)).hide())},onfocusout:function(n){!this.checkable(n)&&(n.name in this.submitted||!this.optional(n))&&this.element(n)},onkeyup:function(n,t){(9!==t.which||""!==this.elementValue(n))&&(n.name in this.submitted||n===this.lastElement)&&this.element(n)},onclick:function(n){n.name in this.submitted?this.element(n):n.parentNode.name in this.submitted&&this.element(n.parentNode)},highlight:function(t,i,r){"radio"===t.type?this.findByName(t.name).addClass(i).removeClass(r):n(t).addClass(i).removeClass(r)},unhighlight:function(t,i,r){"radio"===t.type?this.findByName(t.name).removeClass(i).addClass(r):n(t).removeClass(i).addClass(r)}},setDefaults:function(t){n.extend(n.validator.defaults,t)},messages:{required:"This field is required.",remote:"Please fix this field.",email:"Please enter a valid email address.",url:"Please enter a valid URL.",date:"Please enter a valid date.",dateISO:"Please enter a valid date (ISO).",number:"Please enter a valid number.",digits:"Please enter only digits.",creditcard:"Please enter a valid credit card number.",equalTo:"Please enter the same value again.",maxlength:n.validator.format("Please enter no more than {0} characters."),minlength:n.validator.format("Please enter at least {0} characters."),rangelength:n.validator.format("Please enter a value between {0} and {1} characters long."),range:n.validator.format("Please enter a value between {0} and {1}."),max:n.validator.format("Please enter a value less than or equal to {0}."),min:n.validator.format("Please enter a value greater than or equal to {0}.")},autoCreateRanges:!1,prototype:{init:function(){function i(t){var i=n.data(this[0].form,"validator"),r="on"+t.type.replace(/^validate/,"");i.settings[r]&&i.settings[r].call(i,this[0],t)}var r,t;this.labelContainer=n(this.settings.errorLabelContainer);this.errorContext=this.labelContainer.length&&this.labelContainer||n(this.currentForm);this.containers=n(this.settings.errorContainer).add(this.settings.errorLabelContainer);this.submitted={};this.valueCache={};this.pendingRequest=0;this.pending={};this.invalid={};this.reset();r=this.groups={};n.each(this.settings.groups,function(t,i){"string"==typeof i&&(i=i.split(/\s/));n.each(i,function(n,i){r[i]=t})});t=this.settings.rules;n.each(t,function(i,r){t[i]=n.validator.normalizeRule(r)});n(this.currentForm).validateDelegate(":text, [type='password'], [type='file'], select, textarea, [type='number'], [type='search'] ,[type='tel'], [type='url'], [type='email'], [type='datetime'], [type='date'], [type='month'], [type='week'], [type='time'], [type='datetime-local'], [type='range'], [type='color'] ","focusin focusout keyup",i).validateDelegate("[type='radio'], [type='checkbox'], select, option","click",i);this.settings.invalidHandler&&n(this.currentForm).bind("invalid-form.validate",this.settings.invalidHandler)},form:function(){return this.checkForm(),n.extend(this.submitted,this.errorMap),this.invalid=n.extend({},this.errorMap),this.valid()||n(this.currentForm).triggerHandler("invalid-form",[this]),this.showErrors(),this.valid()},checkForm:function(){this.prepareForm();for(var n=0,t=this.currentElements=this.elements();t[n];n++)this.check(t[n]);return this.valid()},element:function(t){t=this.validationTargetFor(this.clean(t));this.lastElement=t;this.prepareElement(t);this.currentElements=n(t);var i=this.check(t)!==!1;return i?delete this.invalid[t.name]:this.invalid[t.name]=!0,this.numberOfInvalids()||(this.toHide=this.toHide.add(this.containers)),this.showErrors(),i},showErrors:function(t){if(t){n.extend(this.errorMap,t);this.errorList=[];for(var i in t)this.errorList.push({message:t[i],element:this.findByName(i)[0]});this.successList=n.grep(this.successList,function(n){return!(n.name in t)})}this.settings.showErrors?this.settings.showErrors.call(this,this.errorMap,this.errorList):this.defaultShowErrors()},resetForm:function(){n.fn.resetForm&&n(this.currentForm).resetForm();this.submitted={};this.lastElement=null;this.prepareForm();this.hideErrors();this.elements().removeClass(this.settings.errorClass).removeData("previousValue")},numberOfInvalids:function(){return this.objectLength(this.invalid)},objectLength:function(n){var t=0;for(var i in n)t++;return t},hideErrors:function(){this.addWrapper(this.toHide).hide()},valid:function(){return 0===this.size()},size:function(){return this.errorList.length},focusInvalid:function(){if(this.settings.focusInvalid)try{n(this.findLastActive()||this.errorList.length&&this.errorList[0].element||[]).filter(":visible").focus().trigger("focusin")}catch(t){}},findLastActive:function(){var t=this.lastActive;return t&&1===n.grep(this.errorList,function(n){return n.element.name===t.name}).length&&t},elements:function(){var t=this,i={};return n(this.currentForm).find("input, select, textarea").not(":submit, :reset, :image, [disabled]").not(this.settings.ignore).filter(function(){return!this.name&&t.settings.debug&&window.console&&console.error("%o has no name assigned",this),this.name in i||!t.objectLength(n(this).rules())?!1:(i[this.name]=!0,!0)})},clean:function(t){return n(t)[0]},errors:function(){var t=this.settings.errorClass.replace(" ",".");return n(this.settings.errorElement+"."+t,this.errorContext)},reset:function(){this.successList=[];this.errorList=[];this.errorMap={};this.toShow=n([]);this.toHide=n([]);this.currentElements=n([])},prepareForm:function(){this.reset();this.toHide=this.errors().add(this.containers)},prepareElement:function(n){this.reset();this.toHide=this.errorsFor(n)},elementValue:function(t){var r=n(t).attr("type"),i=n(t).val();return"radio"===r||"checkbox"===r?n("input[name='"+n(t).attr("name")+"']:checked").val():"string"==typeof i?i.replace(/\r/g,""):i},check:function(t){var r,u;t=this.validationTargetFor(this.clean(t));var i,f=n(t).rules(),e=!1,s=this.elementValue(t);for(r in f){u={method:r,parameters:f[r]};try{if(i=n.validator.methods[r].call(this,s,t,u.parameters),"dependency-mismatch"===i){e=!0;continue}if(e=!1,"pending"===i)return this.toHide=this.toHide.not(this.errorsFor(t)),void 0;if(!i)return this.formatAndAdd(t,u),!1}catch(o){throw this.settings.debug&&window.console&&console.log("Exception occurred when checking element "+t.id+", check the '"+u.method+"' method.",o),o;}}if(!e)return(this.objectLength(f)&&this.successList.push(t),!0)},customDataMessage:function(t,i){return n(t).data("msg-"+i.toLowerCase())||t.attributes&&n(t).attr("data-msg-"+i.toLowerCase())},customMessage:function(n,t){var i=this.settings.messages[n];return i&&(i.constructor===String?i:i[t])},findDefined:function(){for(var n=0;arguments.length>n;n++)if(void 0!==arguments[n])return arguments[n];return void 0},defaultMessage:function(t,i){return this.findDefined(this.customMessage(t.name,i),this.customDataMessage(t,i),!this.settings.ignoreTitle&&t.title||void 0,n.validator.messages[i],"<strong>Warning: No message defined for "+t.name+"<\/strong>")},formatAndAdd:function(t,i){var r=this.defaultMessage(t,i.method),u=/\$?\{(\d+)\}/g;"function"==typeof r?r=r.call(this,i.parameters,t):u.test(r)&&(r=n.validator.format(r.replace(u,"{$1}"),i.parameters));this.errorList.push({message:r,element:t});this.errorMap[t.name]=r;this.submitted[t.name]=r},addWrapper:function(n){return this.settings.wrapper&&(n=n.add(n.parent(this.settings.wrapper))),n},defaultShowErrors:function(){for(var i,t,n=0;this.errorList[n];n++)t=this.errorList[n],this.settings.highlight&&this.settings.highlight.call(this,t.element,this.settings.errorClass,this.settings.validClass),this.showLabel(t.element,t.message);if(this.errorList.length&&(this.toShow=this.toShow.add(this.containers)),this.settings.success)for(n=0;this.successList[n];n++)this.showLabel(this.successList[n]);if(this.settings.unhighlight)for(n=0,i=this.validElements();i[n];n++)this.settings.unhighlight.call(this,i[n],this.settings.errorClass,this.settings.validClass);this.toHide=this.toHide.not(this.toShow);this.hideErrors();this.addWrapper(this.toShow).show()},validElements:function(){return this.currentElements.not(this.invalidElements())},invalidElements:function(){return n(this.errorList).map(function(){return this.element})},showLabel:function(t,i){var r=this.errorsFor(t);r.length?(r.removeClass(this.settings.validClass).addClass(this.settings.errorClass),r.html(i)):(r=n("<"+this.settings.errorElement+">").attr("for",this.idOrName(t)).addClass(this.settings.errorClass).html(i||""),this.settings.wrapper&&(r=r.hide().show().wrap("<"+this.settings.wrapper+"/>").parent()),this.labelContainer.append(r).length||(this.settings.errorPlacement?this.settings.errorPlacement(r,n(t)):r.insertAfter(t)));!i&&this.settings.success&&(r.text(""),"string"==typeof this.settings.success?r.addClass(this.settings.success):this.settings.success(r,t));this.toShow=this.toShow.add(r)},errorsFor:function(t){var i=this.idOrName(t);return this.errors().filter(function(){return n(this).attr("for")===i})},idOrName:function(n){return this.groups[n.name]||(this.checkable(n)?n.name:n.id||n.name)},validationTargetFor:function(n){return this.checkable(n)&&(n=this.findByName(n.name).not(this.settings.ignore)[0]),n},checkable:function(n){return/radio|checkbox/i.test(n.type)},findByName:function(t){return n(this.currentForm).find("[name='"+t+"']")},getLength:function(t,i){switch(i.nodeName.toLowerCase()){case"select":return n("option:selected",i).length;case"input":if(this.checkable(i))return this.findByName(i.name).filter(":checked").length}return t.length},depend:function(n,t){return this.dependTypes[typeof n]?this.dependTypes[typeof n](n,t):!0},dependTypes:{boolean:function(n){return n},string:function(t,i){return!!n(t,i.form).length},"function":function(n,t){return n(t)}},optional:function(t){var i=this.elementValue(t);return!n.validator.methods.required.call(this,i,t)&&"dependency-mismatch"},startRequest:function(n){this.pending[n.name]||(this.pendingRequest++,this.pending[n.name]=!0)},stopRequest:function(t,i){this.pendingRequest--;0>this.pendingRequest&&(this.pendingRequest=0);delete this.pending[t.name];i&&0===this.pendingRequest&&this.formSubmitted&&this.form()?(n(this.currentForm).submit(),this.formSubmitted=!1):!i&&0===this.pendingRequest&&this.formSubmitted&&(n(this.currentForm).triggerHandler("invalid-form",[this]),this.formSubmitted=!1)},previousValue:function(t){return n.data(t,"previousValue")||n.data(t,"previousValue",{old:null,valid:!0,message:this.defaultMessage(t,"remote")})}},classRuleSettings:{required:{required:!0},email:{email:!0},url:{url:!0},date:{date:!0},dateISO:{dateISO:!0},number:{number:!0},digits:{digits:!0},creditcard:{creditcard:!0}},addClassRules:function(t,i){t.constructor===String?this.classRuleSettings[t]=i:n.extend(this.classRuleSettings,t)},classRules:function(t){var i={},r=n(t).attr("class");return r&&n.each(r.split(" "),function(){this in n.validator.classRuleSettings&&n.extend(i,n.validator.classRuleSettings[this])}),i},attributeRules:function(t){var u={},e=n(t),f=e[0].getAttribute("type"),r,i;for(r in n.validator.methods)"required"===r?(i=e.get(0).getAttribute(r),""===i&&(i=!0),i=!!i):i=e.attr(r),/min|max/.test(r)&&(null===f||/number|range|text/.test(f))&&(i=Number(i)),i?u[r]=i:f===r&&"range"!==f&&(u[r]=!0);return u.maxlength&&/-1|2147483647|524288/.test(u.maxlength)&&delete u.maxlength,u},dataRules:function(t){var i,r,u={},f=n(t);for(i in n.validator.methods)r=f.data("rule-"+i.toLowerCase()),void 0!==r&&(u[i]=r);return u},staticRules:function(t){var i={},r=n.data(t.form,"validator");return r.settings.rules&&(i=n.validator.normalizeRule(r.settings.rules[t.name])||{}),i},normalizeRules:function(t,i){return n.each(t,function(r,u){if(u===!1)return delete t[r],void 0;if(u.param||u.depends){var f=!0;switch(typeof u.depends){case"string":f=!!n(u.depends,i.form).length;break;case"function":f=u.depends.call(i,i)}f?t[r]=void 0!==u.param?u.param:!0:delete t[r]}}),n.each(t,function(r,u){t[r]=n.isFunction(u)?u(i):u}),n.each(["minlength","maxlength"],function(){t[this]&&(t[this]=Number(t[this]))}),n.each(["rangelength","range"],function(){var i;t[this]&&(n.isArray(t[this])?t[this]=[Number(t[this][0]),Number(t[this][1])]:"string"==typeof t[this]&&(i=t[this].split(/[\s,]+/),t[this]=[Number(i[0]),Number(i[1])]))}),n.validator.autoCreateRanges&&(t.min&&t.max&&(t.range=[t.min,t.max],delete t.min,delete t.max),t.minlength&&t.maxlength&&(t.rangelength=[t.minlength,t.maxlength],delete t.minlength,delete t.maxlength)),t},normalizeRule:function(t){if("string"==typeof t){var i={};n.each(t.split(/\s/),function(){i[this]=!0});t=i}return t},addMethod:function(t,i,r){n.validator.methods[t]=i;n.validator.messages[t]=void 0!==r?r:n.validator.messages[t];3>i.length&&n.validator.addClassRules(t,n.validator.normalizeRule(t))},methods:{required:function(t,i,r){if(!this.depend(r,i))return"dependency-mismatch";if("select"===i.nodeName.toLowerCase()){var u=n(i).val();return u&&u.length>0}return this.checkable(i)?this.getLength(t,i)>0:n.trim(t).length>0},email:function(n,t){return this.optional(t)||/^((([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+(\.([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+)*)|((\x22)((((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(([\x01-\x08\x0b\x0c\x0e-\x1f\x7f]|\x21|[\x23-\x5b]|[\x5d-\x7e]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(\\([\x01-\x09\x0b\x0c\x0d-\x7f]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]))))*(((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(\x22)))@((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))$/i.test(n)},url:function(n,t){return this.optional(t)||/^(https?|s?ftp):\/\/(((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:)*@)?(((\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5]))|((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?)(:\d*)?)(\/((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)+(\/(([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)*)*)?)?(\?((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|[\uE000-\uF8FF]|\/|\?)*)?(#((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|\/|\?)*)?$/i.test(n)},date:function(n,t){return this.optional(t)||!/Invalid|NaN/.test(""+new Date(n))},dateISO:function(n,t){return this.optional(t)||/^\d{4}[\/\-]\d{1,2}[\/\-]\d{1,2}$/.test(n)},number:function(n,t){return this.optional(t)||/^-?(?:\d+|\d{1,3}(?:,\d{3})+)?(?:\.\d+)?$/.test(n)},digits:function(n,t){return this.optional(t)||/^\d+$/.test(n)},creditcard:function(n,t){var r,e;if(this.optional(t))return"dependency-mismatch";if(/[^0-9 \-]+/.test(n))return!1;var f=0,i=0,u=!1;for(n=n.replace(/\D/g,""),r=n.length-1;r>=0;r--)e=n.charAt(r),i=parseInt(e,10),u&&(i*=2)>9&&(i-=9),f+=i,u=!u;return 0==f%10},minlength:function(t,i,r){var u=n.isArray(t)?t.length:this.getLength(n.trim(t),i);return this.optional(i)||u>=r},maxlength:function(t,i,r){var u=n.isArray(t)?t.length:this.getLength(n.trim(t),i);return this.optional(i)||r>=u},rangelength:function(t,i,r){var u=n.isArray(t)?t.length:this.getLength(n.trim(t),i);return this.optional(i)||u>=r[0]&&r[1]>=u},min:function(n,t,i){return this.optional(t)||n>=i},max:function(n,t,i){return this.optional(t)||i>=n},range:function(n,t,i){return this.optional(t)||n>=i[0]&&i[1]>=n},equalTo:function(t,i,r){var u=n(r);return this.settings.onfocusout&&u.unbind(".validate-equalTo").bind("blur.validate-equalTo",function(){n(i).valid()}),t===u.val()},remote:function(t,i,r){var f,u,e;return this.optional(i)?"dependency-mismatch":(f=this.previousValue(i),this.settings.messages[i.name]||(this.settings.messages[i.name]={}),f.originalMessage=this.settings.messages[i.name].remote,this.settings.messages[i.name].remote=f.message,r="string"==typeof r&&{url:r}||r,f.old===t)?f.valid:(f.old=t,u=this,this.startRequest(i),e={},e[i.name]=t,n.ajax(n.extend(!0,{url:r,mode:"abort",port:"validate"+i.name,dataType:"json",data:e,success:function(r){var e,h,s,o;u.settings.messages[i.name].remote=f.originalMessage;e=r===!0||"true"===r;e?(h=u.formSubmitted,u.prepareElement(i),u.formSubmitted=h,u.successList.push(i),delete u.invalid[i.name],u.showErrors()):(s={},o=r||u.defaultMessage(i,"remote"),s[i.name]=f.message=n.isFunction(o)?o(t):o,u.invalid[i.name]=!0,u.showErrors(s));f.valid=e;u.stopRequest(i,e)}},r)),"pending")}}});n.format=n.validator.format}(jQuery),function(n){var t={},i;n.ajaxPrefilter?n.ajaxPrefilter(function(n,i,r){var u=n.port;"abort"===n.mode&&(t[u]&&t[u].abort(),t[u]=r)}):(i=n.ajax,n.ajax=function(r){var f=("mode"in r?r:n.ajaxSettings).mode,u=("port"in r?r:n.ajaxSettings).port;return"abort"===f?(t[u]&&t[u].abort(),t[u]=i.apply(this,arguments),t[u]):i.apply(this,arguments)})}(jQuery),function(n){n.extend(n.fn,{validateDelegate:function(t,i,r){return this.bind(i,function(i){var u=n(i.target);if(u.is(t))return r.apply(u,arguments)})}})}(jQuery),function(n){function i(n,t,i){n.rules[t]=i;n.message&&(n.messages[t]=n.message)}function h(n){return n.replace(/^\s+|\s+$/g,"").split(/\s*,\s*/g)}function f(n){return n.replace(/([!"#$%&'()*+,./:;<=>?@\[\\\]^`{|}~])/g,"\\$1")}function e(n){return n.substr(0,n.lastIndexOf(".")+1)}function o(n,t){return n.indexOf("*.")===0&&(n=n.replace("*.",t)),n}function c(t,i){var r=n(this).find("[data-valmsg-for='"+f(i[0].name)+"']"),u=r.attr("data-valmsg-replace"),e=u?n.parseJSON(u)!==!1:null;r.removeClass("field-validation-valid").addClass("field-validation-error");t.data("unobtrusiveContainer",r);e?(r.empty(),t.removeClass("input-validation-error").appendTo(r)):t.hide()}function l(t,i){var u=n(this).find("[data-valmsg-summary=true]"),r=u.find("ul");r&&r.length&&i.errorList.length&&(r.empty(),u.addClass("validation-summary-errors").removeClass("validation-summary-valid"),n.each(i.errorList,function(){n("<li />").html(this.message).appendTo(r)}))}function a(t){var i=t.data("unobtrusiveContainer"),r=i.attr("data-valmsg-replace"),u=r?n.parseJSON(r):null;i&&(i.addClass("field-validation-valid").removeClass("field-validation-error"),t.removeData("unobtrusiveContainer"),u&&i.empty())}function v(){var t=n(this);t.data("validator").resetForm();t.find(".validation-summary-errors").addClass("validation-summary-valid").removeClass("validation-summary-errors");t.find(".field-validation-error").addClass("field-validation-valid").removeClass("field-validation-error").removeData("unobtrusiveContainer").find(">*").removeData("unobtrusiveContainer")}function s(t){var i=n(t),r=i.data(u),f=n.proxy(v,t);return r||(r={options:{errorClass:"input-validation-error",errorElement:"span",errorPlacement:n.proxy(c,t),invalidHandler:n.proxy(l,t),messages:{},rules:{},success:n.proxy(a,t)},attachValidation:function(){i.unbind("reset."+u,f).bind("reset."+u,f).validate(this.options)},validate:function(){return i.validate(),i.valid()}},i.data(u,r)),r}var r=n.validator,t,u="unobtrusiveValidation";r.unobtrusive={adapters:[],parseElement:function(t,i){var u=n(t),f=u.parents("form")[0],r,e,o;f&&(r=s(f),r.options.rules[t.name]=e={},r.options.messages[t.name]=o={},n.each(this.adapters,function(){var i="data-val-"+this.name,r=u.attr(i),s={};r!==undefined&&(i+="-",n.each(this.params,function(){s[this]=u.attr(i+this)}),this.adapt({element:t,form:f,message:r,params:s,rules:e,messages:o}))}),n.extend(e,{__dummy__:!0}),i||r.attachValidation())},parse:function(t){var i=n(t).parents("form").andSelf().add(n(t).find("form")).filter("form");n(t).find(":input[data-val=true]").each(function(){r.unobtrusive.parseElement(this,!0)});i.each(function(){var n=s(this);n&&n.attachValidation()})}};t=r.unobtrusive.adapters;t.add=function(n,t,i){return i||(i=t,t=[]),this.push({name:n,params:t,adapt:i}),this};t.addBool=function(n,t){return this.add(n,function(r){i(r,t||n,!0)})};t.addMinMax=function(n,t,r,u,f,e){return this.add(n,[f||"min",e||"max"],function(n){var f=n.params.min,e=n.params.max;f&&e?i(n,u,[f,e]):f?i(n,t,f):e&&i(n,r,e)})};t.addSingleVal=function(n,t,r){return this.add(n,[t||"val"],function(u){i(u,r||n,u.params[t])})};r.addMethod("__dummy__",function(){return!0});r.addMethod("regex",function(n,t,i){var r;return this.optional(t)?!0:(r=new RegExp(i).exec(n),r&&r.index===0&&r[0].length===n.length)});r.addMethod("nonalphamin",function(n,t,i){var r;return i&&(r=n.match(/\W/g),r=r&&r.length>=i),r});t.addSingleVal("accept","exts").addSingleVal("regex","pattern");t.addBool("creditcard").addBool("date").addBool("digits").addBool("email").addBool("number").addBool("url");t.addMinMax("length","minlength","maxlength","rangelength").addMinMax("range","min","max","range");t.add("equalto",["other"],function(t){var r=e(t.element.name),u=t.params.other,s=o(u,r),h=n(t.form).find(":input[name='"+f(s)+"']")[0];i(t,"equalTo",h)});t.add("required",function(n){(n.element.tagName.toUpperCase()!=="INPUT"||n.element.type.toUpperCase()!=="CHECKBOX")&&i(n,"required",!0)});t.add("remote",["url","type","additionalfields"],function(t){var r={url:t.params.url,type:t.params.type||"GET",data:{}},u=e(t.element.name);n.each(h(t.params.additionalfields||t.element.name),function(i,e){var s=o(e,u);r.data[s]=function(){return n(t.form).find(":input[name='"+f(s)+"']").val()}});i(t,"remote",r)});t.add("password",["min","nonalphamin","regex"],function(n){n.params.min&&i(n,"minlength",n.params.min);n.params.nonalphamin&&i(n,"nonalphamin",n.params.nonalphamin);n.params.regex&&i(n,"regex",n.params.regex)});n(function(){r.unobtrusive.parse(document)})}(jQuery);window.Modernizr=function(n,t,i){function a(n){c.cssText=n}function vt(n,t){return a(y.join(n+";")+(t||""))}function h(n,t){return typeof n===t}function v(n,t){return!!~(""+n).indexOf(t)}function lt(n,t){var u,r;for(u in n)if(r=n[u],!v(r,"-")&&c[r]!==i)return t=="pfx"?r:!0;return!1}function yt(n,t,r){var f,u;for(f in n)if(u=t[n[f]],u!==i)return r===!1?n[f]:h(u,"function")?u.bind(r||t):u;return!1}function f(n,t,i){var r=n.charAt(0).toUpperCase()+n.slice(1),u=(n+" "+ot.join(r+" ")+r).split(" ");return h(t,"string")||h(t,"undefined")?lt(u,t):(u=(n+" "+st.join(r+" ")+r).split(" "),yt(u,t,i))}function pt(){u.input=function(i){for(var r=0,u=i.length;r<u;r++)w[i[r]]=!!(i[r]in o);return w.list&&(w.list=!!(t.createElement("datalist")&&n.HTMLDataListElement)),w}("autocomplete autofocus list placeholder max min multiple pattern required step".split(" "));u.inputtypes=function(n){for(var u=0,r,f,e,h=n.length;u<h;u++)o.setAttribute("type",f=n[u]),r=o.type!=="text",r&&(o.value=g,o.style.cssText="position:absolute;visibility:hidden;",/^range$/.test(f)&&o.style.WebkitAppearance!==i?(s.appendChild(o),e=t.defaultView,r=e.getComputedStyle&&e.getComputedStyle(o,null).WebkitAppearance!=="textfield"&&o.offsetHeight!==0,s.removeChild(o)):/^(search|tel)$/.test(f)||(r=/^(url|email)$/.test(f)?o.checkValidity&&o.checkValidity()===!1:o.value!=g)),ht[n[u]]=!!r;return ht}("search tel url email datetime date month week time datetime-local number range color".split(" "))}var u={},d=!0,s=t.documentElement,e="modernizr",ut=t.createElement(e),c=ut.style,o=t.createElement("input"),g=":)",ft={}.toString,y=" -webkit- -moz- -o- -ms- ".split(" "),et="Webkit Moz O ms",ot=et.split(" "),st=et.toLowerCase().split(" "),p={svg:"http://www.w3.org/2000/svg"},r={},ht={},w={},nt=[],tt=nt.slice,b,l=function(n,i,r,u){var l,a,c,v,f=t.createElement("div"),h=t.body,o=h||t.createElement("body");if(parseInt(r,10))while(r--)c=t.createElement("div"),c.id=u?u[r]:e+(r+1),f.appendChild(c);return l=["­",'<style id="s',e,'">',n,"<\/style>"].join(""),f.id=e,(h?f:o).innerHTML+=l,o.appendChild(f),h||(o.style.background="",o.style.overflow="hidden",v=s.style.overflow,s.style.overflow="hidden",s.appendChild(o)),a=i(f,n),h?f.parentNode.removeChild(f):(o.parentNode.removeChild(o),s.style.overflow=v),!!a},at=function(t){var i=n.matchMedia||n.msMatchMedia,r;return i?i(t).matches:(l("@media "+t+" { #"+e+" { position: absolute; } }",function(t){r=(n.getComputedStyle?getComputedStyle(t,null):t.currentStyle).position=="absolute"}),r)},ct=function(){function r(r,u){u=u||t.createElement(n[r]||"div");r="on"+r;var f=r in u;return f||(u.setAttribute||(u=t.createElement("div")),u.setAttribute&&u.removeAttribute&&(u.setAttribute(r,""),f=h(u[r],"function"),h(u[r],"undefined")||(u[r]=i),u.removeAttribute(r))),u=null,f}var n={select:"input",change:"input",submit:"form",reset:"form",error:"img",load:"img",abort:"img"};return r}(),it={}.hasOwnProperty,rt,k;rt=h(it,"undefined")||h(it.call,"undefined")?function(n,t){return t in n&&h(n.constructor.prototype[t],"undefined")}:function(n,t){return it.call(n,t)};Function.prototype.bind||(Function.prototype.bind=function(n){var t=this,i,r;if(typeof t!="function")throw new TypeError;return i=tt.call(arguments,1),r=function(){var f,e,u;return this instanceof r?(f=function(){},f.prototype=t.prototype,e=new f,u=t.apply(e,i.concat(tt.call(arguments))),Object(u)===u)?u:e:t.apply(n,i.concat(tt.call(arguments)))},r});r.flexbox=function(){return f("flexWrap")};r.flexboxlegacy=function(){return f("boxDirection")};r.canvas=function(){var n=t.createElement("canvas");return!!(n.getContext&&n.getContext("2d"))};r.canvastext=function(){return!!(u.canvas&&h(t.createElement("canvas").getContext("2d").fillText,"function"))};r.webgl=function(){return!!n.WebGLRenderingContext};r.touch=function(){var i;return"ontouchstart"in n||n.DocumentTouch&&t instanceof DocumentTouch?i=!0:l(["@media (",y.join("touch-enabled),("),e,")","{#modernizr{top:9px;position:absolute}}"].join(""),function(n){i=n.offsetTop===9}),i};r.geolocation=function(){return"geolocation"in navigator};r.postmessage=function(){return!!n.postMessage};r.websqldatabase=function(){return!!n.openDatabase};r.indexedDB=function(){return!!f("indexedDB",n)};r.hashchange=function(){return ct("hashchange",n)&&(t.documentMode===i||t.documentMode>7)};r.history=function(){return!!(n.history&&history.pushState)};r.draganddrop=function(){var n=t.createElement("div");return"draggable"in n||"ondragstart"in n&&"ondrop"in n};r.websockets=function(){return"WebSocket"in n||"MozWebSocket"in n};r.rgba=function(){return a("background-color:rgba(150,255,150,.5)"),v(c.backgroundColor,"rgba")};r.hsla=function(){return a("background-color:hsla(120,40%,100%,.5)"),v(c.backgroundColor,"rgba")||v(c.backgroundColor,"hsla")};r.multiplebgs=function(){return a("background:url(https://),url(https://),red url(https://)"),/(url\s*\(.*?){3}/.test(c.background)};r.backgroundsize=function(){return f("backgroundSize")};r.borderimage=function(){return f("borderImage")};r.borderradius=function(){return f("borderRadius")};r.boxshadow=function(){return f("boxShadow")};r.textshadow=function(){return t.createElement("div").style.textShadow===""};r.opacity=function(){return vt("opacity:.55"),/^0.55$/.test(c.opacity)};r.cssanimations=function(){return f("animationName")};r.csscolumns=function(){return f("columnCount")};r.cssgradients=function(){var n="background-image:";return a((n+"-webkit- ".split(" ").join("gradient(linear,left top,right bottom,from(#9f9),to(white));"+n)+y.join("linear-gradient(left top,#9f9, white);"+n)).slice(0,-n.length)),v(c.backgroundImage,"gradient")};r.cssreflections=function(){return f("boxReflect")};r.csstransforms=function(){return!!f("transform")};r.csstransforms3d=function(){var n=!!f("perspective");return n&&"webkitPerspective"in s.style&&l("@media (transform-3d),(-webkit-transform-3d){#modernizr{left:9px;position:absolute;height:3px;}}",function(t){n=t.offsetLeft===9&&t.offsetHeight===3}),n};r.csstransitions=function(){return f("transition")};r.fontface=function(){var n;return l('@font-face {font-family:"font";src:url("https://")}',function(i,r){var f=t.getElementById("smodernizr"),u=f.sheet||f.styleSheet,e=u?u.cssRules&&u.cssRules[0]?u.cssRules[0].cssText:u.cssText||"":"";n=/src/i.test(e)&&e.indexOf(r.split(" ")[0])===0}),n};r.generatedcontent=function(){var n;return l(["#",e,"{font:0/0 a}#",e,':after{content:"',g,'";visibility:hidden;font:3px/1 a}'].join(""),function(t){n=t.offsetHeight>=3}),n};r.video=function(){var i=t.createElement("video"),n=!1;try{(n=!!i.canPlayType)&&(n=new Boolean(n),n.ogg=i.canPlayType('video/ogg; codecs="theora"').replace(/^no$/,""),n.h264=i.canPlayType('video/mp4; codecs="avc1.42E01E"').replace(/^no$/,""),n.webm=i.canPlayType('video/webm; codecs="vp8, vorbis"').replace(/^no$/,""))}catch(r){}return n};r.audio=function(){var i=t.createElement("audio"),n=!1;try{(n=!!i.canPlayType)&&(n=new Boolean(n),n.ogg=i.canPlayType('audio/ogg; codecs="vorbis"').replace(/^no$/,""),n.mp3=i.canPlayType("audio/mpeg;").replace(/^no$/,""),n.wav=i.canPlayType('audio/wav; codecs="1"').replace(/^no$/,""),n.m4a=(i.canPlayType("audio/x-m4a;")||i.canPlayType("audio/aac;")).replace(/^no$/,""))}catch(r){}return n};r.localstorage=function(){try{return localStorage.setItem(e,e),localStorage.removeItem(e),!0}catch(n){return!1}};r.sessionstorage=function(){try{return sessionStorage.setItem(e,e),sessionStorage.removeItem(e),!0}catch(n){return!1}};r.webworkers=function(){return!!n.Worker};r.applicationcache=function(){return!!n.applicationCache};r.svg=function(){return!!t.createElementNS&&!!t.createElementNS(p.svg,"svg").createSVGRect};r.inlinesvg=function(){var n=t.createElement("div");return n.innerHTML="<svg/>",(n.firstChild&&n.firstChild.namespaceURI)==p.svg};r.smil=function(){return!!t.createElementNS&&/SVGAnimate/.test(ft.call(t.createElementNS(p.svg,"animate")))};r.svgclippaths=function(){return!!t.createElementNS&&/SVGClipPath/.test(ft.call(t.createElementNS(p.svg,"clipPath")))};for(k in r)rt(r,k)&&(b=k.toLowerCase(),u[b]=r[k](),nt.push((u[b]?"":"no-")+b));return u.input||pt(),u.addTest=function(n,t){if(typeof n=="object")for(var r in n)rt(n,r)&&u.addTest(r,n[r]);else{if(n=n.toLowerCase(),u[n]!==i)return u;t=typeof t=="function"?t():t;typeof d!="undefined"&&d&&(s.className+=" "+(t?"":"no-")+n);u[n]=t}return u},a(""),ut=o=null,function(n,t){function p(n,t){var i=n.createElement("p"),r=n.getElementsByTagName("head")[0]||n.documentElement;return i.innerHTML="x<style>"+t+"<\/style>",r.insertBefore(i.lastChild,r.firstChild)}function c(){var n=r.elements;return typeof n=="string"?n.split(" "):n}function o(n){var t=h[n[s]];return t||(t={},e++,n[s]=e,h[e]=t),t}function l(n,r,u){if(r||(r=t),i)return r.createElement(n);u||(u=o(r));var f;return f=u.cache[n]?u.cache[n].cloneNode():y.test(n)?(u.cache[n]=u.createElem(n)).cloneNode():u.createElem(n),f.canHaveChildren&&!v.test(n)?u.frag.appendChild(f):f}function w(n,r){if(n||(n=t),i)return n.createDocumentFragment();r=r||o(n);for(var f=r.frag.cloneNode(),u=0,e=c(),s=e.length;u<s;u++)f.createElement(e[u]);return f}function b(n,t){t.cache||(t.cache={},t.createElem=n.createElement,t.createFrag=n.createDocumentFragment,t.frag=t.createFrag());n.createElement=function(i){return r.shivMethods?l(i,n,t):t.createElem(i)};n.createDocumentFragment=Function("h,f","return function(){var n=f.cloneNode(),c=n.createElement;h.shivMethods&&("+c().join().replace(/\w+/g,function(n){return t.createElem(n),t.frag.createElement(n),'c("'+n+'")'})+");return n}")(r,t.frag)}function a(n){n||(n=t);var u=o(n);return!r.shivCSS||f||u.hasCSS||(u.hasCSS=!!p(n,"article,aside,figcaption,figure,footer,header,hgroup,nav,section{display:block}mark{background:#FF0;color:#000}")),i||b(n,u),n}var u=n.html5||{},v=/^<|^(?:button|map|select|textarea|object|iframe|option|optgroup)$/i,y=/^(?:a|b|code|div|fieldset|h1|h2|h3|h4|h5|h6|i|label|li|ol|p|q|span|strong|style|table|tbody|td|th|tr|ul)$/i,f,s="_html5shiv",e=0,h={},i,r;(function(){try{var n=t.createElement("a");n.innerHTML="<xyz><\/xyz>";f="hidden"in n;i=n.childNodes.length==1||function(){t.createElement("a");var n=t.createDocumentFragment();return typeof n.cloneNode=="undefined"||typeof n.createDocumentFragment=="undefined"||typeof n.createElement=="undefined"}()}catch(r){f=!0;i=!0}})();r={elements:u.elements||"abbr article aside audio bdi canvas data datalist details figcaption figure footer header hgroup mark meter nav output progress section summary time video",shivCSS:u.shivCSS!==!1,supportsUnknownElements:i,shivMethods:u.shivMethods!==!1,type:"default",shivDocument:a,createElement:l,createDocumentFragment:w};n.html5=r;a(t)}(this,t),u._version="2.6.2",u._prefixes=y,u._domPrefixes=st,u._cssomPrefixes=ot,u.mq=at,u.hasEvent=ct,u.testProp=function(n){return lt([n])},u.testAllProps=f,u.testStyles=l,u.prefixed=function(n,t,i){return t?f(n,t,i):f(n,"pfx")},s.className=s.className.replace(/(^|\s)no-js(\s|$)/,"$1$2")+(d?" js "+nt.join(" "):""),u}(this,this.document),function(n,t,i){function l(n){var t={},r=/^jQuery\d+$/;return i.each(n.attributes,function(n,i){i.specified&&!r.test(i.name)&&(t[i.name]=i.value)}),t}function f(n,r){var f=this,u=i(f);if(f.value==u.attr("placeholder")&&u.hasClass("placeholder"))if(u.data("placeholder-password")){if(u=u.hide().next().show().attr("id",u.removeAttr("id").data("placeholder-id")),n===!0)return u[0].value=r;u.focus()}else f.value="",u.removeClass("placeholder"),f==t.activeElement&&f.select()}function s(){var t,r=this,n=i(r),e=n,u=this.id;if(r.value==""){if(r.type=="password"){if(!n.data("placeholder-textinput")){try{t=n.clone().attr({type:"text"})}catch(o){t=i("<input>").attr(i.extend(l(this),{type:"text"}))}t.removeAttr("name").data({"placeholder-password":!0,"placeholder-id":u}).bind("focus.placeholder",f);n.data({"placeholder-textinput":t,"placeholder-id":u}).before(t)}n=n.removeAttr("id").hide().prev().attr("id",u).show()}n.addClass("placeholder");n[0].value=n.attr("placeholder")}else n.removeClass("placeholder")}var u="placeholder"in t.createElement("input"),e="placeholder"in t.createElement("textarea"),h=i.fn,c=i.valHooks,o,r;u&&e?(r=h.placeholder=function(){return this},r.input=r.textarea=!0):(r=h.placeholder=function(){var n=this;return n.filter((u?"textarea":":input")+"[placeholder]").not(".placeholder").bind({"focus.placeholder":f,"blur.placeholder":s}).data("placeholder-enabled",!0).trigger("blur.placeholder"),n},r.input=u,r.textarea=e,o={get:function(n){var t=i(n);return t.data("placeholder-enabled")&&t.hasClass("placeholder")?"":n.value},set:function(n,r){var u=i(n);return u.data("placeholder-enabled")?(r==""?(n.value=r,n!=t.activeElement&&s.call(n)):u.hasClass("placeholder")?f.call(n,!0,r)||(n.value=r):n.value=r,u):n.value=r}},u||(c.input=o),e||(c.textarea=o),i(function(){i(t).delegate("form","submit.placeholder",function(){var n=i(".placeholder",this).each(f);setTimeout(function(){n.each(s)},10)})}),i(n).bind("beforeunload.placeholder",function(){i(".placeholder").each(function(){this.value=""})}))}(this,document,jQuery),function(n){"function"==typeof define&&define.amd?define(["jquery"],n):n(jQuery)}(function(n){function r(n){return n}function u(n){return decodeURIComponent(n.replace(f," "))}function i(n){0===n.indexOf('"')&&(n=n.slice(1,-1).replace(/\\"/g,'"').replace(/\\\\/g,"\\"));try{return t.json?JSON.parse(n):n}catch(i){}}var f=/\+/g,t=n.cookie=function(f,e,o){var l,s;if(void 0!==e)return(o=n.extend({},t.defaults,o),"number"==typeof o.expires)&&(l=o.expires,s=o.expires=new Date,s.setDate(s.getDate()+l)),e=t.json?JSON.stringify(e):e+"",document.cookie=[t.raw?f:encodeURIComponent(f),"=",t.raw?e:encodeURIComponent(e),o.expires?"; expires="+o.expires.toUTCString():"",o.path?"; path="+o.path:"",o.domain?"; domain="+o.domain:"",o.secure?"; secure":""].join("");for(var a=t.raw?r:u,v=document.cookie.split("; "),h=f?void 0:{},c=0,b=v.length;b>c;c++){var y=v[c].split("="),p=a(y.shift()),w=a(y.join("="));if(f&&f===p){h=i(w);break}f||(h[p]=i(w))}return h};t.defaults={};n.removeCookie=function(t,i){return void 0!==n.cookie(t)?(n.cookie(t,"",n.extend(i,{expires:-1})),!0):!1}});typeof JSON!="object"&&(JSON={}),function(){"use strict";function i(n){return n<10?"0"+n:n}function o(n){return e.lastIndex=0,e.test(n)?'"'+n.replace(e,function(n){var t=s[n];return typeof t=="string"?t:"\\u"+("0000"+n.charCodeAt(0).toString(16)).slice(-4)})+'"':'"'+n+'"'}function u(i,f){var s,l,h,a,v=n,c,e=f[i];e&&typeof e=="object"&&typeof e.toJSON=="function"&&(e=e.toJSON(i));typeof t=="function"&&(e=t.call(f,i,e));switch(typeof e){case"string":return o(e);case"number":return isFinite(e)?String(e):"null";case"boolean":case"null":return String(e);case"object":if(!e)return"null";if(n+=r,c=[],Object.prototype.toString.apply(e)==="[object Array]"){for(a=e.length,s=0;s<a;s+=1)c[s]=u(s,e)||"null";return h=c.length===0?"[]":n?"[\n"+n+c.join(",\n"+n)+"\n"+v+"]":"["+c.join(",")+"]",n=v,h}if(t&&typeof t=="object")for(a=t.length,s=0;s<a;s+=1)typeof t[s]=="string"&&(l=t[s],h=u(l,e),h&&c.push(o(l)+(n?": ":":")+h));else for(l in e)Object.prototype.hasOwnProperty.call(e,l)&&(h=u(l,e),h&&c.push(o(l)+(n?": ":":")+h));return h=c.length===0?"{}":n?"{\n"+n+c.join(",\n"+n)+"\n"+v+"}":"{"+c.join(",")+"}",n=v,h}}typeof Date.prototype.toJSON!="function"&&(Date.prototype.toJSON=function(){return isFinite(this.valueOf())?this.getUTCFullYear()+"-"+i(this.getUTCMonth()+1)+"-"+i(this.getUTCDate())+"T"+i(this.getUTCHours())+":"+i(this.getUTCMinutes())+":"+i(this.getUTCSeconds())+"Z":null},String.prototype.toJSON=Number.prototype.toJSON=Boolean.prototype.toJSON=function(){return this.valueOf()});var f=/[\u0000\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g,e=/[\\\"\x00-\x1f\x7f-\x9f\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g,n,r,s={"\b":"\\b","\t":"\\t","\n":"\\n","\f":"\\f","\r":"\\r",'"':'\\"',"\\":"\\\\"},t;typeof JSON.stringify!="function"&&(JSON.stringify=function(i,f,e){var o;if(n="",r="",typeof e=="number")for(o=0;o<e;o+=1)r+=" ";else typeof e=="string"&&(r=e);if(t=f,f&&typeof f!="function"&&(typeof f!="object"||typeof f.length!="number"))throw new Error("JSON.stringify");return u("",{"":i})});typeof JSON.parse!="function"&&(JSON.parse=function(text,reviver){function walk(n,t){var r,u,i=n[t];if(i&&typeof i=="object")for(r in i)Object.prototype.hasOwnProperty.call(i,r)&&(u=walk(i,r),u!==undefined?i[r]=u:delete i[r]);return reviver.call(n,t,i)}var j;if(text=String(text),f.lastIndex=0,f.test(text)&&(text=text.replace(f,function(n){return"\\u"+("0000"+n.charCodeAt(0).toString(16)).slice(-4)})),/^[\],:{}\s]*$/.test(text.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,"@").replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,"]").replace(/(?:^|:|,)(?:\s*\[)+/g,"")))return j=eval("("+text+")"),typeof reviver=="function"?walk({"":j},""):j;throw new SyntaxError("JSON.parse");})}(),function(){function ut(){var u=!1,n;if("localStorage"in window)try{window.localStorage.setItem("_tmptest","tmpval");u=!0;window.localStorage.removeItem("_tmptest")}catch(f){}if(u)try{window.localStorage&&(i=window.localStorage,r="localStorage",s=i.jStorage_update)}catch(e){}else if("globalStorage"in window)try{window.globalStorage&&(i=window.globalStorage[window.location.hostname],r="globalStorage",s=i.jStorage_update)}catch(o){}else if(t=document.createElement("link"),t.addBehavior){t.style.behavior="url(#default#userData)";document.getElementsByTagName("head")[0].appendChild(t);try{t.load("jStorage")}catch(h){t.setAttribute("jStorage","{}");t.save("jStorage");t.load("jStorage")}n="{}";try{n=t.getAttribute("jStorage")}catch(c){}try{s=t.getAttribute("jStorage_update")}catch(a){}i.jStorage=n;r="userDataBehavior"}else{t=null;return}it();p();y("local");y("session");ft();rt();"addEventListener"in window&&window.addEventListener("pageshow",function(n){n.persisted&&l()},!1)}function y(t,i){function l(){if(t=="session")try{o=u.parse(window.name||"{}")}catch(n){o={}}}function a(){t=="session"&&(window.name=u.stringify(o))}var c=!1,s=0,h,f,o={},v=Math.random();if(i||typeof window[t+"Storage"]=="undefined"){if(t=="local"&&window.globalStorage){localStorage=window.globalStorage[window.location.hostname];return}if(r=="userDataBehavior"){i&&window[t+"Storage"]&&window[t+"Storage"].parentNode&&window[t+"Storage"].parentNode.removeChild(window[t+"Storage"]);f=document.createElement("button");document.getElementsByTagName("head")[0].appendChild(f);t=="local"?o=n:t=="session"&&l();for(h in o)o.hasOwnProperty(h)&&h!="__jstorage_meta"&&h!="length"&&typeof o[h]!="undefined"&&(h in f||s++,f[h]=o[h]);f.length=s;f.key=function(n){var i=0,t;l();for(t in o)if(o.hasOwnProperty(t)&&t!="__jstorage_meta"&&t!="length"&&typeof o[t]!="undefined"){if(i==n)return t;i++}};f.getItem=function(n){return(l(),t=="session")?o[n]:e.jStorage.get(n)};f.setItem=function(n,t){typeof t!="undefined"&&(f[n]=(t||"").toString())};f.removeItem=function(n){if(t=="local")return e.jStorage.deleteKey(n);f[n]=undefined;c=!0;n in f&&f.removeAttribute(n);c=!1};f.clear=function(){if(t=="session"){window.name="";y("session",!0);return}e.jStorage.flush()};t=="local"&&(d=function(n,t){n!="length"&&(c=!0,typeof t=="undefined"?n in f&&(s--,f.removeAttribute(n)):(n in f||s++,f[n]=(t||"").toString()),f.length=s,c=!1)});f.attachEvent("onpropertychange",function(n){if(n.propertyName!="length"&&!c&&n.propertyName!="length"){if(t=="local")n.propertyName in o||typeof f[n.propertyName]=="undefined"||s++;else if(t=="session"){l();typeof f[n.propertyName]=="undefined"||n.propertyName in o?typeof f[n.propertyName]=="undefined"&&n.propertyName in o?(delete o[n.propertyName],s--):o[n.propertyName]=f[n.propertyName]:(o[n.propertyName]=f[n.propertyName],s++);a();f.length=s;return}e.jStorage.set(n.propertyName,f[n.propertyName]);f.length=s}});window[t+"Storage"]=f}}}function tt(){var n="{}";if(r=="userDataBehavior"){t.load("jStorage");try{n=t.getAttribute("jStorage")}catch(u){}try{s=t.getAttribute("jStorage_update")}catch(f){}i.jStorage=n}it();p();rt()}function ft(){r=="localStorage"||r=="globalStorage"?"addEventListener"in window?window.addEventListener("storage",l,!1):document.attachEvent("onstorage",l):r=="userDataBehavior"&&setInterval(l,1e3)}function l(){var n;clearTimeout(g);g=setTimeout(function(){if(r=="localStorage"||r=="globalStorage")n=i.jStorage_update;else if(r=="userDataBehavior"){t.load("jStorage");try{n=t.getAttribute("jStorage_update")}catch(u){}}n&&n!=s&&(s=n,et())},25)}function et(){var i=u.parse(u.stringify(n.__jstorage_meta.CRC32)),r,t,f,e;tt();r=u.parse(u.stringify(n.__jstorage_meta.CRC32));f=[];e=[];for(t in i)if(i.hasOwnProperty(t)){if(!r[t]){e.push(t);continue}i[t]!=r[t]&&String(i[t]).substr(0,2)=="2."&&f.push(t)}for(t in r)r.hasOwnProperty(t)&&(i[t]||f.push(t));c(f,"updated");c(e,"deleted")}function c(n,t){var u,i,e,r,o;if(n=[].concat(n||[]),t=="flushed"){n=[];for(u in f)f.hasOwnProperty(u)&&n.push(u);t="deleted"}for(i=0,e=n.length;i<e;i++)if(f[n[i]])for(r=0,o=f[n[i]].length;r<o;r++)f[n[i]][r](n[i],t)}function a(){var n=(+new Date).toString();r=="localStorage"||r=="globalStorage"?i.jStorage_update=n:r=="userDataBehavior"&&(t.setAttribute("jStorage_update",n),t.save("jStorage"));l()}function it(){if(i.jStorage)try{n=u.parse(String(i.jStorage))}catch(t){i.jStorage="{}"}else i.jStorage="{}";w=i.jStorage?String(i.jStorage).length:0;n.__jstorage_meta||(n.__jstorage_meta={});n.__jstorage_meta.CRC32||(n.__jstorage_meta.CRC32={})}function v(){st();try{i.jStorage=u.stringify(n);t&&(t.setAttribute("jStorage",i.jStorage),t.save("jStorage"));w=i.jStorage?String(i.jStorage).length:0}catch(r){}}function o(n){if(!n||typeof n!="string"&&typeof n!="number")throw new TypeError("Key name must be string or numeric");if(n=="__jstorage_meta")throw new TypeError("Reserved key name");return!0}function p(){var u,t,i,f,r=Infinity,e=!1,o=[];if(clearTimeout(nt),n.__jstorage_meta&&typeof n.__jstorage_meta.TTL=="object"){u=+new Date;i=n.__jstorage_meta.TTL;f=n.__jstorage_meta.CRC32;for(t in i)i.hasOwnProperty(t)&&(i[t]<=u?(delete i[t],delete f[t],delete n[t],e=!0,o.push(t)):i[t]<r&&(r=i[t]));r!=Infinity&&(nt=setTimeout(p,r-u));e&&(v(),a(),c(o,"deleted"))}}function rt(){var t,r,i;if(n.__jstorage_meta.PubSub){for(r=b,i=len=n.__jstorage_meta.PubSub.length-1;i>=0;i--)t=n.__jstorage_meta.PubSub[i],t[0]>b&&(r=t[0],ot(t[1],t[2]));b=r}}function ot(n,t){if(h[n])for(var i=0,r=h[n].length;i<r;i++)h[n][i](n,u.parse(u.stringify(t)))}function st(){var i,t,r;if(n.__jstorage_meta.PubSub){for(i=+new Date-2e3,t=0,r=n.__jstorage_meta.PubSub.length;t<r;t++)if(n.__jstorage_meta.PubSub[t][0]<=i){n.__jstorage_meta.PubSub.splice(t,n.__jstorage_meta.PubSub.length-t);break}n.__jstorage_meta.PubSub.length||delete n.__jstorage_meta.PubSub}}function ht(t,i){n.__jstorage_meta||(n.__jstorage_meta={});n.__jstorage_meta.PubSub||(n.__jstorage_meta.PubSub=[]);n.__jstorage_meta.PubSub.unshift([+new Date,t,i]);v();a()}function ct(n,t){for(var f=n.length,i=t^f,u=0,r;f>=4;)r=n.charCodeAt(u)&255|(n.charCodeAt(++u)&255)<<8|(n.charCodeAt(++u)&255)<<16|(n.charCodeAt(++u)&255)<<24,r=(r&65535)*1540483477+(((r>>>16)*1540483477&65535)<<16),r^=r>>>24,r=(r&65535)*1540483477+(((r>>>16)*1540483477&65535)<<16),i=(i&65535)*1540483477+(((i>>>16)*1540483477&65535)<<16)^r,f-=4,++u;switch(f){case 3:i^=(n.charCodeAt(u+2)&255)<<16;case 2:i^=(n.charCodeAt(u+1)&255)<<8;case 1:i^=n.charCodeAt(u)&255;i=(i&65535)*1540483477+(((i>>>16)*1540483477&65535)<<16)}return i^=i>>>13,i=(i&65535)*1540483477+(((i>>>16)*1540483477&65535)<<16),i^=i>>>15,i>>>0}var e=window.jQuery||window.$||(window.$={}),u={parse:window.JSON&&(window.JSON.parse||window.JSON.decode)||String.prototype.evalJSON&&function(n){return String(n).evalJSON()}||e.parseJSON||e.evalJSON,stringify:Object.toJSON||window.JSON&&(window.JSON.stringify||window.JSON.encode)||e.toJSON};if(!u.parse||!u.stringify)throw new Error("No JSON support found, include //cdnjs.cloudflare.com/ajax/libs/json2/20110223/json2.js to page");var n={},i={jStorage:"{}"},t=null,w=0,r=!1,f={},g=!1,s=0,h={},b=+new Date,nt,k={isXML:function(n){var t=(n?n.ownerDocument||n:0).documentElement;return t?t.nodeName!=="HTML":!1},encode:function(n){if(!this.isXML(n))return!1;try{return(new XMLSerializer).serializeToString(n)}catch(t){try{return n.xml}catch(i){}}return!1},decode:function(n){var i="DOMParser"in window&&(new DOMParser).parseFromString||window.ActiveXObject&&function(n){var t=new ActiveXObject("Microsoft.XMLDOM");return t.async="false",t.loadXML(n),t},t;return i?(t=i.call("DOMParser"in window&&new DOMParser||window,n,"text/xml"),this.isXML(t)?t:!1):!1}},d=function(){};e.jStorage={version:"0.3.1",set:function(t,i,r){if(o(t),r=r||{},typeof i=="undefined")return this.deleteKey(t),i;if(k.isXML(i))i={_is_xml:!0,xml:k.encode(i)};else{if(typeof i=="function")return undefined;i&&typeof i=="object"&&(i=u.parse(u.stringify(i)))}return n[t]=i,n.__jstorage_meta.CRC32[t]="2."+ct(u.stringify(i)),this.setTTL(t,r.TTL||0),d(t,i),c(t,"updated"),i},get:function(t,i){return(o(t),t in n)?n[t]&&typeof n[t]=="object"&&n[t]._is_xml?k.decode(n[t].xml):n[t]:typeof i=="undefined"?null:i},deleteKey:function(t){return(o(t),t in n)?(delete n[t],typeof n.__jstorage_meta.TTL=="object"&&t in n.__jstorage_meta.TTL&&delete n.__jstorage_meta.TTL[t],delete n.__jstorage_meta.CRC32[t],d(t,undefined),v(),a(),c(t,"deleted"),!0):!1},setTTL:function(t,i){var r=+new Date;return(o(t),i=Number(i)||0,t in n)?(n.__jstorage_meta.TTL||(n.__jstorage_meta.TTL={}),i>0?n.__jstorage_meta.TTL[t]=r+i:delete n.__jstorage_meta.TTL[t],v(),p(),a(),!0):!1},getTTL:function(t){var r=+new Date,i;return(o(t),t in n&&n.__jstorage_meta.TTL&&n.__jstorage_meta.TTL[t])?(i=n.__jstorage_meta.TTL[t]-r,i||0):0},flush:function(){return n={__jstorage_meta:{CRC32:{}}},y("local",!0),v(),a(),c(null,"flushed"),!0},storageObj:function(){function t(){}return t.prototype=n,new t},index:function(){var i=[];for(var t in n)n.hasOwnProperty(t)&&t!="__jstorage_meta"&&i.push(t);return i},storageSize:function(){return w},currentBackend:function(){return r},storageAvailable:function(){return!!r},listenKeyChange:function(n,t){o(n);f[n]||(f[n]=[]);f[n].push(t)},stopListening:function(n,t){if(o(n),f[n]){if(!t){delete f[n];return}for(var i=f[n].length-1;i>=0;i--)f[n][i]==t&&f[n].splice(i,1)}},subscribe:function(n,t){if(n=(n||"").toString(),!n)throw new TypeError("Channel not defined");h[n]||(h[n]=[]);h[n].push(t)},publish:function(n,t){if(n=(n||"").toString(),!n)throw new TypeError("Channel not defined");ht(n,t)},reInit:function(){tt()}};ut()}(),function(n,t){function ut(){}function bi(n,t){if(t)return"'"+n.split("'").join("\\'").split('\\"').join('\\\\\\"').replace(/\n/g,"\\n").replace(/\r/g,"\\r").replace(/\t/g,"\\t")+"'";var i=n.charAt(0),r=n.substring(1);return i==="="?"+("+r+")+":i===":"?"+e("+r+")+":";"+n+";o+="}function e(n,t,i){return(n=n+"",t=t||2,i=t-n.length,i)?rr[t].substring(0,i)+n:n}function ur(t,u){var c=r.browser,o,g=t.css("direction")=="rtl",e,v;if(t.parent().hasClass("k-animation-container"))e=t.parent(".k-animation-container"),v=e[0].style,e.is(":hidden")&&e.show(),o=tt.test(v.width)||tt.test(v.height),o||e.css({width:t.outerWidth(),height:t.outerHeight(),boxSizing:"content-box",mozBoxSizing:"content-box",webkitBoxSizing:"content-box"});else{var y=t.css(i.support.transitions.css+"box-shadow")||t.css("box-shadow"),f=y?y.match(vi)||[0,0,0,0,0]:[0,0,0,0,0],l=p.max(+f[3],+(f[4]||0)),a=-f[1]+l,w=+f[1]+l,b=+f[2]+l,s=t[0].style.width,h=t[0].style.height,k=tt.test(s),d=tt.test(h);c.opera&&(a=w=b=5);o=k||d;!k&&(!u||u&&s)&&(s=t.outerWidth());!d&&(!u||u&&h)&&(h=t.outerHeight());t.wrap(n("<div/>").addClass("k-animation-container").css({width:s,height:h,marginLeft:a*(g?1:-1),paddingLeft:a,paddingRight:w,paddingBottom:b}));o&&t.css({width:"100%",height:"100%",boxSizing:"border-box",mozBoxSizing:"border-box",webkitBoxSizing:"border-box"})}return c.msie&&p.floor(c.version)<=7&&(t.css({zoom:1}),t.children(".k-menu").width(t.width())),t.parent()}function kt(n){for(var t=1,i=arguments.length,t=1;t<i;t++)dt(n,arguments[t]);return n}function dt(n,t){var o=i.data.ObservableArray,s=i.data.DataSource,u,r,f,e;for(u in t)r=t[u],f=typeof r,f===a&&r!==null&&r.constructor!==Array&&r.constructor!==o&&r.constructor!==s?r instanceof Date?n[u]=new Date(r.getTime()):ft(r.clone)?n[u]=r.clone():(e=n[u],n[u]=typeof e===a?e||{}:{},dt(n[u],r)):f!==rt&&(n[u]=r);return n}function ct(n,i,r){for(var u in i)if(i.hasOwnProperty(u)&&i[u].test(n))return u;return r!==t?r:n}function fr(n){return n.replace(/([a-z][A-Z])/g,function(n){return n.charAt(0)+"-"+n.charAt(1).toLowerCase()})}function gt(n){return n.replace(/\-(\w)/g,function(n,t){return t.toUpperCase()})}function er(t,r){var u={},f;return document.defaultView&&document.defaultView.getComputedStyle?(f=document.defaultView.getComputedStyle(t,""),r&&n.each(r,function(n,t){u[t]=f.getPropertyValue(t)})):(f=t.currentStyle,r&&n.each(r,function(n,t){u[t]=f[gt(t)]})),i.size(u)||(u=f),u}function or(n){var t=0;for(var i in n)n.hasOwnProperty(i)&&i!="toJSON"&&t++;return t}function sr(n,t,i){var u,f,e,o;return(t||(t="offset"),u=n[t](),f=r.mobileOS,r.touch&&f.ios&&f.flatVersion<410&&(e=t=="offset"?u:n.offset(),o=u.left==e.left&&u.top==e.top,o))?{top:u.top-window.scrollY,left:u.left-window.scrollX}:(r.browser.msie&&(r.pointers||r.msPointers)&&!i&&(u.top-=window.pageYOffset-document.documentElement.scrollTop,u.left-=window.pageXOffset-document.documentElement.scrollLeft),u)}function hr(n){var t={};return d(typeof n=="string"?n.split(" "):n,function(n){t[n]=this}),t}function cr(n){return new i.effects.Element(n)}function ti(n,t,i,r){return typeof n===u&&(ft(t)&&(r=t,t=400,i=!1),ft(i)&&(r=i,i=!1),typeof t===pt&&(i=t,t=400),n={effects:n,duration:t,reverse:i,complete:r}),s({effects:{},duration:400,reverse:!1,init:g,teardown:g,hide:!1},n,{completeCallback:n.complete,complete:g})}function ii(t,i,r,u,f){for(var e=0,s=t.length,o;e<s;e++)o=n(t[e]),o.queue(function(){h.promise(o,ti(i,r,u,f))});return t}function lr(n,t,i,r,u,f){return h.transitionPromise(n,t,ti(i,r,u,f))}function ar(n,t,i,r){return t&&(t=t.split(" "),d(t,function(t,i){n.toggleClass(i,r)})),n}function wr(n){return(""+n).replace(vr,"&").replace(yr,"<").replace(pr,">")}function at(n,r){var u;return r.indexOf("data")===0&&(r=r.substring(4),r=r.charAt(0).toLowerCase()+r.substring(1)),r=r.replace(gr,"-$1"),u=n.getAttribute("data-"+i.ns+r),u===null?u=t:u==="null"?u=null:u==="true"?u=!0:u==="false"?u=!1:yi.test(u)?u=parseFloat(u):kr.test(u)&&!dr.test(u)&&(u=new Function("return ("+u+")")()),u}function fi(r,u){var o={},e,f;for(e in u)f=at(r,e),f!==t&&(br.test(e)&&(f=i.template(n("#"+f).html())),o[e]=f);return o}function nu(t,i){return n.contains(t,i)?-1:1}function tu(){var t=n(this);return n.inArray(t.attr("data-role"),["slider","rangeslider"])>0||t.is(":visible")}function iu(n,t){var i=n.nodeName.toLowerCase();return(/input|select|textarea|button|object/.test(i)?!n.disabled:"a"===i?n.href||t:t)&&ru(n)}function ru(t){return!n(t).parents().addBack().filter(function(){return n.css(this,"visibility")==="hidden"||n.expr.filters.hidden(this)}).length}function o(n,t){return new o.fn.init(n,t)}var i=window.kendo=window.kendo||{cultures:{}},s=n.extend,d=n.each,li=n.isArray,ot=n.proxy,g=n.noop,p=Math,v,nt=window.JSON||{},r={},tt=/%/,ai=/\{(\d+)(:[^\}]+)?\}/g,vi=/(\d+(?:\.?)\d*)px\s*(\d+(?:\.?)\d*)px\s*(\d+(?:\.?)\d*)px\s*(\d+)?/i,yi=/^(\+|-?)\d+(\.?)\d*$/,c="function",u="string",l="number",a="object",it="null",pt="boolean",rt="undefined",wt={},bt={},st=[].slice,y=window.Globalize,ni,h,lt,ri,ui,w,ei,oi,hi,vt,et,ci,yt,k;i.version="2013.3.1324";ut.extend=function(n){var r=function(){},t,u=this,i=n&&n.init?n.init:function(){u.apply(this,arguments)},f;r.prototype=u.prototype;f=i.fn=i.prototype=new r;for(t in n)f[t]=typeof n[t]!==a||n[t]instanceof Array||n[t]===null?n[t]:s(!0,{},r.prototype[t],n[t]);return f.constructor=i,i.extend=u.extend,i};ut.prototype._initOptions=function(n){this.options=kt({},this.options,n)};var ft=i.isFunction=function(n){return typeof n=="function"},pi=function(){this._defaultPrevented=!0},wi=function(){return this._defaultPrevented===!0},ht=ut.extend({init:function(){this._events={}},bind:function(n,i,r){var f=this,e,s=typeof n===u?[n]:n,h,l,o,v=typeof i===c,a;if(i===t){for(e in n)f.bind(e,n[e]);return f}for(e=0,h=s.length;e<h;e++)n=s[e],o=v?i:i[n],o&&(r&&(l=o,o=function(){f.unbind(n,o);l.apply(f,arguments)}),a=f._events[n]=f._events[n]||[],a.push(o));return f},one:function(n,t){return this.bind(n,t,!0)},first:function(n,t){for(var r=this,e=typeof n===u?[n]:n,f,h=typeof t===c,s,i=0,o=e.length;i<o;i++)n=e[i],f=h?t:t[n],f&&(s=r._events[n]=r._events[n]||[],s.unshift(f));return r},trigger:function(n,t){var u=this,i=u._events[n],r,f;if(i){for(t=t||{},t.sender=u,t._defaultPrevented=!1,t.preventDefault=pi,t.isDefaultPrevented=wi,i=i.slice(),r=0,f=i.length;r<f;r++)i[r].call(u,t);return t._defaultPrevented===!0}return!1},unbind:function(n,i){var u=this,f=u._events[n],r;if(n===t)u._events={};else if(f)if(i)for(r=f.length-1;r>=0;r--)f[r]===i&&f.splice(r,1);else u._events[n]=[];return u}});var ki=/^\w+/,di=/\$\{([^}]*)\}/g,gi=/\\\}/g,nr=/__CURLY__/g,tr=/\\#/g,ir=/__SHARP__/g,rr=["","0","00","000","0000"];v={paramName:"data",useWithBlock:!0,render:function(n,t){for(var u="",i=0,r=t.length;i<r;i++)u+=n(t[i]);return u},compile:function(t,r){var h=s({},this,r),c=h.paramName,a=c.match(ki)[0],l=h.useWithBlock,u="var o,e=kendo.htmlEncode;",o,e,f;if(ft(t))return t.length===2?function(i){return t(n,{data:i}).join("")}:t;for(u+=l?"with("+c+"){":"",u+="o=",e=t.replace(gi,"__CURLY__").replace(di,"#=e($1)#").replace(nr,"}").replace(tr,"__SHARP__").split("#"),f=0;f<e.length;f++)u+=bi(e[f],f%2==0);u+=l?";}":";";u+="return o;";u=u.replace(ir,"#");try{return o=new Function(a,u),o._slotCount=Math.floor(e.length/2),o}catch(v){throw new Error(i.format("Invalid template:'{0}' Generated code:'{1}'",t,u));}}},function(){function o(n){return f.lastIndex=0,f.test(n)?'"'+n.replace(f,function(n){var t=s[n];return typeof t===u?t:"\\u"+("0000"+n.charCodeAt(0).toString(16)).slice(-4)})+'"':'"'+n+'"'}function r(f,e){var v,w,y,k,d=n,p,s=e[f],b;if(s&&typeof s===a&&typeof s.toJSON===c&&(s=s.toJSON(f)),typeof t===c&&(s=t.call(e,f,s)),b=typeof s,b===u)return o(s);if(b===l)return isFinite(s)?String(s):it;if(b===pt||b===it)return String(s);if(b===a){if(!s)return it;if(n+=i,p=[],h.apply(s)==="[object Array]"){for(k=s.length,v=0;v<k;v++)p[v]=r(v,s)||it;return y=p.length===0?"[]":n?"[\n"+n+p.join(",\n"+n)+"\n"+d+"]":"["+p.join(",")+"]",n=d,y}if(t&&typeof t===a)for(k=t.length,v=0;v<k;v++)typeof t[v]===u&&(w=t[v],y=r(w,s),y&&p.push(o(w)+(n?": ":":")+y));else for(w in s)Object.hasOwnProperty.call(s,w)&&(y=r(w,s),y&&p.push(o(w)+(n?": ":":")+y));return y=p.length===0?"{}":n?"{\n"+n+p.join(",\n"+n)+"\n"+d+"}":"{"+p.join(",")+"}",n=d,y}}var f=/[\\\"\x00-\x1f\x7f-\x9f\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g,n,i,s={"\b":"\\b","\t":"\\t","\n":"\\n","\f":"\\f","\r":"\\r",'"':'\\"',"\\":"\\\\"},t,h={}.toString;typeof Date.prototype.toJSON!==c&&(Date.prototype.toJSON=function(){var n=this;return isFinite(n.valueOf())?e(n.getUTCFullYear(),4)+"-"+e(n.getUTCMonth()+1)+"-"+e(n.getUTCDate())+"T"+e(n.getUTCHours())+":"+e(n.getUTCMinutes())+":"+e(n.getUTCSeconds())+"Z":null},String.prototype.toJSON=Number.prototype.toJSON=Boolean.prototype.toJSON=function(){return this.valueOf()});typeof nt.stringify!==c&&(nt.stringify=function(f,e,o){var s;if(n="",i="",typeof o===l)for(s=0;s<o;s+=1)i+=" ";else typeof o===u&&(i=o);if(t=e,e&&typeof e!==c&&(typeof e!==a||typeof e.length!==l))throw new Error("JSON.stringify");return r("",{"":f})})}(),function(){function v(n){if(n){if(n.numberFormat)return n;if(typeof n===u){var t=i.cultures;return t[n]||t[n.split("-")[0]]||null}return null}return null}function w(n){return n&&(n=v(n)),n||i.cultures.current}function rt(n){n.groupSizes=n.groupSize;n.percent.groupSizes=n.percent.groupSize;n.currency.groupSizes=n.currency.groupSize}function ut(n,i,r){r=w(r);var u=r.calendars.standard,f=u.days,o=u.months;return i=u.patterns[i]||i,i.replace(d,function(i){var r;return i==="d"?r=n.getDate():i==="dd"?r=e(n.getDate()):i==="ddd"?r=f.namesAbbr[n.getDay()]:i==="dddd"?r=f.names[n.getDay()]:i==="M"?r=n.getMonth()+1:i==="MM"?r=e(n.getMonth()+1):i==="MMM"?r=o.namesAbbr[n.getMonth()]:i==="MMMM"?r=o.names[n.getMonth()]:i==="yy"?r=e(n.getFullYear()%100):i==="yyyy"?r=e(n.getFullYear(),4):i==="h"?r=n.getHours()%12||12:i==="hh"?r=e(n.getHours()%12||12):i==="H"?r=n.getHours():i==="HH"?r=e(n.getHours()):i==="m"?r=n.getMinutes():i==="mm"?r=e(n.getMinutes()):i==="s"?r=n.getSeconds():i==="ss"?r=e(n.getSeconds()):i==="f"?r=p.floor(n.getMilliseconds()/100):i==="ff"?r=p.floor(n.getMilliseconds()/10):i==="fff"?r=n.getMilliseconds():i==="tt"&&(r=n.getHours()<12?u.AM[0]:u.PM[0]),r!==t?r:i.slice(1,i.length-1)})}function ft(n,i,u){u=w(u);var l=u.numberFormat,ot=l.groupSize[0],lt=l[c],vt=l[f],at=l.decimals,kt=l.pattern[0],dt=[],yt,ft,st,pt,wt,et=n<0,b,p,rt,ei,gt=r,y=r,e,ut,d,ni,ri,it,v,a,bt,ti,ui,ii,fi,ht=-1,ct;if(n===t)return r;if(!isFinite(n))return n;if(!i)return u.name.length?n.toLocaleString():n.toString();if(wt=g.exec(i),wt){if(i=wt[1].toLowerCase(),ft=i==="c",st=i==="p",(ft||st)&&(l=ft?l.currency:l.percent,ot=l.groupSize[0],lt=l[c],vt=l[f],at=l.decimals,yt=l.symbol,kt=l.pattern[et?0:1]),pt=wt[2],pt&&(at=+pt),i==="e")return pt?n.toExponential(at):n.toExponential();if(st&&(n*=100),n=h(n,at),et=n<0,n=n.split(f),b=n[0],p=n[1],et&&(b=b.substring(1)),y=b,rt=b.length,rt>=ot)for(y=r,e=0;e<rt;e++)e>0&&(rt-e)%ot==0&&(y+=lt),y+=b.charAt(e);if(p&&(y+=vt+p),i==="n"&&!et)return y;for(n=r,e=0,ut=kt.length;e<ut;e++)d=kt.charAt(e),n+=d==="n"?y:d==="$"||d==="%"?yt:d;return n}if(et&&(n=-n),(i.indexOf("'")>-1||i.indexOf('"')>-1||i.indexOf("\\")>-1)&&(i=i.replace(nt,function(n){var t=n.charAt(0).replace("\\",""),i=n.slice(1).replace(t,"");return dt.push(i),k})),i=i.split(";"),et&&i[1])i=i[1],ri=!0;else if(n===0){if(i=i[2]||i[0],i.indexOf(o)==-1&&i.indexOf(s)==-1)return i}else i=i[0];if(ui=i.indexOf("%"),ii=i.indexOf("$"),st=ui!=-1,ft=ii!=-1,st&&(n*=100),ft&&i[ii-1]==="\\"&&(i=i.split("\\").join(""),ft=!1),(ft||st)&&(l=ft?l.currency:l.percent,ot=l.groupSize[0],lt=l[c],vt=l[f],at=l.decimals,yt=l.symbol),ni=i.indexOf(c)>-1,ni&&(i=i.replace(tt,r)),it=i.indexOf(f),ut=i.length,it!=-1?(p=n.toString().split("e"),p=p[1]?h(n,Math.abs(p[1])):p[0],p=p.split(f)[1]||r,a=i.lastIndexOf(s)-it,v=i.lastIndexOf(o)-it,bt=a>-1,ti=v>-1,e=p.length,bt||ti||(i=i.substring(0,it)+i.substring(it+1),ut=i.length,it=-1,e=0),bt&&a>v?e=a:v>a&&(ti&&e>v?e=v:bt&&e<a&&(e=a)),e>-1&&(n=h(n,e))):n=h(n),v=i.indexOf(o),fi=a=i.indexOf(s),ht=v==-1&&a!=-1?a:v!=-1&&a==-1?v:v>a?a:v,v=i.lastIndexOf(o),a=i.lastIndexOf(s),ct=v==-1&&a!=-1?a:v!=-1&&a==-1?v:v>a?v:a,ht==ut&&(ct=ht),ht!=-1){if(y=n.toString().split(f),b=y[0],p=y[1]||r,rt=b.length,ei=p.length,et&&n*-1>=0&&(et=!1),ni)if(rt===ot&&rt<it-fi)b=lt+b;else if(rt>ot){for(y=r,e=0;e<rt;e++)e>0&&(rt-e)%ot==0&&(y+=lt),y+=b.charAt(e);b=y}for(n=i.substring(0,ht),et&&!ri&&(n+="-"),e=ht;e<ut;e++){if(d=i.charAt(e),it==-1){if(ct-e<rt){n+=b;break}}else if(a!=-1&&a<e&&(gt=r),it-e<=rt&&it-e>-1&&(n+=b,e=it),it===e){n+=(p?vt:r)+p;e+=ct-it+1;continue}d===s?(n+=d,gt=d):d===o&&(n+=gt)}if(ct>=ht&&(n+=i.substring(ct+1)),ft||st){for(y=r,e=0,ut=n.length;e<ut;e++)d=n.charAt(e),y+=d==="$"||d==="%"?yt:d;n=y}if(ut=dt.length,ut)for(e=0;e<ut;e++)n=n.replace(k,dt[e])}return n}var d=/dddd|ddd|dd|d|MMMM|MMM|MM|M|yyyy|yy|HH|H|hh|h|mm|m|fff|ff|f|tt|ss|s|"[^"]*"|'[^']*'/g,g=/^(n|c|p|e)(\d*)$/i,nt=/(\\.)|(['][^']*[']?)|(["][^"]*["]?)/g,tt=/\,/g,r="",f=".",c=",",o="#",s="0",k="??",a="en-US",it={}.toString;i.cultures["en-US"]={name:a,numberFormat:{pattern:["-n"],decimals:2,",":",",".":".",groupSize:[3],percent:{pattern:["-n %","n %"],decimals:2,",":",",".":".",groupSize:[3],symbol:"%"},currency:{pattern:["($n)","$n"],decimals:2,",":",",".":".",groupSize:[3],symbol:"$"}},calendars:{standard:{days:{names:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],namesAbbr:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],namesShort:["Su","Mo","Tu","We","Th","Fr","Sa"]},months:{names:["January","February","March","April","May","June","July","August","September","October","November","December"],namesAbbr:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"]},AM:["AM","am","AM"],PM:["PM","pm","PM"],patterns:{d:"M/d/yyyy",D:"dddd, MMMM dd, yyyy",F:"dddd, MMMM dd, yyyy h:mm:ss tt",g:"M/d/yyyy h:mm tt",G:"M/d/yyyy h:mm:ss tt",m:"MMMM dd",M:"MMMM dd",s:"yyyy'-'MM'-'ddTHH':'mm':'ss",t:"h:mm tt",T:"h:mm:ss tt",u:"yyyy'-'MM'-'dd HH':'mm':'ss'Z'",y:"MMMM, yyyy",Y:"MMMM, yyyy"},"/":"/",":":":",firstDay:0,twoDigitYearMax:2029}}};i.culture=function(n){var u=i.cultures,r;if(n!==t)r=v(n)||u[a],r.calendar=r.calendars.standard,u.current=r,y&&rt(r.numberFormat);else return u.current};i.findCulture=v;i.getCulture=w;i.culture(a);var et=9e15,h=function(n,t){var i=Math.pow(10,t||0),r=Math.round(n*i);return r>et?n.toFixed(t):(r/i).toFixed(t)},b=function(n,i,r){if(i){if(it.call(n)==="[object Date]")return ut(n,i,r);if(typeof n===l)return ft(n,i,r)}return n!==t?n:""};y&&(b=function(t,i,r){return n.isPlainObject(r)&&(r=r.name),y.format(t,i,r)});i.format=function(n){var t=arguments;return n.replace(ai,function(n,i,r){var u=t[parseInt(i,10)+1];return b(u,r?r.substring(1):"")})};i._extractFormat=function(n){return n.slice(0,3)==="{0:"&&(n=n.slice(3,n.length-1)),n};i._activeElement=function(){try{return document.activeElement}catch(n){return document.documentElement.activeElement}};i._round=h;i.toString=b}(),function(){function r(n,t,i){return!(n>=t&&n<=i)}function b(n){return n.charAt(0)}function s(t){return n.map(t,b)}function k(n,t){t||n.getHours()!==23||n.setHours(n.getHours()+2)}function d(n){for(var t=0,r=n.length,i=[];t<r;t++)i[t]=(n[t]+"").toLowerCase();return i}function h(n){var t={};for(var i in n)t[i]=d(n[i]);return t}function g(n,i,u){if(!n)return null;var p=function(n){for(var t=0;i[rt]===n;)t++,rt++;return t>0&&(rt-=1),t},nt=function(t){var r=e[t]||new RegExp("^\\d{1,"+t+"}"),i=n.substr(b,t).match(r);return i?(i=i[0],b+=i.length,parseInt(i,10)):null},ht=function(t,i){for(var r=0,o=t.length,f,e,u;r<o;r++)if(f=t[r],e=f.length,u=n.substr(b,e),i&&(u=u.toLowerCase()),u==f)return b+=e,r+1;return null},ft=function(){var t=!1;return n.charAt(b)===i[rt]&&(b++,t=!0),t},y=u.calendars.standard,c=null,tt=null,w=null,o=null,it=null,ut=null,d=null,rt=0,b=0,yt=!1,pt=new Date,ct=y.twoDigitYearMax||2029,et=pt.getFullYear(),l,f,dt,wt,bt,kt,gt,g,lt,at,vt,ot,ni,st;for(i||(i="d"),wt=y.patterns[i],wt&&(i=wt),i=i.split(""),dt=i.length;rt<dt;rt++)if(l=i[rt],yt)l==="'"?yt=!1:ft();else if(l==="d"){if(f=p("d"),y._lowerDays||(y._lowerDays=h(y.days)),w=f<3?nt(2):ht(y._lowerDays[f==3?"namesAbbr":"names"],!0),w===null||r(w,1,31))return null}else if(l==="M"){if(f=p("M"),y._lowerMonths||(y._lowerMonths=h(y.months)),tt=f<3?nt(2):ht(y._lowerMonths[f==3?"namesAbbr":"names"],!0),tt===null||r(tt,1,12))return null;tt-=1}else if(l==="y"){if(f=p("y"),c=nt(f),c===null)return null;f==2&&(typeof ct=="string"&&(ct=et+parseInt(ct,10)),c=et-et%100+c,c>ct&&(c-=100))}else if(l==="h"){if(p("h"),o=nt(2),o==12&&(o=0),o===null||r(o,0,11))return null}else if(l==="H"){if(p("H"),o=nt(2),o===null||r(o,0,23))return null}else if(l==="m"){if(p("m"),it=nt(2),it===null||r(it,0,59))return null}else if(l==="s"){if(p("s"),ut=nt(2),ut===null||r(ut,0,59))return null}else if(l==="f"){if(f=p("f"),st=n.substr(b,f).match(e[3]),d=nt(f),d!==null&&(st=st[0].length,st<3&&(d*=Math.pow(10,3-st)),f>3&&(d=parseInt(d.toString().substring(0,3),10))),d===null||r(d,0,999))return null}else if(l==="t"){if(f=p("t"),lt=y.AM,at=y.PM,f===1&&(lt=s(lt),at=s(at)),bt=ht(at),!bt&&!ht(lt))return null}else if(l==="z"){if(kt=!0,f=p("z"),n.substr(b,1)==="Z"){if(!gt)return null;ft();continue}if((g=n.substr(b,6).match(f>2?v:a),!g)||(g=g[0],b=g.length,g=g.split(":"),vt=parseInt(g[0],10),r(vt,-12,13))||f>2&&(ot=parseInt(g[1],10),isNaN(ot)||r(ot,0,59)))return null}else if(l==="T")gt=ft();else if(l==="'")yt=!0,ft();else if(!ft())return null;return(ni=o!==null||it!==null||ut||null,c===null&&tt===null&&w===null&&ni?(c=et,tt=pt.getMonth(),w=pt.getDate()):(c===null&&(c=et),w===null&&(w=1)),bt&&o<12&&(o+=12),kt?(vt&&(o+=-vt),ot&&(it+=-ot),n=new Date(Date.UTC(c,tt,w,o,it,ut,d))):(n=new Date(c,tt,w,o,it,ut,d),k(n,o)),c<100&&n.setFullYear(c),n.getDate()!==w&&kt===t)?null:n}var u=/\u00A0/g,c=/[eE][\-+]?[0-9]+/,a=/[+|\-]\d{1,2}/,v=/[+|\-]\d{1,2}:\d{2}/,p=/^\/Date\((.*?)\)\/$/,w=/[+-]{1}\d+/,f=["G","g","d","F","D","y","m","T","t"],e={2:/^\d{1,2}/,3:/^\d{1,3}/,4:/^\d{4}/},o={}.toString;i.parseDate=function(n,t,r){if(o.call(n)==="[object Date]")return n;var e=0,u=null,s,c,h;if(n&&n.indexOf("/D")===0&&(u=p.exec(n),u))return u=u[1],h=w.exec(u),u=parseInt(u,10),h&&(u-=parseInt(h[0],10)*i.date.MS_PER_MINUTE),new Date(u);if(r=i.getCulture(r),!t){for(t=[],c=r.calendar.patterns,s=f.length;e<s;e++)t[e]=c[f[e]];e=0;t=["yyyy/MM/dd HH:mm:ss","yyyy/MM/dd HH:mm","yyyy/MM/dd","ddd MMM dd yyyy HH:mm:ss","yyyy-MM-ddTHH:mm:ss.fffffffzzz","yyyy-MM-ddTHH:mm:ss.fffzzz","yyyy-MM-ddTHH:mm:sszzz","yyyy-MM-ddTHH:mmzzz","yyyy-MM-ddTHH:mmzz","yyyy-MM-ddTHH:mm:ss","yyyy-MM-ddTHH:mm","yyyy-MM-dd HH:mm:ss","yyyy-MM-dd HH:mm","yyyy-MM-dd"].concat(t)}for(t=li(t)?t:[t],s=t.length;e<s;e++)if(u=g(n,t[e],r),u)return u;return u};i.parseInt=function(n,t){var r=i.parseFloat(n,t);return r&&(r=r|0),r};i.parseFloat=function(n,t,r){if(!n&&n!==0)return null;if(typeof n===l)return n;n=n.toString();t=i.getCulture(t);var f=t.numberFormat,h=f.percent,a=f.currency,s=a.symbol,v=h.symbol,e=n.indexOf("-"),o,y;return c.test(n)?(n=parseFloat(n.replace(f["."],".")),isNaN(n)&&(n=null),n):e>0?null:(e=e>-1,n.indexOf(s)>-1||r&&r.toLowerCase().indexOf("c")>-1?(f=a,o=f.pattern[0].replace("$",s).split("n"),n.indexOf(o[0])>-1&&n.indexOf(o[1])>-1&&(n=n.replace(o[0],"").replace(o[1],""),e=!0)):n.indexOf(v)>-1&&(y=!0,f=h,s=v),n=n.replace("-","").replace(s,"").replace(u," ").split(f[","].replace(u," ")).join("").replace(f["."],"."),n=parseFloat(n),isNaN(n)?n=null:e&&(n*=-1),n&&y&&(n/=100),n)};y&&(i.parseDate=function(n,t,i){return o.call(n)==="[object Date]"?n:y.parseDate(n,t,i)},i.parseFloat=function(i,r){return typeof i===l?i:i===t||i===null?null:(n.isPlainObject(r)&&(r=r.name),i=y.parseFloat(i,r),isNaN(i)?null:i)})}(),function(){var e,i,f,c;r.scrollbar=function(){var n=document.createElement("div"),t;return n.style.cssText="overflow:scroll;overflow-x:hidden;zoom:1;clear:both",n.innerHTML=" ",document.body.appendChild(n),t=n.offsetWidth-n.scrollWidth,document.body.removeChild(n),t};r.isRtl=function(t){return n(t).closest(".k-rtl").length>0};e=document.createElement("table");try{e.innerHTML="<tr><td><\/td><\/tr>";r.tbodyInnerHtml=!0}catch(l){r.tbodyInnerHtml=!1}r.touch="ontouchstart"in window;r.msPointers=window.MSPointerEvent;r.pointers=window.PointerEvent;var o=r.transitions=!1,h=r.transforms=!1,s="HTMLElement"in window?HTMLElement.prototype:[];r.hasHW3D="WebKitCSSMatrix"in window&&"m11"in new window.WebKitCSSMatrix||"MozPerspective"in document.documentElement.style||"msPerspective"in document.documentElement.style;d(["Moz","webkit","O","ms"],function(){var t=this.toString(),i=typeof e.style[t+"Transition"]===u,n;if(i||typeof e.style[t+"Transform"]===u)return n=t.toLowerCase(),h={css:n!="ms"?"-"+n+"-":"",prefix:t,event:n==="o"||n==="webkit"?n:""},i&&(o=h,o.event=o.event?o.event+"TransitionEnd":"transitionend"),!1});e=null;r.transforms=h;r.transitions=o;r.devicePixelRatio=window.devicePixelRatio===t?1:window.devicePixelRatio;try{r.screenWidth=window.outerWidth||window.screen?window.screen.availWidth:window.innerWidth;r.screenHeight=window.outerHeight||window.screen?window.screen.availHeight:window.innerHeight}catch(l){r.screenWidth=window.screen.availWidth;r.screenHeight=window.screen.availHeight}r.detectOS=function(n){var t=!1,u,f=[],o=!/mobile safari/i.test(n),e={fire:/(Silk)\/(\d+)\.(\d+(\.\d+)?)/,android:/(Android|Android.*(?:Opera|Firefox).*?\/)\s*(\d+)\.(\d+(\.\d+)?)/,iphone:/(iPhone|iPod).*OS\s+(\d+)[\._]([\d\._]+)/,ipad:/(iPad).*OS\s+(\d+)[\._]([\d_]+)/,meego:/(MeeGo).+NokiaBrowser\/(\d+)\.([\d\._]+)/,webos:/(webOS)\/(\d+)\.(\d+(\.\d+)?)/,blackberry:/(BlackBerry|BB10).*?Version\/(\d+)\.(\d+(\.\d+)?)/,playbook:/(PlayBook).*?Tablet\s*OS\s*(\d+)\.(\d+(\.\d+)?)/,wp:/(Windows Phone(?: OS)?)\s(\d+)\.(\d+(\.\d+)?)/,windows:/(MSIE)\s+(\d+)\.(\d+(\.\d+)?)/,tizen:/(tizen).*?Version\/(\d+)\.(\d+(\.\d+)?)/i,sailfish:/(sailfish).*rv:(\d+)\.(\d+(\.\d+)?).*firefox/i,ffos:/(Mobile).*rv:(\d+)\.(\d+(\.\d+)?).*Firefox/},s={ios:/^i(phone|pad|pod)$/i,android:/^android|fire$/i,blackberry:/^blackberry|playbook/i,windows:/windows/,wp:/wp/,flat:/sailfish|ffos|tizen/i,meego:/meego/},h={tablet:/playbook|ipad|fire/i},c={omini:/Opera\sMini/i,omobile:/Opera\sMobi/i,firefox:/Firefox|Fennec/i,mobilesafari:/version\/.*safari/i,chrome:/chrome/i,webkit:/webkit/i,ie:/MSIE|Windows\sPhone/i};for(var i in e)if(e.hasOwnProperty(i)&&(f=n.match(e[i]),f)){if(i=="windows"&&"plugins"in navigator)return!1;t={};t.device=i;t.tablet=ct(i,h,!1);t.browser=ct(n,c,"default");t.name=ct(i,s);t[t.name]=!0;t.majorVersion=f[2];t.minorVersion=f[3].replace("_",".");u=t.minorVersion.replace(".","").substr(0,2);t.flatVersion=t.majorVersion+u+new Array(3-(u.length<3?u.length:2)).join("0");t.appMode=window.navigator.standalone||/file|local|wmapp/.test(window.location.protocol)||typeof PhoneGap!==rt||typeof cordova!==rt;t.android&&(r.devicePixelRatio<1.5&&t.flatVersion<400||o)&&(r.screenWidth>800||r.screenHeight>800)&&(t.tablet=i);break}return t};i=r.mobileOS=r.detectOS(navigator.userAgent);r.wpDevicePixelRatio=i.wp?screen.width/320:0;r.kineticScrollNeeded=i&&(r.touch||r.msPointers||r.pointers);r.hasNativeScrolling=!1;(i.ios&&i.majorVersion>4||i.android&&i.majorVersion>2||i.wp)&&(r.hasNativeScrolling=i);r.mouseAndTouchPresent=r.touch&&!(r.mobileOS.ios||r.mobileOS.android);r.detectBrowser=function(n){var t=!1,i=[],r={webkit:/(chrome)[ \/]([\w.]+)/i,safari:/(webkit)[ \/]([\w.]+)/i,opera:/(opera)(?:.*version|)[ \/]([\w.]+)/i,msie:/(msie\s|trident.*? rv:)([\w.]+)/i,mozilla:/(mozilla)(?:.*? rv:([\w.]+)|)/i};for(var u in r)if(r.hasOwnProperty(u)&&(i=n.match(r[u]),i)){t={};t[u]=!0;t[i[1].toLowerCase()]=!0;t.version=parseInt(document.documentMode||i[2],10);break}return t};r.browser=r.detectBrowser(navigator.userAgent);r.zoomLevel=function(){try{return r.touch?document.documentElement.clientWidth/window.innerWidth:r.browser.msie&&r.browser.version>=10?(top||window).document.documentElement.offsetWidth/(top||window).innerWidth:1}catch(n){return 1}};r.cssBorderSpacing=typeof document.documentElement.style.borderSpacing!="undefined"&&!(r.browser.msie&&r.browser.version<8),function(t){var i,r=parseInt(t.version,10);t.msie?i="ie":t.mozilla?i="ff":t.safari?i="safari":t.webkit?i="webkit":t.opera&&(i="opera");i&&n(document.documentElement).addClass("k-"+i+" k-"+i+r)}(r.browser);r.eventCapture=document.documentElement.addEventListener;f=document.createElement("input");r.placeholder="placeholder"in f;r.input=function(){for(var i=["number","date","time","month","week","datetime","datetime-local"],e=i.length,r="test",u={},n=0,t;n<e;n++)t=i[n],f.setAttribute("type",t),f.value=r,u[t.replace("-","")]=f.type!=="text"&&f.value!==r;return u}();f.style.cssText="float:left;";r.cssFloat=!!f.style.cssFloat;f=null;r.stableSort=function(){var n=[0,1,2,3,4,5,6,7,8,9,10,11,12].sort(function(){return 0});return n[0]===0&&n[1]===1&&n[2]===2&&n[3]===3&&n[4]===4&&n[5]===5&&n[6]===6&&n[7]===7&&n[8]===8&&n[9]===9&&n[10]===10&&n[11]===11&&n[12]===12}();r.matchesSelector=s.webkitMatchesSelector||s.mozMatchesSelector||s.msMatchesSelector||s.oMatchesSelector||s.matchesSelector||function(t){for(var i=document.querySelectorAll?(this.parentNode||document).querySelectorAll(t)||[]:n(t),r=i.length;r--;)if(i[r]==this)return!0;return!1};r.pushState=window.history&&window.history.pushState;c=document.documentMode;r.hashChange="onhashchange"in window&&!(r.browser.msie&&(!c||c<=8))}();ni={left:{reverse:"right"},right:{reverse:"left"},down:{reverse:"up"},up:{reverse:"down"},top:{reverse:"bottom"},bottom:{reverse:"top"},"in":{reverse:"out"},out:{reverse:"in"}};h={};n.extend(h,{Element:function(t){this.element=n(t)},promise:function(n,t){n.is(":visible")||n.css({display:n.data("olddisplay")||"block"}).css("display");t.hide&&n.data("olddisplay",n.css("display")).hide();t.init&&t.init();t.completeCallback&&t.completeCallback(n);n.dequeue()},transitionPromise:function(n,t,r){var u=i.wrap(n);return u.append(t),n.hide(),t.show(),r.completeCallback&&r.completeCallback(n),n},disable:function(){this.promise=this.promiseShim;this.transitionPromise=this.transitionPromiseShim},enable:function(){this.promise=this.animatedPromise;this.transitionPromise=this.animatedTransitionPromise}});h.promiseShim=h.promise;h.transitionPromiseShim=h.transitionPromise;"kendoAnimate"in n.fn||s(n.fn,{kendoStop:function(n,t){return this.stop(n,t)},kendoAnimate:function(n,t,i,r){return ii(this,n,t,i,r)},kendoAnimateTo:function(n,t,i,r,u){return lr(this,n,t,i,r,u)},kendoAddClass:function(n,t){return i.toggleClass(this,n,t,!0)},kendoRemoveClass:function(n,t){return i.toggleClass(this,n,t,!1)},kendoToggleClass:function(n,t,r){return i.toggleClass(this,n,t,r)}});var vr=/&/g,yr=/</g,pr=/>/g;lt=function(n){return n.target};r.touch&&(lt=function(n){var t="originalEvent"in n?n.originalEvent.changedTouches:"changedTouches"in n?n.changedTouches:null;return t?document.elementFromPoint(t[0].clientX,t[0].clientY):n.target},d(["swipe","swipeLeft","swipeRight","swipeUp","swipeDown","doubleTap","tap"],function(t,i){n.fn[i]=function(n){return this.bind(i,n)}}));r.touch?r.mobileOS?(r.mousedown="touchstart",r.mouseup="touchend",r.mousemove="touchmove",r.mousecancel="touchcancel",r.click="touchend",r.resize="orientationchange"):(r.mousedown="mousedown touchstart",r.mouseup="mouseup touchend",r.mousemove="mousemove touchmove",r.mousecancel="mouseleave touchcancel",r.click="click",r.resize="resize"):r.pointers?(r.mousemove="pointermove",r.mousedown="pointerdown",r.mouseup="pointerup",r.mousecancel="pointercancel",r.click="pointerup",r.resize="orientationchange resize"):r.msPointers?(r.mousemove="MSPointerMove",r.mousedown="MSPointerDown",r.mouseup="MSPointerUp",r.mousecancel="MSPointerCancel",r.click="MSPointerUp",r.resize="orientationchange resize"):(r.mousemove="mousemove",r.mousedown="mousedown",r.mouseup="mouseup",r.mousecancel="mouseleave",r.click="click",r.resize="resize");ri=function(n,t){for(var o=t||"d",r,i,e=1,u=0,f=n.length;u<f;u++)i=n[u],i!==""&&(r=i.indexOf("["),r!==0&&(r==-1?i="."+i:(e++,i="."+i.substring(0,r)+" || {})"+i.substring(r))),e++,o+=i+(u<f-1?" || {})":")"));return new Array(e).join("(")+o};ui=/^([a-z]+:)?\/\//i;s(i,{ui:i.ui||{},fx:i.fx||cr,effects:i.effects||h,mobile:i.mobile||{},data:i.data||{},dataviz:i.dataviz||{ui:{roles:{}}},keys:{INSERT:45,DELETE:46,BACKSPACE:8,TAB:9,ENTER:13,ESC:27,LEFT:37,UP:38,RIGHT:39,DOWN:40,END:35,HOME:36,SPACEBAR:32,PAGEUP:33,PAGEDOWN:34,F2:113,F10:121,F12:123},support:i.support||r,animate:i.animate||ii,ns:"",attr:function(n){return"data-"+i.ns+n},wrap:ur,deepExtend:kt,getComputedStyles:er,size:or,toCamelCase:gt,toHyphens:fr,getOffset:i.getOffset||sr,parseEffects:i.parseEffects||hr,toggleClass:i.toggleClass||ar,directions:i.directions||ni,Observable:ht,Class:ut,Template:v,template:ot(v.compile,v),render:ot(v.render,v),stringify:ot(nt.stringify,nt),eventTarget:lt,htmlEncode:wr,isLocalUrl:function(n){return n&&!ui.test(n)},expr:function(n,t,i){return n=n||"",typeof t==u&&(i=t,t=!1),i=i||"d",n&&n.charAt(0)!=="["&&(n="."+n),t?ri(n.split("."),i):i+n},getter:function(n,t){return wt[n]=wt[n]||new Function("d","return "+i.expr(n,t))},setter:function(n){return bt[n]=bt[n]||new Function("d,value",i.expr(n)+"=value")},accessor:function(n){return{get:i.getter(n),set:i.setter(n)}},guid:function(){for(var t="",i,n=0;n<32;n++)i=p.random()*16|0,(n==8||n==12||n==16||n==20)&&(t+="-"),t+=(n==12?4:n==16?i&3|8:i).toString(16);return t},roleSelector:function(n){return n.replace(/(\S+)/g,"["+i.attr("role")+"=$1],").slice(0,-1)},triggeredByInput:function(n){return/^(label|input|textarea|select)$/i.test(n.target.tagName)},logToConsole:function(n){var t=window.console;typeof t!="undefined"&&t.log&&t.log(n)}});w=ht.extend({init:function(n,t){var r=this;r.element=i.jQuery(n).handler(r);ht.fn.init.call(r);t=r.options=s(!0,{},r.options,t);r.element.attr(i.attr("role"))||r.element.attr(i.attr("role"),(t.name||"").toLowerCase());r.element.data("kendo"+t.prefix+t.name,r);r.bind(r.events,t)},events:[],options:{prefix:""},_hasBindingTarget:function(){return!!this.element[0].kendoBindingTarget},_tabindex:function(n){n=n||this.wrapper;var i=this.element,t="tabindex",r=n.attr(t)||i.attr(t);i.removeAttr(t);n.attr(t,isNaN(r)?0:r)},setOptions:function(t){for(var i=this,u=0,f=i.events.length,r;u<f;u++)r=i.events[u],i.options[r]&&t[r]&&i.unbind(r,i.options[r]);n.extend(i.options,t);i.bind(i.events,t)},resize:function(n){var t=this.getSize(),i=this._size;(n||!i||t.width!==i.width||t.height!==i.height)&&(this._resize(t),this.trigger("resize",t),this._size=t)},getSize:function(){return i.dimensions(this.element)},size:function(n){if(n)this.setSize(n);else return this.getSize()},setSize:n.noop,_resize:n.noop,destroy:function(){var n=this;n.element.removeData("kendo"+n.options.prefix+n.options.name);n.element.removeData("handler");n.unbind()}});i.dimensions=function(n,t){var i=n[0];return t&&n.css(t),{width:i.offsetWidth,height:i.offsetHeight}};i.notify=g;var br=/template$/i,kr=/^\s*(?:\{(?:.|\r\n|\n)*\}|\[(?:.|\r\n|\n)*\])\s*$/,dr=/^\{(\d+)(:[^\}]+)?\}/,gr=/([A-Z])/g;i.initWidget=function(r,f,e){var s,a,o,l,y,h,v,c;if((e?e.roles&&(e=e.roles):e=i.ui.roles,r=r.nodeType?r:r[0],h=r.getAttribute("data-"+i.ns+"role"),h)&&(o=h.indexOf(".")===-1?e[h]:i.getter(h)(window),o)){for(c=at(r,"dataSource"),f=n.extend({},fi(r,o.fn.options),f),c&&(f.dataSource=typeof c===u?i.getter(c)(window):c),l=0,y=o.fn.events.length;l<y;l++)a=o.fn.events[l],v=at(r,a),v!==t&&(f[a]=i.getter(v)(window));return s=n(r).data("kendo"+o.fn.options.prefix+o.fn.options.name),s?s.setOptions(f):s=new o(r,f),s}};i.rolesFromNamespaces=function(n){var r=[],t,u;for(n[0]||(n=[i.ui,i.dataviz.ui]),t=0,u=n.length;t<u;t++)r[t]=n[t].roles;return s.apply(null,[{}].concat(r.reverse()))};i.init=function(t){var r=i.rolesFromNamespaces(st.call(arguments,1));n(t).find("[data-"+i.ns+"role]").addBack().each(function(){i.initWidget(this,{},r)})};i.destroy=function(t){n(t).find("[data-"+i.ns+"role]").addBack().each(function(){var t=i.widgetInstance(n(this));t&&t.destroy()})};i.resize=function(t){var u=n(t).find("[data-"+i.ns+"role]").addBack().filter(tu),r;u.length&&(r=n.makeArray(u),r.sort(nu),n.each(r,function(){var t=i.widgetInstance(n(this));t&&t.resize()}))};i.parseOptions=fi;s(i.ui,{Widget:w,roles:{},progress:function(t,r){var u=t.find(".k-loading-mask"),o=i.support,c=o.browser,f,s,h,e;r?u.length||(f=o.isRtl(t),s=f?"right":"left",e=t.scrollLeft(),h=c.webkit?f?t[0].scrollWidth-t.width()-2*e:0:0,u=n("<div class='k-loading-mask'><span class='k-loading-text'>Loading...<\/span><div class='k-loading-image'/><div class='k-loading-color'/><\/div>").width("100%").height("100%").css("top",t.scrollTop()).css(s,Math.abs(e)+h).prependTo(t)):u&&u.remove()},plugin:function(r,f,e){var o=r.fn.options.name,s;f=f||i.ui;e=e||"";f[o]=r;f.roles[o.toLowerCase()]=r;s="getKendo"+e+o;o="kendo"+e+o;n.fn[o]=function(f){var e=this,s;return typeof f===u?(s=st.call(arguments,1),this.each(function(){var r=n.data(this,o),u,h;if(!r)throw new Error(i.format("Cannot call method '{0}' of {1} before it is initialized",f,o));if(u=r[f],typeof u!==c)throw new Error(i.format("Cannot find method '{0}' of {1}",f,o));return h=u.apply(r,s),h!==t?(e=h,!1):void 0})):this.each(function(){new r(this,f)}),e};n.fn[s]=function(){return this.data(o)}}});ei={bind:function(){return this}};oi=w.extend({init:function(n,t){w.fn.init.call(this,n,t);this.element.autoApplyNS();this.wrapper=this.element;this.element.addClass("km-widget")},destroy:function(){w.fn.destroy.call(this);this.element.kendoDestroy()},options:{prefix:"Mobile"},events:[],view:function(){var n=this.element.closest(i.roleSelector("view splitview modalview drawer"));return i.widgetInstance(n,i.mobile.ui)},container:function(){var n=this.element.closest(i.roleSelector("view layout modalview drawer"));return i.widgetInstance(n,i.mobile.ui)||ei}});s(i.mobile,{init:function(n){i.init(n,i.mobile.ui,i.ui,i.dataviz.ui)},ui:{Widget:oi,roles:{},plugin:function(n){i.ui.plugin(n,i.mobile.ui,"Mobile")}}});i.touchScroller=function(t,u){return n(t).map(function(t,f){return f=n(f),r.kineticScrollNeeded&&i.mobile.ui.Scroller&&!f.data("kendoMobileScroller")?(f.kendoMobileScroller(u),f.data("kendoMobileScroller")):!1})[0]};i.preventDefault=function(n){n.preventDefault()};i.widgetInstance=function(n,t){var r=n.data(i.ns+"role"),u,f,s,e,o;if(r)for(r==="content"&&(r="scroller"),u=t?[t.roles[r]]:[i.ui.roles[r],i.dataviz.ui.roles[r],i.mobile.ui.roles[r]],r.indexOf(".")>=0&&(u=[i.getter(r)(window)]),f=0,s=u.length;f<s;f++)if(e=u[f],e&&(o=n.data("kendo"+e.fn.options.prefix+e.fn.options.name),o))return o};i.onResize=function(t){var i=t;r.mobileOS.android&&(i=function(){setTimeout(t,600)});n(window).on(r.resize,i);return i};i.unbindResize=function(t){n(window).off(r.resize,t)};i.attrValue=function(n,t){return n.data(i.ns+t)};i.days={Sunday:0,Monday:1,Tuesday:2,Wednesday:3,Thursday:4,Friday:5,Saturday:6};n.extend(n.expr[":"],{kendoFocusable:function(t){var i=n.attr(t,"tabindex");return iu(t,!isNaN(i)&&i>-1)}});var si=["mousedown","mousemove","mouseenter","mouseleave","mouseover","mouseout","mouseup","click"],uu="label, input, [data-rel=external]",f={setupMouseMute:function(){var t=0,u=si.length,e=document.documentElement,i;if(!f.mouseTrap&&r.eventCapture)for(f.mouseTrap=!0,f.bustClick=!1,f.captureMouse=!1,i=function(t){f.captureMouse&&(t.type==="click"?f.bustClick&&!n(t.target).is(uu)&&(t.preventDefault(),t.stopPropagation()):t.stopPropagation())};t<u;t++)e.addEventListener(si[t],i,!0)},muteMouse:function(n){f.captureMouse=!0;n.data.bustClick&&(f.bustClick=!0);clearTimeout(f.mouseTrapTimeoutID)},unMuteMouse:function(){clearTimeout(f.mouseTrapTimeoutID);f.mouseTrapTimeoutID=setTimeout(function(){f.captureMouse=!1;f.bustClick=!1},400)}},b={down:"touchstart mousedown",move:"mousemove touchmove",up:"mouseup touchend touchcancel",cancel:"mouseleave touchcancel"};r.touch&&(r.mobileOS.ios||r.mobileOS.android)?b={down:"touchstart",move:"touchmove",up:"touchend touchcancel",cancel:"touchcancel"}:r.pointers?b={down:"pointerdown",move:"pointermove",up:"pointerup",cancel:"pointercancel pointerleave"}:r.msPointers&&(b={down:"MSPointerDown",move:"MSPointerMove",up:"MSPointerUp",cancel:"MSPointerCancel MSPointerLeave"});!r.msPointers||"onmspointerenter"in window||n.each({MSPointerEnter:"MSPointerOver",MSPointerLeave:"MSPointerOut"},function(t,i){n.event.special[t]={delegateType:i,bindType:i,handle:function(t){var u,f=this,r=t.relatedTarget,e=t.handleObj;return r&&(r===f||n.contains(f,r))||(t.type=e.origType,u=e.handler.apply(this,arguments),t.type=i),u}}});hi=function(n){return b[n]||n};vt=/([^ ]+)/g;i.applyEventMap=function(n,t){return n=n.replace(vt,hi),t&&(n=n.replace(vt,"$1."+t)),n};et=n.fn.on;s(!0,o,n);o.fn=o.prototype=new n;o.fn.constructor=o;o.fn.init=function(t,i){return i&&i instanceof n&&!(i instanceof o)&&(i=o(i)),n.fn.init.call(this,t,i,ci)};o.fn.init.prototype=o.fn;ci=o(document);s(o.fn,{handler:function(n){return this.data("handler",n),this},autoApplyNS:function(n){return this.data("kendoNS",n||i.guid()),this},on:function(){var t=this,l=t.data("kendoNS"),s,n,e,o,h,c;return arguments.length===1?et.call(t,arguments[0]):(s=t,n=st.call(arguments),typeof n[n.length-1]===rt&&n.pop(),e=n[n.length-1],o=i.applyEventMap(n[0],l),r.mouseAndTouchPresent&&o.search(/mouse|click/)>-1&&this[0]!==document.documentElement&&(f.setupMouseMute(),h=n.length===2?null:n[1],c=o.indexOf("click")>-1&&o.indexOf("touchend")>-1,et.call(this,{touchstart:f.muteMouse,touchend:f.unMuteMouse},h,{bustClick:c})),typeof e===u&&(s=t.data("handler"),e=s[e],n[n.length-1]=function(n){e.call(s,n)}),n[0]=o,et.apply(t,n),t)},kendoDestroy:function(n){return n=n||this.data("kendoNS"),n&&this.off("."+n),this}});i.jQuery=o;i.eventMap=b;i.timezone=function(){function i(i,r){var u,o,s,c=r[3],e=r[4],f=r[5],h=r[8];return(h||(r[8]=h={}),h[i])?h[i]:(isNaN(e)?e.indexOf("last")===0?(u=new Date(Date.UTC(i,n[c]+1,1,f[0]-24,f[1],f[2],0)),o=t[e.substr(4,3)],s=u.getUTCDay(),u.setUTCDate(u.getUTCDate()+o-s-(o>s?7:0))):e.indexOf(">=")>=0&&(u=new Date(Date.UTC(i,n[c],e.substr(5),f[0],f[1],f[2],0)),o=t[e.substr(0,3)],s=u.getUTCDay(),u.setUTCDate(u.getUTCDate()+o-s+(o<s?7:0))):u=new Date(Date.UTC(i,n[c],e,f[0],f[1],f[2],0)),h[i]=u)}function f(n,t,r){var f,e,u;return(t=t[r],!t)?(f=r.split(":"),e=0,f.length>1&&(e=f[0]*60+Number(f[1])),[-1e6,"max","-","Jan",1,[0,0,0],e,"-"]):(u=new Date(n).getUTCFullYear(),t=jQuery.grep(t,function(n){var i=n[0],t=n[1];return i<=u&&(t>=u||i==u&&t=="only"||t=="max")}),t.push(n),t.sort(function(n,t){return typeof n!="number"&&(n=Number(i(u,n))),typeof t!="number"&&(t=Number(i(u,t))),n-t}),t[jQuery.inArray(n,t)-1])}function e(n,t,i){var r=t[i],u,f,e;if(typeof r=="string"&&(r=t[r]),!r)throw new Error('Timezone "'+i+'" is either incorrect, or kendo.timezones.min.js is not included.');for(u=r.length-1;u>=0;u--)if(f=r[u][3],f&&n>f)break;if(e=r[u+1],!e)throw new Error('Timezone "'+i+'" not found on '+n+".");return e}function r(n,t,i,r){typeof n!=l&&(n=Date.UTC(n.getFullYear(),n.getMonth(),n.getDate(),n.getHours(),n.getMinutes(),n.getSeconds(),n.getMilliseconds()));var u=e(n,t,r);return{zone:u,rule:f(n,i,u[1])}}function o(n,t){if(t=="Etc/UTC"||t=="Etc/GMT")return 0;var i=r(n,this.zones,this.rules,t),u=i.zone,f=i.rule;return f?u[0]-f[6]:u[0]}function s(n,t){var f=r(n,this.zones,this.rules,t),e=f.zone,i=f.rule,u=e[2];return u.indexOf("/")>=0?u.split("/")[i&&i[6]?1:0]:u.indexOf("%s")>=0?u.replace("%s",!i||i[7]=="-"?"":i[7]):u}function h(n,t,i){var r,f;return typeof t==u&&(t=this.offset(n,t)),typeof i==u&&(i=this.offset(n,i)),r=n.getTimezoneOffset(),n=new Date(n.getTime()+(t-i)*6e4),f=n.getTimezoneOffset(),new Date(n.getTime()+(f-r)*6e4)}function c(n,t){return this.convert(n,n.getTimezoneOffset(),t)}function a(n,t){return this.convert(n,t,n.getTimezoneOffset())}function v(n){return this.apply(new Date(n),"Etc/UTC")}var n={Jan:0,Feb:1,Mar:2,Apr:3,May:4,Jun:5,Jul:6,Aug:7,Sep:8,Oct:9,Nov:10,Dec:11},t={Sun:0,Mon:1,Tue:2,Wed:3,Thu:4,Fri:5,Sat:6};return{zones:{},rules:{},offset:o,convert:h,apply:c,remove:a,abbr:s,toLocalDate:v}}();i.date=function(){function t(n,t){return t===0&&n.getHours()===23?(n.setHours(n.getHours()+2),!0):!1}function e(n,i,r){var u=n.getHours();r=r||1;i=(i-n.getDay()+7*r)%7;n.setDate(n.getDate()+i);t(n,u)}function c(n,t,i){return n=new Date(n),e(n,t,i),n}function o(n){return new Date(n.getFullYear(),n.getMonth(),1)}function l(n){var t=new Date(n.getFullYear(),n.getMonth()+1,0),i=o(n),r=Math.abs(t.getTimezoneOffset()-i.getTimezoneOffset());return r&&t.setHours(i.getHours()+r/60),t}function i(n){return n=new Date(n.getFullYear(),n.getMonth(),n.getDate(),0,0,0),t(n,0),n}function a(n){return Date.UTC(n.getFullYear(),n.getMonth(),n.getDate(),n.getHours(),n.getMinutes(),n.getSeconds(),n.getMilliseconds())}function r(n){return n.getTime()-i(n)}function v(t,i,u){var e=r(i),o=r(u),f;return!t||e==o?!0:(i>=u&&(u+=n),f=r(t),e>f&&(f+=n),o<e&&(o+=n),f>=e&&f<=o)}function y(t,i,r){var e=i.getTime(),u=r.getTime(),f;return e>=u&&(u+=n),f=t.getTime(),f>=e&&f<=u}function u(i,r){var u=i.getHours();return i=new Date(i),s(i,r*n),t(i,u),i}function s(n,t,i){var u=n.getTimezoneOffset(),r;n.setTime(n.getTime()+t);i||(r=n.getTimezoneOffset()-u,n.setTime(n.getTime()+r*f))}function h(){return i(new Date)}function p(n){return i(n).getTime()==h().getTime()}function w(n){var t=new Date(1980,1,1,0,0,0);return n&&t.setHours(n.getHours(),n.getMinutes(),n.getSeconds(),n.getMilliseconds()),t}var f=6e4,n=864e5;return{adjustDST:t,dayOfWeek:c,setDayOfWeek:e,getDate:i,isInDateRange:y,isInTimeRange:v,isToday:p,nextDay:function(n){return u(n,1)},previousDay:function(n){return u(n,-1)},toUtcTime:a,MS_PER_DAY:n,MS_PER_MINUTE:f,setTime:s,addDays:u,today:h,toInvariantTime:w,firstDayOfMonth:o,lastDayOfMonth:l,getMilliseconds:r}}();i.stripWhitespace=function(n){for(var t=document.createNodeIterator(n,NodeFilter.SHOW_TEXT,function(t){return t.parentNode==n?NodeFilter.FILTER_ACCEPT:NodeFilter.FILTER_REJECT},!1);t.nextNode();)t.referenceNode&&!t.referenceNode.textContent.trim()&&t.referenceNode.parentNode.removeChild(t.referenceNode)};yt=window.requestAnimationFrame||window.webkitRequestAnimationFrame||window.mozRequestAnimationFrame||window.oRequestAnimationFrame||window.msRequestAnimationFrame||function(n){setTimeout(n,1e3/60)};i.animationFrame=function(n){yt.call(window,n)};k=[];i.queueAnimation=function(n){k[k.length]=n;k.length===1&&i.runNextAnimation()};i.runNextAnimation=function(){var n=k.shift();i.animationFrame(function(){n();yt[0]&&i.runNextAnimation()})};i.parseQueryStringParams=function(n){for(var u=n.split("?")[1]||"",r={},i=u.split(/&|=/),f=i.length,t=0;t<f;t+=2)i[t]!==""&&(r[decodeURIComponent(i[t])]=decodeURIComponent(i[t+1]));return r}}(jQuery);typeof kendo_module=="undefined"&&(kendo_module=function(){});kendo_module({id:"core",name:"Core",category:"framework",description:"The core of the Kendo framework."});kendo_module({id:"fx",name:"Effects",category:"framework",description:"Required for animation effects in all Kendo UI widgets.",depends:["core"]}),function(n,t){function ii(n){return parseInt(n,10)}function p(n,t){return ii(n.css(t))}function ir(n){var t=n.effects;return t==="zoom"&&(t="zoom:in fade:in"),t==="fade"&&(t="fade:in"),t==="slide"&&(t="tile:left"),/^slide:(.+)$/.test(t)&&(t="tile:"+RegExp.$1),t==="overlay"&&(t="slideIn:left"),/^overlay:(.+)$/.test(t)&&(t="slideIn:"+RegExp.$1),n.effects=i.parseEffects(t),tr&&t=="tile:left"&&(n.previousDivisor=3),n}function rr(n){var t=[];for(var i in n)t.push(i);return t}function st(n){for(var t in n)rt.indexOf(t)!=-1&&d.indexOf(t)==-1&&delete n[t];return n}function ht(n,t){var r=[],u={},o,i,s,c;for(i in t)o=i.toLowerCase(),c=f&&rt.indexOf(o)!=-1,!h.hasHW3D&&c&&d.indexOf(o)==-1?delete t[i]:(s=t[i],c?r.push(i+"("+s+")"):u[i]=s);return r.length&&(u[e]=r.join(" ")),u}function ri(n,t){var u,i,r;return f?(u=n.css(e),u==gi)?t=="scale"?1:0:(i=u.match(new RegExp(t+"\\s*\\(([\\d\\w\\.]+)")),r=0,i?r=ii(i[1]):(i=u.match(vi)||[0,0,0,0,0],t=t.toLowerCase(),yi.test(t)?r=parseFloat(i[3]/i[2]):t=="translatey"?r=parseFloat(i[4]/i[2]):t=="scale"?r=parseFloat(i[2]):t=="rotate"&&(r=parseFloat(Math.atan2(i[2],i[1])))),r):parseFloat(n.css(t))}function lt(n){return n.charAt(0).toUpperCase()+n.substring(1)}function o(n,t){var i=l.extend(t),r=i.prototype.directions;u[lt(n)]=i;u.Element.prototype[n]=function(n,t,r,u){return new i(this.element,n,t,r,u)};a(r,function(t,r){u.Element.prototype[n+lt(r)]=function(n,t,u){return new i(this.element,r,n,t,u)}})}function fi(n,t,i,r){o(n,{directions:ui,startValue:function(n){return this._startValue=n,this},endValue:function(n){return this._endValue=n,this},shouldHide:function(){return this._shouldHide},prepare:function(n,u){var s=this,f,e,h=this._direction==="out",o=s.element.data(t),c=!(isNaN(o)||o==i);f=c?o:typeof this._startValue!="undefined"?this._startValue:h?i:r;e=typeof this._endValue!="undefined"?this._endValue:h?r:i;this._reverse?(n[t]=e,u[t]=f):(n[t]=f,u[t]=e);s._shouldHide=u[t]===r}})}function hi(n,t){var r=i.directions[t].vertical,u=n[r?nt:ft]()/2+"px";return oi[t].replace("$size",u)}var i=window.kendo,u=i.effects,a=n.each,r=n.extend,ci=n.proxy,h=i.support,vt=h.browser,f=h.transforms,s=h.transitions,li={scale:0,scalex:0,scaley:0,scale3d:0},ai={translate:0,translatex:0,translatey:0,translate3d:0},yt=typeof document.documentElement.style.zoom!="undefined"&&!f,vi=/matrix3?d?\s*\(.*,\s*([\d\.\-]+)\w*?,\s*([\d\.\-]+)\w*?,\s*([\d\.\-]+)\w*?,\s*([\d\.\-]+)\w*?/i,pt=/^(-?[\d\.\-]+)?[\w\s]*,?\s*(-?[\d\.\-]+)?[\w\s]*/i,yi=/translatex?$/i,pi=/(zoom|fade|expand)(\w+)/,wt=/(zoom|fade|expand)/,wi=/[xy]$/i,rt=["perspective","rotate","rotatex","rotatey","rotatez","rotate3d","scale","scalex","scaley","scalez","scale3d","skew","skewx","skewy","translate","translatex","translatey","translatez","translate3d","matrix","matrix3d"],d=["rotate","scale","scalex","scaley","skew","skewx","skewy","translate","translatex","translatey","matrix"],bi={rotate:"deg",scale:"",skew:"px",translate:"px"},g=f.css,ki=Math.round,di="",w="px",gi="none",ut="auto",ft="width",nt="height",bt="hidden",et="origin",kt="abortId",tt="overflow",v="translate",b="position",dt="completeCallback",y=g+"transition",e=g+"transform",nr=g+"backface-visibility",gt=g+"perspective",ot="1500px",ni="perspective("+ot+")",tr=h.mobileOS&&h.mobileOS.majorVersion==7,c={left:{reverse:"right",property:"left",transition:"translatex",vertical:!1,modifier:-1},right:{reverse:"left",property:"left",transition:"translatex",vertical:!1,modifier:1},down:{reverse:"up",property:"top",transition:"translatey",vertical:!0,modifier:1},up:{reverse:"down",property:"top",transition:"translatey",vertical:!0,modifier:-1},top:{reverse:"bottom"},bottom:{reverse:"top"},"in":{reverse:"out",modifier:-1},out:{reverse:"in",modifier:1},vertical:{reverse:"vertical"},horizontal:{reverse:"horizontal"}},ti,ct,l,k,ui,ei,oi,si,it,at;i.directions=c;r(n.fn,{kendoStop:function(n,t){return s?u.stopQueue(this,n||!1,t||!1):this.stop(n,t)}});f&&!s&&(a(d,function(t,i){n.fn[i]=function(t){if(typeof t=="undefined")return ri(this,i);var r=n(this)[0],u=i+"("+t+bi[i.replace(wi,"")]+")";return r.style.cssText.indexOf(e)==-1?n(this).css(e,u):r.style.cssText=r.style.cssText.replace(new RegExp(i+"\\(.*?\\)","i"),u),this};n.fx.step[i]=function(t){n(t.elem)[i](t.now)}}),ti=n.fx.prototype.cur,n.fx.prototype.cur=function(){return d.indexOf(this.prop)!=-1?parseFloat(n(this.elem)[this.prop]()):ti.apply(this,arguments)});i.toggleClass=function(n,t,i,u){return t&&(t=t.split(" "),s&&(i=r({exclusive:"all",duration:400,ease:"ease-out"},i),n.css(y,i.exclusive+" "+i.duration+"ms "+i.ease),setTimeout(function(){n.css(y,"").css(nt)},i.duration)),a(t,function(t,i){n.toggleClass(i,u)})),n};i.parseEffects=function(n,t){var i={};return typeof n=="string"?a(n.split(" "),function(n,r){var o=!wt.test(r),s=r.replace(pi,function(n,t,i){return t+":"+i.toLowerCase()}),u=s.split(":"),f=u[1],e={};u.length>1&&(e.direction=t&&o?c[f].reverse:f);i[u[0]]=e}):a(n,function(n){var r=this.direction;r&&t&&!wt.test(n)&&(this.direction=c[r].reverse);i[n]=this}),i};s&&r(u,{transition:function(t,i,u){var h,l=0,a=t.data("keys")||[],f,c,o;if(u=r({duration:200,ease:"ease-out",complete:null,exclusive:"all"},u),c=!1,o=function(){c||(c=!0,f&&(clearTimeout(f),f=null),t.removeData(kt).dequeue().css(y,"").css(y),u.complete.call(t))},u.duration=n.fx?n.fx.speeds[u.duration]||u.duration:u.duration,h=ht(t,i),n.merge(a,rr(h)),t.data("keys",n.unique(a)).height(),t.css(y,u.exclusive+" "+u.duration+"ms "+u.ease).css(y),t.css(h).css(e),s.event){t.one(s.event,o);u.duration!==0&&(l=500)}f=setTimeout(o,u.duration+l);t.data(kt,f);t.data(dt,o)},stopQueue:function(n,t,r){var u,f=n.data("keys"),e=!r&&f,o=n.data(dt);return e&&(u=i.getComputedStyles(n[0],f)),o&&o(),e&&n.css(u),n.removeData("keys").stop(t)}});ct=i.Class.extend({init:function(n,t){var i=this;i.element=n;i.effects=[];i.options=t;i.restore=[]},run:function(t){var a=this,l,h,v,k=t.length,c=a.element,i=a.options,p=n.Deferred(),o={},y={},w,b,d,g;for(a.effects=t,p.then(n.proxy(a,"complete")),c.data("animating",!0),h=0;h<k;h++)for(l=t[h],l.setReverse(i.reverse),l.setOptions(i),a.addRestoreProperties(l.restore),l.prepare(o,y),b=l.children(),v=0,d=b.length;v<d;v++)b[v].duration(i.duration).run();for(g in i.effects)r(y,i.effects[g].properties);for(c.is(":visible")||r(o,{display:c.data("olddisplay")||"block"}),f&&!i.reset&&(w=c.data("targetTransform"),w&&(o=r(w,o))),o=ht(c,o),f&&!s&&(o=st(o)),c.css(o).css(e),h=0;h<k;h++)t[h].setup();return i.init&&i.init(),c.data("targetTransform",y),u.animate(c,y,r({},i,{complete:p.resolve})),p.promise()},stop:function(){n(this.element).kendoStop(!0,!0)},addRestoreProperties:function(n){for(var i=this.element,t,r=0,u=n.length;r<u;r++)t=n[r],this.restore.push(t),i.data(t)||i.data(t,i.css(t))},restoreCallback:function(){for(var t,i=this.element,n=0,r=this.restore.length;n<r;n++)t=this.restore[n],i.css(t,i.data(t))},complete:function(){var i=this,r=0,t=i.element,u=i.options,e=i.effects,o=e.length;for(t.removeData("animating").dequeue(),u.hide&&t.data("olddisplay",t.css("display")).hide(),this.restoreCallback(),yt&&!f&&setTimeout(n.proxy(this,"restoreCallback"),0);r<o;r++)e[r].teardown();u.completeCallback&&u.completeCallback(t)}});u.promise=function(n,t){var r=[],f,s=new ct(n,t),e=i.parseEffects(t.effects),h,o;t.effects=e;for(o in e)f=u[lt(o)],f&&(h=new f(n,e[o].direction),r.push(h));r[0]?s.run(r):(n.is(":visible")||n.css({display:n.data("olddisplay")||"block"}).css("display"),t.init&&t.init(),n.dequeue(),s.complete())};u.transitionPromise=function(n,t,i){return u.animateTo(n,t,i),n};r(u,{animate:function(i,e,o){var h=o.transition!==!1;delete o.transition;s&&"transition"in u&&h?u.transition(i,e,o):f?i.animate(st(e),{queue:!1,show:!1,hide:!1,duration:o.duration,complete:o.complete}):i.each(function(){var i=n(this),u={};a(rt,function(n,o){var c,y=e?e[o]+" ":null,s,w,k,h,l,a;y&&(s=e,o in li&&e[o]!==t?(c=y.match(pt),f&&r(s,{scale:+c[0]})):o in ai&&e[o]!==t&&(w=i.css(b),k=w=="absolute"||w=="fixed",i.data(v)||(k?i.data(v,{top:p(i,"top")||0,left:p(i,"left")||0,bottom:p(i,"bottom"),right:p(i,"right")}):i.data(v,{top:p(i,"marginTop")||0,left:p(i,"marginLeft")||0})),h=i.data(v),c=y.match(pt),c&&(l=o==v+"y"?0:+c[1],a=o==v+"y"?+c[1]:+c[2],k?(isNaN(h.right)?isNaN(l)||r(s,{left:h.left+l}):isNaN(l)||r(s,{right:h.right-l}),isNaN(h.bottom)?isNaN(a)||r(s,{top:h.top+a}):isNaN(a)||r(s,{bottom:h.bottom-a})):(isNaN(l)||r(s,{marginLeft:h.left+l}),isNaN(a)||r(s,{marginTop:h.top+a})))),!f&&o!="scale"&&o in s&&delete s[o],s&&r(u,s))});vt.msie&&delete u.scale;i.animate(u,{queue:!1,show:!1,hide:!1,duration:o.duration,complete:o.complete})})},animateTo:function(t,i,u){function a(n){i[0].style.cssText="";t.each(function(){this.style.cssText=""});h.mobileOS.android||f.css(tt,c);s||e.css(b,l);u.completeCallback&&u.completeCallback.call(t,n)}var o,f=t.parents().filter(i.parents()).first(),e=n().add(t.parent()).add(i.parent()),s=t.css(b)=="absolute",c,l;s||(l=e.css(b),e.css(b,"absolute"));u=ir(u);h.mobileOS.android||(c=f.css(tt),f.css(tt,"hidden"));n.each(u.effects,function(n,t){o=o||t.direction});u.complete=vt.msie?function(){setTimeout(a,0)}:a;u.previous=u.reverse?i:t;u.reset=!0;(u.reverse?t:i).each(function(){n(this).kendoAnimate(r(!0,{},u));u.complete=null;u.previous=null})}});u.animatedPromise=u.promise;u.animatedTransitionPromise=u.transitionPromise;l=i.Class.extend({init:function(n,t){var i=this;i.element=n;i._direction=t;i.options={};i._additionalEffects=[];i.restore||(i.restore=[])},reverse:function(){return this._reverse=!0,this.run()},play:function(){return this._reverse=!1,this.run()},add:function(n){return this._additionalEffects.push(n),this},direction:function(n){return this._direction=n,this},duration:function(n){return this._duration=n,this},compositeRun:function(){var n=this,t=new ct(n.element,{reverse:n._reverse,duration:n._duration}),i=n._additionalEffects.concat([n]);return t.run(i)},run:function(){if(this._additionalEffects&&this._additionalEffects[0])return this.compositeRun();var o=this,t=o.element,h=0,y=o.restore,w=y.length,c,l=n.Deferred(),i={},a={},v,p=o.children(),b=p.length;for(l.then(n.proxy(o,"_complete")),t.data("animating",!0),h=0;h<w;h++)c=y[h],t.data(c)||t.data(c,t.css(c));for(h=0;h<b;h++)p[h].duration(o._duration).run();return o.prepare(i,a),t.is(":visible")||r(i,{display:t.data("olddisplay")||"block"}),f&&(v=t.data("targetTransform"),v&&(i=r(v,i))),i=ht(t,i),f&&!s&&(i=st(i)),t.css(i).css(e),o.setup(),t.data("targetTransform",a),u.animate(t,a,{duration:o._duration,complete:l.resolve}),l.promise()},stop:function(){for(var t=0,i=this.children(),r=i.length,t=0;t<r;t++)i[t].stop();return n(this.element).kendoStop(!0,!0),this},restoreCallback:function(){for(var t,i=this.element,n=0,r=this.restore.length;n<r;n++)t=this.restore[n],i.css(t,i.data(t))},_complete:function(){var t=this,i=t.element;i.removeData("animating").dequeue();t.restoreCallback();t.shouldHide()&&i.data("olddisplay",i.css("display")).hide();yt&&!f&&setTimeout(n.proxy(t,"restoreCallback"),0);t.teardown()},setOptions:function(n){r(!0,this.options,n)},children:function(){return[]},shouldHide:n.noop,setup:n.noop,prepare:n.noop,teardown:n.noop,directions:[],setReverse:function(n){return this._reverse=n,this}});k=["left","right","up","down"];ui=["in","out"];o("slideIn",{directions:k,divisor:function(n){return this.options.divisor=n,this},prepare:function(n,t){var r=this,u,e=r.element,i=c[r._direction],h=-i.modifier*(i.vertical?e.outerHeight():e.outerWidth()),o=h/(r.options&&r.options.divisor||1)+w,s="0px";r._reverse&&(u=n,n=t,t=u);f?(n[i.transition]=o,t[i.transition]=s):(n[i.property]=o,t[i.property]=s)}});o("tile",{directions:k,init:function(n,t,i){l.prototype.init.call(this,n,t);this.options={previous:i}},previousDivisor:function(n){return this.options.previousDivisor=n,this},children:function(){var n=this,t=n._reverse,r=n.options.previous,e=n.options.previousDivisor||1,u=n._direction,f=[i.fx(n.element).slideIn(u).setReverse(t)];return r&&f.push(i.fx(r).slideIn(c[u].reverse).divisor(e).setReverse(!t)),f}});fi("fade","opacity",1,0);fi("zoom","scale",1,.01);o("slideMargin",{prepare:function(n,t){var r=this,i=r.element,u=r.options,o=i.data(et),s=u.offset,f,e=r._reverse;e||o!==null||i.data(et,parseFloat(i.css("margin-"+u.axis)));f=i.data(et)||0;t["margin-"+u.axis]=e?f:f+s}});o("slideTo",{prepare:function(n,t){var u=this,e=u.element,o=u.options,i=o.offset.split(","),r=u._reverse;f?(t.translatex=r?0:i[0],t.translatey=r?0:i[1]):(t.left=r?0:i[0],t.top=r?0:i[1]);e.css("left")}});o("expand",{directions:["horizontal","vertical"],restore:[tt],prepare:function(n,i){var f=this,e=f.element,o=f.options,s=f._reverse,r=f._direction==="vertical"?nt:ft,h=e[0].style[r],c=e.data(r),u=parseFloat(c||h),l=ki(e.css(r,ut)[r]());n.overflow=bt;u=o&&o.reset?l||u:u||l;i[r]=(s?0:u)+w;n[r]=(s?u:0)+w;c===t&&e.data(r,h)},shouldHide:function(){return this._reverse},teardown:function(){var t=this,i=t.element,n=t._direction==="vertical"?nt:ft,r=i.data(n);(r==ut||r===di)&&setTimeout(function(){i.css(n,ut).css(n)},0)}});ei={position:"absolute",marginLeft:0,marginTop:0,scale:1};o("transfer",{init:function(n,t){this.element=n;this.options={target:t};this.restore=[]},setup:function(){this.element.appendTo(document.body)},prepare:function(n,t){var s=this,i=s.element,g=s.options,nt=s._reverse,h=g.target,u,tt=ri(i,"scale"),l=h.offset(),a=h.outerHeight()/i.outerHeight();r(n,ei);t.scale=1;i.css(e,"scale(1)").css(e);u=i.offset();i.css(e,"scale("+tt+")");var f=0,o=0,v=l.left-u.left,y=l.top-u.top,p=f+i.outerWidth(),b=o,it=v+h.outerWidth(),rt=y,c=(y-o)/(v-f),k=(rt-b)/(it-p),d=(o-b-c*f+k*p)/(k-c),ut=o+c*(d-f);n.top=u.top;n.left=u.left;n.transformOrigin=d+w+" "+ut+w;nt?n.scale=a:t.scale=a}});oi={top:"rect(auto auto $size auto)",bottom:"rect($size auto auto auto)",left:"rect(auto $size auto auto)",right:"rect(auto auto auto $size)"};si={top:{start:"rotatex(0deg)",end:"rotatex(180deg)"},bottom:{start:"rotatex(-180deg)",end:"rotatex(0deg)"},left:{start:"rotatey(0deg)",end:"rotatey(-180deg)"},right:{start:"rotatey(180deg)",end:"rotatey(0deg)"}};o("turningPage",{directions:k,init:function(n,t,i){l.prototype.init.call(this,n,t);this._container=i},prepare:function(n,t){var r=this,f=r._reverse,o=f?c[r._direction].reverse:r._direction,u=si[o];n.zIndex=1;r._clipInHalf&&(n.clip=hi(r._container,i.directions[o].reverse));n[nr]=bt;t[e]=ni+(f?u.start:u.end);n[e]=ni+(f?u.end:u.start)},setup:function(){this._container.append(this.element)},face:function(n){return this._face=n,this},shouldHide:function(){var n=this,t=n._reverse,i=n._face;return t&&!i||!t&&i},clipInHalf:function(n){return this._clipInHalf=n,this},temporary:function(){return this.element.addClass("temp-page"),this}});o("staticPage",{directions:k,init:function(n,t,i){l.prototype.init.call(this,n,t);this._container=i},restore:["clip"],prepare:function(n,t){var i=this,r=i._reverse?c[i._direction].reverse:i._direction;n.clip=hi(i._container,r);n.opacity=.999;t.opacity=1},shouldHide:function(){var n=this,t=n._reverse,i=n._face;return t&&!i||!t&&i},face:function(n){return this._face=n,this}});o("pageturn",{directions:["horizontal","vertical"],init:function(n,t,i,r){l.prototype.init.call(this,n,t);this.options={};this.options.face=i;this.options.back=r},children:function(){var r=this,u=r.options,n=r._direction==="horizontal"?"left":"top",f=i.directions[n].reverse,t=r._reverse,o,s=u.face.clone(!0).removeAttr("id"),h=u.back.clone(!0).removeAttr("id"),e=r.element;return t&&(o=n,n=f,f=o),[i.fx(u.face).staticPage(n,e).face(!0).setReverse(t),i.fx(u.back).staticPage(f,e).setReverse(t),i.fx(s).turningPage(n,e).face(!0).clipInHalf(!0).temporary().setReverse(t),i.fx(h).turningPage(f,e).clipInHalf(!0).temporary().setReverse(t)]},prepare:function(n,t){n[gt]=ot;n.transformStyle="preserve-3d";n.opacity=.999;t.opacity=1},teardown:function(){this.element.find(".temp-page").remove()}});o("flip",{directions:["horizontal","vertical"],init:function(n,t,i,r){l.prototype.init.call(this,n,t);this.options={};this.options.face=i;this.options.back=r},children:function(){var n=this,f=n.options,t=n._direction==="horizontal"?"left":"top",r=i.directions[t].reverse,u=n._reverse,e,o=n.element;return u&&(e=t,t=r,r=e),[i.fx(f.face).turningPage(t,o).face(!0).setReverse(u),i.fx(f.back).turningPage(r,o).setReverse(u)]},prepare:function(n){n[gt]=ot;n.transformStyle="preserve-3d"}});it=i.Class.extend({init:function(){var n=this;n._tickProxy=ci(n._tick,n);n._started=!1},tick:n.noop,done:n.noop,onEnd:n.noop,onCancel:n.noop,start:function(){this.done()||(this._started=!0,i.animationFrame(this._tickProxy))},cancel:function(){this._started=!1;this.onCancel()},_tick:function(){var n=this;n._started&&(n.tick(),n.done()?(n._started=!1,n.onEnd()):i.queueAnimation(n._tickProxy))}});at=it.extend({init:function(n){var t=this;r(t,n);it.fn.init.call(t)},done:function(){return this.timePassed()>=this.duration},timePassed:function(){return Math.min(this.duration,new Date-this.startDate)},moveTo:function(n){var t=this,i=t.movable;t.initial=i[t.axis];t.delta=n.location-t.initial;t.duration=typeof n.duration=="number"?n.duration:300;t.tick=t._easeProxy(n.ease);t.startDate=new Date;t.start()},_easeProxy:function(n){var t=this;return function(){t.movable.moveAxis(t.axis,n(t.timePassed(),t.initial,t.delta,t.duration))}}});r(at,{easeOutExpo:function(n,t,i,r){return n==r?t+i:i*(-Math.pow(2,-10*n/r)+1)+t},easeOutBack:function(n,t,i,r,u){return u=1.70158,i*((n=n/r-1)*n*((u+1)*n+u)+1)+t}});u.Animation=it;u.Transition=at;u.createEffect=o}(window.kendo.jQuery);kendo_module({id:"data",name:"Data source",category:"framework",description:"Powerful component for using local and remote data.Fully supports CRUD, Sorting, Paging, Filtering, Grouping, and Aggregates.",depends:["core"],features:[{id:"data-odata",name:"OData",description:"Support for accessing Open Data Protocol (OData) services.",depends:["data.odata"]},{id:"data-XML",name:"XML",description:"Support for binding to XML.",depends:["data.xml"]}]}),function(n,t){function gt(n,t,i,u){return function(f){var e={};for(var o in f)e[o]=f[o];e.field=u?i+"."+f.field:i;t==r&&n._notifyChange&&n._notifyChange(e);n.trigger(t,e)}}function li(t,i){if(t===i)return!0;var r=n.type(t),f=n.type(i),u;if(r!==f)return!1;if(r==="date")return t.getTime()===i.getTime();if(r!=="object"&&r!=="array")return!1;for(u in t)if(!li(t[u],i[u]))return!1;return!0}function ou(n,t){var i;for(var r in n)if((i=n[r],l(i)&&i.field&&i.field===t)||i===t)return i;return null}function u(n){this.data=n||[]}function it(n,i){if(n){var r=typeof n===o?{field:n,dir:i}:n,u=d(r)?r:r!==t?[r]:[];return pr(u,function(n){return!!n.dir})}}function wi(n){var i,f,r,t,u=n.filters;if(u)for(i=0,f=u.length;i<f;i++)r=u[i],t=r.operator,t&&typeof t===o&&(r.operator=pi[t.toLowerCase()]||t),wi(r)}function ct(n){if(n&&!k(n))return(d(n)||!n.filters)&&(n={logic:"and",filters:d(n)?n:[n]}),wi(n),n}function su(n){return d(n)?n:[n]}function rt(n,i){var r=typeof n===o?{field:n,dir:i}:n,u=d(r)?r:r!==t?[r]:[];return vt(u,function(n){return{field:n.field,dir:n.dir||"asc",aggregates:n.aggregates}})}function hu(n,t){return n&&n.getTime&&t&&t.getTime?n.getTime()===t.getTime():n===t}function cu(n,t,r,u,f){var o,h,s,c,e;for(t=t||[],c=t.length,o=0;o<c;o++)h=t[o],s=h.aggregate,e=h.field,n[e]=n[e]||{},n[e][s]=bi[s.toLowerCase()](n[e][s],r,i.accessor(e),u,f)}function ki(n){return typeof n=="number"&&!isNaN(n)}function lu(n){for(var i=n.length,r=new Array(i),t=0;t<i;t++)r[t]=n[t].toJSON();return r}function di(n,t){t=t||{};var i=new u(n),f=t.aggregate,r=t.filter;return r&&(i=i.filter(r)),i.aggregate(f)}function au(n,t,i,r,u){for(var e,f,o,s=0,h=n.length;s<h;s++){e=n[s];for(f in t)o=u[f],o&&o!==f&&(e[o]=t[f](e),delete e[f])}}function tr(n,t,i,r,u){for(var e,f,o,s=0,h=n.length;s<h;s++){e=n[s];for(f in t)e[f]=i._parse(f,t[f](e)),o=u[f],o&&o!==f&&delete e[o]}}function ir(n,t,i,r,u){for(var f,o,e=0,s=n.length;e<s;e++)f=n[e],o=r[f.field],o&&o!=f.field&&(f.field=o),f.value=i._parse(f.field,f.value),f.hasSubgroups?ir(f.items,t,i,r,u):tr(f.items,t,i,r,u)}function ni(n,t,i,r,u,f){return function(e){return e=n(e),e&&!k(r)&&(st.call(e)==="[object Array]"||e instanceof p||(e=[e]),i(e,r,new t,u,f)),e||[]}}function ii(n,t,i,r){for(var f,e=0,u,o;t.length&&r;)if(f=t[e],u=f.items,o=u.length,n&&n.field===f.field&&n.value===f.value?(n.hasSubgroups&&n.items.length?ii(n.items[n.items.length-1],f.items,i,r):(u=u.slice(i,i+r),n.items=n.items.concat(u)),t.splice(e--,1)):f.hasSubgroups&&u.length?ii(f,u,i,r):(u=u.slice(i,i+r),f.items=u,f.items.length||t.splice(e--,1)),u.length===0?i-=o:(i=0,r-=u.length),++e>=t.length)break;e<t.length&&t.splice(e,t.length-e)}function rr(n){for(var i=[],t=0,r=n.length;t<r;t++)i=n[t].hasSubgroups?i.concat(rr(n[t].items)):i.concat(n[t].items.slice());return i}function ur(n,t){var r,f,u,i;if(t)for(r=0,f=n.length;r<f;r++)u=n[r],i=u.items,u.hasSubgroups?ur(i,t):!i.length||i[0]instanceof t||(i.type=t,i.wrapAll(i,i))}function fr(n,t){for(var i=0,r=n.length;i<r;i++)if(n[i].hasSubgroups){if(fr(n[i].items,t))return!0}else if(t(n[i].items,n[i]))return!0}function vu(n,t){for(var i=0,r=n.length;i<r;i++)if(n[i].uid==t.uid)return t=n[i],n.splice(i,1),t}function er(n,t){for(var i,u,r=n.length-1,f=0;r>=f;r--)u=n[r],i={value:t.get(u.field),field:u.field,items:i?[i]:[t],hasSubgroups:!!i,aggregates:{}};return i}function or(n,t){return t?hr(n,function(n){return n[t.idField]===t.id}):-1}function sr(n,t){return t?hr(n,function(n){return n.uid==t.uid}):-1}function hr(n,t){for(var i=0,r=n.length;i<r;i++)if(t(n[i]))return i;return-1}function cr(n,t){if(n&&!k(n)){var i=n[t],r;return(r=l(i)?i.from||i.field||t:n[t]||t,y(r))?t:r}return t}function lr(n,t){var r,f,i={};for(var u in n)u!=="filters"&&(i[u]=n[u]);if(n.filters)for(i.filters=[],r=0,f=n.filters.length;r<f;r++)i.filters[r]=lr(n.filters[r],t);else i.field=cr(t.fields,i.field);return i}function lt(n,t){for(var o=[],i,u,f,r=0,e=n.length;r<e;r++){i={};u=n[r];for(f in u)i[f]=u[f];i.field=cr(t.fields,i.field);i.aggregates&&d(i.aggregates)&&(i.aggregates=lt(i.aggregates,t));o.push(i)}return o}function yu(t,i){for(var o=n(t)[0].children,h=[],e,c=i[0],l=i[1],u,r,f=0,s=o.length;f<s;f++)(e={},r=o[f],r.disabled)||(e[c.field]=r.text,u=r.attributes.value,u=u&&u.specified?r.value:r.text,e[l.field]=u,h.push(e));return h}function pu(t,i){for(var s=n(t)[0].tBodies[0],h=s?s.rows:[],r,v=i.length,l=[],a,f,e,o,u=0,c=h.length;u<c;u++){for(f={},o=!0,a=h[u].cells,r=0;r<v;r++)e=a[r],e.nodeName.toLowerCase()!=="th"&&(o=!1,f[i[r].field]=e.innerHTML);o||l.push(f)}return l}function ar(n){return function(){var t=this._data,i=h.fn[n].apply(this,dt.call(arguments));return this._data!=t&&this._attachBubbleHandlers(),i}}function vr(t,i){function c(n,t){return n.filter(t).add(n.find(t))}for(var l=n(t).children(),v=[],r,b=i[0].field,y=i[1]&&i[1].field,p=i[2]&&i[2].field,w=i[3]&&i[3].field,f,s,o,h,u,e=0,a=l.length;e<a;e++)r={_loaded:!0},f=l.eq(e),o=f[0].firstChild,u=f.children(),t=u.filter("ul"),u=u.filter(":not(ul)"),s=f.attr("data-id"),s&&(r.id=s),o&&(r[b]=o.nodeType==3?o.nodeValue:u.text()),y&&(r[y]=c(u,"a").attr("href")),w&&(r[w]=c(u,"img").attr("src")),p&&(h=c(u,".k-sprite").prop("className"),r[p]=h&&n.trim(h.replace("k-sprite",""))),t.length&&(r.items=vr(t.eq(0),i)),f.attr("data-hasChildren")=="true"&&(r.hasChildren=!0),v.push(r);return v}var e=n.extend,v=n.proxy,l=n.isPlainObject,k=n.isEmptyObject,d=n.isArray,pr=n.grep,at=n.ajax,vt,yt=n.each,b=n.noop,i=window.kendo,y=i.isFunction,g=i.Observable,ft=i.Class,o="string",pt="function",ei="create",oi="read",si="update",hi="destroy",r="change",ci="sync",wt="get",a="error",tt="requestStart",bt="progress",nt="requestEnd",wr=[ei,oi,si,hi],et=function(n){return n},ot=i.getter,kt=i.stringify,f=Math,br=[].push,kr=[].join,dr=[].pop,gr=[].splice,nu=[].shift,dt=[].slice,tu=[].unshift,st={}.toString,iu=i.support.stableSort,ru=/^\/Date\((.*?)\)\/$/,uu=/(\r+|\n+)/g,fu=/(?=['\\])/g,p=g.extend({init:function(n,t){var i=this;i.type=t||s;g.fn.init.call(i);i.length=n.length;i.wrapAll(n,i)},toJSON:function(){for(var i=this.length,t,r=new Array(i),n=0;n<i;n++)t=this[n],t instanceof s&&(t=t.toJSON()),r[n]=t;return r},parent:b,wrapAll:function(n,t){var r=this,i,u,f=function(){return r};for(t=t||[],i=0,u=n.length;i<u;i++)t[i]=r.wrap(n[i],f);return t},wrap:function(n,t){var i=this,u;return n!==null&&st.call(n)==="[object Object]"&&(u=n instanceof i.type||n instanceof c,u||(n=n instanceof s?n.toJSON():n,n=new i.type(n)),n.parent=t,n.bind(r,function(n){i.trigger(r,{field:n.field,node:n.node,index:n.index,items:n.items||[this],action:n.node?n.action||"itemchange":"itemchange"})})),n},push:function(){var i=this.length,n=this.wrapAll(arguments),t;return t=br.apply(this,n),this.trigger(r,{action:"add",index:i,items:n}),t},slice:dt,join:kr,pop:function(){var n=this.length,t=dr.apply(this);return n&&this.trigger(r,{action:"remove",index:n-1,items:[t]}),t},splice:function(n,t,i){var e=this.wrapAll(dt.call(arguments,2)),u,f,o;if(u=gr.apply(this,[n,t].concat(e)),u.length)for(this.trigger(r,{action:"remove",index:n,items:u}),f=0,o=u.length;f<o;f++)u[f].children&&u[f].unbind(r);return i&&this.trigger(r,{action:"add",index:n,items:e}),u},shift:function(){var t=this.length,n=nu.apply(this);return t&&this.trigger(r,{action:"remove",index:0,items:[n]}),n},unshift:function(){var n=this.wrapAll(arguments),t;return t=tu.apply(this,n),this.trigger(r,{action:"add",index:0,items:n}),t},indexOf:function(n){for(var i=this,t=0,r=i.length;t<r;t++)if(i[t]===n)return t;return-1},forEach:function(n){for(var t=0,i=this.length;t<i;t++)n(this[t],t,this)},map:function(n){for(var t=0,i=[],r=this.length;t<r;t++)i[t]=n(this[t],t,this);return i},filter:function(n){for(var t=0,i=[],r,u=this.length;t<u;t++)r=this[t],n(r,t,this)&&(i[i.length]=r);return i},find:function(n){for(var t=0,i,r=this.length;t<r;t++)if(i=this[t],n(i,t,this))return i},every:function(n){for(var t=0,i,r=this.length;t<r;t++)if(i=this[t],!n(i,t,this))return!1;return!0},some:function(n){for(var t=0,i,r=this.length;t<r;t++)if(i=this[t],n(i,t,this))return!0;return!1},remove:function(n){this.splice(this.indexOf(n),1)},empty:function(){this.splice(0,this.length)}}),s=g.extend({init:function(n){var r=this,u,t,f=function(){return r};g.fn.init.call(this);for(t in n)u=n[t],t.charAt(0)!="_"&&(u=r.wrap(u,t,f)),r[t]=u;r.uid=i.guid()},shouldSerialize:function(n){return this.hasOwnProperty(n)&&n!=="_events"&&typeof this[n]!==pt&&n!=="uid"},forEach:function(n){for(var t in this)this.shouldSerialize(t)&&n(this[t],t)},toJSON:function(){var i={},n;for(var t in this)this.shouldSerialize(t)&&(n=this[t],(n instanceof s||n instanceof p)&&(n=n.toJSON()),i[t]=n);return i},get:function(n){var t=this;return t.trigger(wt,{field:n}),n==="this"?t:i.getter(n,!0)(t)},_set:function(n,t){var o=this,f=n.indexOf(".")>=0,r,u,e;if(f)for(r=n.split("."),u="";r.length>1;){if(u+=r.shift(),e=i.getter(u,!0)(o),e instanceof s)return e.set(r.join("."),t),f;u+="."}return i.setter(n)(o,t),f},set:function(n,t){var u=this,f=i.getter(n,!0)(u);f!==t&&(u.trigger("set",{field:n,value:t})||(!u._set(n,u.wrap(t,n,function(){return u}))||n.indexOf("(")>=0||n.indexOf("[")>=0)&&u.trigger(r,{field:n}))},parent:b,wrap:function(n,t,i){var o=this,u=st.call(n),f,e;return n!=null&&(u==="[object Object]"||u==="[object Array]")&&(f=n instanceof p,e=n instanceof h,u!=="[object Object]"||e||f?(u==="[object Array]"||f||e)&&(f||e||(n=new p(n)),n.parent()!=i()&&n.bind(r,gt(o,r,t,!1))):(n instanceof s||(n=new s(n)),n.parent()!=i()&&(n.bind(wt,gt(o,wt,t,!0)),n.bind(r,gt(o,r,t,!0)))),n.parent=i),n}}),ai={number:function(n){return i.parseFloat(n)},date:function(n){return i.parseDate(n)},boolean:function(n){return typeof n===o?n.toLowerCase()==="true":n!=null?!!n:n},string:function(n){return n!=null?n+"":n},"default":function(n){return n}},eu={string:"",number:0,date:new Date,boolean:!1,"default":""},c=s.extend({init:function(i){var r=this;(!i||n.isEmptyObject(i))&&(i=n.extend({},r.defaults,i));s.fn.init.call(r,i);r.dirty=!1;r.idField&&(r.id=r.get(r.idField),r.id===t&&(r.id=r._defaultId))},shouldSerialize:function(n){return s.fn.shouldSerialize.call(this,n)&&n!=="uid"&&!(this.idField!=="id"&&n==="id")&&n!=="dirty"&&n!=="_accessors"},_parse:function(n,t){var u=this,f=n,r=u.fields||{},i;return n=r[n],n||(n=ou(r,f)),n&&(i=n.parse,!i&&n.type&&(i=ai[n.type.toLowerCase()])),i?i(t):t},_notifyChange:function(n){var t=n.action;(t=="add"||t=="remove")&&(this.dirty=!0)},editable:function(n){return n=(this.fields||{})[n],n?n.editable!==!1:!0},set:function(n,t,i){var r=this;r.editable(n)&&(t=r._parse(n,t),li(t,r.get(n))||(r.dirty=!0,s.fn.set.call(r,n,t,i)))},accept:function(n){var t=this,u=function(){return t},i,r;for(i in n)r=n[i],i.charAt(0)!="_"&&(r=t.wrap(n[i],i,u)),t._set(i,r);t.idField&&(t.id=t.get(t.idField));t.dirty=!1},isNew:function(){return this.id===this._defaultId}}),ht,vi,yi,pi,bi,ti,h,ri,ui,w,fi,yr;c.define=function(n,i){i===t&&(i=n,n=c);var s,r=e({defaults:{}},i),f,u,y,l,a,w,p={},h,v=r.id;if(v&&(r.idField=v),r.id&&delete r.id,v&&(r.defaults[v]=r._defaultId=""),st.call(r.fields)==="[object Array]"){for(a=0,w=r.fields.length;a<w;a++)u=r.fields[a],typeof u===o?p[u]={}:u.field&&(p[u.field]=u);r.fields=p}for(f in r.fields)u=r.fields[f],y=u.type||"default",l=null,h=f,f=typeof u.field===o?u.field:f,u.nullable||(l=r.defaults[h!==f?h:f]=u.defaultValue!==t?u.defaultValue:eu[y.toLowerCase()]),i.id===f&&(r._defaultId=l),r.defaults[h!==f?h:f]=l,u.parse=u.parse||ai[y];return s=n.extend(r),s.define=function(n){return c.define(s,n)},r.fields&&(s.fields=r.fields,s.idField=r.idField),s};ht={selector:function(n){return y(n)?n:ot(n)},compare:function(n){var t=this.selector(n);return function(n,i){return(n=t(n),i=t(i),n==null&&i==null)?0:n==null?-1:i==null?1:n.localeCompare?n.localeCompare(i):n>i?1:n<i?-1:0}},create:function(n){var t=n.compare||this.compare(n.field);return n.dir=="desc"?function(n,i){return t(i,n,!0)}:t},combine:function(n){return function(t,i){for(var u=n[0](t,i),r=1,f=n.length;r<f;r++)u=u||n[r](t,i);return u}}};vi=e({},ht,{asc:function(n){var t=this.selector(n);return function(n,i){var r=t(n),u=t(i);return(r&&r.getTime&&u&&u.getTime&&(r=r.getTime(),u=u.getTime()),r===u)?n.__position-i.__position:r==null?-1:u==null?1:r.localeCompare?r.localeCompare(u):r>u?1:-1}},desc:function(n){var t=this.selector(n);return function(n,i){var u=t(n),r=t(i);return(u&&u.getTime&&r&&r.getTime&&(u=u.getTime(),r=r.getTime()),u===r)?n.__position-i.__position:u==null?1:r==null?-1:r.localeCompare?r.localeCompare(u):u<r?1:-1}},create:function(n){return this[n.dir](n.field)}});vt=function(n,t){for(var r=n.length,u=new Array(r),i=0;i<r;i++)u[i]=t(n[i],i,n);return u};yi=function(){function t(n){return n.replace(fu,"\\").replace(uu,"")}function n(n,i,r,u){var f;return r!=null&&(typeof r===o&&(r=t(r),f=ru.exec(r),f?r=new Date(+f[1]):u?(r="'"+r.toLowerCase()+"'",i="("+i+" || '').toLowerCase()"):r="'"+r+"'"),r.getTime&&(i="("+i+"?"+i+".getTime():"+i+")",r=r.getTime())),i+" "+n+" "+r}return{eq:function(t,i,r){return n("==",t,i,r)},neq:function(t,i,r){return n("!=",t,i,r)},gt:function(t,i,r){return n(">",t,i,r)},gte:function(t,i,r){return n(">=",t,i,r)},lt:function(t,i,r){return n("<",t,i,r)},lte:function(t,i,r){return n("<=",t,i,r)},startswith:function(n,i,r){return r&&(n="("+n+" || '').toLowerCase()",i&&(i=i.toLowerCase())),i&&(i=t(i)),n+".lastIndexOf('"+i+"', 0) == 0"},endswith:function(n,i,r){return r&&(n="("+n+" || '').toLowerCase()",i&&(i=i.toLowerCase())),i&&(i=t(i)),n+".indexOf('"+i+"', "+n+".length - "+(i||"").length+") >= 0"},contains:function(n,i,r){return r&&(n="("+n+" || '').toLowerCase()",i&&(i=i.toLowerCase())),i&&(i=t(i)),n+".indexOf('"+i+"') >= 0"},doesnotcontain:function(n,i,r){return r&&(n="("+n+" || '').toLowerCase()",i&&(i=i.toLowerCase())),i&&(i=t(i)),n+".indexOf('"+i+"') == -1"}}}();u.filterExpr=function(n){for(var l=[],r,f,e=[],o=[],h,c,v=n.filters,s=0,a=v.length;s<a;s++)r=v[s],h=r.field,c=r.operator,r.filters?(f=u.filterExpr(r),r=f.expression.replace(/__o\[(\d+)\]/g,function(n,t){return t=+t,"__o["+(o.length+t)+"]"}).replace(/__f\[(\d+)\]/g,function(n,t){return t=+t,"__f["+(e.length+t)+"]"}),o.push.apply(o,f.operators),e.push.apply(e,f.fields)):(typeof h===pt?(f="__f["+e.length+"](d)",e.push(h)):f=i.expr(h),typeof c===pt?(r="__o["+o.length+"]("+f+", "+r.value+")",o.push(c)):r=yi[(c||"eq").toLowerCase()](f,r.value,r.ignoreCase!==t?r.ignoreCase:!0)),l.push(r);return{expression:"("+l.join({and:" && ",or:" || "}[n.logic])+")",fields:e,operators:o}};pi={"==":"eq",equals:"eq",isequalto:"eq",equalto:"eq",equal:"eq","!=":"neq",ne:"neq",notequals:"neq",isnotequalto:"neq",notequalto:"neq",notequal:"neq","<":"lt",islessthan:"lt",lessthan:"lt",less:"lt","<=":"lte",le:"lte",islessthanorequalto:"lte",lessthanequal:"lte",">":"gt",isgreaterthan:"gt",greaterthan:"gt",greater:"gt",">=":"gte",isgreaterthanorequalto:"gte",greaterthanequal:"gte",ge:"gte",notsubstringof:"doesnotcontain"};u.normalizeFilter=ct;u.prototype={toArray:function(){return this.data},range:function(n,t){return new u(this.data.slice(n,n+t))},skip:function(n){return new u(this.data.slice(n))},take:function(n){return new u(this.data.slice(0,n))},select:function(n){return new u(vt(this.data,n))},order:function(n,t){var i={dir:t};return n&&(n.compare?i.compare=n.compare:i.field=n),new u(this.data.slice(0).sort(ht.create(i)))},orderBy:function(n){return this.order(n,"asc")},orderByDescending:function(n){return this.order(n,"desc")},sort:function(n,t,i){var r,f,u=it(n,t),e=[];if(i=i||ht,u.length){for(r=0,f=u.length;r<f;r++)e.push(i.create(u[r]));return this.orderBy({compare:i.combine(e)})}return this},filter:function(n){var t,r,s,i,h,c=this.data,f,e,l=[],o;if(n=ct(n),!n||n.filters.length===0)return this;for(i=u.filterExpr(n),f=i.fields,e=i.operators,h=o=new Function("d, __f, __o","return "+i.expression),(f.length||e.length)&&(o=function(n){return h(n,f,e)}),t=0,s=c.length;t<s;t++)r=c[t],o(r)&&l.push(r);return new u(l)},group:function(n,t){n=rt(n||[]);t=t||this.data;var f=this,i=new u(f.data),r;return n.length>0&&(r=n[0],i=i.groupBy(r).select(function(i){var f=new u(t).filter([{field:i.field,operator:"eq",value:i.value,ignoreCase:!1}]);return{field:i.field,value:i.value,items:n.length>1?new u(i.items).group(n.slice(1),f.toArray()).toArray():i.items,hasSubgroups:n.length>1,aggregates:f.aggregate(r.aggregates)}})),i},groupBy:function(n){if(k(n)||!this.data.length)return new u([]);for(var t=n.field,o=this._sortForGrouping(t,n.dir||"asc"),c=i.accessor(t),s,r=c.get(o[0],t),f={field:t,value:r,items:[]},h,a=[f],e=0,l=o.length;e<l;e++)s=o[e],h=c.get(s,t),hu(r,h)||(r=h,f={field:t,value:r,items:[]},a.push(f)),f.items.push(s);return new u(a)},_sortForGrouping:function(n,t){var i,f,r=this.data;if(!iu){for(i=0,f=r.length;i<f;i++)r[i].__position=i;for(r=new u(r).sort(n,t,vi).toArray(),i=0,f=r.length;i<f;i++)delete r[i].__position;return r}return this.sort(n,t).toArray()},aggregate:function(n){var t,i,r={};if(n&&n.length)for(t=0,i=this.data.length;t<i;t++)cu(r,n,this.data[t],t,i);return r}};bi={sum:function(n,t,i){return(n||0)+i.get(t)},count:function(n){return(n||0)+1},average:function(n,t,i,r,u){return n=(n||0)+i.get(t),r==u-1&&(n=n/u),n},max:function(n,t,i){var r=i.get(t);return n=n||0,n<r&&(n=r),n},min:function(n,t,i){var r=i.get(t);return ki(n)||(n=r),n>r&&ki(r)&&(n=r),n}};u.process=function(n,i){i=i||{};var r=new u(n),f=i.group,e=rt(f||[]).concat(it(i.sort||[])),o,s=i.filter,h=i.skip,c=i.take;return s&&(r=r.filter(s),o=r.toArray().length),e&&(r=r.sort(e),f&&(n=r.toArray())),h!==t&&c!==t&&(r=r.range(h,c)),f&&(r=r.group(f,n)),{total:o,data:r.toArray()}};var gi=ft.extend({init:function(n){this.data=n.data},read:function(n){n.success(this.data)},update:function(n){n.success(n.data)},create:function(n){n.success(n.data)},destroy:function(n){n.success(n.data)}}),nr=ft.extend({init:function(n){var i=this,t;n=i.options=e({},i.options,n);yt(wr,function(t,i){typeof n[i]===o&&(n[i]={url:n[i]})});i.cache=n.cache?ut.create(n.cache):{find:b,add:b};t=n.parameterMap;i.parameterMap=y(t)?t:function(n){var i={};return yt(n,function(n,r){n in t&&(n=t[n],l(n)&&(r=n.value(r),n=n.key));i[n]=r}),i}},options:{parameterMap:et},create:function(n){return at(this.setup(n,ei))},read:function(i){var f=this,r,o,u,e=f.cache;i=f.setup(i,oi);r=i.success||b;o=i.error||b;u=e.find(i.data);u!==t?r(u):(i.success=function(n){e.add(i.data,n);r(n)},n.ajax(i))},update:function(n){return at(this.setup(n,si))},destroy:function(n){return at(this.setup(n,hi))},setup:function(n,t){n=n||{};var u=this,r,i=u.options[t],f=y(i.data)?i.data(n.data):i.data;return n=e(!0,{},i,n),r=e(!0,{},f,n.data),n.data=u.parameterMap(r,t),y(n.url)&&(n.url=n.url(r)),n}}),ut=ft.extend({init:function(){this._store={}},add:function(n,i){n!==t&&(this._store[kt(n)]=i)},find:function(n){return this._store[kt(n)]},clear:function(){this._store={}},remove:function(n){delete this._store[kt(n)]}});ut.create=function(n){var t={inmemory:function(){return new ut}};return l(n)&&y(n.find)?n:n===!0?new ut:t[n]()};ti=ft.extend({init:function(n){var t=this,s,u,i,y;n=n||{};for(s in n)u=n[s],t[s]=typeof u===o?ot(u):u;if(y=n.modelBase||c,l(t.model)&&(t.model=i=y.define(t.model)),t.model){var w=v(t.data,t),b=v(t.groups,t),k=v(t.serialize,t),f={},h={},p={},e={},a=!1,r;i=t.model;i.fields&&(yt(i.fields,function(n,t){var i;r=n;l(t)&&t.field?r=t.field:typeof t===o&&(r=t);l(t)&&t.from&&(i=t.from);a=a||i&&i!==n||r!==n;h[n]=ot(i||r);p[n]=ot(n);f[i||r]=n;e[n]=i||r}),!n.serialize&&a&&(t.serialize=ni(k,i,au,p,f,e)));t.data=ni(w,i,tr,h,f,e);t.groups=ni(b,i,ir,h,f,e)}},errors:function(n){return n?n.errors:null},parse:et,data:et,total:function(n){return n.length},groups:et,aggregates:function(){return{}},serialize:function(n){return n}});h=g.extend({init:function(n){var u=this,o,f;n&&(f=n.data);n=u.options=e({},u.options,n);u._map={};u._prefetch={};u._data=[];u._pristineData=[];u._ranges=[];u._view=[];u._pristine=[];u._destroyed=[];u._pageSize=n.pageSize;u._page=n.page||(n.pageSize?1:t);u._sort=it(n.sort);u._filter=ct(n.filter);u._group=rt(n.group);u._aggregate=n.aggregate;u._total=n.total;g.fn.init.call(u);u.transport=ri.create(n,f);u.reader=new i.data.readers[n.schema.type||"json"](n.schema);o=u.reader.model||{};u._data=u._observe(u._data);u.bind([a,r,tt,ci,nt,bt],n)},options:{data:[],schema:{modelBase:c},serverSorting:!1,serverPaging:!1,serverFiltering:!1,serverGrouping:!1,serverAggregates:!1,batch:!1},_isServerGrouped:function(){var n=this.group()||[];return this.options.serverGrouping&&n.length},_flatData:function(n){return this._isServerGrouped()?rr(n):n},parent:b,get:function(n){for(var i=this._flatData(this._data),t=0,r=i.length;t<r;t++)if(i[t].id==n)return i[t]},getByUid:function(n){var t,r,i=this._flatData(this._data);if(i)for(t=0,r=i.length;t<r;t++)if(i[t].uid==n)return i[t]},indexOf:function(n){return sr(this._data,n)},at:function(n){return this._data[n]},data:function(n){var i=this;if(n!==t)i._data=this._observe(n),i._ranges=[],i._addRange(i._data),i._total=i._data.length,i._process(i._data);else return i._data},view:function(){return this._view},add:function(n){return this.insert(this._data.length,n)},_createNewModel:function(n){return this.reader.model?new this.reader.model(n):new s(n)},insert:function(n,t){return t||(t=n,n=0),t instanceof c||(t=this._createNewModel(t)),this._isServerGrouped()?this._data.splice(n,0,er(this.group(),t)):this._data.splice(n,0,t),t},remove:function(n){var t,i=this,r=i._isServerGrouped();return this._eachItem(i._data,function(u){return t=vu(u,n),t&&r?(t.isNew&&t.isNew()||i._destroyed.push(t),!0):void 0}),n},sync:function(){var t=this,i,f,e=[],o=[],s=t._destroyed,u=t._flatData(t._data),r;if(t.reader.model){for(i=0,f=u.length;i<f;i++)u[i].isNew()?e.push(u[i]):u[i].dirty&&o.push(u[i]);r=t._send("create",e);r.push.apply(r,t._send("update",o));r.push.apply(r,t._send("destroy",s));n.when.apply(null,r).then(function(){for(var n=0,i=arguments.length;n<i;n++)t._accept(arguments[n]);t._change({action:"sync"});t.trigger(ci)})}},cancelChanges:function(n){var t=this;n instanceof i.data.Model?t._cancelModel(n):(t._destroyed=[],t._data=t._observe(t._pristineData),t.options.serverPaging&&(t._total=t.reader.total(t._pristine)),t._change())},hasChanges:function(){var n,i,t=this._data;if(this._destroyed.length)return!0;for(n=0,i=t.length;n<i;n++)if(t[n].isNew()||t[n].dirty)return!0;return!1},_accept:function(t){var r=this,f=t.models,i=t.response,u=0,s=r._isServerGrouped(),h=r._pristineData,e=t.type,o;if(r.trigger(nt,{response:i,type:e}),i&&!k(i)){if(i=r.reader.parse(i),r._handleCustomErrors(i))return;i=r.reader.data(i);n.isArray(i)||(i=[i])}else i=n.map(f,function(n){return n.toJSON()});for(e==="destroy"&&(r._destroyed=[]),u=0,o=f.length;u<o;u++)e!=="destroy"?(f[u].accept(i[u]),e==="create"?h.push(s?er(r.group(),f[u]):i[u]):e==="update"&&r._updatePristineForModel(f[u],i[u])):r._removePristineForModel(f[u])},_updatePristineForModel:function(n,t){this._executeOnPristineForModel(n,function(n,r){i.deepExtend(r[n],t)})},_executeOnPristineForModel:function(n,t){this._eachPristineItem(function(i){var r=or(i,n);if(r>-1)return t(r,i),!0})},_removePristineForModel:function(n){this._executeOnPristineForModel(n,function(n,t){t.splice(n,1)})},_readData:function(n){var t=this._isServerGrouped()?this.reader.groups:this.reader.data;return t(n)},_eachPristineItem:function(n){this._eachItem(this._pristineData,n)},_eachItem:function(n,t){n&&n.length&&(this._isServerGrouped()?fr(n,t):t(n))},_pristineForModel:function(n){var i,t,r=function(r){return t=or(r,n),t>-1?(i=r[t],!0):void 0};return this._eachPristineItem(r),i},_cancelModel:function(n){var i=this._pristineForModel(n),t;this._eachItem(this._data,function(r){t=sr(r,n);t!=-1&&(!n.isNew()&&i?r[t].accept(i):r.splice(t,1))})},_promise:function(t,i,r){var u=this,f=u.transport;return n.Deferred(function(n){u.trigger(tt,{type:r});f[r].call(f,e({success:function(t){n.resolve({response:t,models:i,type:r})},error:function(t,i,r){n.reject(t);u.error(t,i,r)}},t))}).promise()},_send:function(n,t){var r=this,i,f,u=[],e=r.reader.serialize(lu(t));if(r.options.batch)t.length&&u.push(r._promise({data:{models:e}},t,n));else for(i=0,f=t.length;i<f;i++)u.push(r._promise({data:e[i]},[t[i]],n));return u},read:function(n){var t=this,i=t._params(n);t._queueRequest(i,function(){t.trigger(tt,{type:"read"})?t._dequeueRequest():(t.trigger(bt),t._ranges=[],t.transport.read({data:i,success:v(t.success,t),error:v(t.error,t)}))})},success:function(t){var i=this,r=i.options;if(i.trigger(nt,{response:t,type:"read"}),t=i.reader.parse(t),i._handleCustomErrors(t)){i._dequeueRequest();return}i._pristine=l(t)?n.extend(!0,{},t):t.slice?t.slice(0):t;i._total=i.reader.total(t);i._aggregate&&r.serverAggregates&&(i._aggregateResult=i.reader.aggregates(t));t=i._readData(t);i._pristineData=t.slice(0);i._data=i._observe(t);i._addRange(i._data);i._process(i._data);i._dequeueRequest()},_addRange:function(n){var t=this,i=t._skip||0,r=i+t._flatData(n).length;t._ranges.push({start:i,end:r,data:n});t._ranges.sort(function(n,t){return n.start-t.start})},error:function(n,t,i){this._dequeueRequest();this.trigger(nt,{});this.trigger(a,{xhr:n,status:t,errorThrown:i})},_params:function(n){var t=this,i=e({take:t.take(),skip:t.skip(),page:t.page(),pageSize:t.pageSize(),sort:t._sort,filter:t._filter,group:t._group,aggregate:t._aggregate},n);return t.options.serverPaging||(delete i.take,delete i.skip,delete i.page,delete i.pageSize),t.options.serverGrouping?t.reader.model&&i.group&&(i.group=lt(i.group,t.reader.model)):delete i.group,t.options.serverFiltering?t.reader.model&&i.filter&&(i.filter=lr(i.filter,t.reader.model)):delete i.filter,t.options.serverSorting?t.reader.model&&i.sort&&(i.sort=lt(i.sort,t.reader.model)):delete i.sort,t.options.serverAggregates?t.reader.model&&i.aggregate&&(i.aggregate=lt(i.aggregate,t.reader.model)):delete i.aggregate,i},_queueRequest:function(n,i){var r=this;r._requestInProgress?r._pending={callback:v(i,r),options:n}:(r._requestInProgress=!0,r._pending=t,i())},_dequeueRequest:function(){var n=this;n._requestInProgress=!1;n._pending&&n._queueRequest(n._pending.options,n._pending.callback)},_handleCustomErrors:function(n){if(this.reader.errors){var t=this.reader.errors(n);if(t)return this.trigger(a,{xhr:null,status:"customerror",errorThrown:"custom error",errors:t}),!0}return!1},_observe:function(n){var t=this,i=t.reader.model,u=!1;return i&&n.length&&(u=!(n[0]instanceof i)),n instanceof p?u&&(n.type=t.reader.model,n.wrapAll(n,n)):(n=new p(n,t.reader.model),n.parent=function(){return t.parent()}),t._isServerGrouped()&&ur(n,i),t._changeHandler&&t._data&&t._data instanceof p?t._data.unbind(r,t._changeHandler):t._changeHandler=v(t._change,t),n.bind(r,t._changeHandler)},_change:function(n){var t=this,r,f,i=n?n.action:"",u;if(i==="remove")for(r=0,f=n.items.length;r<f;r++)n.items[r].isNew&&n.items[r].isNew()||t._destroyed.push(n.items[r]);t.options.autoSync&&(i==="add"||i==="remove"||i==="itemchange")?t.sync():(u=parseInt(t._total||t.reader.total(t._pristine),10),i==="add"?u+=n.items.length:i==="remove"?u-=n.items.length:i==="itemchange"||i==="sync"||t.options.serverPaging||(u=t.reader.total(t._pristine)),t._total=u,t._process(t._data,n))},_process:function(n,i){var f=this,e={},o;f.options.serverPaging!==!0&&(e.skip=f._skip,e.take=f._take||f._pageSize,e.skip===t&&f._page!==t&&f._pageSize!==t&&(e.skip=(f._page-1)*f._pageSize));f.options.serverSorting!==!0&&(e.sort=f._sort);f.options.serverFiltering!==!0&&(e.filter=f._filter);f.options.serverGrouping!==!0&&(e.group=f._group);f.options.serverAggregates!==!0&&(e.aggregate=f._aggregate,f._aggregateResult=di(n,e));o=u.process(n,e);f._view=o.data;o.total===t||f.options.serverFiltering||(f._total=o.total);i=i||{};i.items=i.items||f._view;f.trigger(r,i)},_mergeState:function(n){var i=this;return n!==t&&(i._pageSize=n.pageSize,i._page=n.page,i._sort=n.sort,i._filter=n.filter,i._group=n.group,i._aggregate=n.aggregate,i._skip=n.skip,i._take=n.take,i._skip===t&&(i._skip=i.skip(),n.skip=i.skip()),i._take===t&&i._pageSize!==t&&(i._take=i._pageSize,n.take=i._take),n.sort&&(i._sort=n.sort=it(n.sort)),n.filter&&(i._filter=n.filter=ct(n.filter)),n.group&&(i._group=n.group=rt(n.group)),n.aggregate&&(i._aggregate=n.aggregate=su(n.aggregate))),n},query:function(n){var i=this,f,e=i.options.serverSorting||i.options.serverPaging||i.options.serverFiltering||i.options.serverGrouping||i.options.serverAggregates;e||(i._data===t||i._data.length===0)&&!i._destroyed.length?i.read(i._mergeState(n)):i.trigger(tt,{type:"read"})||(i.trigger(bt),f=u.process(i._data,i._mergeState(n)),i.options.serverFiltering||(i._total=f.total!==t?f.total:i._data.length),i._view=f.data,i._aggregateResult=di(i._data,n),i.trigger(nt,{}),i.trigger(r,{items:f.data}))},fetch:function(t){var i=this;return n.Deferred(function(n){var f=function(r){i.unbind(a,u);n.resolve();t&&t.call(i,r)},u=function(t){n.reject(t)};i.one(r,f);i.one(a,u);i._query()}).promise()},_query:function(n){var t=this;t.query(e({},{page:t.page(),pageSize:t.pageSize(),sort:t.sort(),filter:t.filter(),group:t.group(),aggregate:t.aggregate()},n))},next:function(n){var t=this,i=t.page(),r=t.total();if(n=n||{},i&&(!r||!(i+1>t.totalPages())))return t._skip=i*t.take(),i+=1,n.page=i,t._query(n),i},prev:function(n){var t=this,i=t.page();if(n=n||{},i&&i!==1)return t._skip=t._skip-t.take(),i-=1,n.page=i,t._query(n),i},page:function(n){var i=this,r;if(n!==t){n=f.max(f.min(f.max(n,1),i.totalPages()),1);i._query({page:n});return}return r=i.skip(),r!==t?f.round((r||0)/(i.take()||1))+1:t},pageSize:function(n){var i=this;if(n!==t){i._query({pageSize:n,page:1});return}return i.take()},sort:function(n){var i=this;if(n!==t){i._query({sort:n});return}return i._sort},filter:function(n){var i=this;if(n===t)return i._filter;i._query({filter:n,page:1})},group:function(n){var i=this;if(n!==t){i._query({group:n});return}return i._group},total:function(){return parseInt(this._total||0,10)},aggregate:function(n){var i=this;if(n!==t){i._query({aggregate:n});return}return i._aggregate},aggregates:function(){return this._aggregateResult},totalPages:function(){var n=this,t=n.pageSize()||n.total();return f.ceil((n.total()||0)/t)},inRange:function(n,t){var i=this,r=f.min(n+t,i.total());return!i.options.serverPaging&&i.data.length>0?!0:i._findRange(n,r).length>0},lastRange:function(){var n=this._ranges;return n[n.length-1]||{start:0,end:0,data:[]}},firstItemUid:function(){var n=this._ranges;return n.length&&n[0].data.length&&n[0].data[0].uid},range:function(n,i){n=f.min(n||0,this.total());var r=this,e=f.max(f.floor(n/i),0)*i,u=f.min(e+i,r.total()),o;if(o=r._findRange(n,f.min(n+i,r.total())),o.length){r._skip=n>r.skip()?f.min(u,(r.totalPages()-1)*r.take()):e;r._take=i;var s=r.options.serverPaging,h=r.options.serverSorting,c=r.options.serverFiltering;try{r.options.serverPaging=!0;r._isServerGrouped()||r.group()&&r.group().length||(r.options.serverSorting=!0);r.options.serverFiltering=!0;s&&(r._data=o=r._observe(o));r._process(o)}finally{r.options.serverPaging=s;r.options.serverSorting=h;r.options.serverFiltering=c}return}i!==t&&(r._rangeExists(e,u)?e<n&&r.prefetch(u,i,function(){r.range(n,i)}):r.prefetch(e,i,function(){n>e&&u<r.total()&&!r._rangeExists(u,f.min(u+i,r.total()))?r.prefetch(u,i,function(){r.range(n,i)}):r.range(n,i)}))},_findRange:function(n,i){for(var f=this,p=f._ranges,r,w=[],c,l,s,b,a,v,h=f.options,g=h.serverSorting||h.serverPaging||h.serverFiltering||h.serverGrouping||h.serverAggregates,y,e,d,o=0,k=p.length;o<k;o++)if(r=p[o],n>=r.start&&n<=r.end){for(e=0,c=o;c<k;c++)if(r=p[c],y=f._flatData(r.data),y.length&&n+e>=r.start&&(b=r.data,a=r.end,g||(d=rt(f.group()||[]).concat(it(f.sort()||[])),v=u.process(r.data,{sort:d,filter:f.filter()}),y=b=v.data,v.total!==t&&(a=v.total)),l=0,n+e>r.start&&(l=n+e-r.start),s=y.length,a>i&&(s=s-(a-i)),e+=s-l,w=f._mergeGroups(w,b,l,s),i<=r.end&&e==i-n))return w;break}return[]},_mergeGroups:function(n,t,i,r){if(this._isServerGrouped()){var u=t.toJSON(),f;return n.length&&(f=n[n.length-1]),ii(f,u,i,r),n.concat(u)}return n.concat(t.slice(i,r))},skip:function(){var n=this;return n._skip===t?n._page!==t?(n._page-1)*(n.take()||1):t:n._skip},take:function(){return this._take||this._pageSize},_prefetchSuccessHandler:function(n,t,i){var u=this;return function(f){var h=!1,e={start:n,end:t,data:[]},o,c,s;if(u._dequeueRequest(),u.trigger(nt,{response:f,type:"read"}),f=u.reader.parse(f),s=u._readData(f),s.length){for(o=0,c=u._ranges.length;o<c;o++)if(u._ranges[o].start===n){h=!0;e=u._ranges[o];break}h||u._ranges.push(e)}e.data=u._observe(s);e.end=e.start+u._flatData(e.data).length;u._ranges.sort(function(n,t){return n.start-t.start});u._total=u.reader.total(f);i&&s.length?i():u.trigger(r,{})}},prefetch:function(n,t,i){var r=this,u=f.min(n+t,r.total()),e={take:t,skip:n,page:n/t+1,pageSize:t,sort:r._sort,filter:r._filter,group:r._group,aggregate:r._aggregate};r._rangeExists(n,u)?i&&i():(clearTimeout(r._timeout),r._timeout=setTimeout(function(){r._queueRequest(e,function(){r.trigger(tt,{type:"read"})?r._dequeueRequest():r.transport.read({data:r._params(e),success:r._prefetchSuccessHandler(n,u,i)})})},100))},_rangeExists:function(n,t){for(var f=this,r=f._ranges,i=0,u=r.length;i<u;i++)if(r[i].start<=n&&r[i].end>=t)return!0;return!1}});ri={};ri.create=function(n,t){var u,r=n.transport;return r?(r.read=typeof r.read===o?{url:r.read}:r.read,n.type&&(i.data.transports[n.type]&&!l(i.data.transports[n.type])?u=new i.data.transports[n.type](e(r,{data:t})):r=e(!0,{},i.data.transports[n.type],r),n.schema=e(!0,{},i.data.schemas[n.type],n.schema)),u||(u=y(r.read)?r:new nr(r))):u=new gi({data:n.data}),u};h.create=function(n){n=n&&n.push?{data:n}:n;var t=n||{},u=t.data,r=t.fields,c=t.table,l=t.select,f,a,s={},o;if(u||!r||t.transport||(c?u=pu(c,r):l&&(u=yu(l,r))),i.data.Model&&r&&(!t.schema||!t.schema.model)){for(f=0,a=r.length;f<a;f++)o=r[f],o.type&&(s[o.field]=o);k(s)||(t.schema=e(!0,t.schema,{model:{fields:s}}))}return t.data=u,t instanceof h?t:new h(t)};ui=c.define({init:function(n){var t=this,r=t.hasChildren||n&&n.hasChildren,f="items",u={};i.data.Model.fn.init.call(t,n);typeof t.children===o&&(f=t.children);u={schema:{data:f,model:{hasChildren:r,id:t.idField}}};typeof t.children!==o&&e(u,t.children);u.data=n;r||(r=u.schema.data);typeof r===o&&(r=i.getter(r));y(r)&&(t.hasChildren=!!r.call(t,t));t._childrenOptions=u;t.hasChildren&&t._initChildren();t._loaded=!!(n&&(n[f]||n._loaded))},_initChildren:function(){var n=this,t,i,u;n.children instanceof w||(t=n.children=new w(n._childrenOptions),i=t.transport,u=i.parameterMap,i.parameterMap=function(t){return t[n.idField||"id"]=n.id,u&&(t=u(t)),t},t.parent=function(){return n},t.bind(r,function(t){t.node=t.node||n;n.trigger(r,t)}),t.bind(a,function(t){var i=n.parent();i&&(t.node=t.node||n,i.trigger(a,t))}),n._updateChildrenField())},append:function(n){this._initChildren();this.loaded(!0);this.children.add(n)},hasChildren:!1,level:function(){for(var n=this.parentNode(),t=0;n&&n.parentNode;)t++,n=n.parentNode?n.parentNode():null;return t},_updateChildrenField:function(){var n=this._childrenOptions.schema.data;this[n||"items"]=this.children.data()},_childrenLoaded:function(){this._loaded=!0;this._updateChildrenField()},load:function(){var i={},u="_query",n;if(this.hasChildren){this._initChildren();n=this.children;i[this.idField||"id"]=this.id;this._loaded||(n._data=t,u="read");n.one(r,v(this._childrenLoaded,this));n[u](i)}else this.loaded(!0)},parentNode:function(){var n=this.parent();return n.parent()},loaded:function(n){if(n!==t)this._loaded=n;else return this._loaded},shouldSerialize:function(n){return c.fn.shouldSerialize.call(this,n)&&n!=="children"&&n!=="_loaded"&&n!=="hasChildren"&&n!=="_childrenOptions"}});w=h.extend({init:function(n){var t=ui.define({children:n});h.fn.init.call(this,e(!0,{},{schema:{modelBase:t,model:t}},n));this._attachBubbleHandlers()},_attachBubbleHandlers:function(){var n=this;n._data.bind(a,function(t){n.trigger(a,t)})},remove:function(n){var t=n.parentNode(),i=this,r;return t&&t._initChildren&&(i=t.children),r=h.fn.remove.call(i,n),t&&!i.data().length&&(t.hasChildren=!1),r},success:ar("success"),data:ar("data"),insert:function(n,t){var i=this.parent();return i&&i._initChildren&&(i.hasChildren=!0,i._initChildren()),h.fn.insert.call(this,n,t)},_find:function(n,t){var r,e,i,u,f;if(i=h.fn[n].call(this,t),i)return i;if(u=this._flatData(this.data()),u)for(r=0,e=u.length;r<e;r++)if((f=u[r].children,f instanceof w)&&(i=f[n](t),i))return i},get:function(n){return this._find("get",n)},getByUid:function(n){return this._find("getByUid",n)}});w.create=function(n){n=n&&n.push?{data:n}:n;var t=n||{},i=t.data,r=t.fields,u=t.list;return i&&i._dataSource?i._dataSource:(i||!r||t.transport||u&&(i=vr(u,r)),t.data=i,t instanceof w?t:new w(t))};fi=i.Observable.extend({init:function(n,t,r){i.Observable.fn.init.call(this);this._prefetching=!1;this.dataSource=n;this.prefetch=!r;var u=this;n.bind("change",function(){u._change()});this._syncWithDataSource();this.setViewSize(t)},setViewSize:function(n){this.viewSize=n;this._recalculate()},at:function(n){var i=this.pageSize,r,u;if(n>=this.total()){this.trigger("endreached",{index:n});return}return this.useRanges?(this.useRanges&&((n<this.dataOffset||n>this.skip+i)&&(u=Math.floor(n/i)*i,this.range(u)),n===this.prefetchThreshold&&this._prefetch(),n===this.midPageThreshold?this.range(this.nextMidRange):n===this.nextPageThreshold?this.range(this.nextFullRange):n===this.pullBackThreshold&&(this.offset===this.skip?this.range(this.previousMidRange):this.range(this.previousFullRange)),r=this.dataSource.at(n-this.dataOffset)),r===t&&this.trigger("endreached",{index:n}),r):this.dataSource.view()[n]},indexOf:function(n){return this.dataSource.data().indexOf(n)+this.dataOffset},total:function(){return parseInt(this.dataSource.total(),10)},next:function(){var n=this,t=n.pageSize,i=n.skip-n.viewSize,r=f.max(f.floor(i/t),0)*t+t;this.offset=i;this.dataSource.prefetch(r,t,function(){n._goToRange(i,!0)})},range:function(n){if(this.offset!==n){var r=this,t=this.pageSize,u=f.max(f.floor(n/t),0)*t+t,i=this.dataSource;this.offset=n;this._recalculate();i.inRange(n,t)?this._goToRange(n):this.prefetch&&i.prefetch(u,t,function(){r._goToRange(n,!0)})}},syncDataSource:function(){var n=this.offset;this.offset=null;this.range(n)},destroy:function(){this.unbind()},_prefetch:function(){var i=this,n=this.pageSize,t=this.skip+n,r=this.dataSource;r.inRange(t,n)||this._prefetching||!this.prefetch||(this._prefetching=!0,this.trigger("prefetching",{skip:t,take:n}),r.prefetch(t,n,function(){i._prefetching=!1;i.trigger("prefetched",{skip:t,take:n})}))},_goToRange:function(n,t){this.offset===n&&(this.dataOffset=n,this._expanding=t,this.dataSource.range(n,this.pageSize))},_change:function(){var n=this.dataSource,t=n.firstItemUid();this.length=this.useRanges?n.lastRange().end:n.view().length;this._firstItemUid===t&&this.useRanges||(this._syncWithDataSource(),this._recalculate(),this.trigger("reset",{offset:this.offset}));this.trigger("resize");this._expanding&&this.trigger("expand");delete this._expanding},_syncWithDataSource:function(){var n=this.dataSource;this._firstItemUid=n.firstItemUid();this.dataOffset=this.offset=n.skip()||0;this.pageSize=n.pageSize();this.useRanges=n.options.serverPaging},_recalculate:function(){var t=this.pageSize,r=this.offset,i=this.viewSize,n=Math.ceil(r/t)*t;this.skip=n;this.midPageThreshold=n+t-1;this.nextPageThreshold=n+i-1;this.prefetchThreshold=n+Math.floor(t/3*2);this.pullBackThreshold=this.offset-1;this.nextMidRange=n+t-i;this.nextFullRange=n;this.previousMidRange=r-i;this.previousFullRange=n-t}});yr=i.Observable.extend({init:function(n,t){var r=this;i.Observable.fn.init.call(r);this.dataSource=n;this.batchSize=t;this._total=0;this.buffer=new fi(n,t*3);this.buffer.bind({endreached:function(n){r.trigger("endreached",{index:n.index})},prefetching:function(n){r.trigger("prefetching",{skip:n.skip,take:n.take})},prefetched:function(n){r.trigger("prefetched",{skip:n.skip,take:n.take})},reset:function(){r._total=0;r.trigger("reset")},resize:function(){r._total=Math.ceil(this.length/r.batchSize);r.trigger("resize",{total:r.total(),offset:this.offset})}})},syncDataSource:function(){this.buffer.syncDataSource()},at:function(n){var i=this.buffer,f=n*this.batchSize,o=this.batchSize,e=[],u,r;for(i.offset>f&&i.at(i.offset-1),r=0;r<o;r++){if(u=i.at(f+r),u===t)break;e.push(u)}return e},total:function(){return this._total},destroy:function(){this.buffer.destroy();this.unbind()}});e(!0,i.data,{readers:{json:ti},Query:u,DataSource:h,HierarchicalDataSource:w,Node:ui,ObservableObject:s,ObservableArray:p,LocalTransport:gi,RemoteTransport:nr,Cache:ut,DataReader:ti,Model:c,Buffer:fi,BatchBuffer:yr})}(window.kendo.jQuery);kendo_module({id:"validator",name:"Validator",category:"web",description:"The Validator offers an easy way to do a client-side form validation.",depends:["core"]}),function(n){function nt(i){var r=t.ui.validator.ruleResolvers||{},u={};for(var f in r)n.extend(!0,u,r[f].resolve(i));return u}function tt(n){return n.replace(/&/g,"&").replace(/"/g,'"').replace(/'/g,"'").replace(/</g,"<").replace(/>/g,">")}function it(n){return(n=(n+"").split("."),n.length>1)?n[1].length:0}function rt(t){return n.parseHTML?n(n.parseHTML(t)):n(t)}var t=window.kendo,f=t.ui.Widget,i=".kendoValidator",u="k-invalid-msg",p=new RegExp(u,"i"),w="k-invalid",b=/^((([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+(\.([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+)*)|((\x22)((((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(([\x01-\x08\x0b\x0c\x0e-\x1f\x7f]|\x21|[\x23-\x5b]|[\x5d-\x7e]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(\\([\x01-\x09\x0b\x0c\x0d-\x7f]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]))))*(((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(\x22)))@((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))$/i,k=/^(https?|ftp):\/\/(((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:)*@)?(((\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5]))|((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?)(:\d*)?)(\/((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)+(\/(([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)*)*)?)?(\?((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|[\uE000-\uF8FF]|\/|\?)*)?(\#((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|\/|\?)*)?$/i,r=":input:not(:button,[type=submit],[type=reset],[disabled],[readonly])",o=":checkbox:not([disabled],[readonly])",e="[type=number],[type=range]",s="blur",h="name",c="form",l="novalidate",d=n.proxy,a=function(n,t){return typeof t=="string"&&(t=new RegExp("^(?:"+t+")$")),t.test(n)},v=function(n,t,i){var r=n.val();return n.filter(t).length&&r!==""?a(r,i):!0},g=function(n,t){return n.length?n[0].attributes[t]!=null:!1},y;t.ui.validator||(t.ui.validator={rules:{},messages:{}});y=f.extend({init:function(i,r){var u=this,e=nt(i);r=r||{};r.rules=n.extend({},t.ui.validator.rules,e.rules,r.rules);r.messages=n.extend({},t.ui.validator.messages,e.messages,r.messages);f.fn.init.call(u,i,r);u._errorTemplate=t.template(u.options.errorTemplate);u.element.is(c)&&u.element.attr(l,l);u._errors={};u._attachEvents()},events:["validate"],options:{name:"Validator",errorTemplate:'<span class="k-widget k-tooltip k-tooltip-validation"><span class="k-icon k-warning"> <\/span> #=message#<\/span>',messages:{required:"{0} is required",pattern:"{0} is not valid",min:"{0} should be greater than or equal to {1}",max:"{0} should be smaller than or equal to {1}",step:"{0} is not valid",email:"{0} is not valid email",url:"{0} is not valid URL",date:"{0} is not valid date"},rules:{required:function(n){var i=n.filter("[type=checkbox]").length&&!n.is(":checked"),t=n.val();return!(g(n,"required")&&(t===""||!t||i))},pattern:function(n){return n.filter("[type=text],[type=email],[type=url],[type=tel],[type=search],[type=password]").filter("[pattern]").length&&n.val()!==""?a(n.val(),n.attr("pattern")):!0},min:function(n){if(n.filter(e+",["+t.attr("type")+"=number]").filter("[min]").length&&n.val()!==""){var i=parseFloat(n.attr("min"))||0,r=t.parseFloat(n.val());return i<=r}return!0},max:function(n){if(n.filter(e+",["+t.attr("type")+"=number]").filter("[max]").length&&n.val()!==""){var i=parseFloat(n.attr("max"))||0,r=t.parseFloat(n.val());return i>=r}return!0},step:function(n){if(n.filter(e+",["+t.attr("type")+"=number]").filter("[step]").length&&n.val()!==""){var f=parseFloat(n.attr("min"))||0,i=parseFloat(n.attr("step"))||1,o=parseFloat(n.val()),r=it(i),u;return r?(u=Math.pow(10,r),(o-f)*u%(i*u)/Math.pow(100,r)==0):(o-f)%i==0}return!0},email:function(n){return v(n,"[type=email],["+t.attr("type")+"=email]",b)},url:function(n){return v(n,"[type=url],["+t.attr("type")+"=url]",k)},date:function(n){return n.filter("[type^=date],["+t.attr("type")+"=date]").length&&n.val()!==""?t.parseDate(n.val(),n.attr(t.attr("format")))!==null:!0}},validateOnBlur:!0},destroy:function(){f.fn.destroy.call(this);this.element.off(i)},_submit:function(n){return this.validate()?!0:(n.stopPropagation(),n.stopImmediatePropagation(),n.preventDefault(),!1)},_attachEvents:function(){var t=this;if(t.element.is(c))t.element.on("submit"+i,d(t._submit,t));if(t.options.validateOnBlur)if(t.element.is(r)){t.element.on(s+i,function(){t.validateInput(t.element)});if(t.element.is(o))t.element.on("click"+i,function(){t.validateInput(t.element)})}else{t.element.on(s+i,r,function(){t.validateInput(n(this))});t.element.on("click"+i,o,function(){t.validateInput(n(this))})}},validate:function(){var i,n,t=!1,f,u;if(this._errors={},this.element.is(r))t=this.validateInput(this.element);else{for(u=!1,i=this.element.find(r),n=0,f=i.length;n<f;n++)this.validateInput(i.eq(n))||(u=!0);t=!u}return this.trigger("validate",{valid:t}),t},validateInput:function(t){var r;t=n(t);var i=this,c=i._errorTemplate,s=i._checkValidity(t),f=s.valid,l="."+u,e=t.attr(h)||"",a=i._findMessageContainer(e).add(t.next(l)).hide(),o;return t.removeAttr("aria-invalid"),f||(o=i._extractMessage(t,s.key),i._errors[e]=o,r=rt(c({message:tt(o)})),i._decorateMessageContainer(r,e),a.replaceWith(r).length||r.insertAfter(t),r.show(),t.attr("aria-invalid",!0)),t.toggleClass(w,!f),f},hideMessages:function(){var i=this,t="."+u,n=i.element;n.is(r)?n.next(t).hide():n.find(t).hide()},_findMessageContainer:function(i){for(var u,h,e=t.ui.validator.messageLocators,o,r=n(),s=this.element[0].getElementsByTagName("*"),f=0,c=s.length;f<c;f++)u=s[f],p.test(u.className)&&(h=u.getAttribute(t.attr("for")),h===i&&(r=r.add(u)));for(o in e)r=r.add(e[o].locate(this.element,i));return r},_decorateMessageContainer:function(n,i){var r=t.ui.validator.messageLocators,f;n.addClass(u).attr(t.attr("for"),i||"");for(f in r)r[f].decorate(n,i);n.attr("role","alert")},_extractMessage:function(n,i){var u=this,r=u.options.messages[i],f=n.attr(h);return r=t.isFunction(r)?r(n):r,t.format(n.attr(t.attr(i+"-msg"))||n.attr("validationMessage")||n.attr("title")||r||"",f,n.attr(i))},_checkValidity:function(n){var t=this.options.rules;for(var i in t)if(!t[i](n))return{valid:!1,key:i};return{valid:!0}},errors:function(){var n=[],t=this._errors;for(var i in t)n.push(t[i]);return n}});t.ui.plugin(y)}(window.kendo.jQuery);kendo_module({id:"userevents",name:"User Events",category:"framework",depends:["core"],hidden:!0}),function(n){function it(n,t){var i=n.x.location,r=n.y.location,u=t.x.location,f=t.y.location,e=i-u,o=r-f;return{center:{x:(i+u)/2,y:(r+f)/2},distance:Math.sqrt(e*e+o*o)}}function h(n){var t=[],r=n.originalEvent,f=n.currentTarget,e=0,s,o,u;if(n.api)t.push({id:2,event:n,target:n.target,currentTarget:n.target,location:n});else if(n.type.match(/touch/))for(o=r?r.changedTouches:[],s=o.length;e<s;e++)u=o[e],t.push({location:u,event:n,target:u.target,currentTarget:f,id:u.identifier});else i.pointers||i.msPointers?t.push({location:r,event:n,target:n.target,currentTarget:f,id:r.pointerId}):t.push({id:1,event:n,target:n.target,currentTarget:f,location:n});return t}function ct(t){var i,r,u;t.preventDefault();i=n(t.data.root);r=i.closest(".k-widget").parent();r[0]||(r=i.parent());u=n.extend(!0,{},t,{target:i[0]});r.trigger(n.Event(t.type,u))}function ut(n){for(var r=t.eventMap.up.split(" "),i=0,u=r.length;i<u;i++)n(r[i])}var t=window.kendo,i=t.support,ft=window.document,c=t.Class,l=t.Observable,u=n.now,f=n.extend,a=i.mobileOS,et=a&&a.android,v=800,ot=i.browser.msie?5:0,y="press",p="hold",w="select",b="start",e="move",o="end",k="cancel",s="tap",d="release",st="gesturestart",g="gesturechange",nt="gestureend",tt="gesturetap",rt=c.extend({init:function(n,t){var i=this;i.axis=n;i._updateLocationData(t);i.startLocation=i.location;i.velocity=i.delta=0;i.timeStamp=u()},move:function(n){var t=this,i=n["page"+t.axis],r=u(),f=r-t.timeStamp||1;(i||!et)&&(t.delta=i-t.location,t._updateLocationData(n),t.initialDelta=i-t.startLocation,t.velocity=t.delta/f,t.timeStamp=r)},_updateLocationData:function(n){var t=this,i=t.axis;t.location=n["page"+i];t.client=n["client"+i];t.screen=n["screen"+i]}}),ht=c.extend({init:function(n,t,i){var r=this;f(r,{x:new rt("X",i.location),y:new rt("Y",i.location),userEvents:n,target:t,currentTarget:i.currentTarget,initialTouch:i.target,id:i.id,_moved:!1,_finished:!1});r.press=function(){r._trigger(y,i);r._holdTimeout=setTimeout(function(){r._trigger(p,i)},n.minHold)}},move:function(n){var t=this;if(!t._finished){if(t.x.move(n.location),t.y.move(n.location),!t._moved){if(t._withinIgnoreThreshold())return;if(r.current&&r.current!==t.userEvents)return t.dispose();t._start(n)}t._finished||t._trigger(e,n)}},end:function(n){var t=this;(t.endTime=u(),t._finished)||(t._finished=!0,t._moved?t._trigger(o,n):t._trigger(s,n),clearTimeout(t._holdTimeout),t._trigger(d,n),t.dispose())},dispose:function(){var t=this,r=t.userEvents,i=r.touches;t._finished=!0;i.splice(n.inArray(t,i),1)},skip:function(){this.dispose()},cancel:function(){this.dispose()},isMoved:function(){return this._moved},_start:function(n){clearTimeout(this._holdTimeout);this.startTime=u();this._moved=!0;this._trigger(b,n)},_trigger:function(n,t){var i=this,r=t.event,u={touch:i,x:i.x,y:i.y,target:i.target,event:r};i.userEvents.notify(n,u)&&r.preventDefault()},_withinIgnoreThreshold:function(){var n=this.x.initialDelta,t=this.y.initialDelta;return Math.sqrt(n*n+t*t)<=this.userEvents.threshold}}),r=l.extend({init:function(r,u){var h=this,a,c=t.guid(),it,rt;u=u||{};a=h.filter=u.filter;h.threshold=u.threshold||ot;h.minHold=u.minHold||v;h.touches=[];h._maxTouches=u.multiTouch?2:1;h.allowSelection=u.allowSelection;h.captureUpIfMoved=u.captureUpIfMoved;h.eventNS=c;r=n(r).handler(h);l.fn.init.call(h);f(h,{element:r,surface:u.global?n(ft.documentElement):n(u.surface||r),stopPropagation:u.stopPropagation,pressed:!1});h.surface.handler(h).on(t.applyEventMap("move",c),"_move").on(t.applyEventMap("up cancel",c),"_end");r.on(t.applyEventMap("down",c),a,"_start");if((i.pointers||i.msPointers)&&r.css("-ms-touch-action","pinch-zoom double-tap-zoom"),u.preventDragEvent)r.on(t.applyEventMap("dragstart",c),t.preventDefault);r.on(t.applyEventMap("mousedown selectstart",c),a,{root:r},"_select");h.captureUpIfMoved&&i.eventCapture&&(it=h.surface[0],rt=n.proxy(h.preventIfMoving,h),ut(function(n){it.addEventListener(n,rt,!0)}));h.bind([y,p,s,b,e,o,d,k,st,g,nt,tt,w],u)},preventIfMoving:function(n){this._isMoved()&&n.preventDefault()},destroy:function(){var n=this,t;n._destroyed||(n._destroyed=!0,n.captureUpIfMoved&&i.eventCapture&&(t=n.surface[0],ut(function(i){t.removeEventListener(i,n.preventIfMoving)})),n.element.kendoDestroy(n.eventNS),n.surface.kendoDestroy(n.eventNS),n.element.removeData("handler"),n.surface.removeData("handler"),n._disposeAll(),n.unbind(),delete n.surface,delete n.element)},capture:function(){r.current=this},cancel:function(){this._disposeAll();this.trigger(k)},notify:function(n,t){var r=this,i=r.touches;if(this._isMultiTouch()){switch(n){case e:n=g;break;case o:n=nt;break;case s:n=tt}f(t,{touches:i},it(i[0],i[1]))}return this.trigger(n,t)},press:function(n,t,i){this._apiCall("_start",n,t,i)},move:function(n,t){this._apiCall("_move",n,t)},end:function(n,t){this._apiCall("_end",n,t)},_isMultiTouch:function(){return this.touches.length>1},_maxTouchesReached:function(){return this.touches.length>=this._maxTouches},_disposeAll:function(){for(var n=this.touches;n.length>0;)n.pop().dispose()},_isMoved:function(){return n.grep(this.touches,function(n){return n.isMoved()}).length},_select:function(n){(!this.allowSelection||this.trigger(w,{event:n}))&&ct(n)},_start:function(t){var i=this,f=0,s=i.filter,e,o=h(t),c=o.length,u;if(!i._maxTouchesReached())for(r.current=null,i.currentTarget=t.currentTarget,i.stopPropagation&&t.stopPropagation();f<c;f++){if(i._maxTouchesReached())break;(u=o[f],e=s?n(u.currentTarget):i.element,e.length)&&(u=new ht(i,e,u),i.touches.push(u),u.press(),i._isMultiTouch()&&i.notify("gesturestart",{}))}},_move:function(n){this._eachTouch("move",n)},_end:function(n){this._eachTouch("end",n)},_eachTouch:function(n,t){for(var c=this,e={},o=h(t),s=c.touches,r,u,f,i=0;i<s.length;i++)r=s[i],e[r.id]=r;for(i=0;i<o.length;i++)u=o[i],f=e[u.id],f&&f[n](u)},_apiCall:function(t,i,r,u){this[t]({api:!0,pageX:i,pageY:r,clientX:i,clientY:r,target:u||this.element,stopPropagation:n.noop,preventDefault:n.noop})}});r.minHold=function(n){v=n};t.getTouches=h;t.touchDelta=it;t.UserEvents=r}(window.kendo.jQuery);kendo_module({id:"draganddrop",name:"Drag & drop",category:"framework",description:"Drag & drop functionality for any DOM element.",depends:["core","userevents"]}),function(n,t){function dt(t,i){try{return n.contains(t,i)||t==i}catch(r){return!1}}function g(n){return kt?l.elementFromPoint(n.x.screen,n.y.screen):l.elementFromPoint(n.x.client,n.y.client)}function w(n,t){return parseInt(n.css(t),10)||0}function st(n,t){return Math.min(Math.max(n,t.min),t.max)}function ht(n,t){var i=b(n),r=i.left+w(n,"borderLeftWidth")+w(n,"paddingLeft"),u=i.top+w(n,"borderTopWidth")+w(n,"paddingTop"),f=r+n.width()-t.outerWidth(!0),e=u+n.height()-t.outerHeight(!0);return{x:{min:r,max:f},y:{min:u,max:e}}}function gt(n,i,r){for(var f,e,u=0,o=i&&i.length,s=r&&r.length;n&&n.parentNode;){for(u=0;u<o;u++)if(f=i[u],f.element[0]===n)return{target:f,targetElement:n};for(u=0;u<s;u++)if(e=r[u],v.matchesSelector.call(n,e.options.filter))return{target:e,targetElement:n};n=n.parentNode}return t}var i=window.kendo,v=i.support,l=window.document,pt=i.Class,o=i.ui.Widget,u=i.Observable,wt=i.UserEvents,f=n.proxy,r=n.extend,b=i.getOffset,y={},s={},h={},e,k=v.mobileOS,bt=k&&k.android,kt=bt&&k.browser=="chrome",tt="keyup",a="change",it="dragstart",rt="hold",ut="drag",ft="dragend",et="dragcancel",d="dragenter",p="dragleave",ot="drop",ni=u.extend({init:function(t,r){var e=this,o=t[0];e.capture=!1;o.addEventListener?(n.each(i.eventMap.down.split(" "),function(){o.addEventListener(this,f(e._press,e),!0)}),n.each(i.eventMap.up.split(" "),function(){o.addEventListener(this,f(e._release,e),!0)})):(n.each(i.eventMap.down.split(" "),function(){o.attachEvent(this,f(e._press,e))}),n.each(i.eventMap.up.split(" "),function(){o.attachEvent(this,f(e._release,e))}));u.fn.init.call(e);e.bind(["press","release"],r||{})},captureNext:function(){this.capture=!0},cancelCapture:function(){this.capture=!1},_press:function(n){var t=this;t.trigger("press");t.capture&&n.preventDefault()},_release:function(n){var t=this;t.trigger("release");t.capture&&(n.preventDefault(),t.cancelCapture())}}),ct=u.extend({init:function(t){var i=this;u.fn.init.call(i);i.forcedEnabled=!1;n.extend(i,t);i.scale=1;i.horizontal?(i.measure="offsetWidth",i.scrollSize="scrollWidth",i.axis="x"):(i.measure="offsetHeight",i.scrollSize="scrollHeight",i.axis="y")},makeVirtual:function(){n.extend(this,{virtual:!0,forcedEnabled:!0,_virtualMin:0,_virtualMax:0})},virtualSize:function(n,t){(this._virtualMin!==n||this._virtualMax!==t)&&(this._virtualMin=n,this._virtualMax=t,this.update())},outOfBounds:function(n){return n>this.max||n<this.min},forceEnabled:function(){this.forcedEnabled=!0},getSize:function(){return this.container[0][this.measure]},getTotal:function(){return this.element[0][this.scrollSize]},rescale:function(n){this.scale=n},update:function(n){var t=this,u=t.virtual?t._virtualMax:t.getTotal(),r=u*t.scale,i=t.getSize();t.max=t.virtual?-t._virtualMin:0;t.size=i;t.total=r;t.min=Math.min(t.max,i-r);t.minScale=i/u;t.centerOffset=(r-i)/2;t.enabled=t.forcedEnabled||r>i;n||t.trigger(a,t)}}),ti=u.extend({init:function(n){var t=this;u.fn.init.call(t);t.x=new ct(r({horizontal:!0},n));t.y=new ct(r({horizontal:!1},n));t.container=n.container;t.forcedMinScale=n.minScale;t.maxScale=n.maxScale||100;t.bind(a,n)},rescale:function(n){this.x.rescale(n);this.y.rescale(n);this.refresh()},centerCoordinates:function(){return{x:Math.min(0,-this.x.centerOffset),y:Math.min(0,-this.y.centerOffset)}},refresh:function(){var n=this;n.x.update();n.y.update();n.enabled=n.x.enabled||n.y.enabled;n.minScale=n.forcedMinScale||Math.min(n.x.minScale,n.y.minScale);n.fitScale=Math.max(n.x.minScale,n.y.minScale);n.trigger(a)}}),lt=u.extend({init:function(n){var t=this;r(t,n);u.fn.init.call(t)},dragMove:function(n){var t=this,i=t.dimension,r=t.axis,u=t.movable,f=u[r]+n;i.enabled&&((f<i.min&&n<0||f>i.max&&n>0)&&(n*=t.resistance),u.translateAxis(r,n),t.trigger(a,t))}}),ii=pt.extend({init:function(n){var t=this,u,f,e,i;r(t,{elastic:!0},n);e=t.elastic?.5:0;i=t.movable;t.x=u=new lt({axis:"x",dimension:t.dimensions.x,resistance:e,movable:i});t.y=f=new lt({axis:"y",dimension:t.dimensions.y,resistance:e,movable:i});t.userEvents.bind(["move","end","gesturestart","gesturechange"],{gesturestart:function(n){t.gesture=n;t.offset=t.dimensions.container.offset()},gesturechange:function(n){var h=t.gesture,c=h.center,l=n.center,r=n.distance/h.distance,v=t.dimensions.minScale,a=t.dimensions.maxScale,e,o,s;i.scale<=v&&r<1&&(r+=(1-r)*.8);i.scale*r>=a&&(r=a/i.scale);o=i.x+t.offset.left;s=i.y+t.offset.top;e={x:(o-c.x)*r+l.x-o,y:(s-c.y)*r+l.y-s};i.scaleWith(r);u.dragMove(e.x);f.dragMove(e.y);t.dimensions.rescale(i.scale);t.gesture=n;n.preventDefault()},move:function(n){n.event.target.tagName.match(/textarea|input/i)||(u.dimension.enabled||f.dimension.enabled?(u.dragMove(n.x.delta),f.dragMove(n.y.delta),n.preventDefault()):n.touch.skip())},end:function(n){n.preventDefault()}})}}),ri=v.transitions.prefix+"Transform",nt,at,c,vt,yt;nt=v.hasHW3D?function(n,t,i){return"translate3d("+n+"px,"+t+"px,0) scale("+i+")"}:function(n,t,i){return"translate("+n+"px,"+t+"px) scale("+i+")"};at=u.extend({init:function(t){var i=this;u.fn.init.call(i);i.element=n(t);i.element[0].style.webkitTransformOrigin="left top";i.x=0;i.y=0;i.scale=1;i._saveCoordinates(nt(i.x,i.y,i.scale))},translateAxis:function(n,t){this[n]+=t;this.refresh()},scaleTo:function(n){this.scale=n;this.refresh()},scaleWith:function(n){this.scale*=n;this.refresh()},translate:function(n){this.x+=n.x;this.y+=n.y;this.refresh()},moveAxis:function(n,t){this[n]=t;this.refresh()},moveTo:function(n){r(this,n);this.refresh()},refresh:function(){var n=this,r=n.x,u=n.y,t;n.round&&(r=Math.round(r),u=Math.round(u));t=nt(r,u,n.scale);t!=n.coordinates&&(i.support.browser.msie&&i.support.browser.version<10?(n.element[0].style.position="absolute",n.element[0].style.left=n.x+"px",n.element[0].style.top=n.y+"px"):n.element[0].style[ri]=t,n._saveCoordinates(t),n.trigger(a))},_saveCoordinates:function(n){this.coordinates=n}});c=o.extend({init:function(n,t){var i=this,r;o.fn.init.call(i,n,t);r=i.options.group;r in s?s[r].push(i):s[r]=[i]},events:[d,p,ot],options:{name:"DropTarget",group:"default"},destroy:function(){var i=this.options.group,t=s[i]||h[i],n;if(t.length>1){for(o.fn.destroy.call(this),n=0;n<t.length;n++)if(t[n]==this){t.splice(n,1);break}}else c.destroyGroup(i)},_trigger:function(n,t){var i=this,u=y[i.options.group];if(u)return i.trigger(n,r({},t.event,{draggable:u,dropTarget:t.dropTarget}))},_over:function(n){this._trigger(d,n)},_out:function(n){this._trigger(p,n)},_drop:function(n){var t=this,i=y[t.options.group];i&&(i.dropped=!t._trigger(ot,n))}});c.destroyGroup=function(n){var t=s[n]||h[n],i;if(t){for(i=0;i<t.length;i++)o.fn.destroy.call(t[i]);t.length=0;delete s[n];delete h[n]}};c._cache=s;vt=c.extend({init:function(n,t){var i=this,r;o.fn.init.call(i,n,t);r=i.options.group;r in h?h[r].push(i):h[r]=[i]},options:{name:"DropTargetArea",group:"default",filter:null}});yt=o.extend({init:function(n,t){var r=this;o.fn.init.call(r,n,t);r._activated=!1;r.userEvents=new wt(r.element,{global:!0,stopPropagation:!0,filter:r.options.filter,threshold:r.options.distance,start:f(r._start,r),hold:f(r._hold,r),move:f(r._drag,r),end:f(r._end,r),cancel:f(r._cancel,r)});r._afterEndHandler=f(r._afterEnd,r);r.captureEscape=function(n){n.keyCode===i.keys.ESC&&(r._trigger(et,{event:n}),r.userEvents.cancel())}},events:[rt,it,ut,ft,et],options:{name:"Draggable",distance:5,group:"default",cursorOffset:null,axis:null,container:null,holdToDrag:!1,dropped:!1},cancelHold:function(){this._activated=!1},_updateHint:function(t){var r=this,i,o=r.options,u=r.boundaries,e=o.axis,f=r.options.cursorOffset;f?i={left:t.x.location+f.left,top:t.y.location+f.top}:(r.hintOffset.left+=t.x.delta,r.hintOffset.top+=t.y.delta,i=n.extend({},r.hintOffset));u&&(i.top=st(i.top,u.y),i.left=st(i.left,u.x));e==="x"?delete i.top:e==="y"&&delete i.left;r.hint.css(i)},_start:function(t){var r=this,u=r.options,o=u.container,f=u.hint,e;if(u.holdToDrag&&!r._activated){r.userEvents.cancel();return}r.currentTarget=t.target;r.currentTargetOffset=b(r.currentTarget);f&&(r.hint&&r.hint.stop(!0,!0).remove(),r.hint=i.isFunction(f)?n(f.call(r,r.currentTarget)):f,e=b(r.currentTarget),r.hintOffset=e,r.hint.css({position:"absolute",zIndex:2e4,left:e.left,top:e.top}).appendTo(l.body));y[u.group]=r;r.dropped=!1;o&&(r.boundaries=ht(o,r.hint));r._trigger(it,t)&&(r.userEvents.cancel(),r._afterEnd());n(l).on(tt,r.captureEscape)},_hold:function(n){this.currentTarget=n.target;this._trigger(rt,n)?this.userEvents.cancel():this._activated=!0},_drag:function(t){var i=this;t.preventDefault();i._withDropTarget(t,function(i,u){if(!i){e&&(e._trigger(p,r(t,{dropTarget:n(e.targetElement)})),e=null);return}if(e){if(u===e.targetElement)return;e._trigger(p,r(t,{dropTarget:n(e.targetElement)}))}i._trigger(d,r(t,{dropTarget:n(u)}));e=r(i,{targetElement:u})});i._trigger(ut,t);i.hint&&i._updateHint(t)},_end:function(t){var i=this;i._withDropTarget(t,function(i,u){i&&(i._drop(r({},t,{dropTarget:n(u)})),e=null)});i._trigger(ft,t);i._cancel(t.event)},_cancel:function(){var n=this;n._activated=!1;n.hint&&!n.dropped?setTimeout(function(){n.hint.stop(!0,!0).animate(n.currentTargetOffset,"fast",n._afterEndHandler)},0):n._afterEnd()},_trigger:function(n,t){var i=this;return i.trigger(n,r({},t.event,{x:t.x,y:t.y,currentTarget:i.currentTarget,dropTarget:t.dropTarget}))},_withDropTarget:function(n,t){var r=this,i,u,o=r.options,f=s[o.group],e=h[o.group];(f&&f.length||e&&e.length)&&(i=g(n),r.hint&&dt(r.hint[0],i)&&(r.hint.hide(),i=g(n),i||(i=g(n)),r.hint.show()),u=gt(i,f,e),u?t(u.target,u.targetElement):t())},destroy:function(){var n=this;o.fn.destroy.call(n);n._afterEnd();n.userEvents.destroy()},_afterEnd:function(){var t=this;t.hint&&t.hint.remove();delete y[t.options.group];t.trigger("destroy");n(l).off(tt,t.captureEscape)}});i.ui.plugin(c);i.ui.plugin(vt);i.ui.plugin(yt);i.TapCapture=ni;i.containerBoundaries=ht;r(i.ui,{Pane:ii,PaneDimensions:ti,Movable:at})}(window.kendo.jQuery);kendo_module({id:"reorderable",name:"Reorderable",category:"framework",depends:["core","draganddrop"],advanced:!0}),function(n){function u(t,i){t=n(t);i?t.find(".k-drag-status").removeClass("k-add").addClass("k-denied"):t.find(".k-drag-status").removeClass("k-denied").addClass("k-add")}var t=window.kendo,i=t.ui.Widget,r="change",f="k-reorderable",e=i.extend({init:function(e,o){var s=this,h,c=t.guid()+"-reorderable";i.fn.init.call(s,e,o);e=s.element.addClass(f);o=s.options;s.draggable=h=o.draggable||new t.ui.Draggable(e,{group:c,filter:o.filter,hint:o.hint});s.reorderDropCue=n('<div class="k-reorder-cue"><div class="k-icon k-i-arrow-s"><\/div><div class="k-icon k-i-arrow-n"><\/div><\/div>');e.find(h.options.filter).kendoDropTarget({group:h.options.group,dragenter:function(n){if(s._draggable){var i=this.element,r,f=i[0]===s._draggable[0];u(n.draggable.hint,f);f||(r=t.getOffset(i),s.reorderDropCue.css({height:i.outerHeight(),top:r.top,left:r.left+(i.index()>s._draggable.index()?i.outerWidth():0)}).appendTo(document.body))}},dragleave:function(n){u(n.draggable.hint,!0);s.reorderDropCue.remove()},drop:function(){if(s._draggable){var t=s._draggable[0],i=this.element[0],n;t!==i&&(n=e.find(h.options.filter),s.trigger(r,{element:s._draggable,oldIndex:n.index(t),newIndex:n.index(i)}))}}});h.bind(["dragcancel","dragend","dragstart"],{dragcancel:function(){s.reorderDropCue.remove();s._draggable=null},dragend:function(){s.reorderDropCue.remove();s._draggable=null},dragstart:function(n){s._draggable=n.currentTarget}})},options:{name:"Reorderable",filter:"*"},events:[r],destroy:function(){var n=this;i.fn.destroy.call(n);n.draggable&&n.draggable.destroy();t.destroy(n.element)}});t.ui.plugin(e)}(window.kendo.jQuery);kendo_module({id:"resizable",name:"Resizable",category:"framework",depends:["core","draganddrop"],advanced:!0}),function(n,t){var u=window.kendo,o=u.ui,f=o.Widget,r=n.proxy,e=u.isFunction,s=n.extend,i="horizontal",h="vertical",c="start",l="resize",a="resizeend",v=f.extend({init:function(n,t){var u=this;f.fn.init.call(u,n,t);u.orientation=u.options.orientation.toLowerCase()!=h?i:h;u._positionMouse=u.orientation==i?"x":"y";u._position=u.orientation==i?"left":"top";u._sizingDom=u.orientation==i?"outerWidth":"outerHeight";u.draggable=new o.Draggable(n,{distance:0,filter:t.handle,drag:r(u._resize,u),dragcancel:r(u._cancel,u),dragstart:r(u._start,u),dragend:r(u._stop,u)});u.userEvents=u.draggable.userEvents},events:[l,a,c],options:{name:"Resizable",orientation:i},resize:function(){},_max:function(n){var i=this,u=i.hint?i.hint[i._sizingDom]():0,r=i.options.max;return e(r)?r(n):r!==t?i._initialElementPosition+r-u:r},_min:function(n){var r=this,i=r.options.min;return e(i)?i(n):i!==t?r._initialElementPosition+i:i},_start:function(t){var i=this,r=i.options.hint,u=n(t.currentTarget);i._initialElementPosition=u.position()[i._position];i._initialMousePosition=t[i._positionMouse].startLocation;r&&(i.hint=e(r)?n(r(u)):r,i.hint.css({position:"absolute"}).css(i._position,i._initialElementPosition).appendTo(i.element));i.trigger(c,t);i._maxPosition=i._max(t);i._minPosition=i._min(t);n(document.body).css("cursor",u.css("cursor"))},_resize:function(n){var i=this,u=i._maxPosition,f=i._minPosition,e=i._initialElementPosition+(n[i._positionMouse].location-i._initialMousePosition),r;r=f!==t?Math.max(f,e):e;i.position=r=u!==t?Math.min(u,r):r;i.hint&&i.hint.toggleClass(i.options.invalidClass||"",r==u||r==f).css(i._position,r);i.resizing=!0;i.trigger(l,s(n,{position:r}))},_stop:function(t){var i=this;i.hint&&i.hint.remove();i.resizing=!1;i.trigger(a,s(t,{position:i.position}));n(document.body).css("cursor","")},_cancel:function(n){var i=this;i.hint&&(i.position=t,i.hint.css(i._position,i._initialElementPosition),i._stop(n))},destroy:function(){var n=this;f.fn.destroy.call(n);n.draggable&&n.draggable.destroy()},press:function(n){if(n){var t=n.position(),i=this;i.userEvents.press(t.left,t.top,n[0]);i.targetPosition=t;i.target=n}},move:function(n){var i=this,f=i._position,r=i.targetPosition,u=i.position;u===t&&(u=r[f]);r[f]=u+n;i.userEvents.move(r.left,r.top)},end:function(){this.userEvents.end();this.target=this.position=t}});u.ui.plugin(v)}(window.kendo.jQuery);kendo_module({id:"sortable",name:"Sortable",category:"framework",depends:["data"],advanced:!0}),function(n,t){var i=window.kendo,s=n.proxy,r="dir",u="asc",h="single",c="field",f="desc",l=".kendoSortable",a=".k-link",e="aria-sort",o=i.ui.Widget,v=o.extend({init:function(n,t){var i=this,r;o.fn.init.call(i,n,t);i._refreshHandler=s(i.refresh,i);i.dataSource=i.options.dataSource.bind("change",i._refreshHandler);r=i.element.find(a);r[0]||(r=i.element.wrapInner('<a class="k-link" href="#"/>').find(a));i.link=r;i.element.on("click"+l,s(i._click,i))},options:{name:"Sortable",mode:h,allowUnsort:!0,compare:null,filter:""},destroy:function(){var n=this;o.fn.destroy.call(n);n.element.off(l);n.dataSource.unbind("change",n._refreshHandler)},refresh:function(){var o=this,a=o.dataSource.sort()||[],s,v,h,l,t=o.element,y=t.attr(i.attr(c));for(t.removeAttr(i.attr(r)),t.removeAttr(e),s=0,v=a.length;s<v;s++)h=a[s],y==h.field&&t.attr(i.attr(r),h.dir);l=t.attr(i.attr(r));t.find(".k-i-arrow-n,.k-i-arrow-s").remove();l===u?(n('<span class="k-icon k-i-arrow-n" />').appendTo(o.link),t.attr(e,"ascending")):l===f&&(n('<span class="k-icon k-i-arrow-s" />').appendTo(o.link),t.attr(e,"descending"))},_click:function(n){var e=this,v=e.element,y=v.attr(i.attr(c)),s=v.attr(i.attr(r)),l=e.options,p=e.options.compare==null?t:e.options.compare,o=e.dataSource.sort()||[],a,w;if(n.preventDefault(),!l.filter||v.is(l.filter)){if(s=s===u?f:s===f&&l.allowUnsort?t:u,l.mode===h)o=[{field:y,dir:s,compare:p}];else if(l.mode==="multiple"){for(a=0,w=o.length;a<w;a++)if(o[a].field===y){o.splice(a,1);break}o.push({field:y,dir:s,compare:p})}e.dataSource.sort(o)}}});i.ui.plugin(v)}(window.kendo.jQuery);kendo_module({id:"selectable",name:"Selectable",category:"framework",depends:["core","userevents"],advanced:!0}),function(n){function y(n,t){var i=u.getOffset(n),r=t.left+t.width,f=t.top+t.height;return i.right=i.left+n.outerWidth(),i.bottom=i.top+n.outerHeight(),!(i.left>r||i.right<t.left||i.top>f||i.bottom<t.top)}function p(n,i,u,e){for(var o,s=0,h=n.length;s<h;s++)o=n.eq(s),y(o,u)?o.hasClass(t)?e&&i!==o[0]&&o.removeClass(t).addClass(r):o.hasClass(f)||o.hasClass(r)||o.addClass(f):o.hasClass(f)?o.removeClass(f):e&&o.hasClass(r)&&o.removeClass(r).addClass(t)}var u=window.kendo,s=u.ui.Widget,i=n.proxy,h=Math.abs,c="aria-selected",t="k-state-selected",f="k-state-selecting",e="k-selectable",o="change",v=".kendoSelectable",r="k-state-unselecting",l=!1,a;(function(n){(function(){n('<div class="parent"><span /><\/div>').on("click",">*",function(){l=!0}).find("span").click().end().off()})()})(n);a=s.extend({init:function(t,r){var f=this,o;s.fn.init.call(f,t,r);f._marquee=n("<div class='k-marquee'><div class='k-marquee-color'><\/div><\/div>");f._lastActive=null;f.element.addClass(e);o=f.options.multiple;f.userEvents=new u.UserEvents(f.element,{global:!0,allowSelection:!0,filter:(l?"":"."+e+" ")+f.options.filter,tap:i(f._tap,f)});o&&f.userEvents.bind("start",i(f._start,f)).bind("move",i(f._move,f)).bind("end",i(f._end,f)).bind("select",i(f._select,f))},events:[o],options:{name:"Selectable",filter:">*",multiple:!1},_tap:function(i){var u=n(i.target),r=this,f=i.event.ctrlKey||i.event.metaKey,s=r.options.multiple,a=s&&i.event.shiftKey,h,c=i.event.which,l=i.event.button;u.closest("."+e)[0]!==r.element[0]||c&&c==3||l&&l==2||(h=u.hasClass(t),s&&f||r.clear(),a?r.selectRange(r._firstSelectee(),u):(h&&f?(r._unselect(u),r._notify(o)):r.value(u),r._lastActive=r._downTarget=u))},_start:function(i){var u=this,f=n(i.target),s=f.hasClass(t),o=i.event.ctrlKey||i.event.metaKey;if(u._downTarget=f,f.closest("."+e)[0]!==u.element[0]){u.userEvents.cancel();u._downTarget=null;return}u._marquee.appendTo(document.body).css({left:i.x.client+1,top:i.y.client+1,width:0,height:0});o||u.clear();s&&(u._selectElement(f,!0),o&&f.addClass(r))},_move:function(n){var t=this,i={left:n.x.startLocation>n.x.location?n.x.location:n.x.startLocation,top:n.y.startLocation>n.y.location?n.y.location:n.y.startLocation,width:h(n.x.initialDelta),height:h(n.y.initialDelta)},r=t.element.find(t.options.filter);t._marquee.css(i);p(r,t._downTarget[0],i,n.event.ctrlKey||n.event.metaKey);n.preventDefault()},_end:function(){var n=this;n._marquee.remove();n._unselect(n.element.find(n.options.filter+"."+r)).removeClass(r);n.value(n.element.find(n.options.filter+"."+f));n._lastActive=n._downTarget},value:function(n){var r=this,u=i(r._selectElement,r);if(n){n.each(function(){u(this)});r._notify(o);return}return r.element.find(r.options.filter+"."+t)},_firstSelectee:function(){var n=this,t;return n._lastActive!==null?n._lastActive:(t=n.value(),t.length>0?t[0]:n.element.find(n.options.filter))},_selectElement:function(i,r){var u=n(i),e=!r&&this._notify("select",{element:i});u.removeClass(f);e||(u.addClass(t),this.options.aria&&u.attr(c,!0))},_notify:function(n,t){return t=t||{},this.trigger(n,t)},_unselect:function(n){return n.removeClass(t),this.options.aria&&n.attr(c,!1),n},_select:function(t){var i="input,a,textarea,.k-multiselect-wrap,select",r=u.support.browser.msie;n(t.event.target).is(i)?(this.userEvents.cancel(),this._downTarget=null):r&&(!r||n(u._activeElement()).is(i))||t.preventDefault()},clear:function(){var n=this.element.find(this.options.filter+"."+t);this._unselect(n)},selectRange:function(r,u){var e=this,s=!1,h,l,a,f,v=e.element.find(e.options.filter),c=i(e._selectElement,e);for(r=n(r)[0],u=n(u)[0],h=0,l=v.length;h<l;h++)f=v[h],s?(c(f),s=f!==u):f===r?(s=r!==u,c(f)):f===u?(a=r,r=u,u=a,s=!0,c(f)):n(f).removeClass(t);e._notify(o)},destroy:function(){var n=this;s.fn.destroy.call(n);n.element.off(v);n.userEvents.destroy()}});u.ui.plugin(a)}(window.kendo.jQuery);kendo_module({id:"button",name:"Button",category:"web",description:"The Button widget displays styled buttons.",depends:["core"]}),function(n,t){var u=window.kendo,o=u.ui.Widget,i=n.proxy,f=u.keys,e="click",l="k-button",a="k-button-icon",v="k-button-icontext",r=".kendoButton",s="disabled",y="k-state-disabled",h="k-state-focused",c="k-state-selected",p=o.extend({init:function(n,t){var f=this;o.fn.init.call(f,n,t);n=f.wrapper=f.element;t=f.options;n.addClass(l).attr("role","button");t.enable=t.enable&&!n.attr(s);f.enable(t.enable);f._tabindex();f._graphics();n.on(e+r,i(f._click,f)).on("focus"+r,i(f._focus,f)).on("blur"+r,i(f._blur,f)).on("keydown"+r,i(f._keydown,f)).on("keyup"+r,i(f._keyup,f));u.notify(f)},events:[e],options:{name:"Button",icon:"",spriteCssClass:"",imageUrl:"",enable:!0},_isNativeButton:function(){return this.element.prop("tagName").toLowerCase()=="button"},_click:function(n){this.options.enable&&this.trigger(e,{event:n})},_focus:function(){this.options.enable&&this.element.addClass(h)},_blur:function(){this.element.removeClass(h)},_keydown:function(n){var t=this;t._isNativeButton()||(n.keyCode==f.ENTER||n.keyCode==f.SPACEBAR)&&(n.keyCode==f.SPACEBAR&&(n.preventDefault(),t.options.enable&&t.element.addClass(c)),t._click(n))},_keyup:function(){this.element.removeClass(c)},_graphics:function(){var h=this,t=h.element,u=h.options,f=u.icon,e=u.spriteCssClass,o=u.imageUrl,i,r,s;(e||o||f)&&(s=!0,t.contents().not("span.k-sprite").not("span.k-icon").not("img.k-image").each(function(t,i){(i.nodeType==1||i.nodeType==3&&n.trim(i.nodeValue).length>0)&&(s=!1)}),s?t.addClass(a):t.addClass(v));f?(i=t.children("span.k-icon").first(),i[0]||(i=n('<span class="k-icon"><\/span>').prependTo(t)),i.addClass("k-i-"+f)):e?(i=t.children("span.k-sprite").first(),i[0]||(i=n('<span class="k-sprite"><\/span>').prependTo(t)),i.addClass(e)):o&&(r=t.children("img.k-image").first(),r[0]||(r=n('<img alt="icon" class="k-image" />').prependTo(t)),r.attr("src",o))},enable:function(n){var i=this,r=i.element;n===t&&(n=!0);n=!!n;i.options.enable=n;r.toggleClass(y,!n).attr("aria-disabled",!n).attr(s,!n)}});u.ui.plugin(p)}(window.kendo.jQuery);kendo_module({id:"pager",name:"Pager",category:"framework",depends:["data"],advanced:!0}),function(n,t){function v(n,t,r,u,f){return n({idx:t,text:r,ns:i.ns,numeric:u,title:f||""})}function e(n,t,i){return tt({className:n.substring(1),text:t,wrapClassName:i||""})}function o(n,t,r,u){n.find(t).parent().attr(i.attr("page"),r).attr("tabindex",-1).toggleClass("k-state-disabled",u)}function w(n,t){o(n,h,1,t<=1)}function b(n,t){o(n,l,Math.max(1,t-1),t<=1)}function k(n,t,i){o(n,a,Math.min(i,t+1),t>=i)}function d(n,t,i){o(n,c,i,t>=i)}var i=window.kendo,y=i.ui,s=y.Widget,u=n.proxy,h=".k-i-seek-w",c=".k-i-seek-e",l=".k-i-arrow-w",a=".k-i-arrow-e",r="change",f=".kendoPager",p="click",g="keydown",nt="disabled",tt=i.template('<a href="\\#" title="#=text#" class="k-link k-pager-nav #= wrapClassName #"><span class="k-icon #= className #">#=text#<\/span><\/a>'),it=s.extend({init:function(t,o){var v=this,nt,y;if(s.fn.init.call(v,t,o),o=v.options,v.dataSource=i.data.DataSource.create(o.dataSource),v.linkTemplate=i.template(v.options.linkTemplate),v.selectTemplate=i.template(v.options.selectTemplate),nt=v.page(),y=v.totalPages(),v._refreshHandler=u(v.refresh,v),v.dataSource.bind(r,v._refreshHandler),o.previousNext&&(v.element.find(h).length||(v.element.append(e(h,o.messages.first,"k-pager-first")),w(v.element,nt,y)),v.element.find(l).length||(v.element.append(e(l,o.messages.previous)),b(v.element,nt,y))),o.numeric&&(v.list=v.element.find(".k-pager-numbers"),v.list.length||(v.list=n('<ul class="k-pager-numbers k-reset" />').appendTo(v.element))),o.input){v.element.find(".k-pager-input").length||v.element.append('<span class="k-pager-input k-label">'+o.messages.page+'<input class="k-textbox">'+i.format(o.messages.of,y)+"<\/span>");v.element.on(g+f,".k-pager-input input",u(v._keydown,v))}if(o.previousNext&&(v.element.find(a).length||(v.element.append(e(a,o.messages.next)),k(v.element,nt,y)),v.element.find(c).length||(v.element.append(e(c,o.messages.last,"k-pager-last")),d(v.element,nt,y))),o.pageSizes){v.element.find(".k-pager-sizes").length||n('<span class="k-pager-sizes k-label"><select/>'+o.messages.itemsPerPage+"<\/span>").appendTo(v.element).find("select").html(n.map(n.isArray(o.pageSizes)?o.pageSizes:[5,10,20],function(n){return"<option>"+n+"<\/option>"}).join("")).end().appendTo(v.element);v.element.find(".k-pager-sizes select").val(v.pageSize());i.ui.DropDownList&&v.element.find(".k-pager-sizes select").show().kendoDropDownList();v.element.on(r+f,".k-pager-sizes select",u(v._change,v))}if(o.refresh){v.element.find(".k-pager-refresh").length||v.element.append('<a href="#" class="k-pager-refresh k-link" title="'+o.messages.refresh+'"><span class="k-icon k-i-refresh">'+o.messages.refresh+"<\/span><\/a>");v.element.on(p+f,".k-pager-refresh",u(v._refreshClick,v))}o.info&&(v.element.find(".k-pager-info").length||v.element.append('<span class="k-pager-info k-label" />'));v.element.on(p+f,"a",u(v._click,v)).addClass("k-pager-wrap k-widget");o.autoBind&&v.refresh();i.notify(v)},destroy:function(){var n=this;s.fn.destroy.call(n);n.element.off(f);n.dataSource.unbind(r,n._refreshHandler);i.destroy(n.element)},events:[r],options:{name:"Pager",selectTemplate:'<li><span class="k-state-selected">#=text#<\/span><\/li>',linkTemplate:'<li><a tabindex="-1" href="\\#" class="k-link" data-#=ns#page="#=idx#" #if (title !== "") {# title="#=title#" #}#>#=text#<\/a><\/li>',buttonCount:10,autoBind:!0,numeric:!0,info:!0,input:!1,previousNext:!0,pageSizes:!1,refresh:!1,messages:{display:"{0} - {1} of {2} items",empty:"No items to display",page:"Page",of:"of {0}",itemsPerPage:"items per page",first:"Go to the first page",previous:"Go to the previous page",next:"Go to the next page",last:"Go to the last page",refresh:"Refresh",morePages:"More pages"}},setDataSource:function(n){var t=this;t.dataSource.unbind(r,t._refreshHandler);t.dataSource=t.options.dataSource=n;n.bind(r,t._refreshHandler);t.options.autoBind&&n.fetch()},refresh:function(n){var t=this,e,a,s=1,f="",y,r=t.page(),u=t.options,h=t.pageSize(),c=t.dataSource.total(),o=t.totalPages(),p=t.linkTemplate,l=u.buttonCount;if(!n||n.action!="itemchange"){if(u.numeric){for(r>l&&(y=r%l,s=y===0?r-l+1:r-y+1),a=Math.min(s+l-1,o),s>1&&(f+=v(p,s-1,"...",!1,u.messages.morePages)),e=s;e<=a;e++)f+=v(e==r?t.selectTemplate:p,e,e,!0);a<o&&(f+=v(p,e,"...",!1,u.messages.morePages));f===""&&(f=t.selectTemplate({text:0}));t.list.html(f)}u.info&&(f=c>0?i.format(u.messages.display,(r-1)*h+1,Math.min(r*h,c),c):u.messages.empty,t.element.find(".k-pager-info").html(f));u.input&&t.element.find(".k-pager-input").html(t.options.messages.page+'<input class="k-textbox">'+i.format(u.messages.of,o)).find("input").val(r).attr(nt,c<1).toggleClass("k-state-disabled",c<1);u.previousNext&&(w(t.element,r,o),b(t.element,r,o),k(t.element,r,o),d(t.element,r,o));u.pageSizes&&t.element.find(".k-pager-sizes select").val(h).filter("["+i.attr("role")+"=dropdownlist]").kendoDropDownList("value",h).kendoDropDownList("text",h)}},_keydown:function(n){if(n.keyCode===i.keys.ENTER){var r=this.element.find(".k-pager-input").find("input"),t=parseInt(r.val(),10);(isNaN(t)||t<1||t>this.totalPages())&&(t=this.page());r.val(t);this.page(t)}},_refreshClick:function(n){n.preventDefault();this.dataSource.read()},_change:function(n){var t=parseInt(n.currentTarget.value,10);isNaN(t)||this.dataSource.pageSize(t)},_click:function(t){var r=n(t.currentTarget);t.preventDefault();r.is(".k-state-disabled")||this.page(r.attr(i.attr("page")))},totalPages:function(){return Math.ceil((this.dataSource.total()||0)/this.pageSize())},pageSize:function(){return this.dataSource.pageSize()||this.dataSource.total()},page:function(n){if(n!==t)this.dataSource.page(n),this.trigger(r,{index:n});else return this.dataSource.total()>0?this.dataSource.page():0}});y.plugin(it)}(window.kendo.jQuery);kendo_module({id:"popup",name:"Pop-up",category:"framework",depends:["core"],advanced:!0}),function(n){function y(t,i){return t===i||n.contains(t,i)}var t=window.kendo,it=t.ui,p=it.Widget,f=t.support,r=t.getOffset,lt=t._activeElement,w="open",b="close",rt="deactivate",ut="activate",u="center",ft="left",s="right",k="top",h="bottom",d="absolute",et="hidden",c="body",g="location",e="position",ot="visible",st="effects",ht="k-state-active",l="k-state-border",at=/k-state-border-(\w+)/,ct=".k-picker-wrap, .k-dropdown-wrap, .k-link",a="down",nt=n(window),tt=n(document.documentElement),v="resize scroll",vt=f.transitions.css,yt=vt+"transform",i=n.extend,o=".kendoPopup",pt=["font-family","font-size","font-stretch","font-style","font-weight","line-height"],wt=p.extend({init:function(r,u){var f=this,e;u=u||{};u.isRtl&&(u.origin=u.origin||h+" "+s,u.position=u.position||k+" "+s);p.fn.init.call(f,r,u);r=f.element;u=f.options;f.collisions=u.collision?u.collision.split(" "):[];f.collisions.length===1&&f.collisions.push(f.collisions[0]);e=n(f.options.anchor).closest(".k-popup,.k-group").filter(":not([class^=km-])");u.appendTo=n(n(u.appendTo)[0]||e[0]||c);f.element.hide().addClass("k-popup k-group k-reset").toggleClass("k-rtl",!!u.isRtl).css({position:d}).appendTo(u.appendTo).on("mouseenter"+o,function(){f._hovered=!0}).on("mouseleave"+o,function(){f._hovered=!1});if(f.wrapper=n(),u.animation===!1&&(u.animation={open:{effects:{}},close:{hide:!0,effects:{}}}),i(u.animation.open,{complete:function(){f.wrapper.css({overflow:ot});f.trigger(ut)}}),i(u.animation.close,{complete:function(){f.wrapper.hide();var o=f.wrapper.data(g),s=n(u.anchor),i,e;o&&f.wrapper.css(o);u.anchor!=c&&(i=(s[0].className.match(at)||["","down"])[1],e=l+"-"+i,s.removeClass(e).children(ct).removeClass(ht).removeClass(e),r.removeClass(l+"-"+t.directions[i].reverse));f._closing=!1;f.trigger(rt)}}),f._mousedownProxy=function(n){f._mousedown(n)},f._resizeProxy=function(n){f._resize(n)},u.toggleTarget)n(u.toggleTarget).on(u.toggleEvent+o,n.proxy(f.toggle,f))},events:[w,ut,b,rt],options:{name:"Popup",toggleEvent:"click",origin:h+" "+ft,position:k+" "+ft,anchor:c,collision:"flip fit",viewport:window,copyAnchorStyles:!0,autosize:!1,modal:!1,animation:{open:{effects:"slideIn:down",transition:!0,duration:200},close:{duration:100,hide:!0}}},destroy:function(){var i=this,r=i.options,f=i.element.off(o),u;p.fn.destroy.call(i);r.toggleTarget&&n(r.toggleTarget).off(o);r.modal||(tt.unbind(a,i._mousedownProxy),nt.unbind(v,i._resizeProxy));t.destroy(i.element.children());r.appendTo[0]===document.body&&(u=f.parent(".k-animation-container"),u[0]?u.remove():f.remove())},open:function(r,u){var o=this,rt={isFixed:!isNaN(parseInt(u,10)),x:r,y:u},y=o.element,s=o.options,p="down",h,b,g=n(s.anchor),it;if(!o.visible()){if(s.copyAnchorStyles&&y.css(t.getComputedStyles(g[0],pt)),y.data("animating")||o.trigger(w))return;s.modal||(tt.unbind(a,o._mousedownProxy).bind(a,o._mousedownProxy),f.mobileOS.ios||f.mobileOS.android||nt.unbind(v,o._resizeProxy).bind(v,o._resizeProxy));o.wrapper=b=t.wrap(y,s.autosize).css({overflow:et,display:"block",position:d});f.mobileOS.android&&b.add(g).css(yt,"translatez(0)");b.css(e);n(s.appendTo)[0]==document.body&&b.css(k,"-10000px");h=i(!0,{},s.animation.open);o.flipped=o._position(rt);h.effects=t.parseEffects(h.effects,o.flipped);p=h.effects.slideIn?h.effects.slideIn.direction:p;s.anchor!=c&&(it=l+"-"+p,y.addClass(l+"-"+t.directions[p].reverse),g.addClass(it).children(ct).addClass(ht).addClass(it));y.data(st,h.effects).kendoStop(!0).kendoAnimate(h)}},toggle:function(){var n=this;n[n.visible()?b:w]()},visible:function(){return this.element.is(":"+ot)},close:function(){var r=this,s=r.options,o,u,f,e;if(r.visible()){if(o=r.wrapper[0]?r.wrapper:t.wrap(r.element).hide(),r._closing||r.trigger(b))return;r.element.find(".k-popup").each(function(){var i=n(this),t=i.data("kendoPopup");t&&t.close()});tt.unbind(a,r._mousedownProxy);nt.unbind(v,r._resizeProxy);u=i(!0,{},s.animation.close);f=r.element.data(st);e=u.effects;!e&&!t.size(e)&&f&&t.size(f)&&(u.effects=f,u.reverse=!0);r._closing=!0;r.element.kendoStop(!0);o.css({overflow:et});r.element.kendoAnimate(u)}},_resize:function(n){var t=this;n.type==="resize"?(clearTimeout(t._resizeTimeout),t._resizeTimeout=setTimeout(function(){t._position();t._resizeTimeout=null},50)):t._hovered||y(t.element[0],lt())||t.close()},_mousedown:function(i){var u=this,s=u.element[0],e=u.options,h=n(e.anchor)[0],o=e.toggleTarget,f=t.eventTarget(i),r=n(f).closest(".k-popup"),c=r.parent().parent(".km-shim").length;(r=r[0],c||!r||r===u.element[0])&&n(i.target).closest("a").data("rel")!=="popover"&&(y(s,f)||y(h,f)||o&&y(n(o)[0],f)||u.close())},_fit:function(n,t,i){var r=0;return n+t>i&&(r=i-(n+t)),n<0&&(r=-n),r},_flip:function(n,t,i,r,f,e,o){var s=0;return o=o||t,e!==f&&e!==u&&f!==u&&(n+o>r&&(s+=-(i+t)),n+s<0&&(s+=i+t)),s},_position:function(t){var o=this,nt=o.element.css(e,""),u=o.wrapper,y=o.options,c=n(y.viewport),ot=n(c).offset(),l=n(y.anchor),tt=y.origin.toLowerCase().split(" "),it=y.position.toLowerCase().split(" "),p=o.collisions,w=f.zoomLevel(),b,rt,h,k=10002,ut=0,st,v,s,et;if(b=l.parents().filter(u.siblings()),b[0])if(h=Number(n(b).css("zIndex")),h)k=h+1;else for(rt=l.parentsUntil(b),st=rt.length;ut<st;ut++)h=Number(n(rt[ut]).css("zIndex")),h&&k<h&&(k=h+1);u.css("zIndex",k);t&&t.isFixed?u.css({left:t.x,top:t.y}):u.css(o._align(tt,it));var ft=r(u,e,l[0]===u.offsetParent()[0]),a=r(u),ht=l.offsetParent().parent(".k-animation-container,.k-popup,.k-group");return ht.length&&(ft=r(u,e,!0),a=r(u)),c[0]===window?(a.top-=window.pageYOffset||document.documentElement.scrollTop||0,a.left-=window.pageXOffset||document.documentElement.scrollLeft||0):(a.top-=ot.top,a.left-=ot.left),o.wrapper.data(g)||u.data(g,i({},ft)),v=i({},a),s=i({},ft),p[0]==="fit"&&(s.top+=o._fit(v.top,u.outerHeight(),c.height()/w)),p[1]==="fit"&&(s.left+=o._fit(v.left,u.outerWidth(),c.width()/w)),et=i({},s),p[0]==="flip"&&(s.top+=o._flip(v.top,nt.outerHeight(),l.outerHeight(),c.height()/w,tt[0],it[0],u.outerHeight())),p[1]==="flip"&&(s.left+=o._flip(v.left,nt.outerWidth(),l.outerWidth(),c.width()/w,tt[1],it[1],u.outerWidth())),nt.css(e,d),u.css(s),s.left!=et.left||s.top!=et.top},_align:function(t,i){var c=this,v=c.wrapper,l=n(c.options.anchor),y=t[0],p=t[1],w=i[0],b=i[1],k=r(l),d=n(c.options.appendTo),a,g=v.outerWidth(),nt=v.outerHeight(),tt=l.outerWidth(),it=l.outerHeight(),f=k.top,e=k.left,o=Math.round;return d[0]!=document.body&&(a=r(d),f-=a.top,e-=a.left),y===h&&(f+=it),y===u&&(f+=o(it/2)),w===h&&(f-=nt),w===u&&(f-=o(nt/2)),p===s&&(e+=tt),p===u&&(e+=o(tt/2)),b===s&&(e-=g),b===u&&(e-=o(g/2)),{top:f,left:e}}});it.plugin(wt)}(window.kendo.jQuery);kendo_module({id:"tooltip",name:"Tooltip",category:"web",description:"The Tooltip widget displays a popup hint for a given html element.",depends:["core","popup"]}),function(n){function w(n){while(n.length)ot(n),n=n.parent()}function ot(n){var i=n.data(t.ns+"title");i&&(n.attr("title",i),n.removeData(t.ns+"title"))}function st(n){var i=n.attr("title");i&&(n.data(t.ns+"title",i),n.attr("title",""))}function b(n){while(n.length&&!n.is("body"))st(n),n=n.parent()}var t=window.kendo,u=t.ui.Widget,k=t.ui.Popup,d=t.isFunction,g=n.isPlainObject,s=n.extend,r=n.proxy,f=n(document),nt=t.isLocalUrl,h="_tt_active",c="aria-describedby",l="show",a="hide",v="error",e="contentLoad",y="requestStart",o="k-content-frame",tt='<div role="tooltip" class="k-widget k-tooltip#if (!autoHide) {# k-tooltip-closable#}#">#if (!autoHide) {# <div class="k-tooltip-button"><a href="\\#" class="k-icon k-i-close">close<\/a><\/div> #}#<div class="k-tooltip-content"><\/div>#if (callout){ #<div class="k-callout k-callout-#=dir#"><\/div>#}#<\/div>',it=t.template("<iframe frameborder='0' class='"+o+"' src='#= content.url #'>This page requires frames in order to show content<\/iframe>"),i=".kendoTooltip",rt={bottom:{origin:"bottom center",position:"top center"},top:{origin:"top center",position:"bottom center"},left:{origin:"center left",position:"center right",collision:"fit flip"},right:{origin:"center right",position:"center left",collision:"fit flip"},center:{position:"center center",origin:"center center"}},ut={top:"bottom",bottom:"top",left:"right",right:"left",center:"center"},p={bottom:"n",top:"s",left:"e",right:"w",center:"n"},ft={horizontal:{offset:"top",size:"outerHeight"},vertical:{offset:"left",size:"outerWidth"}},et=function(n){return n.target.data(t.ns+"title")},ht=u.extend({init:function(n,t){var f=this,e;u.fn.init.call(f,n,t);e=f.options.position.match(/left|right/)?"horizontal":"vertical";f.dimensions=ft[e];f._documentKeyDownHandler=r(f._documentKeyDown,f);f.element.on(f.options.showOn+i,f.options.filter,r(f._showOn,f)).on("mouseenter"+i,f.options.filter,r(f._mouseenter,f));if(this.options.autoHide)f.element.on("mouseleave"+i,f.options.filter,r(f._mouseleave,f))},options:{name:"Tooltip",filter:"",content:et,showAfter:100,callout:!0,position:"bottom",showOn:"mouseenter",autoHide:!0,width:null,height:null,animation:{open:{effects:"fade:in",duration:0},close:{effects:"fade:out",duration:40,hide:!0}}},events:[l,a,e,v,y],_mouseenter:function(t){b(n(t.currentTarget))},_showOn:function(t){var i=this,r=n(t.currentTarget);i.options.showOn&&i.options.showOn.match(/click|focus/)?i._show(r):(clearTimeout(i.timeout),i.timeout=setTimeout(function(){i._show(r)},i.options.showAfter))},_appendContent:function(n){var u=this,r=u.options.content,f=u.content,h=u.options.iframe,s;if(g(r)&&r.url)if("iframe"in u.options||(h=!nt(r.url)),u.trigger(y,{options:r,target:n}),h){f.hide();s=f.find("."+o)[0];s?s.src=r.url||s.src:f.html(it({content:r}));f.find("."+o).off("load"+i).on("load"+i,function(){u.trigger(e);f.show()})}else f.empty(),t.ui.progress(f,!0),u._ajaxRequest(r);else r&&d(r)?(r=r({sender:this,target:n}),u.content.html(r||"")):u.content.html(r)},_ajaxRequest:function(n){var i=this;jQuery.ajax(s({type:"GET",dataType:"html",cache:!1,error:function(n,r){t.ui.progress(i.content,!1);i.trigger(v,{status:r,xhr:n})},success:r(function(n){t.ui.progress(i.content,!1);i.content.html(n);i.trigger(e)},i)},n))},_documentKeyDown:function(n){n.keyCode===t.keys.ESC&&this.hide()},refresh:function(){var t=this,n=t.popup;n&&n.options.anchor&&t._appendContent(n.options.anchor)},hide:function(){this.popup&&this.popup.close()},show:function(n){n=n||this.element;b(n);this._show(n)},_show:function(n){var t=this,r=t.target();t.popup||t._initPopup();r&&r[0]!=n[0]&&(t.popup.close(),t.popup.element.kendoStop(!0,!0));r&&r[0]==n[0]||(t._appendContent(n),t.popup.options.anchor=n);t.popup.one("deactivate",function(){w(n);n.removeAttr(c);this.element.removeAttr("id").attr("aria-hidden",!0);f.off("keydown"+i,t._documentKeyDownHandler)});t.popup.open()},_initPopup:function(){var u=this,e=u.options,o=n(t.template(tt)({callout:e.callout&&e.position!=="center",dir:p[e.position],autoHide:e.autoHide}));if(u.popup=new k(o,s({activate:function(){var t=this.options.anchor,n=t[0].id||u.element[0].id;n&&(t.attr(c,n+h),this.element.attr("id",n+h));e.callout&&u._positionCallout();this.element.removeAttr("aria-hidden");f.on("keydown"+i,u._documentKeyDownHandler);u.trigger(l)},close:function(){u.trigger(a)},copyAnchorStyles:!1,animation:e.animation},rt[e.position])),o.css({width:e.width,height:e.height}),u.content=o.find(".k-tooltip-content"),u.arrow=o.find(".k-callout"),e.autoHide)o.on("mouseleave"+i,r(u._mouseleave,u));else o.on("click"+i,".k-tooltip-button",r(u._closeButtonClick,u))},_closeButtonClick:function(n){n.preventDefault();this.hide()},_mouseleave:function(t){if(this.popup){var r=n(t.currentTarget),i=r.offset(),u=t.pageX,f=t.pageY;if(i.right=i.left+r.outerWidth(),i.bottom=i.top+r.outerHeight(),u>i.left&&u<i.right&&f>i.top&&f<i.bottom)return;this.popup.close()}else w(n(t.currentTarget));clearTimeout(this.timeout)},_positionCallout:function(){var t=this,u=t.options.position,f=t.dimensions,i=f.offset,r=t.popup,e=r.options.anchor,o=n(e).offset(),s=parseInt(t.arrow.css("border-top-width"),10),h=n(r.element).offset(),c=p[r.flipped?ut[u]:u],l=o[i]-h[i]+n(e)[f.size]()/2-s;t.arrow.removeClass("k-callout-n k-callout-s k-callout-w k-callout-e").addClass("k-callout-"+c).css(i,l)},target:function(){return this.popup?this.popup.options.anchor:null},destroy:function(){var n=this.popup;n&&(n.element.off(i),n.destroy());this.element.off(i);f.off("keydown"+i,this._documentKeyDownHandler);u.fn.destroy.call(this)}});t.ui.plugin(ht)}(window.kendo.jQuery);kendo_module({id:"list",name:"List",category:"framework",depends:["data","popup"],hidden:!0}),function(n,t){function b(t,i){t.filters&&(t.filters=n.grep(t.filters,function(n){return b(n,i),n.filters?n.filters.length:n.field!=i}))}var i=window.kendo,l=i.ui,o=l.Widget,f=i.keys,u=i.support,ft=i.htmlEncode,et=i._activeElement,s="id",a="li",r="change",v="character",k="k-state-focused",y="k-state-hover",d="k-loading",p="open",g="close",nt="select",w="selected",tt="progress",it="requestEnd",rt="width",ut=n.extend,e=n.proxy,h=u.browser,ot=h.msie&&h.version<9,st=/"/g,ht={ComboBox:"DropDownList",DropDownList:"ComboBox"},c=o.extend({init:function(t,i){var r=this,h=r.ns,f;o.fn.init.call(r,t,i);t=r.element;r._isSelect=t.is(nt);r._template();r.ul=n('<ul unselectable="on" class="k-list k-reset"/>').css({overflow:u.kineticScrollNeeded?"":"auto"}).on("mouseenter"+h,a,function(){n(this).addClass(y)}).on("mouseleave"+h,a,function(){n(this).removeClass(y)}).on("click"+h,a,e(r._click,r)).attr({tabIndex:-1,role:"listbox","aria-hidden":!0});r.list=n("<div class='k-list-container'/>").append(r.ul).on("mousedown"+h,function(n){n.preventDefault()});f=t.attr(s);f&&(r.list.attr(s,f+"-list"),r.ul.attr(s,f+"_listbox"),r._optionID=f+"_option_selected");r._header();r._accessors();r._initValue()},options:{valuePrimitive:!1,headerTemplate:""},setOptions:function(n){o.fn.setOptions.call(this,n);n&&n.enable!==t&&(n.enabled=n.enable)},focus:function(){this._focused.focus()},readonly:function(n){this._editable({readonly:n===t?!0:n,disable:!1})},enable:function(n){this._editable({readonly:!1,disable:!(n=n===t?!0:n)})},_filterSource:function(n){var i=this,u=i.options,r=i.dataSource,t=r.filter()||{};b(t,u.dataTextField);n&&(t=t.filters||[],t.push(n));r.filter(t)},_header:function(){var t=this.options.headerTemplate,i;n.isFunction(t)&&(t=t({}));t&&(this.list.prepend(t),i=this.ul.prev(),this.header=i[0]?i:null)},_initValue:function(){var n=this,t=n.options.value;t!==null?n.element.val(t):(t=n._accessor(),n.options.value=t);n._old=t},_ignoreCase:function(){var t=this,i=t.dataSource.reader.model,n;i&&i.fields&&(n=i.fields[t.options.dataTextField],n&&n.type&&n.type!=="string"&&(t.options.ignoreCase=!1))},items:function(){return this.ul[0].children},current:function(n){var i=this,r=i._optionID;if(n!==t)i._current&&(i._current.removeClass(k).removeAttr("aria-selected").removeAttr(s),i._focused.removeAttr("aria-activedescendant")),n&&(n.addClass(k),i._scroll(n),r&&(n.attr("id",r),i._focused.attr("aria-activedescendant",r))),i._current=n;else return i._current},destroy:function(){var n=this,t=n.ns;o.fn.destroy.call(n);n._unbindDataSource();n.ul.off(t);n.list.off(t);n._touchScroller&&n._touchScroller.destroy();n.popup.destroy();n._form&&n._form.off("reset",n._resetHandler)},dataItem:function(n){var i=this;return n===t&&(n=i.selectedIndex),i._data()[n]},_accessors:function(){var n=this,r=n.element,t=n.options,u=i.getter,f=r.attr(i.attr("text-field")),e=r.attr(i.attr("value-field"));f&&(t.dataTextField=f);e&&(t.dataValueField=e);n._text=u(t.dataTextField);n._value=u(t.dataValueField)},_aria:function(n){var i=this,r=i.options,u=i._focused;r.suggest!==t&&u.attr("aria-autocomplete",r.suggest?"both":"list");n=n?n+" "+i.ul[0].id:i.ul[0].id;u.attr("aria-owns",n);i.ul.attr("aria-live",!r.filter||r.filter==="none"?"off":"polite")},_blur:function(){var n=this;n._change();n.close()},_change:function(){var n=this,i=n.selectedIndex,e=n.options.value,u=n.value(),f;n._isSelect&&!n._bound&&e&&(u=e);u!==n._old?f=!0:i!==t&&i!==n._oldIndex&&(f=!0);f&&(n._old=u,n._oldIndex=i,n.trigger(r),n.element.trigger(r))},_click:function(t){t.isDefaultPrevented()||this._accept(n(t.currentTarget))},_data:function(){return this.dataSource.view()},_enable:function(){var n=this,i=n.options,r=n.element.is("[disabled]");i.enable!==t&&(i.enabled=i.enable);!i.enabled||r?n.enable(!1):n.readonly(n.element.is("[readonly]"))},_focus:function(n){var t=this;if(t.popup.visible()&&n&&t.trigger(nt,{item:n})){t.close();return}t._select(n);t._triggerCascade(!0);t._blur()},_index:function(n){for(var i=this,u=i._data(),t=0,r=u.length;t<r;t++)if(i._dataValue(u[t])==n)return t;return-1},_dataValue:function(n){var i=this._value(n);return i===t&&(i=this._text(n)),i},_height:function(n){if(n){var t=this,r=t.list,e=t.popup.visible(),i=t.options.height,f=t.header,u;u=r.add(r.parent(".k-animation-container")).show();i=t.ul[0].scrollHeight>i?i:"auto";u.height(i);f&&t.ul.height(i=="auto"?i:r.height()-f.height());e||u.hide()}},_adjustListWidth:function(){var t=this.list,i=t[0].style.width,u=this.wrapper,n,r;if(t.data(rt)||!i)return n=window.getComputedStyle?window.getComputedStyle(u[0],null):0,r=n?parseFloat(n.width):u.outerWidth(),n&&(h.mozilla||h.msie)&&(r+=parseFloat(n.paddingLeft)+parseFloat(n.paddingRight)+parseFloat(n.borderLeftWidth)+parseFloat(n.borderRightWidth)),i=t.css("box-sizing")!=="border-box"?r-(t.outerWidth()-t.width()):r,t.css({fontFamily:u.css("font-family"),width:i}).data(rt,i),!0},_popup:function(){var n=this,e=n.list,t=n._focused,r=n.options,f=n.wrapper;n.popup=new l.Popup(e,ut({},r.popup,{anchor:f,open:function(i){n._adjustListWidth();n.trigger(p)?i.preventDefault():(t.attr("aria-expanded",!0),n.ul.attr("aria-hidden",!1))},close:function(i){n.trigger(g)?i.preventDefault():(t.attr("aria-expanded",!1),n.ul.attr("aria-hidden",!0))},animation:r.animation,isRtl:u.isRtl(f)}));n.popup.one(p,function(){n._height(n._data().length)});n._touchScroller=i.touchScroller(n.popup.element)},_makeUnselectable:function(){ot&&this.list.find("*").attr("unselectable","on")},_toggleHover:function(t){n(t.currentTarget).toggleClass(y,t.type==="mouseenter")},_toggle:function(n){var i=this,r=u.touch&&u.MSPointers&&u.pointers;n=n!==t?n:!i.popup.visible();r||i._focused[0]===et()||i._focused.focus();i[n?p:g]()},_scroll:function(n){if(n){n[0]&&(n=n[0]);var r=this.ul[0],t=n.offsetTop,o=n.offsetHeight,u=r.scrollTop,s=r.clientHeight,h=t+o,f=this._touchScroller,i,e;f?(i=f.dimensions.y,i.enabled&&t>i.size&&(t=t-i.size+o+4,f.scrollTo(0,-t))):(e=this.header?this.header.outerHeight():0,r.scrollTop=u>t?t-e:h>u+s?h-s-e:u)}},_template:function(){var t=this,n=t.options,r=n.template,u=n.dataSource;t._isSelect&&t.element[0].length&&(u||(n.dataTextField=n.dataTextField||"text",n.dataValueField=n.dataValueField||"value"));r?(r=i.template(r),t.template=function(n){return'<li tabindex="-1" role="option" unselectable="on" class="k-item">'+r(n)+"<\/li>"}):t.template=i.template('<li tabindex="-1" role="option" unselectable="on" class="k-item">${'+i.expr(n.dataTextField,"data")+"}<\/li>",{useWithBlock:!1})},_triggerCascade:function(n){var t=this,i=t.value();(!t._bound&&i||t._old!==i)&&t.trigger("cascade",{userTriggered:n})},_unbindDataSource:function(){var n=this;n.dataSource.unbind(r,n._refreshHandler).unbind(tt,n._progressHandler).unbind(it,n._requestEndHandler).unbind("error",n._errorHandler)}});ut(c,{caret:function(n){var t=n.ownerDocument.selection;return t?Math.abs(t.createRange().moveStart(v,-n.value.length)):n.selectionStart},selectText:function(n,t,i){try{if(n.createTextRange){n.focus();var r=n.createTextRange();r.collapse(!0);r.moveStart(v,t);r.moveEnd(v,i-t);r.select()}else n.setSelectionRange(t,i)}catch(u){}},inArray:function(n,t){var i,r,u=t.children;if(!n||n.parentNode!==t)return-1;for(i=0,r=u.length;i<r;i++)if(n===u[i])return i;return-1}});i.ui.List=c;l.Select=c.extend({init:function(n,t){c.fn.init.call(this,n,t);this._initial=this.element.val()},setDataSource:function(n){this.options.dataSource=n;this._dataSource();this._bound=!1;this.options.autoBind&&this.dataSource.fetch()},close:function(){this.popup.close()},select:function(n){var i=this;if(n===t)return i.selectedIndex;i._select(n);i._triggerCascade();i._old=i._accessor();i._oldIndex=i.selectedIndex},_accessor:function(n,i){var r=this.element[0],e=this._isSelect,f=r.selectedIndex,u;if(n===t)return e?f>-1&&(u=r.options[f],u&&(n=u.value)):n=r.value,n;e?(f>-1&&r.options[f].removeAttribute(w),r.selectedIndex=i,u=r.options[i],u&&u.setAttribute(w,w)):r.value=n},_hideBusy:function(){var n=this;clearTimeout(n._busy);n._arrow.removeClass(d);n._focused.attr("aria-busy",!1);n._busy=null},_showBusy:function(){var n=this;(n._request=!0,n._busy)||(n._busy=setTimeout(function(){n._focused.attr("aria-busy",!0);n._arrow.addClass(d)},100))},_requestEnd:function(){this._request=!1},_dataSource:function(){var t=this,s=t.element,f=t.options,u=f.dataSource||{},o;u=n.isArray(u)?{data:u}:u;t._isSelect&&(o=s[0].selectedIndex,o>-1&&(f.index=o),u.select=s,u.fields=[{field:f.dataTextField},{field:f.dataValueField}]);t.dataSource&&t._refreshHandler?t._unbindDataSource():(t._refreshHandler=e(t.refresh,t),t._progressHandler=e(t._showBusy,t),t._requestEndHandler=e(t._requestEnd,t),t._errorHandler=e(t._hideBusy,t));t.dataSource=i.data.DataSource.create(u).bind(r,t._refreshHandler).bind(tt,t._progressHandler).bind(it,t._requestEndHandler).bind("error",t._errorHandler)},_get:function(t){var r=this,u=r._data(),i,f;if(typeof t=="function")for(i=0,f=u.length;i<f;i++)if(t(u[i])){t=i;break}if(typeof t=="number"){if(t<0)return n();t=n(r.ul[0].children[t])}return t&&t.nodeType&&(t=n(t)),t},_move:function(n){var t=this,e=n.keyCode,o=t.ul[0],c=t.popup.visible()?"_select":"_accept",i=t._current,h=e===f.DOWN,u,s;if(e===f.UP||h){if(n.altKey)t.toggle(h);else{if(u=o.firstChild,!u&&!t._accessor()&&t._state!=="filter"){if(!t._fetch){t.dataSource.one(r,function(){t._move(n);t._fetch=!1});t._fetch=!0;t._filterSource()}return n.preventDefault(),!0}h?(i&&(t.selectedIndex!==-1||t.value()||i[0]!==u)?(i=i[0].nextSibling,i||u!==o.lastChild||(i=u)):i=u,t[c](i)):(i=i?i[0].previousSibling:o.lastChild,i||u!==o.lastChild||(i=u),t[c](i))}n.preventDefault();s=!0}else e===f.ENTER||e===f.TAB?(t.popup.visible()&&n.preventDefault(),(t._typing||!t.popup.visible()&&t.selectedIndex===-1)&&(i=null),t._accept(i),s=!0):e===f.ESC&&(t.popup.visible()&&n.preventDefault(),t.close(),s=!0);return s},_selectItem:function(){var n=this,i=n.options,u,r;u=n._isSelect&&!n._initial&&!i.value&&i.index&&!n._bound;u||(r=n._selectedValue||i.value||n._accessor());r?n.value(r):n._bound===t&&n.select(i.index)},_fetchItems:function(n){var t=this,i=t.ul[0].firstChild;if(t._request)return!0;if(!t._fetch&&!i){if(t.options.cascadeFrom)return!i;t.dataSource.one(r,function(){t.value(n);t._fetch=!1});return t._fetch=!0,t.dataSource.fetch(),!0}},_options:function(n,i){var e=this,c=e.element,l=n.length,o="",u,s,h,r,f=0;for(i&&(f=1,o=i);f<l;f++)u="<option",s=n[f],h=e._text(s),r=e._value(s),r!==t&&(r+="",r.indexOf('"')!==-1&&(r=r.replace(st,""")),u+=' value="'+r+'"'),u+=">",h!==t&&(u+=ft(h)),u+="<\/option>",o+=u;c.html(o)},_reset:function(){var t=this,i=t.element,r=i.attr("form"),u=r?n("#"+r):i.closest("form");u[0]&&(t._resetHandler=function(){setTimeout(function(){t.value(t._initial)})},t._form=u.on("reset",t._resetHandler))},_cascade:function(){var t=this,u=t.options,s=u.cascadeFrom,i,f,e,o,h;if(s){if(t._selectedValue=u.value||t._accessor(),f=n("#"+s),i=f.data("kendo"+u.name),i||(i=f.data("kendo"+ht[u.name])),!i)return;u.autoBind=!1;o=u.cascadeFromField||i.options.dataValueField;h=function(){var n=t._selectedValue||t.value();t._userTriggered?t._clearSelection(i,!0):n?(t.value(n),t.dataSource.view()[0]&&t.selectedIndex!==-1||t._clearSelection(i,!0)):t.select(u.index);t.enable();t._triggerCascade(t._userTriggered);t._userTriggered=!1};e=function(){var e=i.dataItem(),n=e?i._value(e):null,u,f;n||n===0?(u=t.dataSource.filter()||{},b(u,o),f=u.filters||[],f.push({field:o,operator:"eq",value:n}),t.dataSource.one(r,h).filter(f)):(t.enable(!1),t._clearSelection(i),t._triggerCascade(t._userTriggered),t._userTriggered=!1)};i.bind("cascade",function(n){t._userTriggered=n.userTriggered;e()});i._bound?e():i.value()||t.enable(!1)}}})}(window.kendo.jQuery);kendo_module({id:"calendar",name:"Calendar",category:"web",description:"The Calendar widget renders a graphical calendar that supports navigation and selection.",depends:["core"]}),function(n,t){function li(n,t,i,r){var u=n.getFullYear(),e=t.getFullYear(),o=i.getFullYear(),f;return u=u-u%r,f=u+(r-1),u<e&&(u=e),f>o&&(f=o),u+"-"+f}function d(n){for(var t=0,i,f=n.min,e=n.max,r=n.start,o=n.setter,s=n.build,h=n.cells||12,c=n.perRow||4,l=n.content||bi,a=n.empty||ki,u=n.html||'<table tabindex="0" role="grid" class="k-content k-meta-view" cellspacing="0"><tbody><tr role="row">';t<h;t++)t>0&&t%c==0&&(u+='<\/tr><tr role="row">'),i=s(r,t),u+=nt(r,f,e)?l(i):a(i),o(r,1);return u+"<\/tr><\/tbody><\/table>"}function st(n,t,i){var f=n.getFullYear(),r=t.getFullYear(),e=r,u=0;return i&&(r=r-r%i,e=r-r%i+i-1),f>e?u=1:f<r&&(u=-1),u}function g(){var n=new i;return new i(n.getFullYear(),n.getMonth(),n.getDate())}function v(n,t,r){var u=g();return n&&(u=new i(+n)),t>u?u=new i(+t):r<u&&(u=new i(+r)),u}function nt(n,t,i){return+n>=+t&&+n<=+i}function ai(n,t){return n.slice(t).concat(n.slice(0,t))}function vi(n,t,r){t=t instanceof i?t.getFullYear():n.getFullYear()+r*t;n.setFullYear(t)}function yi(t){n(this).toggleClass(nr,tr.indexOf(t.type)>-1||t.type==ri)}function ur(n){n.preventDefault()}function ht(n){return at(n).calendars.standard}function ct(n){var i=o[n.start],r=o[n.depth],u=at(n.culture);n.format=wi(n.format||u.calendars.standard.patterns.d);isNaN(i)&&(i=0,n.start=a);(r===t||r>i)&&(n.depth=a);n.dates||(n.dates=[])}function pi(n){di&&n.find("*").attr("unselectable","on")}function fr(n,t){for(var i=0,r=t.length;i<r;i++)if(n===+t[i])return!0;return!1}function er(n,t){return n?n.getFullYear()===t.getFullYear()&&n.getMonth()===t.getMonth()&&n.getDate()===t.getDate():!1}function or(n,t){return n?n.getFullYear()===t.getFullYear()&&n.getMonth()===t.getMonth():!1}var r=window.kendo,tt=r.support,lt=r.ui,y=lt.Widget,u=r.keys,it=r.parseDate,p=r.date.adjustDST,wi=r._extractFormat,l=r.template,at=r.getCulture,vt=r.support.transitions,yt=vt?vt.css+"transform-origin":"",bi=l('<td#=data.cssClass# role="gridcell"><a tabindex="-1" class="k-link" href="\\#" data-#=data.ns#value="#=data.dateString#">#=data.value#<\/a><\/td>',{useWithBlock:!1}),ki=l('<td role="gridcell"> <\/td>',{useWithBlock:!1}),pt=r.support.browser,di=pt.msie&&pt.version<9,f=".kendoCalendar",s="click"+f,gi="keydown"+f,rt="id",wt="min",bt="left",ut="slideIn",a="month",kt="century",ft="change",dt="navigate",et="value",nr="k-state-hover",h="k-state-disabled",c="k-state-focused",w="k-other-month",gt=' class="'+w+'"',ni="k-nav-today",ti="td:has(.k-link)",ii="blur"+f,ri="focus",ui=ri+f,tr=tt.touch?"touchstart":"mouseenter",fi=tt.touch?"touchstart"+f:"mouseenter"+f,ei=tt.touch?"touchend"+f+" touchmove"+f:"mouseleave"+f,ir=6e4,oi=864e5,b="_prevArrow",k="_nextArrow",ot="aria-disabled",si="aria-selected",hi=n.proxy,ci=n.extend,i=Date,o={month:0,year:1,decade:2,century:3},rr=y.extend({init:function(t,u){var e=this,h,l;y.fn.init.call(e,t,u);t=e.wrapper=e.element;u=e.options;u.url=window.unescape(u.url);e._templates();e._header();e._footer(e.footer);l=t.addClass("k-widget k-calendar").on(fi+" "+ei,ti,yi).on(gi,"table.k-content",hi(e._move,e)).on(s,ti,function(t){var i=t.currentTarget.firstChild;i.href.indexOf("#")!=-1&&t.preventDefault();e._click(n(i))}).on("mouseup"+f,function(){e._focusView(e.options.focusOnNav!==!1)}).attr(rt);l&&(e._cellID=l+"_cell_selected");ct(u);h=it(u.value,u.format,u.culture);e._index=o[u.start];e._current=new i(+v(h,u.min,u.max));e._addClassProxy=function(){e._active=!0;e._cell.addClass(c)};e._removeClassProxy=function(){e._active=!1;e._cell.removeClass(c)};e.value(h);r.notify(e)},options:{name:"Calendar",value:null,min:new i(1900,0,1),max:new i(2099,11,31),dates:[],url:"",culture:"",footer:"",format:"",month:{},start:a,depth:a,animation:{horizontal:{effects:ut,reverse:!0,duration:500,divisor:2},vertical:{effects:"zoomIn",duration:400}}},events:[ft,dt],setOptions:function(n){var t=this;ct(n);y.fn.setOptions.call(t,n);t._templates();t._footer(t.footer);t._index=o[t.options.start];t.navigate()},destroy:function(){var n=this,t=n._today;n.element.off(f);n._title.off(f);n[b].off(f);n[k].off(f);r.destroy(n._table);t&&r.destroy(t.off(f));y.fn.destroy.call(n)},current:function(){return this._current},view:function(){return this._view},focus:function(n){n=n||this._table;this._bindTable(n);n.focus()},min:function(n){return this._option(wt,n)},max:function(n){return this._option("max",n)},navigateToPast:function(){this._navigate(b,-1)},navigateToFuture:function(){this._navigate(k,1)},navigateUp:function(){var n=this,t=n._index;n._title.hasClass(h)||n.navigate(n._current,++t)},navigateDown:function(n){var t=this,i=t._index,r=t.options.depth;if(n){if(i===o[r]){+t._value!=+n&&(t.value(n),t.trigger(ft));return}t.navigate(n,--i)}},navigate:function(r,u){u=isNaN(u)?o[u]:u;var f=this,l=f.options,tt=l.culture,p=l.min,w=l.max,it=f._title,y=f._table,d=f._oldTable,rt=f._value,ut=f._current,ft=r&&+r>+ut,et=u!==t&&u!==f._index,g,a,nt,s;r||(r=ut);f._current=r=new i(+v(r,p,w));u===t?u=f._index:f._index=u;f._view=a=e.views[u];nt=a.compare;s=u===o[kt];it.toggleClass(h,s).attr(ot,s);s=nt(r,p)<1;f[b].toggleClass(h,s).attr(ot,s);s=nt(r,w)>-1;f[k].toggleClass(h,s).attr(ot,s);y&&d&&d.data("animating")&&(d.kendoStop(!0,!0),y.kendoStop(!0,!0));f._oldTable=y;(!y||f._changeView)&&(it.html(a.title(r,p,w,tt)),f._table=g=n(a.content(ci({min:p,max:w,date:r,url:l.url,dates:l.dates,format:l.format,culture:tt},f[a.name]))),pi(g),f._animate({from:y,to:g,vertical:et,future:ft}),f._focus(r),f.trigger(dt));u===o[l.depth]&&rt&&f._class("k-state-selected",a.toDateString(rt));f._class(c,a.toDateString(r));!y&&f._cell&&f._cell.removeClass(c);f._changeView=!0},value:function(n){var r=this,f=r._view,u=r.options,e=r._view,o=u.min,s=u.max;if(n===t)return r._value;n=it(n,u.format,u.culture);n!==null&&(n=new i(+n),nt(n,o,s)||(n=null));r._value=n;e&&n===null&&r._cell?r._cell.removeClass("k-state-selected"):(r._changeView=!n||f&&f.compare(n,r._current)!==0,r.navigate(n))},_move:function(t){var f=this,y=f.options,e=t.keyCode,p=f._view,w=f._index,s=new i(+f._current),h=r.support.isRtl(f.wrapper),c,o,l,a;return t.target===f._table[0]&&(f._active=!0),t.ctrlKey?e==u.RIGHT&&!h||e==u.LEFT&&h?(f.navigateToFuture(),o=!0):e==u.LEFT&&!h||e==u.RIGHT&&h?(f.navigateToPast(),o=!0):e==u.UP?(f.navigateUp(),o=!0):e==u.DOWN&&(f._click(n(f._cell[0].firstChild)),o=!0):(e==u.RIGHT&&!h||e==u.LEFT&&h?(c=1,o=!0):e==u.LEFT&&!h||e==u.RIGHT&&h?(c=-1,o=!0):e==u.UP?(c=w===0?-7:-4,o=!0):e==u.DOWN?(c=w===0?7:4,o=!0):e==u.ENTER?(f._click(n(f._cell[0].firstChild)),o=!0):e==u.HOME||e==u.END?(l=e==u.HOME?"first":"last",a=p[l](s),s=new i(a.getFullYear(),a.getMonth(),a.getDate(),s.getHours(),s.getMinutes(),s.getSeconds(),s.getMilliseconds()),o=!0):e==u.PAGEUP?(o=!0,f.navigateToPast()):e==u.PAGEDOWN&&(o=!0,f.navigateToFuture()),(c||l)&&(l||p.setDate(s,c),f._focus(v(s,y.min,y.max)))),o&&t.preventDefault(),f._current},_animate:function(n){var t=this,i=n.from,r=n.to,u=t._active;i?i.parent().data("animating")?(i.parent().kendoStop(!0,!0).remove(),i.remove(),r.insertAfter(t.element[0].firstChild),t._focusView(u)):i.is(":visible")&&t.options.animation!==!1?t[n.vertical?"_vertical":"_horizontal"](i,r,n.future):(r.insertAfter(i),i.remove(),t._focusView(u)):(r.insertAfter(t.element[0].firstChild),t._bindTable(r))},_horizontal:function(n,i,r){var u=this,o=u._active,f=u.options.animation.horizontal,s=f.effects,e=n.outerWidth();s&&s.indexOf(ut)!=-1&&(n.add(i).css({width:e}),n.wrap("<div/>"),u._focusView(o,n),n.parent().css({position:"relative",width:e*2,float:bt,"margin-left":r?0:-e}),i[r?"insertAfter":"insertBefore"](n),ci(f,{effects:ut+":"+(r?"right":bt),complete:function(){n.remove();i.unwrap();u._focusView(o);u._oldTable=t}}),n.parent().kendoStop(!0,!0).kendoAnimate(f))},_vertical:function(n,i){var r=this,e=r.options.animation.vertical,o=e.effects,s=r._active,f,u;o&&o.indexOf("zoom")!=-1&&(i.css({position:"absolute",top:n.prev().outerHeight(),left:0}).insertBefore(n),yt&&(f=r._cellByDate(r._view.toDateString(r._current)),u=f.position(),u=u.left+parseInt(f.width()/2,10)+"px "+(u.top+parseInt(f.height()/2,10)+"px"),i.css(yt,u)),n.kendoStop(!0,!0).kendoAnimate({effects:"fadeOut",duration:600,complete:function(){n.remove();i.css({position:"static",top:0,left:0});r._focusView(s);r._oldTable=t}}),i.kendoStop(!0,!0).kendoAnimate(e))},_cellByDate:function(t){return this._table.find("td:not(."+w+")").filter(function(){return n(this.firstChild).attr(r.attr(et))===t})},_class:function(t,i){var u=this,e=u._cellID,f=u._cell;f&&f.removeAttr(si).removeAttr("aria-label").removeAttr(rt);f=u._table.find("td:not(."+w+")").removeClass(t).filter(function(){return n(this.firstChild).attr(r.attr(et))===i}).attr(si,!0);t!==c||u._active||u.options.focusOnNav===!1||(t="");f.addClass(t);f[0]&&(u._cell=f);e&&(f.attr(rt,e),u._table.removeAttr("aria-activedescendant").attr("aria-activedescendant",e))},_bindTable:function(n){n.on(ui,this._addClassProxy).on(ii,this._removeClassProxy)},_click:function(n){var u=this,f=u.options,e=new Date(+u._current),t=n.attr(r.attr(et)).split("/");t=new i(t[0],t[1],t[2]);p(t,0);u._view.setDate(e,t);u.navigateDown(v(e,f.min,f.max))},_focus:function(n){var t=this,i=t._view;i.compare(n,t._current)!==0?t.navigate(n):(t._current=n,t._class(c,i.toDateString(n)))},_focusView:function(n,t){n&&this.focus(t)},_footer:function(t){var i=this,f=g(),e=i.element,u=e.find(".k-footer");if(!t){i._toggle(!1);u.hide();return}u[0]||(u=n('<div class="k-footer"><a href="#" class="k-link k-nav-today"><\/a><\/div>').appendTo(e));i._today=u.show().find(".k-link").html(t(f)).attr("title",r.toString(f,"D",i.options.culture));i._toggle()},_header:function(){var n=this,i=n.element,t;i.find(".k-header")[0]||i.html('<div class="k-header"><a href="#" role="button" class="k-link k-nav-prev"><span class="k-icon k-i-arrow-w"><\/span><\/a><a href="#" role="button" aria-live="assertive" aria-atomic="true" class="k-link k-nav-fast"><\/a><a href="#" role="button" class="k-link k-nav-next"><span class="k-icon k-i-arrow-e"><\/span><\/a><\/div>');t=i.find(".k-link").on(fi+" "+ei+" "+ui+" "+ii,yi).click(!1);n._title=t.eq(1).on(s,function(){n._focusView(n.options.focusOnNav!==!1);n.navigateUp()});n[b]=t.eq(0).on(s,function(){n._focusView(n.options.focusOnNav!==!1);n.navigateToPast()});n[k]=t.eq(2).on(s,function(){n._focusView(n.options.focusOnNav!==!1);n.navigateToFuture()})},_navigate:function(n,t){var r=this,f=r._index+1,u=new i(+r._current);n=r[n];n.hasClass(h)||(f>3?u.setFullYear(u.getFullYear()+100*t):e.views[f].setDate(u,t),r.navigate(u))},_option:function(n,r){var u=this,f=u.options,e=u._value||u._current,o;if(r===t)return f[n];(r=it(r,f.format,f.culture),r)&&(f[n]=new i(+r),o=n===wt?r>e:e>r,(o||or(e,r))&&(o&&(u._value=null),u._changeView=!0),u._changeView||(u._changeView=!!(f.month.content||f.month.empty)),u.navigate(u._value),u._toggle())},_toggle:function(n){var i=this,u=i.options,r=i._today;if(n===t&&(n=nt(g(),u.min,u.max)),r)if(r.off(s),n)r.addClass(ni).removeClass(h).on(s,hi(i._todayClick,i));else r.removeClass(ni).addClass(h).on(s,ur)},_todayClick:function(n){var t=this,r=o[t.options.depth],i=g();n.preventDefault();t._view.compare(t._current,i)===0&&t._index==r&&(t._changeView=!1);t._value=i;t.navigate(i,r);t.trigger(ft)},_templates:function(){var n=this,t=n.options,i=t.footer,u=t.month,f=u.content,e=u.empty;n.month={content:l('<td#=data.cssClass# role="gridcell"><a tabindex="-1" class="k-link#=data.linkClass#" href="#=data.url#" '+r.attr("value")+'="#=data.dateString#" title="#=data.title#">'+(f||"#=data.value#")+"<\/a><\/td>",{useWithBlock:!!f}),empty:l('<td role="gridcell">'+(e||" ")+"<\/td>",{useWithBlock:!!e})};n.footer=i!==!1?l(i||'#= kendo.toString(data,"D","'+t.culture+'") #',{useWithBlock:!1}):null}}),e;lt.plugin(rr);e={firstDayOfMonth:function(n){return new i(n.getFullYear(),n.getMonth(),1)},firstVisibleDay:function(n,t){t=t||r.culture().calendar;for(var f=t.firstDay,u=new i(n.getFullYear(),n.getMonth(),0,n.getHours(),n.getMinutes(),n.getSeconds(),n.getMilliseconds());u.getDay()!=f;)e.setTime(u,-1*oi);return u},setTime:function(n,t){var u=n.getTimezoneOffset(),r=new i(n.getTime()+t),f=r.getTimezoneOffset()-u;n.setTime(r.getTime()+f*ir)},views:[{name:a,title:function(n,t,i,r){return ht(r).months.names[n.getMonth()]+" "+n.getFullYear()},content:function(n){for(var u=this,f=0,o=n.min,s=n.max,h=n.date,c=n.dates,nt=n.format,l=n.culture,y=n.url,tt=y&&c[0],a=ht(l),b=a.firstDay,k=a.days,it=ai(k.names,b),rt=ai(k.namesShort,b),v=e.firstVisibleDay(h,a),ut=u.first(h),ft=u.last(h),et=u.toDateString,t=new i,g='<table tabindex="0" role="grid" class="k-content" cellspacing="0"><thead><tr role="row">';f<7;f++)g+='<th scope="col" title="'+it[f]+'">'+rt[f]+"<\/th>";return t=new i(t.getFullYear(),t.getMonth(),t.getDate()),p(t,0),t=+t,d({cells:42,perRow:7,html:g+='<\/tr><\/thead><tbody><tr role="row">',start:new i(v.getFullYear(),v.getMonth(),v.getDate()),min:new i(o.getFullYear(),o.getMonth(),o.getDate()),max:new i(s.getFullYear(),s.getMonth(),s.getDate()),content:n.content,empty:n.empty,setter:u.setDate,build:function(n){var i=[],u=n.getDay(),f="",e="#";return(n<ut||n>ft)&&i.push(w),+n===t&&i.push("k-today"),(u===0||u===6)&&i.push("k-weekend"),tt&&fr(+n,c)&&(e=y.replace("{0}",r.toString(n,nt,l)),f=" k-action-link"),{date:n,dates:c,ns:r.ns,title:r.toString(n,"D",l),value:n.getDate(),dateString:et(n),cssClass:i[0]?' class="'+i.join(" ")+'"':"",linkClass:f,url:e}}})},first:function(n){return e.firstDayOfMonth(n)},last:function(n){var t=new i(n.getFullYear(),n.getMonth()+1,0),r=e.firstDayOfMonth(n),u=Math.abs(t.getTimezoneOffset()-r.getTimezoneOffset());return u&&t.setHours(r.getHours()+u/60),t},compare:function(n,t){var i=n.getMonth(),r=n.getFullYear(),u=t.getMonth(),f=t.getFullYear();return r>f?1:r<f?-1:i==u?0:i>u?1:-1},setDate:function(n,t){var r=n.getHours();t instanceof i?n.setFullYear(t.getFullYear(),t.getMonth(),t.getDate()):e.setTime(n,t*oi);p(n,r)},toDateString:function(n){return n.getFullYear()+"/"+n.getMonth()+"/"+n.getDate()}},{name:"year",title:function(n){return n.getFullYear()},content:function(n){var f=ht(n.culture).months.namesAbbr,e=this.toDateString,t=n.min,u=n.max;return d({min:new i(t.getFullYear(),t.getMonth(),1),max:new i(u.getFullYear(),u.getMonth(),1),start:new i(n.date.getFullYear(),0,1),setter:this.setDate,build:function(n){return{value:f[n.getMonth()],ns:r.ns,dateString:e(n),cssClass:""}}})},first:function(n){return new i(n.getFullYear(),0,n.getDate())},last:function(n){return new i(n.getFullYear(),11,n.getDate())},compare:function(n,t){return st(n,t)},setDate:function(n,t){var r,u=n.getHours();t instanceof i?(r=t.getMonth(),n.setFullYear(t.getFullYear(),r,n.getDate()),r!==n.getMonth()&&n.setDate(0)):(r=n.getMonth()+t,n.setMonth(r),r>11&&(r-=12),r>0&&n.getMonth()!=r&&n.setDate(0));p(n,u)},toDateString:function(n){return n.getFullYear()+"/"+n.getMonth()+"/1"}},{name:"decade",title:function(n,t,i){return li(n,t,i,10)},content:function(n){var t=n.date.getFullYear(),u=this.toDateString;return d({start:new i(t-t%10-1,0,1),min:new i(n.min.getFullYear(),0,1),max:new i(n.max.getFullYear(),0,1),setter:this.setDate,build:function(n,t){return{value:n.getFullYear(),ns:r.ns,dateString:u(n),cssClass:t===0||t==11?gt:""}}})},first:function(n){var t=n.getFullYear();return new i(t-t%10,n.getMonth(),n.getDate())},last:function(n){var t=n.getFullYear();return new i(t-t%10+9,n.getMonth(),n.getDate())},compare:function(n,t){return st(n,t,10)},setDate:function(n,t){vi(n,t,1)},toDateString:function(n){return n.getFullYear()+"/0/1"}},{name:kt,title:function(n,t,i){return li(n,t,i,100)},content:function(n){var o=n.date.getFullYear(),f=n.min.getFullYear(),e=n.max.getFullYear(),s=this.toDateString,t=f,u=e;return t=t-t%10,u=u-u%10,u-t<10&&(u=t+9),d({start:new i(o-o%100-10,0,1),min:new i(t,0,1),max:new i(u,0,1),setter:this.setDate,build:function(n,t){var i=n.getFullYear(),u=i+9;return i<f&&(i=f),u>e&&(u=e),{ns:r.ns,value:i+" - "+u,dateString:s(n),cssClass:t===0||t==11?gt:""}}})},first:function(n){var t=n.getFullYear();return new i(t-t%100,n.getMonth(),n.getDate())},last:function(n){var t=n.getFullYear();return new i(t-t%100+99,n.getMonth(),n.getDate())},compare:function(n,t){return st(n,t,100)},setDate:function(n,t){vi(n,t,10)},toDateString:function(n){var t=n.getFullYear();return t-t%10+"/0/1"}}]};e.isEqualDatePart=er;e.makeUnselectable=pi;e.restrictValue=v;e.isInRange=nt;e.normalize=ct;e.viewsEnum=o;r.calendar=e}(window.kendo.jQuery);kendo_module({id:"datepicker",name:"DatePicker",category:"web",description:"The DatePicker widget allows the user to select a date from a calendar or by direct input.",depends:["calendar","popup"]}),function(n,t){function d(t){var i=t.parseFormats,r=t.format;o.normalize(t);i=n.isArray(i)?i:[i];n.inArray(r,i)===-1&&i.splice(0,0,t.format);t.parseFormats=i}function pt(n){n.preventDefault()}var i=window.kendo,f=i.ui,e=f.Widget,c=i.parseDate,u=i.keys,bt=i.template,kt=i._activeElement,g="<div />",nt="<span />",r=".kendoDatePicker",tt="click"+r,l="open",a="close",v="change",it="disabled",rt="readonly",y="k-state-default",ut="k-state-focused",ft="k-state-selected",p="k-state-disabled",dt="k-state-hover",ii="keydown"+r,gt="mouseenter"+r+" mouseleave"+r,et="mousedown"+r,w="id",ot="min",st="max",ht="month",ct="aria-disabled",lt="aria-expanded",b="aria-hidden",at="aria-readonly",o=i.calendar,ni=o.isInRange,vt=o.restrictValue,ti=o.isEqualDatePart,k=n.extend,s=n.proxy,yt=Date,h=function(t){var r=this,u,o=document.body,e=n(g).attr(b,"true").addClass("k-calendar-container").appendTo(o);r.options=t=t||{};u=t.id;u&&(u+="_dateview",e.attr(w,u),r._dateViewID=u);r.popup=new f.Popup(e,k(t.popup,t,{name:"Popup",isRtl:i.support.isRtl(t.anchor)}));r.div=e;r.value(t.value)},wt;h.prototype={_calendar:function(){var t=this,r=t.calendar,u=t.options,e;r||(e=n(g).attr(w,i.guid()).appendTo(t.popup.element).on(et,pt).on(tt,"td:has(.k-link)",s(t._click,t)),t.calendar=r=new f.Calendar(e),t._setOptions(u),i.calendar.makeUnselectable(r.element),r.navigate(t._value||t._current,u.start),t.value(t._value))},_setOptions:function(n){this.calendar.setOptions({focusOnNav:!1,change:n.change,culture:n.culture,dates:n.dates,depth:n.depth,footer:n.footer,format:n.format,max:n.max,min:n.min,month:n.month,start:n.start})},setOptions:function(n){var t=this.options;this.options=k(t,n,{change:t.change,close:t.close,open:t.open});this.calendar&&this._setOptions(this.options)},destroy:function(){this.popup.destroy()},open:function(){var n=this;n._calendar();n.popup.open()},close:function(){this.popup.close()},min:function(n){this._option(ot,n)},max:function(n){this._option(st,n)},toggle:function(){var n=this;n[n.popup.visible()?a:l]()},move:function(n){var t=this,i=n.keyCode,r=t.calendar,f=n.ctrlKey&&i==u.DOWN||i==u.ENTER;if(i==u.ESC){t.close();return}if(n.altKey){i==u.DOWN?(t.open(),n.preventDefault()):i==u.UP&&(t.close(),n.preventDefault());return}if(t.popup.visible()){if(f&&r._cell.hasClass(ft)){t.close();n.preventDefault();return}t._current=r._move(n)}},current:function(n){this._current=n;this.calendar._focus(n)},value:function(n){var t=this,i=t.calendar,r=t.options;t._value=n;t._current=new yt(+vt(n,r.min,r.max));i&&i.value(n)},_click:function(n){n.currentTarget.className.indexOf(ft)!==-1&&this.close()},_option:function(n,t){var i=this,r=i.calendar;i.options[n]=t;r&&r[n](t)}};h.normalize=d;i.DateView=h;wt=e.extend({init:function(n,t){var r=this,f,u;e.fn.init.call(r,n,t);n=r.element;t=r.options;d(t);r._wrapper();r.dateView=new h(k({},t,{id:n.attr(w),anchor:r.wrapper,change:function(){r._change(this.value());r.close()},close:function(t){r.trigger(a)?t.preventDefault():(n.attr(lt,!1),u.attr(b,!0))},open:function(t){var f=r.options,i;r.trigger(l)?t.preventDefault():(r.element.val()!==r._oldText&&(i=c(n.val(),f.parseFormats,f.culture),r.dateView[i?"current":"value"](i)),n.attr(lt,!0),u.attr(b,!1),r._updateARIA(i))}}));u=r.dateView.div;r._icon();try{n[0].setAttribute("type","text")}catch(o){n[0].type="text"}n.addClass("k-input").attr({role:"combobox","aria-expanded":!1,"aria-owns":r.dateView._dateViewID});r._reset();r._template();f=n.is("[disabled]");f?r.enable(!1):r.readonly(n.is("[readonly]"));r._old=r._update(t.value||r.element.val());r._oldText=n.val();i.notify(r)},events:[l,a,v],options:{name:"DatePicker",value:null,footer:"",format:"",culture:"",parseFormats:[],min:new Date(1900,0,1),max:new Date(2099,11,31),start:ht,depth:ht,animation:{},month:{},dates:[],ARIATemplate:'Current focused date is #=kendo.toString(data.current, "D")#'},setOptions:function(n){var t=this,r=t._value;e.fn.setOptions.call(t,n);n=t.options;d(n);t.dateView.setOptions(n);r&&(t.element.val(i.toString(r,n.format,n.culture)),t._updateARIA(r))},_editable:function(n){var t=this,o=t._dateIcon.off(r),f=t.element.off(r),e=t._inputWrapper.off(r),u=n.readonly,i=n.disable;if(u||i)e.addClass(i?p:y).removeClass(i?y:p),f.attr(it,i).attr(rt,u).attr(ct,i).attr(at,u);else{e.addClass(y).removeClass(p).on(gt,t._toggleHover);f.removeAttr(it).removeAttr(rt).attr(ct,!1).attr(at,!1).on("keydown"+r,s(t._keydown,t)).on("blur"+r,s(t._blur,t)).on("focus"+r,function(){t._inputWrapper.addClass(ut)});o.on(tt,s(t._click,t)).on(et,pt)}},readonly:function(n){this._editable({readonly:n===t?!0:n,disable:!1})},enable:function(n){this._editable({readonly:!1,disable:!(n=n===t?!0:n)})},destroy:function(){var n=this;e.fn.destroy.call(n);n.dateView.destroy();n.element.off(r);n._dateIcon.off(r);n._inputWrapper.off(r);n._form&&n._form.off("reset",n._resetHandler)},open:function(){this.dateView.open()},close:function(){this.dateView.close()},min:function(n){return this._option(ot,n)},max:function(n){return this._option(st,n)},value:function(n){var i=this;if(n===t)return i._value;i._old=i._update(n);i._old===null&&i.element.val("");i._oldText=i.element.val()},_toggleHover:function(t){n(t.currentTarget).toggleClass(dt,t.type==="mouseenter")},_blur:function(){var n=this,t=n.element.val();n.close();t!==n._oldText&&n._change(t);n._inputWrapper.removeClass(ut)},_click:function(){var n=this,t=n.element;n.dateView.toggle();i.support.touch||t[0]===kt()||t.focus()},_change:function(n){var t=this;n=t._update(n);+t._old!=+n&&(t._old=n,t._oldText=t.element.val(),t.trigger(v),t.element.trigger(v))},_keydown:function(n){var t=this,i=t.dateView,r=t.element.val();i.popup.visible()||n.keyCode!=u.ENTER||r===t._oldText?(i.move(n),t._updateARIA(i._current)):t._change(r)},_icon:function(){var i=this,r=i.element,t;t=r.next("span.k-select");t[0]||(t=n('<span unselectable="on" class="k-select"><span unselectable="on" class="k-icon k-i-calendar">select<\/span><\/span>').insertAfter(r));i._dateIcon=t.attr({role:"button","aria-controls":i.dateView._dateViewID})},_option:function(n,i){var u=this,r=u.options;if(i===t)return r[n];(i=c(i,r.parseFormats,r.culture),i)&&(r[n]=new yt(+i),u.dateView[n](i))},_update:function(n){var u=this,r=u.options,f=r.min,o=r.max,t=c(n,r.parseFormats,r.culture),e;return+t==+u._value?(e=i.toString(t,r.format,r.culture),e!==n&&u.element.val(t===null?n:e),t):(t!==null&&ti(t,f)?t=vt(t,f,o):ni(t,f,o)||(t=null),u._value=t,u.dateView.value(t),u.element.val(t?i.toString(t,r.format,r.culture):n),u._updateARIA(t),t)},_wrapper:function(){var r=this,i=r.element,t;t=i.parents(".k-datepicker");t[0]||(t=i.wrap(nt).parent().addClass("k-picker-wrap k-state-default"),t=t.wrap(nt).parent());t[0].style.cssText=i[0].style.cssText;i.css({width:"100%",height:i[0].style.height});r.wrapper=t.addClass("k-widget k-datepicker k-header").addClass(i[0].className);r._inputWrapper=n(t[0].firstChild)},_reset:function(){var t=this,i=t.element,r=i.attr("form"),u=r?n("#"+r):i.closest("form");u[0]&&(t._resetHandler=function(){t.value(i[0].defaultValue)},t._form=u.on("reset",t._resetHandler))},_template:function(){this._ariaTemplate=bt(this.options.ARIATemplate)},_updateARIA:function(n){var i,t=this,r=t.dateView.calendar;t.element.removeAttr("aria-activedescendant");r&&(i=r._cell,i.attr("aria-label",t._ariaTemplate({current:n||r.current()})),t.element.attr("aria-activedescendant",i.attr("id")))}});f.plugin(wt)}(window.kendo.jQuery);kendo_module({id:"dropdownlist",name:"DropDownList",category:"web",description:"The DropDownList widget displays a list of values and allows the selection of a single value from the list.",depends:["list"],features:[{id:"mobile-scroller",name:"Mobile scroller",description:"Support for kinetic scrolling in mobile device",depends:["mobile.scroller"]}]}),function(n,t){function o(n,t,i){for(var u=0,f=t.length-1,r;u<f;++u)r=t[u],r in n||(n[r]={}),n=n[r];n[t[f]]=i}var r=window.kendo,s=r.ui,u=s.Select,f=r.support.mobileOS,i=".kendoDropDownList",a="disabled",v="readonly",y="change",p="k-state-focused",h="k-state-default",c="k-state-disabled",w="aria-disabled",b="aria-readonly",l="k-state-selected",k="mouseenter"+i+" mouseleave"+i,e="tabindex",d=n.proxy,g=u.extend({init:function(f,o){var s=this,a=o&&o.index,c,l,h;s.ns=i;o=n.isArray(o)?{dataSource:o}:o;u.fn.init.call(s,f,o);s._focusHandler=function(){s.wrapper.focus()};o=s.options;f=s.element.on("focus"+i,s._focusHandler);this._inputTemplate();s._reset();s._word="";s._wrapper();s._tabindex();s.wrapper.data(e,s.wrapper.attr(e));s._aria();s._span();s._popup();s._mobile();s._dataSource();s._ignoreCase();s._enable();s._oldIndex=s.selectedIndex=-1;s._cascade();a!==t&&(o.index=a);o.autoBind?s.dataSource.fetch():s.selectedIndex===-1&&(h=o.text||"",h||(c=o.optionLabel,l=c&&o.index===0,s._isSelect?h=l?c:f.children(":selected").text():!f[0].value&&l&&(h=c)),s._textAccessor(h));r.notify(s)},options:{name:"DropDownList",enabled:!0,autoBind:!0,index:0,text:null,value:null,template:"",valueTemplate:"",delay:500,height:200,dataTextField:"",dataValueField:"",optionLabel:"",cascadeFrom:"",cascadeFromField:"",ignoreCase:!0,animation:{}},events:["open","close",y,"select","dataBinding","dataBound","cascade"],setOptions:function(n){u.fn.setOptions.call(this,n);this._template();this._inputTemplate();this._accessors();this._aria()},destroy:function(){var n=this;n.wrapper.off(i);n.element.off(i);n._inputWrapper.off(i);u.fn.destroy.call(n)},open:function(){var n=this;n.ul[0].firstChild?(n.popup.open(),n._scroll(n._current)):(n._open=!0,n._request||n.dataSource.fetch())},toggle:function(n){this._toggle(n)},refresh:function(){var n=this,u=n._data(),t=u.length,i=n.options.optionLabel,e=n.element[0],f;n.trigger("dataBinding");n._current&&n.current(null);n.ul[0].innerHTML=r.render(n.template,u);n._height(t);n.popup.visible()&&n.popup._position();n._isSelect&&(f=e.selectedIndex,i&&t&&(i='<option value="">'+n._optionLabelText(i)+"<\/option>"),n._options(u,i),e.selectedIndex=f===-1?0:f);n._open&&(n._open=!1,n.toggle(!!t));n._hideBusy();n._makeUnselectable();n._fetch||(t?n._selectItem():n._textAccessor()!==i&&(n.element.val(""),n._textAccessor("")));n._bound=!!t;n.trigger("dataBound")},search:function(n){if(n){var i=this,r=i.options.ignoreCase;r&&(n=n.toLowerCase());i._select(function(u){var f=i._text(u);if(f!==t)return f=f+"",r&&(f=f.toLowerCase()),f.indexOf(n)===0})}},text:function(n){var i=this,r,u,f=i.options.ignoreCase;if(n=n===null?"":n,n!==t)typeof n=="string"&&(u=f?n.toLowerCase():n,r=i._select(function(n){return n=i._text(n),f&&(n=(n+"").toLowerCase()),n===u}),r&&(n=r)),i._textAccessor(n);else return i._textAccessor()},value:function(n){var i=this,r,u;if(n!==t){if(n!==null&&(n=n.toString()),i._selectedValue=n,u=n||i.options.optionLabel&&!i.element[0].disabled&&n==="",u&&i._fetchItems(n))return;r=i._index(n);i.select(r>-1?r:0)}else return i._accessor()},_editable:function(n){var t=this,s=t.element,o=n.disable,l=n.readonly,u=t.wrapper.off(i),f=t._inputWrapper.off(k),y=function(){f.addClass(p);t._blured=!1},g=function(){if(!t._blured){t._triggerCascade();var n=window.self!==window.top;r.support.mobileOS.ios&&n?t._change():t._blur();f.removeClass(p);t._blured=!0;s.blur()}};if(l||o){if(o)u.removeAttr(e),f.addClass(c).removeClass(h);else{f.addClass(h).removeClass(c);u.on("focusin"+i,y).on("focusout"+i,g)}s.attr(a,o).attr(v,l);u.attr(w,o).attr(b,l)}else{s.removeAttr(a).removeAttr(v);f.addClass(h).removeClass(c).on(k,t._toggleHover);u.attr(e,u.data(e)).attr(w,!1).attr(b,!1).on("click"+i,function(n){t._blured=!1;n.preventDefault();t.toggle()}).on("keydown"+i,d(t._keydown,t)).on("keypress"+i,d(t._keypress,t)).on("focusin"+i,y).on("focusout"+i,g)}},_accept:function(n){this._focus(n)},_optionLabelText:function(){var t=this.options,i=t.dataTextField,n=t.optionLabel;return n&&i&&typeof n=="object"?this._text(n):n},_data:function(){var h=this,f=h.options,t=f.optionLabel,i=f.dataTextField,e=f.dataValueField,u=h.dataSource.view(),c=u.length,n=t,s=0;if(t&&c){for(typeof t=="object"?n=t:i&&(n={},i=i.split("."),e=e.split("."),o(n,e,""),o(n,i,t)),n=new r.data.ObservableArray([n]);s<c;s++)n.push(u[s]);u=n}return u},_selectItem:function(){u.fn._selectItem.call(this);this.current()||this.select(0)},_keydown:function(n){var u=this,t=n.keyCode,i=r.keys,f=u.ul[0];t===i.LEFT?t=i.UP:t===i.RIGHT&&(t=i.DOWN);n.keyCode=t;u._move(n);t===i.HOME?(n.preventDefault(),u._select(f.firstChild)):t===i.END&&(n.preventDefault(),u._select(f.lastChild))},_selectNext:function(n,t){for(var i=this,r,f=t,u=i._data(),o=u.length,s=i.options.ignoreCase,e=function(t,r){return t=t+"",s&&(t=t.toLowerCase()),t.indexOf(n)===0?(i._select(r),i._triggerEvents(),!0):void 0};t<o;t++)if(r=i._text(u[t]),r&&e(r,t))return!0;if(f>0)for(t=0;t<=f;t++)if(r=i._text(u[t]),r&&e(r,t))return!0;return!1},_keypress:function(n){if(n.charCode!==0){var t=this,i=String.fromCharCode(n.charCode||n.keyCode),u=t.selectedIndex,r=t._word;(t.options.ignoreCase&&(i=i.toLowerCase()),i===" "&&n.preventDefault(),t._last===i&&r.length<=1&&u>-1&&(r||(r=i),t._selectNext(r,u+1)))||(t._word=r+i,t._last=i,t._search())}},_popup:function(){u.fn._popup.call(this);this.popup.one("open",function(){this.wrapper=r.wrap(this.element).addClass("km-popup")})},_search:function(){var n=this,i=n.dataSource,t=n.selectedIndex,r=n._word;if(clearTimeout(n._typing),n._typing=setTimeout(function(){n._word=""},n.options.delay),t===-1&&(t=0),!n.ul[0].firstChild){i.one(y,function(){i.data()[0]&&t>-1&&n._selectNext(r,t)}).fetch();return}n._selectNext(r,t);n._triggerEvents()},_select:function(n){var i=this,e=i._current,r=null,f,u;return n=i._get(n),n&&n[0]&&!n.hasClass(l)&&(e&&e.removeClass(l),u=s.List.inArray(n[0],i.ul[0]),u>-1&&(r=i._data()[u],f=i._value(r),i.selectedIndex=u,i._textAccessor(r),i._accessor(f!==t?f:i._text(r),u),i._selectedValue=i._accessor(),i.current(n.addClass(l)),i._optionID&&i._current.attr("aria-selected",!0))),r},_triggerEvents:function(){this.popup.visible()||(this._triggerCascade(),this._change())},_mobile:function(){var t=this,n=t.popup,i=n.element.parents(".km-root").eq(0);i.length&&f&&(n.options.animation.open.effects=f.android||f.meego?"fadeIn":f.ios||f.wp?"slideIn:up":n.options.animation.open.effects)},_span:function(){var t=this,i=t.wrapper,u="span.k-input",r;r=i.find(u);r[0]||(i.append('<span unselectable="on" class="k-dropdown-wrap k-state-default"><span unselectable="on" class="k-input"> <\/span><span unselectable="on" class="k-select"><span unselectable="on" class="k-icon k-i-arrow-s">select<\/span><\/span><\/span>').append(t.element),r=i.find(u));t.span=r;t._inputWrapper=n(i[0].firstChild);t._arrow=i.find(".k-icon").mousedown(function(n){n.preventDefault()})},_wrapper:function(){var i=this,t=i.element,r=t[0],n;n=t.parent();n.is("span.k-widget")||(n=t.wrap("<span />").parent(),n[0].style.cssText=r.style.cssText);t.hide();i._focused=i.wrapper=n.addClass("k-widget k-dropdown k-header").addClass(r.className).css("display","").attr({unselectable:"on",role:"listbox","aria-haspopup":!0,"aria-expanded":!1})},_clearSelection:function(){var n=this,t=n.options.optionLabel;if(n.options.value="",n._selectedValue="",n.dataSource.view()[0]&&(t||n._userTriggered)){n.select(0);return}n.selectedIndex=-1;n.element.val("");n._textAccessor(n.options.optionLabel)},_inputTemplate:function(){var i=this,t=i.options.valueTemplate;t=t?r.template(t):n.proxy(r.template("#:this._text(data)#"),i);i.valueTemplate=t},_textAccessor:function(i){var u=this.dataItem(),f=this.options,e=this.span;if(i!==t)n.isPlainObject(i)||i instanceof r.data.ObservableObject?u=i:u&&this._text(u)===i||(f.dataTextField?(u={},o(u,f.dataTextField.split("."),i),o(u,f.dataValueField.split("."),this._accessor())):u=i),e.html(this.valueTemplate(u));else return e.text()}});s.plugin(g)}(window.kendo.jQuery);kendo_module({id:"combobox",name:"ComboBox",category:"web",description:"The ComboBox widget allows the selection from pre-defined values or entering a new value.",depends:["list"],features:[{id:"mobile-scroller",name:"Mobile scroller",description:"Support for kinetic scrolling in mobile device",depends:["mobile.scroller"]}]}),function(n,t){var r=window.kendo,o=r.ui,u=o.List,f=o.Select,ut=r.support,v=ut.placeholder,s=r._activeElement,h=r.keys,i=".kendoComboBox",y="click"+i,p="mousedown"+i,w="disabled",b="readonly",k="change",c="k-state-default",d="k-state-focused",l="k-state-disabled",g="aria-disabled",nt="aria-readonly",tt="k-state-selected",e="filter",a="accept",it="rebind",ft="mouseenter"+i+" mouseleave"+i,rt=null,et=n.proxy,ot=f.extend({init:function(t,u){var e=this,o;e.ns=i;u=n.isArray(u)?{dataSource:u}:u;f.fn.init.call(e,t,u);e._focusHandler=function(){e.input.focus()};u=e.options;t=e.element.on("focus"+i,e._focusHandler);u.placeholder=u.placeholder||t.attr("placeholder");e._reset();e._wrapper();e._input();e._tabindex(e.input);e._popup();e._dataSource();e._ignoreCase();e._enable();e._cascade();e._aria();e._oldIndex=e.selectedIndex=-1;u.autoBind?e._filterSource():(o=u.text,!o&&e._isSelect&&(o=t.children(":selected").text()),o&&(e.input.val(o),e._prev=o));o||e._placeholder();r.notify(e)},options:{name:"ComboBox",enabled:!0,index:-1,text:null,value:null,autoBind:!0,delay:200,dataTextField:"",dataValueField:"",minLength:0,height:200,highlightFirst:!0,template:"",filter:"none",placeholder:"",suggest:!1,cascadeFrom:"",cascadeFromField:"",ignoreCase:!0,animation:{}},events:["open","close",k,"select","dataBinding","dataBound","cascade"],setOptions:function(n){f.fn.setOptions.call(this,n);this._template();this._accessors();this._aria()},current:function(n){var r=this,i=r._current;if(n===t)return i;i&&i.removeClass(tt);f.fn.current.call(r,n)},destroy:function(){var n=this;n.input.off(i);n.element.off(i);n._inputWrapper.off(i);f.fn.destroy.call(n)},_editable:function(n){var t=this,r=n.disable,f=n.readonly,u=t._inputWrapper.off(i),e=t.element.add(t.input.off(i)),o=t._arrow.parent().off(y+" "+p);if(f||r)u.addClass(r?l:c).removeClass(r?c:l),e.attr(w,r).attr(b,f).attr(g,r).attr(nt,f);else{u.addClass(c).removeClass(l).on(ft,t._toggleHover);e.removeAttr(w).removeAttr(b).attr(g,!1).attr(nt,!1);o.on(y,function(){t.toggle()}).on(p,function(n){n.preventDefault()});t.input.on("keydown"+i,et(t._keydown,t)).on("focus"+i,function(){u.addClass(d);t._placeholder(!1)}).on("blur"+i,function(){u.removeClass(d);clearTimeout(t._typing);t.options.text!==t.input.val()&&t.text(t.text());t._placeholder();t._blur();t.element.blur()})}},open:function(){var n=this,t=n.dataSource.options.serverFiltering;n.popup.visible()||(n.ul[0].firstChild&&(n._state!==a||t)?(n.popup.open(),n._scroll(n._current)):(n._open=!0,n._state=it,n._filterSource()))},refresh:function(){var i=this,f=i.ul[0],l=i.options,a=i._state,o=i._data(),h=o.length,v=!0,y,c,u;i.trigger("dataBinding");f.innerHTML=r.render(i.template,o);i._height(h);i.popup.visible()&&i.popup._position();i._isSelect&&(y=i.element[0].firstChild,a===it&&(i._state=""),u=i._option,i._option=t,i._options(o),u&&u[0].selected?i._custom(u.val(),v):i._bound||y||i._custom("",v));h&&(l.highlightFirst&&i.current(n(f.firstChild)),l.suggest&&i.input.val()&&i._request!==t&&i.suggest(n(f.firstChild)));a===e||i._fetch||i._selectItem();i._open&&(i._open=!1,c=!!h,i._typing&&i.input[0]!==s()&&(c=!1),i.toggle(c),i._typing=t);i._touchScroller&&i._touchScroller.reset();i._makeUnselectable();i._hideBusy();i._bound=!0;i.trigger("dataBound")},search:function(n){n=typeof n=="string"?n:this.text();var t=this,f=n.length,i=t.options,r=i.ignoreCase,u=i.filter,o=i.dataTextField;clearTimeout(t._typing);f>=i.minLength&&(t._state=e,u==="none"?t._filter(n):(t._open=!0,t._filterSource({value:r?n.toLowerCase():n,field:o,operator:u,ignoreCase:r})))},suggest:function(n){var r=this,o=r.input[0],i=r.text(),e=u.caret(o),c=r._last,f;if(c==h.BACKSPACE||c==h.DELETE){r._last=t;return}n=n||"";typeof n!="string"&&(f=u.inArray(n[0],r.ul[0]),n=f>-1?r._text(r.dataSource.view()[f]):"");e<=0&&(e=i.toLowerCase().indexOf(n.toLowerCase())+1);n?(f=n.toLowerCase().indexOf(i.toLowerCase()),f>-1&&(i+=n.substring(f+i.length))):i=i.substring(0,e);i.length===e&&n||(o.value=i,o===s()&&u.selectText(o,e,i.length))},text:function(n){n=n===null?"":n;var i=this,u=i.input[0],e=i.options.ignoreCase,f=n,r;if(n!==t){if(r=i.dataItem(),r&&i._text(r)===n&&i._value(r).toString()===i._old){i._triggerCascade();return}e&&(f=f.toLowerCase());i._select(function(n){return n=i._text(n),e&&(n=(n+"").toLowerCase()),n===f});i.selectedIndex<0&&(i._custom(n),u.value=n);i._prev=u.value;i._triggerCascade()}else return u.value},toggle:function(n){var t=this;t._toggle(n)},value:function(n){var i=this,u=i.options,r;if(n!==t){if(n!==null&&(n=n.toString()),i._selectedValue=n,!i._open&&n&&i._fetchItems(n))return;r=i._index(n);r>-1?i.select(r):(i.current(rt),i._custom(n),(u.value!==n||u.text!==i.input.val())&&(i.text(n),i._placeholder()));i._old=i._accessor();i._oldIndex=i.selectedIndex}else return i._accessor()},_accept:function(n){var t=this;n?t._focus(n):(t.text(t.text()),t._change())},_custom:function(t,i){var r=this,f=r.element,u=r._option;r._state!==e||i||(r._state=a);r._isSelect?(u||(u=r._option=n("<option/>"),f.append(u)),u.text(t),u[0].selected=!0):f.val(t);r._selectedValue=t},_filter:function(n){var i=this,r=i.options,u=i.dataSource,f=r.ignoreCase,e=function(r){var u=i._text(r);if(u!==t)return(u=u+"",u!==""&&n==="")?!1:(f&&(u=u.toLowerCase()),u.indexOf(n)===0)};if(f&&(n=n.toLowerCase()),!i.ul[0].firstChild){u.one(k,function(){u.data()[0]&&i.search(n)}).fetch();return}i._highlight(e)!==-1&&(r.suggest&&i._current&&i.suggest(i._current),i.open());i._hideBusy()},_highlight:function(i){var r=this,f;return i===t||i===null?-1:(i=r._get(i),f=u.inArray(i[0],r.ul[0]),f==-1&&(r.options.highlightFirst&&!r.text()?(i=r.ul[0].firstChild,i&&(i=n(i))):i=rt),r.current(i),f)},_input:function(){var t=this,i=t.element.removeClass("k-input")[0],e=i.accessKey,u=t.wrapper,o="input.k-input",f=i.name||"",r;f&&(f='name="'+f+'_input" ');r=u.find(o);r[0]||(u.append('<span tabindex="-1" unselectable="on" class="k-dropdown-wrap k-state-default"><input '+f+'class="k-input" type="text" autocomplete="off"/><span tabindex="-1" unselectable="on" class="k-select"><span unselectable="on" class="k-icon k-i-arrow-s">select<\/span><\/span><\/span>').append(t.element),r=u.find(o));r[0].style.cssText=i.style.cssText;i.maxLength>-1&&(r[0].maxLength=i.maxLength);r.addClass(i.className).val(this.options.text||i.value).css({width:"100%",height:i.style.height}).attr({role:"combobox","aria-expanded":!1}).show();v&&r.attr("placeholder",t.options.placeholder);e&&(i.accessKey="",r[0].accessKey=e);t._focused=t.input=r;t._inputWrapper=n(u[0].firstChild);t._arrow=u.find(".k-icon").attr({role:"button",tabIndex:-1});i.id&&t._arrow.attr("aria-controls",t.ul[0].id)},_keydown:function(n){var t=this,i=n.keyCode;t._last=i;clearTimeout(t._typing);i==h.TAB||t._move(n)||t._search()},_placeholder:function(n){if(!v){var f=this,i=f.input,r=f.options.placeholder,e;if(r){if(e=f.value(),n===t&&(n=!e),i.toggleClass("k-readonly",n),!n){if(e)return;r=""}i.val(r);r||i[0]!==s()||u.selectText(i[0],0,0)}}},_search:function(){var n=this;n._typing=setTimeout(function(){var t=n.text();n._prev!==t&&(n._prev=t,n.search(t));n._typing=null},n.options.delay)},_select:function(n){var i=this,f,o,r=i._data(),u=i._highlight(n);i.selectedIndex=u;u!==-1&&(i._state===e&&(i._state=a),i._current.addClass(tt),r=r[u],f=i._text(r),o=i._value(r),i._prev=i.input[0].value=f,i._accessor(o!==t?o:f,u),i._selectedValue=i._accessor(),i._placeholder(),i._optionID&&i._current.attr("aria-selected",!0))},_wrapper:function(){var i=this,n=i.element,t=n.parent();t.is("span.k-widget")||(t=n.hide().wrap("<span />").parent(),t[0].style.cssText=n[0].style.cssText);i.wrapper=t.addClass("k-widget k-combobox k-header").addClass(n[0].className).css("display","")},_clearSelection:function(n,t){var i=this,r=n._selectedValue||n.value(),u=r&&n.selectedIndex===-1;(t||!r||u)&&(i.value(""),i.options.value="")}});o.plugin(ot)}(window.kendo.jQuery);kendo_module({id:"multiselect",name:"MultiSelect",category:"web",description:"The MultiSelect widget allows the selection from pre-defined values.",depends:["list"],features:[{id:"mobile-scroller",name:"Mobile scroller",description:"Support for kinetic scrolling in mobile device",depends:["mobile.scroller"]}]}),function(n,t){function ni(n,t){var i;if(n===null&&t!==null||n!==null&&t===null||(i=n.length,i!==t.length))return!1;while(i--)if(n[i]!==t[i])return!1;return!0}function s(t){var i=t.firstChild;return(i&&i.style.display==="none"&&(i=h(i,it)),i)?n(i):i}function lt(t){var i=t.lastChild;return(i&&i.style.display==="none"&&(i=h(i,rt)),i)?n(i):i}function h(n,t){return n=n[t],n&&n.style.display==="none"&&(n=h(n,t)),n}var i=window.kendo,d=i.ui,f=d.List,r=i.keys,g=i._activeElement,at=i.data.ObservableArray,c=n.proxy,e="id",v="li",y="accept",p="filter",nt="open",tt="close",o="change",vt="progress",w="select",it="nextSibling",rt="previousSibling",yt=' style="display:none"',ut="aria-disabled",ft="aria-readonly",l="k-state-focused",b="k-loading-hidden",et="k-state-hover",k="k-state-disabled",ot="disabled",st="readonly",u=".kendoMultiSelect",pt="click"+u,wt="keydown"+u,ht="mouseenter"+u,ct="mouseleave"+u,bt=ht+" "+ct,kt=/"/g,a=n.isArray,dt=["font-family","font-size","font-stretch","font-style","font-weight","letter-spacing","text-transform","line-height"],gt=f.extend({init:function(t,r){var o=this,s,h;o.ns=u;f.fn.init.call(o,t,r);o._wrapper();o._tagList();o._input();o._textContainer();o._loader();o._tabindex(o.input);t=o.element.attr("multiple","multiple").hide();r=o.options;h=r.value;r.placeholder||(r.placeholder=t.data("placeholder"));s=t.attr(e);s&&(o._tagID=s+"_tag_active",s=s+"_taglist",o.tagList.attr(e,s));o._aria(s);o._dataSource();o._ignoreCase();o._popup();o._values=[];o._dataItems=[];o._reset();o._enable();o._placeholder();r.autoBind?o.dataSource.fetch():h&&(a(h)||(h=[h]),(n.isPlainObject(h[0])||!r.dataValueField)&&(o._retrieveData=!0,o.dataSource.data(h),o.value(o._initialValues)));i.notify(o)},options:{name:"MultiSelect",enabled:!0,autoBind:!0,autoClose:!0,highlightFirst:!0,dataTextField:"",dataValueField:"",filter:"startswith",ignoreCase:!0,minLength:0,delay:100,value:null,maxSelectedItems:null,itemTemplate:"",tagTemplate:"",placeholder:"",height:200,animation:{}},events:[nt,tt,o,w,"dataBinding","dataBound"],setDataSource:function(n){this.options.dataSource=n;this._dataSource();this.options.autoBind&&this.dataSource.fetch()},setOptions:function(n){f.fn.setOptions.call(this,n);this._template();this._accessors();this._aria(this.tagList.attr(e))},current:function(n){return this.currentTag(null),f.fn.current.call(this,n)},currentTag:function(n){var i=this;if(n!==t)i._currentTag&&(i._currentTag.removeClass(l).removeAttr(e),i.input.removeAttr("aria-activedescendant")),n&&(n.addClass(l).attr(e,i._tagID),i.input.attr("aria-activedescendant",i._tagID)),i._currentTag=n;else return i._currentTag},dataItems:function(){return this._dataItems},destroy:function(){var n=this,t=n.ns;n.wrapper.off(t);n.tagList.off(t);n.input.off(t);f.fn.destroy.call(n)},_editable:function(t){var i=this,r=t.disable,f=t.readonly,e=i.wrapper.off(u),s=i.tagList.off(u),o=i.element.add(i.input.off(u));if(f||r)r?e.addClass(k):e.removeClass(k),o.attr(ot,r).attr(st,f).attr(ut,r).attr(ft,f);else{e.removeClass(k).on(bt,i._toggleHover).on("mousedown"+u,function(n){var t=n.target.nodeName.toLowerCase()!=="input";t&&n.preventDefault();n.target.className.indexOf("k-delete")===-1&&(i.input[0]!==g()&&t&&i.input.focus(),i.options.minLength===0&&i.open())});i.input.on(wt,c(i._keydown,i)).on("paste"+u,c(i._search,i)).on("focus"+u,function(){i._placeholder(!1)}).on("blur"+u,function(){clearTimeout(i._typing);i._placeholder();i.close();i._state===p&&(i._state=y);i.element.blur()});o.removeAttr(ot).removeAttr(st).attr(ut,!1).attr(ft,!1);s.on(ht,v,function(){n(this).addClass(et)}).on(ct,v,function(){n(this).removeClass(et)}).on(pt,".k-delete",function(t){i._unselect(n(t.target).closest(v));i._change();i.close()})}},_close:function(){var n=this;n.options.autoClose||!n._visibleItems?n.close():(n.current(n.options.highlightFirst?s(n.ul[0]):null),n.popup._position())},close:function(){this.popup.close();this.current(null)},open:function(){var n=this;!n.ul[0].firstChild||n._state===y||n._retrieveData?(n._state="",n._open=!0,n._retrieveData=!1,n._filterSource()):n._visibleItems&&n._allowSelection()&&(n.popup.open(),n.current(n.options.highlightFirst?s(n.ul[0]):null))},toggle:function(n){n=n!==t?n:!this.popup.visible();this[n?nt:tt]()},refresh:function(){var n=this,i=null,t;n.trigger("dataBinding");t=n._render(n.dataSource.view());n._height(t);n._setInitialValues&&(n._setInitialValues=!1,n.value(n._initialValues));n._open&&(n._open=!1,n.toggle(t));n.popup.visible()&&(n.popup._position(),n.options.highlightFirst&&(i=s(n.ul[0])));n.current(i);n._touchScroller&&n._touchScroller.reset();n._makeUnselectable();n._hideBusy();n.trigger("dataBound")},search:function(n){var t=this,i=t.options,u=i.ignoreCase,f=i.filter,e=i.dataTextField,r=t.input.val();i.placeholder===r&&(r="");clearTimeout(t._typing);n=typeof n=="string"?n:r;n.length>=i.minLength&&(t._state=p,t._open=!0,t._filterSource({value:u?n.toLowerCase():n,field:e,operator:f,ignoreCase:u}))},value:function(i){var r=this,o=n(r.tagList[0].children),f=o.length,e,u=0;if(i===t)return r._values;if(!r._fetchItems(i)){for(;u<f;u++)r._unselect(o.eq(u));if(i!==null){for(i=a(i)||i instanceof at?i:[i],u=0,f=i.length;u<f;u++)e=r._index(i[u]),e>-1&&r._select(e);r._old=r._values.slice()}}},_dataSource:function(){var n=this,u=n.element,r=n.options,t=r.dataSource||{};t=a(t)?{data:t}:t;t.select=u;t.fields=[{field:r.dataTextField},{field:r.dataValueField}];n.dataSource&&n._refreshHandler?n._unbindDataSource():(n._refreshHandler=c(n.refresh,n),n._progressHandler=c(n._showBusy,n));n.dataSource=i.data.DataSource.create(t).bind(o,n._refreshHandler).bind(vt,n._progressHandler)},_fetchItems:function(t){var i=this,r=n.isArray(t)&&t.length===0;if(!r&&t&&!i._fetch&&!i.ul[0].firstChild){i.dataSource.one(o,function(){i.value(t);i._fetch=!1});return i._fetch=!0,i.dataSource.fetch(),!0}},_reset:function(){var t=this,i=t.element,r=i.attr("form"),u=r?n("#"+r):i.closest("form");u[0]&&(t._resetHandler=function(){setTimeout(function(){t.value(t._initialValues)})},t._form=u.on("reset",t._resetHandler))},_initValue:function(){var t=this,n=t.options.value||t.element.val();n===null?n=[]:(a(n)||(n=[n]),n=t._mapValues(n));t._old=t._initialValues=n;t._setInitialValues=!!n[0]},_mapValues:function(t){var i=this;return t&&n.isPlainObject(t[0])&&(t=n.map(t,function(n){return i._value(n)})),t},_change:function(){var n=this,t=n.value();ni(t,n._old)||(n._old=t.slice(),n.trigger(o),n.element.trigger(o))},_click:function(t){var i=this,r=n(t.currentTarget);if(!t.isDefaultPrevented()){if(i.trigger(w,{item:r})){i._close();return}i._select(r);i._change();i._close()}},_item:function(n,t){return n=n[t](),n[0]&&!n.is(":visible")&&(n=this._item(n,t)),n},_keydown:function(t){var u=this,e=t.keyCode,f=u._currentTag,o=u._current,l=u.input.val(),a=i.support.isRtl(u.wrapper),c=u.popup.visible();if(e===r.DOWN){if(t.preventDefault(),!c){u.open();return}o=o?h(o[0],it):s(u.ul[0]);o&&u.current(n(o))}else if(e===r.UP)c&&(o=o?h(o[0],rt):lt(u.ul[0]),u.current(n(o)),u._current[0]||u.close()),t.preventDefault();else if(e===r.LEFT&&!a||e===r.RIGHT&&a)l||(f=f?f.prev():n(u.tagList[0].lastChild),f[0]&&u.currentTag(f));else if(e===r.RIGHT&&!a||e===r.LEFT&&a)!l&&f&&(f=f.next(),u.currentTag(f[0]?f:null));else if(e===r.ENTER&&c){if(o){if(u.trigger(w,{item:o})){u._close();return}u._select(o)}u._change();u._close();t.preventDefault()}else e===r.ESC?(c?t.preventDefault():u.currentTag(null),u.close()):e===r.HOME?c?u.current(s(u.ul[0])):l||(f=u.tagList[0].firstChild,f&&u.currentTag(n(f))):e===r.END?c?u.current(lt(u.ul[0])):l||(f=u.tagList[0].lastChild,f&&u.currentTag(n(f))):e!==r.DELETE&&e!==r.BACKSPACE||l?(clearTimeout(u._typing),setTimeout(function(){u._scale()}),u._search()):(e!==r.BACKSPACE||f||(f=n(u.tagList[0].lastChild)),f&&f[0]&&(u._unselect(f),u._change(),u._close()))},_hideBusy:function(){var n=this;clearTimeout(n._busy);n.input.attr("aria-busy",!1);n._loading.addClass(b);n._busy=null},_showBusy:function(){var n=this;n._busy||(n._busy=setTimeout(function(){n.input.attr("aria-busy",!0);n._loading.removeClass(b)},100))},_placeholder:function(n){var i=this,r=i.input,u=g();n===t?(n=!1,r[0]!==u&&(n=!i._dataItems[0]),i.wrapper.removeClass(l)):i.wrapper.addClass(l);i._prev="";r.toggleClass("k-readonly",n).val(n?i.options.placeholder:"");r[0]===u&&f.selectText(r[0],0,0);i._scale()},_scale:function(){var n=this,r=n.wrapper,u=r.width(),t=n._span.text(n.input.val()),i;r.is(":visible")?i=t.width()+25:(t.appendTo(document.documentElement),u=i=t.width()+25,t.appendTo(r));n.input.width(i>u?u:i)},_option:function(n,r){var f="<option",e=this._text(n),u=this._value(n);return u!==t&&(u+="",u.indexOf('"')!==-1&&(u=u.replace(kt,""")),f+=' value="'+u+'"'),r&&(f+=' selected="selected"'),f+=">",e!==t&&(f+=i.htmlEncode(e)),f+"<\/option>"},_render:function(n){for(var t=this,r=n.length,c=t.itemTemplate,e=t._dataItems.slice(0),o=0,i=0,s="",h="",u,f;i<r;i++)u=n[i],f=t._selected(e,u),h+=c(u,i,f),s+=t._option(u,f),f||(o+=1);if(r=e.length,r)for(i=0;i<r;i++)s+=t._option(e[i],!0);return t.ul[0].innerHTML=h,t.element.html(s),t._visibleItems=o,o},_selected:function(n,i){var o=this,s=o._text,h=o._value,f=h(i),c=n.length,e=!1,r,u=0;for(f===t&&(f=s(i));u<c;u++)if(i=n[u],r=h(i),r===t&&(r=s(i)),r!==t&&r===f){e=!0;break}return e&&n.splice(u,1),e},_search:function(){var n=this;n._typing=setTimeout(function(){var t=n.input.val();n._prev!==t&&(n._prev=t,n.search(t))},n.options.delay)},_allowSelection:function(){var n=this.options.maxSelectedItems;return n===null||n>this._values.length},_select:function(n){var t=this,u=t._values,r,i;t._allowSelection()&&(isNaN(n)?i=n.hide().data("idx"):(i=n,t.ul[0].children[i].style.display="none"),t.element[0].children[i].selected=!0,r=t.dataSource.view()[i],t.tagList.append(t.tagTemplate(r)),t._dataItems.push(r),u.push(t._dataValue(r)),t._visibleItems-=1,t.currentTag(null),t._placeholder(),t._height(t._visibleItems),t._state===p&&(t._state=y))},_unselect:function(t){var i=this,r=t.index(),o,u,f,e,s;if(t.remove(),i.currentTag(null),i._values.splice(r,1),o=i._dataItems.splice(r,1)[0],u=i._dataValue(o),r=i._index(u),r!==-1)n(i.ul[0].children[r]).show(),i.element[0].children[r].selected=!1,i._visibleItems+=1,i._height(i._visibleItems);else for(r=i.dataSource.view().length,f=i.element[0].children,s=f.length;r<s;r++)if(e=f[r],e.value==u){e.selected=!1;break}i._placeholder()},_template:function(){var t=this,n=t.options,r=n.itemTemplate,u=n.tagTemplate,e=n.dataSource,f;t.element[0].length&&!e&&(n.dataTextField=n.dataTextField||"text",n.dataValueField=n.dataValueField||"value");f=i.template("#:"+i.expr(n.dataTextField,"data")+"#",{useWithBlock:!1});r=r?i.template(r):f;u=u?i.template(u):f;t.itemTemplate=function(n,t,i){return'<li tabindex="-1" role="option" data-idx="'+t+'" unselectable="on" class="k-item"'+(i?yt:"")+">"+r(n)+"<\/li>"};t.tagTemplate=function(n){return'<li class="k-button" unselectable="on"><span unselectable="on">'+u(n)+'<\/span><span unselectable="on" class="k-icon k-delete">delete<\/span><\/li>'}},_input:function(){var t=this,r=t.element[0].accessKey,i=t._innerWrapper.children("input.k-input");i[0]||(i=n('<input class="k-input" style="width: 25px" />').appendTo(t._innerWrapper));t.element.removeAttr("accesskey");t._focused=t.input=i.attr({accesskey:r,role:"listbox","aria-expanded":!1})},_tagList:function(){var t=this,i=t._innerWrapper.children("ul");i[0]||(i=n('<ul role="listbox" unselectable="on" class="k-reset"/>').appendTo(t._innerWrapper));t.tagList=i},_loader:function(){this._loading=n('<span class="k-icon k-loading '+b+'"><\/span>').insertAfter(this.input)},_textContainer:function(){var t=i.getComputedStyles(this.input[0],dt);t.position="absolute";t.visibility="hidden";t.top=-3333;t.left=-3333;this._span=n("<span/>").css(t).appendTo(this.wrapper)},_wrapper:function(){var r=this,t=r.element,i=t.parent("span.k-multiselect");i[0]||(i=t.wrap('<div class="k-widget k-multiselect k-header" unselectable="on" />').parent(),i[0].style.cssText=t[0].style.cssText,n('<div class="k-multiselect-wrap k-floatwrap" unselectable="on" />').insertBefore(t));r.wrapper=i.addClass(t[0].className).css("display","");r._innerWrapper=n(i[0].firstChild)}});d.plugin(gt)}(window.kendo.jQuery);kendo_module({id:"columnmenu",name:"Column Menu",category:"framework",depends:["popup","filtermenu","menu"],advanced:!0}),function(n,t){function g(t){return n.trim(t).replace(/ /gi,"")}var i=window.kendo,a=i.ui,e=n.proxy,d=n.extend,s=n.grep,v=n.map,h=n.inArray,u="k-state-selected",c="asc",y="desc",p="change",w="init",o="select",l="kendoPopup",b="kendoFilterMenu",k="kendoMenu",r=".kendoColumnMenu",f=a.Widget,nt=f.extend({init:function(t,u){var o=this,s;f.fn.init.call(o,t,u);t=o.element;u=o.options;o.owner=u.owner;o.dataSource=u.dataSource;o.field=t.attr(i.attr("field"));s=t.find(".k-header-column-menu");s[0]||(s=t.addClass("k-with-icon").prepend('<a class="k-header-column-menu" href="#"><span class="k-icon k-i-arrowhead-s"/><\/a>').find(".k-header-column-menu"));o.link=s.attr("tabindex",-1).on("click"+r,e(o._click,o));o.wrapper=n('<div class="k-column-menu"/>')},_init:function(){var n=this;n.pane=n.options.pane;n.pane&&(n._isMobile=!0);n._isMobile?n._createMobileMenu():n._createMenu();n._sort();n._columns();n._filter();n.trigger(w,{field:n.field,container:n.wrapper})},events:[w],options:{name:"ColumnMenu",messages:{sortAscending:"Sort Ascending",sortDescending:"Sort Descending",filter:"Filter",columns:"Columns",done:"Done",settings:"Column Settings"},filter:"",columns:!0,sortable:!0,filterable:!0,animations:{left:"slide"}},_createMenu:function(){var n=this,t=n.options;n.wrapper.html(i.template(tt)({ns:i.ns,messages:t.messages,sortable:t.sortable,filterable:t.filterable,columns:n._ownerColumns(),showColumns:t.columns}));n.popup=n.wrapper[l]({anchor:n.link,open:e(n._open,n),activate:e(n._activate,n),close:n.options.closeCallback}).data(l);n.menu=n.wrapper.children()[k]({orientation:"vertical",closeOnClick:!1}).data(k)},_createMobileMenu:function(){var n=this,t=n.options,r=i.template(it)({ns:i.ns,field:n.field,messages:t.messages,sortable:t.sortable,filterable:t.filterable,columns:n._ownerColumns(),showColumns:t.columns});n.view=n.pane.append(r);n.wrapper=n.view.element.find(".k-column-menu");n.menu=new rt(n.wrapper.children(),{pane:n.pane});n.view.element.on("click",".k-done",function(t){n.close();t.preventDefault()})},destroy:function(){var n=this;f.fn.destroy.call(n);n.filterMenu&&n.filterMenu.destroy();n._refreshHandler&&n.dataSource.unbind(p,n._refreshHandler);n.options.columns&&n.owner&&(n.owner.unbind("columnShow",n._updateColumnsMenuHandler),n.owner.unbind("columnHide",n._updateColumnsMenuHandler));n.menu&&(n.menu.element.off(r),n.menu.destroy());n.wrapper.off(r);n.popup&&n.popup.destroy();n.view&&n.view.purge();n.link.off(r)},close:function(){this.menu.close();this.popup&&(this.popup.close(),this.popup.element.off("keydown"+r))},_click:function(n){n.preventDefault();n.stopPropagation();var t=this.options;t.filter&&this.element.is(!t.filter)||(this.popup||this.pane||this._init(),this._isMobile?this.pane.navigate(this.view,this.options.animations.left):this.popup.toggle())},_open:function(){var t=this;n(".k-column-menu").not(t.wrapper).each(function(){n(this).data(l).close()});t.popup.element.on("keydown"+r,function(n){n.keyCode==i.keys.ESC&&t.close()})},_activate:function(){this.menu.element.focus()},_ownerColumns:function(){var n=this.owner.columns,t=s(n,function(n){var t=!0,i=g(n.title||"");return n.menu!==!1&&(n.field||i.length)||(t=!1),t});return v(t,function(t){return{originalField:t.field,field:t.field||t.title,title:t.title||t.field,hidden:t.hidden,index:h(t,n)}})},_sort:function(){var t=this;t.options.sortable&&(t.refresh(),t._refreshHandler=e(t.refresh,t),t.dataSource.bind(p,t._refreshHandler),t.menu.bind(o,function(i){var f=n(i.item),r;(f.hasClass("k-sort-asc")?r=c:f.hasClass("k-sort-desc")&&(r=y),r)&&(f.parent().find(".k-sort-"+(r==c?y:c)).removeClass(u),t._sortDataSource(f,r),t.close())}))},_sortDataSource:function(n,i){var f=this,o=f.options.sortable,s=f.dataSource,e,h,r=s.sort()||[];if(n.hasClass(u)&&o&&o.allowUnsort!==!1?(n.removeClass(u),i=t):n.addClass(u),o===!0||o.mode==="single")r=[{field:f.field,dir:i}];else{for(e=0,h=r.length;e<h;e++)if(r[e].field===f.field){r.splice(e,1);break}r.push({field:f.field,dir:i})}s.sort(r)},_columns:function(){var t=this;t.options.columns&&(t._updateColumnsMenu(),t._updateColumnsMenuHandler=e(t._updateColumnsMenu,t),t.owner.bind(["columnHide","columnShow"],t._updateColumnsMenuHandler),t.menu.bind(o,function(r){var c=n(r.item),u,f,e,l=t.owner.columns,o;(t._isMobile&&r.preventDefault(),c.parent().closest("li.k-columns-item")[0])&&((u=c.find(":checkbox"),u.attr("disabled"))||(o=u.attr(i.attr("field")),e=s(l,function(n){return n.field==o||n.title==o})[0],f=h(e,l),e.hidden===!0?t.owner.showColumn(f):t.owner.hideColumn(f)))}))},_updateColumnsMenu:function(){var r=i.attr("field"),t=s(this._ownerColumns(),function(n){return!n.hidden}),u=s(t,function(n){return n.originalField}).length;t=v(t,function(n){return n.field});this.wrapper.find(".k-columns-item input["+r+"]").prop("checked",!1).filter(function(){return h(n(this).attr(r),t)>-1}).prop("checked",!0).prop("disabled",u==1)},_filter:function(){var t=this,i=t.options;i.filterable!==!1&&(t.filterMenu=t.wrapper.find(".k-filterable")[b](d(!0,{},{appendToElement:!0,dataSource:i.dataSource,values:i.values,field:t.field},i.filterable)).data(b),t._isMobile&&t.menu.bind(o,function(i){var r=n(i.item);r.hasClass("k-filter-item")&&t.pane.navigate(t.filterMenu.view,t.options.animations.left)}))},refresh:function(){var n=this,r=n.options.dataSource.sort()||[],i,e=n.field,t,f;for(n.wrapper.find(".k-sort-asc, .k-sort-desc").removeClass(u),t=0,f=r.length;t<f;t++)i=r[t],e==i.field&&n.wrapper.find(".k-sort-"+i.dir).addClass(u)}}),tt='<ul>#if(sortable){#<li class="k-item k-sort-asc"><span class="k-link"><span class="k-sprite k-i-sort-asc"><\/span>${messages.sortAscending}<\/span><\/li><li class="k-item k-sort-desc"><span class="k-link"><span class="k-sprite k-i-sort-desc"><\/span>${messages.sortDescending}<\/span><\/li>#if(showColumns || filterable){#<li class="k-separator"><\/li>#}##}##if(showColumns){#<li class="k-item k-columns-item"><span class="k-link"><span class="k-sprite k-i-columns"><\/span>${messages.columns}<\/span><ul>#for (var idx = 0; idx < columns.length; idx++) {#<li><input type="checkbox" data-#=ns#field="#=columns[idx].field.replace(/"/g,"&\\#34;")#" data-#=ns#index="#=columns[idx].index#"/>#=columns[idx].title#<\/li>#}#<\/ul><\/li>#if(filterable){#<li class="k-separator"><\/li>#}##}##if(filterable){#<li class="k-item k-filter-item"><span class="k-link"><span class="k-sprite k-filter"><\/span>${messages.filter}<\/span><ul><li><div class="k-filterable"><\/div><\/li><\/ul><\/li>#}#<\/ul>',it='<div data-#=ns#role="view" data-#=ns#init-widgets="false" class="k-grid-column-menu"><div data-#=ns#role="header" class="k-header">${messages.settings}<button class="k-button k-done">#=messages.done#<\/button><\/div><div class="k-column-menu k-mobile-list"><ul><li><span class="k-link">${field}<\/span><ul>#if(sortable){#<li class="k-item k-sort-asc"><span class="k-link"><span class="k-sprite k-i-sort-asc"><\/span>${messages.sortAscending}<\/span><\/li><li class="k-item k-sort-desc"><span class="k-link"><span class="k-sprite k-i-sort-desc"><\/span>${messages.sortDescending}<\/span><\/li>#}##if(filterable){#<li class="k-item k-filter-item"><span class="k-link k-filterable"><span class="k-sprite k-filter"><\/span>${messages.filter}<\/span><\/li>#}#<\/ul><\/li>#if(showColumns){#<li class="k-columns-item"><span class="k-link">${messages.columns}<\/span><ul>#for (var idx = 0; idx < columns.length; idx++) {#<li class="k-item"><label class="k-label"><input type="checkbox" class="k-check" data-#=ns#field="#=columns[idx].field.replace(/"/g,"&\\#34;")#" data-#=ns#index="#=columns[idx].index#"/>#=columns[idx].title#<\/label><\/li>#}#<\/ul><\/li>#}#<\/ul><\/div><\/div>',rt=f.extend({init:function(n,t){f.fn.init.call(this,n,t);this.element.on("click"+r,"li:not(.k-separator)","_click")},events:[o],_click:function(n){this.trigger(o,{item:n.currentTarget})&&n.preventDefault()},close:function(){this.options.pane.navigate("")},destroy:function(){f.fn.destroy.call(this);this.element.off(r)}});a.plugin(nt)}(window.kendo.jQuery);kendo_module({id:"grid",name:"Grid",category:"web",description:"The Grid widget displays tabular data and offers rich support for interacting with data,including paging, sorting, grouping, and selection.",depends:["data"],features:[{id:"grid-editing",name:"Editing",description:"Support for record editing",depends:["editable","window"]},{id:"grid-filtering",name:"Filtering",description:"Support for record filtering",depends:["filtermenu"]},{id:"grid-columnmenu",name:"Column menu",description:"Support for header column menu",depends:["columnmenu"]},{id:"grid-grouping",name:"Grouping",description:"Support for grid grouping",depends:["groupable"]},{id:"grid-paging",name:"Paging",description:"Suppot for grid paging",depends:["pager"]},{id:"grid-selection",name:"Selection",description:"Support for row selection",depends:["selectable"]},{id:"grid-sorting",name:"Sorting",description:"Support for grid sorting",depends:["sortable"]},{id:"grid-column-reorder",name:"Column reordering",description:"Support for column reordering",depends:["reorderable"]},{id:"grid-column-resize",name:"Column resizing",description:"Support for column resizing",depends:["resizable"]},{id:"grid-mobile",name:"Grid adaptive rendering",description:"Support for adaptive rendering",depends:["mobile.actionsheet","mobile.pane"]}]}),function(n,t){function pt(n){return new Array(n+1).join('<td class="k-group-cell"> <\/td>')}function lt(n){var t,i=" ";if(n){if(typeof n===c)return n;for(t in n)i+=t+'="'+n[t]+'"'}return i}function pr(t){var i=0;return n("> .k-grouping-header, > .k-grid-toolbar",t).each(function(){i+=this.offsetHeight}),i}function ui(t,i){n("th, th .k-grid-filter, th .k-link",t).add(document.body).css("cursor",i)}function fi(n){var t,i,r={},u={};if(!at(n))for(k(n)||(n=[n]),t=0,i=n.length;t<i;t++)r[n[t].aggregate]=0,u[n[t].field]=r;return u}function et(n,t,i){var r=n.eq(t),u=n.eq(i);r[t>i?"insertBefore":"insertAfter"](u)}function wr(n,t,i){var e,c,u,s;for(i=k(i)?i:[i],e=0,c=i.length;e<c;e++)if(u=i[e],o(u)&&u.click){s=u.name||u.text;t.on(h+r,"a.k-grid-"+(s||"").replace(/\s/g,""),{commandName:s},f(u.click,n))}}function tt(n){return b(n,function(n){return!n.hidden})}function ot(n){n=n||{};var t=n.style;return t?(t=t.replace(/((.*)?display)(.*)?:([^;]*)/i,"$1:none"),t===n.style&&(t=t.replace(/(.*)?/i,"display:none;$1"))):t="display:none",u({},n,{style:t})}function ei(n){n=n||{};var t=n.style;return t&&(n.style=t.replace(/(display\s*:\s*none\s*;?)*/ig,"")),n}function ir(t,r,u,f){var o=t.find(">colgroup"),s,h=bt(r,function(n){return(s=n.width,s&&parseInt(s,10)!==0)?i.format('<col style="width:{0}"/>',typeof s===c?s:s+"px"):"<col />"});(u||o.find(".k-hierarchy-col").length)&&h.splice(0,0,'<col class="k-hierarchy-col" />');o.length&&o.remove();o=n(new Array(f+1).join('<col class="k-group-col">')+h.join(""));o.is("colgroup")||(o=n("<colgroup/>").append(o));t.prepend(o);e.msie&&e.version==8&&(t.css("display","inline-table"),window.setTimeout(function(){t.css("display","")},1))}function rr(n){for(var r={},i,t=0,u=n.length;t<u;t++)i=n[t],r[i.value]=i.text;return r}function br(n,t,r){var f=r&&r.length&&o(r[0])&&"value"in r[0],u=f?rr(r)[n]:n;return u=u!=null?u:"",t?i.format(t,u):u}function st(n,t,i){for(var u=0,f,r=n[u];r;){if(f=i?!0:r.style.display!=="none",f&&!ar.test(r.className)&&--t<0){r.style.display=i?"":"none";break}r=n[++u]}}function oi(n,t){var r,u,i;if(typeof n===c&&n===t||o(n)&&n.name===t)return n;if(k(n))for(r=0,u=n.length;r<u;r++)if(i=n[r],typeof i===c&&i===t||i.name===t)return i;return null}function l(t,i){var u=e.msie,r,f,o;if(i===!0){if(t=n(t),r=u&&t.parent().is(".k-grid-content,.k-grid-header-wrap"),r&&(f=t.parent().scrollTop(),o=t.parent().scrollLeft()),u)try{t[0].setActive()}catch(s){t[0].focus()}else t[0].focus();r&&(t.parent().scrollTop(f),t.parent().scrollLeft(o))}else n(t).one("focusin",function(n){n.preventDefault()}).focus()}function dr(t){var r=n(t.currentTarget),f=r.is("th"),u=r.closest("table")[0];i.support.touch||(u===this.table[0]||u===this.thead.parent()[0])&&(this.current(r),(f||!n(t.target).is(":button,a,:input,a>.k-icon,textarea,span.k-icon,span.k-link,.k-input,.k-multiselect-wrap"))&&setTimeout(function(){yr&&n(i._activeElement()).hasClass("k-widget")||l(u,!0)}),f&&t.preventDefault())}var i=window.kendo,it=i.ui,ur=i.data.DataSource,fr=it.Groupable,er=i.support.tbodyInnerHtml,rt=i._activeElement,w=it.Widget,s=i.keys,o=n.isPlainObject,u=n.extend,bt=n.map,b=n.grep,k=n.isArray,d=n.inArray,f=n.proxy,or=i.isFunction,at=n.isEmptyObject,y=Math,kt="progress",dt="error",g=":not(.k-group-cell):not(.k-hierarchy-cell):visible",sr="tbody>tr:not(.k-grouping-row):not(.k-detail-row):not(.k-group-footer) > td:not(.k-group-cell):not(.k-hierarchy-cell)",ut="tr:not(.k-footer-template):visible",v=":not(.k-group-cell):not(.k-hierarchy-cell):visible",ft=ut+":first>"+v+":first",vt="th.k-header:not(.k-group-cell,.k-hierarchy-cell)",r=".kendoGrid",yt="edit",gt="save",si="remove",ni="detailInit",hi="filterMenuInit",ci="columnMenuInit",a="change",li="columnHide",ai="columnShow",vi="saveChanges",yi="dataBound",pi="detailExpand",wi="detailCollapse",ht="k-state-focused",bi="k-state-selected",ki="columnResize",di="columnReorder",h="click",ti="height",nt="tabIndex",ct="function",c="string",gi="Are you sure you want to delete this record?",hr="Delete",cr="Cancel",lr=/(\}|\#)/ig,ii=/#/ig,nr="[\\x20\\t\\r\\n\\f]",ar=new RegExp("(^|"+nr+")(k-group-cell|k-hierarchy-cell)("+nr+"|$)"),vr='<a class="k-button k-button-icontext #=className#" #=attr# href="\\#"><span class="#=iconClass# #=imageClass#"><\/span>#=text#<\/a>',p=!1,e=i.support.browser,ri=e.msie&&e.version==7,yr=e.msie&&e.version==8,tr=w.extend({init:function(n,t){var i=this;w.fn.init.call(i,n,t);i._refreshHandler=f(i.refresh,i);i.setDataSource(t.dataSource);i.wrap()},setDataSource:function(n){var t=this;t.dataSource&&t.dataSource.unbind(a,t._refreshHandler);t.dataSource=n;t.dataSource.bind(a,t._refreshHandler)},options:{name:"VirtualScrollable",itemHeight:n.noop},destroy:function(){var n=this;w.fn.destroy.call(n);n.dataSource.unbind(a,n._refreshHandler);n.wrapper.add(n.verticalScrollbar).off(r);n.drag&&n.drag.destroy()},wrap:function(){var t=this,o=i.support.scrollbar()+1,u=t.element,e;u.css({width:"auto",overflow:"hidden"}).css(p?"padding-left":"padding-right",o);t.content=u.children().first();e=t.wrapper=t.content.wrap('<div class="k-virtual-scrollable-wrap"/>').parent().bind("DOMMouseScroll"+r+" mousewheel"+r,f(t._wheelScroll,t));i.support.kineticScrollNeeded&&(t.drag=new i.UserEvents(t.wrapper,{global:!0,move:function(n){t.verticalScrollbar.scrollTop(t.verticalScrollbar.scrollTop()-n.y.delta);e.scrollLeft(e.scrollLeft()-n.x.delta);n.preventDefault()}}));t.verticalScrollbar=n('<div class="k-scrollbar k-scrollbar-vertical" />').css({width:o}).appendTo(u).bind("scroll"+r,f(t._scroll,t))},_wheelScroll:function(n){var u=this,e=u.verticalScrollbar.scrollTop(),i=n.originalEvent,f=i.wheelDeltaY,r;i.wheelDelta?(f===t||f)&&(r=i.wheelDelta):i.detail&&i.axis===i.VERTICAL_AXIS&&(r=-i.detail*10);r&&(n.preventDefault(),u.verticalScrollbar.scrollTop(e+-r))},_scroll:function(n){var t=this,i=n.currentTarget.scrollTop,f=t.dataSource,r=t.itemHeight,e=f.skip()||0,o=t._rangeStart||e,s=t.element.innerHeight(),h=!!(t._scrollbarTop&&t._scrollbarTop>i),u=y.max(y.floor(i/r),0),c=y.max(u+y.floor(s/r),0);t._scrollTop=i-o*r;t._scrollbarTop=i;t._fetch(u,c,h)||(t.wrapper[0].scrollTop=t._scrollTop)},_fetch:function(n,t,i){var u=this,e=u.dataSource,h=u.itemHeight,r=e.take(),f=u._rangeStart||e.skip()||0,o=y.floor(n/r)*r,s=!1,c=.33;return n<f?(s=!0,f=y.max(0,t-r),u._scrollTop=(n-f)*h,u._page(f,r)):t>=f+r&&!i?(s=!0,f=n,u._scrollTop=h,u._page(f,r)):u._fetching||(n<o+r-r*c&&n>r&&e.prefetch(o-r,r),t>o+r*c&&e.prefetch(o+r,r)),s},_page:function(n,t){var r=this,u=r.dataSource;clearTimeout(r._timeout);r._fetching=!0;r._rangeStart=n;u.inRange(n,t)?u.range(n,t):(i.ui.progress(r.wrapper.parent(),!0),r._timeout=setTimeout(function(){u.range(n,t)},100))},refresh:function(){var n=this,u="",t=25e4,o=n.dataSource,c=n._rangeStart,l=i.support.kineticScrollNeeded?0:i.support.scrollbar(),f=n.wrapper[0],r,e,s,h;for(i.ui.progress(n.wrapper.parent(),!1),clearTimeout(n._timeout),s=n.itemHeight=n.options.itemHeight()||0,h=f.scrollWidth>f.offsetWidth?l:0,r=o.total()*s+h,e=0;e<y.floor(r/t);e++)u+='<div style="width:1px;height:'+t+'px"><\/div>';r%t&&(u+='<div style="width:1px;height:'+r%t+'px"><\/div>');n.verticalScrollbar.html(u);f.scrollTop=n._scrollTop;n.drag&&n.drag.cancel();c&&!n._fetching&&(n._rangeStart=o.skip());n._fetching=!1}}),wt={create:{text:"Add new record",imageClass:"k-add",className:"k-grid-add",iconClass:"k-icon"},cancel:{text:"Cancel changes",imageClass:"k-cancel",className:"k-grid-cancel-changes",iconClass:"k-icon"},save:{text:"Save changes",imageClass:"k-update",className:"k-grid-save-changes",iconClass:"k-icon"},destroy:{text:"Delete",imageClass:"k-delete",className:"k-grid-delete",iconClass:"k-icon"},edit:{text:"Edit",imageClass:"k-edit",className:"k-grid-edit",iconClass:"k-icon"},update:{text:"Update",imageClass:"k-update",className:"k-grid-update",iconClass:"k-icon"},canceledit:{text:"Cancel",imageClass:"k-cancel",className:"k-grid-cancel",iconClass:"k-icon"}},kr=w.extend({init:function(n,t){var r=this;t=k(t)?{dataSource:t}:t;w.fn.init.call(r,n,t);p=i.support.isRtl(n);r._element();r._aria();r._columns(r.options.columns);r._dataSource();r._tbody();r._pageable();r._thead();r._groupable();r._toolbar();r._setContentHeight();r._templates();r._navigatable();r._selectable();r._details();r._editable();r._attachCustomCommandsEvent();r.options.autoBind?r.dataSource.fetch():r._footer();i.notify(r)},events:[a,"dataBinding","cancel",yi,pi,wi,ni,hi,ci,yt,gt,si,vi,ki,di,ai,li],setDataSource:function(n){var t=this;t.options.dataSource=n;t._dataSource();t._pageable();t.options.groupable&&t._groupable();t._thead();t.virtualScrollable&&t.virtualScrollable.setDataSource(t.options.dataSource);t.options.autoBind&&n.fetch()},options:{name:"Grid",columns:[],toolbar:null,autoBind:!0,filterable:!1,scrollable:!0,sortable:!1,selectable:!1,navigatable:!1,pageable:!1,editable:!1,groupable:!1,rowTemplate:"",altRowTemplate:"",dataSource:{},height:null,resizable:!1,reorderable:!1,columnMenu:!1,detailTemplate:null,columnResizeHandleWidth:3,mobile:""},destroy:function(){var t=this,u;w.fn.destroy.call(t);t.pager&&t.pager.destroy();t.groupable&&t.groupable.destroy();t.options.reorderable&&t.wrapper.data("kendoReorderable").destroy();t.selectable&&t.selectable.destroy();t.resizable&&(t.resizable.destroy(),t._resizeUserEvents&&(t._resizeHandleDocumentClickHandler&&n(document).off("click",t._resizeHandleDocumentClickHandler),t._resizeUserEvents.destroy()));t.virtualScrollable&&t.virtualScrollable.destroy();t._destroyColumnAttachments();t._destroyEditable();t.dataSource.unbind(a,t._refreshHandler).unbind(kt,t._progressHandler).unbind(dt,t._errorHandler);u=t.element.add(t.wrapper).add(t.table).add(t.thead).add(t.wrapper.find(">.k-grid-toolbar"));t.content&&(u=u.add(t.content).add(t.content.find(">.k-virtual-scrollable-wrap")));t.pane&&t.pane.destroy();u.off(r);i.destroy(t.wrapper)},setOptions:function(n){var t=this;w.fn.setOptions.call(this,n);t._templates()},items:function(){return this.tbody.children(":not(.k-grouping-row,.k-detail-row,.k-group-footer)")},_destroyColumnAttachments:function(){var t=this;t.resizeHandle=null;t.thead.find("th").each(function(){var t=n(this),i=t.data("kendoFilterMenu"),r=t.data("kendoSortable"),u=t.data("kendoColumnMenu");i&&i.destroy();r&&r.destroy();u&&u.destroy()})},_attachCustomCommandsEvent:function(){for(var t=this,r=t.columns||[],i,n=0,u=r.length;n<u;n++)i=r[n].command,i&&wr(t,t.wrapper,i)},_aria:function(){var n=this.element.attr("id")||"aria";n&&(this._cellId=n+"_active_cell")},_element:function(){var t=this,i=t.element;i.is("table")||(i=t.options.scrollable?t.element.find("> .k-grid-content > table"):t.element.children("table"),i.length||(i=n("<table />").appendTo(t.element)));ri&&i.attr("cellspacing",0);t.table=i.attr("role",t._hasDetails()?"treegrid":"grid");t._wrapper()},_createResizeHandle:function(t,i){var u=this,s=u.options.columnResizeHandleWidth,h=u.options.scrollable,f=u.resizeHandle,o;if(f||(f=u.resizeHandle=n('<div class="k-resize-handle"><div class="k-resize-handle-inner"><\/div><\/div>'),t.append(f)),p){var r=i.closest(".k-grid-header-wrap"),c=e.msie?r.scrollLeft():0,l=e.webkit?r[0].scrollWidth-r[0].offsetWidth-r.scrollLeft():0,a=e.mozilla?r[0].scrollWidth-r[0].offsetWidth-(r[0].scrollWidth-r[0].offsetWidth-r.scrollLeft()):0;o=i.position().left-l+a-c}else o=i[0].offsetWidth,i.prevAll(":visible").each(function(){o+=this.offsetWidth});f.css({top:h?0:pr(u.wrapper),left:o-s,height:i.outerHeight(),width:s*3}).data("th",i).show()},_positionColumnResizeHandle:function(t){var i=this,u=i.resizeHandle,f=i.options.columnResizeHandleWidth;i.thead.on("mousemove"+r,"th:not(.k-group-cell,.k-hierarchy-cell)",function(r){var e=n(this),o=r.clientX,s=n(window).scrollLeft(),h=e.offset().left+(p?0:this.offsetWidth);o+s>h-f&&o+s<h+f?i._createResizeHandle(t,e):u?u.hide():ui(i.wrapper,"")})},_resizeHandleDocumentClick:function(t){n(t.target).closest(".k-column-active").length||(n(document).off(t),this._hideResizeHandle())},_hideResizeHandle:function(){this.resizeHandle&&(this.resizeHandle.data("th").removeClass("k-column-active"),this.resizeHandle.hide())},_positionColumnResizeHandleTouch:function(t){var r=this;r._resizeUserEvents=new i.UserEvents(r.thead,{filter:"th:not(.k-group-cell,.k-hierarchy-cell)",threshold:10,hold:function(i){var u=n(i.target);i.preventDefault();u.addClass("k-column-active");r._createResizeHandle(t,u);r._resizeHandleDocumentClickHandler||(r._resizeHandleDocumentClickHandler=f(r._resizeHandleDocumentClick,r));n(document).on("click",r._resizeHandleDocumentClickHandler)}})},_resizable:function(){var t=this,r=t.options,u,e,f,o,h=this._isMobile,s,i;r.resizable&&(u=r.scrollable?t.wrapper.find(".k-grid-header-wrap:first"):t.wrapper,h?t._positionColumnResizeHandleTouch(u):t._positionColumnResizeHandle(u),t.resizable=new it.Resizable(u,{handle:".k-resize-handle",hint:function(i){return n('<div class="k-grid-resize-indicator" />').css({height:i.data("th").outerHeight()+t.tbody.attr("clientHeight")})},start:function(u){i=n(u.currentTarget).data("th");h&&t._hideResizeHandle();var c=n.inArray(i[0],i.parent().children(":visible")),l=t.tbody.parent(),a=t.footer||n();ui(t.wrapper,"col-resize");s=r.scrollable?t.thead.parent().find("col:eq("+c+")").add(l.children("colgroup").find("col:eq("+c+")")).add(a.find("colgroup").find("col:eq("+c+")")):l.children("colgroup").find("col:eq("+c+")");e=u.x.location;f=i.outerWidth();o=t.tbody.outerWidth()},resize:function(i){var u=p?-1:1,h=f+i.x.location*u-e*u,c=t.footer||n();h>10&&(s.css("width",h),r.scrollable&&o&&(t._footerWidth=o+i.x.location*u-e*u,t.tbody.parent().add(t.thead.parent()).add(c.find("table")).css("width",t._footerWidth)))},resizeend:function(){var n=i.outerWidth(),r;ui(t.wrapper,"");f!=n&&(r=t.columns[i.parent().find("th:not(.k-group-cell,.k-hierarchy-cell)").index(i)],r.width=n,t.trigger(ki,{column:r,oldWidth:f,newWidth:n}));t._hideResizeHandle();i=null}}))},_draggable:function(){var t=this;t.options.reorderable&&(t._draggableInstance&&t._draggableInstance.destroy(),t._draggableInstance=t.wrapper.kendoDraggable({group:i.guid(),filter:t.content?".k-grid-header:first "+vt:"table:first>.k-grid-header "+vt,drag:function(){t._hideResizeHandle()},hint:function(t){return n('<div class="k-header k-drag-clue" />').css({width:t.width(),paddingLeft:t.css("paddingLeft"),paddingRight:t.css("paddingRight"),lineHeight:t.height()+"px",paddingTop:t.css("paddingTop"),paddingBottom:t.css("paddingBottom")}).html(t.attr(i.attr("title"))||t.attr(i.attr("field"))||t.text()).prepend('<span class="k-icon k-drag-status k-denied" />')}}).data("kendoDraggable"))},_reorderable:function(){var n=this;n.options.reorderable&&n.wrapper.kendoReorderable({draggable:n._draggableInstance,change:function(t){var r=d(n.columns[t.newIndex],n.columns),i=n.columns[t.oldIndex];n.trigger(di,{newIndex:r,oldIndex:d(i,n.columns),column:i});n.reorderColumn(r,i)}})},reorderColumn:function(n,t){var i=this,r=d(t,i.columns),e=d(t,tt(i.columns)),o=d(i.columns[n],tt(i.columns)),s,u,h,f=i.footer||i.wrapper.find(".k-grid-footer");if(r!==n)for(i._hideResizeHandle(),i.columns.splice(r,1),i.columns.splice(n,0,t),i._templates(),et(i.thead.prev().find("col:not(.k-group-col,.k-hierarchy-col)"),e,o),i.options.scrollable&&et(i.tbody.prev().find("col:not(.k-group-col,.k-hierarchy-col)"),e,o),et(i.thead.find(".k-header:not(.k-group-cell,.k-hierarchy-cell)"),r,n),f&&f.length&&(et(f.find(".k-grid-footer-wrap>table>colgroup>col:not(.k-group-col,.k-hierarchy-col)"),e,o),et(f.find(".k-footer-template>td:not(.k-group-cell,.k-hierarchy-cell)"),r,n)),s=i.tbody.children(":not(.k-grouping-row,.k-detail-row)"),u=0,h=s.length;u<h;u+=1)et(s.eq(u).find(">td:not(.k-group-cell,.k-hierarchy-cell)"),r,n)},cellIndex:function(t){return n(t).parent().children("td:not(.k-group-cell,.k-hierarchy-cell)").index(t)},_modelForContainer:function(t){t=n(t);t.is("tr")||this._editMode()==="popup"||(t=t.closest("tr"));var r=t.attr(i.attr("uid"));return this.dataSource.getByUid(r)},_editable:function(){var t=this,f=t.selectable&&t.selectable.options.multiple,i=t.options.editable,e=function(){var i=rt(),r=t._editContainer;!r||n.contains(r[0],i)||r[0]===i||n(i).closest(".k-animation-container").length||t.editable.end()&&t.closeCell()},u;if(i){if(u=t._editMode(),u==="incell"){if(i.update!==!1)t.wrapper.on(h+r,"tr:not(.k-grouping-row) > td",function(i){var r=n(this);r.hasClass("k-hierarchy-cell")||r.hasClass("k-detail-cell")||r.hasClass("k-group-cell")||r.hasClass("k-edit-cell")||r.has("a.k-grid-delete").length||r.has("button.k-grid-delete").length||r.closest("tbody")[0]!==t.tbody[0]||n(i.target).is(":input")||(t.editable?t.editable.end()&&(f&&n(rt()).blur(),t.closeCell(),t.editCell(r)):t.editCell(r))}).on("focusin"+r,function(){clearTimeout(t.timer);t.timer=null}).on("focusout"+r,function(){t.timer=setTimeout(e,1)})}else if(i.update!==!1)t.wrapper.on(h+r,"tbody>tr:not(.k-detail-row,.k-grouping-row):visible a.k-grid-edit",function(i){i.preventDefault();t.editRow(n(this).closest("tr"))});if(i.destroy!==!1)t.wrapper.on(h+r,"tbody>tr:not(.k-detail-row,.k-grouping-row):visible .k-grid-delete",function(i){i.preventDefault();i.stopPropagation();t.removeRow(n(this).closest("tr"))});else t.wrapper.on(h+r,"tbody>tr:not(.k-detail-row,.k-grouping-row):visible button.k-grid-delete",function(n){n.stopPropagation();t._confirmation()||n.preventDefault()})}},editCell:function(t){t=n(t);var i=this,r=i.columns[i.cellIndex(t)],u=i._modelForContainer(t);u&&(!u.editable||u.editable(r.field))&&!r.command&&r.field&&(i._attachModelChange(u),i._editContainer=t,i.editable=t.addClass("k-edit-cell").kendoEditable({fields:{field:r.field,format:r.format,editor:r.editor,values:r.values},model:u,change:function(n){i.trigger(gt,{values:n.values,container:t,model:u})&&n.preventDefault()}}).data("kendoEditable"),t.parent().addClass("k-grid-edit-row"),i.trigger(yt,{container:t,model:u}))},_destroyEditable:function(){var n=this,t=function(){n.editable&&(n._detachModelChange(),n.editable.destroy(),n.editable=null,n._editContainer=null,n._destroyEditView())};n.editable&&(n._editMode()!=="popup"||n._isMobile?t():n._editContainer.data("kendoWindow").bind("deactivate",t).close());n._actionSheet&&(n._actionSheet.destroy(),n._actionSheet=null)},_destroyEditView:function(){this.editView&&(this.editView.purge(),this.editView=null,this.pane.navigate(""))},_attachModelChange:function(n){var t=this;t._modelChangeHandler=function(n){t._modelChange({field:n.field,model:this})};n.bind("change",t._modelChangeHandler)},_detachModelChange:function(){var n=this,i=n._editContainer,t=n._modelForContainer(i);t&&t.unbind(a,n._modelChangeHandler)},closeCell:function(t){var u=this,r=u._editContainer,e,o,f;r&&((e=r.closest("tr").attr(i.attr("uid")),f=u.dataSource.getByUid(e),t&&u.trigger("cancel",{container:r,model:f}))||(r.removeClass("k-edit-cell"),o=u.columns[u.cellIndex(r)],r.parent().removeClass("k-grid-edit-row"),u._destroyEditable(),u._displayCell(r,o,f),r.hasClass("k-dirty-cell")&&n('<span class="k-dirty"/>').prependTo(r)))},_displayCell:function(n,t,r){var s=this,e={storage:{},count:0},h=u({},i.Template,s.options.templateSettings),o=i.template(s._cellTmpl(t,e),h);e.count>0&&(o=f(o,e.storage));n.empty().html(o(r))},removeRow:function(n){this._confirmation(n)&&this._removeRow(n)},_removeRow:function(t){var i=this,r,u;t=n(t).hide();r=i._modelForContainer(t);r&&!i.trigger(si,{row:t,model:r})&&(u=i._editMode(),u!=="incell"&&i.cancelRow(),i.dataSource.remove(r),(u==="inline"||u==="popup")&&i.dataSource.sync())},_editMode:function(){var t="incell",n=this.options.editable;return n!==!0&&(t=typeof n=="string"?n:n.mode||t),t},editRow:function(t){var f,u=this,e,s,o;if(t instanceof i.data.ObservableObject?f=t:(t=n(t),f=u._modelForContainer(t)),e=u._editMode(),s=u.options.navigatable,u.cancelRow(),f){u._attachModelChange(f);e==="popup"?u._createPopupEditor(f):e==="inline"?u._createInlineEditor(t,f):e==="incell"&&n(t).children(g).each(function(){var t=n(this),i=u.columns[t.index()];return f=u._modelForContainer(t),f&&(!f.editable||f.editable(i.field))&&i.field?(u.editCell(t),!1):void 0});o=u.editView?u.editView.element:u._editContainer;o.on(h+r,"a.k-grid-cancel",function(t){if(t.preventDefault(),t.stopPropagation(),!u.trigger("cancel",{container:o,model:f})){var i=u.items().index(n(u.current()).parent());u.cancelRow();s&&(u.current(u.items().eq(i).children().filter(v).first()),l(u.table,!0))}});o.on(h+r,"a.k-grid-update",function(n){n.preventDefault();n.stopPropagation();u.saveRow()})}},_createPopupEditor:function(t){var r=this,s="<div "+i.attr("uid")+'="'+t.uid+'" class="k-popup-edit-form'+(r._isMobile?" k-mobile-list":"")+'"><div class="k-edit-form-container">',e,h,ut=[],a,k,d,tt,it,y,p,rt=r.options.editable,w=rt.template,g=o(rt)?rt.window:{},ft=u({},i.Template,r.options.templateSettings),nt,b;if(g=g||{},w)for(typeof w===c&&(w=window.unescape(w)),s+=i.template(w,ft)(t),a=0,k=r.columns.length;a<k;a++)e=r.columns[a],e.command&&(y=oi(e.command,"edit"),y&&(h=y));else for(a=0,k=r.columns.length;a<k;a++)e=r.columns[a],e.command?e.command&&(y=oi(e.command,"edit"),y&&(h=y)):(s+='<div class="k-edit-label"><label for="'+e.field+'">'+(e.title||e.field||"")+"<\/label><\/div>",(!t.editable||t.editable(e.field))&&e.field?(ut.push({field:e.field,format:e.format,editor:e.editor,values:e.values}),s+="<div "+i.attr("container-for")+'="'+e.field+'" class="k-edit-field"><\/div>'):(nt={storage:{},count:0},d=i.template(r._cellTmpl(e,nt),ft),nt.count>0&&(d=f(d,nt.storage)),s+='<div class="k-edit-field">'+d(t)+"<\/div>"));h&&o(h)&&(h.text&&o(h.text)&&(tt=h.text.update,it=h.text.cancel),h.attr&&(p=h.attr));r._isMobile?(s+="<\/div><\/div>",r.editView=r.pane.append("<div data-"+i.ns+'role="view" data-'+i.ns+'init-widgets="false" class="k-grid-edit-form"><div data-'+i.ns+'role="header" class="k-header">'+r._createButton({name:"update",text:tt,attr:p})+(g.title||"Edit")+r._createButton({name:"canceledit",text:it,attr:p})+"<\/div>"+s+"<\/div>"),b=r._editContainer=r.editView.element.find(".k-popup-edit-form")):(s+='<div class="k-edit-buttons k-state-default">',s+=r._createButton({name:"update",text:tt,attr:p})+r._createButton({name:"canceledit",text:it,attr:p}),s+="<\/div><\/div><\/div>",b=r._editContainer=n(s).appendTo(r.wrapper).eq(0).kendoWindow(u({modal:!0,resizable:!1,draggable:!0,title:"Edit",visible:!1,close:function(i){if(i.userTriggered){if(i.sender.element.focus(),r.trigger("cancel",{container:b,model:t})){i.preventDefault();return}var u=r.items().index(n(r.current()).parent());r.cancelRow();r.options.navigatable&&(r.current(r.items().eq(u).children().filter(v).first()),l(r.table,!0))}}},g)));r.editable=r._editContainer.kendoEditable({fields:ut,model:t,clearContainer:!1}).data("kendoEditable");r._isMobile&&b.find("input[type=checkbox],input[type=radio]").parent(".k-edit-field").addClass("k-check").prev(".k-edit-label").addClass("k-check").click(function(){n(this).next().children("input").click()});r._openPopUpEditor();r.trigger(yt,{container:b,model:t})},_openPopUpEditor:function(){this._isMobile?this.pane.navigate(this.editView,this._editAnimation):this._editContainer.data("kendoWindow").center().open()},_createInlineEditor:function(t,r){var e=this,u,s,f,h=[];t.children(":not(.k-group-cell,.k-hierarchy-cell)").each(function(){if(s=n(this),u=e.columns[e.cellIndex(s)],!u.command&&u.field&&(!r.editable||r.editable(u.field)))h.push({field:u.field,format:u.format,editor:u.editor,values:u.values}),s.attr(i.attr("container-for"),u.field),s.empty();else if(u.command&&(f=oi(u.command,"edit"),f)){s.empty();var c,l,t;o(f)&&(f.text&&o(f.text)&&(c=f.text.update,l=f.text.cancel),f.attr&&(t=f.attr));n(e._createButton({name:"update",text:c,attr:t})+e._createButton({name:"canceledit",text:l,attr:t})).appendTo(s)}});e._editContainer=t;e.editable=t.addClass("k-grid-edit-row").kendoEditable({fields:h,model:r,clearContainer:!1}).data("kendoEditable");e.trigger(yt,{container:t,model:r})},cancelRow:function(){var n=this,t=n._editContainer,r;t&&(r=n._modelForContainer(t),n._destroyEditable(),n.dataSource.cancelChanges(r),n._editMode()!=="popup"?n._displayRow(t):n._displayRow(n.items().filter("["+i.attr("uid")+"="+r.uid+"]")))},saveRow:function(){var n=this,t=n._editContainer,r=n._modelForContainer(t),i=n.editable;t&&i&&i.end()&&!n.trigger(gt,{container:t,model:r})&&n.dataSource.sync()},_displayRow:function(t){var i=this,r=i._modelForContainer(t);r&&t.replaceWith(n((t.hasClass("k-alt")?i.altRowTemplate:i.rowTemplate)(r)))},_showMessage:function(t,r){var u=this;if(!u._isMobile)return window.confirm(t.title);var f=i.template('<ul><li class="km-actionsheet-title">#:title#<\/li><li><a href="\\#" class="k-button k-grid-delete">#:confirmDelete#<\/a><\/li><\/ul>'),e=n(f(t)).appendTo(u.view.element),o=u._actionSheet=new i.mobile.ui.ActionSheet(e,{cancel:t.cancelDelete,cancelTemplate:'<li class="km-actionsheet-cancel"><a class="k-button" href="\\#">#:cancel#<\/a><\/li>',close:function(){this.destroy()},command:function(t){var i=n(t.currentTarget).parent();i.hasClass("km-actionsheet-cancel")||u._removeRow(r)},popup:u._actionSheetPopupOptions});return o.open(r),!1},_confirmation:function(n){var r=this,t=r.options.editable,i=t===!0||typeof t===c?gi:t.confirmation;return i!==!1&&i!=null?r._showMessage({confirmDelete:t.confirmDelete||hr,cancelDelete:t.cancelDelete||cr,title:i===!0?gi:i},n):!0},cancelChanges:function(){this.dataSource.cancelChanges()},saveChanges:function(){var n=this;(n.editable&&n.editable.end()||!n.editable)&&!n.trigger(vi)&&n.dataSource.sync()},addRow:function(){var n=this,r,t=n.dataSource,f=n._editMode(),c=n.options.editable.createAt||"",e=t.pageSize(),o=t.view()||[];if(n.editable&&n.editable.end()||!n.editable){f!="incell"&&n.cancelRow();r=t.indexOf(o[0]);c.toLowerCase()=="bottom"&&(r+=o.length,e&&!t.options.serverPaging&&e<=o.length&&(r-=1));r<0&&(r=t.page()>t.totalPages()?(t.page()-1)*e:0);var s=t.insert(r,{}),l=s.uid,u=n.table.find("tr["+i.attr("uid")+"="+l+"]"),h=u.children("td:not(.k-group-cell,.k-hierarchy-cell)").eq(n._firstEditableColumnIndex(u));f==="inline"&&u.length?n.editRow(u):f==="popup"?n.editRow(s):h.length&&n.editCell(h)}},_firstEditableColumnIndex:function(n){for(var u=this,i,f=u.columns,r=u._modelForContainer(n),t=0,e=f.length;t<e;t++)if(i=f[t],r&&(!r.editable||r.editable(i.field))&&!i.command&&i.field)return t;return-1},_toolbar:function(){var t=this,s=t.wrapper,u=t.options.toolbar,o=t.options.editable,e;if(u&&(e=t.wrapper.find(".k-grid-toolbar"),e.length||(or(u)||(u=typeof u===c?u:t._toolbarTmpl(u).replace(ii,"\\#"),u=f(i.template(u),t)),e=n('<div class="k-toolbar k-grid-toolbar" />').html(u({})).prependTo(s)),o&&o.create!==!1))e.on(h+r,".k-grid-add",function(n){n.preventDefault();t.addRow()}).on(h+r,".k-grid-cancel-changes",function(n){n.preventDefault();t.cancelChanges()}).on(h+r,".k-grid-save-changes",function(n){n.preventDefault();t.saveChanges()})},_toolbarTmpl:function(n){var u=this,t,i,r="";if(k(n))for(t=0,i=n.length;t<i;t++)r+=u._createButton(n[t]);return r},_createButton:function(n){var f=n.template||vr,t=typeof n===c?n:n.name||n.text,e=wt[t]?wt[t].className:"k-grid-"+(t||"").replace(/\s/g,""),r={className:e,text:t,imageClass:"",attr:"",iconClass:""};if(!t&&!(o(n)&&n.template))throw new Error("Custom commands should have name specified");return o(n)?(n.className&&(n.className+=" "+r.className),t==="edit"&&o(n.text)&&(n=u(!0,{},n),n.text=n.text.edit),n.attr&&o(n.attr)&&(n.attr=lt(n.attr)),r=u(!0,r,wt[t],n)):r=u(!0,r,wt[t]),i.template(f)(r)},_hasFooters:function(){for(var t=this.columns,i=t.length,n=0;n<i;n++)if(t[n].footerTemplate!==""||t[n].groupFooterTemplate!=="")return!0;return!1},_groupable:function(){var t=this;t._groupableClickHandler?t.table.off(h+r,t._groupableClickHandler):t._groupableClickHandler=function(i){var r=n(this),u=r.closest("tr");r.hasClass("k-i-collapse")?t.collapseGroup(u):t.expandGroup(u);i.preventDefault();i.stopPropagation()};t.table.on(h+r,".k-grouping-row .k-i-collapse, .k-grouping-row .k-i-expand",t._groupableClickHandler);t._attachGroupable()},_attachGroupable:function(){var t=this,r=t.wrapper,f=t.options.groupable,e=vt+":visible["+i.attr("field")+"]",o=vt+"["+i.attr("field")+"]";f&&(r.has("div.k-grouping-header")[0]||n("<div> <\/div>").addClass("k-grouping-header").prependTo(r),t.groupable&&t.groupable.destroy(),t.groupable=new fr(r,u({},f,{draggable:t._draggableInstance,groupContainer:">div.k-grouping-header",dataSource:t.dataSource,draggableElements:t.content?".k-grid-header:first "+e:"table:first>.k-grid-header "+e,filter:t.content?".k-grid-header:first "+o:"table:first>.k-grid-header "+o,allowDrag:t.options.reorderable})))},_selectable:function(){var n=this,f,e,t=[],u=n.options.selectable;if(u&&(f=typeof u===c&&u.toLowerCase().indexOf("multiple")>-1,e=typeof u===c&&u.toLowerCase().indexOf("cell")>-1,n._hasDetails()&&(t[t.length]=".k-detail-row"),(n.options.groupable||n._hasFooters())&&(t[t.length]=".k-grouping-row,.k-group-footer"),t=t.join(","),t!==""&&(t=":not("+t+")"),n.selectable=new i.ui.Selectable(n.table,{filter:">"+(e?sr:"tbody>tr"+t),aria:!0,multiple:f,change:function(){n.trigger(a)}}),n.options.navigatable))n.table.on("keydown"+r,function(t){var i=n.current();if(t.keyCode===s.SPACEBAR&&t.target==n.table[0]&&!i.is(".k-edit-cell,.k-header")&&i.parent().is(":not(.k-grouping-row,.k-detail-row,.k-group-footer)")){if(t.preventDefault(),t.stopPropagation(),i=e?i:i.parent(),f)if(t.ctrlKey){if(i.hasClass(bi)){i.removeClass(bi);n.trigger(a);return}}else n.selectable.clear();else n.selectable.clear();n.selectable.value(i)}})},clearSelection:function(){var n=this;n.selectable.clear();n.trigger(a)},select:function(t){var r=this,i=r.selectable;if(t=n(t),t.length){i.options.multiple||(i.clear(),t=t.first());i.value(t);return}return i.value()},current:function(i){var r=this,f=r.options.scrollable,u=r._current,e=r.table.add(r.thead.parent());return i!==t&&i.length&&(u&&u[0]===i[0]||(u&&(u.removeClass(ht).removeAttr("id"),e.removeAttr("aria-activedescendant")),i.attr("id",r._cellId),r._current=i.addClass(ht),e.attr("aria-activedescendant",r._cellId),i.length&&f&&(n.contains(r.content[0],i[0])&&r._scrollTo(i.parent()[0],r.content[0]),f.virtual?r._scrollTo(i[0],r.content.find(">.k-virtual-scrollable-wrap")[0]):r._scrollTo(i[0],r.content[0])))),r._current},_removeCurrent:function(){this._current&&(this._current.removeClass(ht),this._current=null)},_scrollTo:function(n,t){var e=n.tagName.toLowerCase(),i=e==="td"||e==="th",r=n[i?"offsetLeft":"offsetTop"],o=n[i?"offsetWidth":"offsetHeight"],u=t[i?"scrollLeft":"scrollTop"],f=t[i?"clientWidth":"clientHeight"],s=r+o,h=0;h=u>r?r:s>u+f?o<=f?s-f:r:u;t[i?"scrollLeft":"scrollTop"]=h},_navigatable:function(){var t=this,o=f(t.current,t),u=t.table,h=t.thead.parent(),c=u,a=i.support.isRtl(t.element);if(t.options.navigatable){t.options.scrollable&&(c=u.add(h),h.attr(nt,-1));h.on("keydown"+r,function(n){n.altKey&&n.keyCode==s.DOWN&&(o().find(".k-grid-filter, .k-header-column-menu").click(),n.stopImmediatePropagation())}).find("a.k-link").attr("tabIndex",-1);u.attr(nt,y.max(u.attr(nt)||0,0)).on("mousedown"+r+" keydown"+r,".k-detail-cell",function(n){n.target!==n.currentTarget&&n.stopImmediatePropagation()});c.on(i.support.touch?"touchstart"+r:"mousedown"+r,ut+">"+v,f(dr,t)).on("focus"+r,function(){if(!i.support.touch){var t=o();t&&t.is(":visible")?t.addClass(ht):o(n(this).find(ft));this==u[0]?(h.attr(nt,-1),u.attr(nt,0)):(u.attr(nt,-1),h.attr(nt,0))}}).on("focusout"+r,function(){var n=o();n&&n.removeClass(ht)}).on("keydown"+r,function(i){var h=i.keyCode,f=!1,p=!i.isDefaultPrevented()&&!n(i.target).is(":button,a,:input,a>.k-icon"),st=t.options.pageable,w=t.dataSource,nt=t._editMode()=="incell",b,tt,c,k,it,et=i.shiftKey,r=o(),ot,d,y;r&&r.is("th")&&(p=!0);p&&h==s.UP?(r?(c=r.parent().prevAll(ut).first(),c[0]||(it=t.thead.parent(),l(it,!0),c=it.find(ut).first()),k=r.index(),r=c.children().eq(k),r[0]&&r.is(v)||(r=c.children(v).first())):r=u.find(ft),f=!0,o(r)):p&&h==s.DOWN?(r?(c=r.parent().nextAll(ut).first(),!c[0]&&r.is("th")&&(l(t.tbody.parent()),c=t.tbody.find(ut).first()),k=r.index(),r=c.children().eq(k),r[0]&&r.is(v)||(r=c.children(v).first())):r=u.find(ft),f=!0,o(r)):p&&h==(a?s.RIGHT:s.LEFT)?(o(r?r.prevAll(g+":first"):u.find(ft)),f=!0):p&&h==(a?s.LEFT:s.RIGHT)?(r?r.next()[0]&&(r=r.nextAll(g+":first")):r=u.find(ft),f=!0,o(r)):p&&st&&s.PAGEDOWN==h?(w.page(w.page()+1),f=!0):p&&st&&s.PAGEUP==h?(w.page(w.page()-1),f=!0):h==s.ENTER||s.F2==h?(r=r?r:u.find(ft),r.is("th")?(r.find(".k-link").click(),f=!0):r.parent().is(".k-master-row,.k-grouping-row")?(r.parent().find(".k-icon:first").click(),f=!0):(ot=r.find(":kendoFocusable:first"),!r.hasClass("k-edit-cell")&&ot[0]&&r.hasClass("k-state-focused")?(ot.focus(),f=!0):t.options.editable&&!n(i.target).is(":button,.k-button,textarea")&&(d=n(i.target).closest("[role=gridcell]"),d[0]||(d=r),t._handleEditing(d),f=!0))):s.ESC==h?(b=rt(),r&&n.contains(r[0],b)&&!r.hasClass("k-edit-cell")&&!r.parent().hasClass("k-grid-edit-row")?(l(t.table[0],!0),f=!0):t._editContainer&&(!r||t._editContainer.has(r[0])||r[0]===t._editContainer[0])&&(nt?t.closeCell(!0):(tt=t.items().index(n(r).parent()),b&&b.blur(),t.cancelRow(),tt>=0&&t.current(t.items().eq(tt).children().filter(v).first())),e.msie&&e.version<9&&document.body.focus(),l(u,!0),f=!0)):s.TAB==h&&(r=n(r),t.options.editable&&nt&&(y=n(rt()).closest(".k-edit-cell"),y[0]&&y[0]!==r[0]&&(r=y)),y=et?r.prevAll(g+":first"):r.nextAll(":visible:first"),y.length||(y=r.parent()[et?"prevAll":"nextAll"]("tr:not(.k-grouping-row):not(.k-detail-row):visible:first").children(g+(et?":last":":first"))),!r.is("th")&&y.length&&t.options.editable&&nt&&(t._handleEditing(r,y),f=!0));f&&(i.preventDefault(),i.stopPropagation())})}},_handleEditing:function(t,i){var r=this,u=n(rt()),f=r._editMode(),c=e.msie,a=c&&e.version<9,o=r._editContainer,s,h;if(h=f=="incell"?t.hasClass("k-edit-cell"):t.parent().hasClass("k-grid-edit-row"),r.editable){if(n.contains(o[0],u[0])&&(e.opera||a?u.change().triggerHandler("blur"):(u.blur(),c&&u.blur())),!r.editable){l(r.table);return}if(r.editable.end())f=="incell"?r.closeCell():(r.saveRow(),h=!0);else{f=="incell"?r.current(o):r.current(o.children().filter(g).first());s=o.find(":kendoFocusable:first")[0];s&&s.focus();return}}i&&r.current(i);a&&document.body.focus();l(r.table,!0);(h||i)&&!i||(f=="incell"?r.editCell(r.current()):r.editRow(r.current().parent()))},_wrapper:function(){var n=this,r=n.table,i=n.options.height,t=n.element;t.is("div")||(t=t.wrap("<div/>").parent());n.wrapper=t.addClass("k-grid k-widget k-secondary");i&&(n.wrapper.css(ti,i),r.css(ti,"auto"));n._initMobile()},_initMobile:function(){var t=this.options,r;this._isMobile=t.mobile===!0&&i.support.mobileOS||t.mobile==="phone"||t.mobile==="tablet";this._isMobile&&(r=this.wrapper.addClass("k-grid-mobile").wrap("<div data-"+i.ns+'role="view" data-'+i.ns+'init-widgets="false"><\/div>').parent(),this.pane=i.mobile.ui.Pane.wrap(r),this.view=this.pane.view(),this._actionSheetPopupOptions=n(document.documentElement).hasClass("km-root")?{modal:!1}:{align:"bottom center",position:"bottom center",effect:"slideIn:up"},t.height&&this.pane.element.parent().css(ti,t.height),this._editAnimation="slide")},_tbody:function(){var i=this,r=i.table,t;t=r.find(">tbody");t.length||(t=n("<tbody/>").appendTo(r));i.tbody=t},_scrollable:function(){var t=this,u,s,y=t.options,o=y.scrollable,v=o!==!0&&o.virtual&&!t.virtualScrollable,c=!i.support.kineticScrollNeeded||v?i.support.scrollbar():0,l,a,h;o&&(u=t.wrapper.children(".k-grid-header"),u[0]||(u=n('<div class="k-grid-header" />').insertBefore(t.table)),u.css(p?"padding-left":"padding-right",o.virtual?c+1:c),s=n('<table role="grid" />'),ri&&s.attr("cellspacing",0),s.append(t.thead),u.empty().append(n('<div class="k-grid-header-wrap" />').append(s)),t.content=t.table.parent(),t.content.is(".k-virtual-scrollable-wrap")&&(t.content=t.content.parent()),t.content.is(".k-grid-content, .k-virtual-scrollable-wrap")||(t.content=t.table.wrap('<div class="k-grid-content" />').parent()),v&&(t.virtualScrollable=new tr(t.content,{dataSource:t.dataSource,itemHeight:f(t._averageRowHeight,t)})),t.scrollables=u.children(".k-grid-header-wrap"),l=t.wrapper.find(".k-grid-footer"),a=p&&e.webkit?c:0,l.length&&(t.scrollables=t.scrollables.add(l.children(".k-grid-footer-wrap"))),o.virtual?t.content.find(">.k-virtual-scrollable-wrap").bind("scroll"+r,function(){t.scrollables.scrollLeft(this.scrollLeft+a)}):(t.content.bind("scroll"+r,function(){t.scrollables.scrollLeft(this.scrollLeft+a)}),h=i.touchScroller(t.content),h&&h.movable&&h.movable.bind("change",function(n){t.scrollables.scrollLeft(-n.sender.x)})))},_setContentWidth:function(){var t=this,u="k-grid-content-expander",e='<div class="'+u+'"><\/div>',r=t.resizable,i;t.options.scrollable&&t.wrapper.is(":visible")&&(i=t.table.parent().children("."+u),t._setContentWidthHandler=f(t._setContentWidth,t),t.dataSource&&t.dataSource.view().length?i[0]&&(i.remove(),r&&r.unbind("resize",t._setContentWidthHandler)):(i[0]||(i=n(e).appendTo(t.table.parent()),r&&r.bind("resize",t._setContentWidthHandler)),t.thead&&i.width(t.thead.width())))},_setContentHeight:function(){var n=this,r=n.options,t=n.wrapper.innerHeight(),e=n.wrapper.children(".k-grid-header"),u=i.support.scrollbar(),f;r.scrollable&&n.wrapper.is(":visible")&&(t-=e.outerHeight(),n.pager&&(t-=n.pager.element.outerHeight()),r.groupable&&(t-=n.wrapper.children(".k-grouping-header").outerHeight()),r.toolbar&&(t-=n.wrapper.children(".k-grid-toolbar").outerHeight()),n.footerTemplate&&(t-=n.wrapper.children(".k-grid-footer").outerHeight()),f=function(n){var t,i;return n[0].style.height?!0:(t=n.height(),n.height("auto"),i=n.height(),t!=i)?(n.height(""),!0):(n.height(""),!1)},f(n.wrapper)&&(t>u*2?n.content.height(t):n.content.height(u*2+1)))},_averageRowHeight:function(){var n=this,t=n._rowHeight,i;return n._rowHeight||(n._rowHeight=t=n.table.outerHeight()/n.items().length,n._sum=t,n._measures=1),i=n.table.outerHeight()/n.items().length,t!==i&&(n._measures++,n._sum+=i,n._rowHeight=n._sum/n._measures),t},_dataSource:function(){var n=this,e=n.options,r,i=e.dataSource;i=k(i)?{data:i}:i;o(i)&&(u(i,{table:n.table,fields:n.columns}),r=e.pageable,o(r)&&r.pageSize!==t&&(i.pageSize=r.pageSize));n.dataSource&&n._refreshHandler?n.dataSource.unbind(a,n._refreshHandler).unbind(kt,n._progressHandler).unbind(dt,n._errorHandler):(n._refreshHandler=f(n.refresh,n),n._progressHandler=f(n._requestStart,n),n._errorHandler=f(n._error,n));n.dataSource=ur.create(i).bind(a,n._refreshHandler).bind(kt,n._progressHandler).bind(dt,n._errorHandler)},_error:function(){this._progress(!1)},_requestStart:function(){this._progress(!0)},_modelChange:function(t){var r=this,h=t.model,f=r.tbody.find("tr["+i.attr("uid")+"="+h.uid+"]"),u,o,l=f.hasClass("k-alt"),s,e=r.items().index(f),c;if(f.children(".k-edit-cell").length&&!r.options.rowTemplate)f.children(":not(.k-group-cell,.k-hierarchy-cell)").each(function(){u=n(this);o=r.columns[r.cellIndex(u)];o.field===t.field&&(u.hasClass("k-edit-cell")?u.addClass("k-dirty-cell"):(r._displayCell(u,o,h),n('<span class="k-dirty"/>').prependTo(u)))});else if(!f.hasClass("k-grid-edit-row")){for(s=(l?r.altRowTemplate:r.rowTemplate)(h),f.replaceWith(s),s=r.items().eq(e),e=0,c=r.columns.length;e<c;e++)o=r.columns[e],o.field===t.field&&(u=s.children(":not(.k-group-cell,.k-hierarchy-cell)").eq(e),n('<span class="k-dirty"/>').prependTo(u));r.trigger("itemChange",{item:s,data:h,ns:it})}},_pageable:function(){var t=this,f,r=t.options.pageable;r&&(f=t.wrapper.children("div.k-grid-pager"),f.length||(f=n('<div class="k-pager-wrap k-grid-pager"/>').appendTo(t.wrapper)),t.pager&&t.pager.destroy(),t.pager=typeof r=="object"&&r instanceof i.ui.Pager?r:new i.ui.Pager(f,u({},r,{dataSource:t.dataSource})))},_footer:function(){var t=this,u=t.dataSource.aggregates(),r="",s=t.footerTemplate,e=t.options,f,i=t.footer||t.wrapper.find(".k-grid-footer"),o;s?(u=at(u)?fi(t.dataSource.aggregate()):u,r=n(t._wrapFooter(s(u))),i.length?(o=r,i.replaceWith(o),i=t.footer=o):i=e.scrollable?t.footer=e.pageable?r.insertBefore(t.wrapper.children("div.k-grid-pager")):r.appendTo(t.wrapper):t.footer=r.insertBefore(t.tbody)):i&&!t.footer&&(t.footer=i);i.length&&(e.scrollable&&(f=i.attr("tabindex",-1).children(".k-grid-footer-wrap"),t.scrollables=t.scrollables.not(".k-grid-footer-wrap").add(f)),t._footerWidth&&i.find("table").css("width",t._footerWidth),f&&f.scrollLeft(t.content.scrollLeft()))},_wrapFooter:function(t){var u=this,r="",f=i.support.mobileOS?0:i.support.scrollbar();return u.options.scrollable?(r=n('<div class="k-grid-footer"><div class="k-grid-footer-wrap"><table'+(ri?' cellspacing="0"':"")+"><tbody>"+t+"<\/tbody><\/table><\/div><\/div>"),u._appendCols(r.find("table")),r.css(p?"padding-left":"padding-right",f),r):'<tfoot class="k-grid-footer">'+t+"<\/tfoot>"},_columnMenu:function(){var t=this,s,v=t.columns,r,e=t.options,f=e.columnMenu,h,c,a,y=this._isMobile,p=function(){l(t.thead.parent(),!0)},w=function(n){t.trigger(ci,{field:n.field,container:n.container})},o;f&&(typeof f=="boolean"&&(f={}),t.thead.find("th:not(.k-hierarchy-cell,.k-group-cell)").each(function(l){r=v[l];o=n(this);!r.command&&(r.field||o.attr("data-"+i.ns+"field"))&&(s=o.data("kendoColumnMenu"),s&&s.destroy(),c=r.sortable!==!1&&f.sortable!==!1?e.sortable:!1,a=e.filterable&&r.filterable!==!1&&f.filterable!==!1?u({pane:t.pane},r.filterable,e.filterable):!1,h={dataSource:t.dataSource,values:r.values,columns:f.columns,sortable:c,filterable:a,messages:f.messages,owner:t,closeCallback:p,init:w,pane:t.pane,filter:y?":not(.k-column-active)":""},o.kendoColumnMenu(h))}))},_filterable:function(){var t=this,r=t.columns,f,e,s=function(){l(t.thead.parent(),!0)},o=t.options.filterable;o&&!t.options.columnMenu&&t.thead.find("th:not(.k-hierarchy-cell,.k-group-cell)").each(function(h){if(f=n(this),r[h].filterable!==!1&&!r[h].command&&(r[h].field||f.attr("data-"+i.ns+"field"))){e=f.data("kendoFilterMenu");e&&e.destroy();var c=r[h].filterable,l=u({},o,c,{dataSource:t.dataSource,values:r[h].values,closeCallback:s,init:function(n){t.trigger(hi,{field:n.field,container:n.container})},pane:t.pane});c&&c.messages&&(l.messages=u(!0,{},o.messages,c.messages));f.kendoFilterMenu(l)}})},_sortable:function(){var r=this,s=r.columns,t,f,e,o=r.options.sortable;o&&r.thead.find("th:not(.k-hierarchy-cell,.k-group-cell)").each(function(h){t=s[h];t.sortable!==!1&&!t.command&&t.field&&(f=n(this),e=f.data("kendoSortable"),e&&e.destroy(),f.attr("data-"+i.ns+"field",t.field).kendoSortable(u({},o,t.sortable,{dataSource:r.dataSource,aria:!0,filter:":not(.k-column-active)"})))})},_columns:function(t){var r=this,f=r.table,e,s=f.find("col"),o=r.options.dataSource;t=t.length?t:bt(f.find("th"),function(t,r){t=n(t);var f=t.attr(i.attr("sortable")),e=t.attr(i.attr("filterable")),o=t.attr(i.attr("type")),h=t.attr(i.attr("groupable")),u=t.attr(i.attr("field")),c=t.attr(i.attr("menu"));return u||(u=t.text().replace(/\s|[^A-z0-9]/g,"")),{field:u,type:o,sortable:f!=="false",filterable:e!=="false",groupable:h!=="false",menu:c,template:t.attr(i.attr("template")),width:s.eq(r).css("width")}});e=!(r.table.find("tbody tr").length>0&&(!o||!o.transport));r.columns=bt(t,function(n){return n=typeof n===c?{field:n}:n,n.hidden&&(n.attributes=ot(n.attributes),n.footerAttributes=ot(n.footerAttributes),n.headerAttributes=ot(n.headerAttributes)),u({encoded:e},n)})},_groups:function(){var n=this.dataSource.group();return n?n.length:0},_tmpl:function(n,t){var r=this,c=u({},i.Template,r.options.templateSettings),e,l=r.columns.length,a,h={storage:{},count:0},o,p,v=r._hasDetails(),s=[],y=r._groups();if(!n){for(n="<tr",t&&s.push("k-alt"),v&&s.push("k-master-row"),s.length&&(n+=' class="'+s.join(" ")+'"'),l&&(n+=" "+i.attr("uid")+'="#='+i.expr("uid",c.paramName)+'#"'),n+=" role='row'>",y>0&&(n+=pt(y)),v&&(n+='<td class="k-hierarchy-cell"><a class="k-icon k-plus" href="\\#" tabindex="-1"><\/a><\/td>'),e=0;e<l;e++)o=r.columns[e],a=o.template,p=typeof a,n+="<td"+lt(o.attributes)+" role='gridcell'>",n+=r._cellTmpl(o,h),n+="<\/td>";n+="<\/tr>"}return(n=i.template(n,c),h.count>0)?f(n,h.storage):n},_headerCellText:function(n){var e=this,o=u({},i.Template,e.options.templateSettings),t=n.headerTemplate,f=typeof t,r=n.title||n.field||"";return f===ct?r=i.template(t,o)({}):f===c&&(r=t),r},_cellTmpl:function(n,t){var h=this,y=u({},i.Template,h.options.templateSettings),l=n.template,a=y.paramName,f=n.field,r="",s,p,v=n.format,w=typeof l,e=n.values;if(n.command){if(k(n.command)){for(s=0,p=n.command.length;s<p;s++)r+=h._createButton(n.command[s]);return r.replace(ii,"\\#")}return h._createButton(n.command).replace(ii,"\\#")}return w===ct?(t.storage["tmpl"+t.count]=l,r+="#=this.tmpl"+t.count+"("+a+")#",t.count++):w===c?r+=l:e&&e.length&&o(e[0])&&"value"in e[0]&&f?(r+="#var v ="+i.stringify(rr(e))+"#",r+="#var f = v[",y.useWithBlock||(r+=a+"."),r+=f+"]#",r+="${f != null ? f : ''}"):(r+=n.encoded?"#:":"#=",v&&(r+='kendo.format("'+v.replace(lr,"\\$1")+'",'),f?(f=i.expr(f,a),r+=f+"==null?'':"+f):r+="''",v&&(r+=")"),r+="#"),r},_templates:function(){var t=this,r=t.options,u=t.dataSource,f=u.group(),e=t.footer||t.wrapper.find(".k-grid-footer"),i=u.aggregate();t.rowTemplate=t._tmpl(r.rowTemplate);t.altRowTemplate=t._tmpl(r.altRowTemplate||r.rowTemplate,!0);t._hasDetails()&&(t.detailTemplate=t._detailTmpl(r.detailTemplate||""));(!t._group||at(i))&&(at(i)||e.length)&&!b(t.columns,function(n){return n.footerTemplate}).length||(t.footerTemplate=t._footerTmpl(i,"footerTemplate","k-footer-template"));f&&b(t.columns,function(n){return n.groupFooterTemplate}).length&&(i=n.map(f,function(n){return n.aggregates}),t.groupFooterTemplate=t._footerTmpl(i,"groupFooterTemplate","k-group-footer"))},_footerTmpl:function(n,t,r){var s=this,a=u({},i.Template,s.options.templateSettings),v=a.paramName,e="",c,y,d=s.columns,o,p,w={},l=0,b={},k=s._groups(),g=fi(n),h;for(e+='<tr class="'+r+'">',k>0&&(e+=pt(k)),s._hasDetails()&&(e+='<td class="k-hierarchy-cell"> <\/td>'),c=0,y=s.columns.length;c<y;c++)h=d[c],o=h[t],p=typeof o,e+="<td"+lt(h.footerAttributes)+">",o?(p!==ct&&(b=g[h.field]?u({},a,{paramName:v+"."+h.field}):{},o=i.template(o,b)),w["tmpl"+l]=o,e+="#=this.tmpl"+l+"("+v+")#",l++):e+=" ",e+="<\/td>";return(e+="<\/tr>",e=i.template(e,a),l>0)?f(e,w):e},_detailTmpl:function(n){var e=this,t="",o=u({},i.Template,e.options.templateSettings),l=o.paramName,s={},r=0,h=e._groups(),c=tt(e.columns).length,a=typeof n;return(t+='<tr class="k-detail-row">',h>0&&(t+=pt(h)),t+='<td class="k-hierarchy-cell"><\/td><td class="k-detail-cell"'+(c?' colspan="'+c+'"':"")+">",a===ct?(s["tmpl"+r]=n,t+="#=this.tmpl"+r+"("+l+")#",r++):t+=n,t+="<\/td><\/tr>",t=i.template(t,o),r>0)?f(t,s):t},_hasDetails:function(){var n=this;return n.options.detailTemplate!==null||(n._events[ni]||[]).length},_details:function(){var t=this;t.table.on(h+r,".k-hierarchy-cell .k-plus, .k-hierarchy-cell .k-minus",function(i){var f=n(this),u=f.hasClass("k-plus"),r=f.closest("tr.k-master-row"),e,s=t.detailTemplate,o,h=t._hasDetails();return f.toggleClass("k-plus",!u).toggleClass("k-minus",u),h&&!r.next().hasClass("k-detail-row")&&(o=t.dataItem(r),n(s(o)).addClass(r.hasClass("k-alt")?"k-alt":"").insertAfter(r),t.trigger(ni,{masterRow:r,detailRow:r.next(),data:o,detailCell:r.next().find(".k-detail-cell")})),e=r.next(),t.trigger(u?pi:wi,{masterRow:r,detailRow:e}),e.toggle(u),t._current&&t._current.attr("aria-expanded",u),i.preventDefault(),!1})},dataItem:function(t){if(t=n(t)[0],!t)return null;for(var f=this.tbody.children(),u=t.sectionRowIndex,r=u,i=0;i<u;i++)/k-grouping-row|k-detail-row|k-group-footer/.test(f[i].className)&&r--;return this._data[r]},expandRow:function(t){n(t).find("> td .k-plus, > td .k-i-expand").click()},collapseRow:function(t){n(t).find("> td .k-minus, > td .k-i-collapse").click()},_thead:function(){var r=this,h=r.columns,l=r._hasDetails()&&h.length,s,a,e="",o=r.table.find(">thead"),f,c,u;if(o.length||(o=n("<thead/>").insertBefore(r.tbody)),f=r.element.find("tr:has(th):first"),f.length||(f=o.children().first(),f.length||(f=n("<tr/>"))),f.children().length)l&&!f.find(".k-hierarchy-cell")[0]&&f.prepend('<th class="k-hierarchy-cell"> <\/th>');else{for(l&&(e+='<th class="k-hierarchy-cell"> <\/th>'),s=0,a=h.length;s<a;s++)u=h[s],c=r._headerCellText(u),u.command?e+="<th"+lt(u.headerAttributes)+">"+c+"<\/th>":(e+="<th role='columnheader' "+i.attr("field")+"='"+(u.field||"")+"' ",u.title&&(e+=i.attr("title")+'="'+u.title.replace(/'/g,"'")+'" '),u.groupable!==t&&(e+=i.attr("groupable")+"='"+u.groupable+"' "),u.aggregates&&(e+=i.attr("aggregates")+"='"+u.aggregates+"'"),e+=lt(u.headerAttributes),e+=">"+c+"<\/th>");f.html(e)}f.find("th").addClass("k-header");r.options.scrollable||o.addClass("k-grid-header");f.find("script").remove().end().appendTo(o);r.thead&&r._destroyColumnAttachments();r.thead=o;r._sortable();r._filterable();r._scrollable();r._updateCols();r._resizable();r._draggable();r._reorderable();r.groupable&&r._attachGroupable();r._columnMenu()},_updateCols:function(){var n=this;n._appendCols(n.thead.parent().add(n.table))},_appendCols:function(n){var t=this;ir(n,tt(t.columns),t._hasDetails(),t._groups())},_autoColumns:function(n){if(n&&n.toJSON){var t=this,i;n=n.toJSON();for(i in n)t.columns.push({field:i});t._thead();t._templates()}},_rowsHtml:function(n){for(var i=this,r="",f=i.rowTemplate,e=i.altRowTemplate,t=0,u=n.length;t<u;t++)r+=t%2?e(n[t]):f(n[t]),i._data.push(n[t]);return r},_groupRowHtml:function(n,t,r){var f=this,e="",o,l,a=n.field,s=b(f.columns,function(n){return n.field==a})[0]||{},h=s.groupHeaderTemplate,v=(s.title||a)+": "+br(n.value,s.format,s.values),y=u({},{field:n.field,value:n.value},n.aggregates[n.field]),p=f._groupAggregatesDefaultObject||{},c=n.items;if(h&&(v=typeof h===ct?h(y):i.template(h)(y)),e+='<tr class="k-grouping-row">'+pt(r)+'<td colspan="'+t+'" aria-expanded="true"><p class="k-reset"><a class="k-icon k-i-collapse" href="#" tabindex="-1"><\/a>'+v+"<\/p><\/td><\/tr>",n.hasSubgroups)for(o=0,l=c.length;o<l;o++)e+=f._groupRowHtml(c[o],t-1,r+1);else e+=f._rowsHtml(c);return f.groupFooterTemplate&&(e+=f.groupFooterTemplate(u(p,n.aggregates))),e},collapseGroup:function(t){t=n(t).find(".k-icon").addClass("k-i-expand").removeClass("k-i-collapse").end();var f=t.find(".k-group-cell").length,r=1,u,i;t.find("td:first").attr("aria-expanded",!1);t.nextAll("tr").each(function(){if(i=n(this),u=i.find(".k-group-cell").length,i.hasClass("k-grouping-row")?r++:i.hasClass("k-group-footer")&&r--,u<=f||i.hasClass("k-group-footer")&&r<0)return!1;i.hide()})},expandGroup:function(t){t=n(t).find(".k-icon").addClass("k-i-collapse").removeClass("k-i-expand").end();var e=this,f=t.find(".k-group-cell").length,i,r,u=1;t.find("td:first").attr("aria-expanded",!0);t.nextAll("tr").each(function(){if(i=n(this),r=i.find(".k-group-cell").length,r<=f)return!1;r!=f+1||i.hasClass("k-detail-row")||(i.show(),i.hasClass("k-grouping-row")&&i.find(".k-icon").hasClass("k-i-collapse")&&e.expandGroup(i),i.hasClass("k-master-row")&&i.find(".k-icon").hasClass("k-minus")&&i.next().show());i.hasClass("k-grouping-row")&&u++;i.hasClass("k-group-footer")&&(u==1?i.show():u--)})},_updateHeader:function(t){var r=this,u=r.thead.find("th.k-group-cell"),i=u.length;t>i?n(new Array(t-i+1).join('<th class="k-group-cell k-header"> <\/th>')).prependTo(r.thead.find("tr")):t<i&&(i=i-t,n(b(u,function(n,t){return i>t})).remove())},_firstDataItem:function(n,t){return n&&t&&(n=n.hasSubgroups?this._firstDataItem(n.items[0],t):n.items[0]),n},hideColumn:function(t){var i=this,a,f,r,h,u,v,c,o=0,l,y=i.footer||i.wrapper.find(".k-grid-footer"),p=i.columns,s;if(t=typeof t=="number"?p[t]:b(p,function(n){return n.field===t})[0],t&&!t.hidden){for(s=d(t,tt(p)),t.hidden=!0,t.attributes=ot(t.attributes),t.footerAttributes=ot(t.footerAttributes),t.headerAttributes=ot(t.headerAttributes),i._templates(),i._updateCols(),st(i.thead.find(">tr")[0].cells,s,!1),y[0]&&(i._appendCols(y.find("table:first")),st(y.find(".k-footer-template")[0].cells,s,!1)),a=i.tbody.children(),u=0,l=a.length;u<l;u+=1)f=a.eq(u),f.is(".k-grouping-row,.k-detail-row")?(r=f.children(":not(.k-group-cell):first,.k-detail-cell").last(),r.attr("colspan",parseInt(r.attr("colspan"),10)-1)):(f.hasClass("k-grid-edit-row")&&(r=f.children(".k-edit-container")[0])&&(r=n(r),r.attr("colspan",parseInt(r.attr("colspan"),10)-1),r.find("col").eq(s).remove(),f=r.find("tr:first")),st(f[0].cells,s,!1));for(v=i.thead.prev().find("col"),u=0,l=v.length;u<l;u+=1)if(c=v[u].style.width,c&&c.indexOf("%")==-1)o+=parseInt(c,10);else{o=0;break}h=n(">.k-grid-header table:first,>.k-grid-footer table:first",i.wrapper).add(i.table);i._footerWidth=null;o&&(h.width(o),i._footerWidth=o);e.msie&&e.version==8&&(h.css("display","inline-table"),setTimeout(function(){h.css("display","table")},1));i.trigger(li,{column:t})}},showColumn:function(t){var i=this,c,u,o,f,r,l,e,a,v,s=i.columns,y=i.footer||i.wrapper.find(".k-grid-footer"),h;if(t=typeof t=="number"?s[t]:b(s,function(n){return n.field===t})[0],t&&t.hidden){for(h=d(t,s),t.hidden=!1,t.attributes=ei(t.attributes),t.footerAttributes=ei(t.footerAttributes),t.headerAttributes=ei(t.headerAttributes),i._templates(),i._updateCols(),st(i.thead.find(">tr")[0].cells,h,!0),y[0]&&(i._appendCols(y.find("table:first")),st(y.find(".k-footer-template")[0].cells,h,!0)),c=i.tbody.children(),u=0,o=c.length;u<o;u+=1)f=c.eq(u),f.is(".k-grouping-row,.k-detail-row")?(r=f.children(":not(.k-group-cell):first,.k-detail-cell").last(),r.attr("colspan",parseInt(r.attr("colspan"),10)+1)):(f.hasClass("k-grid-edit-row")&&(r=f.children(".k-edit-container")[0])&&(r=n(r),r.attr("colspan",parseInt(r.attr("colspan"),10)+1),ir(r.find(">form>table"),tt(s),!1,0),f=r.find("tr:first")),st(f[0].cells,h,!0));if(l=n(">.k-grid-header table:first,>.k-grid-footer table:first",i.wrapper).add(i.table),t.width){for(e=0,v=i.thead.prev().find("col"),u=0,o=v.length;u<o;u+=1){if(a=v[u].style.width,a.indexOf("%")>-1){e=0;break}e+=parseInt(a,10)}i._footerWidth=null;e&&(l.width(e),i._footerWidth=e)}else l.width("");i.trigger(ai,{column:t})}},_progress:function(n){var t=this,r=t.element.is("table")?t.element.parent():t.content&&t.content.length?t.content:t.element;i.ui.progress(r,n)},_resize:function(){this.content&&(this._setContentHeight(),this._setContentWidth())},refresh:function(t){var i=this,y,f,e="",o=i.dataSource.view(),w=i.options.navigatable,s,h,u,p=n(i.current()),c=!1,r=(i.dataSource.group()||[]).length,a=r+tt(i.columns).length,v;if((!t||t.action!=="itemchange"||!i.editable)&&(t=t||{},!i.trigger("dataBinding",{action:t.action||"rebind",index:t.index,items:t.items}))){if(v=rt(),w&&(i.table[0]===v||n.contains(i.table[0],v)||i._editContainer&&i._editContainer.data("kendoWindow"))&&(c=p.is("th"),u=0,c&&(u=i.thead.find("th:not(.k-group-cell)").index(p))),i._destroyEditable(),i._progress(!1),i._hideResizeHandle(),i._data=[],i.columns.length||(i._autoColumns(i._firstDataItem(o[0],r)),a=r+i.columns.length),i._group=r>0||i._group,i._group&&(i._templates(),i._updateCols(),i._updateHeader(r),i._group=r>0),r>0)for(i.detailTemplate&&a++,i.groupFooterTemplate&&(i._groupAggregatesDefaultObject=fi(i.dataSource.aggregate())),f=0,y=o.length;f<y;f++)e+=i._groupRowHtml(o[f],a,0);else e+=i._rowsHtml(o);er?i.tbody[0].innerHTML=e:(h=document.createElement("div"),h.innerHTML="<table><tbody>"+e+"<\/tbody><\/table>",s=h.firstChild.firstChild,i.table[0].replaceChild(s,i.tbody[0]),i.tbody=n(s));i._footer();i._setContentHeight();i._setContentWidth();u>=0&&(i._removeCurrent(),c?i.current(i.thead.find("th:not(.k-group-cell)").eq(u)):i.current(i.items().eq(u).children().filter(g).first()),i._current&&l(i._current.closest("table")[0],!0));i.trigger(yi)}}});it.plugin(kr);it.plugin(tr)}(window.kendo.jQuery);kendo_module({id:"listview",name:"ListView",category:"web",description:"The ListView widget offers rich support for interacting with data.",depends:["data"],features:[{id:"listview-editing",name:"Editing",description:"Support for record editing",depends:["editable"]},{id:"listview-selection",name:"Selection",description:"Support for selection",depends:["selectable"]}]}),function(n,t){var i=window.kendo,f="change",c="cancel",l="dataBound",a="dataBinding",e=i.ui.Widget,r=i.keys,v=">*",y="progress",p="error",s="k-state-focused",w="k-state-selected",h="k-edit-item",tt="string",b="edit",k="remove",d="save",it="click",u=".kendoListView",o=n.proxy,g=i._activeElement,nt=i.ui.progress,rt=i.data.DataSource,ut=e.extend({init:function(t,r){var u=this;r=n.isArray(r)?{dataSource:r}:r;e.fn.init.call(u,t,r);r=u.options;u.wrapper=t=u.element;t[0].id&&(u._itemId=t[0].id+"_lv_active");u._element();u._dataSource();u._templates();u._navigatable();u._selectable();u._pageable();u._crudHandlers();u.options.autoBind&&u.dataSource.fetch();i.notify(u)},events:[f,c,a,l,b,k,d],options:{name:"ListView",autoBind:!0,selectable:!1,navigatable:!1,template:"",altTemplate:"",editTemplate:""},setOptions:function(n){e.fn.setOptions.call(this,n);this._templates()},_templates:function(){var n=this.options;this.template=i.template(n.template||"");this.altTemplate=i.template(n.altTemplate||n.template);this.editTemplate=i.template(n.editTemplate||"")},_item:function(n){return this.element.children()[n]()},items:function(){return this.element.children()},setDataSource:function(n){this.options.dataSource=n;this._dataSource();this.options.autoBind&&n.fetch()},_unbindDataSource:function(){var n=this;n.dataSource.unbind(f,n._refreshHandler).unbind(y,n._progressHandler).unbind(p,n._errorHandler)},_dataSource:function(){var n=this;n.dataSource&&n._refreshHandler?n._unbindDataSource():(n._refreshHandler=o(n.refresh,n),n._progressHandler=o(n._progress,n),n._errorHandler=o(n._error,n));n.dataSource=rt.create(n.options.dataSource).bind(f,n._refreshHandler).bind(y,n._progressHandler).bind(p,n._errorHandler)},_progress:function(){nt(this.element,!0)},_error:function(){nt(this.element,!1)},_element:function(){this.element.addClass("k-widget k-listview").attr("role","listbox")},refresh:function(n){var t=this,f=t.dataSource.view(),e,s,u,h="",r,o,c=t.template,v=t.altTemplate,y=g();if(n=n||{},n.action==="itemchange"){t._hasBindingTarget()||t.editable||(e=n.items[0],u=t.items().filter("["+i.attr("uid")+"="+e.uid+"]"),u.length>0&&(r=u.index(),u.replaceWith(c(e)),u=t.items().eq(r),u.attr(i.attr("uid"),e.uid),t.trigger("itemChange",{item:u,data:e})));return}if(!t.trigger(a,{action:n.action||"rebind",items:n.items,index:n.index})){for(t._destroyEditable(),r=0,o=f.length;r<o;r++)h+=r%2?v(f[r]):c(f[r]);for(t.element.html(h),s=t.items(),r=0,o=f.length;r<o;r++)s.eq(r).attr(i.attr("uid"),f[r].uid).attr("role","option").attr("aria-selected","false");t.element[0]===y&&t.options.navigatable&&t.current(s.eq(0));t.trigger(l)}},_pageable:function(){var t=this,r=t.options.pageable,u,f;n.isPlainObject(r)&&(f=r.pagerId,u=n.extend({},r,{dataSource:t.dataSource,pagerId:null}),t.pager=new i.ui.Pager(n("#"+f),u))},_selectable:function(){var n=this,e,t,o=n.options.selectable,s=n.options.navigatable;if(o&&(e=typeof o===tt&&o.toLowerCase().indexOf("multiple")>-1,e&&n.element.attr("aria-multiselectable",!0),n.selectable=new i.ui.Selectable(n.element,{aria:!0,multiple:e,filter:v,change:function(){n.trigger(f)}}),s))n.element.on("keydown"+u,function(i){if(i.keyCode===r.SPACEBAR){if(t=n.current(),i.target==i.currentTarget&&i.preventDefault(),e)if(i.ctrlKey){if(t&&t.hasClass(w)){t.removeClass(w);return}}else n.selectable.clear();else n.selectable.clear();n.selectable.value(t)}})},current:function(n){var r=this,f=r.element,i=r._current,u=r._itemId;if(n===t)return i;i&&i[0]&&(i[0].id===u&&i.removeAttr("id"),i.removeClass(s),f.removeAttr("aria-activedescendant"));n&&n[0]&&(u=n[0].id||u,r._scrollTo(n[0]),f.attr("aria-activedescendant",u),n.addClass(s).attr("id",u));r._current=n},_scrollTo:function(t){var u=this,i,e=!1,r="scroll",f;u.wrapper.css("overflow")=="auto"||u.wrapper.css("overflow")==r?i=u.wrapper[0]:(i=window,e=!0);f=function(u,f){var o=e?n(t).offset()[u.toLowerCase()]:t["offset"+u],s=t["client"+f],h=n(i)[r+u](),c=n(i)[f.toLowerCase()]();o+s>h+c?n(i)[r+u](o+s-c):o<h&&n(i)[r+u](o)};f("Top","Height");f("Left","Width")},_navigatable:function(){var t=this,e=t.options.navigatable,f=t.element,c=function(i){t.current(n(i.currentTarget));n(i.target).is(":button,a,:input,a>.k-icon,textarea")||f.focus()};if(e){t._tabindex();f.on("focus"+u,function(){var n=t._current;n&&n.is(":visible")||(n=t._item("first"));t.current(n)}).on("focusout"+u,function(){t._current&&t._current.removeClass(s)}).on("keydown"+u,function(u){var e=u.keyCode,o=t.current(),v=n(u.target),y=!v.is(":button,textarea,a,a>.t-icon,input"),a=v.is(":text"),s=i.preventDefault,c=f.find("."+h),p=g(),l,w;if((y||a||r.ESC==e)&&(!a||r.ESC==e||r.ENTER==e))if(r.UP===e||r.LEFT===e)o&&(o=o.prev()),t.current(!o||!o[0]?t._item("last"):o),s(u);else if(r.DOWN===e||r.RIGHT===e)o&&(o=o.next()),t.current(!o||!o[0]?t._item("first"):o),s(u);else if(r.PAGEUP===e)t.current(null),t.dataSource.page(t.dataSource.page()-1),s(u);else if(r.PAGEDOWN===e)t.current(null),t.dataSource.page(t.dataSource.page()+1),s(u);else if(r.HOME===e)t.current(t._item("first")),s(u);else if(r.END===e)t.current(t._item("last")),s(u);else if(r.ENTER===e)if(c.length!==0&&(y||a)){l=t.items().index(c);p&&p.blur();t.save();w=function(){t.element.trigger("focus");t.current(t.items().eq(l))};t.one("dataBound",w)}else t.options.editTemplate!==""&&t.edit(o);else if(r.ESC===e){if(c=f.find("."+h),c.length===0)return;l=t.items().index(c);t.cancel();t.element.trigger("focus");t.current(t.items().eq(l))}});f.on("mousedown"+u+" touchstart"+u,v,o(c,t))}},clearSelection:function(){var n=this;n.selectable.clear();n.trigger(f)},select:function(t){var r=this,i=r.selectable;if(t=n(t),t.length){i.options.multiple||(i.clear(),t=t.first());i.value(t);return}return i.value()},_destroyEditable:function(){var n=this;n.editable&&(n.editable.destroy(),delete n.editable)},_modelFromElement:function(n){var t=n.attr(i.attr("uid"));return this.dataSource.getByUid(t)},_closeEditable:function(n){var t=this,r=t.editable,u,e,o=t.template,f=!0;return r&&(n&&(f=r.end()),f&&(r.element.index()%2&&(o=t.altTemplate),u=t._modelFromElement(r.element),t._destroyEditable(),e=r.element.index(),r.element.replaceWith(o(u)),t.items().eq(e).attr(i.attr("uid"),u.uid))),f},edit:function(n){var t=this,r=t._modelFromElement(n),u,e=r.uid,f;t.cancel();n=t.items().filter("["+i.attr("uid")+"="+e+"]");f=n.index();n.replaceWith(t.editTemplate(r));u=t.items().eq(f).addClass(h).attr(i.attr("uid"),r.uid);t.editable=u.kendoEditable({model:r,clearContainer:!1,errorTemplate:!1}).data("kendoEditable");t.trigger(b,{model:r,item:u})},save:function(){var n=this,t=n.editable,i;t&&(t=t.element,i=n._modelFromElement(t),!n.trigger(d,{model:i,item:t})&&n._closeEditable(!0)&&n.dataSource.sync())},remove:function(n){var t=this,i=t.dataSource,r=t._modelFromElement(n);t.trigger(k,{model:r,item:n})||(n.hide(),i.remove(r),i.sync())},add:function(){var n=this,t=n.dataSource,i=t.indexOf((t.view()||[])[0]);i<0&&(i=0);n.cancel();t.insert(i,{});n.edit(n.element.children().first())},cancel:function(){var n=this,r=n.dataSource,t,i;n.editable&&(t=n.editable.element,i=n._modelFromElement(t),n.trigger(c,{model:i,container:t})||(r.cancelChanges(i),n._closeEditable(!1)))},_crudHandlers:function(){var t=this,r=it+u;t.element.on(r,".k-edit-button",function(r){var u=n(this).closest("["+i.attr("uid")+"]");t.edit(u);r.preventDefault()});t.element.on(r,".k-delete-button",function(r){var u=n(this).closest("["+i.attr("uid")+"]");t.remove(u);r.preventDefault()});t.element.on(r,".k-update-button",function(n){t.save();n.preventDefault()});t.element.on(r,".k-cancel-button",function(n){t.cancel();n.preventDefault()})},destroy:function(){var n=this;e.fn.destroy.call(n);n._unbindDataSource();n._destroyEditable();n.element.off(u);n.pager&&n.pager.destroy();n.selectable&&n.selectable.destroy();i.destroy(n.element)}});i.ui.plugin(ut)}(window.kendo.jQuery);kendo_module({id:"numerictextbox",name:"NumericTextBox",category:"web",description:"The NumericTextBox widget can format and display numeric, percentage or currency textbox.",depends:["core","userevents"]}),function(n,t){function ut(n,t){return'<span unselectable="on" class="k-link"><span unselectable="on" class="k-icon k-i-arrow-'+n+'" title="'+t+'">'+t+"<\/span><\/span>"}function y(i,r){var f,s=r!==t,u,e,o,h;return i.selectionStart!==t?s?(i.focus(),i.setSelectionRange(r,r)):r=[i.selectionStart,i.selectionEnd]:document.selection&&(n(i).is(":visible")&&i.focus(),f=document.selection.createRange(),s?(f.move("character",r),f.select()):(u=i.createTextRange(),e=u.duplicate(),u.moveToBookmark(f.getBookmark()),e.setEndPoint("EndToStart",u),o=e.text.length,h=o+u.text.length,r=[o,h])),r}var r=window.kendo,e=r.keys,p=r.ui,s=p.Widget,ft=r._activeElement,et=r._extractFormat,ot=r.parseFloat,st=r.support.placeholder,ht=r.getCulture,w=r._round,h="change",b="disabled",k="readonly",ct="k-input",d="spin",u=".kendoNumericTextBox",lt="touchend",at="mouseleave"+u,g="mouseenter"+u+" "+at,c="k-state-default",nt="k-state-focused",tt="k-state-hover",l="focus",f=".",a="k-state-selected",v="k-state-disabled",it="aria-disabled",rt="aria-readonly",vt=/^(-)?(\d*)$/,i=null,o=n.proxy,yt=s.extend({init:function(n,f){var e=this,p=f&&f.step!==t,h,c,a,v,y;if(s.fn.init.call(e,n,f),f=e.options,n=e.element.on("blur"+u,o(e._focusout,e)).attr("role","spinbutton"),f.placeholder=f.placeholder||n.attr("placeholder"),e._reset(),e._wrapper(),e._arrows(),e._input(),r.support.mobileOS)e._text.on(lt+u+" "+l+u,function(t){e._toggleText(!1);t.type===l&&n.focus()});else e._text.on(l+u,o(e._click,e));h=e.min(n.attr("min"));c=e.max(n.attr("max"));a=e._parse(n.attr("step"));f.min===i&&h!==i&&(f.min=h);f.max===i&&c!==i&&(f.max=c);p||a===i||(f.step=a);n.attr("aria-valuemin",f.min).attr("aria-valuemax",f.max);f.format=et(f.format);v=f.value;e.value(v!==i?v:n.val());y=n.is("[disabled]");y?e.enable(!1):e.readonly(n.is("[readonly]"));r.notify(e)},options:{name:"NumericTextBox",decimals:i,min:i,max:i,value:i,step:1,culture:"",format:"n",spinners:!0,placeholder:"",upArrowText:"Increase value",downArrowText:"Decrease value"},events:[h,d],_editable:function(n){var t=this,f=t.element,i=n.disable,r=n.readonly,e=t._text.add(f),s=t._inputWrapper.off(g);if(t._toggleText(!0),t._upArrowEventHandler.unbind("press"),t._downArrowEventHandler.unbind("press"),f.off("keydown"+u).off("keypress"+u).off("paste"+u),r||i)s.addClass(i?v:c).removeClass(i?c:v),e.attr(b,i).attr(k,r).attr(it,i).attr(rt,r);else{s.addClass(c).removeClass(v).on(g,t._toggleHover);e.removeAttr(b).removeAttr(k).attr(it,!1).attr(rt,!1);t._upArrowEventHandler.bind("press",function(n){n.preventDefault();t._spin(1);t._upArrow.addClass(a)});t._downArrowEventHandler.bind("press",function(n){n.preventDefault();t._spin(-1);t._downArrow.addClass(a)});t.element.on("keydown"+u,o(t._keydown,t)).on("keypress"+u,o(t._keypress,t)).on("paste"+u,o(t._paste,t))}},readonly:function(n){this._editable({readonly:n===t?!0:n,disable:!1})},enable:function(n){this._editable({readonly:!1,disable:!(n=n===t?!0:n)})},destroy:function(){var n=this;n.element.add(n._text).add(n._upArrow).add(n._downArrow).add(n._inputWrapper).off(u);n._upArrowEventHandler.destroy();n._downArrowEventHandler.destroy();n._form&&n._form.off("reset",n._resetHandler);s.fn.destroy.call(n)},min:function(n){return this._option("min",n)},max:function(n){return this._option("max",n)},step:function(n){return this._option("step",n)},value:function(n){var i=this,r;if(n===t)return i._value;(n=i._parse(n),r=i._adjust(n),n===r)&&(i._update(n),i._old=i._value)},focus:function(){this._focusin()},_adjust:function(n){var f=this,u=f.options,t=u.min,r=u.max;return n===i?n:(t!==i&&n<t?n=t:r!==i&&n>r&&(n=r),n)},_arrows:function(){var t=this,i,f=function(){clearTimeout(t._spinning);i.removeClass(a)},u=t.options,e=u.spinners,o=t.element;i=o.siblings(".k-icon");i[0]||(i=n(ut("n",u.upArrowText)+ut("s",u.downArrowText)).insertAfter(o),i.wrapAll('<span class="k-select"/>'));e||(i.parent().toggle(e),t._inputWrapper.addClass("k-expand-padding"));t._upArrow=i.eq(0);t._upArrowEventHandler=new r.UserEvents(t._upArrow,{release:f});t._downArrow=i.eq(1);t._downArrowEventHandler=new r.UserEvents(t._downArrow,{release:f})},_blur:function(){var n=this;n._toggleText(!0);n._change(n.element.val())},_click:function(n){var t=this;clearTimeout(t._focusing);t._focusing=setTimeout(function(){var o=n.target,l=y(o)[0],s=o.value.substring(0,l),h=t._format(t.options.format),i=h[","],r,c,u,e=0;i&&(c=new RegExp("\\"+i,"g"),u=new RegExp("([\\d\\"+i+"]+)(\\"+h[f]+")?(\\d+)?"));u&&(r=u.exec(s));r&&(e=r[0].replace(c,"").length,s.indexOf("(")!=-1&&t._value<0&&e++);t._focusin();y(t.element[0],e)})},_change:function(n){var t=this;t._update(n);n=t._value;t._old!=n&&(t._old=n,t.trigger(h),t.element.trigger(h))},_culture:function(n){return n||ht(this.options.culture)},_focusin:function(){var n=this;n._inputWrapper.addClass(nt);n._toggleText(!1);n.element[0].focus()},_focusout:function(){var n=this;clearTimeout(n._focusing);n._inputWrapper.removeClass(nt).removeClass(tt);n._blur()},_format:function(n,t){var i=this._culture(t).numberFormat;return n=n.toLowerCase(),n.indexOf("c")>-1?i=i.currency:n.indexOf("p")>-1&&(i=i.percent),i},_input:function(){var r=this,u="k-formatted-value",t=r.element.addClass(ct).show()[0],e=t.accessKey,o=r.wrapper,i;i=o.find(f+u);i[0]||(i=n('<input type="text"/>').insertBefore(t).addClass(u));try{t.setAttribute("type","text")}catch(s){t.type="text"}i[0].tabIndex=t.tabIndex;i[0].style.cssText=t.style.cssText;i.prop("placeholder",r.options.placeholder);e&&(i.attr("accesskey",e),t.accessKey="");r._text=i.addClass(t.className)},_keydown:function(n){var t=this,i=n.keyCode;i==e.DOWN?t._step(-1):i==e.UP?t._step(1):i==e.ENTER&&t._change(t.element.val())},_keypress:function(n){if(n.which!==0&&n.keyCode!==e.BACKSPACE&&n.keyCode!==e.ENTER){var i=this.element,f=String.fromCharCode(n.which),r=y(i[0]),o=r[0],s=r[1],u=this.options.min,t=i.val();t=t.substring(0,o)+f+t.substring(s);(u!==null&&u>=0&&t.charAt(0)==="-"||!this._numericRegex().test(t))&&n.preventDefault()}},_numericRegex:function(){var t=this,u=t.options,e=t._format(u.format),n=e[f],r=u.decimals;return(n===f&&(n="\\"+n),r===i&&(r=e.decimals),r===0)?vt:(t._separator!==n&&(t._separator=n,t._floatRegExp=new RegExp("^(-)?(((\\d+("+n+"\\d*)?)|("+n+"\\d*)))?$")),t._floatRegExp)},_paste:function(n){var t=this,r=n.target,u=r.value;setTimeout(function(){t._parse(r.value)===i&&t._update(u)})},_option:function(n,i){var r=this,u=r.options;if(i===t)return u[n];(i=r._parse(i),i||n!=="step")&&(u[n]=i,r.element.attr("aria-value"+n,i).attr(n,i))},_spin:function(n,t){var i=this;t=t||500;clearTimeout(i._spinning);i._spinning=setTimeout(function(){i._spin(n,50)},t);i._step(n)},_step:function(n){var t=this,i=t.element,r=t._parse(i.val())||0;ft()!=i[0]&&t._focusin();r+=t.options.step*n;t._update(t._adjust(r));t.trigger(d)},_toggleHover:function(t){n(t.currentTarget).toggleClass(tt,t.type==="mouseenter")},_toggleText:function(n){var t=this;t._text.toggle(n);t.element.toggle(!n)},_parse:function(n,t){return ot(n,this._culture(t),this.options.format)},_update:function(n){var t=this,s=t.options,h=s.format,u=s.decimals,e=t._culture(),c=t._format(h,e),o;u===i&&(u=c.decimals);n=t._parse(n,e);o=n!==i;o&&(n=parseFloat(w(n,u)));t._value=n=t._adjust(n);t._placeholder(r.toString(n,h,e));o?(n=n.toString(),n.indexOf("e")!==-1&&(n=w(+n,u)),n=n.replace(f,c[f])):n="";t.element.val(n).attr("aria-valuenow",n)},_placeholder:function(n){this._text.val(n);st||n||this._text.val(this.options.placeholder)},_wrapper:function(){var i=this,r=i.element,u=r[0],t;t=r.parents(".k-numerictextbox");t.is("span.k-numerictextbox")||(t=r.hide().wrap('<span class="k-numeric-wrap k-state-default" />').parent(),t=t.wrap("<span/>").parent());t[0].style.cssText=u.style.cssText;u.style.width="";i.wrapper=t.addClass("k-widget k-numerictextbox").addClass(u.className).css("display","");i._inputWrapper=n(t[0].firstChild)},_reset:function(){var t=this,i=t.element,r=i.attr("form"),u=r?n("#"+r):i.closest("form");u[0]&&(t._resetHandler=function(){setTimeout(function(){t.value(i[0].value)})},t._form=u.on("reset",t._resetHandler))}});p.plugin(yt)}(window.kendo.jQuery);kendo_module({id:"menu",name:"Menu",category:"web",description:"The Menu widget displays hierarchical data as a multi-level menu.",depends:["popup"]}),function(n,t){function yi(n,t){return n=n.split(" ")[!t+0]||n,n.replace("top","up").replace("bottom","down")}function pi(n,t,r){n=n.split(" ")[!t+0]||n;var u={origin:["bottom",r?"right":"left"],position:["top",r?"right":"left"]},f=/left|right/.test(n);return f?(u.origin=["top",n],u.position[1]=i.directions[n].reverse):(u.origin[0]=n,u.position[0]=i.directions[n].reverse),u.origin=u.origin.join(" "),u.position=u.position.join(" "),u}function d(t,i){try{return n.contains(t,i)}catch(r){return!1}}function oi(t){t=n(t);t.addClass("k-item").children(pt).addClass(kt);t.children("a").addClass(k).children(pt).addClass(kt);t.filter(":not([disabled])").addClass(ui);t.filter(".k-separator:empty").append(" ");t.filter("li[disabled]").addClass(y).removeAttr("disabled").attr("aria-disabled",!0);t.filter("[role]").length||t.attr("role","menuitem");t.children("."+k).length||t.contents().filter(function(){return!this.nodeName.match(ci)&&!(this.nodeType==3&&!n.trim(this.nodeValue))}).wrapAll("<span class='"+k+"'/>");b(t);c(t)}function b(t){t=n(t);t.find("> .k-link > [class*=k-i-arrow]:not(.k-sprite)").remove();t.filter(":has(.k-group)").children(".k-link:not(:has([class*=k-i-arrow]:not(.k-sprite)))").each(function(){var t=n(this),i=t.parent().parent();t.append("<span class='k-icon "+(i.hasClass(h+"-horizontal")?"k-i-arrow-s":"k-i-arrow-e")+"'/>")})}function c(t){t=n(t);t.filter(".k-first:not(:first-child)").removeClass(bt);t.filter(".k-last:not(:last-child)").removeClass(wt);t.filter(":first-child").addClass(bt);t.filter(":last-child").addClass(wt)}var i=window.kendo,si=i.ui,hi=i._activeElement,ft=i.support.touch&&i.support.mobileOS,et="mousedown",ot="click",f=n.extend,u=n.proxy,st=n.each,o=i.template,e=i.keys,g=si.Widget,ci=/^(ul|a|div)$/i,r=".kendoMenu",pt="img",ht="open",h="k-menu",k="k-link",wt="k-last",nt="close",tt="timer",bt="k-first",kt="k-image",dt="select",a="zIndex",gt="activate",ni="deactivate",ti="touchstart"+r+" MSPointerDown"+r+" pointerdown"+r,it=i.support.pointers,rt=i.support.msPointers,ct=it?"pointerover":rt?"MSPointerOver":"mouseenter",ii=it?"pointerout":rt?"MSPointerOut":"mouseleave",ri=ft||rt||it,ut="kendoPopup",ui="k-state-default",lt="k-state-hover",v="k-state-focused",y="k-state-disabled",at=".k-group",p=":not(.k-list) > .k-item",li=".k-item.k-state-disabled",vt=".k-item:not(.k-state-disabled)",ai=".k-item:not(.k-state-disabled) > .k-link",fi=":not(.k-item.k-separator)",w=fi+":eq(0)",ei=fi+":last",vi="div:not(.k-animation-container,.k-list-container)",s={content:o("<div class='k-content k-group' tabindex='-1'>#= content(item) #<\/div>"),group:o("<ul class='#= groupCssClass(group) #'#= groupAttributes(group) # role='menu' aria-hidden='true'>#= renderItems(data) #<\/ul>"),itemWrapper:o("<#= tag(item) # class='#= textClass(item) #'#= textAttributes(item) #>#= image(item) ##= sprite(item) ##= text(item) ##= arrow(data) #<\/#= tag(item) #>"),item:o("<li class='#= wrapperCssClass(group, item) #' role='menuitem' #=item.items ? \"aria-haspopup='true'\": \"\"##=item.enabled === false ? \"aria-disabled='true'\" : ''#>#= itemWrapper(data) ## if (item.items) { ##= subGroup({ items: item.items, menu: menu, group: { expanded: item.expanded } }) ## } else if (item.content || item.contentUrl) { ##= renderContent(data) ## } #<\/li>"),image:o("<img class='k-image' alt='' src='#= imageUrl #' />"),arrow:o("<span class='#= arrowClass(item, group) #'><\/span>"),sprite:o("<span class='k-sprite #= spriteCssClass #'><\/span>"),empty:o("")},yt={wrapperCssClass:function(n,t){var i="k-item",r=t.index;return i+=t.enabled===!1?" k-state-disabled":" k-state-default",n.firstLevel&&r===0&&(i+=" k-first"),r==n.length-1&&(i+=" k-last"),t.cssClass&&(i+=" "+t.cssClass),i},textClass:function(){return k},textAttributes:function(n){return n.url?" href='"+n.url+"'":""},arrowClass:function(n,t){return"k-icon"+(t.horizontal?" k-i-arrow-s":" k-i-arrow-e")},text:function(n){return n.encoded===!1?n.text:i.htmlEncode(n.text)},tag:function(n){return n.url?"a":"span"},groupAttributes:function(n){return n.expanded!==!0?" style='display:none'":""},groupCssClass:function(){return"k-group"},content:function(n){return n.content?n.content:" "}},l=g.extend({init:function(t,f){var e=this;g.fn.init.call(e,t,f);t=e.wrapper=e.element;f=e.options;e._initData(f);e._updateClasses();e._animations(f);e.nextItemZIndex=100;e._tabindex();e._focusProxy=u(e._focusHandler,e);t.on(ti,e._focusProxy).on(ot+r,li,!1).on(ot+r,vt,u(e._click,e)).on("keydown"+r,u(e._keydown,e)).on("focus"+r,u(e._focus,e)).on("focus"+r,".k-content",u(e._focus,e)).on(ti+" "+et+r,".k-content",u(e._preventClose,e)).on("blur"+r,u(e._removeHoverItem,e)).on("blur"+r,"[tabindex]",u(e._checkActiveElement,e)).on(ct+r,vt,u(e._mouseenter,e)).on(ii+r,vt,u(e._mouseleave,e)).on(ct+r+" "+ii+r+" "+et+r+" "+ot+r,ai,u(e._toggleHover,e));f.openOnClick&&(e.clicked=!1,e._documentClickHandler=u(e._documentClick,e),n(document).click(e._documentClickHandler));t.attr("role","menubar");t[0].id&&(e._ariaId=i.format("{0}_mn_active",t[0].id));i.notify(e)},events:[ht,nt,gt,ni,dt],options:{name:"Menu",animation:{open:{duration:200},close:{duration:100}},orientation:"horizontal",direction:"default",openOnClick:!1,closeOnClick:!0,hoverDelay:100},_initData:function(n){var t=this;n.dataSource&&(t.element.empty(),t.append(n.dataSource,t.element))},setOptions:function(n){var t=this.options.animation;this._animations(n);n.animation=f(!0,t,n.animation);"dataSource"in n&&this._initData(n);g.fn.setOptions.call(this,n)},destroy:function(){var t=this;g.fn.destroy.call(t);t.element.off(r);t._documentClickHandler&&n(document).unbind("click",t._documentClickHandler);i.destroy(t.element)},enable:function(n,t){return this._toggleDisabled(n,t!==!1),this},disable:function(n){return this._toggleDisabled(n,!1),this},append:function(n,t){t=this.element.find(t);var i=this._insert(n,t,t.length?t.find("> .k-group, > .k-animation-container > .k-group"):null);return st(i.items,function(){i.group.append(this);b(this)}),b(t),c(i.group.find(".k-first, .k-last").add(i.items)),this},insertBefore:function(n,t){t=this.element.find(t);var i=this._insert(n,t,t.parent());return st(i.items,function(){t.before(this);b(this);c(this)}),c(t),this},insertAfter:function(n,t){t=this.element.find(t);var i=this._insert(n,t,t.parent());return st(i.items,function(){t.after(this);b(this);c(this)}),c(t),this},_insert:function(t,i,r){var c=this,u,s,e,o;return i&&i.length||(r=c.element),e=n.isPlainObject(t),o={firstLevel:r.hasClass(h),horizontal:r.hasClass(h+"-horizontal"),expanded:!0,length:r.children().length},i&&!r.length&&(r=n(l.renderGroup({group:o})).appendTo(i)),e||n.isArray(t)?u=n(n.map(e?[t]:t,function(t,i){return typeof t=="string"?n(t).get():n(l.renderItem({group:o,item:f(t,{index:i})})).get()})):(u=n(t),s=u.find("> ul").addClass("k-group").attr("role","menu"),u=u.filter("li"),u.add(s.find("> li")).each(function(){oi(this)})),{items:u,group:r}},remove:function(n){var r;n=this.element.find(n);var u=this,t=n.parentsUntil(u.element,p),i=n.parent("ul:not(.k-menu)");return n.remove(),i&&!i.children(p).length&&(r=i.parent(".k-animation-container"),r.length?r.remove():i.remove()),t.length&&(t=t.eq(0),b(t),c(t)),u},open:function(r){var u=this,e=u.options,s=e.orientation=="horizontal",o=e.direction,c=i.support.isRtl(u.wrapper);return r=u.element.find(r),/^(top|bottom|default)$/.test(o)&&(o=c?s?(o+" left").replace("default","bottom"):"left":s?(o+" right").replace("default","bottom"):"right"),r.siblings().find(">.k-popup:visible,>.k-animation-container>.k-popup:visible").each(function(){var t=n(this).data("kendoPopup");t&&t.close()}),r.each(function(){var i=n(this);clearTimeout(i.data(tt));i.data(tt,setTimeout(function(){var r=i.find(".k-group:first:hidden"),l;if(r[0]&&u.trigger(ht,{item:i[0]})===!1){!r.find(".k-group")[0]&&r.children(".k-item").length>1?setTimeout(function(){r.css({maxHeight:n(window).height(),overflow:"auto"})}):r.css({maxHeight:"",overflow:""});i.data(a,i.css(a));i.css(a,u.nextItemZIndex++);l=r.data(ut);var y=i.parent().hasClass(h),b=y&&s,v=pi(o,y,c),p=e.animation.open.effects,w=p!==t?p:"slideIn:"+yi(o,y);l?(l=r.data(ut),l.options.origin=v.origin,l.options.position=v.position,l.options.animation.open.effects=w):l=r.kendoPopup({activate:function(){u.trigger(gt,{item:this.wrapper.parent()})},deactivate:function(){u.trigger(ni,{item:this.wrapper.parent()})},origin:v.origin,position:v.position,collision:e.popupCollision!==t?e.popupCollision:b?"fit":"fit flip",anchor:i,appendTo:i,animation:{open:f(!0,{effects:w},e.animation.open),close:e.animation.close},close:function(n){var t=n.sender.wrapper.parent();u.trigger(nt,{item:t[0]})?n.preventDefault():(t.css(a,t.data(a)),t.removeData(a),ri&&(t.removeClass(lt),u._removeHoverItem()))}}).data(ut);r.removeAttr("aria-hidden");l.open()}},u.options.hoverDelay))}),u},close:function(t){var i=this,r=i.element;return t=r.find(t),t.length||(t=r.find(">.k-item")),t.each(function(){var t=n(this);i._isRootItem(t)&&(i.clicked=!1);clearTimeout(t.data(tt));t.data(tt,setTimeout(function(){var n=t.find(".k-group:not(.k-list-container):not(.k-calendar-container):first:visible").data(ut);n&&(n.close(),n.element.attr("aria-hidden",!0))},i.options.hoverDelay))}),i},_toggleDisabled:function(t,i){this.element.find(t).each(function(){n(this).toggleClass(ui,i).toggleClass(y,!i).attr("aria-disabled",!i)})},_toggleHover:function(t){var r=n(i.eventTarget(t)||t.target).closest(p),u=t.type==ct||et.indexOf(t.type)!==-1;r.parents("li."+y).length||r.toggleClass(lt,u||t.type=="mousedown"||t.type=="click");this._removeHoverItem()},_preventClose:function(){this.options.closeOnClick||(this._closurePrevented=!0)},_checkActiveElement:function(t){var u=this,f=n(t?t.currentTarget:this._hoverItem()),r=u._findRootParent(f)[0];this._closurePrevented||setTimeout(function(){document.hasFocus()&&(d(r,i._activeElement())||!t||d(r,t.currentTarget))||u.close(r)},0);this._closurePrevented=!1},_removeHoverItem:function(){var n=this._hoverItem();n&&n.hasClass(v)&&(n.removeClass(v),this._oldHoverItem=null)},_updateClasses:function(){var n=this.element,t;n.addClass("k-widget k-reset k-header "+h).addClass(h+"-"+this.options.orientation);n.find("li > ul").addClass("k-group").attr("role","menu").attr("aria-hidden",n.is(":visible")).end().find("li > div").addClass("k-content").attr("tabindex","-1");t=n.find("> li,.k-group > li");t.each(function(){oi(this)})},_mouseenter:function(t){var i=this,r=n(t.currentTarget),f=r.children(".k-animation-container").length||r.children(at).length;t.delegateTarget==r.parents(".k-menu")[0]&&(i.options.openOnClick&&!i.clicked||ft||!d(t.currentTarget,t.relatedTarget)&&f&&i.open(r),(i.options.openOnClick&&i.clicked||ri)&&r.siblings().each(u(function(n,t){i.close(t)},i)))},_mouseleave:function(t){var r=this,i=n(t.currentTarget),u=i.children(".k-animation-container").length||i.children(at).length;if(i.parentsUntil(".k-animation-container",".k-list-container,.k-calendar-container")[0]){t.stopImmediatePropagation();return}r.options.openOnClick||ft||(it||rt)&&t.originalEvent.pointerType==t.originalEvent.MSPOINTER_TYPE_TOUCH||d(t.currentTarget,t.relatedTarget||t.target)||!u||r.close(i)},_click:function(t){var r=this,c,f=r.options,e=n(i.eventTarget(t)),o=e[0]?e[0].nodeName.toUpperCase():"",v=o=="INPUT"||o=="SELECT"||o=="BUTTON"||o=="LABEL",l=e.closest("."+k),u=e.closest(p),w=l.attr("href"),s,b,a=!!w&&w!==n("<a href='#' />").attr("href");if(!u.children(vi)[0]){if(u.hasClass(y)){t.preventDefault();return}if(t.handled||!r.trigger(dt,{item:u[0]})||v||t.preventDefault(),t.handled=!0,s=u.children(at+",.k-animation-container"),b=s.is(":visible"),f.closeOnClick&&!a&&(!s.length||f.openOnClick&&b)){u.removeClass(lt).css("height");r._oldHoverItem=r._findRootParent(u);r.close(l.parentsUntil(r.element,p));r.clicked=!1;"MSPointerUp".indexOf(t.type)!=-1&&t.preventDefault();return}(a&&t.enterKey&&l[0].click(),u.parent().hasClass(h)&&f.openOnClick||i.support.touch)&&(a||v||t.preventDefault(),r.clicked=!0,c=s.is(":visible")?nt:ht,f.closeOnClick||c!=nt)&&r[c](u)}},_documentClick:function(n){d(this.element[0],n.target)||(this.clicked=!1)},_focus:function(t){var i=this,r=t.target,u=i._hoverItem(),f=hi();if(r!=i.wrapper[0]&&!n(r).is(":kendoFocusable")){t.stopPropagation();n(r).closest(".k-content").closest(".k-group").closest(".k-item").addClass(v);i.wrapper.focus();return}f===t.currentTarget&&(u.length?i._moveHover([],u):i._oldHoverItem||i._moveHover([],i.wrapper.children().first()))},_keydown:function(n){var t=this,f=n.keyCode,r=t._oldHoverItem,u,o,s,h=i.support.isRtl(t.wrapper);if(n.target==n.currentTarget||f==e.ESC){if(r||(r=t._oldHoverItem=t._hoverItem()),o=t._itemBelongsToVertival(r),s=t._itemHasChildren(r),f==e.RIGHT)u=t[h?"_itemLeft":"_itemRight"](r,o,s);else if(f==e.LEFT)u=t[h?"_itemRight":"_itemLeft"](r,o,s);else if(f==e.DOWN)u=t._itemDown(r,o,s);else if(f==e.UP)u=t._itemUp(r,o,s);else if(f==e.ESC)u=t._itemEsc(r,o);else if(f==e.ENTER||f==e.SPACEBAR)u=r.children(".k-link"),u.length>0&&(t._click({target:u[0],preventDefault:function(){},enterKey:!0}),t._moveHover(r,t._findRootParent(r)));else if(f==e.TAB){u=t._findRootParent(r);t._moveHover(r,u);t._checkActiveElement();return}u&&u[0]&&(n.preventDefault(),n.stopPropagation())}},_hoverItem:function(){return this.wrapper.find(".k-item.k-state-hover,.k-item.k-state-focused").filter(":visible")},_itemBelongsToVertival:function(n){var t=this.wrapper.hasClass("k-menu-vertical");return n.length?n.parent().hasClass("k-group")||t:t},_itemHasChildren:function(n){return n.length?n.children("ul.k-group, div.k-animation-container").length>0:!1},_moveHover:function(n,t){var r=this,i=r._ariaId;n.length&&t.length&&(n.removeClass(v),n[0].id===i&&n.removeAttr("id"));t.length&&(t[0].id&&(i=t[0].id),t.addClass(v),r._oldHoverItem=t,i&&(r.element.removeAttr("aria-activedescendant"),t.attr("id",i),r.element.attr("aria-activedescendant",i)))},_findRootParent:function(n){return n.parent().hasClass("k-menu")?n:n.parentsUntil(".k-menu","li.k-item").last()},_isRootItem:function(n){return n.parent().hasClass("k-menu")},_itemRight:function(n,t,i){var u=this,r,f;if(!n.hasClass(y))return t?i?(u.open(n),r=n.find(".k-group").children().first()):u.options.orientation=="horizontal"&&(f=u._findRootParent(n),u.close(f),r=f.nextAll(w)):(r=n.nextAll(w),r.length||(r=n.prevAll(ei))),r&&!r.length?r=u.wrapper.children(".k-item").first():r||(r=[]),u._moveHover(n,r),r},_itemLeft:function(n,t){var r=this,i;return t?(i=n.parent().closest(".k-item"),r.close(i),r._isRootItem(i)&&r.options.orientation=="horizontal"&&(i=i.prevAll(w))):(i=n.prevAll(w),i.length||(i=n.nextAll(ei))),i.length||(i=r.wrapper.children(".k-item").last()),r._moveHover(n,i),i},_itemDown:function(n,t,i){var u=this,r;if(t)r=n.nextAll(w);else{if(!i||n.hasClass(y))return;u.open(n);r=n.find(".k-group").children().first()}return!r.length&&n.length?r=n.parent().children().first():n.length||(r=u.wrapper.children(".k-item").first()),u._moveHover(n,r),r},_itemUp:function(n,t){var r=this,i;if(t)i=n.prevAll(w);else return;return!i.length&&n.length?i=n.parent().children().last():n.length||(i=r.wrapper.children(".k-item").last()),r._moveHover(n,i),i},_itemEsc:function(n,t){var r=this,i;if(t)i=n.parent().closest(".k-item"),r.close(i),r._moveHover(n,i);else return n;return i},_focusHandler:function(t){var u=this,r=n(i.eventTarget(t)).closest(p);setTimeout(function(){u._moveHover([],r);r.children(".k-content")[0]&&r.parent().closest(".k-item").removeClass(v)},200)},_animations:function(n){n&&"animation"in n&&!n.animation&&(n.animation={open:{effects:{}},close:{hide:!0,effects:{}}})}});f(l,{renderItem:function(n){n=f({menu:{},group:{}},n);var i=s.empty,t=n.item;return s.item(f(n,{image:t.imageUrl?s.image:i,sprite:t.spriteCssClass?s.sprite:i,itemWrapper:s.itemWrapper,renderContent:l.renderContent,arrow:t.items||t.content?s.arrow:i,subGroup:l.renderGroup},yt))},renderGroup:function(n){return s.group(f({renderItems:function(n){for(var r="",t=0,i=n.items,u=i?i.length:0,e=f({length:u},n.group);t<u;t++)r+=l.renderItem(f(n,{group:e,item:f({index:t},i[t])}));return r}},n,yt))},renderContent:function(n){return s.content(f(n,yt))}});i.ui.plugin(l)}(window.kendo.jQuery);kendo_module({id:"filtermenu",name:"Filtering Menu",category:"framework",depends:["datepicker","numerictextbox","dropdownlist"],advanced:!0}),function(n){function c(t,i){t.filters&&(t.filters=n.grep(t.filters,function(n){return c(n,i),n.filters?n.filters.length:n.field!=i}))}function l(n){var i,u,t,f,e,r;if(n&&n.length)for(r=[],i=0,u=n.length;i<u;i++)t=n[i],e=t.text||t.value||t,f=t.value==null?t.text||t:t.value,r[i]={text:e,value:f};return r}function d(t,i){return n.grep(t,function(t){return t.filters?(t.filters=n.grep(t.filters,function(n){return n.field!=i}),t.filters.length):t.field!=i})}var t=window.kendo,s=t.ui,i=n.proxy,u="kendoPopup",h="init",r=".kendoFilterMenu",f="Is equal to",e="Is not equal to",a={number:"numerictextbox",date:"datepicker"},v={string:"text",number:"number",date:"date"},y=t.isFunction,o=s.Widget,p='<div><div class="k-filter-help-text">#=messages.info#<\/div><label><input type="radio" data-#=ns#bind="checked: filters[0].value" value="true" name="filters[0].value"/>#=messages.isTrue#<\/label><label><input type="radio" data-#=ns#bind="checked: filters[0].value" value="false" name="filters[0].value"/>#=messages.isFalse#<\/label><div><button type="submit" class="k-button">#=messages.filter#<\/button><button type="reset" class="k-button">#=messages.clear#<\/button><\/div><\/div>',w='<div><div class="k-filter-help-text">#=messages.info#<\/div><select data-#=ns#bind="value: filters[0].operator" data-#=ns#role="dropdownlist">#for(var op in operators){#<option value="#=op#">#=operators[op]#<\/option>#}#<\/select>#if(values){#<select data-#=ns#bind="value:filters[0].value" data-#=ns#text-field="text" data-#=ns#value-field="value" data-#=ns#source=\'#=kendo.stringify(values).replace(/\'/g,"&\\#39;")#\' data-#=ns#role="dropdownlist" data-#=ns#option-label="#=messages.selectValue#"><\/select>#}else{#<input data-#=ns#bind="value:filters[0].value" class="k-textbox" type="text" #=role ? "data-" + ns + "role=\'" + role + "\'" : ""# />#}##if(extra){#<select class="k-filter-and" data-#=ns#bind="value: logic" data-#=ns#role="dropdownlist"><option value="and">#=messages.and#<\/option><option value="or">#=messages.or#<\/option><\/select><select data-#=ns#bind="value: filters[1].operator" data-#=ns#role="dropdownlist">#for(var op in operators){#<option value="#=op#">#=operators[op]#<\/option>#}#<\/select>#if(values){#<select data-#=ns#bind="value:filters[1].value" data-#=ns#text-field="text" data-#=ns#value-field="value" data-#=ns#source=\'#=kendo.stringify(values).replace(/\'/g,"&\\#39;")#\' data-#=ns#role="dropdownlist" data-#=ns#option-label="#=messages.selectValue#"><\/select>#}else{#<input data-#=ns#bind="value: filters[1].value" class="k-textbox" type="text" #=role ? "data-" + ns + "role=\'" + role + "\'" : ""#/>#}##}#<div><button type="submit" class="k-button">#=messages.filter#<\/button><button type="reset" class="k-button">#=messages.clear#<\/button><\/div><\/div>',b='<div data-#=ns#role="view" data-#=ns#init-widgets="false" class="k-grid-filter-menu"><div data-#=ns#role="header" class="k-header"><button class="k-button k-cancel">#=messages.cancel#<\/button>#=field#<button type="submit" class="k-button k-submit">#=messages.filter#<\/button><\/div><form class="k-filter-menu k-mobile-list k-secondary"><ul class="k-filter-help-text"><li><span class="k-link">#=messages.info#<\/span><ul><li class="k-item"><label class="k-label">#=messages.operator#<select data-#=ns#bind="value: filters[0].operator">#for(var op in operators){#<option value="#=op#">#=operators[op]#<\/option>#}#<\/select><\/label><\/li><li class="k-item"><label class="k-label">#=messages.value##if(values){#<select data-#=ns#bind="value:filters[0].value"><option value="">#=messages.selectValue#<\/option>#for(var val in values){#<option value="#=values[val].value#">#=values[val].text#<\/option>#}#<\/select>#}else{#<input data-#=ns#bind="value:filters[0].value" class="k-textbox" type="#=inputType#" #=useRole ? "data-" + ns + "role=\'" + role + "\'" : ""# />#}#<\/label><\/li>#if(extra){#<\/ul><ul class="k-filter-help-text"><li><span class="k-link"><\/span><li class="k-item"><label class="k-label"><input type="radio" name="logic" class="k-check" data-#=ns#bind="checked: logic" value="and" />#=messages.and#<\/label><\/li><li class="k-item"><label class="k-label"><input type="radio" name="logic" class="k-check" data-#=ns#bind="checked: logic" value="or" />#=messages.or#<\/label><\/li><\/ul><ul class="k-filter-help-text"><li><span class="k-link"><\/span><li class="k-item"><label class="k-label">#=messages.operator#<select data-#=ns#bind="value: filters[1].operator">#for(var op in operators){#<option value="#=op#">#=operators[op]#<\/option>#}#<\/select><\/label><\/li><li class="k-item"><label class="k-label">#=messages.value##if(values){#<select data-#=ns#bind="value:filters[1].value"><option value="">#=messages.selectValue#<\/option>#for(var val in values){#<option value="#=values[val].value#">#=values[val].text#<\/option>#}#<\/select>#}else{#<input data-#=ns#bind="value:filters[1].value" class="k-textbox" type="#=inputType#" #=useRole ? "data-" + ns + "role=\'" + role + "\'" : ""# />#}#<\/label><\/li>#}#<\/ul><\/li><li class="k-button-container"><button type="reset" class="k-button">#=messages.clear#<\/button><\/li><\/ul><\/div><\/form><\/div>',k='<div data-#=ns#role="view" data-#=ns#init-widgets="false" class="k-grid-filter-menu"><div data-#=ns#role="header" class="k-header"><button class="k-button k-cancel">#=messages.cancel#<\/button>#=field#<button type="submit" class="k-button k-submit">#=messages.filter#<\/button><\/div><form class="k-filter-menu k-mobile-list k-secondary"><ul class="k-filter-help-text"><li><span class="k-link">#=messages.info#<\/span><ul><li class="k-item"><label class="k-label"><input class="k-check" type="radio" data-#=ns#bind="checked: filters[0].value" value="true" name="filters[0].value"/>#=messages.isTrue#<\/label><\/li><li class="k-item"><label class="k-label"><input class="k-check" type="radio" data-#=ns#bind="checked: filters[0].value" value="false" name="filters[0].value"/>#=messages.isFalse#<\/label><\/li><\/ul><\/li><li class="k-button-container"><button type="reset" class="k-button">#=messages.clear#<\/button><\/li><\/ul><\/form><\/div>',g=o.extend({init:function(u,f){var e=this,h="string",l,a,c,s;if(o.fn.init.call(e,u,f),l=e.operators=f.operators||{},u=e.element,f=e.options,!f.appendToElement){c=u.addClass("k-with-icon k-filterable").find(".k-grid-filter");c[0]||(c=u.prepend('<a class="k-grid-filter" href="#"><span class="k-icon k-filter"/><\/a>').find(".k-grid-filter"));c.attr("tabindex",-1).on("click"+r,i(e._click,e))}e.link=c||n();e.dataSource=f.dataSource;e.field=f.field||u.attr(t.attr("field"));e.model=e.dataSource.reader.model;e._parse=function(n){return n+""};e.model&&e.model.fields&&(s=e.model.fields[e.field],s&&(h=s.type||"string",s.parse&&(e._parse=i(s.parse,s))));f.values&&(h="enums");e.type=h;l=l[h]||f.operators[h];for(a in l)break;e._defaultFilter=function(){return{field:e.field,operator:a||"eq",value:""}};e._refreshHandler=i(e.refresh,e);e.dataSource.bind("change",e._refreshHandler);f.appendToElement?e._init():e.refresh()},_init:function(){var u=this,f=u.options.ui,o=y(f),e;u.pane=u.options.pane;u.pane&&(u._isMobile=!0);o||(e=f||a[u.type]);u._isMobile?u._createMobileForm(e):u._createForm(e);u.form.on("submit"+r,i(u._submit,u)).on("reset"+r,i(u._reset,u));o&&u.form.find(".k-textbox").removeClass("k-textbox").each(function(){f(n(this))});u.form.find("["+t.attr("role")+"=numerictextbox]").removeClass("k-textbox").end().find("["+t.attr("role")+"=datetimepicker]").removeClass("k-textbox").end().find("["+t.attr("role")+"=timepicker]").removeClass("k-textbox").end().find("["+t.attr("role")+"=datepicker]").removeClass("k-textbox");u.refresh();u.trigger(h,{field:u.field,container:u.form})},_createForm:function(f){var e=this,o=e.options,h=e.operators||{},s=e.type;h=h[s]||o.operators[s];e.form=n('<form class="k-filter-menu k-secondary"/>').html(t.template(s==="boolean"?p:w)({field:e.field,format:o.format,ns:t.ns,messages:o.messages,extra:o.extra,operators:h,type:s,role:f,values:l(o.values)}));o.appendToElement?(e.element.append(e.form),e.popup=e.element.closest(".k-popup").data(u)):e.popup=e.form[u]({anchor:e.link,open:i(e._open,e),activate:i(e._activate,e),close:e.options.closeCallback}).data(u);e.form.on("keydown"+r,i(e._keydown,e))},_createMobileForm:function(i){var r=this,f=r.options,e=r.operators||{},u=r.type;e=e[u]||f.operators[u];r.form=n("<div />").html(t.template(u==="boolean"?k:b)({field:r.field,format:f.format,ns:t.ns,messages:f.messages,extra:f.extra,operators:e,type:u,role:i,useRole:!t.support.input.date&&u==="date"||u==="number",inputType:v[u],values:l(f.values)}));r.view=r.pane.append(r.form.html());r.form=r.view.element.find("form");r.view.element.on("click",".k-submit",function(n){r.form.submit();n.preventDefault()}).on("click",".k-cancel",function(n){r._closeForm();n.preventDefault()})},refresh:function(){var n=this,i=n.dataSource.filter()||{filters:[],logic:"and"};n.filterModel=t.observable({logic:"and",filters:[n._defaultFilter(),n._defaultFilter()]});n.form&&t.bind(n.form.children().first(),n.filterModel);n._bind(i)?n.link.addClass("k-state-active"):n.link.removeClass("k-state-active")},destroy:function(){var n=this;o.fn.destroy.call(n);n.form&&(t.unbind(n.form),t.destroy(n.form),n.form.unbind(r),n.popup&&n.popup.destroy());n.view&&n.view.purge();n.link.unbind(r);n._refreshHandler&&n.dataSource.unbind("change",n._refreshHandler)},_bind:function(n){for(var i=this,s=n.filters,f=!1,o=0,e=i.filterModel,r,t,u=0,h=s.length;u<h;u++)t=s[u],t.field==i.field?(e.set("logic",n.logic),r=e.filters[o],r||(e.filters.push({field:i.field}),r=e.filters[o]),r.set("value",i._parse(t.value)),r.set("operator",t.operator),o++,f=!0):t.filters&&(f=f||i._bind(t));return f},_merge:function(t){var f=this,s=t.logic||"and",r=t.filters,e,i=f.dataSource.filter()||{filters:[],logic:"and"},u,o;for(c(i,f.field),r=n.grep(r,function(n){return n.value!==""&&n.value!=null}),u=0,o=r.length;u<o;u++)e=r[u],e.value=f._parse(e.value);return r.length&&(i.filters.length?(t.filters=r,i.logic!=="and"&&(i.filters=[{logic:i.logic,filters:i.filters}],i.logic="and"),r.length>1?i.filters.push(t):i.filters.push(r[0])):(i.filters=r,i.logic=s)),i},filter:function(n){n=this._merge(n);n.filters.length&&this.dataSource.filter(n)},clear:function(){var i=this,t=i.dataSource.filter()||{filters:[]};t.filters=n.grep(t.filters,function(n){return n.filters?(n.filters=d(n.filters,i.field),n.filters.length):n.field!=i.field});t.filters.length||(t=null);i.dataSource.filter(t)},_submit:function(n){n.preventDefault();n.stopPropagation();this.filter(this.filterModel.toJSON());this._closeForm()},_reset:function(){this.clear();this._closeForm()},_closeForm:function(){this._isMobile?this.pane.navigate("",this.options.animations.right):this.popup.close()},_click:function(n){n.preventDefault();n.stopPropagation();this.popup||this.pane||this._init();this._isMobile?this.pane.navigate(this.view,this.options.animations.left):this.popup.toggle()},_open:function(){var t;n(".k-filter-menu").not(this.form).each(function(){t=n(this).data(u);t&&t.close()})},_activate:function(){this.form.find(":kendoFocusable:first").focus()},_keydown:function(n){n.keyCode==t.keys.ESC&&this.popup.close()},events:[h],options:{name:"FilterMenu",extra:!0,appendToElement:!1,type:"string",operators:{string:{eq:f,neq:e,startswith:"Starts with",contains:"Contains",doesnotcontain:"Does not contain",endswith:"Ends with"},number:{eq:f,neq:e,gte:"Is greater than or equal to",gt:"Is greater than",lte:"Is less than or equal to",lt:"Is less than"},date:{eq:f,neq:e,gte:"Is after or equal to",gt:"Is after",lte:"Is before or equal to",lt:"Is before"},enums:{eq:f,neq:e}},messages:{info:"Show items with value that:",isTrue:"is true",isFalse:"is false",filter:"Filter",clear:"Clear",and:"And",or:"Or",selectValue:"-Select value-",operator:"Operator",value:"Value",cancel:"Cancel"},animations:{left:"slide",right:"slide:right"}}});s.plugin(g)}(window.kendo.jQuery);kendo_module({id:"panelbar",name:"PanelBar",category:"web",description:"The PanelBar widget displays hierarchical data as a multi-level expandable panel bar.",depends:["core"]}),function(n,t){function wt(t){t=n(t);t.children(r).children(".k-icon").remove();t.filter(":has(.k-panel),:has(.k-content)").children(".k-link:not(:has([class*=k-i-arrow]))").each(function(){var t=n(this),i=t.parent();t.append("<span class='k-icon "+(i.hasClass(w)?"k-i-arrow-n k-panelbar-collapse":"k-i-arrow-s k-panelbar-expand")+"'/>")})}function a(t){t=n(t);t.filter(".k-first:not(:first-child)").removeClass(ct);t.filter(".k-last:not(:last-child)").removeClass(ht);t.filter(":first-child").addClass(ct);t.filter(":last-child").addClass(ht)}var e=window.kendo,oi=e.ui,o=e.keys,i=n.extend,ot=n.each,s=e.template,nt=oi.Widget,si=/^(ul|a|div)$/i,h=".kendoPanelBar",bt="img",st="href",ht="k-last",tt="k-link",r="."+tt,kt="error",u=".k-item",b=".k-group:visible",dt="k-image",ct="k-first",lt="expand",at="select",it="k-content",gt="activate",rt="collapse",ni="mouseenter",hi="mouseleave",ti="contentLoad",w="k-state-active",v="> .k-panel",k="> .k-content",ii="k-state-focused",f="k-state-disabled",d="k-state-selected",ut="."+d,c="k-state-highlight",ft=u+":not(.k-state-disabled)",ri=ft+" > .k-link",ci=u+".k-state-disabled > .k-link",ui="> li > "+ut+", .k-panel > li > "+ut,fi="k-state-default",vt="aria-disabled",g="aria-expanded",yt="aria-hidden",et="aria-selected",y=":visible",li=":empty",ei="single",l={content:s("<div role='region' class='k-content'#= contentAttributes(data) #>#= content(item) #<\/div>"),group:s("<ul role='group' aria-hidden='true' class='#= groupCssClass(group) #'#= groupAttributes(group) #>#= renderItems(data) #<\/ul>"),itemWrapper:s("<#= tag(item) # class='#= textClass(item, group) #' #= contentUrl(item) ##= textAttributes(item) #>#= image(item) ##= sprite(item) ##= text(item) ##= arrow(data) #<\/#= tag(item) #>"),item:s("<li role='menuitem' #=aria(item)#class='#= wrapperCssClass(group, item) #'>#= itemWrapper(data) ## if (item.items) { ##= subGroup({ items: item.items, panelBar: panelBar, group: { expanded: item.expanded } }) ## } else if (item.content || item.contentUrl) { ##= renderContent(data) ## } #<\/li>"),image:s("<img class='k-image' alt='' src='#= imageUrl #' />"),arrow:s("<span class='#= arrowClass(item) #'><\/span>"),sprite:s("<span class='k-sprite #= spriteCssClass #'><\/span>"),empty:s("")},pt={aria:function(n){var t="";return(n.items||n.content||n.contentUrl)&&(t+=g+"='"+(n.expanded?"true":"false")+"' "),n.enabled===!1&&(t+=vt+"='true'"),t},wrapperCssClass:function(n,t){var i="k-item",r=t.index;return i+=t.enabled===!1?" "+f:t.expanded===!0?" "+w:" k-state-default",r===0&&(i+=" k-first"),r==n.length-1&&(i+=" k-last"),t.cssClass&&(i+=" "+t.cssClass),i},textClass:function(n,t){var i=tt;return t.firstLevel&&(i+=" k-header"),i},textAttributes:function(n){return n.url?" href='"+n.url+"'":""},arrowClass:function(n){return"k-icon"+(n.expanded?" k-i-arrow-n k-panelbar-collapse":" k-i-arrow-s k-panelbar-expand")},text:function(n){return n.encoded===!1?n.text:e.htmlEncode(n.text)},tag:function(n){return n.url||n.contentUrl?"a":"span"},groupAttributes:function(n){return n.expanded!==!0?" style='display:none'":""},groupCssClass:function(){return"k-group k-panel"},contentAttributes:function(n){return n.item.expanded!==!0?" style='display:none'":""},content:function(n){return n.content?n.content:n.contentUrl?"":" "},contentUrl:function(n){return n.contentUrl?'href="'+n.contentUrl+'"':""}},p=nt.extend({init:function(t,i){var r=this,u;nt.fn.init.call(r,t,i);t=r.wrapper=r.element.addClass("k-widget k-reset k-header k-panelbar");i=r.options;t[0].id&&(r._itemId=t[0].id+"_pb_active");r._tabindex();r._initData(i);r._updateClasses();r._animations(i);t.on("click"+h,ri,function(t){r._click(n(t.currentTarget))&&t.preventDefault()}).on(ni+h+" "+hi+h,ri,r._toggleHover).on("click"+h,ci,!1).on("keydown"+h,n.proxy(r._keydown,r)).on("focus"+h,function(){var n=r.select();r._current(n[0]?n:r._first())}).on("blur"+h,function(){r._current(null)}).attr("role","menu");u=t.find("li."+w+" > ."+it);u[0]&&r.expand(u.parent(),!1);e.notify(r)},events:[lt,rt,at,gt,kt,ti],options:{name:"PanelBar",animation:{expand:{effects:"expand:vertical",duration:200},collapse:{duration:200}},expandMode:"multiple"},destroy:function(){nt.fn.destroy.call(this);this.element.off(h);e.destroy(this.element)},_initData:function(n){var t=this;n.dataSource&&(t.element.empty(),t.append(n.dataSource,t.element))},setOptions:function(n){var t=this.options.animation;this._animations(n);n.animation=i(!0,t,n.animation);"dataSource"in n&&this._initData(n);nt.fn.setOptions.call(this,n)},expand:function(t,i){var r=this,u={};return i=i!==!1,t=this.element.find(t),t.each(function(e,o){o=n(o);var s=o.find(v).add(o.find(k));if(!o.hasClass(f)&&s.length>0){if(r.options.expandMode==ei&&r._collapseAllExpanded(o))return r;t.find("."+c).removeClass(c);o.addClass(c);i||(u=r.options.animation,r.options.animation={expand:{effects:{}},collapse:{hide:!0,effects:{}}});r._triggerEvent(lt,o)||r._toggleItem(o,!1);i||(r.options.animation=u)}}),r},collapse:function(t,i){var r=this,u={};return i=i!==!1,t=r.element.find(t),t.each(function(t,e){e=n(e);var o=e.find(v).add(e.find(k));!e.hasClass(f)&&o.is(y)&&(e.removeClass(c),i||(u=r.options.animation,r.options.animation={expand:{effects:{}},collapse:{hide:!0,effects:{}}}),r._triggerEvent(rt,e)||r._toggleItem(e,!0),i||(r.options.animation=u))}),r},_toggleDisabled:function(n,t){n=this.element.find(n);n.toggleClass(fi,t).toggleClass(f,!t).attr(vt,!t)},select:function(i){var u=this;return i===t?u.element.find(ui).parent():(u.element.find(i).each(function(){var t=n(this),i=t.children(r);if(t.hasClass(f))return u;u._triggerEvent(at,t)||u._updateSelected(i)}),u)},enable:function(n,t){return this._toggleDisabled(n,t!==!1),this},disable:function(n){return this._toggleDisabled(n,!1),this},append:function(n,t){t=this.element.find(t);var i=this._insert(n,t,t.length?t.find(v):null);return ot(i.items,function(){i.group.append(this);a(this)}),wt(t),a(i.group.find(".k-first, .k-last")),i.group.height("auto"),this},insertBefore:function(n,t){t=this.element.find(t);var i=this._insert(n,t,t.parent());return ot(i.items,function(){t.before(this);a(this)}),a(t),i.group.height("auto"),this},insertAfter:function(n,t){t=this.element.find(t);var i=this._insert(n,t,t.parent());return ot(i.items,function(){t.after(this);a(this)}),a(t),i.group.height("auto"),this},remove:function(n){n=this.element.find(n);var r=this,t=n.parentsUntil(r.element,u),i=n.parent("ul");return n.remove(),!i||i.hasClass("k-panelbar")||i.children(u).length||i.remove(),t.length&&(t=t.eq(0),wt(t),a(t)),r},reload:function(t){var i=this;t=i.element.find(t);t.each(function(){var t=n(this);i._ajaxRequest(t,t.children("."+it),!t.is(y))})},_first:function(){return this.element.children(ft).first()},_last:function(){var n=this.element.children(ft).last(),t=n.children(b);return t[0]?t.children(ft).last():n},_current:function(n){var i=this,u=i._focused,f=i._itemId;if(n===t)return u;i.element.removeAttr("aria-activedescendant");u&&(u[0].id===f&&u.removeAttr("id"),u.children(r).removeClass(ii));n&&(f=n[0].id||f,n.attr("id",f).children(r).addClass(ii),i.element.attr("aria-activedescendant",f));i._focused=n},_keydown:function(n){var t=this,i=n.keyCode,u=t._current();n.target==n.currentTarget&&(i==o.DOWN||i==o.RIGHT?(t._current(t._nextItem(u)),n.preventDefault()):i==o.UP||i==o.LEFT?(t._current(t._prevItem(u)),n.preventDefault()):i==o.ENTER||i==o.SPACEBAR?(t._click(u.children(r)),n.preventDefault()):i==o.HOME?(t._current(t._first()),n.preventDefault()):i==o.END&&(t._current(t._last()),n.preventDefault()))},_nextItem:function(n){if(!n)return this._first();var i=n.children(b),t=n.next();return i[0]&&(t=i.children("."+ct)),t[0]||(t=n.parent(b).parent(u).next()),t[0]&&t.is(":visible")||(t=this._first()),t.hasClass(f)&&(t=this._nextItem(t)),t},_prevItem:function(n){if(!n)return this._last();var t=n.prev(),i;if(t[0])for(i=t;i[0];)i=i.children(b).children("."+ht),i[0]&&(t=i);else t=n.parent(b).parent(u),t[0]||(t=this._last());return t.hasClass(f)&&(t=this._prevItem(t)),t},_insert:function(t,r,u){var s=this,f,h=n.isPlainObject(t),e=r&&r[0],o;return e||(u=s.element),o={firstLevel:u.hasClass("k-panelbar"),expanded:u.parent().hasClass(w),length:u.children().length},e&&!u.length&&(u=n(p.renderGroup({group:o})).appendTo(r)),h||n.isArray(t)?(f=n.map(h?[t]:t,function(t,r){return typeof t=="string"?n(t):n(p.renderItem({group:o,item:i(t,{index:r})}))}),e&&r.attr(g,!1)):(f=n(t),s._updateItemsClasses(f)),{items:f,group:u}},_toggleHover:function(t){var i=n(t.currentTarget);i.parents("li."+f).length||i.toggleClass("k-state-hover",t.type==ni)},_updateClasses:function(){var i=this,r,t;r=i.element.find("li > ul").not(function(){return n(this).parentsUntil(".k-panelbar","div").length}).addClass("k-group k-panel").attr("role","group");r.parent().attr(g,!1).not("."+w).children("ul").attr(yt,!0).hide();t=i.element.add(r).children();i._updateItemsClasses(t);wt(t);a(t)},_updateItemsClasses:function(n){for(var i=n.length,t=0;t<i;t++)this._updateItemClasses(n[t],t)},_updateItemClasses:function(t,i){var s=this._selected,f=this.options.contentUrls,h=f&&f[i],c=this.element[0],o,u;t=n(t).addClass("k-item").attr("role","menuitem");e.support.browser.msie&&t.css("list-style-position","inside").css("list-style-position","");t.children(bt).addClass(dt);u=t.children("a").addClass(tt);u[0]&&(u.attr("href",h),u.children(bt).addClass(dt));t.filter(":not([disabled]):not([class*=k-state])").addClass("k-state-default");t.filter("li[disabled]").addClass("k-state-disabled").attr(vt,!0).removeAttr("disabled");t.children("div").addClass(it).attr("role","region").attr(yt,!0).hide().parent().attr(g,!1);u=t.children(ut);u[0]&&(s&&s.removeAttr(et).children(ut).removeClass(d),u.addClass(d),this._selected=t.attr(et,!0));t.children(r)[0]||(o="<span class='"+tt+"'/>",f&&f[i]&&t[0].parentNode==c&&(o='<a class="k-link k-header" href="'+f[i]+'"/>'),t.contents().filter(function(){return!this.nodeName.match(si)&&!(this.nodeType==3&&!n.trim(this.nodeValue))}).wrapAll(o));t.parent(".k-panelbar")[0]&&t.children(r).addClass("k-header")},_click:function(n){var t=this,a=t.element,i,o,s,l,h,e,c;if(!n.parents("li."+f).length)return n.closest(".k-widget")[0]!=a[0]?void 0:(h=n.closest(r),e=h.closest(u),t._updateSelected(h),o=e.find(v).add(e.find(k)),s=h.attr(st),l=s&&(s.charAt(s.length-1)=="#"||s.indexOf("#"+t.element[0].id+"-")!=-1),i=!!(l||o.length),o.data("animating"))?i:(t._triggerEvent(at,e)&&(i=!0),i===!1)?void 0:t.options.expandMode==ei&&t._collapseAllExpanded(e)?i:(o.length&&(c=o.is(y),t._triggerEvent(c?rt:lt,e)||(i=t._toggleItem(e,c))),i)},_toggleItem:function(n,i){var e=this,o=n.find(v),s=n.find(r),h=s.attr(st),f,u;return o.length?(this._toggleGroup(o,i),f=!0):(u=n.children("."+it),u.length&&(f=!0,u.is(li)&&h!==t?e._ajaxRequest(n,u,i):e._toggleGroup(u,i))),f},_toggleGroup:function(n,t){var e=this,o=e.options.animation,r=o.expand,f=i({},o.collapse),s=f&&"effects"in f;n.is(y)==t&&(n.parent().attr(g,!t).attr(yt,t).toggleClass(fi,t).toggleClass(w,!t).find("> .k-link > .k-icon").toggleClass("k-i-arrow-n",!t).toggleClass("k-panelbar-collapse",!t).toggleClass("k-i-arrow-s",t).toggleClass("k-panelbar-expand",t),r=t?i(s?f:i({reverse:!0},r),{hide:!0}):i({complete:function(n){e._triggerEvent(gt,n.closest(u))}},r),n.kendoStop(!0,!0).kendoAnimate(r))},_collapseAllExpanded:function(t){var e=this,o,i=!1,f;if(t.children(r).hasClass("k-header"))return f=t.find(v).add(t.find(k)),f.is(y)&&(i=!0),f.is(y)||f.length===0||(o=n(e.element).children(),o.find(v).add(o.find(k)).filter(function(){return n(this).is(y)}).each(function(t,r){r=n(r);i=e._triggerEvent(rt,r.closest(u));i||e._toggleGroup(r,!0)})),i},_ajaxRequest:function(t,i,u){var f=this,e=t.find(".k-panelbar-collapse, .k-panelbar-expand"),s=t.find(r),h=setTimeout(function(){e.addClass("k-loading")},100),o=s.attr(st);n.ajax({type:"GET",cache:!1,url:o,dataType:"html",data:{},error:function(n,t){e.removeClass("k-loading");f.trigger(kt,{xhr:n,status:t})&&this.complete()},complete:function(){clearTimeout(h);e.removeClass("k-loading")},success:function(n){try{i.html(n)}catch(e){var r=window.console;r&&r.error&&r.error(e.name+": "+e.message+" in "+o);this.error(this.xhr,"error")}f._toggleGroup(i,u);f.trigger(ti,{item:t[0],contentElement:i[0]})}})},_triggerEvent:function(n,t){var i=this;return i.trigger(n,{item:t[0]})},_updateSelected:function(n){var t=this,i=t.element,r=n.parent(u),f=t._selected;f&&f.removeAttr(et);t._selected=r.attr(et,!0);i.find(ui).removeClass(d);i.find("> ."+c+", .k-panel > ."+c).removeClass(c);n.addClass(d);n.parentsUntil(i,u).filter(":has(.k-header)").addClass(c);t._current(r)},_animations:function(n){n&&"animation"in n&&!n.animation&&(n.animation={expand:{effects:{}},collapse:{hide:!0,effects:{}}})}});i(p,{renderItem:function(n){n=i({panelBar:{},group:{}},n);var r=l.empty,t=n.item;return l.item(i(n,{image:t.imageUrl?l.image:r,sprite:t.spriteCssClass?l.sprite:r,itemWrapper:l.itemWrapper,renderContent:p.renderContent,arrow:t.items||t.content||t.contentUrl?l.arrow:r,subGroup:p.renderGroup},pt))},renderGroup:function(n){return l.group(i({renderItems:function(n){for(var u="",t=0,r=n.items,f=r?r.length:0,e=i({length:f},n.group);t<f;t++)u+=p.renderItem(i(n,{group:e,item:i({index:t},r[t])}));return u}},n,pt))},renderContent:function(n){return l.content(i(n,pt))}});e.ui.plugin(p)}(window.kendo.jQuery);kendo_module({id:"timepicker",name:"TimePicker",category:"web",description:"The TimePicker widget allows the end user to select a value from a list of predefined values or to type a new value.",depends:["popup"]}),function(n,t){function ui(n,t,i){var u=n.getTimezoneOffset(),r;n.setTime(n.getTime()+t);i||(r=n.getTimezoneOffset()-u,n.setTime(n.getTime()+r*h))}function fi(){var n=new u,t=new u(n.getFullYear(),n.getMonth(),n.getDate(),0,0,0),i=new u(n.getFullYear(),n.getMonth(),n.getDate(),12,0,0);return-1*(t.getTimezoneOffset()-i.getTimezoneOffset())}function e(n){return n.getHours()*60*h+n.getMinutes()*h+n.getSeconds()*1e3+n.getMilliseconds()}function kt(n,t,i){var u=e(t),f=e(i),r;return!n||u==f?!0:(r=e(n),u>r&&(r+=s),f<u&&(f+=s),r>=u&&r<=f)}function gt(n){var t=n.parseFormats;n.format=ii(n.format||r.getCulture(n.culture).calendars.standard.patterns.t);t=bt(t)?t:[t];t.splice(0,0,n.format);n.parseFormats=t}function ni(n){n.preventDefault()}var r=window.kendo,o=r.keys,ti=r._activeElement,ii=r._extractFormat,l=r.support,tt=l.browser,p=r.ui,a=p.Widget,it="open",rt="close",w="change",i=".kendoTimePicker",ut="click"+i,b="k-state-default",ft="disabled",et="readonly",k="li",ot="<span/>",st="k-state-focused",d="k-state-hover",ri="mouseenter"+i+" mouseleave"+i,ht="mousedown"+i,h=6e4,s=864e5,ct="k-state-selected",g="k-state-disabled",lt="aria-selected",at="aria-expanded",vt="aria-hidden",yt="aria-disabled",pt="aria-readonly",wt="aria-activedescendant",v="id",bt=n.isArray,nt=n.extend,y=n.proxy,u=Date,f=new u,c,dt;f=new u(f.getFullYear(),f.getMonth(),f.getDate(),0,0,0);c=function(t){var u=this,f=t.id;u.options=t;u.ul=n('<ul tabindex="-1" role="listbox" aria-hidden="true" unselectable="on" class="k-list k-reset"/>').css({overflow:l.kineticScrollNeeded?"":"auto"}).on(ut,k,y(u._click,u)).on("mouseenter"+i,k,function(){n(this).addClass(d)}).on("mouseleave"+i,k,function(){n(this).removeClass(d)});u.list=n("<div class='k-list-container'/>").append(u.ul).on(ht,ni);f&&(u._timeViewID=f+"_timeview",u._optionID=f+"_option_selected",u.ul.attr(v,u._timeViewID));u._popup();u.template=r.template('<li tabindex="-1" role="option" class="k-item" unselectable="on">#=data#<\/li>',{useWithBlock:!1})};c.prototype={current:function(i){var r=this,u=r.options.active;if(i!==t)r._current&&r._current.removeClass(ct).removeAttr(lt).removeAttr(v),i&&(i=n(i).addClass(ct).attr(v,r._optionID).attr(lt,!0),r.scroll(i[0])),r._current=i,u&&u(i);else return r._current},close:function(){this.popup.close()},destroy:function(){var n=this;n.ul.off(i);n.list.off(i);n._touchScroller&&n._touchScroller.destroy();n.popup.destroy()},open:function(){var n=this;n.ul[0].firstChild||n.bind();n.popup.open();n._current&&n.scroll(n._current[0])},dataBind:function(n){for(var i=this,t=i.options,s=t.format,h=r.toString,c=i.template,e=n.length,u=0,f,o="";u<e;u++)f=n[u],kt(f,t.min,t.max)&&(o+=c(h(f,s,t.culture)));i._html(o,e)},refresh:function(){var l=this,i=l.options,g=i.format,y=fi(),p=y<0,w=i.min,b=i.max,a=e(w),n=e(b),o=i.interval*h,nt=r.toString,tt=l.template,t=new u(+w),it=t.getDate(),v,k,c=0,f,d="";for(f=p?(s+y*h)/o:s/o,a!=n&&(a>n&&(n+=s),f=(n-a)/o+1),k=parseInt(f,10);c<f;c++)c&&ui(t,o,p),n&&k==c&&(v=e(t),it<t.getDate()&&(v+=s),v>n&&(t=new u(+b))),d+=tt(nt(t,g,i.culture));l._html(d,f)},bind:function(){var n=this,t=n.options.dates;t&&t[0]?n.dataBind(t):n.refresh()},_html:function(n,t){var i=this;i.ul[0].innerHTML=n;i._height(t);i.current(null);i.select(i._value)},scroll:function(n){if(n){var i=this.ul[0],t=n.offsetTop,f=n.offsetHeight,r=i.scrollTop,e=i.clientHeight,o=t+f,s=this._touchScroller,u;s?(u=this.list.height(),t>u&&(t=t-u+f),s.scrollTo(0,-t)):i.scrollTop=r>t?t:o>r+e?o-e:r}},select:function(t){var i=this,f=i.options,u=i._current;t instanceof Date&&(t=r.toString(t,f.format,f.culture));typeof t=="string"&&(u&&u.text()===t?t=u:(t=n.grep(i.ul[0].childNodes,function(n){return(n.textContent||n.innerText)==t}),t=t[0]?t:null));i.current(t)},setOptions:function(n){var t=this.options;this.options=nt(t,n,{active:t.active,change:t.change,close:t.close,open:t.open});this.bind()},toggle:function(){var n=this;n.popup.visible()?n.close():n.open()},value:function(n){var t=this;t._value=n;t.ul[0].firstChild&&t.select(n)},_click:function(t){var i=this,r=n(t.currentTarget);t.isDefaultPrevented()||(i.select(r),i.options.change(r.text(),!0),i.close())},_height:function(n){if(n){var t=this,i=t.list,u=i.parent(".k-animation-container"),r=t.options.height;i.add(u).show().height(t.ul[0].scrollHeight>r?r:"auto").hide()}},_parse:function(n){var o=this,s=o.options,t=o._value||f,i,e;return n instanceof u?n:(n!=null&&(i=n.indexOf(":"),i==-1?n=n.length<=2?n+":00":n.slice(2).length==1?n.slice(0,2)+":"+n.slice(2)+"0":n.slice(0,2)+":"+n.slice(2):i==0?n="00"+n:(e=n.split(":"),e[1].length==0?n=n+"00":e[1].length==1&&(n=n+"0"))),n=r.parseDate(n,s.parseFormats,s.culture),n&&(n=new u(t.getFullYear(),t.getMonth(),t.getDate(),n.getHours(),n.getMinutes(),n.getSeconds(),n.getMilliseconds())),n)},_adjustListWidth:function(){var t=this.list,i=t[0].style.width,r=this.options.anchor,n,u;(t.data("width")||!i)&&(n=window.getComputedStyle?window.getComputedStyle(r[0],null):0,u=n?parseFloat(n.width):r.outerWidth(),n&&(tt.mozilla||tt.msie)&&(u+=parseFloat(n.paddingLeft)+parseFloat(n.paddingRight)+parseFloat(n.borderLeftWidth)+parseFloat(n.borderRightWidth)),i=u-(t.outerWidth()-t.width()),t.css({fontFamily:r.css("font-family"),width:i}).data("width",i))},_popup:function(){var t=this,i=t.list,n=t.options,u=n.anchor;t.popup=new p.Popup(i,nt(n.popup,{anchor:u,open:n.open,close:n.close,animation:n.animation,isRtl:l.isRtl(n.anchor)}));t._touchScroller=r.touchScroller(t.popup.element)},move:function(n){var i=this,r=n.keyCode,f=i.ul[0],t=i._current,u=r===o.DOWN;if(r===o.UP||u){if(n.altKey){i.toggle(u);return}t=u?t?t[0].nextSibling:f.firstChild:t?t[0].previousSibling:f.lastChild;t&&i.select(t);i.options.change(i._current.text());n.preventDefault()}else(r===o.ENTER||r===o.TAB||r===o.ESC)&&(n.preventDefault(),t&&i.options.change(t.text(),!0),i.close())}};c.getMilliseconds=e;r.TimeView=c;dt=a.extend({init:function(n,t){var i=this,f,u,e;a.fn.init.call(i,n,t);n=i.element;t=i.options;gt(t);i._wrapper();i.timeView=u=new c(nt({},t,{id:n.attr(v),anchor:i.wrapper,format:t.format,change:function(t,r){r?i._change(t):n.val(t)},open:function(t){i.timeView._adjustListWidth();i.trigger(it)?t.preventDefault():(n.attr(at,!0),f.attr(vt,!1))},close:function(t){i.trigger(rt)?t.preventDefault():(n.attr(at,!1),f.attr(vt,!0))},active:function(t){n.removeAttr(wt);t&&n.attr(wt,u._optionID)}}));f=u.ul;i._icon();i._reset();try{n[0].setAttribute("type","text")}catch(o){n[0].type="text"}n.addClass("k-input").attr({role:"combobox","aria-expanded":!1,"aria-owns":u._timeViewID});e=n.is("[disabled]");e?i.enable(!1):i.readonly(n.is("[readonly]"));i._old=i._update(t.value||i.element.val());i._oldText=n.val();r.notify(i)},options:{name:"TimePicker",min:f,max:f,format:"",dates:[],parseFormats:[],value:null,interval:30,height:200,animation:{}},events:[it,rt,w],setOptions:function(n){var t=this,i=t._value;a.fn.setOptions.call(t,n);n=t.options;gt(n);t.timeView.setOptions(n);i&&t.element.val(r.toString(i,n.format,n.culture))},dataBind:function(n){bt(n)&&this.timeView.dataBind(n)},_editable:function(n){var t=this,r=n.disable,u=n.readonly,o=t._arrow.off(i),f=t.element.off(i),e=t._inputWrapper.off(i);if(u||r)e.addClass(r?g:b).removeClass(r?b:g),f.attr(ft,r).attr(et,u).attr(yt,r).attr(pt,u);else{e.addClass(b).removeClass(g).on(ri,t._toggleHover);f.removeAttr(ft).removeAttr(et).attr(yt,!1).attr(pt,!1).on("keydown"+i,y(t._keydown,t)).on("blur"+i,y(t._blur,t)).on("focus"+i,function(){t._inputWrapper.addClass(st)});o.on(ut,y(t._click,t)).on(ht,ni)}},readonly:function(n){this._editable({readonly:n===t?!0:n,disable:!1})},enable:function(n){this._editable({readonly:!1,disable:!(n=n===t?!0:n)})},destroy:function(){var n=this;a.fn.destroy.call(n);n.timeView.destroy();n.element.off(i);n._arrow.off(i);n._inputWrapper.off(i);n._form&&n._form.off("reset",n._resetHandler)},close:function(){this.timeView.close()},open:function(){this.timeView.open()},min:function(n){return this._option("min",n)},max:function(n){return this._option("max",n)},value:function(n){var i=this;if(n===t)return i._value;i._old=i._update(n);i._old===null&&i.element.val("");i._oldText=i.element.val()},_blur:function(){var n=this,t=n.element.val();n.close();t!==n._oldText&&n._change(t);n._inputWrapper.removeClass(st)},_click:function(){var n=this,t=n.element;n.timeView.toggle();l.touch||t[0]===ti()||t.focus()},_change:function(n){var t=this;n=t._update(n);+t._old!=+n&&(t._old=n,t._oldText=t.element.val(),t.trigger(w),t.element.trigger(w))},_icon:function(){var i=this,r=i.element,t;t=r.next("span.k-select");t[0]||(t=n('<span unselectable="on" class="k-select"><span unselectable="on" class="k-icon k-i-clock">select<\/span><\/span>').insertAfter(r));i._arrow=t.attr({role:"button","aria-controls":i.timeView._timeViewID})},_keydown:function(n){var t=this,u=n.keyCode,i=t.timeView,r=t.element.val();i.popup.visible()||n.altKey?i.move(n):u===o.ENTER&&r!==t._oldText&&t._change(r)},_option:function(n,i){var r=this,f=r.options;if(i===t)return f[n];(i=r.timeView._parse(i),i)&&(i=new u(+i),f[n]=i,r.timeView.options[n]=i,r.timeView.bind())},_toggleHover:function(t){n(t.currentTarget).toggleClass(d,t.type==="mouseenter")},_update:function(n){var i=this,u=i.options,f=i.timeView,t=f._parse(n);return kt(t,u.min,u.max)||(t=null),i._value=t,i.element.val(t?r.toString(t,u.format,u.culture):n),f.value(t),t},_wrapper:function(){var r=this,i=r.element,t;t=i.parents(".k-timepicker");t[0]||(t=i.wrap(ot).parent().addClass("k-picker-wrap k-state-default"),t=t.wrap(ot).parent());t[0].style.cssText=i[0].style.cssText;r.wrapper=t.addClass("k-widget k-timepicker k-header").addClass(i[0].className);i.css({width:"100%",height:i[0].style.height});r._inputWrapper=n(t[0].firstChild)},_reset:function(){var t=this,i=t.element,r=i.attr("form"),u=r?n("#"+r):i.closest("form");u[0]&&(t._resetHandler=function(){t.value(i[0].defaultValue)},t._form=u.on("reset",t._resetHandler))}});p.plugin(dt)}(window.kendo.jQuery);kendo_module({id:"window",name:"Window",category:"web",description:"The Window widget displays content in a modal or non-modal HTML window.",depends:["draganddrop"]}),function(n,t){function rt(n){return typeof n!="undefined"}function o(n,t,i){return Math.max(Math.min(parseInt(n,10),i===Infinity?i:parseInt(i,10)),parseInt(t,10))}function ii(n,t){return function(){var i=this,r=i.wrapper,f=r[0].style,o=i.options;if(!o.isMaximized&&!o.isMinimized)return i.restoreOptions={width:f.width,height:f.height},r.children(h).hide().end().children(e).find(gt).parent().hide().eq(0).before(u.action({name:"Restore"})),t.call(i),n=="maximize"?i.wrapper.children(e).find(st).parent().hide():i.wrapper.children(e).find(st).parent().show(),i}}function ri(n){var t=this;t.owner=n;t._draggable=new ht(n.wrapper,{filter:h,group:n.wrapper.id+"-resizing",dragstart:f(t.dragstart,t),drag:f(t.drag,t),dragend:f(t.dragend,t)})}function ui(n,t){var i=this;i.owner=n;i._draggable=new ht(n.wrapper,{filter:t,group:n.wrapper.id+"-moving",dragstart:f(i.dragstart,i),drag:f(i.drag,i),dragend:f(i.dragend,i),dragcancel:f(i.dragcancel,i)});i._draggable.userEvents.stopPropagation=!1}var i=window.kendo,d=i.ui.Widget,ht=i.ui.Draggable,ct=n.isPlainObject,fi=i._activeElement,f=n.proxy,l=n.extend,ut=n.each,s=i.template,g="body",u,r=".kendoWindow",a=".k-window",ft=".k-window-title",e=ft+"bar",v=".k-window-content",h=".k-resize-handle",nt=".k-overlay",w="k-content-frame",lt="k-loading",at="k-state-hover",vt="k-state-focused",yt="k-window-maximized",y=":visible",tt="hidden",p="cursor",et="open",ot="activate",pt="deactivate",wt="close",it="refresh",bt="dragstart",kt="dragend",dt="error",c="overflow",b="zIndex",gt=".k-window-actions .k-i-minimize,.k-window-actions .k-i-maximize",ni=".k-i-pin",ti=".k-i-unpin",st=ni+","+ti,k=".k-window-titlebar .k-window-action",ei=i.isLocalUrl,oi=d.extend({init:function(u,o){var s=this,h,w={},g,nt,c,it=!1,l,b,ut=o&&o.actions&&!o.actions.length,p;d.fn.init.call(s,u,o);o=s.options;c=o.position;u=s.element;l=o.content;ut&&(o.actions=[]);s.appendTo=n(o.appendTo);s._animations();l&&!ct(l)&&(l=o.content={url:l});u.find("script").filter(function(){return!this.type||this.type.toLowerCase().indexOf("script")>=0}).remove();u.parent().is(s.appendTo)||c.top!==t&&c.left!==t||(u.is(y)?(w=u.offset(),it=!0):(g=u.css("visibility"),nt=u.css("display"),u.css({visibility:tt,display:""}),w=u.offset(),u.css({visibility:g,display:nt})),c.top===t&&(c.top=w.top),c.left===t&&(c.left=w.left));rt(o.visible)&&o.visible!==null||(o.visible=u.is(y));h=s.wrapper=u.closest(a);u.is(".k-content")&&h[0]||(u.addClass("k-window-content k-content"),s._createWindow(u,o),h=s.wrapper=u.closest(a),s._dimensions());s._position();o.pinned&&s.pin(!0);l&&s.refresh(l);o.visible&&s.toFront();b=h.children(v);s._tabindex(b);o.visible&&o.modal&&s._overlay(h.is(y)).css({opacity:.5});h.on("mouseenter"+r,k,function(){n(this).addClass(at)}).on("mouseleave"+r,k,function(){n(this).removeClass(at)}).on("click"+r,"> "+k,f(s._windowActionHandler,s));b.on("keydown"+r,f(s._keydown,s)).on("focus"+r,function(){h.addClass(vt)}).on("blur"+r,function(){h.removeClass(vt)});this._resizable();this._draggable();p=u.attr("id");p&&(p=p+"_wnd_title",h.children(e).children(ft).attr("id",p),b.attr({role:"dialog","aria-labelledby":p}));h.add(h.children(".k-resize-handle,"+e)).on("mousedown"+r,f(s.toFront,s));s.touchScroller=i.touchScroller(u);s._resizeHandler=function(n){return s._onDocumentResize(n)};n(window).on("resize",s._resizeHandler);o.visible&&(s.trigger(et),s.trigger(ot));i.notify(s)},_dimensions:function(){var i=this,t=i.wrapper,n=i.options,r=n.width,u=n.height,f=n.maxHeight;i.title(n.title);ut(["minWidth","minHeight","maxWidth","maxHeight"],function(i,r){var u=n[r];u&&u!=Infinity&&t.css(r,u)});f&&f!=Infinity&&i.element.css("maxHeight",f);r&&(r.toString().indexOf("%")>0?t.width(r):t.width(o(r,n.minWidth,n.maxWidth)));u&&(u.toString().indexOf("%")>0?t.height(u):t.height(o(u,n.minHeight,n.maxHeight)));n.visible||t.hide()},_position:function(){var t=this,i=t.wrapper,n=t.options.position;n.top===0&&(n.top=n.top.toString());n.left===0&&(n.left=n.left.toString());i.css({top:n.top||"",left:n.left||""})},_animations:function(){var n=this.options;n.animation===!1&&(n.animation={open:{effects:{}},close:{hide:!0,effects:{}}})},_resize:function(){i.resize(this.element.children())},_resizable:function(){var i=this.options.resizable,t=this.wrapper;if(this.resizing&&(t.off("dblclick"+r).children(h).remove(),this.resizing.destroy(),this.resizing=null),i){t.on("dblclick"+r,e,f(function(t){n(t.target).closest(".k-window-action").length||this.toggleMaximization()},this));ut("n e s w se sw ne nw".split(" "),function(n,i){t.append(u.resizeHandle(i))});this.resizing=new ri(this)}},_draggable:function(){var n=this.options.draggable;this.dragging&&(this.dragging.destroy(),this.dragging=null);n&&(this.dragging=new ui(this,n.dragHandle||e))},setOptions:function(n){var t=this;d.fn.setOptions.call(t,n);t._animations();t._dimensions();t._position();t._resizable();t._draggable()},events:[et,ot,pt,wt,it,"resize",bt,kt,dt],options:{name:"Window",animation:{open:{effects:{zoom:{direction:"in"},fade:{direction:"in"}},duration:350},close:{effects:{zoom:{direction:"out",properties:{scale:.7}},fade:{direction:"out"}},duration:350,hide:!0}},title:"",actions:["Close"],autoFocus:!0,modal:!1,resizable:!0,draggable:!0,minWidth:90,minHeight:50,maxWidth:Infinity,maxHeight:Infinity,pinned:!1,position:{},content:null,visible:null,height:null,width:null,appendTo:"body"},_closable:function(){return n.inArray("close",n.map(this.options.actions,function(n){return n.toLowerCase()}))>-1},_keydown:function(n){var u=this,h=u.options,f=i.keys,e=n.keyCode,t=u.wrapper,c,r,s=10,p=u.options.isMaximized,v,y,l,a;n.target!=n.currentTarget||u._closing||(e==f.ESC&&u._closable()&&u._close(!0),!h.draggable||n.ctrlKey||p||(c=i.getOffset(t),e==f.UP?r=t.css("top",c.top-s):e==f.DOWN?r=t.css("top",c.top+s):e==f.LEFT?r=t.css("left",c.left-s):e==f.RIGHT&&(r=t.css("left",c.left+s))),h.resizable&&n.ctrlKey&&!p&&(e==f.UP?(r=!0,y=t.height()-s):e==f.DOWN&&(r=!0,y=t.height()+s),e==f.LEFT?(r=!0,v=t.width()-s):e==f.RIGHT&&(r=!0,v=t.width()+s),r&&(l=o(v,h.minWidth,h.maxWidth),a=o(y,h.minHeight,h.maxHeight),isNaN(l)||(t.width(l),u.options.width=l+"px"),isNaN(a)||(t.height(a),u.options.height=a+"px"),u.resize())),r&&n.preventDefault())},_overlay:function(t){var i=this.appendTo.children(nt),r=this.wrapper;return i.length||(i=n("<div class='k-overlay' />")),i.insertBefore(r[0]).toggle(t).css(b,parseInt(r.css(b),10)-1),i},_windowActionHandler:function(t){var r=n(t.target).closest(".k-window-action").find(".k-icon"),i=this;i._closing||ut({"k-i-close":function(){i._close(!0)},"k-i-maximize":i.maximize,"k-i-minimize":i.minimize,"k-i-restore":i.restore,"k-i-refresh":i.refresh,"k-i-pin":i.pin,"k-i-unpin":i.unpin},function(n,u){if(r.hasClass(n))return t.preventDefault(),u.call(i),!1})},_modals:function(){var t=this;return n(a).filter(function(){var i=n(this),r=t._object(i).options;return r.modal&&r.visible&&i.is(y)}).sort(function(t,i){return+n(t).css("zIndex")-+n(i).css("zIndex")})},_object:function(n){var t=n.children(v);return t.data("kendoWindow")||t.data("kendo"+this.options.name)},center:function(){var t=this,e=t.options.position,r=t.wrapper,i=n(window),o=0,s=0,u,f;return t.options.isMaximized?t:(t.options.pinned||(o=i.scrollTop(),s=i.scrollLeft()),f=s+Math.max(0,(i.width()-r.width())/2),u=o+Math.max(0,(i.height()-r.height())/2),r.css({left:f,top:u}),e.top=u,e.left=f,t)},title:function(n){var i=this,r=i.wrapper,s=i.options,t=r.children(e),f=t.children(ft),o=t.outerHeight();return arguments.length?(n===!1?(r.addClass("k-window-titleless"),t.remove()):(t.length||r.prepend(u.titlebar(l(u,s))),r.css("padding-top",o),t.css("margin-top",-o)),f.text(n),i.options.title=n,i):f.text()},content:function(n){var t=this.wrapper.children(v),r=t.children(".km-scroll-container");return(t=r[0]?r:t,!rt(n))?t.html():(i.destroy(this.element.children()),t.html(n),this)},open:function(){var t=this,f=t.wrapper,r=t.options,e=r.animation.open,s=f.children(v),h=s.css(c),u,o;return t.trigger(et)||(t._closing&&f.kendoStop(!0,!0),t._closing=!1,t.toFront(),r.autoFocus&&t.element.focus(),r.visible=!0,r.modal&&(u=t._overlay(!1),u.kendoStop(!0,!0),e.duration&&i.effects.Fade?(o=i.fx(u).fadeIn(),o.duration(e.duration||0),o.endValue(.5),o.play()):u.css("opacity",.5),u.show()),f.is(y)||(s.css(c,tt),f.show().kendoStop().kendoAnimate({effects:e.effects,duration:e.duration,complete:function(){r.autoFocus&&t.element.focus();t.trigger(ot);s.css(c,h)}}))),r.isMaximized&&(t._documentScrollTop=n(document).scrollTop(),n("html, body").css(c,tt)),t},_removeOverlay:function(r){var f=this._modals(),e=this.options,s=e.modal&&!f.length,h=e.modal?this._overlay(!0):n(t),o=e.animation.close,u;s?!r&&o.duration&&i.effects.Fade?(u=i.fx(h).fadeOut(),u.duration(o.duration||0),u.startValue(.5),u.play()):this._overlay(!1).remove():f.length&&this._object(f.last())._overlay(!0)},_close:function(t){var i=this,r=i.wrapper,u=i.options,e=u.animation.open,f=u.animation.close;r.is(y)&&!i.trigger(wt,{userTriggered:!!t})&&(i._closing=!0,u.visible=!1,n(a).each(function(t,i){var u=n(i).children(v);i!=r&&u.find("> ."+w).length>0&&u.children(nt).remove()}),this._removeOverlay(),r.kendoStop().kendoAnimate({effects:f.effects||e.effects,reverse:f.reverse===!0,duration:f.duration,complete:function(){r.hide().css("opacity","");i.trigger(pt);var n=i._object(i._modals().last());n&&n.toFront()}}));i.options.isMaximized&&(n("html, body").css(c,""),i._documentScrollTop&&i._documentScrollTop>0&&n(document).scrollTop(i._documentScrollTop))},close:function(){return this._close(!1),this},_actionable:function(t){return n(t).is(k+","+k+" .k-icon,:input,a")},_shouldFocus:function(t){var r=fi(),i=this.element;return this.options.autoFocus&&!n(r).is(i)&&!this._actionable(t)&&(!i.find(r).length||!i.find(t).length)},toFront:function(t){var r=this,i=r.wrapper,s=i[0],f=+i.css(b),h=f,c=t&&t.target||null,e,o;return n(a).each(function(t,i){var r=n(i),e=r.css(b),o=r.children(v);isNaN(e)||(f=Math.max(+e,f));i!=s&&o.find("> ."+w).length>0&&o.append(u.overlay)}),(!i[0].style.zIndex||h<f)&&i.css(b,f+2),r.element.find("> .k-overlay").remove(),r._shouldFocus(c)&&(r.element.focus(),e=n(window).scrollTop(),o=parseInt(i.position().top,10),o>0&&o<e&&(e>0?n(window).scrollTop(o):i.css("top",e))),r},toggleMaximization:function(){return this._closing?this:this[this.options.isMaximized?"restore":"maximize"]()},restore:function(){var t=this,i=t.options,u=i.minHeight,r=t.restoreOptions;return!i.isMaximized&&!i.isMinimized?t:(u&&u!=Infinity&&t.wrapper.css("min-height",u),t.wrapper.css({position:i.pinned?"fixed":"absolute",left:r.left,top:r.top,width:r.width,height:r.height}).removeClass(yt).find(".k-window-content,.k-resize-handle").show().end().find(".k-window-titlebar .k-i-restore").parent().remove().end().end().find(gt).parent().show().end().end().find(st).parent().show(),t.options.width=r.width,t.options.height=r.height,n("html, body").css(c,""),this._documentScrollTop&&this._documentScrollTop>0&&n(document).scrollTop(this._documentScrollTop),i.isMaximized=i.isMinimized=!1,t.resize(),t)},maximize:ii("maximize",function(){var t=this,i=t.wrapper,r=i.position();l(t.restoreOptions,{left:r.left,top:r.top});i.css({left:0,top:0,position:"fixed"}).addClass(yt);this._documentScrollTop=n(document).scrollTop();n("html, body").css(c,tt);t.options.isMaximized=!0;t._onDocumentResize()}),minimize:ii("minimize",function(){var n=this;n.wrapper.css({height:"",minHeight:""});n.element.hide();n.options.isMinimized=!0}),pin:function(t){var i=this,u=n(window),r=i.wrapper,f=parseInt(r.css("top"),10),o=parseInt(r.css("left"),10);!t&&(i.options.pinned||i.options.isMaximized)||(r.css({position:"fixed",top:f-u.scrollTop(),left:o-u.scrollLeft()}),r.children(e).find(ni).addClass("k-i-unpin").removeClass("k-i-pin"),i.options.pinned=!0)},unpin:function(){var t=this,r=n(window),i=t.wrapper,u=parseInt(i.css("top"),10),f=parseInt(i.css("left"),10);t.options.pinned&&!t.options.isMaximized&&(i.css({position:"",top:u+r.scrollTop(),left:f+r.scrollLeft()}),i.children(e).find(ti).addClass("k-i-pin").removeClass("k-i-unpin"),t.options.pinned=!1)},_onDocumentResize:function(){var t=this,u=t.wrapper,f=n(window),i,r;t.options.isMaximized&&(i=f.width(),r=f.height()-parseInt(u.css("padding-top"),10),u.css({width:i,height:r}),t.options.width=i,t.options.height=r,t.resize())},refresh:function(t){var i=this,e=i.options,o=n(i.element),h,f,c;if(ct(t)||(t={url:t}),t=l({},e.content,t),f=rt(e.iframe)?e.iframe:t.iframe,c=t.url,c)if(rt(f)||(f=!ei(c)),f){h=o.find("."+w)[0];h?h.src=c||h.src:o.html(u.contentFrame(l({},e,{content:t})));o.find("."+w).unbind("load"+r).on("load"+r,function(){i.trigger(it)})}else i._ajaxRequest(t);else t.template&&i.content(s(t.template)({})),i.trigger(it);return o.toggleClass("k-window-iframecontent",f),i},_ajaxRequest:function(t){var i=this,r=t.template,u=i.wrapper.find(".k-window-titlebar .k-i-refresh"),f=setTimeout(function(){u.addClass(lt)},100);n.ajax(l({type:"GET",dataType:"html",cache:!1,error:function(n,t){i.trigger(dt,{status:t,xhr:n})},complete:function(){clearTimeout(f);u.removeClass(lt)},success:function(n){r&&(n=s(r)(n||{}));i.content(n);i.element.prop("scrollTop",0);i.trigger(it)}},t))},destroy:function(){var t=this.wrapper;d.fn.destroy.call(this);i.destroy(t);this.resizing&&this.resizing.destroy();this.dragging&&this.dragging.destroy();this.element.children("iframe").remove();t.find(".k-resize-handle,.k-window-titlebar").off(r);t.remove().off(r);n(window).off("resize",this._resizeHandler);this._removeOverlay(!0)},_createWindow:function(){var e=this,t=e.element,f=e.options,o,r,s=i.support.isRtl(t);f.scrollable===!1&&t.attr("style","overflow:hidden;");r=n(u.wrapper(f));f.title!==!1&&r.append(u.titlebar(l(u,f)));o=t.find("iframe:not(.k-content)").map(function(){var n=this.getAttribute("src");return this.src="",n});r.toggleClass("k-rtl",s).appendTo(e.appendTo).append(t).find("iframe:not(.k-content)").each(function(n){this.src=o[n]});r.find(".k-window-title").css(s?"left":"right",r.find(".k-window-actions").outerWidth()+10);t.show();t.find("[data-role=editor]").each(function(){var t=n(this).data("kendoEditor");t&&t.refresh()})}});u={wrapper:s("<div class='k-widget k-window' />"),action:s("<a role='button' href='\\#' class='k-window-action k-link'><span role='presentation' class='k-icon k-i-#= name.toLowerCase() #'>#= name #<\/span><\/a>"),titlebar:s("<div class='k-window-titlebar k-header'> <span class='k-window-title'>#= title #<\/span><div class='k-window-actions'># for (var i = 0; i < actions.length; i++) { ##= action({ name: actions[i] }) ## } #<\/div><\/div>"),overlay:"<div class='k-overlay' />",contentFrame:s("<iframe frameborder='0' title='#= title #' class='"+w+"' src='#= content.url #'>This page requires frames in order to show content<\/iframe>"),resizeHandle:s("<div class='k-resize-handle k-resize-#= data #'><\/div>")};ri.prototype={dragstart:function(t){var r=this,e=r.owner,f=e.wrapper;r.elementPadding=parseInt(e.wrapper.css("padding-top"),10);r.initialCursorPosition=i.getOffset(f,"position");r.resizeDirection=t.currentTarget.prop("className").replace("k-resize-handle k-resize-","");r.initialSize={width:f.width(),height:f.height()};r.containerOffset=i.getOffset(e.appendTo);f.append(u.overlay).children(h).not(t.currentTarget).hide();n(g).css(p,t.currentTarget.css(p))},drag:function(n){var u=this,f=u.owner,e=f.wrapper,t=f.options,s=u.resizeDirection,h=u.containerOffset,c=u.initialCursorPosition,v=u.initialSize,i,r,l,a,y=Math.max(n.x.location,h.left),p=Math.max(n.y.location,h.top);s.indexOf("e")>=0?(i=y-c.left,e.width(o(i,t.minWidth,t.maxWidth))):s.indexOf("w")>=0&&(a=c.left+v.width,i=o(a-y,t.minWidth,t.maxWidth),e.css({left:a-i-h.left,width:i}));s.indexOf("s")>=0?(r=p-c.top-u.elementPadding,e.height(o(r,t.minHeight,t.maxHeight))):s.indexOf("n")>=0&&(l=c.top+v.height,r=o(l-p,t.minHeight,t.maxHeight),e.css({top:l-r-h.top,height:r}));i&&(f.options.width=i+"px");r&&(f.options.height=r+"px");f.resize()},dragend:function(t){var i=this,r=i.owner,u=r.wrapper;return u.find(nt).remove().end().children(h).not(t.currentTarget).show(),n(g).css(p,""),r.touchScroller&&r.touchScroller.reset(),t.keyCode==27&&u.css(i.initialCursorPosition).css(i.initialSize),!1},destroy:function(){this._draggable.destroy()}};ui.prototype={dragstart:function(t){var r=this.owner,f=r.element,e=f.find(".k-window-actions"),o=i.getOffset(r.appendTo);r.trigger(bt);r.initialWindowPosition=i.getOffset(r.wrapper,"position");r.startPosition={left:t.x.client-r.initialWindowPosition.left,top:t.y.client-r.initialWindowPosition.top};r.minLeftPosition=e.length>0?e.outerWidth()+parseInt(e.css("right"),10)-f.outerWidth():20-f.outerWidth();r.minLeftPosition-=o.left;r.minTopPosition=-o.top;r.wrapper.append(u.overlay).children(h).hide();n(g).css(p,t.currentTarget.css(p))},drag:function(t){var i=this.owner,r=i.options.position,u=Math.max(t.y.client-i.startPosition.top,i.minTopPosition),f=Math.max(t.x.client-i.startPosition.left,i.minLeftPosition),e={left:f,top:u};n(i.wrapper).css(e);r.top=u;r.left=f},_finishDrag:function(){var t=this.owner;t.wrapper.children(h).toggle(!t.options.isMinimized).end().find(nt).remove();n(g).css(p,"")},dragcancel:function(n){this._finishDrag();n.currentTarget.closest(a).css(this.owner.initialWindowPosition)},dragend:function(){return this._finishDrag(),this.owner.trigger(kt),!1},destroy:function(){this._draggable.destroy()}};i.ui.plugin(oi)}(window.kendo.jQuery);!function(n){return n(["./kendo.data.min","./kendo.combobox.min","./kendo.multiselect.min","./kendo.validator.min"],function(){!function(n,t){function u(t,i,r,u){var f={};return t.sort?(f[this.options.prefix+"sort"]=n.map(t.sort,function(n){return n.field+"-"+n.dir}).join("~"),delete t.sort):f[this.options.prefix+"sort"]="",t.page&&(f[this.options.prefix+"page"]=t.page,delete t.page),t.pageSize&&(f[this.options.prefix+"pageSize"]=t.pageSize,delete t.pageSize),t.group?(f[this.options.prefix+"group"]=n.map(t.group,function(n){return n.field+"-"+n.dir}).join("~"),delete t.group):f[this.options.prefix+"group"]="",t.aggregate&&(f[this.options.prefix+"aggregate"]=n.map(t.aggregate,function(n){return n.field+"-"+n.aggregate}).join("~"),delete t.aggregate),t.filter?(f[this.options.prefix+"filter"]=o(t.filter,r),delete t.filter):(f[this.options.prefix+"filter"]="",delete t.filter),delete t.take,delete t.skip,e(f,t,"",u),f}function c(n){var t=i.culture().numberFormat[h];return(""+n).replace(h,t)}function l(n,t){return n instanceof Date?n=t?i.stringify(n).replace(/"/g,""):i.format("{0:G}",n):"number"==typeof n&&(n=c(n)),n}function f(n,i,r,u,f,o){b(i)?a(n,i,f,o):k(i)?e(n,i,f,o):n[f]===t&&(n[f]=r[u]=l(i,o))}function e(n,t,i,r){var u,e,o;for(u in t)e=i?i+"."+u:u,o=t[u],f(n,o,t,u,e,r)}function a(n,t,i,r){for(var s,o,h,u=0,e=0;u<t.length;u++)s=t[u],o="["+e+"]",h=i+o,f(n,s,t,o,h,r),e++}function o(i,r){return i.filters?n.map(i.filters,function(n){var i=n.filters&&n.filters.length>1,t=o(n,r);return t&&i&&(t="("+t+")"),t}).join("~"+i.logic+"~"):i.field?i.field+"~"+i.operator+"~"+v(i.value,r):t}function v(n,t){if("string"==typeof n){if(!(n.indexOf("Date(")>-1))return n=n.replace(w,"''"),t&&(n=encodeURIComponent(n)),"'"+n+"'";n=new Date(parseInt(n.replace(/^\/Date\((.*?)\)\/$/,"$1"),10))}return n&&n.getTime?"datetime'"+i.format("{0:yyyy-MM-ddTHH-mm-ss}",n)+"'":n}function s(i){return{value:t!==i.Key?i.Key:i.value,field:i.Member||i.field,hasSubgroups:i.HasSubgroups||i.hasSubgroups||!1,aggregates:p(i.Aggregates||i.aggregates),items:i.HasSubgroups?n.map(i.Items||i.items,s):i.Items||i.items}}function y(n){var t={};return t[n.AggregateMethodName.toLowerCase()]=n.Value,t}function p(n){var t,i,r,u={};for(t in n){u={};r=n[t];for(i in r)u[i.toLowerCase()]=r[i];n[t]=u}return n}var i=window.kendo,w=/'/gi,r=n.extend,b=n.isArray,k=n.isPlainObject,h=".";r(!0,i.data,{schemas:{"aspnetmvc-ajax":{groups:function(t){return n.map(this.data(t),s)},aggregates:function(n){n=n.d||n;for(var t,u={},e=n.AggregateResults||[],i=0,f=e.length;f>i;i++)t=e[i],u[t.Member]=r(!0,u[t.Member],y(t));return u}}}});r(!0,i.data,{transports:{"aspnetmvc-ajax":i.data.RemoteTransport.extend({init:function(n){var t=this,f=(n||{}).stringifyDates;i.data.RemoteTransport.fn.init.call(this,r(!0,{},this.options,n,{parameterMap:function(n,i){return u.call(t,n,i,!1,f)}}))},read:function(n){var t=this.options.data,r=this.options.read.url;t?(r&&(this.options.data=null),!t.Data.length&&r?i.data.RemoteTransport.fn.read.call(this,n):n.success(t)):i.data.RemoteTransport.fn.read.call(this,n)},options:{read:{type:"POST"},update:{type:"POST"},create:{type:"POST"},destroy:{type:"POST"},parameterMap:u,prefix:""}})}});r(!0,i.data,{transports:{"aspnetmvc-server":i.data.RemoteTransport.extend({init:function(n){var t=this;i.data.RemoteTransport.fn.init.call(this,r(n,{parameterMap:function(n,i){return u.call(t,n,i,!0)}}))},read:function(t){var r,i,u=this.options.prefix,f=[u+"sort",u+"page",u+"pageSize",u+"group",u+"aggregate",u+"filter"],e=RegExp("("+f.join("|")+")=[^&]*&?","g");i=location.search.replace(e,"").replace("?","");i.length&&!/&$/.test(i)&&(i+="&");t=this.setup(t,"read");r=t.url;r.indexOf("?")>=0?(i=i.replace(/(.*?=.*?)&/g,function(n){return r.indexOf(n.substr(0,n.indexOf("=")))>=0?"":n}),r+="&"+i):r+="?"+i;r+=n.map(t.data,function(n,t){return t+"="+n}).join("&");location.href=r}})}})}(window.kendo.jQuery),function(n){var i=window.kendo,t=i.ui;t&&t.ComboBox&&(t.ComboBox.requestData=function(t){var i=n(t).data("kendoComboBox"),u=i.dataSource.filter(),r=i.input.val();return u||(r=""),{text:r}})}(window.kendo.jQuery),function(n){var i=window.kendo,t=i.ui;t&&t.MultiSelect&&(t.MultiSelect.requestData=function(t){var i=n(t).data("kendoMultiSelect"),r=i.input.val();return{text:r!==i.options.placeholder?r:""}})}(window.kendo.jQuery),function(n){var t=window.kendo,i=(t.ui,n.extend),r=n.isFunction;i(!0,t.data,{schemas:{"imagebrowser-aspnetmvc":{data:function(n){return n||[]},model:{id:"name",fields:{name:{field:"Name"},size:{field:"Size"},type:{field:"EntryType",parse:function(n){return 0==n?"f":"d"}}}}}}});i(!0,t.data,{transports:{"imagebrowser-aspnetmvc":t.data.RemoteTransport.extend({init:function(i){t.data.RemoteTransport.fn.init.call(this,n.extend(!0,{},this.options,i))},_call:function(i,u){u.data=n.extend({},u.data,{path:this.options.path()});r(this.options[i])?this.options[i].call(this,u):t.data.RemoteTransport.fn[i].call(this,u)},read:function(n){this._call("read",n)},create:function(n){this._call("create",n)},destroy:function(n){this._call("destroy",n)},update:function(){},options:{read:{type:"POST"},update:{type:"POST"},create:{type:"POST"},destroy:{type:"POST"},parameterMap:function(n,t){return"read"!=t&&(n.EntryType="f"===n.EntryType?0:1),n}}})}})}(window.kendo.jQuery),function(n){function r(){var n,i={};for(n in t)i["mvc"+n]=s(n);return i}function u(){var n,i={};for(n in t)i["mvc"+n]=h(n);return i}function f(n,t){var u,i,r,f={},e=n.data(),o=t.length;for(r in e)i=r.toLowerCase(),u=i.indexOf(t),u>-1&&(i=i.substring(u+o,r.length),i&&(f[i]=e[r]));return f}function e(t){for(var u=t.Fields||[],f={},i=0,r=u.length;r>i;i++)n.extend(!0,f,o(u[i]));return f}function o(n){for(var i,f,o={},s={},u=n.FieldName,r=n.ValidationRules,t=0,e=r.length;e>t;t++)i=r[t].ValidationType,f=r[t].ValidationParameters,o[u+i]=l(u,i,f),s[u+i]=c(r[t].ErrorMessage);return{rules:o,messages:s}}function s(n){return function(t){return t.attr("data-val-"+n)}}function h(n){return function(i){return i.filter("[data-val-"+n+"]").length?t[n](i,f(i,n)):!0}}function c(n){return function(){return n}}function l(n,i,r){return function(u){return u.filter("[name="+n+"]").length?t[i](u,r):!0}}function a(n,t){return"string"==typeof t&&(t=RegExp("^(?:"+t+")$")),t.test(n)}var i=/("|\%|'|\[|\]|\$|\.|\,|\:|\;|\+|\*|\&|\!|\#|\(|\)|<|>|\=|\?|\@|\^|\{|\}|\~|\/|\||`)/g,t={required:function(n){var f,t,r=n.val(),u=n.filter("[type=checkbox]");return u.length&&(f=u[0].name.replace(i,"\\$1"),t=u.next("input:hidden[name='"+f+"']"),r=t.length?t.val():"checked"===n.attr("checked")),!(""===r||!r)},number:function(n){return""===n.val()||null!==kendo.parseFloat(n.val())},regex:function(n,t){return""!==n.val()?a(n.val(),t.pattern):!0},range:function(n,t){return""!==n.val()?this.min(n,t)&&this.max(n,t):!0},min:function(n,t){var i=parseFloat(t.min)||0,r=kendo.parseFloat(n.val());return r>=i},max:function(n,t){var i=parseFloat(t.max)||0,r=kendo.parseFloat(n.val());return i>=r},date:function(n){return""===n.val()||null!==kendo.parseDate(n.val())},length:function(t,i){if(""!==t.val()){var r=n.trim(t.val()).length;return(!i.min||r>=(i.min||0))&&(!i.max||r<=(i.max||0))}return!0}};n.extend(!0,kendo.ui.validator,{rules:u(),messages:r(),messageLocators:{mvcLocator:{locate:function(n,t){return t=t.replace(i,"\\$1"),n.find(".field-validation-valid[data-valmsg-for="+t+"], .field-validation-error[data-valmsg-for="+t+"]")},decorate:function(n,t){n.addClass("field-validation-error").attr("data-valmsg-for",t||"")}},mvcMetadataLocator:{locate:function(n,t){return t=t.replace(i,"\\$1"),n.find("#"+t+"_validationMessage.field-validation-valid")},decorate:function(n,t){n.addClass("field-validation-error").attr("id",t+"_validationMessage")}}},ruleResolvers:{mvcMetaDataResolver:{resolve:function(t){var i,r=window.mvcClientValidationMetadata||[];if(r.length)for(t=n(t),i=0;i<r.length;i++)if(r[i].FormId==t.attr("id"))return e(r[i]);return{}}}}})}(window.kendo.jQuery)})}("function"==typeof define&&define.amd?define:function(n,t){return t()});!function(n){return n([],function(){!function(n){var t=n.kendo||(n.kendo={cultures:{}});t.cultures["pl-PL"]={name:"pl-PL",numberFormat:{pattern:["-n"],decimals:2,",":" ",".":",",groupSize:[3],percent:{pattern:["-n%","n%"],decimals:2,",":" ",".":",",groupSize:[3],symbol:"%"},currency:{pattern:["-n $","n $"],decimals:2,",":" ",".":",",groupSize:[3],symbol:"zł"}},calendars:{standard:{days:{names:["niedziela","poniedziałek","wtorek","środa","czwartek","piątek","sobota"],namesAbbr:["N","Pn","Wt","Śr","Cz","Pt","So"],namesShort:["N","Pn","Wt","Śr","Cz","Pt","So"]},months:{names:["styczeń","luty","marzec","kwiecień","maj","czerwiec","lipiec","sierpień","wrzesień","październik","listopad","grudzień",""],namesAbbr:["sty","lut","mar","kwi","maj","cze","lip","sie","wrz","paź","lis","gru",""]},AM:[""],PM:[""],patterns:{d:"yyyy-MM-dd",D:"d MMMM yyyy",F:"d MMMM yyyy HH:mm:ss",g:"yyyy-MM-dd HH:mm",G:"yyyy-MM-dd HH:mm:ss",m:"d MMMM",M:"d MMMM",s:"yyyy'-'MM'-'dd'T'HH':'mm':'ss",t:"HH:mm",T:"HH:mm:ss",u:"yyyy'-'MM'-'dd HH':'mm':'ss'Z'",y:"MMMM yyyy",Y:"MMMM yyyy"},"/":"-",":":":",firstDay:1}}}}(this)})}("function"==typeof define&&define.amd?define:function(n,t){return t()}),function(){function n(n){return function(){return n}}(function(t){var u=this||eval("this"),r=u.document,e=u.navigator,i=u.jQuery,f=u.JSON;(function(n){"function"==typeof require&&"object"==typeof exports&&"object"==typeof module?n(module.exports||exports):"function"==typeof define&&define.amd?define(["exports"],n):n(u.ko={})})(function(o){function c(n,t,i,r){s.d[n]={init:function(n){return s.a.f.set(n,a,{}),{controlsDescendantBindings:!0}},update:function(n,u,f,e,o){f=s.a.f.get(n,a);u=s.a.c(u());e=!i!=!u;var h=!f.fb;(h||t||e!==f.vb)&&(h&&(f.fb=s.a.Oa(s.e.childNodes(n),!0)),e?(h||s.e.P(n,s.a.Oa(f.fb)),s.Ja(r?r(o,u):o,n)):s.e.ba(n),f.vb=e)}};s.g.S[n]=!1;s.e.L[n]=!0}function v(n,t,i){i&&t!==s.h.n(n)&&s.h.W(n,t);t!==s.h.n(n)&&s.q.I(s.a.Ga,null,[n,"change"])}var s="undefined"!=typeof o?o:{},y,h,l,a;s.b=function(n,t){for(var i=n.split("."),r=s,u=0;u<i.length-1;u++)r=r[i[u]];r[i[i.length-1]]=t};s.r=function(n,t,i){n[t]=i};s.version="2.3.0";s.b("version",s.version);s.a=function(){function o(n,t){for(var i in n)n.hasOwnProperty(i)&&t(i,n[i])}function h(n,t){if("input"!==s.a.u(n)||!n.type||"click"!=t.toLowerCase())return!1;var i=n.type;return"checkbox"==i||"radio"==i}var c={},l={},a,n;return c[e&&/Firefox\/2/i.test(e.userAgent)?"KeyboardEvent":"UIEvents"]=["keyup","keydown","keypress"],c.MouseEvents="click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave".split(" "),o(c,function(n,t){if(t.length)for(var i=0,r=t.length;i<r;i++)l[t[i]]=n}),a={propertychange:!0},n=r&&function(){for(var n=3,i=r.createElement("div"),u=i.getElementsByTagName("i");i.innerHTML="<!--[if gt IE "+ ++n+"]><i><\/i><![endif]-->",u[0];);return 4<n?n:t}(),{Ta:["authenticity_token",/^__RequestVerificationToken(_.*)?$/],p:function(n,t){for(var i=0,r=n.length;i<r;i++)t(n[i])},k:function(n,t){if("function"==typeof Array.prototype.indexOf)return Array.prototype.indexOf.call(n,t);for(var i=0,r=n.length;i<r;i++)if(n[i]===t)return i;return-1},La:function(n,t,i){for(var r=0,u=n.length;r<u;r++)if(t.call(i,n[r]))return n[r];return null},ka:function(n,t){var i=s.a.k(n,t);0<=i&&n.splice(i,1)},Ma:function(n){n=n||[];for(var i=[],t=0,r=n.length;t<r;t++)0>s.a.k(i,n[t])&&i.push(n[t]);return i},Z:function(n,t){n=n||[];for(var r=[],i=0,u=n.length;i<u;i++)r.push(t(n[i]));return r},Y:function(n,t){n=n||[];for(var r=[],i=0,u=n.length;i<u;i++)t(n[i])&&r.push(n[i]);return r},R:function(n,t){if(t instanceof Array)n.push.apply(n,t);else for(var i=0,r=t.length;i<r;i++)n.push(t[i]);return n},ja:function(n,t,i){var r=n.indexOf?n.indexOf(t):s.a.k(n,t);0>r?i&&n.push(t):i||n.splice(r,1)},extend:function(n,t){if(t)for(var i in t)t.hasOwnProperty(i)&&(n[i]=t[i]);return n},w:o,oa:function(n){for(;n.firstChild;)s.removeNode(n.firstChild)},Mb:function(n){n=s.a.N(n);for(var i=r.createElement("div"),t=0,u=n.length;t<u;t++)i.appendChild(s.H(n[t]));return i},Oa:function(n,t){for(var r,i=0,f=n.length,u=[];i<f;i++)r=n[i].cloneNode(!0),u.push(t?s.H(r):r);return u},P:function(n,t){if(s.a.oa(n),t)for(var i=0,r=t.length;i<r;i++)n.appendChild(t[i])},eb:function(n,t){var r=n.nodeType?[n]:n;if(0<r.length){for(var f=r[0],e=f.parentNode,i=0,u=t.length;i<u;i++)e.insertBefore(t[i],f);for(i=0,u=r.length;i<u;i++)s.removeNode(r[i])}},hb:function(t,i){7>n?t.setAttribute("selected",i):t.selected=i},F:function(n){return null===n||n===t?"":n.trim?n.trim():n.toString().replace(/^[\s\xa0]+|[\s\xa0]+$/g,"")},Wb:function(n,t){for(var r,u=[],f=(n||"").split(t),i=0,e=f.length;i<e;i++)r=s.a.F(f[i]),""!==r&&u.push(r);return u},Tb:function(n,t){return n=n||"",t.length>n.length?!1:n.substring(0,t.length)===t},yb:function(n,t){if(t.compareDocumentPosition)return 16==(t.compareDocumentPosition(n)&16);for(;null!=n;){if(n==t)return!0;n=n.parentNode}return!1},aa:function(n){return s.a.yb(n,n.ownerDocument)},pb:function(n){return!!s.a.La(n,s.a.aa)},u:function(n){return n&&n.tagName&&n.tagName.toLowerCase()},o:function(t,r,u){var o=n&&a[r],f,e,c;if(o||"undefined"==typeof i)if(o||"function"!=typeof t.addEventListener)if("undefined"!=typeof t.attachEvent)f=function(n){u.call(t,n)},e="on"+r,t.attachEvent(e,f),s.a.C.ia(t,function(){t.detachEvent(e,f)});else throw Error("Browser doesn't support addEventListener or attachEvent");else t.addEventListener(r,u,!1);else h(t,r)&&(c=u,u=function(n,t){var i=this.checked;t&&(this.checked=!0!==t.sb);c.call(this,n);this.checked=i}),i(t).bind(r,u)},Ga:function(n,t){if(!n||!n.nodeType)throw Error("element must be a DOM node when calling triggerEvent");if("undefined"!=typeof i){var f=[];h(n,t)&&f.push({sb:n.checked});i(n).trigger(t,f)}else if("function"==typeof r.createEvent)if("function"==typeof n.dispatchEvent)f=r.createEvent(l[t]||"HTMLEvents"),f.initEvent(t,!0,!0,u,0,0,0,0,0,!1,!1,!1,!1,0,n),n.dispatchEvent(f);else throw Error("The supplied element doesn't support dispatchEvent");else if("undefined"!=typeof n.fireEvent)h(n,t)&&(n.checked=!0!==n.checked),n.fireEvent("on"+t);else throw Error("Browser doesn't support triggering events");},c:function(n){return s.T(n)?n():n},ya:function(n){return s.T(n)?n.t():n},ga:function(n,t,i){if(t){var r=/\S+/g,u=n.className.match(r)||[];s.a.p(t.match(r),function(n){s.a.ja(u,n,i)});n.className=u.join(" ")}},ib:function(n,i){var u=s.a.c(i),f;(null===u||u===t)&&(u="");f=s.e.firstChild(n);!f||3!=f.nodeType||s.e.nextSibling(f)?s.e.P(n,[r.createTextNode(u)]):f.data=u;s.a.Bb(n)},gb:function(t,i){if(t.name=i,7>=n)try{t.mergeAttributes(r.createElement("<input name='"+t.name+"'/>"),!1)}catch(u){}},Bb:function(t){9<=n&&(t=1==t.nodeType?t:t.parentNode,t.style&&(t.style.zoom=t.style.zoom))},zb:function(t){if(n){var i=t.style.width;t.style.width=0;t.style.width=i}},Qb:function(n,t){n=s.a.c(n);t=s.a.c(t);for(var r=[],i=n;i<=t;i++)r.push(i);return r},N:function(n){for(var i=[],t=0,r=n.length;t<r;t++)i.push(n[t]);return i},Ub:6===n,Vb:7===n,ca:n,Ua:function(n,t){for(var r=s.a.N(n.getElementsByTagName("input")).concat(s.a.N(n.getElementsByTagName("textarea"))),f="string"==typeof t?function(n){return n.name===t}:function(n){return t.test(n.name)},u=[],i=r.length-1;0<=i;i--)f(r[i])&&u.push(r[i]);return u},Nb:function(n){return"string"==typeof n&&(n=s.a.F(n))?f&&f.parse?f.parse(n):new Function("return "+n)():null},Ca:function(n,t,i){if(!f||!f.stringify)throw Error("Cannot find JSON.stringify(). Some browsers (e.g., IE < 8) don't support it natively, but you can overcome this by adding a script reference to json2.js, downloadable from http://www.json.org/json2.js");return f.stringify(s.a.c(n),t,i)},Ob:function(n,t,i){var v,e,h,f,u,c;i=i||{};var l=i.params||{},a=i.includeFields||this.Ta,v=n;if("object"==typeof n&&"form"===s.a.u(n))for(v=n.action,e=a.length-1;0<=e;e--)for(h=s.a.Ua(n,a[e]),f=h.length-1;0<=f;f--)l[h[f].name]=h[f].value;t=s.a.c(t);u=r.createElement("form");u.style.display="none";u.action=v;u.method="post";for(c in t)n=r.createElement("input"),n.name=c,n.value=s.a.Ca(s.a.c(t[c])),u.appendChild(n);o(l,function(n,t){var i=r.createElement("input");i.name=n;i.value=t;u.appendChild(i)});r.body.appendChild(u);i.submitter?i.submitter(u):u.submit();setTimeout(function(){u.parentNode.removeChild(u)},0)}}}();s.b("utils",s.a);s.b("utils.arrayForEach",s.a.p);s.b("utils.arrayFirst",s.a.La);s.b("utils.arrayFilter",s.a.Y);s.b("utils.arrayGetDistinctValues",s.a.Ma);s.b("utils.arrayIndexOf",s.a.k);s.b("utils.arrayMap",s.a.Z);s.b("utils.arrayPushAll",s.a.R);s.b("utils.arrayRemoveItem",s.a.ka);s.b("utils.extend",s.a.extend);s.b("utils.fieldsIncludedWithJsonPost",s.a.Ta);s.b("utils.getFormFields",s.a.Ua);s.b("utils.peekObservable",s.a.ya);s.b("utils.postJson",s.a.Ob);s.b("utils.parseJson",s.a.Nb);s.b("utils.registerEventHandler",s.a.o);s.b("utils.stringifyJson",s.a.Ca);s.b("utils.range",s.a.Qb);s.b("utils.toggleDomNodeCssClass",s.a.ga);s.b("utils.triggerEvent",s.a.Ga);s.b("utils.unwrapObservable",s.a.c);s.b("utils.objectForEach",s.a.w);s.b("utils.addOrRemoveItem",s.a.ja);s.b("unwrap",s.a.c);Function.prototype.bind||(Function.prototype.bind=function(n){var i=this,t=Array.prototype.slice.call(arguments);return n=t.shift(),function(){return i.apply(n,t.concat(Array.prototype.slice.call(arguments)))}});s.a.f=new function(){var r=0,n="__ko__"+(new Date).getTime(),i={};return{get:function(n,i){var r=s.a.f.pa(n,!1);return r===t?t:r[i]},set:function(n,i,r){(r!==t||s.a.f.pa(n,!1)!==t)&&(s.a.f.pa(n,!0)[i]=r)},pa:function(u,f){var e=u[n];if(!e||"null"===e||!i[e]){if(!f)return t;e=u[n]="ko"+r++;i[e]={}}return i[e]},clear:function(t){var r=t[n];return r?(delete i[r],t[n]=null,!0):!1}}};s.b("utils.domData",s.a.f);s.b("utils.domData.clear",s.a.f.clear);s.a.C=new function(){function n(n,i){var r=s.a.f.get(n,u);return r===t&&i&&(r=[],s.a.f.set(n,u,r)),r}function r(t){var u=n(t,!1),e;if(u)for(u=u.slice(0),e=0;e<u.length;e++)u[e](t);if(s.a.f.clear(t),"function"==typeof i&&"function"==typeof i.cleanData&&i.cleanData([t]),f[t.nodeType])for(u=t.firstChild;t=u;)u=t.nextSibling,8===t.nodeType&&r(t)}var u="__ko_domNodeDisposal__"+(new Date).getTime(),e={1:!0,8:!0,9:!0},f={1:!0,9:!0};return{ia:function(t,i){if("function"!=typeof i)throw Error("Callback must be a function");n(t,!0).push(i)},cb:function(i,r){var f=n(i,!1);f&&(s.a.ka(f,r),0==f.length&&s.a.f.set(i,u,t))},H:function(n){var t,i,u;if(e[n.nodeType]&&(r(n),f[n.nodeType]))for(t=[],s.a.R(t,n.getElementsByTagName("*")),i=0,u=t.length;i<u;i++)r(t[i]);return n},removeNode:function(n){s.H(n);n.parentNode&&n.parentNode.removeChild(n)}}};s.H=s.a.C.H;s.removeNode=s.a.C.removeNode;s.b("cleanNode",s.H);s.b("removeNode",s.removeNode);s.b("utils.domNodeDisposal",s.a.C);s.b("utils.domNodeDisposal.addDisposeCallback",s.a.C.ia);s.b("utils.domNodeDisposal.removeDisposeCallback",s.a.C.cb),function(){s.a.xa=function(n){var t,f;if("undefined"!=typeof i){if(i.parseHTML)t=i.parseHTML(n)||[];else if((t=i.clean([n]))&&t[0]){for(n=t[0];n.parentNode&&11!==n.parentNode.nodeType;)n=n.parentNode;n.parentNode&&n.parentNode.removeChild(n)}}else{for(f=s.a.F(n).toLowerCase(),t=r.createElement("div"),f=f.match(/^<(thead|tbody|tfoot)/)&&[1,"<table>","<\/table>"]||!f.indexOf("<tr")&&[2,"<table><tbody>","<\/tbody><\/table>"]||(!f.indexOf("<td")||!f.indexOf("<th"))&&[3,"<table><tbody><tr>","<\/tr><\/tbody><\/table>"]||[0,"",""],n="ignored<div>"+f[1]+n+f[2]+"<\/div>","function"==typeof u.innerShiv?t.appendChild(u.innerShiv(n)):t.innerHTML=n;f[0]--;)t=t.lastChild;t=s.a.N(t.lastChild.childNodes)}return t};s.a.fa=function(n,r){if(s.a.oa(n),r=s.a.c(r),null!==r&&r!==t)if("string"!=typeof r&&(r=r.toString()),"undefined"!=typeof i)i(n).html(r);else for(var f=s.a.xa(r),u=0;u<f.length;u++)n.appendChild(f[u])}}();s.b("utils.parseHtmlFragment",s.a.xa);s.b("utils.setHtml",s.a.fa);s.s=function(){function i(n,t){var r;if(n)if(8==n.nodeType)r=s.s.$a(n.nodeValue),null!=r&&t.push({xb:n,Kb:r});else if(1==n.nodeType)for(var r=0,u=n.childNodes,f=u.length;r<f;r++)i(u[r],t)}var n={};return{va:function(t){if("function"!=typeof t)throw Error("You can only pass a function to ko.memoization.memoize()");var i=(4294967296*(1+Math.random())|0).toString(16).substring(1)+(4294967296*(1+Math.random())|0).toString(16).substring(1);return n[i]=t,"<!--[ko_memo:"+i+"]-->"},mb:function(i,r){var u=n[i];if(u===t)throw Error("Couldn't find any memo with ID "+i+". Perhaps it's already been unmemoized.");try{return u.apply(null,r||[]),!0}finally{delete n[i]}},nb:function(n,t){var f=[],u,o,r,e;for(i(n,f),u=0,o=f.length;u<o;u++)r=f[u].xb,e=[r],t&&s.a.R(e,t),s.s.mb(f[u].Kb,e),r.nodeValue="",r.parentNode&&r.parentNode.removeChild(r)},$a:function(n){return(n=n.match(/^\[ko_memo\:(.*?)\]$/))?n[1]:null}}}();s.b("memoization",s.s);s.b("memoization.memoize",s.s.va);s.b("memoization.unmemoize",s.s.mb);s.b("memoization.parseMemoText",s.s.$a);s.b("memoization.unmemoizeDomNodeAndDescendants",s.s.nb);s.Sa={throttle:function(n,t){n.throttleEvaluation=t;var i=null;return s.j({read:n,write:function(r){clearTimeout(i);i=setTimeout(function(){n(r)},t)}})},notify:function(t,i){return t.equalityComparer="always"==i?n(!1):s.m.fn.equalityComparer,t}};s.b("extenders",s.Sa);s.kb=function(n,t,i){this.target=n;this.la=t;this.wb=i;s.r(this,"dispose",this.B)};s.kb.prototype.B=function(){this.Hb=!0;this.wb()};s.V=function(){this.G={};s.a.extend(this,s.V.fn);s.r(this,"subscribe",this.Da);s.r(this,"extend",this.extend);s.r(this,"getSubscriptionsCount",this.Db)};s.V.fn={Da:function(n,t,i){i=i||"change";var r=new s.kb(this,t?n.bind(t):n,function(){s.a.ka(this.G[i],r)}.bind(this));return this.G[i]||(this.G[i]=[]),this.G[i].push(r),r},notifySubscribers:function(n,t){t=t||"change";this.G[t]&&s.q.I(function(){s.a.p(this.G[t].slice(0),function(t){t&&!0!==t.Hb&&t.la(n)})},this)},Db:function(){var n=0;return s.a.w(this.G,function(t,i){n+=i.length}),n},extend:function(n){var t=this;return n&&s.a.w(n,function(n,i){var r=s.Sa[n];"function"==typeof r&&(t=r(t,i))}),t}};s.Wa=function(n){return null!=n&&"function"==typeof n.Da&&"function"==typeof n.notifySubscribers};s.b("subscribable",s.V);s.b("isSubscribable",s.Wa);s.q=function(){var n=[];return{rb:function(t){n.push({la:t,Ra:[]})},end:function(){n.pop()},bb:function(t){if(!s.Wa(t))throw Error("Only subscribable things can act as dependencies");if(0<n.length){var i=n[n.length-1];!i||0<=s.a.k(i.Ra,t)||(i.Ra.push(t),i.la(t))}},I:function(t,i,r){try{return n.push(null),t.apply(i,r||[])}finally{n.pop()}}}}();y={undefined:!0,boolean:!0,number:!0,string:!0};s.m=function(n){function t(){return 0<arguments.length?(t.equalityComparer&&t.equalityComparer(i,arguments[0])||(t.K(),i=arguments[0],t.J()),this):(s.q.bb(t),i)}var i=n;return s.V.call(t),t.t=function(){return i},t.J=function(){t.notifySubscribers(i)},t.K=function(){t.notifySubscribers(i,"beforeChange")},s.a.extend(t,s.m.fn),s.r(t,"peek",t.t),s.r(t,"valueHasMutated",t.J),s.r(t,"valueWillMutate",t.K),t};s.m.fn={equalityComparer:function(n,t){return null===n||typeof n in y?n===t:!1}};h=s.m.Pb="__ko_proto__";s.m.fn[h]=s.m;s.qa=function(n,i){return null===n||n===t||n[h]===t?!1:n[h]===i?!0:s.qa(n[h],i)};s.T=function(n){return s.qa(n,s.m)};s.Xa=function(n){return"function"==typeof n&&n[h]===s.m||"function"==typeof n&&n[h]===s.j&&n.Eb?!0:!1};s.b("observable",s.m);s.b("isObservable",s.T);s.b("isWriteableObservable",s.Xa);s.U=function(n){if(n=n||[],"object"!=typeof n||!("length"in n))throw Error("The argument passed when initializing an observable array must be an array, or null, or undefined.");return n=s.m(n),s.a.extend(n,s.U.fn),n};s.U.fn={remove:function(n){for(var u,r=this.t(),i=[],f="function"==typeof n?n:function(t){return t===n},t=0;t<r.length;t++)u=r[t],f(u)&&(0===i.length&&this.K(),i.push(u),r.splice(t,1),t--);return i.length&&this.J(),i},removeAll:function(n){if(n===t){var i=this.t(),r=i.slice(0);return this.K(),i.splice(0,i.length),this.J(),r}return n?this.remove(function(t){return 0<=s.a.k(n,t)}):[]},destroy:function(n){var i=this.t(),r="function"==typeof n?n:function(t){return t===n},t;for(this.K(),t=i.length-1;0<=t;t--)r(i[t])&&(i[t]._destroy=!0);this.J()},destroyAll:function(i){return i===t?this.destroy(n(!0)):i?this.destroy(function(n){return 0<=s.a.k(i,n)}):[]},indexOf:function(n){var t=this();return s.a.k(t,n)},replace:function(n,t){var i=this.indexOf(n);0<=i&&(this.K(),this.t()[i]=t,this.J())}};s.a.p("pop push reverse shift sort splice unshift".split(" "),function(n){s.U.fn[n]=function(){var t=this.t();return this.K(),t=t[n].apply(t,arguments),this.J(),t}});s.a.p(["slice"],function(n){s.U.fn[n]=function(){var t=this();return t[n].apply(t,arguments)}});s.b("observableArray",s.U);s.j=function(i,r,u){function w(){s.a.p(o,function(n){n.B()});o=[]}function nt(){var n=f.throttleEvaluation;n&&0<=n?(clearTimeout(d),d=setTimeout(c,n)):c()}function c(){var n,u,i;if(!y)if(a&&p())h();else{y=!0;try{for(n=s.a.Z(o,function(n){return n.target}),s.q.rb(function(i){var r;0<=(r=s.a.k(n,i))?n[r]=t:o.push(i.Da(nt))}),u=e.call(r),i=n.length-1;0<=i;i--)n[i]&&o.splice(i,1)[0].B();a=!0;f.notifySubscribers(l,"beforeChange");l=u;f.notifySubscribers(l)}finally{s.q.end();y=!1}o.length||h()}}function f(){if(0<arguments.length){if("function"==typeof k)k.apply(r,arguments);else throw Error("Cannot write a value to a ko.computed unless you specify a 'write' option. If you wish to read the current value, don't pass any parameters.");return this}return a||c(),s.q.bb(f),l}function b(){return!a||0<o.length}var l,a=!1,y=!1,e=i,g,p;if(e&&"object"==typeof e?(u=e,e=u.read):(u=u||{},e||(e=u.read)),"function"!=typeof e)throw Error("Pass a function that returns the value of the ko.computed");var k=u.write,v=u.disposeWhenNodeIsRemoved||u.$||null,p=u.disposeWhen||u.Qa||n(!1),h=w,o=[],d=null;return r||(r=u.owner),f.t=function(){return a||c(),l},f.Cb=function(){return o.length},f.Eb="function"==typeof u.write,f.B=function(){h()},f.ta=b,s.V.call(f),s.a.extend(f,s.j.fn),s.r(f,"peek",f.t),s.r(f,"dispose",f.B),s.r(f,"isActive",f.ta),s.r(f,"getDependenciesCount",f.Cb),!0!==u.deferEvaluation&&c(),v&&b()&&(h=function(){s.a.C.cb(v,h);w()},s.a.C.ia(v,h),g=p,p=function(){return!s.a.aa(v)||g()}),f};s.Gb=function(n){return s.qa(n,s.j)};o=s.m.Pb;s.j[o]=s.m;s.j.fn={};s.j.fn[o]=s.j;s.b("dependentObservable",s.j);s.b("computed",s.j);s.b("isComputed",s.Gb),function(){function n(u,f,e){if(e=e||new i,u=f(u),"object"!=typeof u||null===u||u===t||u instanceof Date||u instanceof String||u instanceof Number||u instanceof Boolean)return u;var o=u instanceof Array?[]:{};return e.save(u,o),r(u,function(i){var r=f(u[i]),s;switch(typeof r){case"boolean":case"number":case"string":case"function":o[i]=r;break;case"object":case"undefined":s=e.get(r);o[i]=s!==t?s:n(r,f,e)}}),o}function r(n,t){if(n instanceof Array){for(var i=0;i<n.length;i++)t(i);"function"==typeof n.toJSON&&t("toJSON")}else for(i in n)t(i)}function i(){this.keys=[];this.Ha=[]}s.lb=function(t){if(0==arguments.length)throw Error("When calling ko.toJS, pass the object you want to convert.");return n(t,function(n){for(var t=0;s.T(n)&&10>t;t++)n=n();return n})};s.toJSON=function(n,t,i){return n=s.lb(n),s.a.Ca(n,t,i)};i.prototype={save:function(n,t){var i=s.a.k(this.keys,n);0<=i?this.Ha[i]=t:(this.keys.push(n),this.Ha.push(t))},get:function(n){return n=s.a.k(this.keys,n),0<=n?this.Ha[n]:t}}}();s.b("toJS",s.lb);s.b("toJSON",s.toJSON),function(){s.h={n:function(n){switch(s.a.u(n)){case"option":return!0===n.__ko__hasDomDataOptionValue__?s.a.f.get(n,s.d.options.wa):7>=s.a.ca?n.getAttributeNode("value")&&n.getAttributeNode("value").specified?n.value:n.text:n.value;case"select":return 0<=n.selectedIndex?s.h.n(n.options[n.selectedIndex]):t;default:return n.value}},W:function(n,i){switch(s.a.u(n)){case"option":switch(typeof i){case"string":s.a.f.set(n,s.d.options.wa,t);"__ko__hasDomDataOptionValue__"in n&&delete n.__ko__hasDomDataOptionValue__;n.value=i;break;default:s.a.f.set(n,s.d.options.wa,i);n.__ko__hasDomDataOptionValue__=!0;n.value="number"==typeof i?i:""}break;case"select":""===i&&(i=t);(null===i||i===t)&&(n.selectedIndex=-1);for(var r=n.options.length-1;0<=r;r--)if(s.h.n(n.options[r])==i){n.selectedIndex=r;break}1<n.size||-1!==n.selectedIndex||(n.selectedIndex=0);break;default:(null===i||i===t)&&(i="");n.value=i}}}}();s.b("selectExtensions",s.h);s.b("selectExtensions.readValue",s.h.n);s.b("selectExtensions.writeValue",s.h.W);s.g=function(){function n(n,i){for(var r=null;n!=r;)r=n,n=n.replace(t,function(n,t){return i[t]});return n}var t=/\@ko_token_(\d+)\@/g,i=["true","false","null","undefined"],r=/^(?:[$_a-z][$\w]*|(.+)(\.\s*[$_a-z][$\w]*|\[.+\]))$/i;return{S:[],da:function(t){var i=s.a.F(t),f,e,r,u;if(3>i.length)return[];for("{"===i.charAt(0)&&(i=i.substring(1,i.length-1)),t=[],f=null,r=0;r<i.length;r++)if(u=i.charAt(r),null===f)switch(u){case'"':case"'":case"/":f=r;e=u}else if(u==e&&"\\"!==i.charAt(r-1)){u=i.substring(f,r+1);t.push(u);var c="@ko_token_"+(t.length-1)+"@",i=i.substring(0,f)+c+i.substring(r+1),r=r-(u.length-c.length),f=null}e=f=null;for(var o=0,h=null,r=0;r<i.length;r++){if(u=i.charAt(r),null===f)switch(u){case"{":f=r;h=u;e="}";break;case"(":f=r;h=u;e=")";break;case"[":f=r;h=u;e="]"}u===h?o++:u===e&&(o--,0===o&&(u=i.substring(f,r+1),t.push(u),c="@ko_token_"+(t.length-1)+"@",i=i.substring(0,f)+c+i.substring(r+1),r-=u.length-c.length,f=null))}for(e=[],i=i.split(","),f=0,r=i.length;f<r;f++)o=i[f],h=o.indexOf(":"),0<h&&h<o.length-1?(u=o.substring(h+1),e.push({key:n(o.substring(0,h),t),value:n(u,t)})):e.push({unknown:n(o,t)});return e},ea:function(n){var e="string"==typeof n?s.g.da(n):n,f=[],t,h,o,u;for(n=[],h=0;t=e[h];h++)if(0<f.length&&f.push(","),t.key){n:{o=t.key;u=s.a.F(o);switch(u.length&&u.charAt(0)){case"'":case'"':break n;default:o="'"+u+"'"}}t=t.value;f.push(o);f.push(":");f.push(t);t=s.a.F(t);0<=s.a.k(i,s.a.F(t).toLowerCase())?t=!1:(u=t.match(r),t=null===u?!1:u[1]?"Object("+u[1]+")"+u[2]:t);t&&(0<n.length&&n.push(", "),n.push(o+" : function(__ko_value) { "+t+" = __ko_value; }"))}else t.unknown&&f.push(t.unknown);return e=f.join(""),0<n.length&&(e=e+", '_ko_property_writers' : { "+n.join("")+" } "),e},Jb:function(n,t){for(var i=0;i<n.length;i++)if(s.a.F(n[i].key)==t)return!0;return!1},ha:function(n,t,i,r,u){n&&s.T(n)?!s.Xa(n)||u&&n.t()===r||n(r):(n=t()._ko_property_writers)&&n[i]&&n[i](r)}}}();s.b("expressionRewriting",s.g);s.b("expressionRewriting.bindingRewriteValidators",s.g.S);s.b("expressionRewriting.parseObjectLiteral",s.g.da);s.b("expressionRewriting.preProcessBindings",s.g.ea);s.b("jsonExpressionRewriting",s.g);s.b("jsonExpressionRewriting.insertPropertyAccessorsIntoJson",s.g.ea),function(){function n(n){return 8==n.nodeType&&(i?n.text:n.nodeValue).match(e)}function t(n){return 8==n.nodeType&&(i?n.text:n.nodeValue).match(o)}function u(i,r){for(var u=i,f=1,e=[];u=u.nextSibling;){if(t(u)&&(f--,0===f))return e;e.push(u);n(u)&&f++}if(!r)throw Error("Cannot find closing comment tag to match: "+i.nodeValue);return null}function f(n,t){var i=u(n,t);return i?0<i.length?i[i.length-1].nextSibling:n.nextSibling:null}var i=r&&"<!--test-->"===r.createComment("test").text,e=i?/^\x3c!--\s*ko(?:\s+(.+\s*\:[\s\S]*))?\s*--\x3e$/:/^\s*ko(?:\s+(.+\s*\:[\s\S]*))?\s*$/,o=i?/^\x3c!--\s*\/ko\s*--\x3e$/:/^\s*\/ko\s*$/,h={ul:!0,ol:!0};s.e={L:{},childNodes:function(t){return n(t)?u(t):t.childNodes},ba:function(t){if(n(t)){t=s.e.childNodes(t);for(var i=0,r=t.length;i<r;i++)s.removeNode(t[i])}else s.a.oa(t)},P:function(t,i){if(n(t)){s.e.ba(t);for(var u=t.nextSibling,r=0,f=i.length;r<f;r++)u.parentNode.insertBefore(i[r],u)}else s.a.P(t,i)},ab:function(t,i){n(t)?t.parentNode.insertBefore(i,t.nextSibling):t.firstChild?t.insertBefore(i,t.firstChild):t.appendChild(i)},Va:function(t,i,r){r?n(t)?t.parentNode.insertBefore(i,r.nextSibling):r.nextSibling?t.insertBefore(i,r.nextSibling):t.appendChild(i):s.e.ab(t,i)},firstChild:function(i){return n(i)?!i.nextSibling||t(i.nextSibling)?null:i.nextSibling:i.firstChild},nextSibling:function(i){return n(i)&&(i=f(i)),i.nextSibling&&t(i.nextSibling)?null:i.nextSibling},ob:function(t){return(t=n(t))?t[1]:null},Za:function(i){var o,r,u,e;if(h[s.a.u(i)]&&(o=i.firstChild,o))do if(1===o.nodeType){if(r=o.firstChild,u=null,r)do u?u.push(r):n(r)?(e=f(r,!0),e?r=e:u=[r]):t(r)&&(u=[r]);while(r=r.nextSibling);if(r=u)for(u=o.nextSibling,e=0;e<r.length;e++)u?i.insertBefore(r[e],u):i.appendChild(r[e])}while(o=o.nextSibling)}}}();s.b("virtualElements",s.e);s.b("virtualElements.allowedBindings",s.e.L);s.b("virtualElements.emptyNode",s.e.ba);s.b("virtualElements.insertAfter",s.e.Va);s.b("virtualElements.prepend",s.e.ab);s.b("virtualElements.setDomNodeChildren",s.e.P),function(){s.M=function(){this.Na={}};s.a.extend(s.M.prototype,{nodeHasBindings:function(n){switch(n.nodeType){case 1:return null!=n.getAttribute("data-bind");case 8:return null!=s.e.ob(n);default:return!1}},getBindings:function(n,t){var i=this.getBindingsString(n,t);return i?this.parseBindingsString(i,t,n):null},getBindingsString:function(n){switch(n.nodeType){case 1:return n.getAttribute("data-bind");case 8:return s.e.ob(n);default:return null}},parseBindingsString:function(n,t,i){var r,f,e,o;try{return(r=this.Na[n])||(f=this.Na,o="with($context){with($data||{}){return{"+s.g.ea(n)+"}}}",e=new Function("$context","$element",o),r=f[n]=e),r(t,i)}catch(u){throw u.message="Unable to parse bindings.\nBindings value: "+n+"\nMessage: "+u.message,u;}}});s.M.instance=new s.M}();s.b("bindingProvider",s.M),function(){function n(n,t,r){for(var u=s.e.firstChild(t);t=u;)u=s.e.nextSibling(t),i(n,t,r)}function i(t,i,u){var e=!0,f=1===i.nodeType;f&&s.e.Za(i);(f&&u||s.M.instance.nodeHasBindings(i))&&(e=r(i,null,t,u).Sb);e&&n(t,i,!f)}function r(n,i,r,u){function c(n){return function(){return e[n]}}function l(){return e}var o=0,e,h,a=s.a.f.get(n,f);if(!i){if(a)throw Error("You cannot apply bindings multiple times to the same element.");s.a.f.set(n,f,!0)}return s.j(function(){var f=r&&r instanceof s.A?r:new s.A(s.a.c(r)),v=f.$data;!a&&u&&s.jb(n,f);(e=("function"==typeof i?i(f,n):i)||s.M.instance.getBindings(n,f))&&(0===o&&(o=1,s.a.w(e,function(i){var r=s.d[i];if(r&&8===n.nodeType&&!s.e.L[i])throw Error("The binding '"+i+"' cannot be used with virtual elements");if(r&&"function"==typeof r.init&&(r=r.init(n,c(i),l,v,f))&&r.controlsDescendantBindings){if(h!==t)throw Error("Multiple bindings ("+h+" and "+i+") are trying to control descendant bindings of the same element. You cannot use these bindings together on the same element.");h=i}}),o=2),2===o&&s.a.w(e,function(t){var i=s.d[t];i&&"function"==typeof i.update&&i.update(n,c(t),l,v,f)}))},null,{$:n}),{Sb:h===t}}s.d={};s.A=function(n,t,i){t?(s.a.extend(this,t),this.$parentContext=t,this.$parent=t.$data,this.$parents=(t.$parents||[]).slice(0),this.$parents.unshift(this.$parent)):(this.$parents=[],this.$root=n,this.ko=s);this.$data=n;i&&(this[i]=n)};s.A.prototype.createChildContext=function(n,t){return new s.A(n,this,t)};s.A.prototype.extend=function(n){var t=s.a.extend(new s.A,this);return s.a.extend(t,n)};var f="__ko_boundElement";s.jb=function(n,t){if(2==arguments.length)s.a.f.set(n,"__ko_bindingContext__",t);else return s.a.f.get(n,"__ko_bindingContext__")};s.Ka=function(n,t,i){return 1===n.nodeType&&s.e.Za(n),r(n,t,i,!0)};s.Ja=function(t,i){1!==i.nodeType&&8!==i.nodeType||n(t,i,!0)};s.Ia=function(n,t){if(t&&1!==t.nodeType&&8!==t.nodeType)throw Error("ko.applyBindings: first parameter should be your view model; second parameter should be a DOM node");t=t||u.document.body;i(n,t,!0)};s.na=function(n){switch(n.nodeType){case 1:case 8:var i=s.jb(n);if(i)return i;if(n.parentNode)return s.na(n.parentNode)}return t};s.ub=function(n){return(n=s.na(n))?n.$data:t};s.b("bindingHandlers",s.d);s.b("applyBindings",s.Ia);s.b("applyBindingsToDescendants",s.Ja);s.b("applyBindingsToNode",s.Ka);s.b("contextFor",s.na);s.b("dataFor",s.ub)}();l={"class":"className","for":"htmlFor"};s.d.attr={update:function(n,i){var r=s.a.c(i())||{};s.a.w(r,function(i,r){r=s.a.c(r);var u=!1===r||null===r||r===t;u&&n.removeAttribute(i);8>=s.a.ca&&i in l?(i=l[i],u?n.removeAttribute(i):n[i]=r):u||n.setAttribute(i,r.toString());"name"===i&&s.a.gb(n,u?"":r.toString())})}};s.d.checked={init:function(t,i,r){s.a.o(t,"click",function(){var u,n,f;if("checkbox"==t.type)u=t.checked;else if("radio"==t.type&&t.checked)u=t.value;else return;n=i();f=s.a.c(n);"checkbox"==t.type&&f instanceof Array?s.a.ja(n,t.value,t.checked):s.g.ha(n,r,"checked",u,!0)});"radio"!=t.type||t.name||s.d.uniqueName.init(t,n(!0))},update:function(n,t){var i=s.a.c(t());"checkbox"==n.type?n.checked=i instanceof Array?0<=s.a.k(i,n.value):i:"radio"==n.type&&(n.checked=n.value==i)}};s.d.css={update:function(n,t){var i=s.a.c(t());"object"==typeof i?s.a.w(i,function(t,i){i=s.a.c(i);s.a.ga(n,t,i)}):(i=String(i||""),s.a.ga(n,n.__ko__cssValue,!1),n.__ko__cssValue=i,s.a.ga(n,i,!0))}};s.d.enable={update:function(n,t){var i=s.a.c(t());i&&n.disabled?n.removeAttribute("disabled"):i||n.disabled||(n.disabled=!0)}};s.d.disable={update:function(n,t){s.d.enable.update(n,function(){return!s.a.c(t())})}};s.d.event={init:function(n,t,i,r){var u=t()||{};s.a.w(u,function(u){"string"==typeof u&&s.a.o(n,u,function(n){var e,o=t()[u],h,f;if(o){h=i();try{f=s.a.N(arguments);f.unshift(r);e=o.apply(r,f)}finally{!0!==e&&(n.preventDefault?n.preventDefault():n.returnValue=!1)}!1===h[u+"Bubble"]&&(n.cancelBubble=!0,n.stopPropagation&&n.stopPropagation())}})})}};s.d.foreach={Ya:function(n){return function(){var i=n(),t=s.a.ya(i);return!t||"number"==typeof t.length?{foreach:i,templateEngine:s.D.sa}:(s.a.c(i),{foreach:t.data,as:t.as,includeDestroyed:t.includeDestroyed,afterAdd:t.afterAdd,beforeRemove:t.beforeRemove,afterRender:t.afterRender,beforeMove:t.beforeMove,afterMove:t.afterMove,templateEngine:s.D.sa})}},init:function(n,t){return s.d.template.init(n,s.d.foreach.Ya(t))},update:function(n,t,i,r,u){return s.d.template.update(n,s.d.foreach.Ya(t),i,r,u)}};s.g.S.foreach=!1;s.e.L.foreach=!0;s.d.hasfocus={init:function(n,t,i){function r(r){var u,f;if(n.__ko_hasfocusUpdating=!0,u=n.ownerDocument,"activeElement"in u){try{f=u.activeElement}catch(e){f=u.body}r=f===n}u=t();s.g.ha(u,i,"hasfocus",r,!0);n.__ko_hasfocusLastValue=r;n.__ko_hasfocusUpdating=!1}var u=r.bind(null,!0),f=r.bind(null,!1);s.a.o(n,"focus",u);s.a.o(n,"focusin",u);s.a.o(n,"blur",f);s.a.o(n,"focusout",f)},update:function(n,t){var i=!!s.a.c(t());n.__ko_hasfocusUpdating||n.__ko_hasfocusLastValue===i||(i?n.focus():n.blur(),s.q.I(s.a.Ga,null,[n,i?"focusin":"focusout"]))}};s.d.hasFocus=s.d.hasfocus;s.d.html={init:function(){return{controlsDescendantBindings:!0}},update:function(n,t){s.a.fa(n,t())}};a="__ko_withIfBindingData";c("if");c("ifnot",!1,!0);c("with",!0,!1,function(n,t){return n.createChildContext(t)});s.d.options={init:function(n){if("select"!==s.a.u(n))throw Error("options binding applies only to SELECT elements");for(;0<n.length;)n.remove(0);return{controlsDescendantBindings:!0}},update:function(n,i,u){function a(n,t,i){var r=typeof t;return"function"==r?t(n):"string"==r?n[t]:i}function y(n,t){if(e){var i=0<=s.a.k(e,s.h.n(t[0]));s.a.hb(t[0],i)}}var p=0==n.length,h=!p&&n.multiple?n.scrollTop:null,l;i=s.a.c(i());var f=u(),w=f.optionsIncludeDestroyed,c={},o,e;n.multiple?e=s.a.Z(n.selectedOptions||s.a.Y(n.childNodes,function(n){return n.tagName&&"option"===s.a.u(n)&&n.selected}),function(n){return s.h.n(n)}):0<=n.selectedIndex&&(e=[s.h.n(n.options[n.selectedIndex])]);i?("undefined"==typeof i.length&&(i=[i]),l=s.a.Y(i,function(n){return w||n===t||null===n||!s.a.c(n._destroy)}),"optionsCaption"in f&&(o=s.a.c(f.optionsCaption),null!==o&&o!==t&&l.unshift(c))):i=[];u=y;f.optionsAfterRender&&(u=function(n,i){y(0,i);s.q.I(f.optionsAfterRender,null,[i[0],n!==c?n:t])});s.a.Aa(n,l,function(n,i,u){return u.length&&(e=u[0].selected&&[s.h.n(u[0])]),i=r.createElement("option"),n===c?(s.a.fa(i,o),s.h.W(i,t)):(u=a(n,f.optionsValue,n),s.h.W(i,s.a.c(u)),n=a(n,f.optionsText,u),s.a.ib(i,n)),[i]},null,u);e=null;p&&"value"in f&&v(n,s.a.ya(f.value),!0);s.a.zb(n);h&&20<Math.abs(h-n.scrollTop)&&(n.scrollTop=h)}};s.d.options.wa="__ko.optionValueDomData__";s.d.selectedOptions={init:function(n,t,i){s.a.o(n,"change",function(){var u=t(),r=[];s.a.p(n.getElementsByTagName("option"),function(n){n.selected&&r.push(s.h.n(n))});s.g.ha(u,i,"selectedOptions",r)})},update:function(n,t){if("select"!=s.a.u(n))throw Error("values binding applies only to SELECT elements");var i=s.a.c(t());i&&"number"==typeof i.length&&s.a.p(n.getElementsByTagName("option"),function(n){var t=0<=s.a.k(i,s.h.n(n));s.a.hb(n,t)})}};s.d.style={update:function(n,t){var i=s.a.c(t()||{});s.a.w(i,function(t,i){i=s.a.c(i);n.style[t]=i||""})}};s.d.submit={init:function(n,t,i,r){if("function"!=typeof t())throw Error("The value for a submit binding must be a function");s.a.o(n,"submit",function(i){var u,f=t();try{u=f.call(r,n)}finally{!0!==u&&(i.preventDefault?i.preventDefault():i.returnValue=!1)}})}};s.d.text={update:function(n,t){s.a.ib(n,t())}};s.e.L.text=!0;s.d.uniqueName={init:function(n,t){if(t()){var i="ko_unique_"+ ++s.d.uniqueName.tb;s.a.gb(n,i)}}};s.d.uniqueName.tb=0;s.d.value={init:function(n,t,i){function f(){e=!1;var r=t(),u=s.h.n(n);s.g.ha(r,i,"value",u)}var r=["change"],u=i().valueUpdate,e=!1;u&&("string"==typeof u&&(u=[u]),s.a.R(r,u),r=s.a.Ma(r));!s.a.ca||"input"!=n.tagName.toLowerCase()||"text"!=n.type||"off"==n.autocomplete||n.form&&"off"==n.form.autocomplete||-1!=s.a.k(r,"propertychange")||(s.a.o(n,"propertychange",function(){e=!0}),s.a.o(n,"blur",function(){e&&f()}));s.a.p(r,function(t){var i=f;s.a.Tb(t,"after")&&(i=function(){setTimeout(f,0)},t=t.substring(5));s.a.o(n,t,i)})},update:function(n,t){var u="select"===s.a.u(n),r=s.a.c(t()),i=s.h.n(n);r!==i&&(i=function(){s.h.W(n,r)},i(),u&&setTimeout(i,0));u&&0<n.length&&v(n,r,!1)}};s.d.visible={update:function(n,t){var i=s.a.c(t()),r="none"!=n.style.display;i&&!r?n.style.display="":!i&&r&&(n.style.display="none")}},function(n){s.d[n]={init:function(t,i,r,u){return s.d.event.init.call(this,t,function(){var t={};return t[n]=i(),t},r,u)}}}("click");s.v=function(){};s.v.prototype.renderTemplateSource=function(){throw Error("Override renderTemplateSource");};s.v.prototype.createJavaScriptEvaluatorBlock=function(){throw Error("Override createJavaScriptEvaluatorBlock");};s.v.prototype.makeTemplateSource=function(n,t){if("string"==typeof n){t=t||r;var i=t.getElementById(n);if(!i)throw Error("Cannot find template with ID "+n);return new s.l.i(i)}if(1==n.nodeType||8==n.nodeType)return new s.l.Q(n);throw Error("Unknown template type: "+n);};s.v.prototype.renderTemplate=function(n,t,i,r){return n=this.makeTemplateSource(n,r),this.renderTemplateSource(n,t,i)};s.v.prototype.isTemplateRewritten=function(n,t){return!1===this.allowTemplateRewriting?!0:this.makeTemplateSource(n,t).data("isRewritten")};s.v.prototype.rewriteTemplate=function(n,t,i){n=this.makeTemplateSource(n,i);t=t(n.text());n.text(t);n.data("isRewritten",!0)};s.b("templateEngine",s.v);s.Ea=function(){function n(n,t,i,r){var o,f,u,e;for(n=s.g.da(n),o=s.g.S,f=0;f<n.length;f++)if(u=n[f].key,o.hasOwnProperty(u))if(e=o[u],"function"==typeof e){if(u=e(n[f].value))throw Error(u);}else if(!e)throw Error("This template engine does not support the '"+u+"' binding within its templates");return i="ko.__tr_ambtns(function($context,$element){return(function(){return{ "+s.g.ea(n)+" } })()},'"+i.toLowerCase()+"')",r.createJavaScriptEvaluatorBlock(i)+t}var t=/(<([a-z]+\d*)(?:\s+(?!data-bind\s*=\s*)[a-z0-9\-]+(?:=(?:\"[^\"]*\"|\'[^\']*\'))?)*\s+)data-bind\s*=\s*(["'])([\s\S]*?)\3/gi,i=/\x3c!--\s*ko\b\s*([\s\S]*?)\s*--\x3e/g;return{Ab:function(n,t,i){t.isTemplateRewritten(n,i)||t.rewriteTemplate(n,function(n){return s.Ea.Lb(n,t)},i)},Lb:function(r,u){return r.replace(t,function(t,i,r,f,e){return n(e,i,r,u)}).replace(i,function(t,i){return n(i,"<!-- ko -->","#comment",u)})},qb:function(n,t){return s.s.va(function(i,r){var u=i.nextSibling;u&&u.nodeName.toLowerCase()===t&&s.Ka(u,n,r)})}}}();s.b("__tr_ambtns",s.Ea.qb),function(){s.l={};s.l.i=function(n){this.i=n};s.l.i.prototype.text=function(){var n=s.a.u(this.i),n="script"===n?"text":"textarea"===n?"value":"innerHTML",t;if(0==arguments.length)return this.i[n];t=arguments[0];"innerHTML"===n?s.a.fa(this.i,t):this.i[n]=t};s.l.i.prototype.data=function(n){if(1===arguments.length)return s.a.f.get(this.i,"templateSourceData_"+n);s.a.f.set(this.i,"templateSourceData_"+n,arguments[1])};s.l.Q=function(n){this.i=n};s.l.Q.prototype=new s.l.i;s.l.Q.prototype.text=function(){if(0==arguments.length){var n=s.a.f.get(this.i,"__ko_anon_template__")||{};return n.Fa===t&&n.ma&&(n.Fa=n.ma.innerHTML),n.Fa}s.a.f.set(this.i,"__ko_anon_template__",{Fa:arguments[0]})};s.l.i.prototype.nodes=function(){if(0==arguments.length)return(s.a.f.get(this.i,"__ko_anon_template__")||{}).ma;s.a.f.set(this.i,"__ko_anon_template__",{ma:arguments[0]})};s.b("templateSources",s.l);s.b("templateSources.domElement",s.l.i);s.b("templateSources.anonymousTemplate",s.l.Q)}(),function(){function r(n,t,i){var r;for(t=s.e.nextSibling(t);n&&(r=n)!==t;)n=s.e.nextSibling(r),1!==r.nodeType&&8!==r.nodeType||i(r)}function u(n,t){if(n.length){var i=n[0],u=n[n.length-1];r(i,u,function(n){s.Ia(t,n)});r(i,u,function(n){s.s.nb(n,[t])})}}function n(n){return n.nodeType?n:0<n.length?n[0]:null}function f(t,r,f,e,o){o=o||{};var h=t&&n(t),h=h&&h.ownerDocument,c=o.templateEngine||i;if(s.Ea.Ab(f,c,h),f=c.renderTemplate(f,e,o,h),"number"!=typeof f.length||0<f.length&&"number"!=typeof f[0].nodeType)throw Error("Template engine must return an array of DOM nodes");h=!1;switch(r){case"replaceChildren":s.e.P(t,f);h=!0;break;case"replaceNode":s.a.eb(t,f);h=!0;break;case"ignoreTargetNode":break;default:throw Error("Unknown renderMode: "+r);}return h&&(u(f,e),o.afterRender&&s.q.I(o.afterRender,null,[f,e.$data])),f}var i;s.Ba=function(n){if(n!=t&&!(n instanceof s.v))throw Error("templateEngine must inherit from ko.templateEngine");i=n};s.za=function(r,u,e,o,h){if(e=e||{},(e.templateEngine||i)==t)throw Error("Set a template engine before calling renderTemplate");if(h=h||"replaceChildren",o){var c=n(o);return s.j(function(){var t=u&&u instanceof s.A?u:new s.A(s.a.c(u)),i="function"==typeof r?r(t.$data,t):r,t=f(o,h,i,t,e);"replaceNode"==h&&(o=t,c=n(o))},null,{Qa:function(){return!c||!s.a.aa(c)},$:c&&"replaceNode"==h?c.parentNode:c})}return s.s.va(function(n){s.za(r,u,e,n,"replaceNode")})};s.Rb=function(n,i,r,e,o){function c(n,t){u(t,h);r.afterRender&&r.afterRender(t,n)}function l(t,i){h=o.createChildContext(s.a.c(t),r.as);h.$index=i;var u="function"==typeof n?n(t,h):n;return f(null,"ignoreTargetNode",u,h,r)}var h;return s.j(function(){var n=s.a.c(i)||[];"undefined"==typeof n.length&&(n=[n]);n=s.a.Y(n,function(n){return r.includeDestroyed||n===t||null===n||!s.a.c(n._destroy)});s.q.I(s.a.Aa,null,[e,n,l,r,c])},null,{$:e})};s.d.template={init:function(n,t){var i=s.a.c(t());return"string"==typeof i||i.name||1!=n.nodeType&&8!=n.nodeType||(i=1==n.nodeType?n.childNodes:s.e.childNodes(n),i=s.a.Mb(i),new s.l.Q(n).nodes(i)),{controlsDescendantBindings:!0}},update:function(n,i,r,u,f){i=s.a.c(i());r={};u=!0;var e,o=null;"string"!=typeof i&&(r=i,i=s.a.c(r.name),"if"in r&&(u=s.a.c(r["if"])),u&&"ifnot"in r&&(u=!s.a.c(r.ifnot)),e=s.a.c(r.data));"foreach"in r?o=s.Rb(i||n,u&&r.foreach||[],r,n,f):u?(f="data"in r?f.createChildContext(e,r.as):f,o=s.za(i||n,f,r,n)):s.e.ba(n);f=o;(e=s.a.f.get(n,"__ko__templateComputedDomDataKey__"))&&"function"==typeof e.B&&e.B();s.a.f.set(n,"__ko__templateComputedDomDataKey__",f&&f.ta()?f:t)}};s.g.S.template=function(n){return n=s.g.da(n),1==n.length&&n[0].unknown||s.g.Jb(n,"name")?null:"This template engine does not support anonymous templates nested within its templates"};s.e.L.template=!0}();s.b("setTemplateEngine",s.Ba);s.b("renderTemplate",s.za);s.a.Pa=function(){function n(n,t,i,r,u){for(var o=Math.min,l=Math.max,s=[],a=n.length,f,h=t.length,c=h-a||1,w=a+h+1,v,p,b,y,e=0;e<=a;e++)for(p=v,s.push(v=[]),b=o(h,e+c),f=l(0,e-1);f<=b;f++)v[f]=f?e?n[e-1]===t[f-1]?p[f-1]:o(p[f]||w,v[f-1]||w)+1:f+1:e+1;for(o=[],l=[],c=[],e=a,f=h;e||f;)h=s[e][f]-1,f&&h===s[e][f-1]?l.push(o[o.length]={status:i,value:t[--f],index:f}):e&&h===s[e-1][f]?c.push(o[o.length]={status:r,value:n[--e],index:e}):(o.push({status:"retained",value:t[--f]}),--e);if(l.length&&c.length)for(n=10*a,t=i=0;(u||t<n)&&(y=l[i]);i++){for(r=0;s=c[r];r++)if(y.value===s.value){y.moved=s.index;s.moved=y.index;c.splice(r,1);t=r=0;break}t+=r}return o.reverse()}return function(t,i,r){return t=t||[],i=i||[],t.length<=i.length?n(t,i,"added","deleted",r):n(i,t,"deleted","added",r)}}();s.b("utils.compareArrays",s.a.Pa),function(){function n(n){for(;n.length&&!s.a.aa(n[0]);)n.splice(0,1);if(1<n.length){for(var t=n[0],r=n[n.length-1],i=[t];t!==r;){if(t=t.nextSibling,!t)return;i.push(t)}Array.prototype.splice.apply(n,[0,n.length].concat(i))}return n}function i(i,r,u,f,e){var o=[];return i=s.j(function(){var t=r(u,e,n(o))||[];0<o.length&&(s.a.eb(o,t),f&&s.q.I(f,null,[u,t,e]));o.splice(0,o.length);s.a.R(o,t)},null,{$:i,Qa:function(){return!s.a.pb(o)}}),{O:o,j:i.ta()?i:t}}s.a.Aa=function(r,u,f,e,o){function rt(t,i){h=k[i];nt!==i&&(it[t]=h);h.ra(nt++);n(h.O);g.push(h);p.push(h)}function v(n,t){if(n)for(var i=0,r=t.length;i<r;i++)t[i]&&s.a.p(t[i].O,function(r){n(r,i,t[i].X)})}var c,y,ut;u=u||[];e=e||{};var y=s.a.f.get(r,"setDomNodeChildrenFromArrayMapping_lastMappingResult")===t,k=s.a.f.get(r,"setDomNodeChildrenFromArrayMapping_lastMappingResult")||[],d=s.a.Z(k,function(n){return n.X}),l=s.a.Pa(d,u,e.dontLimitMoves),g=[],a=0,nt=0,tt=[],p=[];u=[];for(var it=[],d=[],h,c=0,w,b;w=l[c];c++)switch(b=w.moved,w.status){case"deleted":b===t&&(h=k[a],h.j&&h.j.B(),tt.push.apply(tt,n(h.O)),e.beforeRemove&&(u[c]=h,p.push(h)));a++;break;case"retained":rt(c,a++);break;case"added":b!==t?rt(c,b):(h={X:w.value,ra:s.m(nt++)},g.push(h),p.push(h),y||(d[c]=h))}for(v(e.beforeMove,it),s.a.p(tt,e.beforeRemove?s.H:s.removeNode),c=0,y=s.e.firstChild(r);h=p[c];c++){for(h.O||s.a.extend(h,i(r,f,h.X,o,h.ra)),a=0;l=h.O[a];y=l.nextSibling,ut=l,a++)l!==y&&s.e.Va(r,l,ut);!h.Fb&&o&&(o(h.X,h.O,h.ra),h.Fb=!0)}v(e.beforeRemove,u);v(e.afterMove,it);v(e.afterAdd,d);s.a.f.set(r,"setDomNodeChildrenFromArrayMapping_lastMappingResult",g)}}();s.b("utils.setDomNodeChildrenFromArrayMapping",s.a.Aa);s.D=function(){this.allowTemplateRewriting=!1};s.D.prototype=new s.v;s.D.prototype.renderTemplateSource=function(n){var t=(9>s.a.ca?0:n.nodes)?n.nodes():null;return t?s.a.N(t.cloneNode(!0).childNodes):(n=n.text(),s.a.xa(n))};s.D.sa=new s.D;s.Ba(s.D.sa);s.b("nativeTemplateEngine",s.D),function(){s.ua=function(){var n=this.Ib=function(){if("undefined"==typeof i||!i.tmpl)return 0;try{if(0<=i.tmpl.tag.tmpl.open.toString().indexOf("__"))return 2}catch(n){}return 1}();this.renderTemplateSource=function(t,u,f){if(f=f||{},2>n)throw Error("Your version of jQuery.tmpl is too old. Please upgrade to jQuery.tmpl 1.0.0pre or later.");var e=t.data("precompiled");return e||(e=t.text()||"",e=i.template(null,"{{ko_with $item.koBindingContext}}"+e+"{{/ko_with}}"),t.data("precompiled",e)),t=[u.$data],u=i.extend({koBindingContext:u},f.templateOptions),u=i.tmpl(e,t,u),u.appendTo(r.createElement("div")),i.fragments={},u};this.createJavaScriptEvaluatorBlock=function(n){return"{{ko_code ((function() { return "+n+" })()) }}"};this.addTemplate=function(n,t){r.write("<script type='text/html' id='"+n+"'>"+t+"<\/script>")};0<n&&(i.tmpl.tag.ko_code={open:"__.push($1 || '');"},i.tmpl.tag.ko_with={open:"with($1) {",close:"} "})};s.ua.prototype=new s.v;var n=new s.ua;0<n.Ib&&s.Ba(n);s.b("jqueryTmplTemplateEngine",s.ua)}()})})()}();!function(n){"function"==typeof require&&"object"==typeof exports&&"object"==typeof module?n(require("knockout"),require("jquery"),require("kendo")):"function"==typeof define&&define.amd?define(["knockout","jquery","kendo"],n):n(window.ko,window.jQuery,window.kendo)}(function(n,t,i,r){var y;i=i||window.kendo;n.kendo=n.kendo||{};n.kendo.BindingFactory=function(){var u=this,f;this.createBinding=function(i){if(t()[i.parent||i.name]){var r={};r.init=function(n,t,f,e,o){var s=u.buildOptions(i,t);return s.async===!0||i.async===!0&&s.async!==!1?(setTimeout(function(){r.setup(n,s,o)},0),void 0):(r.setup(n,s,o),s&&s.useKOTemplates?{controlsDescendantBindings:!0}:void 0)};r.setup=function(r,f,e){var o,s=t(r);u.setupTemplates(i.templates,f,r,e);o=u.getWidget(i,f,s);u.handleEvents(f,i,r,o,e);u.watchValues(o,f,i,r);o.destroy&&n.utils.domNodeDisposal.addDisposeCallback(r,function(){o.destroy()})};r.options={};r.widgetConfig=i;n.bindingHandlers[i.bindingName||i.name]=r}};this.buildOptions=function(t,r){var f=t.defaultOption,e=n.utils.extend({},n.bindingHandlers[t.name].options),u=n.utils.unwrapObservable(r());return u instanceof i.data.DataSource||"object"!=typeof u||null===u||f&&!(f in u)?e[f]=r():n.utils.extend(e,u),e};f=function(t,i){return function(r){return n.renderTemplate(t,i.createChildContext(r._raw&&r._raw()||r))}};this.setupTemplates=function(t,i,r,u){var e,h,o,s;if(t&&i&&i.useKOTemplates){for(e=0,h=t.length;h>e;e++)o=t[e],i[o]&&(i[o]=f(i[o],u));s=i.dataBound;i.dataBound=function(){n.memoization.unmemoizeDomNodeAndDescendants(r);s&&s.apply(this,arguments)}}};this.unwrapOneLevel=function(t){var r,u={};if(t)if(t instanceof i.data.DataSource)u=t;else if("object"==typeof t)for(r in t)u[r]=n.utils.unwrapObservable(t[r]);return u};this.getWidget=function(t,i,r){var u,f;return t.parent?(f=r.closest("[data-bind*='"+t.parent+":']"),u=f.length?f.data(t.parent):null):u=r[t.name](this.unwrapOneLevel(i)).data(t.name),n.isObservable(i.widget)&&i.widget(u),u};this.watchValues=function(n,t,i,r){var f,e=i.watch;if(e)for(f in e)e.hasOwnProperty(f)&&u.watchOneValue(f,n,t,i,r)};this.watchOneValue=function(i,u,f,e,o){var s=n.computed({read:function(){var a,l,s=e.watch[i],h=n.utils.unwrapObservable(f[i]),c=e.parent?[o]:[];t.isArray(s)?s=u[h?s[0]:s[1]]:"string"==typeof s?s=u[s]:l=!0;s&&f[i]!==r&&(l?c.push(h,f):(a=s.apply(u,c),c.push(h)),(l||a!==h)&&s.apply(u,c))},disposeWhenNodeIsRemoved:o}).extend({throttle:f.throttle||0===f.throttle?f.throttle:1});n.isObservable(f[i])||s.dispose()};this.handleEvents=function(n,t,i,r,f){var o,e,s=t.events;if(s)for(o in s)s.hasOwnProperty(o)&&(e=s[o],"string"==typeof e&&(e={value:e,writeTo:e}),u.handleOneEvent(o,e,n,i,r,t.childProp,f))};this.handleOneEvent=function(t,i,r,u,f,e,o){var s="function"==typeof i?i:r[i.call];"function"==typeof i?s=s.bind(o.$data,r):i.call&&"function"==typeof r[i.call]?s=r[i.call].bind(o.$data,o.$data):i.writeTo&&n.isWriteableObservable(r[i.writeTo])&&(s=function(n){var t,f;e&&n[e]&&n[e]!==u||(t=i.value,f="string"==typeof t&&this[t]?this[t](e&&u):t,r[i.writeTo](f))});s&&f.bind(t,s)}};n.kendo.bindingFactory=new n.kendo.BindingFactory;n.kendo.setDataSource=function(t,r,u){var f,e;return r instanceof i.data.DataSource?(t.setDataSource(r),void 0):(u&&u.useKOTemplates||(f=n.mapping&&r&&r.__ko_mapping__,e=r&&f?n.mapping.toJS(r):n.toJS(r)),t.dataSource.data(e||r),void 0)},function(){var n=i.data.ObservableArray.fn.wrap;i.data.ObservableArray.fn.wrap=function(t){var i=n.apply(this,arguments);return i._raw=function(){return t},i}}();var c=function(t){return function(i){i&&(n.utils.extend(this.options[t],i),this.redraw(),this.value(.001+this.value()))}},f=n.kendo.bindingFactory.createBinding.bind(n.kendo.bindingFactory),d="clicked",s="close",p="collapse",g="content",w="data",e="enable",b="expand",l="expanded",rt="error",ut="info",o="isOpen",a="max",v="min",h="open",nt="search",tt="selected",ft="success",it="size",u="value",k="values",et="warning";f({name:"kendoAutoComplete",events:{change:u,open:{writeTo:o,value:!0},close:{writeTo:o,value:!1}},watch:{enabled:e,search:[nt,s],data:function(t){n.kendo.setDataSource(this,t)},value:u}});f({name:"kendoButton",defaultOption:d,events:{click:{call:d}},watch:{enabled:e}});f({name:"kendoCalendar",defaultOption:u,events:{change:u},watch:{max:a,min:v,value:u}});f({name:"kendoColorPicker",events:{change:u,open:{writeTo:o,value:!0},close:{writeTo:o,value:!1}},watch:{enabled:e,value:u,color:u,palette:"palette"}});f({name:"kendoComboBox",events:{change:u,open:{writeTo:o,value:!0},close:{writeTo:o,value:!1}},watch:{enabled:e,isOpen:[h,s],data:function(t){n.kendo.setDataSource(this,t)},value:u}});f({name:"kendoDatePicker",defaultOption:u,events:{change:u,open:{writeTo:o,value:!0},close:{writeTo:o,value:!1}},watch:{enabled:e,max:a,min:v,value:u,isOpen:[h,s]}});f({name:"kendoDateTimePicker",defaultOption:u,events:{change:u,open:{writeTo:o,value:!0},close:{writeTo:o,value:!1}},watch:{enabled:e,max:a,min:v,value:u,isOpen:[h,s]}});f({name:"kendoDropDownList",events:{change:u,open:{writeTo:o,value:!0},close:{writeTo:o,value:!1}},watch:{enabled:e,isOpen:[h,s],data:function(t){n.kendo.setDataSource(this,t);t.length&&this.options.optionLabel&&this.select()<0&&this.select(0)},value:u}});f({name:"kendoEditor",defaultOption:u,events:{change:u},watch:{enabled:e,value:u}});f({name:"kendoGrid",defaultOption:w,watch:{data:function(t,i){n.kendo.setDataSource(this,t,i)}},templates:["rowTemplate","altRowTemplate"]});f({name:"kendoListView",defaultOption:w,watch:{data:function(t,i){n.kendo.setDataSource(this,t,i)}},templates:["template"]});f({name:"kendoMaskedTextBox",defaultOption:u,events:{change:u},watch:{enabled:e,isReadOnly:"readonly",value:u}});f({name:"kendoMenu",async:!0});f({name:"kendoMenuItem",parent:"kendoMenu",watch:{enabled:e,isOpen:[h,s]},async:!0});f({name:"kendoMultiSelect",events:{change:u,open:{writeTo:o,value:!0},close:{writeTo:o,value:!1}},watch:{enabled:e,search:[nt,s],data:function(t){n.kendo.setDataSource(this,t)},value:u}});y=function(n,t){t||0===t?this.show(t,n):this.hide()};f({name:"kendoNotification",watch:{error:function(n){y.call(this,rt,n)},info:function(n){y.call(this,ut,n)},success:function(n){y.call(this,ft,n)},warning:function(n){y.call(this,et,n)}}});f({name:"kendoNumericTextBox",defaultOption:u,events:{change:u},watch:{enabled:e,value:u,max:function(n){this.options.max=n;var t=this.value();(t||0===t)&&t>n&&this.value(n)},min:function(n){this.options.min=n;var t=this.value();(t||0===t)&&n>t&&this.value(n)}}});f({name:"kendoPanelBar",async:!0});f({name:"kendoPanelItem",parent:"kendoPanelBar",watch:{enabled:e,expanded:[b,p],selected:["select"]},childProp:"item",events:{expand:{writeTo:l,value:!0},collapse:{writeTo:l,value:!1},select:{writeTo:tt,value:u}},async:!0});f({name:"kendoProgressBar",defaultOption:u,events:{change:u},watch:{enabled:e,value:u}});f({name:"kendoRangeSlider",defaultOption:k,events:{change:k},watch:{values:k,enabled:e}});f({async:!0,name:"kendoScheduler",watch:{data:function(t,i){n.kendo.setDataSource(this,t,i)}}});f({name:"kendoSlider",defaultOption:u,events:{change:u},watch:{value:u,enabled:e}});f({name:"kendoSortable",defaultOption:w,events:{end:function(i,r){var u="__ko_kendo_sortable_data__",f="receive"!==r.action?n.dataFor(r.item[0]):r.draggableEvent[u],o=i.data,e=i.data;("sort"===r.action||"remove"===r.action)&&(e.splice(r.oldIndex,1),"remove"===r.action&&(r.draggableEvent[u]=f));("sort"===r.action||"receive"===r.action)&&(e.splice(r.newIndex,0,f),delete r.draggableEvent[u],t(r.draggableEvent.target).hide(),r.preventDefault());o.valueHasMutated()}}});f({name:"kendoSplitter",async:!0});f({name:"kendoSplitterPane",parent:"kendoSplitter",watch:{max:a,min:v,size:it,expanded:[b,p]},childProp:"pane",events:{collapse:{writeTo:l,value:!1},expand:{writeTo:l,value:!0},resize:it},async:!0});f({name:"kendoTabStrip",async:!0});f({name:"kendoTab",parent:"kendoTabStrip",watch:{enabled:e},childProp:"item",async:!0});f({name:"kendoTooltip",events:{},watch:{content:g,filter:"filter"}});f({name:"kendoTimePicker",defaultOption:u,events:{change:u},watch:{max:a,min:v,value:u,enabled:e,isOpen:[h,s]}});f({name:"kendoTreeView",async:!0});f({name:"kendoTreeItem",parent:"kendoTreeView",watch:{enabled:e,expanded:[b,p],selected:function(n,t){t?this.select(n):this.select()[0]==n&&this.select(null)}},childProp:"node",events:{collapse:{writeTo:l,value:!1},expand:{writeTo:l,value:!0},select:{writeTo:tt,value:!0}},async:!0});f({name:"kendoUpload",watch:{enabled:e}});f({async:!0,name:"kendoWindow",events:{open:{writeTo:o,value:!0},close:{writeTo:o,value:!1}},watch:{content:g,title:"title",isOpen:[h,s]}});f({name:"kendoChart",watch:{data:function(t){n.kendo.setDataSource(this,t)}}});f({name:"kendoLinearGauge",defaultOption:u,watch:{value:u,gaugeArea:c("gaugeArea"),pointer:c("pointer"),scale:c("scale")}});f({name:"kendoRadialGauge",defaultOption:u,watch:{value:u,gaugeArea:c("gaugeArea"),pointer:c("pointer"),scale:c("scale")}})});Raphael=function(){function n(){var r;if(n.is(arguments[0],et)){for(var i=arguments[0],f=rr[b](n,i.splice(0,3+n.is(i[0],nt))),e=f.set(),u=0,o=i[t];u<o;u++)r=i[u]||{},ku.test(r.type)&&e[a](f[r.type]().attr(r));return e}return rr[b](n,arguments)}function y(){}function si(t){var u,i;return n.vml?(u=/^\s+|\s+$/g,si=ut(function(n){var f,t,i;n=(n+r)[w](u,r);try{t=new st.ActiveXObject("htmlfile");t.write("<body>");t.close();f=t.body}catch(e){f=st.createPopup().document.body}t=f.createTextRange();try{return f.style.color=n,i=t.queryCommandValue("ForeColor"),i=(i&255)<<16|i&65280|(i&16711680)>>>16,"#"+("000000"+i[d](16)).slice(-6)}catch(o){return"none"}})):(i=c.createElement("i"),i.title="Raphaël Colour Picker",i.style.display="none",c.body[o](i),si=ut(function(n){return i.style.color=n,c.defaultView.getComputedStyle(i,r).getPropertyValue("color")})),si(t)}function nf(){return"hsb("+[this.h,this.s,this.b]+")"}function tf(){return this.hex}function ut(n,r,u){function f(){var c=Array[i].slice.call(arguments,0),e=c[tt]("►"),o=f.cache=f.cache||{},h=f.count=f.count||[];return o[s](e)?u?u(o[e]):o[e]:(h[t]>=1e3&&delete o[h.shift()],h[a](e),o[e]=n[b](r,c),u?u(o[e]):o[e])}return f}function ci(i){var f=[],r,e,u,o;for(n.is(i,et)&&n.is(i&&i[0],et)||(i=n.parsePathString(i)),r=0,e=i[t];r<e;r++)for(f[r]=[],u=0,o=i[r][t];u<o;u++)f[r][u]=i[r][u];return f[d]=n._path2string,f}function li(n,t,i,r){return[n,t,i,r,i,r]}function vr(n,t,i,r,u,f){var e=1/3,o=2/3;return[e*n+o*i,e*t+o*r,e*u+o*i,e*f+o*r,u,f]}function yr(n,i,r,u,f,o,s,h,c,l){var y=e.PI,it=y*120/180,g=y/180*(+f||0),b=[],a,nt=ut(function(n,t,i){var r=n*e.cos(i)-t*e.sin(i);return n=n*e.sin(i)+t*e.cos(i),{x:r,y:n}}),d,w,v;if(l?(v=l[0],a=l[1],o=l[2],w=l[3]):(a=nt(n,i,-g),n=a.x,i=a.y,a=nt(h,c,-g),h=a.x,c=a.y,e.cos(y/180*f),e.sin(y/180*f),a=(n-h)/2,v=(i-c)/2,w=a*a/(r*r)+v*v/(u*u),w>1&&(w=e.sqrt(w),r=w*r,u=w*u),w=r*r,d=u*u,w=(o==s?-1:1)*e.sqrt(e.abs((w*d-w*v*v-d*a*a)/(w*v*v+d*a*a))),o=w*r*v/u+(n+h)/2,w=w*-u*a/r+(i+c)/2,v=e.asin(((i-w)/u).toFixed(7)),a=e.asin(((c-w)/u).toFixed(7)),v=n<o?y-v:v,a=h<o?y-a:a,v<0&&(v=y*2+v),a<0&&(a=y*2+a),s&&v>a&&(v-=y*2),!s&&a>v&&(a-=y*2)),y=a-v,e.abs(y)>it&&(b=a,y=h,d=c,a=v+it*(s&&a>v?1:-1),h=o+r*e.cos(a),c=w+u*e.sin(a),b=yr(h,c,r,u,f,0,s,y,d,[a,b,o,w])),y=a-v,f=e.cos(v),o=e.sin(v),s=e.cos(a),a=e.sin(a),y=e.tan(y/4),r=4/3*r*y,y=4/3*u*y,u=[n,i],n=[n+r*o,i-y*f],i=[h+r*a,c-y*s],h=[h,c],n[0]=2*u[0]-n[0],n[1]=2*u[1]-n[1],l)return[n,i,h][k](b);for(b=[n,i,h][k](b)[tt]()[p](","),l=[],h=0,c=b[t];h<c;h++)l[h]=h%2?nt(b[h-1],b[h],g).y:nt(b[h],b[h+1],g).x;return l}function ii(n,t,i,r,u,f,e,o,s){var h=1-s;return{x:l(h,3)*n+l(h,2)*3*s*i+h*3*s*s*u+l(s,3)*e,y:l(h,3)*t+l(h,2)*3*s*r+h*3*s*s*f+l(s,3)*o}}function wr(t,i,r,u){if(n.is(t,wt)||n.is(t,"object")){if(t=n.is(t,wt)?c.getElementById(t):t,t.tagName)return i==null?{container:t,width:t.style.pixelWidth||t.offsetWidth,height:t.style.pixelHeight||t.offsetHeight}:{container:t,width:i,height:r}}else return{container:1,x:t,y:i,width:r,height:u}}function nr(n,t){var r=this;for(var i in t)if(t[s](i)&&!(i in n))switch(typeof t[i]){case"function":(function(t){n[i]=n===r?t:function(){return t[b](r,arguments)}})(t[i]);break;case"object":n[i]=n[i]||{};nr.call(this,n[i],t[i]);break;default:n[i]=t[i]}}function gt(n,t){n==t.top&&(t.top=n.prev);n==t.bottom&&(t.bottom=n.next);n.next&&(n.next.prev=n.prev);n.prev&&(n.prev.next=n.next)}function br(n,t){t.top!==n&&(gt(n,t),n.next=null,n.prev=t.top,t.top.next=n,t.top=n)}function kr(n,t){t.bottom!==n&&(gt(n,t),n.next=t.bottom,n.prev=null,t.bottom.prev=n,t.bottom=n)}function dr(n,t,i){gt(n,i);t==i.top&&(i.top=n);t.next&&(t.next.prev=n);n.next=t.next;n.prev=t;t.next=n}function gr(n,t,i){gt(n,i);t==i.bottom&&(i.bottom=n);t.prev&&(t.prev.next=n);n.prev=t.prev;t.prev=n;n.next=t}function nu(n){return function(){throw new Error("Raphaël: you are calling to method “"+n+"” of removed object");}}function cf(){this.returnValue=!1}function lf(){return this.originalEvent.preventDefault()}function af(){this.cancelBubble=!0}function vf(){return this.originalEvent.stopPropagation()}function vu(){return this.x+g+this.y}function fr(t,i){return function(r,u,f){r=ai(r);for(var o,s,e,l,h="",a={},c=0,v=0,y=r.length;v<y;v++){if(e=r[v],e[0]=="M")o=+e[1],s=+e[2];else{if(l=yf(o,s,e[1],e[2],e[3],e[4],e[5],e[6]),c+l>u){if(i&&!a.start){if(o=ur(o,s,e[1],e[2],e[3],e[4],e[5],e[6],u-c),h+=["C",o.start.x,o.start.y,o.m.x,o.m.y,o.x,o.y],f)return h;a.start=h;h=["M",o.x,o.y+"C",o.n.x,o.n.y,o.end.x,o.end.y,e[5],e[6]][tt]();c+=l;o=+e[5];s=+e[6];continue}if(!t&&!i)return o=ur(o,s,e[1],e[2],e[3],e[4],e[5],e[6],u-c),{x:o.x,y:o.y,alpha:o.alpha}}c+=l;o=+e[5];s=+e[6]}h+=e}return a.end=h,o=t?c:i?a:n.findDotsAtSegment(o,s,e[1],e[2],e[3],e[4],e[5],e[6],1),o.alpha&&(o={x:o.x,y:o.y,alpha:o.alpha}),o}}function pu(){var et=+new Date,p,l,i,ut,k,ft;for(p in rt)if(p!="length"&&rt[s](p))if(l=rt[p],l.stop||l.el.removed)delete rt[p],rt[t]--;else{var w=et-l.start,a=l.ms,u=l.easing,o=l.from,f=l.diff,h=l.to,b=l.t,d=l.prev||0,c=l.el,y=l.callback,it={},e;if(w<a){y=n.easing_formulas[u]?n.easing_formulas[u](w/a):w/a;for(i in o)if(o[s](i)){switch(di[i]){case"along":e=y*a*f[i];h.back&&(e=h.len-e);u=vi(h[i],e);c.translate(f.sx-f.x||0,f.sy-f.y||0);f.x=u.x;f.y=u.y;c.translate(u.x-f.sx,u.y-f.sy);h.rot&&c.rotate(f.r+u.alpha,u.x,u.y);break;case nt:e=+o[i]+y*a*f[i];break;case"colour":e="rgb("+[or(v(o[i].r+y*a*f[i].r)),or(v(o[i].g+y*a*f[i].g)),or(v(o[i].b+y*a*f[i].b))][tt](",")+")";break;case"path":for(e=[],u=0,ut=o[i][t];u<ut;u++){for(e[u]=[o[i][u][0]],k=1,ft=o[i][u][t];k<ft;k++)e[u][k]=+o[i][u][k]+y*a*f[i][u][k];e[u]=e[u][tt](g)}e=e[tt](g);break;case"csv":switch(i){case"translation":e=f[i][0]*(w-d);u=f[i][1]*(w-d);b.x+=e;b.y+=u;e=e+g+u;break;case"rotation":e=+o[i][0]+y*a*f[i][0];o[i][1]&&(e+=","+o[i][1]+","+o[i][2]);break;case"scale":e=[+o[i][0]+y*a*f[i][0],+o[i][1]+y*a*f[i][1],2 in h[i]?h[i][2]:r,3 in h[i]?h[i][3]:r][tt](g);break;case"clip-rect":for(e=[],u=4;u--;)e[u]=+o[i][u]+y*a*f[i][u]}}it[i]=e}c.attr(it);c._run&&c._run.call(c)}else h.along&&(u=vi(h.along,h.len*!h.back),c.translate(f.sx-(f.x||0)+u.x-f.sx,f.sy-(f.y||0)+u.y-f.sy),h.rot&&c.rotate(f.r+u.alpha,u.x,u.y)),(b.x||b.y)&&c.translate(-b.x,-b.y),h.scale&&(h.scale+=r),c.attr(h),delete rt[p],rt[t]--,c.in_animation=null,n.is(y,"function")&&y.call(c);l.prev=w}n.svg&&c&&c.paper&&c.paper.safari();rt[t]&&st.setTimeout(pu)}function or(n){return ht(lt(n,255),0)}function yi(n,t){if(n==null)return{x:this._.tx,y:this._.ty,toString:vu};this._.tx+=+n;this._.ty+=+t;switch(this.type){case"circle":case"ellipse":this.attr({cx:+n+this.attrs.cx,cy:+t+this.attrs.cy});break;case"rect":case"image":case"text":this.attr({x:+n+this.attrs.x,y:+t+this.attrs.y});break;case"path":var i=gi(this.attrs.path);i[0][1]+=+n;i[0][2]+=+t;this.attr({path:i})}return this}function wu(t){return function(i,r,f,e){var o={back:t};return n.is(f,"function")?e=f:o.rot=f,i&&i.constructor==u&&(i=i.attrs.path),i&&(o.along=i),this.animate(o,r,e)}}function ct(n){if(this.items=[],this[t]=0,this.type="set",n)for(var i=0,r=n[t];i<r;i++)n[i]&&(n[i].constructor==u||n[i].constructor==ct)&&(this[this.items[t]]=this.items[this.items[t]]=n[i],this[t]++)}var bt,lr,ar,ti,gi,dt,tr,f,cu,it,au,ur,rt,pi,bu;n.version="1.4.3";var ft=/[, ]+/,ku=/^(circle|rect|path|ellipse|text|image)$/,i="prototype",s="hasOwnProperty",c=document,st=window,sr={was:Object[i][s].call(st,"Raphael"),is:st.Raphael};var o="appendChild",b="apply",k="concat",wi="createTouch"in c,r="",g=" ",p="split",hr="click dblclick mousedown mousemove mouseout mouseover mouseup touchstart touchmove touchend orientationchange touchcancel gesturestart gesturechange gestureend"[p](g),bi={mousedown:"touchstart",mousemove:"touchmove",mouseup:"touchend"},tt="join",t="length",yt=String[i].toLowerCase,e=Math,ht=e.max,lt=e.min,nt="number",wt="string",et="array",d="toString",at="fill",du=Object[i][d],l=e.pow,a="push",kt=/^(?=[\da-f]$)/,cr=/^url\(['"]?([^\)]+?)['"]?\)$/i,gu=/^\s*((#[a-f\d]{6})|(#[a-f\d]{3})|rgba?\(\s*([\d\.]+\s*,\s*[\d\.]+\s*,\s*[\d\.]+(?:\s*,\s*[\d\.]+)?)\s*\)|rgba?\(\s*([\d\.]+%\s*,\s*[\d\.]+%\s*,\s*[\d\.]+%(?:\s*,\s*[\d\.]+%))\s*\)|hs[bl]\(\s*([\d\.]+\s*,\s*[\d\.]+\s*,\s*[\d\.]+)\s*\)|hs[bl]\(\s*([\d\.]+%\s*,\s*[\d\.]+%\s*,\s*[\d\.]+%)\s*\))\s*$/i,v=e.round,ot="setAttribute",h=parseFloat,pt=parseInt,ki=" progid:DXImageTransform.Microsoft",ei=String[i].toUpperCase,oi={blur:0,"clip-rect":"0 0 1e9 1e9",cursor:"default",cx:0,cy:0,fill:"#fff","fill-opacity":1,font:'10px "Arial"',"font-family":'"Arial"',"font-size":"10","font-style":"normal","font-weight":400,gradient:0,height:0,href:"http://raphaeljs.com/",opacity:1,path:"M0,0",r:0,rotation:0,rx:0,ry:0,scale:"1 1",src:"",stroke:"#000","stroke-dasharray":"","stroke-linecap":"butt","stroke-linejoin":"butt","stroke-miterlimit":0,"stroke-opacity":1,"stroke-width":1,target:"_blank","text-anchor":"middle",title:"Raphael",translation:"0 0",width:0,x:0,y:0},di={along:"along",blur:nt,"clip-rect":"csv",cx:nt,cy:nt,fill:"colour","fill-opacity":nt,"font-size":nt,height:nt,opacity:nt,path:"path",r:nt,rotation:"csv",rx:nt,ry:nt,scale:"csv",stroke:"colour","stroke-opacity":nt,"stroke-width":nt,translation:"csv",width:nt,x:nt,y:nt},w="replace";if(n.type=st.SVGAngle||c.implementation.hasFeature("http://www.w3.org/TR/SVG11/feature#BasicStructure","1.1")?"SVG":"VML",n.type=="VML"){if(bt=c.createElement("div"),bt.innerHTML="<!--[if vml]><br><br><![endif]-->",bt.childNodes[t]!=2)return n.type=null;bt=null}n.svg=!(n.vml=n.type=="VML");y[i]=n[i];n._id=0;n._oid=0;n.fn={};n.is=function(n,t){return t=yt.call(t),t=="object"&&n===Object(n)||t=="undefined"&&typeof n==t||t=="null"&&n==null||yt.call(du.call(n).slice(8,-1))==t};n.setWindow=function(n){st=n;c=st.document};n.hsb2rgb=ut(function(t,i,r){var u;if(n.is(t,"object")&&"h"in t&&"s"in t&&"b"in t&&(r=t.b,i=t.s,t=t.h),r==0)return{r:0,g:0,b:0,hex:"#000"};(t>1||i>1||r>1)&&(t/=255,i/=255,r/=255);u=~~(t*6);t=t*6-u;var f=r*(1-i),o=r*(1-i*t),e=r*(1-i*(1-t));return t=[r,o,f,f,e,r,r][u],i=[e,r,r,o,f,f,e][u],u=[f,f,e,r,r,o,f][u],t*=255,i*=255,u*=255,r={r:t,g:i,b:u,toString:tf},t=(~~t)[d](16),i=(~~i)[d](16),u=(~~u)[d](16),t=t[w](kt,"0"),i=i[w](kt,"0"),u=u[w](kt,"0"),r.hex="#"+t+i+u,r},n);n.rgb2hsb=ut(function(t,i,r){var f,u,e,o;return(n.is(t,"object")&&"r"in t&&"g"in t&&"b"in t&&(r=t.b,i=t.g,t=t.r),n.is(t,wt)&&(f=n.getRGB(t),t=f.r,i=f.g,r=f.b),(t>1||i>1||r>1)&&(t/=255,i/=255,r/=255),u=ht(t,i,r),e=lt(t,i,r),f=u,e==u)?{h:0,s:0,b:u}:(o=u-e,e=o/u,t=t==u?(i-r)/o:i==u?2+(r-t)/o:4+(t-i)/o,t/=6,t<0&&t++,t>1&&t--,{h:t,s:e,b:f,toString:nf})},n);var rf=/,?([achlmqrstvxz]),?/gi,hi=/\s*,\s*/,uf={hs:1,rg:1};n._path2string=function(){return this.join(",")[w](rf,"$1")};n.getRGB=ut(function(t){if(!t||(t+=r).indexOf("-")+1)return{r:-1,g:-1,b:-1,hex:"none",error:1};if(t=="none")return{r:-1,g:-1,b:-1,hex:"none"};uf[s](t.substring(0,2))||t.charAt()=="#"||(t=si(t));var i,u,f,o,e;return(t=t.match(gu))?(t[2]&&(f=pt(t[2].substring(5),16),u=pt(t[2].substring(3,5),16),i=pt(t[2].substring(1,3),16)),t[3]&&(f=pt((e=t[3].charAt(3))+e,16),u=pt((e=t[3].charAt(2))+e,16),i=pt((e=t[3].charAt(1))+e,16)),t[4]&&(t=t[4][p](hi),i=h(t[0]),u=h(t[1]),f=h(t[2]),o=h(t[3])),t[5]&&(t=t[5][p](hi),i=h(t[0])*2.55,u=h(t[1])*2.55,f=h(t[2])*2.55,o=h(t[3])),t[6])?(t=t[6][p](hi),i=h(t[0]),u=h(t[1]),f=h(t[2]),n.hsb2rgb(i,u,f)):t[7]?(t=t[7][p](hi),i=h(t[0])*2.55,u=h(t[1])*2.55,f=h(t[2])*2.55,n.hsb2rgb(i,u,f)):(t={r:i,g:u,b:f},i=(~~i)[d](16),u=(~~u)[d](16),f=(~~f)[d](16),i=i[w](kt,"0"),u=u[w](kt,"0"),f=f[w](kt,"0"),t.hex="#"+i+u+f,isFinite(h(o))&&(t.o=o),t):{r:-1,g:-1,b:-1,hex:"none",error:1}},n);n.getColor=function(n){n=this.getColor.start=this.getColor.start||{h:0,s:1,b:n||.75};var t=this.hsb2rgb(n.h,n.s,n.b);return n.h+=.075,n.h>1&&(n.h=0,n.s-=.2,n.s<=0&&(this.getColor.start={h:0,s:1,b:n.b})),t.hex};n.getColor.reset=function(){delete this.start};lr=/([achlmqstvz])[\s,]*((-?\d*\.?\d*(?:e[-+]?\d+)?\s*,?\s*)+)/ig;ar=/(-?\d*\.?\d*(?:e[-+]?\d+)?)\s*,?\s*/ig;n.parsePathString=ut(function(i){if(!i)return null;var f={a:7,c:6,h:1,l:2,m:2,q:4,s:4,t:2,v:1,z:0},u=[];return n.is(i,et)&&n.is(i[0],et)&&(u=ci(i)),u[t]||(i+r)[w](lr,function(n,i,r){var e=[];for(n=yt.call(i),r[w](ar,function(n,t){t&&e[a](+t)}),n=="m"&&e[t]>2&&(u[a]([i][k](e.splice(0,2))),n="l",i=i=="m"?"l":"L");e[t]>=f[n];)if(u[a]([i][k](e.splice(0,f[n]))),!f[n])break}),u[d]=n._path2string,u});n.findDotsAtSegment=function(n,t,i,r,u,f,o,s,h){var c=1-h,w=l(c,3)*n+l(c,2)*3*h*i+c*3*h*h*u+l(h,3)*o;c=l(c,3)*t+l(c,2)*3*h*r+c*3*h*h*f+l(h,3)*s;var a=n+2*h*(i-n)+h*h*(u-2*i+n),v=t+2*h*(r-t)+h*h*(f-2*r+t),y=i+2*h*(u-i)+h*h*(o-2*u+i),p=r+2*h*(f-r)+h*h*(s-2*f+r);return n=(1-h)*n+h*i,t=(1-h)*t+h*r,u=(1-h)*u+h*o,f=(1-h)*f+h*s,s=90-e.atan((a-y)/(v-p))*180/e.PI,(a>y||v<p)&&(s+=180),{x:w,y:c,m:{x:a,y:v},n:{x:y,y:p},start:{x:n,y:t},end:{x:u,y:f},alpha:s}};ti=ut(function(n){if(!n)return{x:0,y:0,width:0,height:0};n=ai(n);for(var r=0,e=0,u=[],f=[],i,o=0,s=n[t];o<s;o++)i=n[o],i[0]=="M"?(r=i[1],e=i[2],u[a](r),f[a](e)):(r=ff(r,e,i[1],i[2],i[3],i[4],i[5],i[6]),u=u[k](r.min.x,r.max.x),f=f[k](r.min.y,r.max.y),r=i[5],e=i[6]);return n=lt[b](0,u),i=lt[b](0,f),{x:n,y:i,width:ht[b](0,u)-n,height:ht[b](0,f)-i}});gi=ut(function(i){var v,u,r,h,y;n.is(i,et)&&n.is(i&&i[0],et)||(i=n.parsePathString(i));var e=[],s=0,o=0,c=0,l=0,f=0;for(i[0][0]=="M"&&(s=i[0][1],o=i[0][2],c=s,l=o,f++,e[a](["M",s,o])),f=f,v=i[t];f<v;f++){if(u=e[f]=[],r=i[f],r[0]!=yt.call(r[0])){u[0]=yt.call(r[0]);switch(u[0]){case"a":u[1]=r[1];u[2]=r[2];u[3]=r[3];u[4]=r[4];u[5]=r[5];u[6]=+(r[6]-s).toFixed(3);u[7]=+(r[7]-o).toFixed(3);break;case"v":u[1]=+(r[1]-o).toFixed(3);break;case"m":c=r[1];l=r[2];default:for(h=1,y=r[t];h<y;h++)u[h]=+(r[h]-(h%2?s:o)).toFixed(3)}}else for(e[f]=[],r[0]=="m"&&(c=r[1]+s,l=r[2]+o),u=0,h=r[t];u<h;u++)e[f][u]=r[u];r=e[f][t];switch(e[f][0]){case"z":s=c;o=l;break;case"h":s+=+e[f][r-1];break;case"v":o+=+e[f][r-1];break;default:s+=+e[f][r-2];o+=+e[f][r-1]}}return e[d]=n._path2string,e},0,ci);dt=ut(function(i){var v,u,r,e,c;n.is(i,et)&&n.is(i&&i[0],et)||(i=n.parsePathString(i));var h=[],o=0,s=0,l=0,a=0,f=0;for(i[0][0]=="M"&&(o=+i[0][1],s=+i[0][2],l=o,a=s,f++,h[0]=["M",o,s]),f=f,v=i[t];f<v;f++){if(u=h[f]=[],r=i[f],r[0]!=ei.call(r[0])){u[0]=ei.call(r[0]);switch(u[0]){case"A":u[1]=r[1];u[2]=r[2];u[3]=r[3];u[4]=r[4];u[5]=r[5];u[6]=+(r[6]+o);u[7]=+(r[7]+s);break;case"V":u[1]=+r[1]+s;break;case"H":u[1]=+r[1]+o;break;case"M":l=+r[1]+o;a=+r[2]+s;default:for(e=1,c=r[t];e<c;e++)u[e]=+r[e]+(e%2?o:s)}}else for(e=0,c=r[t];e<c;e++)h[f][e]=r[e];switch(u[0]){case"Z":o=l;s=a;break;case"H":o=u[1];break;case"V":s=u[1];break;default:o=h[f][h[f][t]-2];s=h[f][h[f][t]-1]}}return h[d]=n._path2string,h},null,ci);var ff=ut(function(n,t,i,r,u,f,o,s){var c=u-2*i+n-(o-2*u+i),l=2*(i-n)-2*(u-i),p=n-i,h=(-l+e.sqrt(l*l-4*c*p))/2/c,v,y;return c=(-l-e.sqrt(l*l-4*c*p))/2/c,v=[t,s],y=[n,o],e.abs(h)>1e12&&(h=.5),e.abs(c)>1e12&&(c=.5),h>0&&h<1&&(h=ii(n,t,i,r,u,f,o,s,h),y[a](h.x),v[a](h.y)),c>0&&c<1&&(h=ii(n,t,i,r,u,f,o,s,c),y[a](h.x),v[a](h.y)),c=f-2*r+t-(s-2*f+r),l=2*(r-t)-2*(f-r),p=t-r,h=(-l+e.sqrt(l*l-4*c*p))/2/c,c=(-l-e.sqrt(l*l-4*c*p))/2/c,e.abs(h)>1e12&&(h=.5),e.abs(c)>1e12&&(c=.5),h>0&&h<1&&(h=ii(n,t,i,r,u,f,o,s,h),y[a](h.x),v[a](h.y)),c>0&&c<1&&(h=ii(n,t,i,r,u,f,o,s,c),y[a](h.x),v[a](h.y)),{min:{x:lt[b](0,y),y:lt[b](0,v)},max:{x:ht[b](0,y),y:ht[b](0,v)}}}),ai=ut(function(n,i){function a(n,t){var i;if(!n)return["C",t.x,t.y,t.x,t.y,t.x,t.y];n[0]in{T:1,Q:1}||(t.qx=t.qy=null);switch(n[0]){case"M":t.X=n[1];t.Y=n[2];break;case"A":n=["C"][k](yr[b](0,[t.x,t.y][k](n.slice(1))));break;case"S":i=t.x+(t.x-(t.bx||t.x));t=t.y+(t.y-(t.by||t.y));n=["C",i,t][k](n.slice(1));break;case"T":t.qx=t.x+(t.x-(t.qx||t.x));t.qy=t.y+(t.y-(t.qy||t.y));n=["C"][k](vr(t.x,t.y,t.qx,t.qy,n[1],n[2]));break;case"Q":t.qx=n[1];t.qy=n[2];n=["C"][k](vr(t.x,t.y,n[1],n[2],n[3],n[4]));break;case"L":n=["C"][k](li(t.x,t.y,n[1],n[2]));break;case"H":n=["C"][k](li(t.x,t.y,n[1],t.y));break;case"V":n=["C"][k](li(t.x,t.y,t.x,n[1]));break;case"Z":n=["C"][k](li(t.x,t.y,t.X,t.Y))}return n}function v(n,i){if(n[i][t]>7){n[i].shift();for(var u=n[i];u[t];)n.splice(i++,0,["C"][k](u.splice(0,6)));n.splice(i,1);s=ht(f[t],r&&r[t]||0)}}function y(n,i,u,e,o){n&&i&&n[o][0]=="M"&&i[o][0]!="M"&&(i.splice(o,0,["M",e.x,e.y]),u.bx=0,u.by=0,u.x=n[o][1],u.y=n[o][2],s=ht(f[t],r&&r[t]||0))}var f=dt(n),r=i&&dt(i),u,s;for(n={x:0,y:0,bx:0,by:0,X:0,Y:0,qx:null,qy:null},i={x:0,y:0,bx:0,by:0,X:0,Y:0,qx:null,qy:null},u=0,s=ht(f[t],r&&r[t]||0);u<s;u++){f[u]=a(f[u],n);v(f,u);r&&(r[u]=a(r[u],i));r&&v(r,u);y(f,r,n,i,u);y(r,f,i,n,u);var e=f[u],o=r&&r[u],c=e[t],l=r&&o[t];n.x=e[c-2];n.y=e[c-1];n.bx=h(e[c-4])||n.x;n.by=h(e[c-3])||n.y;i.bx=r&&(h(o[l-4])||i.x);i.by=r&&(h(o[l-3])||i.y);i.x=r&&o[l-2];i.y=r&&o[l-1]}return r?[f,r]:f},null,ci),pr=ut(function(i){for(var r,f,e=[],u=0,o=i[t];u<o;u++){if(r={},f=i[u].match(/^([^:]*):?([\d\.]*)/),r.color=n.getRGB(f[1]),r.color.error)return null;r.color=r.color.hex;f[2]&&(r.offset=f[2]+"%");e[a](r)}for(u=1,o=e[t]-1;u<o;u++)if(!e[u].offset){for(i=h(e[u-1].offset||0),f=0,r=u+1;r<o;r++)if(e[r].offset){f=e[r].offset;break}for(f||(f=100,r=o),f=h(f),f=(f-i)/(r-u+1);u<r;u++)i+=f,e[u].offset=i+"%"}return e});if(tr=/^r(?:\(([^,]+?)\s*,\s*([^\)]+?)\))?/,n.svg){y[i].svgns="http://www.w3.org/2000/svg";y[i].xlink="http://www.w3.org/1999/xlink";v=function(n){return+n+(~~n===n)*.5};f=function(n,t){if(t)for(var u in t)t[s](u)&&n[ot](u,t[u]+r);else return n=c.createElementNS(y[i].svgns,n),n.style.webkitTapHighlightColor="rgba(0,0,0,0)",n};n[d]=function(){return"Your browser supports SVG.\nYou are running Raphaël "+this.version};var tu=function(n,t){var i=f("path");return t.canvas&&t.canvas[o](i),t=new u(i,t),t.type="path",vt(t,{fill:"none",stroke:"#000",path:n}),t},ri=function(i,u,s){var b="linear",k=.5,y=.5,g=i.style,a,v,nt;if(u=(u+r)[w](tr,function(n,t,i){return b="radial",t&&i&&(k=h(t),y=h(i),n=(y>.5)*2-1,l(k-.5,2)+l(y-.5,2)>.25&&(y=e.sqrt(.25-l(k-.5,2))*n+.5)&&y!=.5&&(y=y.toFixed(5)-1e-5*n)),r}),u=u[p](/\s*\-\s*/),b=="linear"){if(a=u.shift(),a=-h(a),isNaN(a))return null;a=[0,0,e.cos(a*e.PI/180),e.sin(a*e.PI/180)];v=1/(ht(e.abs(a[2]),e.abs(a[3]))||1);a[2]*=v;a[3]*=v;a[2]<0&&(a[0]=-a[2],a[2]=0);a[3]<0&&(a[1]=-a[3],a[3]=0)}if(u=pr(u),!u)return null;for(v=i.getAttribute(at),(v=v.match(/^url\(#(.*)\)$/))&&s.defs.removeChild(c.getElementById(v[1])),v=f(b+"Gradient"),v.id="r"+(n._id++)[d](36),f(v,b=="radial"?{fx:k,fy:y}:{x1:a[0],y1:a[1],x2:a[2],y2:a[3]}),s.defs[o](v),s=0,a=u[t];s<a;s++)nt=f("stop"),f(nt,{offset:u[s].offset?u[s].offset:s?"100%":"0%","stop-color":u[s].color||"#fff"}),v[o](nt);return f(i,{fill:"url(#"+v.id+")",opacity:1,"fill-opacity":1}),g.fill=r,g.opacity=1,g.fillOpacity=1},ir=function(t){var i=t.getBBox();f(t.pattern,{patternTransform:n.format("translate({0},{1})",i.x,i.y)})},vt=function(i,u){function et(n,i){var e,o,r;if(i=st[yt.call(i)]){for(e=n.attrs["stroke-width"]||"1",n={round:e,square:e,butt:0}[n.attrs["stroke-linecap"]||u["stroke-linecap"]]||0,o=[],r=i[t];r--;)o[r]=i[r]*e+(r%2?1:-1)*n;f(l,{"stroke-dasharray":o[tt](",")})}}var st={"":[0],none:[0],"-":[3,1],".":[1,1],"-.":[3,1,1,1],"-..":[3,1,1,1,1,1],". ":[1,3],"- ":[4,3],"--":[8,3],"- .":[4,3,1,3],"--.":[8,3,1,3],"--..":[8,3,1,3,1,3]},l=i.node,b=i.attrs,rt=i.rotate(),k,y,e,a,it,nt,ut;u[s]("rotation")&&(rt=u.rotation);k=(rt+r)[p](ft);k.length-1?(k[1]=+k[1],k[2]=+k[2]):k=null;h(rt)&&i.rotate(0,!0);for(y in u)if(u[s](y)&&oi[s](y)){e=u[y];b[y]=e;switch(y){case"blur":i.blur(e);break;case"rotation":i.rotate(e,!0);break;case"href":case"title":case"target":a=l.parentNode;yt.call(a.tagName)!="a"&&(it=f("a"),a.insertBefore(it,l),it[o](l),a=it);a.setAttributeNS(i.paper.xlink,y,e);break;case"cursor":l.style.cursor=e;break;case"clip-rect":a=(e+r)[p](ft);a[t]==4&&(i.clip&&i.clip.parentNode.parentNode.removeChild(i.clip.parentNode),nt=f("clipPath"),it=f("rect"),nt.id="r"+(n._id++)[d](36),f(it,{x:a[0],y:a[1],width:a[2],height:a[3]}),nt[o](it),i.paper.defs[o](nt),f(l,{"clip-path":"url(#"+nt.id+")"}),i.clip=it);e||((e=c.getElementById(l.getAttribute("clip-path")[w](/(^url\(#|\)$)/g,r)))&&e.parentNode.removeChild(e),f(l,{"clip-path":r}),delete i.clip);break;case"path":i.type=="path"&&f(l,{d:e?b.path=dt(e):"M0,0"});break;case"width":if(l[ot](y,e),b.fx)y="x",e=b.x;else break;case"x":b.fx&&(e=-b.x-(b.width||0));case"rx":if(y=="rx"&&i.type=="rect")break;case"cx":k&&(y=="x"||y=="cx")&&(k[1]+=e-b[y]);l[ot](y,v(e));i.pattern&&ir(i);break;case"height":if(l[ot](y,e),b.fy)y="y",e=b.y;else break;case"y":b.fy&&(e=-b.y-(b.height||0));case"ry":if(y=="ry"&&i.type=="rect")break;case"cy":k&&(y=="y"||y=="cy")&&(k[2]+=e-b[y]);l[ot](y,v(e));i.pattern&&ir(i);break;case"r":i.type=="rect"?f(l,{rx:e,ry:e}):l[ot](y,e);break;case"src":i.type=="image"&&l.setAttributeNS(i.paper.xlink,"href",e);break;case"stroke-width":l.style.strokeWidth=e;l[ot](y,e);b["stroke-dasharray"]&&et(i,b["stroke-dasharray"]);break;case"stroke-dasharray":et(i,e);break;case"translation":e=(e+r)[p](ft);e[0]=+e[0]||0;e[1]=+e[1]||0;k&&(k[1]+=e[0],k[2]+=e[1]);yi.call(i,e[0],e[1]);break;case"scale":e=(e+r)[p](ft);i.scale(+e[0]||1,+e[1]||+e[0]||1,isNaN(h(e[2]))?null:+e[2],isNaN(h(e[3]))?null:+e[3]);break;case at:if(a=(e+r).match(cr)){nt=f("pattern");ut=f("image");nt.id="r"+(n._id++)[d](36);f(nt,{x:0,y:0,patternUnits:"userSpaceOnUse",height:1,width:1});f(ut,{x:0,y:0});ut.setAttributeNS(i.paper.xlink,"href",a[1]);nt[o](ut);e=c.createElement("img");e.style.cssText="position:absolute;left:-9999em;top-9999em";e.onload=function(){f(nt,{width:this.offsetWidth,height:this.offsetHeight});f(ut,{width:this.offsetWidth,height:this.offsetHeight});c.body.removeChild(this);i.paper.safari()};c.body[o](e);e.src=a[1];i.paper.defs[o](nt);l.style.fill="url(#"+nt.id+")";f(l,{fill:"url(#"+nt.id+")"});i.pattern=nt;i.pattern&&ir(i);break}if(a=n.getRGB(e),a.error){if(({circle:1,ellipse:1}[s](i.type)||(e+r).charAt()!="r")&&ri(l,e,i.paper)){b.gradient=e;b.fill="none";break}}else delete u.gradient,delete b.gradient,!n.is(b.opacity,"undefined")&&n.is(u.opacity,"undefined")&&f(l,{opacity:b.opacity}),!n.is(b["fill-opacity"],"undefined")&&n.is(u["fill-opacity"],"undefined")&&f(l,{"fill-opacity":b["fill-opacity"]});a[s]("o")&&f(l,{"fill-opacity":a.o/100});case"stroke":a=n.getRGB(e);l[ot](y,a.hex);y=="stroke"&&a[s]("o")&&f(l,{"stroke-opacity":a.o/100});break;case"gradient":({circle:1,ellipse:1}[s](i.type)||(e+r).charAt()!="r")&&ri(l,e,i.paper);break;case"opacity":case"fill-opacity":if(b.gradient){(a=c.getElementById(l.getAttribute(at)[w](/^url\(#|\)$/g,r)))&&(a=a.getElementsByTagName("stop"),a[a[t]-1][ot]("stop-opacity",e));break}default:y=="font-size"&&(e=pt(e,10)+"px");a=y[w](/(\-.)/g,function(n){return ei.call(n.substring(1))});l.style[a]=e;l[ot](y,e)}}ef(i,u);k?i.rotate(k.join(g)):h(rt)&&i.rotate(rt,!0)},iu=1.2,ef=function(n,i){var u,l,a;if(!(n.type!="text"||!(i[s]("text")||i[s]("font")||i[s]("font-size")||i[s]("x")||i[s]("y")))){var h=n.attrs,e=n.node,v=e.firstChild?pt(c.defaultView.getComputedStyle(e.firstChild,r).getPropertyValue("font-size"),10):10;if(i[s]("text")){for(h.text=i.text;e.firstChild;)e.removeChild(e.firstChild);for(i=(i.text+r)[p]("\n"),u=0,l=i[t];u<l;u++)i[u]&&(a=f("tspan"),u&&f(a,{dy:v*iu,x:h.x}),a[o](c.createTextNode(i[u])),e[o](a))}else for(i=e.getElementsByTagName("tspan"),u=0,l=i[t];u<l;u++)u&&f(i[u],{dy:v*iu,x:h.x});f(e,{y:h.y});n=n.getBBox();(n=h.y-(n.y+n.height/2))&&isFinite(n)&&f(e,{y:h.y+n})}},u=function(t,i){this[0]=t;this.id=n._oid++;this.node=t;t.raphael=this;this.paper=i;this.attrs=this.attrs||{};this.transformations=[];this._={tx:0,ty:0,rt:{deg:0,cx:0,cy:0},sx:1,sy:1};i.bottom||(i.bottom=this);(this.prev=i.top)&&(i.top.next=this);i.top=this;this.next=null};u[i].rotate=function(i,u,e){if(this.removed)return this;if(i==null)return this._.rt.cx?[this._.rt.deg,this._.rt.cx,this._.rt.cy][tt](g):this._.rt.deg;var o=this.getBBox();return i=(i+r)[p](ft),i[t]-1&&(u=h(i[1]),e=h(i[2])),i=h(i[0]),u!=null?this._.rt.deg=i:this._.rt.deg+=i,e==null&&(u=null),this._.rt.cx=u,this._.rt.cy=e,u=u==null?o.x+o.width/2:u,e=e==null?o.y+o.height/2:e,this._.rt.deg?(this.transformations[0]=n.format("rotate({0} {1} {2})",this._.rt.deg,u,e),this.clip&&f(this.clip,{transform:n.format("rotate({0} {1} {2})",-this._.rt.deg,u,e)})):(this.transformations[0]=r,this.clip&&f(this.clip,{transform:r})),f(this.node,{transform:this.transformations[tt](g)}),this};u[i].hide=function(){return this.removed||(this.node.style.display="none"),this};u[i].show=function(){return this.removed||(this.node.style.display=""),this};u[i].remove=function(){if(!this.removed){gt(this,this.paper);this.node.parentNode.removeChild(this.node);for(var n in this)delete this[n];this.removed=!0}};u[i].getBBox=function(){var r,n,i,u,t;if(this.removed)return this;if(this.type=="path")return ti(this.attrs.path);this.node.style.display=="none"&&(this.show(),r=!0);n={};try{n=this.node.getBBox()}catch(f){}finally{n=n||{}}if(this.type=="text")for(n={x:n.x,y:Infinity,width:0,height:0},i=0,u=this.node.getNumberOfChars();i<u;i++)t=this.node.getExtentOfChar(i),t.y<n.y&&(n.y=t.y),t.y+t.height-n.y>n.height&&(n.height=t.y+t.height-n.y),t.x+t.width-n.x>n.width&&(n.width=t.x+t.width-n.x);return r&&this.hide(),n};u[i].attr=function(t,i){var r,u;if(this.removed)return this;if(t==null){t={};for(r in this.attrs)this.attrs[s](r)&&(t[r]=this.attrs[r]);return this._.rt.deg&&(t.rotation=this.rotate()),(this._.sx!=1||this._.sy!=1)&&(t.scale=this.scale()),t.gradient&&t.fill=="none"&&(t.fill=t.gradient)&&delete t.gradient,t}if(i==null&&n.is(t,wt))return t=="translation"?yi.call(this):t=="rotation"?this.rotate():t=="scale"?this.scale():t==at&&this.attrs.fill=="none"&&this.attrs.gradient?this.attrs.gradient:this.attrs[t];if(i==null&&n.is(t,et)){for(i={},r=0,u=t.length;r<u;r++)i[t[r]]=this.attr(t[r]);return i}return i!=null?(r={},r[t]=i,vt(this,r)):t!=null&&n.is(t,"object")&&vt(this,t),this};u[i].toFront=function(){if(this.removed)return this;this.node.parentNode[o](this.node);var n=this.paper;return n.top!=this&&br(this,n),this};u[i].toBack=function(){return this.removed?this:(this.node.parentNode.firstChild!=this.node&&(this.node.parentNode.insertBefore(this.node,this.node.parentNode.firstChild),kr(this,this.paper)),this)};u[i].insertAfter=function(n){if(this.removed)return this;var t=n.node;return t.nextSibling?t.parentNode.insertBefore(this.node,t.nextSibling):t.parentNode[o](this.node),dr(this,n,this.paper),this};u[i].insertBefore=function(n){if(this.removed)return this;var t=n.node;return t.parentNode.insertBefore(this.node,t),gr(this,n,this.paper),this};u[i].blur=function(t){var i=this,r,u;+t!=0?(r=f("filter"),u=f("feGaussianBlur"),i.attrs.blur=t,r.id="r"+(n._id++)[d](36),f(u,{stdDeviation:+t||1.5}),r.appendChild(u),i.paper.defs.appendChild(r),i._blur=r,f(i.node,{filter:"url(#"+r.id+")"})):(i._blur&&(i._blur.parentNode.removeChild(i._blur),delete i._blur,delete i.attrs.blur),i.node.removeAttribute("filter"))};var ru=function(n,t,i,r){t=v(t);i=v(i);var e=f("circle");return n.canvas&&n.canvas[o](e),n=new u(e,n),n.attrs={cx:t,cy:i,r:r,fill:"none",stroke:"#000"},n.type="circle",f(e,n.attrs),n},uu=function(n,t,i,r,e,s){t=v(t);i=v(i);var h=f("rect");return n.canvas&&n.canvas[o](h),n=new u(h,n),n.attrs={x:t,y:i,width:r,height:e,r:s||0,rx:s||0,ry:s||0,fill:"none",stroke:"#000"},n.type="rect",f(h,n.attrs),n},fu=function(n,t,i,r,e){t=v(t);i=v(i);var s=f("ellipse");return n.canvas&&n.canvas[o](s),n=new u(s,n),n.attrs={cx:t,cy:i,rx:r,ry:e,fill:"none",stroke:"#000"},n.type="ellipse",f(s,n.attrs),n},eu=function(n,t,i,r,e,s){var h=f("image");return f(h,{x:i,y:r,width:e,height:s,preserveAspectRatio:"none"}),h.setAttributeNS(n.xlink,"href",t),n.canvas&&n.canvas[o](h),n=new u(h,n),n.attrs={x:i,y:r,width:e,height:s,src:t},n.type="image",n},ou=function(n,t,i,r){var e=f("text");return f(e,{x:t,y:i,"text-anchor":"middle"}),n.canvas&&n.canvas[o](e),n=new u(e,n),n.attrs={x:t,y:i,"text-anchor":"middle",text:r,font:oi.font,stroke:"none",fill:"#000"},n.type="text",vt(n,n.attrs),n},su=function(n,t){return this.width=n||this.width,this.height=t||this.height,this.canvas[ot]("width",this.width),this.canvas[ot]("height",this.height),this},rr=function(){var i=wr[b](0,arguments),t=i&&i.container,e=i.x,s=i.y,u=i.width,r;if(i=i.height,!t)throw new Error("SVG container not found.");return r=f("svg"),e=e||0,s=s||0,u=u||512,i=i||342,f(r,{xmlns:"http://www.w3.org/2000/svg",version:1.1,width:u,height:i}),t==1?(r.style.cssText="position:absolute;left:"+e+"px;top:"+s+"px",c.body[o](r)):t.firstChild?t.insertBefore(r,t.firstChild):t[o](r),t=new y,t.width=u,t.height=i,t.canvas=r,nr.call(t,t,n.fn),t.clear(),t};y[i].clear=function(){for(var n=this.canvas;n.firstChild;)n.removeChild(n.firstChild);this.bottom=this.top=null;(this.desc=f("desc"))[o](c.createTextNode("Created with Raphaël"));n[o](this.desc);n[o](this.defs=f("defs"))};y[i].remove=function(){this.canvas.parentNode&&this.canvas.parentNode.removeChild(this.canvas);for(var n in this)this[n]=nu(n)}}if(n.vml){var hu={M:"m",L:"l",C:"c",Z:"x",m:"t",l:"r",c:"v",z:"x"},of=/([clmz]),?([^clmz]*)/gi,sf=/-?[^,\s-]+/g,ui=1e3+g+1e3,ni=10,fi={path:1,rect:1},hf=function(n){var i=/[ahqstv]/ig,u=dt,f,e,h,o,s;if((n+r).match(i)&&(u=ai),i=/[clmz]/g,u==dt&&!(n+r).match(i))return(n+r)[w](of,function(n,i,r){var u=[],e=yt.call(i)=="m",f=hu[i];return r[w](sf,function(n){e&&u[t]==2&&(f+=u+hu[i=="m"?"l":"L"],u=[]);u[a](v(n*ni))}),f+u});for(i=u(n),n=[],e=0,h=i[t];e<h;e++){for(u=i[e],f=yt.call(i[e][0]),f=="z"&&(f="x"),o=1,s=u[t];o<s;o++)f+=v(u[o]*ni)+(o!=s-1?",":r);n[a](f)}return n[tt](g)};n[d]=function(){return"Your browser doesn’t support SVG. Falling down to VML.\nYou are running Raphaël "+this.version};tu=function(n,t){var f=it("group"),i,e;return f.style.cssText="position:absolute;left:0;top:0;width:"+t.width+"px;height:"+t.height+"px",f.coordsize=t.coordsize,f.coordorigin=t.coordorigin,i=it("shape"),e=i.style,e.width=t.width+"px",e.height=t.height+"px",i.coordsize=ui,i.coordorigin=t.coordorigin,f[o](i),i=new u(i,f,t),e={fill:"none",stroke:"#000"},n&&(e.path=n),i.isAbsolute=!0,i.type="path",i.path=[],i.Path=r,vt(i,e),t.canvas[o](f),i};vt=function(i,u){var y,b,k,d;i.attrs=i.attrs||{};var a=i.node,e=i.attrs,f=a.style,l;l=(u.x!=e.x||u.y!=e.y||u.width!=e.width||u.height!=e.height||u.r!=e.r)&&i.type=="rect";y=i;for(b in u)u[s](b)&&(e[b]=u[b]);if(l&&(e.path=lu(e.x,e.y,e.width,e.height,e.r),i.X=e.x,i.Y=e.y,i.W=e.width,i.H=e.height),u.href&&(a.href=u.href),u.title&&(a.title=u.title),u.target&&(a.target=u.target),u.cursor&&(f.cursor=u.cursor),"blur"in u&&i.blur(u.blur),(u.path&&i.type=="path"||l)&&(a.path=hf(e.path)),u.rotation!=null&&i.rotate(u.rotation,!0),u.translation&&(l=(u.translation+r)[p](ft),yi.call(i,l[0],l[1]),i._.rt.cx!=null&&(i._.rt.cx+=+l[0],i._.rt.cy+=+l[1],i.setBox(i.attrs,l[0],l[1]))),u.scale&&(l=(u.scale+r)[p](ft),i.scale(+l[0]||1,+l[1]||+l[0]||1,+l[2]||null,+l[3]||null)),"clip-rect"in u&&(l=(u["clip-rect"]+r)[p](ft),l[t]==4&&(l[2]=+l[2]+ +l[0],l[3]=+l[3]+ +l[1],b=a.clipRect||c.createElement("div"),k=b.style,d=a.parentNode,k.clip=n.format("rect({1}px {2}px {3}px {0}px)",l),a.clipRect||(k.position="absolute",k.top=0,k.left=0,k.width=i.paper.width+"px",k.height=i.paper.height+"px",d.parentNode.insertBefore(b,d),b[o](d),a.clipRect=b)),u["clip-rect"]||a.clipRect&&(a.clipRect.style.clip=r)),i.type=="image"&&u.src&&(a.src=u.src),i.type=="image"&&u.opacity&&(a.filterOpacity=ki+".Alpha(opacity="+u.opacity*100+")",f.filter=(a.filterMatrix||r)+(a.filterOpacity||r)),u.font&&(f.font=u.font),u["font-family"]&&(f.fontFamily='"'+u["font-family"][p](",")[0][w](/^['"]+|['"]+$/g,r)+'"'),u["font-size"]&&(f.fontSize=u["font-size"]),u["font-weight"]&&(f.fontWeight=u["font-weight"]),u["font-style"]&&(f.fontStyle=u["font-style"]),(u.opacity!=null||u["stroke-width"]!=null||u.fill!=null||u.stroke!=null||u["stroke-width"]!=null||u["stroke-opacity"]!=null||u["fill-opacity"]!=null||u["stroke-dasharray"]!=null||u["stroke-miterlimit"]!=null||u["stroke-linejoin"]!=null||u["stroke-linecap"]!=null)&&(a=i.shape||a,f=a.getElementsByTagName(at)&&a.getElementsByTagName(at)[0],l=!1,f||(l=f=it(at)),("fill-opacity"in u||"opacity"in u)&&(i=((+e["fill-opacity"]+1||2)-1)*((+e.opacity+1||2)-1)*((+n.getRGB(u.fill).o+1||2)-1),i<0&&(i=0),i>1&&(i=1),f.opacity=i),u.fill&&(f.on=!0),(f.on==null||u.fill=="none")&&(f.on=!1),f.on&&u.fill&&((i=u.fill.match(cr))?(f.src=i[1],f.type="tile"):(f.color=n.getRGB(u.fill).hex,f.src=r,f.type="solid",n.getRGB(u.fill).error&&(y.type in{circle:1,ellipse:1}||(u.fill+r).charAt()!="r")&&ri(y,u.fill)&&(e.fill="none",e.gradient=u.fill))),l&&a[o](f),f=a.getElementsByTagName("stroke")&&a.getElementsByTagName("stroke")[0],l=!1,f||(l=f=it("stroke")),(u.stroke&&u.stroke!="none"||u["stroke-width"]||u["stroke-opacity"]!=null||u["stroke-dasharray"]||u["stroke-miterlimit"]||u["stroke-linejoin"]||u["stroke-linecap"])&&(f.on=!0),(u.stroke=="none"||f.on==null||u.stroke==0||u["stroke-width"]==0)&&(f.on=!1),i=n.getRGB(u.stroke),f.on&&u.stroke&&(f.color=i.hex),i=((+e["stroke-opacity"]+1||2)-1)*((+e.opacity+1||2)-1)*((+i.o+1||2)-1),b=(h(u["stroke-width"])||1)*.75,i<0&&(i=0),i>1&&(i=1),u["stroke-width"]==null&&(b=e["stroke-width"]),u["stroke-width"]&&(f.weight=b),b&&b<1&&(i*=b)&&(f.weight=1),f.opacity=i,u["stroke-linejoin"]&&(f.joinstyle=u["stroke-linejoin"]||"miter"),f.miterlimit=u["stroke-miterlimit"]||8,u["stroke-linecap"]&&(f.endcap=u["stroke-linecap"]=="butt"?"flat":u["stroke-linecap"]=="square"?"square":"round"),u["stroke-dasharray"]&&(i={"-":"shortdash",".":"shortdot","-.":"shortdashdot","-..":"shortdashdotdot",". ":"dot","- ":"dash","--":"longdash","- .":"dashdot","--.":"longdashdot","--..":"longdashdotdot"},f.dashstyle=i[s](u["stroke-dasharray"])?i[u["stroke-dasharray"]]:r),l&&a[o](f)),y.type=="text"){f=y.paper.span.style;e.font&&(f.font=e.font);e["font-family"]&&(f.fontFamily=e["font-family"]);e["font-size"]&&(f.fontSize=e["font-size"]);e["font-weight"]&&(f.fontWeight=e["font-weight"]);e["font-style"]&&(f.fontStyle=e["font-style"]);y.node.string&&(y.paper.span.innerHTML=(y.node.string+r)[w](/</g,"<")[w](/&/g,"&")[w](/\n/g,"<br>"));y.W=e.w=y.paper.span.offsetWidth;y.H=e.h=y.paper.span.offsetHeight;y.X=e.x;y.Y=e.y+v(y.H/2);switch(e["text-anchor"]){case"start":y.node.style["v-text-align"]="left";y.bbx=v(y.W/2);break;case"end":y.node.style["v-text-align"]="right";y.bbx=-v(y.W/2);break;default:y.node.style["v-text-align"]="center"}}};ri=function(n,i){var s,c,o,u,f,v;if((n.attrs=n.attrs||{},s="linear",c=".5 .5",n.attrs.gradient=i,i=(i+r)[w](tr,function(n,t,i){return s="radial",t&&i&&(t=h(t),i=h(i),l(t-.5,2)+l(i-.5,2)>.25&&(i=e.sqrt(.25-l(t-.5,2))*((i>.5)*2-1)+.5),c=t+g+i),r}),i=i[p](/\s*\-\s*/),s=="linear"&&(o=i.shift(),o=-h(o),isNaN(o)))||(u=pr(i),!u))return null;if(n=n.shape||n.node,i=n.getElementsByTagName(at)[0]||it(at),i.parentNode||n.appendChild(i),u[t]){for(i.on=!0,i.method="none",i.color=u[0].color,i.color2=u[u[t]-1].color,n=[],f=0,v=u[t];f<v;f++)u[f].offset&&n[a](u[f].offset+g+u[f].color);i.colors&&(i.colors.value=n[t]?n[tt]():"0% "+i.color);s=="radial"?(i.type="gradientradial",i.focus="100%",i.focussize=c,i.focusposition=c):(i.type="gradient",i.angle=(270-o)%360)}return 1};u=function(t,i,r){this[0]=t;this.id=n._oid++;this.node=t;t.raphael=this;this.Y=this.X=0;this.attrs={};this.Group=i;this.paper=r;this._={tx:0,ty:0,rt:{deg:0},sx:1,sy:1};r.bottom||(r.bottom=this);(this.prev=r.top)&&(r.top.next=this);r.top=this;this.next=null};u[i].rotate=function(n,i,u){return this.removed?this:n==null?this._.rt.cx?[this._.rt.deg,this._.rt.cx,this._.rt.cy][tt](g):this._.rt.deg:(n=(n+r)[p](ft),n[t]-1&&(i=h(n[1]),u=h(n[2])),n=h(n[0]),i!=null?this._.rt.deg=n:this._.rt.deg+=n,u==null&&(i=null),this._.rt.cx=i,this._.rt.cy=u,this.setBox(this.attrs,i,u),this.Group.style.rotation=this._.rt.deg,this)};u[i].setBox=function(n,t,i){var c,e,o,u,h,f;if(this.removed)return this;c=this.Group.style;e=this.shape&&this.shape.style||this.node.style;n=n||{};for(o in n)n[s](o)&&(this.attrs[o]=n[o]);t=t||this._.rt.cx;i=i||this._.rt.cy;u=this.attrs;switch(this.type){case"circle":n=u.cx-u.r;o=u.cy-u.r;h=u=u.r*2;break;case"ellipse":n=u.cx-u.rx;o=u.cy-u.ry;h=u.rx*2;u=u.ry*2;break;case"image":n=+u.x;o=+u.y;h=u.width||0;u=u.height||0;break;case"text":this.textpath.v=["m",v(u.x),", ",v(u.y-2),"l",v(u.x)+1,", ",v(u.y-2)][tt](r);n=u.x-v(this.W/2);o=u.y-this.H/2;h=this.W;u=this.H;break;case"rect":case"path":this.attrs.path?(u=ti(this.attrs.path),n=u.x,o=u.y,h=u.width,u=u.height):(o=n=0,h=this.paper.width,u=this.paper.height);break;default:o=n=0;h=this.paper.width;u=this.paper.height}t=t==null?n+h/2:t;i=i==null?o+u/2:i;t=t-this.paper.width/2;i=i-this.paper.height/2;c.left!=(f=t+"px")&&(c.left=f);c.top!=(f=i+"px")&&(c.top=f);this.X=fi[s](this.type)?-t:n;this.Y=fi[s](this.type)?-i:o;this.W=h;this.H=u;fi[s](this.type)?(e.left!=(f=-t*ni+"px")&&(e.left=f),e.top!=(f=-i*ni+"px")&&(e.top=f)):this.type=="text"?(e.left!=(f=-t+"px")&&(e.left=f),e.top!=(f=-i+"px")&&(e.top=f)):(c.width!=(f=this.paper.width+"px")&&(c.width=f),c.height!=(f=this.paper.height+"px")&&(c.height=f),e.left!=(f=n-t+"px")&&(e.left=f),e.top!=(f=o-i+"px")&&(e.top=f),e.width!=(f=h+"px")&&(e.width=f),e.height!=(f=u+"px")&&(e.height=f))};u[i].hide=function(){return this.removed||(this.Group.style.display="none"),this};u[i].show=function(){return this.removed||(this.Group.style.display="block"),this};u[i].getBBox=function(){return this.removed?this:fi[s](this.type)?ti(this.attrs.path):{x:this.X+(this.bbx||0),y:this.Y,width:this.W,height:this.H}};u[i].remove=function(){if(!this.removed){gt(this,this.paper);this.node.parentNode.removeChild(this.node);this.Group.parentNode.removeChild(this.Group);this.shape&&this.shape.parentNode.removeChild(this.shape);for(var n in this)delete this[n];this.removed=!0}};u[i].attr=function(i,u){var e,f;if(this.removed)return this;if(i==null){i={};for(e in this.attrs)this.attrs[s](e)&&(i[e]=this.attrs[e]);return this._.rt.deg&&(i.rotation=this.rotate()),(this._.sx!=1||this._.sy!=1)&&(i.scale=this.scale()),i.gradient&&i.fill=="none"&&(i.fill=i.gradient)&&delete i.gradient,i}if(u==null&&n.is(i,wt))return i=="translation"?yi.call(this):i=="rotation"?this.rotate():i=="scale"?this.scale():i==at&&this.attrs.fill=="none"&&this.attrs.gradient?this.attrs.gradient:this.attrs[i];if(this.attrs&&u==null&&n.is(i,et)){for(f={},e=0,u=i[t];e<u;e++)f[i[e]]=this.attr(i[e]);return f}return u!=null&&(f={},f[i]=u),u==null&&n.is(i,"object")&&(f=i),f&&(f.text&&this.type=="text"&&(this.node.string=f.text),vt(this,f),f.gradient&&({circle:1,ellipse:1}[s](this.type)||(f.gradient+r).charAt()!="r")&&ri(this,f.gradient),(!fi[s](this.type)||this._.rt.deg)&&this.setBox(this.attrs)),this};u[i].toFront=function(){return this.removed||this.Group.parentNode[o](this.Group),this.paper.top!=this&&br(this,this.paper),this};u[i].toBack=function(){return this.removed?this:(this.Group.parentNode.firstChild!=this.Group&&(this.Group.parentNode.insertBefore(this.Group,this.Group.parentNode.firstChild),kr(this,this.paper)),this)};u[i].insertAfter=function(n){return this.removed?this:(n.Group.nextSibling?n.Group.parentNode.insertBefore(this.Group,n.Group.nextSibling):n.Group.parentNode[o](this.Group),dr(this,n,this.paper),this)};u[i].insertBefore=function(n){return this.removed?this:(n.Group.parentNode.insertBefore(this.Group,n.Group),gr(this,n,this.paper),this)};cu=/ progid:\S+Blur\([^\)]+\)/g;u[i].blur=function(n){var t=this.node.style,i=t.filter;i=i.replace(cu,"");+n!=0?(this.attrs.blur=n,t.filter=i+ki+".Blur(pixelradius="+(+n||1.5)+")",t.margin=Raphael.format("-{0}px 0 0 -{0}px",Math.round(+n||1.5))):(t.filter=i,t.margin=0,delete this.attrs.blur)};ru=function(n,t,i,r){var e=it("group"),f=it("oval");return e.style.cssText="position:absolute;left:0;top:0;width:"+n.width+"px;height:"+n.height+"px",e.coordsize=ui,e.coordorigin=n.coordorigin,e[o](f),f=new u(f,e,n),f.type="circle",vt(f,{stroke:"#000",fill:"none"}),f.attrs.cx=t,f.attrs.cy=i,f.attrs.r=r,f.setBox({x:t-r,y:i-r,width:r*2,height:r*2}),n.canvas[o](e),f};function lu(t,i,r,u,f){return f?n.format("M{0},{1}l{2},0a{3},{3},0,0,1,{3},{3}l0,{5}a{3},{3},0,0,1,{4},{3}l{6},0a{3},{3},0,0,1,{4},{4}l0,{7}a{3},{3},0,0,1,{3},{4}z",t+f,i,r-f*2,f,-f,u-f*2,f*2-r,f*2-u):n.format("M{0},{1}l{2},0,0,{3},{4},0z",t,i,r,u,-r)}uu=function(n,t,i,r,u,f){var o=lu(t,i,r,u,f),e;return n=n.path(o),e=n.attrs,n.X=e.x=t,n.Y=e.y=i,n.W=e.width=r,n.H=e.height=u,e.r=f,e.path=o,n.type="rect",n};fu=function(n,t,i,r,f){var s=it("group"),e=it("oval");return s.style.cssText="position:absolute;left:0;top:0;width:"+n.width+"px;height:"+n.height+"px",s.coordsize=ui,s.coordorigin=n.coordorigin,s[o](e),e=new u(e,s,n),e.type="ellipse",vt(e,{stroke:"#000"}),e.attrs.cx=t,e.attrs.cy=i,e.attrs.rx=r,e.attrs.ry=f,e.setBox({x:t-r,y:i-f,width:r*2,height:f*2}),n.canvas[o](s),e};eu=function(n,t,i,r,f,e){var h=it("group"),s=it("image");return h.style.cssText="position:absolute;left:0;top:0;width:"+n.width+"px;height:"+n.height+"px",h.coordsize=ui,h.coordorigin=n.coordorigin,s.src=t,h[o](s),s=new u(s,h,n),s.type="image",s.attrs.src=t,s.attrs.x=i,s.attrs.y=r,s.attrs.w=f,s.attrs.h=e,s.setBox({x:i,y:r,width:f,height:e}),n.canvas[o](h),s};ou=function(t,i,f,e){var h=it("group"),c=it("shape"),s=c.style,l=it("path"),a=it("textpath");return h.style.cssText="position:absolute;left:0;top:0;width:"+t.width+"px;height:"+t.height+"px",h.coordsize=ui,h.coordorigin=t.coordorigin,l.v=n.format("m{0},{1}l{2},{1}",v(i*10),v(f*10),v(i*10)+1),l.textpathok=!0,s.width=t.width,s.height=t.height,a.string=e+r,a.on=!0,c[o](a),c[o](l),h[o](c),s=new u(a,h,t),s.shape=c,s.textpath=l,s.type="text",s.attrs.text=e,s.attrs.x=i,s.attrs.y=f,s.attrs.w=1,s.attrs.h=1,vt(s,{font:oi.font,stroke:"none",fill:"#000"}),s.setBox(),t.canvas[o](h),s};su=function(n,t){var i=this.canvas.style;return n==+n&&(n+="px"),t==+t&&(t+="px"),i.width=n,i.height=t,i.clip="rect(0 "+n+" "+t+" 0)",this};c.createStyleSheet().addRule(".rvml","behavior:url(#default#VML)");try{c.namespaces.rvml||c.namespaces.add("rvml","urn:schemas-microsoft-com:vml");it=function(n){return c.createElement("<rvml:"+n+' class="rvml">')}}catch(pf){it=function(n){return c.createElement("<"+n+' xmlns="urn:schemas-microsoft.com:vml" class="rvml">')}}rr=function(){var i=wr[b](0,arguments),r=i.container,u=i.height,f=i.width,h=i.x;if(i=i.y,!r)throw new Error("VML container not found.");var t=new y,e=t.canvas=c.createElement("div"),s=e.style;return h=h||0,i=i||0,f=f||512,u=u||342,f==+f&&(f+="px"),u==+u&&(u+="px"),t.width=1e3,t.height=1e3,t.coordsize=ni*1e3+g+ni*1e3,t.coordorigin="0 0",t.span=c.createElement("span"),t.span.style.cssText="position:absolute;left:-9999em;top:-9999em;padding:0;margin:0;line-height:1;display:inline;",e[o](t.span),s.cssText=n.format("width:{0};height:{1};display:inline-block;position:relative;clip:rect(0 {0} {1} 0);overflow:hidden",f,u),r==1?(c.body[o](e),s.left=h+"px",s.top=i+"px",s.position="absolute"):r.firstChild?r.insertBefore(e,r.firstChild):r[o](e),nr.call(t,t,n.fn),t};y[i].clear=function(){this.canvas.innerHTML=r;this.span=c.createElement("span");this.span.style.cssText="position:absolute;left:-9999em;top:-9999em;padding:0;margin:0;line-height:1;display:inline;";this.canvas[o](this.span);this.bottom=this.top=null};y[i].remove=function(){this.canvas.parentNode.removeChild(this.canvas);for(var n in this)this[n]=nu(n);return!0}}for(y[i].safari=/^Apple|^Google/.test(st.navigator.vendor)&&(!(st.navigator.userAgent.indexOf("Version/4.0")+1)||st.navigator.platform.slice(0,2)=="iP")?function(){var n=this.rect(-99,-99,this.width+99,this.height+99);st.setTimeout(function(){n.remove()})}:function(){},au=function(){return c.addEventListener?function(n,t,i,r){function f(u){if(wi&&bi[s](t))for(var f=0,e=u.targetTouches&&u.targetTouches.length;f<e;f++)if(u.targetTouches[f].target==n){e=u;u=u.targetTouches[f];u.originalEvent=e;u.preventDefault=lf;u.stopPropagation=vf;break}return i.call(r,u)}var u=wi&&bi[t]?bi[t]:t;return n.addEventListener(u,f,!1),function(){return n.removeEventListener(u,f,!1),!0}}:c.attachEvent?function(n,t,i,r){function u(n){return n=n||st.event,n.preventDefault=n.preventDefault||cf,n.stopPropagation=n.stopPropagation||af,i.call(r,n)}function f(){return n.detachEvent("on"+t,u),!0}return n.attachEvent("on"+t,u),f}:void 0}(),bt=hr[t];bt--;)(function(r){n[r]=u[i][r]=function(t){return n.is(t,"function")&&(this.events=this.events||[],this.events.push({name:r,f:t,unbind:au(this.shape||this.node||c,r,t,this)})),this};n["un"+r]=u[i]["un"+r]=function(n){for(var i=this.events,u=i[t];u--;)if(i[u].name==r&&i[u].f==n)return i[u].unbind(),i.splice(u,1),i.length||delete this.events,this;return this}})(hr[bt]);u[i].hover=function(n,t){return this.mouseover(n).mouseout(t)};u[i].unhover=function(n,t){return this.unmouseover(n).unmouseout(t)};u[i].drag=function(n,t,i){function u(t){var u=t.clientX,f=t.clientY,e,i;if(wi){for(e=t.touches.length;e--;)if(i=t.touches[e],i.identifier==r._drag.id){u=i.clientX;f=i.clientY;(t.originalEvent?t.originalEvent:t).preventDefault();break}}else t.preventDefault();n&&n.call(r,u-r._drag.x,f-r._drag.y,u,f)}function f(){r._drag={};Raphael.unmousemove(u).unmouseup(f);i&&i.call(r)}this._drag={};var r=this.mousedown(function(n){(n.originalEvent?n.originalEvent:n).preventDefault();this._drag.x=n.clientX;this._drag.y=n.clientY;this._drag.id=n.identifier;t&&t.call(this,n.clientX,n.clientY);Raphael.mousemove(u).mouseup(f)});return this};y[i].circle=function(n,t,i){return ru(this,n||0,t||0,i||0)};y[i].rect=function(n,t,i,r,u){return uu(this,n||0,t||0,i||0,r||0,u||0)};y[i].ellipse=function(n,t,i,r){return fu(this,n||0,t||0,i||0,r||0)};y[i].path=function(t){return!t||n.is(t,wt)||n.is(t[0],et)||(t+=r),tu(n.format[b](n,arguments),this)};y[i].image=function(n,t,i,r,u){return eu(this,n||"about:blank",t||0,i||0,r||0,u||0)};y[i].text=function(n,t,i){return ou(this,n||0,t||0,i||r)};y[i].set=function(n){return arguments[t]>1&&(n=Array[i].splice.call(arguments,0,arguments[t])),new ct(n)};y[i].setSize=su;y[i].top=y[i].bottom=null;y[i].raphael=n;u[i].resetScale=function(){if(this.removed)return this;this._.sx=1;this._.sy=1;this.attrs.scale="1 1"};u[i].scale=function(n,i,u,f){var a,o,h,nt,it,l,s,w;if(this.removed)return this;if(n==null&&i==null)return{x:this._.sx,y:this._.sy,toString:vu};if(i=i||n,+i||(i=n),h=this.attrs,n!=0){var c=this.getBBox(),v=c.x+c.width/2,p=c.y+c.height/2;a=n/this._.sx;o=i/this._.sy;u=+u||u==0?u:v;f=+f||f==0?f:p;c=~~(n/e.abs(n));var y=~~(i/e.abs(i)),rt=this.node.style,d=u+(v-u)*a;p=f+(p-f)*o;switch(this.type){case"rect":case"image":nt=h.width*c*a;it=h.height*y*o;this.attr({height:it,r:h.r*lt(c*a,y*o),width:nt,x:d-nt/2,y:p-it/2});break;case"circle":case"ellipse":this.attr({rx:h.rx*c*a,ry:h.ry*y*o,r:h.r*lt(c*a,y*o),cx:d,cy:p});break;case"text":this.attr({x:d,y:p});break;case"path":v=gi(h.path);for(var ut=!0,b=0,ft=v[t];b<ft;b++)if(l=v[b],s=ei.call(l[0]),!(s=="M"&&ut))if(ut=!1,s=="A")l[v[b][t]-2]*=a,l[v[b][t]-1]*=o,l[1]*=c*a,l[2]*=y*o,l[5]=+!(c+y?!+l[5]:+l[5]);else if(s=="H")for(s=1,w=l[t];s<w;s++)l[s]*=a;else if(s=="V")for(s=1,w=l[t];s<w;s++)l[s]*=o;else for(s=1,w=l[t];s<w;s++)l[s]*=s%2?a:o;o=ti(v);a=d-o.x-o.width/2;o=p-o.y-o.height/2;v[0][1]+=a;v[0][2]+=o;this.attr({path:v})}this.type in{text:1,image:1}&&(c!=1||y!=1)?this.transformations?(this.transformations[2]="scale("[k](c,",",y,")"),this.node[ot]("transform",this.transformations[tt](g)),a=c==-1?-h.x-(nt||0):h.x,o=y==-1?-h.y-(it||0):h.y,this.attr({x:a,y:o}),h.fx=c-1,h.fy=y-1):(this.node.filterMatrix=ki+".Matrix(M11="[k](c,", M12=0, M21=0, M22=",y,", Dx=0, Dy=0, sizingmethod='auto expand', filtertype='bilinear')"),rt.filter=(this.node.filterMatrix||r)+(this.node.filterOpacity||r)):this.transformations?(this.transformations[2]=r,this.node[ot]("transform",this.transformations[tt](g)),h.fx=0,h.fy=0):(this.node.filterMatrix=r,rt.filter=(this.node.filterMatrix||r)+(this.node.filterOpacity||r));h.scale=[n,i,u,f][tt](g);this._.sx=n;this._.sy=i}return this};u[i].clone=function(){if(this.removed)return null;var n=this.attr();return delete n.scale,delete n.translation,this.paper[this.type]().attr(n)};ur=ut(function(t,i,r,u,f,e,o,s,h){for(var y,a,v=0,c=0;c<1.001;c+=.001){if(a=n.findDotsAtSegment(t,i,r,u,f,e,o,s,c),c&&(v+=l(l(y.x-a.x,2)+l(y.y-a.y,2),.5)),v>=h)return a;y=a}});var yf=ut(function(n,t,i,r,u,f,e,o){for(var h,c={x:0,y:0},a=0,s=0;s<1.01;s+=.01)h=ii(n,t,i,r,u,f,e,o,s),s&&(a+=l(l(c.x-h.x,2)+l(c.y-h.y,2),.5)),c=h;return a}),yu=fr(1),vi=fr(),er=fr(0,1);u[i].getTotalLength=function(){if(this.type=="path")return this.node.getTotalLength?this.node.getTotalLength():yu(this.attrs.path)};u[i].getPointAtLength=function(n){if(this.type=="path")return vi(this.attrs.path,n)};u[i].getSubpath=function(n,t){if(this.type=="path")return e.abs(this.getTotalLength()-t)<1e-6?er(this.attrs.path,n).end:(t=er(this.attrs.path,t,1),n?er(t,n).end:t)};n.easing_formulas={linear:function(n){return n},"<":function(n){return l(n,3)},">":function(n){return l(n-1,3)+1},"<>":function(n){return(n*=2,n<1)?l(n,3)/2:(n-=2,(l(n,3)+2)/2)},backIn:function(n){var t=1.70158;return n*n*((t+1)*n-t)},backOut:function(n){n-=1;var t=1.70158;return n*n*((t+1)*n+t)+1},elastic:function(n){if(n==0||n==1)return n;var t=.3,i=t/4;return l(2,-10*n)*e.sin((n-i)*2*e.PI/t)+1},bounce:function(n){var i=7.5625,t=2.75;return n<1/t?n=i*n*n:n<2/t?(n-=1.5/t,n=i*n*n+.75):n<2.5/t?(n-=2.25/t,n=i*n*n+.9375):(n-=2.625/t,n=i*n*n+.984375),n}};rt={length:0};u[i].animateWith=function(n,t,i,r,u){return rt[n.id]&&(t.start=rt[n.id].start),this.animate(t,i,r,u)};u[i].animateAlong=wu();u[i].animateAlongBack=wu(1);u[i].onAnimation=function(n){return this._run=n||0,this};u[i].animate=function(i,u,f,e){var o,w,k;(n.is(f,"function")||!f)&&(e=f||null);var l={},y={},a={};for(o in i)if(i[s](o)&&di[s](o)){l[o]=this.attr(o);l[o]==null&&(l[o]=oi[o]);y[o]=i[o];switch(di[o]){case"along":var c=yu(i[o]),v=vi(i[o],c*!!i.back),b=this.getBBox();a[o]=c/u;a.tx=b.x;a.ty=b.y;a.sx=v.x;a.sy=v.y;y.rot=i.rot;y.back=i.back;y.len=c;i.rot&&(a.r=h(this.rotate())||0);break;case nt:a[o]=(y[o]-l[o])/u;break;case"colour":l[o]=n.getRGB(l[o]);c=n.getRGB(y[o]);a[o]={r:(c.r-l[o].r)/u,g:(c.g-l[o].g)/u,b:(c.b-l[o].b)/u};break;case"path":for(c=ai(l[o],y[o]),l[o]=c[0],v=c[1],a[o]=[],c=0,b=l[o][t];c<b;c++)for(a[o][c]=[0],w=1,k=l[o][c][t];w<k;w++)a[o][c][w]=(v[c][w]-l[o][c][w])/u;break;case"csv":v=(i[o]+r)[p](ft);c=(l[o]+r)[p](ft);switch(o){case"translation":l[o]=[0,0];a[o]=[v[0]/u,v[1]/u];break;case"rotation":l[o]=c[1]==v[1]&&c[2]==v[2]?c:[0,v[1],v[2]];a[o]=[(v[0]-l[o][0])/u,0,0];break;case"scale":i[o]=v;l[o]=(l[o]+r)[p](ft);a[o]=[(v[0]-l[o][0])/u,(v[1]-l[o][1])/u,0,0];break;case"clip-rect":for(l[o]=(l[o]+r)[p](ft),a[o]=[],c=4;c--;)a[o][c]=(v[c]-l[o][c])/u}y[o]=v}}return this.stop(),this.in_animation=1,rt[this.id]={start:i.start||+new Date,ms:u,easing:f,from:l,diff:a,to:y,el:this,callback:e,t:{x:0,y:0}},++rt[t]==1&&pu(),this};u[i].stop=function(){return rt[this.id]&&rt[t]--,delete rt[this.id],this};u[i].translate=function(n,t){return this.attr({translation:n+" "+t})};u[i][d]=function(){return"Raphaël’s object"};n.ae=rt;ct[i][a]=function(){for(var n,i,r=0,f=arguments[t];r<f;r++)(n=arguments[r])&&(n.constructor==u||n.constructor==ct)&&(i=this.items[t],this[i]=this.items[i]=n,this[t]++);return this};ct[i].pop=function(){return delete this[this[t]--],this.items.pop()};for(pi in u[i])u[i][s](pi)&&(ct[i][pi]=function(n){return function(){for(var i=0,r=this.items[t];i<r;i++)this.items[i][n][b](this.items[i],arguments);return this}}(pi));return ct[i].attr=function(i,r){var u,f;if(i&&n.is(i,et)&&n.is(i[0],"object"))for(r=0,u=i[t];r<u;r++)this.items[r].attr(i[r]);else for(u=0,f=this.items[t];u<f;u++)this.items[u].attr(i,r);return this},ct[i].animate=function(i,r,u,f){(n.is(u,"function")||!u)&&(f=u||null);var s=this.items[t],o=s,h,c=this,e;for(f&&(e=function(){--s||f.call(c)}),u=n.is(u,wt)?u:e,h=this.items[--o].animate(i,r,u,e);o--;)this.items[o].animateWith(h,i,r,u,e);return this},ct[i].insertAfter=function(n){for(var i=this.items[t];i--;)this.items[i].insertAfter(n);return this},ct[i].getBBox=function(){for(var n,i=[],r=[],u=[],f=[],e=this.items[t];e--;)n=this.items[e].getBBox(),i[a](n.x),r[a](n.y),u[a](n.x+n.width),f[a](n.y+n.height);return i=lt[b](0,i),r=lt[b](0,r),{x:i,y:r,width:ht[b](0,u)-i,height:ht[b](0,f)-r}},ct[i].clone=function(n){n=new ct;for(var i=0,r=this.items[t];i<r;i++)n[a](this.items[i].clone());return n},n.registerFont=function(n){var i,t,u,r,f;if(!n.face)return n;this.fonts=this.fonts||{};i={w:n.w,face:{},glyphs:{}};t=n.face["font-family"];for(u in n.face)n.face[s](u)&&(i.face[u]=n.face[u]);if(this.fonts[t]?this.fonts[t][a](i):this.fonts[t]=[i],!n.svg){i.face["units-per-em"]=pt(n.face["units-per-em"],10);for(r in n.glyphs)if(n.glyphs[s](r)&&(t=n.glyphs[r],i.glyphs[r]={w:t.w,k:{},d:t.d&&"M"+t.d[w](/[mlcxtrv]/g,function(n){return{l:"L",c:"C",x:"z",t:"m",r:"l",v:"c"}[n]||"M"})+"z"},t.k))for(f in t.k)t[s](f)&&(i.glyphs[r].k[f]=t.k[f])}return n},y[i].getFont=function(i,u,f,e){var h,o,c;if(e=e||"normal",f=f||"normal",u=+u||{normal:400,bold:700,lighter:300,bolder:800}[u]||400,n.fonts){if(h=n.fonts[i],!h){i=new RegExp("(^|\\s)"+i[w](/[^\w\d\s+!~.:_-]/g,r)+"(\\s|$)","i");for(o in n.fonts)if(n.fonts[s](o)&&i.test(o)){h=n.fonts[o];break}}if(h)for(o=0,i=h[t];o<i;o++)if(c=h[o],c.face["font-weight"]==u&&(c.face["font-style"]==f||!c.face["font-style"])&&c.face["font-stretch"]==e)break;return c}},y[i].print=function(i,u,f,e,o,s){var h,b,l,v;s=s||"middle";var y=this.set(),c=(f+r)[p](r),w=0;if(n.is(e,f)&&(e=this.getFont(e)),e){for(f=(o||16)/e.face["units-per-em"],h=e.face.bbox.split(ft),o=+h[0],s=+h[1]+(s=="baseline"?h[3]-h[1]+ +e.face.descent:(h[3]-h[1])/2),h=0,b=c[t];h<b;h++)l=h&&e.glyphs[c[h-1]]||{},v=e.glyphs[c[h]],w+=h?(l.w||e.w)+(l.k&&l.k[c[h]]||0):0,v&&v.d&&y[a](this.path(v.d).attr({fill:"#000",stroke:"none",translation:[w,0]}));y.scale(f,f,o,s).translate(i-o,u-s)}return y},bu=/\{(\d+)\}/g,n.format=function(i,u){var f=n.is(u,et)?[0][k](u):arguments;return i&&n.is(i,wt)&&f[t]-1&&(i=i[w](bu,function(n,t){return f[++t]==null?r:f[t]})),i||r},n.ninja=function(){return sr.was?Raphael=sr.is:delete Raphael,n},n.el=u[i],n}();dateTimeFromServer=new Date;dateTimeFromClient=new Date;$(document).ready(function(){function n(n){return n<10?"0"+n.toString():n.toString()}$(".multiMenu").hover(function(){mouse_is_inside=!0},function(){mouse_is_inside=!1});$("body").mouseup(function(){mouse_is_inside||$(".multiMenu .layer").slideUp(function(){$(this).parent("div").removeClass("active")})});try{$.ajax({url:"/Home/BiezacaDataGodzina",type:"GET",async:!1,cache:!1,success:function(n){dateTimeFromServer=new Date(parseInt(n.substr(6)));dateTimeFromClient=new Date}})}catch(t){}setInterval(function(){var u=dateTimeFromServer-dateTimeFromClient,f=(new Date).getTime(),r=new Date,t,i;r.setTime(f+u);t=r;t.setDate(t.getDate());var e=t.getDate(),o=t.getMonth()+1,s=t.getFullYear(),h=n(e)+" - "+n(o)+" - "+s;$("#date").html(h);i=r;i.setDate(i.getDate());var c=i.getHours(),l=i.getMinutes(),a=n(c)+":"+n(l);$("#time").html(a)},1e3);$(".showDetails").click(function(){$(this).prev(".details").slideToggle();$(this).find(".gui").toggleClass("icoDArrDown icoDArrUp");$(this).toggleClass("act")});indirectStation()});mouse_is_inside=!1,function(n){n.cookies={render:function(t){var i="";i+='<div id="cookiesBar"><div id="cookiesBarWrap"><p>'+C_Cookie_Tekst_1;i+=t.privacyPolicy?' <a href="'+t.cookiesPageURL+'" title="'+C_Cookie_PolitykaPrywatnosciTitle+'">'+C_Cookie_PolitykaPrywatnosci+"<\/a>.<\/p>":' <a href="'+t.cookiesPageURL+'" title="'+C_Cookie_RegulaminSerwisu+'">'+C_Cookie_RegulaminSerwisu+"<\/a>.<\/p>";i+="<p>"+C_Cookie_Tekst_2+'<\/p><a id="cookiesBarClose" href="#" title="'+C_Cookie_Zamknij+'">'+C_Cookie_Zamknij+"<\/a><\/div><\/div>";n.cookie("cookie")||(n("body").append(i),n.fn.delegate?n("#cookiesBar").delegate("#cookiesBarClose","click",function(t){n.cookies.closeCallback(t)}):n("#cookiesBarClose").bind("click",function(t){n.cookies.closeCallback(t)}))},closeCallback:function(t){return n("#cookiesBar").fadeOut(),n.cookie("cookie")||n.cookie("cookie",!0,{path:"/",expires:30}),t.preventDefault(),!1}}}(jQuery);String.prototype.replaceAll=function(n,t){return this.split(n).join(t)};$.ajaxSetup({headers:{"X-Kendo-Ui-Version":"r3-2016-sp2"}});!function(n){function i(){var i=document.createElement("smartbanner"),n={WebkitTransition:"webkitTransitionEnd",MozTransition:"transitionend",OTransition:"oTransitionEnd otransitionend",transition:"transitionend"};for(var t in n)if(i.style[t]!==undefined)return{end:n[t]};return!1}var t=function(t){var f,i,r,u;if((this.origHtmlMargin=parseFloat(n("html").css("margin-top")),this.options=n.extend({},n.smartbanner.defaults,t),f=navigator.standalone,i=navigator.userAgent,this.options.force?this.type=this.options.force:i.match(/Windows Phone 8/i)!=null&&i.match(/Touch/i)!==null?this.type="windows":i.match(/iPhone|iPod/i)!=null||i.match(/iPad/)&&this.options.iOSUniversalApp?i.match(/Safari/i)!=null&&(i.match(/CriOS/i)!=null||window.Number(i.substr(i.indexOf("OS ")+3,3).replace("_","."))<6)&&(this.type="ios"):i.match(/\bSilk\/(.*\bMobile Safari\b)?/)||i.match(/\bKF\w/)||i.match("Kindle Fire")?this.type="kindle":i.match(/Android/i)!=null&&(this.type="android"),this.type&&!f&&!this.getCookie("sb-closed")&&!this.getCookie("sb-installed"))&&(this.scale=this.options.scale=="auto"?n(window).width()/window.screen.width:this.options.scale,this.scale<1&&(this.scale=1),r=n(this.type=="android"?'meta[name="google-play-app"]':this.type=="ios"?'meta[name="apple-itunes-app"]':this.type=="kindle"?'meta[name="kindle-fire-app"]':'meta[name="msApplication-ID"]'),r.length!=0)){if(this.type=="windows")this.appId=n('meta[name="msApplication-PackageFamilyName"]').attr("content");else if(u=/app-id=([^\s,]+)/.exec(r.attr("content")),u)this.appId=u[1];else return;this.title=this.options.title?this.options.title:r.data("title")||n("title").text().replace(/\s*[|\-·].*$/,"");this.author=this.options.author?this.options.author:r.data("author")||(n('meta[name="author"]').length?n('meta[name="author"]').attr("content"):window.location.hostname);this.iconUrl=r.data("icon-url");this.price=r.data("price");this.create();this.show();this.listen()}};(t.prototype={constructor:t,create:function(){var t,i=this.options.url?this.options.url:(this.type=="windows"?"ms-windows-store:navigate?appid=":this.type=="android"?"market://details?id=":this.type=="kindle"?"amzn://apps/android?asin=":"https://itunes.apple.com/"+this.options.appStoreLanguage+"/app/id")+this.appId,u=this.price||this.options.price,e=u?u+" - "+(this.type=="android"?this.options.inGooglePlay:this.type=="kindle"?this.options.inAmazonAppStore:this.type=="ios"?this.options.inAppStore:this.options.inWindowsStore):"",f=this.options.iconGloss===null?this.type=="ios":this.options.iconGloss,r;this.type=="android"&&this.options.GooglePlayParams&&(i=i+"&referrer="+this.options.GooglePlayParams);r='<div id="smartbanner" class="'+this.type+'"><div class="sb-container"><a href="#" class="sb-close">×<\/a><span class="sb-icon"><\/span><div class="sb-info"><strong>'+this.title+"<\/strong><span>"+this.author+"<\/span><span>"+e+'<\/span><\/div><a href="'+i+'" class="sb-button"><span>'+this.options.button+"<\/span><\/a><\/div><\/div>";this.options.layer?n(this.options.appendToSelector).append(r):n(this.options.appendToSelector).prepend(r);this.options.icon?t=this.options.icon:this.iconUrl?t=this.iconUrl:n('link[rel="apple-touch-icon-precomposed"]').length>0?(t=n('link[rel="apple-touch-icon-precomposed"]').attr("href"),this.options.iconGloss===null&&(f=!1)):n('link[rel="apple-touch-icon"]').length>0?t=n('link[rel="apple-touch-icon"]').attr("href"):n('meta[name="msApplication-TileImage"]').length>0?t=n('meta[name="msApplication-TileImage"]').attr("content"):n('meta[name="msapplication-TileImage"]').length>0&&(t=n('meta[name="msapplication-TileImage"]').attr("content"));t?(n("#smartbanner .sb-icon").css("background-image","url("+t+")"),f&&n("#smartbanner .sb-icon").addClass("gloss")):n("#smartbanner").addClass("no-icon");this.bannerHeight=n("#smartbanner").outerHeight()+2;this.scale>1&&(n("#smartbanner").css("top",parseFloat(n("#smartbanner").css("top"))*this.scale).css("height",parseFloat(n("#smartbanner").css("height"))*this.scale).hide(),n("#smartbanner .sb-container").css("-webkit-transform","scale("+this.scale+")").css("-msie-transform","scale("+this.scale+")").css("-moz-transform","scale("+this.scale+")").css("width",n(window).width()/this.scale));n("#smartbanner").css("position",this.options.layer?"absolute":"static")},listen:function(){n("#smartbanner .sb-close").on("click",n.proxy(this.close,this));n("#smartbanner .sb-button").on("click",n.proxy(this.install,this))},show:function(t){var i=n("#smartbanner"),r;i.stop();this.options.layer?(i.animate({top:0,display:"block"},this.options.speedIn).addClass("shown").show(),n(this.pushSelector).animate({paddingTop:this.origHtmlMargin+this.bannerHeight*this.scale},this.options.speedIn,"swing",t)):n.support.transition?(i.animate({top:0},this.options.speedIn).addClass("shown"),r=function(){n("html").removeClass("sb-animation");t&&t()},n(this.pushSelector).addClass("sb-animation").one(n.support.transition.end,r).emulateTransitionEnd(this.options.speedIn).css("margin-top",this.origHtmlMargin+this.bannerHeight*this.scale)):i.slideDown(this.options.speedIn).addClass("shown")},hide:function(t){var i=n("#smartbanner"),r;i.stop();this.options.layer?(i.animate({top:-1*this.bannerHeight*this.scale,display:"block"},this.options.speedIn).removeClass("shown"),n(this.pushSelector).animate({paddingTop:this.origHtmlMargin},this.options.speedIn,"swing",t)):n.support.transition?(this.type!=="android"?i.css("top",-1*this.bannerHeight*this.scale).removeClass("shown"):i.css({display:"none"}).removeClass("shown"),r=function(){n("html").removeClass("sb-animation");t&&t()},n(this.pushSelector).addClass("sb-animation").one(n.support.transition.end,r).emulateTransitionEnd(this.options.speedOut).css("margin-top",this.origHtmlMargin)):i.slideUp(this.options.speedOut).removeClass("shown")},close:function(n){n.preventDefault();this.hide();this.setCookie("sb-closed","true",this.options.daysHidden)},install:function(){this.options.hideOnInstall&&this.hide();this.setCookie("sb-installed","true",this.options.daysReminder)},setCookie:function(n,t,i){var r=new Date;r.setDate(r.getDate()+i);t=encodeURI(t)+(i==null?"":"; expires="+r.toUTCString());document.cookie=n+"="+t+"; path=/;"},getCookie:function(n){for(var r,u,i=document.cookie.split(";"),t=0;t<i.length;t++)if(r=i[t].substr(0,i[t].indexOf("=")),u=i[t].substr(i[t].indexOf("=")+1),r=r.replace(/^\s+|\s+$/g,""),r==n)return decodeURI(u);return null},switchType:function(){var t=this;this.hide(function(){t.type=t.type=="android"?"ios":"android";var i=n(t.type=="android"?'meta[name="google-play-app"]':'meta[name="apple-itunes-app"]').attr("content");t.appId=/app-id=([^\s,]+)/.exec(i)[1];n("#smartbanner").detach();t.create();t.show()})}},n.smartbanner=function(i){var u=n(window),r=u.data("smartbanner"),f=typeof i=="object"&&i;r||u.data("smartbanner",r=new t(f));typeof i=="string"&&r[i]()},n.smartbanner.defaults={title:null,author:null,price:"FREE",appStoreLanguage:"us",inAppStore:"On the App Store",inGooglePlay:"In Google Play",inAmazonAppStore:"In the Amazon Appstore",inWindowsStore:"In the Windows Store",GooglePlayParams:null,icon:null,iconGloss:null,button:"VIEW",url:null,scale:"auto",speedIn:300,speedOut:400,daysHidden:15,daysReminder:90,force:null,hideOnInstall:!0,layer:!1,iOSUniversalApp:!0,appendToSelector:"body",pushSelector:"html"},n.smartbanner.Constructor=t,n.support.transition===undefined)&&(n.fn.emulateTransitionEnd=function(t){var i=!1,u=this,r;n(this).one(n.support.transition.end,function(){i=!0});return r=function(){i||n(u).trigger(n.support.transition.end)},setTimeout(r,t),this},n(function(){n.support.transition=i()}))}(window.jQuery) \ No newline at end of file